USD102517S - Design fob a grave marker - Google Patents
Design fob a grave marker Download PDFInfo
- Publication number
- USD102517S USD102517S US D102517 S USD102517 S US D102517S
- Authority
- US
- United States
- Prior art keywords
- grave marker
- design fob
- grave
- marker
- design
- Prior art date
Links
- 239000003550 marker Substances 0.000 title description 10
- 101710040692 PARPBP Proteins 0.000 description 2
- 235000020639 clam Nutrition 0.000 description 2
- OYFJQPXVCSSHAI-QFPUQLAESA-N enalapril maleate Chemical compound OC(=O)\C=C/C(O)=O.C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 OYFJQPXVCSSHAI-QFPUQLAESA-N 0.000 description 2
Images
Description
Dec. 29, 1936. 1.. B. SEIBERT E! AL Des. 102,517
GRAVE MARKER Filed pril 28, 1956 INVENTOR. d ab 6. 8.:LM
ma. W
ATTO NEYS.
Patented Dec. 29, 1936 UNITED STATES Des. 102,517
PATENT OFFICE DESIGN FOR A GRAVE MARKER Luther B. Seibert, Greensburg, and Noble Neilan Willams, Pittsburgh, Pa.
Application April 28, 1936, Serial No. 62,352
Term of patent 14 years To all whom it may concem:
Be it known that we, Luther B. Sebert and Noble Nei1an Williams, ctizens of the United States, residing, respectively, at Greensburg, Westmoreland County, and. Pttsburgh, Allegheny County, both in the State of Pennsylvania, have invented a new, origina], and ornamental Design for a. Grave Marker, of whch the followng is a. specfica.ton, reference being ha.d to the accompanying drawing, forming pari; thereof and. in which:
Figure 1 is a, pian view ci the grave marker shovvng our design, and
Figure 2 a view in perspective thereof. We clam: The ornamental design for a grave marker, as shown.
LUTHER B. SEIBERT. N. NEILAN WILLIAMS.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD102517S (en) | Design fob a grave marker | |
| USD102518S (en) | Design fob a grave marker | |
| USD84927S (en) | Design fob a memorial stone fob gbaves | |
| USD102096S (en) | Design foe | |
| USD102011S (en) | Design fob an atomizer | |
| USD131054S (en) | Design for a glass dish | |
| USD130510S (en) | Design foe a swing | |
| USD101903S (en) | Design fob an atomizer | |
| USD115516S (en) | Design for a jug | |
| USD84633S (en) | Design for a tumbler | |
| USD93130S (en) | Design fob a display stand | |
| USD98420S (en) | Design for a drinking tumbler | |
| USD130587S (en) | Design for a vase | |
| USD105723S (en) | Design fob a closure | |
| USD131965S (en) | Design for a combination glass dish | |
| USD102097S (en) | Design for | |
| USD112451S (en) | Design for a plate or similar article | |
| USD62955S (en) | Design fob a gas stove | |
| USD99076S (en) | Design for a glass building block | |
| USD119278S (en) | Design fob a tumbler or similar article | |
| USD115155S (en) | Design for a bottle | |
| USD101656S (en) | Design for an atomizer | |
| USD132177S (en) | Design for a building | |
| USD102910S (en) | Design fob a bottle | |
| USD90761S (en) | Design fob a smoker s stand |