USD101744S - Design fob a marksmanship - Google Patents
Design fob a marksmanship Download PDFInfo
- Publication number
- USD101744S USD101744S US D101744 S USD101744 S US D101744S
- Authority
- US
- United States
- Prior art keywords
- marksmanship
- design fob
- design
- rockola
- david
- Prior art date
Links
- MWMQNVGAHVXSPE-UHFFFAOYSA-N Pyriprole Chemical compound ClC=1C=C(C(F)(F)F)C=C(Cl)C=1N1N=C(C#N)C(SC(F)F)=C1NCC1=CC=CC=N1 MWMQNVGAHVXSPE-UHFFFAOYSA-N 0.000 description 2
Images
Description
Oct. 27, 1936. D. c. ROCKOLA Des. 101,744 I MARKSMANSHIP PRACTIC ING APPARATUS Filed Sept. 14, 1936 David G. fiockola INVENT OR.
H15 ATTORNEY.
Patented Oct. 27, 1936 UNITED STATES Des. 101,744
PATENT OFFICE DESIGN FOR. A MARKSMANSHIP PRACTICING APPARATUS David C. Rockola, Chicago, Ill. Application September 14, 1936, Serial No. 64,849
Term of patent 3% years To all whom it may concern:
Be it known that 1, David C. Rockola, a citizen of the Dominion of Canada and a resident of Chicago, in the county of Cook and State of Illinois, have invented a new, original, and ornamental Design for a Marksmanship Practicing Apparatus, of which the following is a specification, reference being had to the accompanying drawing, forming a part thereof, and in which:
The single figure is a perspective view of the marksmanship practicing apparatus showing my new design.
I claim:
The ornamental design for a marksmanship practicing apparatus, as shown.
DAVID C. ROCKOLA.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD101744S (en) | Design fob a marksmanship | |
| USD97616S (en) | Design for a bar cabinet | |
| USD103446S (en) | Design fob a container | |
| USD87759S (en) | Design fob | |
| USD103649S (en) | Design for an illuminated coin | |
| USD84401S (en) | Fredebic j | |
| USD96650S (en) | Design fob a lamp base | |
| USD100443S (en) | Design for a support for funnels | |
| USD84404S (en) | Frederic j | |
| USD86660S (en) | William f | |
| USD103234S (en) | Design for a tray | |
| USD91666S (en) | Design fob an announcement board | |
| USD103995S (en) | Design fob a book cover | |
| USD103233S (en) | Design for a tray | |
| USD100336S (en) | Design fob a store front | |
| USD117680S (en) | Design for an illuminable holder for | |
| USD90284S (en) | Design fob a combined coaster and ash tray | |
| USD84403S (en) | Frederic j | |
| USD100124S (en) | Design for a bar cabinet | |
| USD93030S (en) | Design fob a cravat holder | |
| USD97807S (en) | Design fob a scale | |
| USD90897S (en) | Design for a game device | |
| USD91355S (en) | Design fob a sign | |
| USD102926S (en) | Design fob an ashtray | |
| USD93767S (en) | Design for a game apparatus |