US9610285B2 - Compositions for controlling food intake and uses therefor - Google Patents
Compositions for controlling food intake and uses therefor Download PDFInfo
- Publication number
- US9610285B2 US9610285B2 US14/358,418 US201214358418A US9610285B2 US 9610285 B2 US9610285 B2 US 9610285B2 US 201214358418 A US201214358418 A US 201214358418A US 9610285 B2 US9610285 B2 US 9610285B2
- Authority
- US
- United States
- Prior art keywords
- baclofen
- naltrexone
- lesogaberan
- gabapentin
- pregabalin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active, expires
Links
- 239000000203 mixture Substances 0.000 title claims description 12
- 230000037406 food intake Effects 0.000 title description 12
- 235000012631 food intake Nutrition 0.000 title description 12
- 235000000346 sugar Nutrition 0.000 claims abstract description 37
- 208000014679 binge eating disease Diseases 0.000 claims abstract description 24
- 235000013305 food Nutrition 0.000 claims abstract description 20
- 208000010235 Food Addiction Diseases 0.000 claims abstract description 14
- 206010004716 Binge eating Diseases 0.000 claims abstract description 13
- 208000032841 Bulimia Diseases 0.000 claims abstract description 13
- 230000020595 eating behavior Effects 0.000 claims abstract description 12
- 235000021149 fatty food Nutrition 0.000 claims abstract description 5
- 229960000794 baclofen Drugs 0.000 claims description 212
- KPYSYYIEGFHWSV-UHFFFAOYSA-N Baclofen Chemical compound OC(=O)CC(CN)C1=CC=C(Cl)C=C1 KPYSYYIEGFHWSV-UHFFFAOYSA-N 0.000 claims description 210
- 229960003086 naltrexone Drugs 0.000 claims description 205
- DQCKKXVULJGBQN-XFWGSAIBSA-N naltrexone Chemical compound N1([C@@H]2CC3=CC=C(C=4O[C@@H]5[C@](C3=4)([C@]2(CCC5=O)O)CC1)O)CC1CC1 DQCKKXVULJGBQN-XFWGSAIBSA-N 0.000 claims description 203
- 238000013265 extended release Methods 0.000 claims description 115
- 238000000034 method Methods 0.000 claims description 12
- SNPPWIUOZRMYNY-UHFFFAOYSA-N bupropion Chemical compound CC(C)(C)NC(C)C(=O)C1=CC=CC(Cl)=C1 SNPPWIUOZRMYNY-UHFFFAOYSA-N 0.000 claims description 10
- 235000005911 diet Nutrition 0.000 claims description 9
- 230000037213 diet Effects 0.000 claims description 9
- 229960001058 bupropion Drugs 0.000 claims description 7
- 230000002195 synergetic effect Effects 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims 9
- 239000008194 pharmaceutical composition Substances 0.000 claims 3
- 238000002648 combination therapy Methods 0.000 abstract description 3
- 238000011284 combination treatment Methods 0.000 abstract description 3
- 235000013410 fast food Nutrition 0.000 abstract description 3
- UGJMXCAKCUNAIE-UHFFFAOYSA-N Gabapentin Chemical compound OC(=O)CC1(CN)CCCCC1 UGJMXCAKCUNAIE-UHFFFAOYSA-N 0.000 description 320
- 229960002870 gabapentin Drugs 0.000 description 160
- 229950004084 lesogaberan Drugs 0.000 description 160
- LJNUIEQATDYXJH-GSVOUGTGSA-N lesogaberan Chemical compound NC[C@@H](F)CP(O)=O LJNUIEQATDYXJH-GSVOUGTGSA-N 0.000 description 160
- AYXYPKUFHZROOJ-ZETCQYMHSA-N pregabalin Chemical compound CC(C)C[C@H](CN)CC(O)=O AYXYPKUFHZROOJ-ZETCQYMHSA-N 0.000 description 159
- 229960001233 pregabalin Drugs 0.000 description 159
- 229960004127 naloxone Drugs 0.000 description 83
- UZHSEJADLWPNLE-GRGSLBFTSA-N naloxone Chemical compound O=C([C@@H]1O2)CC[C@@]3(O)[C@H]4CC5=CC=C(O)C2=C5[C@@]13CCN4CC=C UZHSEJADLWPNLE-GRGSLBFTSA-N 0.000 description 83
- KQWVAUSXZDRQPZ-UMTXDNHDSA-N 4-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enyl-1-piperazinyl]-(3-methoxyphenyl)methyl]-N,N-diethylbenzamide Chemical compound C1=CC(C(=O)N(CC)CC)=CC=C1[C@H](C=1C=C(OC)C=CC=1)N1[C@@H](C)CN(CC=C)[C@H](C)C1 KQWVAUSXZDRQPZ-UMTXDNHDSA-N 0.000 description 81
- UIQMVEYFGZJHCZ-SSTWWWIQSA-N Nalorphine Chemical compound C([C@@H](N(CC1)CC=C)[C@@H]2C=C[C@@H]3O)C4=CC=C(O)C5=C4[C@@]21[C@H]3O5 UIQMVEYFGZJHCZ-SSTWWWIQSA-N 0.000 description 81
- 229960000938 nalorphine Drugs 0.000 description 81
- OZYUPQUCAUTOBP-QXAKKESOSA-N Levallorphan Chemical compound C([C@H]12)CCC[C@@]11CCN(CC=C)[C@@H]2CC2=CC=C(O)C=C21 OZYUPQUCAUTOBP-QXAKKESOSA-N 0.000 description 80
- 229960001736 buprenorphine Drugs 0.000 description 80
- RMRJXGBAOAMLHD-IHFGGWKQSA-N buprenorphine Chemical compound C([C@]12[C@H]3OC=4C(O)=CC=C(C2=4)C[C@@H]2[C@]11CC[C@]3([C@H](C1)[C@](C)(O)C(C)(C)C)OC)CN2CC1CC1 RMRJXGBAOAMLHD-IHFGGWKQSA-N 0.000 description 80
- 229960000263 levallorphan Drugs 0.000 description 80
- BSDGOJHPAHUWOO-QMHKHESXSA-N tan-67 Chemical compound C1([C@]23CCN(C[C@@H]2CC2=C(N)C4=CC=CC=C4N=C2C3)C)=CC=CC(O)=C1 BSDGOJHPAHUWOO-QMHKHESXSA-N 0.000 description 76
- DHHVAGZRUROJKS-UHFFFAOYSA-N phentermine Chemical compound CC(C)(N)CC1=CC=CC=C1 DHHVAGZRUROJKS-UHFFFAOYSA-N 0.000 description 64
- 230000000694 effects Effects 0.000 description 36
- SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 description 35
- 229960002715 nicotine Drugs 0.000 description 35
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 35
- AFCGFAGUEYAMAO-UHFFFAOYSA-N acamprosate Chemical compound CC(=O)NCCCS(O)(=O)=O AFCGFAGUEYAMAO-UHFFFAOYSA-N 0.000 description 34
- 229960004047 acamprosate Drugs 0.000 description 34
- KZWQAWBTWNPFPW-QGZVFWFLSA-N 2-[methyl-[(3r)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]acetic acid Chemical compound O([C@H](CCN(C)CC(O)=O)C=1C=CC=CC=1)C1=CC=C(C(F)(F)F)C=C1 KZWQAWBTWNPFPW-QGZVFWFLSA-N 0.000 description 33
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 description 32
- PYHRZPFZZDCOPH-QXGOIDDHSA-N (S)-amphetamine sulfate Chemical compound [H+].[H+].[O-]S([O-])(=O)=O.C[C@H](N)CC1=CC=CC=C1.C[C@H](N)CC1=CC=CC=C1 PYHRZPFZZDCOPH-QXGOIDDHSA-N 0.000 description 32
- DYDCUQKUCUHJBH-UWTATZPHSA-N D-Cycloserine Chemical compound N[C@@H]1CONC1=O DYDCUQKUCUHJBH-UWTATZPHSA-N 0.000 description 32
- DYDCUQKUCUHJBH-UHFFFAOYSA-N D-Cycloserine Natural products NC1CONC1=O DYDCUQKUCUHJBH-UHFFFAOYSA-N 0.000 description 32
- PWKSKIMOESPYIA-BYPYZUCNSA-N L-N-acetyl-Cysteine Chemical compound CC(=O)N[C@@H](CS)C(O)=O PWKSKIMOESPYIA-BYPYZUCNSA-N 0.000 description 32
- DUGOZIWVEXMGBE-UHFFFAOYSA-N Methylphenidate Chemical compound C=1C=CC=CC=1C(C(=O)OC)C1CCCCN1 DUGOZIWVEXMGBE-UHFFFAOYSA-N 0.000 description 32
- 229960004308 acetylcysteine Drugs 0.000 description 32
- 229940047812 adderall Drugs 0.000 description 32
- VAAUVRVFOQPIGI-SPQHTLEESA-N ceftriaxone Chemical compound S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)\C(=N/OC)C=2N=C(N)SC=2)CC=1CSC1=NC(=O)C(=O)NN1C VAAUVRVFOQPIGI-SPQHTLEESA-N 0.000 description 32
- 229960004755 ceftriaxone Drugs 0.000 description 32
- 229960000632 dexamfetamine Drugs 0.000 description 32
- 229940099242 dexedrine Drugs 0.000 description 32
- DUGOZIWVEXMGBE-CHWSQXEVSA-N dexmethylphenidate Chemical compound C([C@@H]1[C@H](C(=O)OC)C=2C=CC=CC=2)CCCN1 DUGOZIWVEXMGBE-CHWSQXEVSA-N 0.000 description 32
- 229960001042 dexmethylphenidate Drugs 0.000 description 32
- VOBHXZCDAVEXEY-JSGCOSHPSA-N lisdexamfetamine Chemical compound NCCCC[C@H](N)C(=O)N[C@@H](C)CC1=CC=CC=C1 VOBHXZCDAVEXEY-JSGCOSHPSA-N 0.000 description 32
- 229960001451 lisdexamfetamine Drugs 0.000 description 32
- 229960001344 methylphenidate Drugs 0.000 description 32
- 229960003562 phentermine Drugs 0.000 description 32
- JZCPYUJPEARBJL-UHFFFAOYSA-N rimonabant Chemical compound CC=1C(C(=O)NN2CCCCC2)=NN(C=2C(=CC(Cl)=CC=2)Cl)C=1C1=CC=C(Cl)C=C1 JZCPYUJPEARBJL-UHFFFAOYSA-N 0.000 description 32
- 229960003015 rimonabant Drugs 0.000 description 32
- JQSHBVHOMNKWFT-DTORHVGOSA-N varenicline Chemical compound C12=CC3=NC=CN=C3C=C2[C@H]2C[C@@H]1CNC2 JQSHBVHOMNKWFT-DTORHVGOSA-N 0.000 description 32
- 229960004751 varenicline Drugs 0.000 description 32
- 150000001875 compounds Chemical class 0.000 description 31
- 239000003814 drug Substances 0.000 description 17
- 239000005557 antagonist Substances 0.000 description 16
- 238000002347 injection Methods 0.000 description 16
- 239000007924 injection Substances 0.000 description 16
- 239000003185 4 aminobutyric acid B receptor stimulating agent Substances 0.000 description 15
- 229940079593 drug Drugs 0.000 description 14
- 235000021076 total caloric intake Nutrition 0.000 description 13
- 241000700159 Rattus Species 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- 239000011780 sodium chloride Substances 0.000 description 11
- 230000001225 therapeutic effect Effects 0.000 description 9
- 238000011282 treatment Methods 0.000 description 9
- 206010033307 Overweight Diseases 0.000 description 8
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 6
- 101001032845 Homo sapiens Metabotropic glutamate receptor 5 Proteins 0.000 description 6
- 102100038357 Metabotropic glutamate receptor 5 Human genes 0.000 description 6
- 239000000556 agonist Substances 0.000 description 6
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 6
- 238000007912 intraperitoneal administration Methods 0.000 description 6
- 229940044601 receptor agonist Drugs 0.000 description 6
- 239000000018 receptor agonist Substances 0.000 description 6
- 230000003247 decreasing effect Effects 0.000 description 5
- 230000001629 suppression Effects 0.000 description 5
- LEPBHAAYNPPRRA-WMZHIEFXSA-N 3-[(4aS,12aR)-2-methyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridin-4a-yl]phenol Chemical compound C1([C@]23CCN(C[C@@H]2CC2=CC4=CC=CC=C4N=C2C3)C)=CC=CC(O)=C1 LEPBHAAYNPPRRA-WMZHIEFXSA-N 0.000 description 4
- 229930006000 Sucrose Natural products 0.000 description 4
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- 239000005720 sucrose Substances 0.000 description 4
- 229960004793 sucrose Drugs 0.000 description 4
- 102000006941 Amino Acid Transport System X-AG Human genes 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 108091006151 Glutamate transporters Proteins 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 239000004471 Glycine Substances 0.000 description 3
- 101001071429 Homo sapiens Metabotropic glutamate receptor 2 Proteins 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- 102100036837 Metabotropic glutamate receptor 2 Human genes 0.000 description 3
- 102000004868 N-Methyl-D-Aspartate Receptors Human genes 0.000 description 3
- 108090001041 N-Methyl-D-Aspartate Receptors Proteins 0.000 description 3
- 241000283984 Rodentia Species 0.000 description 3
- 239000012190 activator Substances 0.000 description 3
- 230000003190 augmentative effect Effects 0.000 description 3
- 229960003638 dopamine Drugs 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 239000004031 partial agonist Substances 0.000 description 3
- 239000003368 psychostimulant agent Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 229940124597 therapeutic agent Drugs 0.000 description 3
- 239000003981 vehicle Substances 0.000 description 3
- BUZAJRPLUGXRAB-UHFFFAOYSA-N AM-251 Chemical compound CC=1C(C(=O)NN2CCCCC2)=NN(C=2C(=CC(Cl)=CC=2)Cl)C=1C1=CC=C(I)C=C1 BUZAJRPLUGXRAB-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 238000003255 drug test Methods 0.000 description 2
- 239000002960 lipid emulsion Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000002623 mu opiate receptor antagonist Substances 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 150000008163 sugars Chemical class 0.000 description 2
- 239000008399 tap water Substances 0.000 description 2
- 235000020679 tap water Nutrition 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- ZFSXKSSWYSZPGQ-UHFFFAOYSA-N (2-hydroxycyclopentyl)azanium;chloride Chemical compound Cl.NC1CCCC1O ZFSXKSSWYSZPGQ-UHFFFAOYSA-N 0.000 description 1
- QEDVGROSOZBGOZ-WXXKFALUSA-N (e)-but-2-enedioic acid;n-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]morpholine-4-carboxamide Chemical compound OC(=O)\C=C\C(O)=O.C=1C=C(O)C=CC=1OCC(O)CNCCNC(=O)N1CCOCC1.C=1C=C(O)C=CC=1OCC(O)CNCCNC(=O)N1CCOCC1 QEDVGROSOZBGOZ-WXXKFALUSA-N 0.000 description 1
- OKMWKBLSFKFYGZ-UHFFFAOYSA-N 1-behenoylglycerol Chemical compound CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(O)CO OKMWKBLSFKFYGZ-UHFFFAOYSA-N 0.000 description 1
- LEPBHAAYNPPRRA-HSTJUUNISA-N 3-[(12ar)-2-methyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridin-4a-yl]phenol Chemical compound C([C@@H]1CC2=CC3=CC=CC=C3N=C2C2)N(C)CCC12C1=CC=CC(O)=C1 LEPBHAAYNPPRRA-HSTJUUNISA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- KPYSYYIEGFHWSV-QMMMGPOBSA-N Arbaclofen Chemical compound OC(=O)C[C@@H](CN)C1=CC=C(Cl)C=C1 KPYSYYIEGFHWSV-QMMMGPOBSA-N 0.000 description 1
- 229940124802 CB1 antagonist Drugs 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 229940123431 GABA B receptor agonist Drugs 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 229920000881 Modified starch Chemical class 0.000 description 1
- 208000008589 Obesity Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 235000019789 appetite Nutrition 0.000 description 1
- 230000036528 appetite Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 229940078456 calcium stearate Drugs 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 235000019577 caloric intake Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000011260 co-administration Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 238000013270 controlled release Methods 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 235000020931 dietary conditions Nutrition 0.000 description 1
- 235000021004 dietary regimen Nutrition 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000000890 drug combination Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- MVPICKVDHDWCJQ-UHFFFAOYSA-N ethyl 3-pyrrolidin-1-ylpropanoate Chemical compound CCOC(=O)CCN1CCCC1 MVPICKVDHDWCJQ-UHFFFAOYSA-N 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229940049654 glyceryl behenate Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 244000144993 groups of animals Species 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229920000609 methyl cellulose Chemical class 0.000 description 1
- 239000001923 methylcellulose Chemical class 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- 229960000858 naltrexone hydrochloride Drugs 0.000 description 1
- 150000007523 nucleic acids Chemical group 0.000 description 1
- 230000035764 nutrition Effects 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 235000020824 obesity Nutrition 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 238000001543 one-way ANOVA Methods 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000009097 single-agent therapy Methods 0.000 description 1
- 229940045902 sodium stearyl fumarate Drugs 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 238000013222 sprague-dawley male rat Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000021147 sweet food Nutrition 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000004797 therapeutic response Effects 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 230000003442 weekly effect Effects 0.000 description 1
Images
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/485—Morphinan derivatives, e.g. morphine, codeine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/13—Amines
- A61K31/135—Amines having aromatic rings, e.g. ketamine, nortriptyline
- A61K31/137—Arylalkylamines, e.g. amphetamine, epinephrine, salbutamol, ephedrine or methadone
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/16—Amides, e.g. hydroxamic acids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/185—Acids; Anhydrides, halides or salts thereof, e.g. sulfur acids, imidic, hydrazonic or hydroximic acids
- A61K31/19—Carboxylic acids, e.g. valproic acid
- A61K31/195—Carboxylic acids, e.g. valproic acid having an amino group
- A61K31/197—Carboxylic acids, e.g. valproic acid having an amino group the amino and the carboxyl groups being attached to the same acyclic carbon chain, e.g. gamma-aminobutyric acid [GABA], beta-alanine, epsilon-aminocaproic acid or pantothenic acid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K45/00—Medicinal preparations containing active ingredients not provided for in groups A61K31/00 - A61K41/00
- A61K45/06—Mixtures of active ingredients without chemical characterisation, e.g. antiphlogistics and cardiaca
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/04—Anorexiants; Antiobesity agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2300/00—Mixtures or combinations of active ingredients, wherein at least one active ingredient is fully defined in groups A61K31/00 - A61K41/00
-
- Y10S514/909—
Definitions
- the present invention relates to a combination therapy for the treatment of food addiction, obesity, binge eating disorder, or binge eating behavior.
- the present invention is directed to a combination treatment of a mu-opioid receptor antagonist and a GABA B receptor agonist and, optionally, a third therapeutic agent selected from CB-1 receptor antagonists, glycine reuptake inhibitors, dopamine augmenting compounds, nicotine receptor agonists, psychostimulants, mGlu2/3 agonists, mGlu5 antagonists, glycine-site partial agonists, cystine-glutamate exchangers, cystine-glutamate activators, glutamate transporter inhibitors, mGlu5 receptor agonists or NMDA receptor co-agonists, for the treatment of individuals who meet the definition of food addiction; individuals who are overweight or obese (e.g., a BMI ⁇ 25); individuals who have a binge eating disorder; or individuals who engage in a binge eating behavior.
- a third therapeutic agent selected from CB-1 receptor antagonists, glycine reuptake inhibitors, dopamine augmenting compounds, nicotine receptor agonists, psychostimulants, mGlu2/3
- Tables 2-3 provide exemplary combinations of specific compounds suitable for the treatment of individuals who meet the definition of food addiction; individuals who are overweight or obese (e.g., a BMI ⁇ 25 or having a BMI between 25 and 35); individuals who have a binge eating disorder; or individuals who engage in a binge eating behavior.
- the invention may also be used for individuals who have difficulty in controlling the amounts of fast food consumed during a given period of time.
- FIG. 1 Baclofen (alone) has no effect on binge eating of sugar.
- FIGS. 2A-2B Baclofen (alone) reduces intake of oil-containing palatable foods.
- FIGS. 3A-3C Neurotrexone has a trend toward reducing food intake in the oil containing groups, but has no effect on sugar-binging rats.
- FIGS. 4A-4C The combination of baclofen/naltrexone at higher doses (naltrexone at 1.0 mg/kg and baclofen at 1.8 mg/kg) robustly reduces intake of sugar, fat, or both fat and sugar.
- FIGS. 5A-5C The effect of baclofen/naltrexone on suppressing palatable food intake is specific to palatable food regardless of the group tested. No effects were seen on the intake of plain chow.
- FIG. 6 The Yale Food Addiction Scale (survey).
- the present invention is directed to a combination treatment of a mu-opioid receptor antagonist and a GABA B agonist and, optionally, a third therapeutic agent selected from CB-1 receptor antagonists, glycine reuptake inhibitors, dopamine augmenting compounds, nicotine receptor agonists, psychostimulants, mGlu2/3 agonists, mGlu5 antagonists, glycine-site partial agonists, cystine-glutamate exchangers, cystine-glutamate activators, glutamate transporter inhibitors, mGlu5 receptor agonists or NMDA receptor co-agonists, for the treatment of individuals who meet the definition of food addiction; individuals who are overweight or obese (e.g., a BMI ⁇ 25); individuals who have a binge eating disorder; or individuals who engage in a binge eating behavior.
- a third therapeutic agent selected from CB-1 receptor antagonists, glycine reuptake inhibitors, dopamine augmenting compounds, nicotine receptor agonists, psychostimulants, mGlu2/3
- Tables 2-3 provide exemplary combinations of specific compounds suitable for the treatment of individuals who meet the definition of food addiction; individuals who are overweight or obese (e.g., a BMI ⁇ 25 or having a BMI between 25 and 35); individuals who have a binge eating disorder; or individuals who engage in a binge eating behavior.
- the invention may also be used for individuals who have difficulty in controlling the amounts of fast food consumed during a given period of time.
- a first compound in combination with a second compound includes co-administration of a first therapeutically effective compound and a second therapeutically effective compound, which for example may be dissolved or intermixed in the same pharmaceutically acceptable carrier.
- concurrently administered when referring to the various compounds disclosed herein indicates that the compounds can be administered separately at the same time or sequentially in any order at different points in time. The compounds, however, should be administered close in time so as to provide an effect suitable for the treatment of individuals who meet the definition of food addiction; individuals who are overweight or obese (e.g., a BMI ⁇ 25); individuals who have a binge eating disorder; or individuals who engage in a binge eating behavior.
- concurrently administered compounds are administered within 60 minutes of one another.
- the term “synergistic effect” as used herein refers to the combined effect of administering two (or three) therapeutic compounds where the overall response is greater than the sum of the two individual effects (e.g., the effects observed when each compound is administered alone as a monotherapy).
- the dosage of the individual therapeutic compounds that are to be administered to individuals may be adjusted to provide the optimal therapeutic response.
- the specific dose level for any particular patient may vary depending upon a variety of factors, including, but not limited to, the activity of the specific compound employed; the age, body weight, general health, sex and diet of the patient; the time of administration; the rate of excretion; the drug combination; the severity of the particular disease being treated; and the form of administration.
- in vitro dosage-effect results provide useful guidance on the proper doses for patient administration. The considerations for determining the proper dose levels are well-known in the art.
- naltrexone is co-administered or administered in combination with baclofen and, optionally, additional therapeutic compounds.
- naltrexone in an amount of about 25 to 100 milligrams per day, and baclofen, in an amount ranging between about 15 and about 120 milligrams per day (preferably between about 20 milligrams and about 80 milligrams per day) can be administered in combination or co-administered.
- baclofen in an amount ranging between about 15 and about 120 milligrams per day (preferably between about 20 milligrams and about 80 milligrams per day) can be administered in combination or co-administered.
- a combination of three therapeutic compounds can be used in the disclosed methods.
- naltrexone in an amount of about 25 to 100 milligrams per day
- baclofen in an amount ranging between about 15 and about 120 milligrams per day (preferably between about 20 milligrams and about 80 milligrams per day)
- acamprosate in an amount between about 300 and 2500 milligrams per day (e.g., as two 333-mg tablets taken three times a day)
- naltrexone in an amount of about 25 to 100 milligrams per day
- baclofen in an amount ranging between about 15 and about 120 milligrams per day (preferably between about 20 milligrams and about 80 milligrams per day)
- bupropion or bupropion extended release
- Other combinations of therapeutic compounds and compositions according to the invention are set forth in Tables 2 and 3.
- the therapeutic compounds used in the disclosed combination therapies can be administered in oral forms. These include, but are not limited to, tablets, capsules, pills, powders, granules, elixirs, tinctures, suspensions, syrups, and emulsions. Rapid-release and time-controlled release (extended release) formulations of the disclosed therapeutic compounds can be used for the treatment of individuals who meet the definition of food addiction; individuals who are overweight or obese (e.g., a BMI ⁇ 25); individuals who have a binge eating disorder; or individuals who engage in a binge eating behavior.
- the therapeutic compounds disclosed herein can, typically, be administered in “pharmaceutically acceptable carriers” such as pharmaceutical diluents, pharmaceutical excipients or pharmaceutical carriers.
- tablets or capsules can comprise one or more of the disclosed therapeutic compounds and lactose, starch, sucrose, glucose, modified sugars, modified starches, methyl cellulose and its derivatives, dicalcium phosphate, calcium sulfate, mannitol, sorbitol and other reducing and non-reducing sugars, magnesium stearate, steric acid, sodium stearyl fumarate, glyceryl behenate, calcium stearate and the like.
- Liquid formulations can comprise one or more therapeutic agents in combination with ethanol, glycerol, water and the like. Additionally, the compositions can contain binders, lubricants, disintegrating agents, coloring agents and/or flavoring agents as desired.
- the term “individual” refers to a mammal.
- the mammal can be a rodent, such as a mouse or rat.
- the mammal is a human.
- Individuals to whom the methods disclosed herein can be applied can be identified by a variety of means, including the use of body mass index (BMI) or surveys that identify individuals exhibiting symptoms of food addiction (e.g., the Yale Food Addiction Scale (see FIG. 6 )).
- BMI body mass index
- surveys that identify individuals exhibiting symptoms of food addiction (e.g., the Yale Food Addiction Scale (see FIG. 6 )).
- certain aspects of the disclosed invention provide methods for the treatment of individuals who meet the definition of food addiction; individuals who are overweight or obese (e.g., a BMI ⁇ 25); individuals who have a binge eating disorder; or individuals who engage in a binge eating behavior.
- These methods comprise the administration of a composition as set forth in any one of Tables 1-3 to an individual meeting the definition of food addiction, an individual who is obese or overweight, an individual who has a binge-eating disorder or an individual who engages in binge eating behavior in amounts effective to control or reduce the intake of food.
- the foods are fatty foods, sugar-rich foods, or foods that are both fatty and sugar-rich.
- Baclofen (at 1.0 and 1.8 mg/kg, administered i.p.)
- Naltrexone (at 0.1 and 1.0 mg/kg, administered i.p.)
- rats Groups of animals (rats) were maintained on their diets for 3 weeks to establish stable binge eating behavior. After this period of time, the rats were administered three days of daily i.p. injections of saline (to acclimate to the injection procedure), and sugar/chow intake was measured after the first hour of access and then hourly for the next 3 hours, as well as at the end of the 12-h access period. After this three-day period, rats were given baclofen+naloxone, and measurements taken as described above. Other dosage amounts of baclofen and naloxone were tested, as were the effects of these compounds alone (with measurements being performed as described above). Vehicle injections were performed between the various tests in order to allow for suitable clearance of compounds from the animals.
- Rats Male Sprague-Dawley rats, 250-300 g at the onset of the experiment, were obtained from Taconic Farms (Germantown, N.Y., USA). Rats were housed individually on a 12-h reversed light/dark cycle and given 1 wk to acclimate before diet training began.
- the Binge Sugar group had access to a 10% (w/v) sucrose solution (Domino® Granulated Pure Cane Sugar, dissolved in tap water, 0.4 kcal/mL)
- the Binge Fat group had access to a 35% (w/v) fat emulsion (3.1 kcal/mL)
- the Binge Sugar-Fat group had access to a 10% (w/v) sugar solution and 35% (w/v) fat emulsion (3.5 kcal/mL).
- Both emulsions were made with Wesson® Pure Vegetable Oil in tap water and 0.6% (w/v) Emplex, a commercially available emulsifier (American Ingredients Company, Kansas City, Mo., USA).
- Palatable food intakes were recorded daily. Chow intake was recorded weekly. Body weights were taken at the beginning and end of the 21-day diet period.
- Drug injections included combinations of R-baclofen (Tocris, Ellisville, Mo., USA) and naltrexone hydrochloride (Sigma, St. Louis, Mo., USA): 0.1 mg/kg naltrexone and 1.0 mg/kg baclofen, or 1.0 mg/kg naltrexone and 1.8 mg/kg baclofen, or either drug was tested alone: 0.1 and 1.0 mg/kg naltrexone, or 1.0 and 1.8 mg/kg baclofen. Intake of palatable food and chow was measured hourly after injection for 4 h and again at the end of the 12-h access period.
- Table 4 shows a summary of palatable food intake in response to the drugs tested as a percent of each groups' saline injections.
Landscapes
- Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Epidemiology (AREA)
- Emergency Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Engineering & Computer Science (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Organic Chemistry (AREA)
- Child & Adolescent Psychology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Abstract
Description
| TABLE 1 |
| Triple Combination Compound Classes |
| GABA-B agonists and Mu antagonists and | |||
| CB-1 antagonists | |||
| GABA-B agonists and Mu antagonists and | |||
| Glycine reuptake inhibitors | |||
| GABA-B agonists and Mu antagonists and | |||
| Dopamine augmenting compounds | |||
| GABA-B agonists and Mu antagonists and | |||
| Nicotine receptor agonists | |||
| GABA-B agonists and Mu antagonists and | |||
| Psychostimulants | |||
| GABA-B agonists and Mu antagonists and | |||
| mGlu⅔ agonists | |||
| GABA-B agonists and Mu antagonists and | |||
| mGlu5 antagonists | |||
| GABA-B agonists and Mu antagonists and | |||
| Glycine-site partial agonists | |||
| GABA-B agonists and Mu antagonists and | |||
| Cystine-glutamate exchangers | |||
| GABA-B agonists and Mu antagonists and | |||
| Cystine-glutamate activators | |||
| GABA-B agonists and Mu antagonists and | |||
| Glutamate transporter inhibitors | |||
| GABA-B agonists and Mu antagonists and | |||
| mGlu5 receptor agonists | |||
| GABA-B agonists and Mu antagonists and | |||
| NMDA receptor co-agonists | |||
| TABLE 2 |
| Two Compound Combinations |
| baclofen and naltrexone | |||
| baclofen and naloxone | |||
| baclofen and nalorphine | |||
| baclofen and levallorphan | |||
| baclofen and buprenorphine | |||
| baclofen and extended release naltrexone | |||
| baclofen and 2-methyl-4aalpha-(3- | |||
| hydroxyphenyl)-1,2,3,4,4a,5,12,12aalpha- | |||
| octahydro-quinolino(2,3-g)isoquinoline | |||
| (TAN-67) | |||
| baclofen and (+)-4-[(αR)-α-((2S,5R)-4-Allyl- | |||
| 2,5-dimethyl-1-piperazinyl)-3- | |||
| methoxybenzyl]-N,N-diethylbenzamide | |||
| (SNC80) | |||
| lesogaberan and naltrexone | |||
| lesogaberan and naloxone | |||
| lesogaberan and nalorphine | |||
| lesogaberan and levallorphan | |||
| lesogaberan and buprenorphine | |||
| lesogaberan and extended release naltrexone | |||
| lesogaberan and TAN-67 | |||
| lesogaberan and SNC80 | |||
| gabapentin and naltrexone | |||
| gabapentin and naloxone | |||
| gabapentin and nalorphine | |||
| gabapentin and levallorphan | |||
| gabapentin and buprenorphine | |||
| gabapentin and extended release naltrexone | |||
| gabapentin and TAN-67 | |||
| gabapentin and SNC80 | |||
| pregabalin and naltrexone | |||
| pregabalin and naloxone | |||
| pregabalin and nalorphine | |||
| pregabalin and levallorphan | |||
| pregabalin and buprenorphine | |||
| pregabalin and extended release naltrexone | |||
| pregabalin and TAN-67 | |||
| pregabalin and SNC80 | |||
| TABLE 3 |
| Three Compound Combinations |
| baclofen and naltrexone and rimonabant | |
| baclofen and naloxone and N-(Piperidin-1-yl)-5-(4- | |
| iodophenyl)-1-(2,4-dichlorophenyl)-4- methyl-1H- | |
| pyrazole-3-carboxamide (AM-251) | |
| baclofen and nalorphine and 2-[methyl-[(3R)-3- | |
| phenyl-3-[4-(trifluoromethyl)phenoxy]propyl] | |
| amino]acetic acid (org24598) | |
| baclofen and naltrexone and acamprosate | |
| baclofen and naltrexone and buproprion | |
| baclofen and naltrexone and buproprion | |
| (extended release) | |
| baclofen and naltrexone and nicotine | |
| baclofen and naltrexone and varenicline | |
| baclofen and naloxone and rimonabant | |
| baclofen and naloxone and am-251 | |
| baclofen and naloxone and org24598 | |
| baclofen and naloxone and acamprosate | |
| baclofen and naloxone and buproprion | |
| baclofen and naloxone and buproprion | |
| (extended release) | |
| baclofen and naloxone and nicotine | |
| baclofen and naloxone and varenicline | |
| baclofen and nalorphine and rimonabant | |
| baclofen and nalorphine and am-251 | |
| baclofen and nalorphine and org24598 | |
| baclofen and nalorphine and acamprosate | |
| baclofen and nalorphine and buproprion | |
| baclofen and nalorphine and buproprion | |
| (extended release) | |
| baclofen and nalorphine and nicotine | |
| baclofen and nalorphine and varenicline | |
| baclofen and levallorphan and rimonabant | |
| baclofen and levallorphan and am-251 | |
| baclofen and levallorphan and org24598 | |
| baclofen and levallorphan and acamprosate | |
| baclofen and levallorphan and buproprion | |
| baclofen and levallorphan and buproprion | |
| (extended release) | |
| baclofen and levallorphan and nicotine | |
| baclofen and levallorphan and varenicline | |
| baclofen and buprenorphine and rimonabant | |
| baclofen and buprenorphine and am-251 | |
| baclofen and buprenorphine and org24598 | |
| baclofen and buprenorphine and acamprosate | |
| baclofen and buprenorphine and buproprion | |
| baclofen and buprenorphine and buproprion | |
| (extended release) | |
| baclofen and buprenorphine and nicotine | |
| baclofen and buprenorphine and varenicline | |
| baclofen and extended release naltrexone and rimonabant | |
| baclofen and extended release naltrexone and am-251 | |
| baclofen and extended release naltrexone and org24598 | |
| baclofen and extended release naltrexone and acamprosate | |
| baclofen and extended release naltrexone and buproprion | |
| baclofen and extended release naltrexone and buproprion | |
| (extended release) | |
| baclofen and extended release naltrexone and nicotine | |
| baclofen and extended release naltrexone and varenicline | |
| baclofen and tan-67 and rimonabant | |
| baclofen and tan-67 and am-251 | |
| baclofen and tan-67 and org24598 | |
| baclofen and tan-67 and acamprosate | |
| baclofen and tan-67 and buproprion | |
| baclofen and tan-67 and buproprion | |
| (extended release) | |
| baclofen and tan-67 and nicotine | |
| baclofen and tan-67 and varenicline | |
| baclofen and snc80 and rimonabant | |
| baclofen and snc80 and am-251 | |
| baclofen and snc80 and org24598 | |
| baclofen and snc80 and acamprosate | |
| baclofen and snc80 and buproprion | |
| baclofen and snc80 and buproprion | |
| (extended release) | |
| baclofen and snc80 and nicotine | |
| baclofen and snc80 and varenicline | |
| lesogaberan and naltrexone and rimonabant | |
| lesogaberan and naltrexone and am-251 | |
| lesogaberan and naltrexone and org24598 | |
| lesogaberan and naltrexone and acamprosate | |
| lesogaberan and naltrexone and buproprion | |
| lesogaberan and naltrexone and buproprion | |
| (extended release) | |
| lesogaberan and naltrexone and nicotine | |
| lesogaberan and naltrexone and varenicline | |
| lesogaberan and naloxone and rimonabant | |
| lesogaberan and naloxone and am-251 | |
| lesogaberan and naloxone and org24598 | |
| lesogaberan and naloxone and acamprosate | |
| lesogaberan and naloxone and buproprion | |
| lesogaberan and naloxone and buproprion | |
| (extended release) | |
| lesogaberan and naloxone and nicotine | |
| lesogaberan and naloxone and varenicline | |
| lesogaberan and nalorphine and rimonabant | |
| lesogaberan and nalorphine and am-251 | |
| lesogaberan and nalorphine and org24598 | |
| lesogaberan and nalorphine and acamprosate | |
| lesogaberan and nalorphine and buproprion | |
| lesogaberan and nalorphine and buproprion | |
| (extended release) | |
| lesogaberan and nalorphine and nicotine | |
| lesogaberan and nalorphine and varenicline | |
| lesogaberan and levallorphan and rimonabant | |
| lesogaberan and levallorphan and am-251 | |
| lesogaberan and levallorphan and org24598 | |
| lesogaberan and levallorphan and acamprosate | |
| lesogaberan and levallorphan and buproprion | |
| lesogaberan and levallorphan and buproprion | |
| (extended release) | |
| lesogaberan and levallorphan and nicotine | |
| lesogaberan and levallorphan and varenicline | |
| lesogaberan and buprenorphine and rimonabant | |
| lesogaberan and buprenorphine and am-251 | |
| lesogaberan and buprenorphine and org24598 | |
| lesogaberan and buprenorphine and acamprosate | |
| lesogaberan and buprenorphine and buproprion | |
| lesogaberan and buprenorphine and buproprion | |
| (extended release) | |
| lesogaberan and buprenorphine and nicotine | |
| lesogaberan and buprenorphine and varenicline | |
| lesogaberan and extended release naltrexone and rimonabant | |
| lesogaberan and extended release naltrexone and am-251 | |
| lesogaberan and extended release naltrexone and org24598 | |
| lesogaberan and extended release naltrexone and acamprosate | |
| lesogaberan and extended release naltrexone and buproprion | |
| lesogaberan and extended release naltrexone and buproprion | |
| (extended release) | |
| lesogaberan and extended release naltrexone and nicotine | |
| lesogaberan and extended release naltrexone and varenicline | |
| lesogaberan and tan-67 and rimonabant | |
| lesogaberan and tan-67 and am-251 | |
| lesogaberan and tan-67 and org24598 | |
| lesogaberan and tan-67 and acamprosate | |
| lesogaberan and tan-67 and buproprion | |
| lesogaberan and tan-67 and buproprion | |
| (extended release) | |
| lesogaberan and tan-67 and nicotine | |
| lesogaberan and tan-67 and varenicline | |
| lesogaberan and snc80 and rimonabant | |
| lesogaberan and snc80 and am-251 | |
| lesogaberan and snc80 and org24598 | |
| lesogaberan and snc80 and acamprosate | |
| lesogaberan and snc80 and buproprion | |
| lesogaberan and snc80 and buproprion | |
| (extended release) | |
| lesogaberan and snc80 and nicotine | |
| lesogaberan and snc80 and varenicline | |
| gabapentin and naltrexone and rimonabant | |
| gabapentin and naltrexone and am-251 | |
| gabapentin and naltrexone and org24598 | |
| gabapentin and naltrexone and acamprosate | |
| gabapentin and naltrexone and buproprion | |
| gabapentin and naltrexone and buproprion | |
| (extended release) | |
| gabapentin and naltrexone and nicotine | |
| gabapentin and naltrexone and varenicline | |
| gabapentin and naloxone and rimonabant | |
| gabapentin and naloxone and am-251 | |
| gabapentin and naloxone and org24598 | |
| gabapentin and naloxone and acamprosate | |
| gabapentin and naloxone and buproprion | |
| gabapentin and naloxone and buproprion | |
| (extended release) | |
| gabapentin and naloxone and nicotine | |
| gabapentin and naloxone and varenicline | |
| gabapentin and nalorphine and rimonabant | |
| gabapentin and nalorphine and am-251 | |
| gabapentin and nalorphine and org24598 | |
| gabapentin and nalorphine and acamprosate | |
| gabapentin and nalorphine and buproprion | |
| gabapentin and nalorphine and buproprion | |
| (extended release) | |
| gabapentin and nalorphine and nicotine | |
| gabapentin and nalorphine and varenicline | |
| gabapentin and levallorphan and rimonabant | |
| gabapentin and levallorphan and am-251 | |
| gabapentin and levallorphan and org24598 | |
| gabapentin and levallorphan and acamprosate | |
| gabapentin and levallorphan and buproprion | |
| gabapentin and levallorphan and buproprion | |
| (extended release) | |
| gabapentin and levallorphan and nicotine | |
| gabapentin and levallorphan and varenicline | |
| gabapentin and buprenorphine and rimonabant | |
| gabapentin and buprenorphine and am-251 | |
| gabapentin and buprenorphine and org24598 | |
| gabapentin and buprenorphine and acamprosate | |
| gabapentin and buprenorphine and buproprion | |
| gabapentin and buprenorphine and buproprion | |
| (extended release) | |
| gabapentin and buprenorphine and nicotine | |
| gabapentin and buprenorphine and varenicline | |
| gabapentin and extended release naltrexone and rimonabant | |
| gabapentin and extended release naltrexone and am-251 | |
| gabapentin and extended release naltrexone and org24598 | |
| gabapentin and extended release naltrexone and acamprosate | |
| gabapentin and extended release naltrexone and buproprion | |
| gabapentin and extended release naltrexone and buproprion | |
| (extended release) | |
| gabapentin and extended release naltrexone and nicotine | |
| gabapentin and extended release naltrexone and varenicline | |
| gabapentin and tan-67 and rimonabant | |
| gabapentin and tan-67 and am-251 | |
| gabapentin and tan-67 and org24598 | |
| gabapentin and tan-67 and acamprosate | |
| gabapentin and tan-67 and buproprion | |
| gabapentin and tan-67 and buproprion | |
| (extended release) | |
| gabapentin and tan-67 and nicotine | |
| gabapentin and tan-67 and varenicline | |
| gabapentin and snc80 and rimonabant | |
| gabapentin and snc80 and am-251 | |
| gabapentin and snc80 and org24598 | |
| gabapentin and snc80 and acamprosate | |
| gabapentin and snc80 and buproprion | |
| gabapentin and snc80 and buproprion | |
| (extended release) | |
| gabapentin and snc80 and nicotine | |
| gabapentin and snc80 and varenicline | |
| pregabalin and naltrexone and rimonabant | |
| pregabalin and naltrexone and am-251 | |
| pregabalin and naltrexone and org24598 | |
| pregabalin and naltrexone and acamprosate | |
| pregabalin and naltrexone and buproprion | |
| pregabalin and naltrexone and buproprion | |
| (extended release) | |
| ppregabalin and naltrexone and nicotine | |
| pregabalin and naltrexone and varenicline | |
| pregabalin and naloxone and rimonabant | |
| pregabalin and naloxone and am-251 | |
| pregabalin and naloxone and org24598 | |
| pregabalin and naloxone and acamprosate | |
| pregabalin and naloxone and buproprion | |
| pregabalin and naloxone and buproprion | |
| (extended release) | |
| pregabalin and naloxone and nicotine | |
| pregabalin and naloxone and varenicline | |
| pregabalin and nalorphine and rimonabant | |
| pregabalin and nalorphine and am-251 | |
| pregabalin and nalorphine and org24598 | |
| pregabalin and nalorphine and acamprosate | |
| pregabalin and nalorphine and buproprion | |
| pregabalin and nalorphine and buproprion | |
| (extended release) | |
| pregabalin and nalorphine and nicotine | |
| pregabalin and nalorphine and varenicline | |
| pregabalin and levallorphan and rimonabant | |
| pregabalin and levallorphan and am-251 | |
| pregabalin and levallorphan and org24598 | |
| pregabalin and levallorphan and acamprosate | |
| pregabalin and levallorphan and buproprion | |
| pregabalin and levallorphan and buproprion | |
| (extended release) | |
| pregabalin and levallorphan and nicotine | |
| pregabalin and levallorphan and varenicline | |
| pregabalin and buprenorphine and rimonabant | |
| pregabalin and buprenorphine and am-251 | |
| pregabalin and buprenorphine and org24598 | |
| pregabalin and buprenorphine and acamprosate | |
| pregabalin and buprenorphine and buproprion | |
| pregabalin and buprenorphine and buproprion | |
| (extended release) | |
| pregabalin and buprenorphine and nicotine | |
| pregabalin and buprenorphine and varenicline | |
| pregabalin and extended release naltrexone and rimonabant | |
| pregabalin and extended release naltrexone and am-251 | |
| pregabalin and extended release naltrexone and org24598 | |
| pregabalin and extended release naltrexone and acamprosate | |
| pregabalin and extended release naltrexone and buproprion | |
| pregabalin and extended release naltrexone and buproprion | |
| (extended release) | |
| pregabalin and extended release naltrexone and nicotine | |
| pregabalin and extended release naltrexone and varenicline | |
| pregabalin and tan-67 and rimonabant | |
| pregabalin and tan-67 and am-251 | |
| pregabalin and tan-67 and org24598 | |
| pregabalin and tan-67 and acamprosate | |
| pregabalin and tan-67 and buproprion | |
| pregabalin and tan-67 and buproprion | |
| (extended release) | |
| pregabalin and tan-67 and nicotine | |
| pregabalin and tan-67 and varenicline | |
| pregabalin and snc80 and rimonabant | |
| pregabalin and snc80 and am-251 | |
| pregabalin and snc80 and org24598 | |
| pregabalin and snc80 and acamprosate | |
| pregabalin and snc80 and buproprion | |
| pregabalin and snc80 and buproprion | |
| (extended release) | |
| pregabalin and snc80 and nicotine | |
| pregabalin and snc80 and varenicline | |
| baclofen and naltrexone and phentermine | |
| baclofen and naltrexone and dexmethylphenidate | |
| baclofen and naltrexone and dextroamphetamine | |
| baclofen and naltrexone and dexedrine | |
| baclofen and naltrexone and Adderall | |
| baclofen and naltrexone and methylphenidate | |
| baclofen and naltrexone and modafanil | |
| baclofen and naltrexone and lisdexamfetamine | |
| baclofen and naloxone and phentermine | |
| baclofen and naloxone and dexmethylphenidate | |
| baclofen and naloxone and dextroamphetamine | |
| baclofen and naloxone and dexedrine | |
| baclofen and naloxone and Adderall | |
| baclofen and naloxone and methylphenidate | |
| baclofen and naloxone and modafanil | |
| baclofen and naloxone and lisdexamfetamine | |
| baclofen and nalorphine and phentermine | |
| baclofen and nalorphine and dexmethylphenidate | |
| baclofen and nalorphine and dextroamphetamine | |
| baclofen and nalorphine and dexedrine | |
| baclofen and nalorphine and Adderall | |
| baclofen and nalorphine and methylphenidate | |
| baclofen and nalorphine and modafanil | |
| baclofen and nalorphine and lisdexamfetamine | |
| baclofen and levallorphan and phentermine | |
| baclofen and levallorphan and dexmethylphenidate | |
| baclofen and levallorphan and dextroamphetamine | |
| baclofen and levallorphan and dexedrine | |
| baclofen and levallorphan and Adderall | |
| baclofen and levallorphan and methylphenidate | |
| baclofen and levallorphan and modafanil | |
| baclofen and levallorphan and lisdexamfetamine | |
| baclofen and buprenorphine and phentermine | |
| baclofen and buprenorphine and dexmethylphenidate | |
| baclofen and buprenorphine and dextroamphetamine | |
| baclofen and buprenorphine and dexedrine | |
| baclofen and buprenorphine and Adderall | |
| baclofen and buprenorphine and methylphenidate | |
| baclofen and buprenorphine and modafanil | |
| baclofen and buprenorphine and lisdexamfetamine | |
| baclofen and extended release naltrexone and phentermine | |
| baclofen and extended release naltrexone and dexmethylphenidate | |
| baclofen and extended release naltrexone and dextroamphetamine | |
| baclofen and extended release naltrexone and dexedrine | |
| baclofen and extended release naltrexone and Adderall | |
| baclofen and extended release naltrexone and methylphenidate | |
| baclofen and extended release naltrexone and modafanil | |
| baclofen and extended release naltrexone and lisdexamfetamine | |
| baclofen and tan-67 and phentermine | |
| baclofen and tan-67 and dexmethylphenidate | |
| baclofen and tan-67 and dextroamphetamine | |
| baclofen and tan-67 and dexedrine | |
| baclofen and tan-67 and Adderall | |
| baclofen and tan-67 and methylphenidate | |
| baclofen and tan-67 and modafanil | |
| baclofen and tan-67 and lisdexamfetamine | |
| baclofen and snc80 and phentermine | |
| baclofen and snc80 and dexmethylphenidate | |
| baclofen and snc80 and dextroamphetamine | |
| baclofen and snc80 and dexedrine | |
| baclofen and snc80 and Adderall | |
| baclofen and snc80 and methylphenidate | |
| baclofen and snc80 and modafanil | |
| baclofen and snc80 and lisdexamfetamine | |
| lesogaberan and naltrexone and phentermine | |
| lesogaberan and naltrexone and dexmethylphenidate | |
| lesogaberan and naltrexone and dextroamphetamine | |
| lesogaberan and naltrexone and dexedrine | |
| lesogaberan and naltrexone and Adderall | |
| lesogaberan and naltrexone and methylphenidate | |
| lesogaberan and naltrexone and modafanil | |
| lesogaberan and naltrexone and lisdexamfetamine | |
| lesogaberan and naloxone and phentermine | |
| lesogaberan and naloxone and dexmethylphenidate | |
| lesogaberan and naloxone and dextroamphetamine | |
| lesogaberan and naloxone and dexedrine | |
| lesogaberan and naloxone and Adderall | |
| lesogaberan and naloxone and methylphenidate | |
| lesogaberan and naloxone and modafanil | |
| lesogaberan and naloxone and lisdexamfetamine | |
| lesogaberan and nalorphine and phentermine | |
| lesogaberan and nalorphine and dexmethylphenidate | |
| lesogaberan and nalorphine and dextroamphetamine | |
| lesogaberan and nalorphine and dexedrine | |
| lesogaberan and nalorphine and Adderall | |
| lesogaberan and nalorphine and methylphenidate | |
| lesogaberan and nalorphine and modafanil | |
| lesogaberan and nalorphine and lisdexamfetamine | |
| lesogaberan and levallorphan and phentermine | |
| lesogaberan and levallorphan and dexmethylphenidate | |
| lesogaberan and levallorphan and dextroamphetamine | |
| lesogaberan and levallorphan and dexedrine | |
| lesogaberan and levallorphan and Adderall | |
| lesogaberan and levallorphan and methylphenidate | |
| lesogaberan and levallorphan and modafanil | |
| lesogaberan and levallorphan and lisdexamfetamine | |
| lesogaberan and buprenorphine and phentermine | |
| lesogaberan and buprenorphine and dexmethylphenidate | |
| lesogaberan and buprenorphine and dextroamphetamine | |
| lesogaberan and buprenorphine and dexedrine | |
| lesogaberan and buprenorphine and Adderall | |
| lesogaberan and buprenorphine and methylphenidate | |
| lesogaberan and buprenorphine and modafanil | |
| lesogaberan and buprenorphine and lisdexamfetamine | |
| lesogaberan and extended release naltrexone and phentermine | |
| lesogaberan and extended release naltrexone and dexmethylphenidate | |
| lesogaberan and extended release naltrexone and dextroamphetamine | |
| lesogaberan and extended release naltrexone and dexedrine | |
| lesogaberan and extended release naltrexone and Adderall | |
| lesogaberan and extended release naltrexone and methylphenidate | |
| lesogaberan and extended release naltrexone and modafanil | |
| lesogaberan and extended release naltrexone and lisdexamfetamine | |
| lesogaberan and tan-67 and phentermine | |
| lesogaberan and tan-67 and dexmethylphenidate | |
| lesogaberan and tan-67 and dextroamphetamine | |
| lesogaberan and tan-67 and dexedrine | |
| lesogaberan and tan-67 and Adderall | |
| lesogaberan and tan-67 and methylphenidate | |
| lesogaberan and tan-67 and modafanil | |
| lesogaberan and tan-67 and lisdexamfetamine | |
| lesogaberan and snc80 and phentermine | |
| lesogaberan and snc80 and dexmethylphenidate | |
| lesogaberan and snc80 and dextroamphetamine | |
| lesogaberan and snc80 and dexedrine | |
| lesogaberan and snc80 and Adderall | |
| lesogaberan and snc80 and methylphenidate | |
| lesogaberan and snc80 and modafanil | |
| lesogaberan and snc80 and lisdexamfetamine | |
| gabapentin and naltrexone and phentermine | |
| gabapentin and naltrexone and dexmethylphenidate | |
| gabapentin and naltrexone and dextroamphetamine | |
| gabapentin and naltrexone and dexedrine | |
| gabapentin and naltrexone and Adderall | |
| gabapentin and naltrexone and methylphenidate | |
| gabapentin and naltrexone and modafanil | |
| gabapentin and naltrexone and lisdexamfetamine | |
| gabapentin and naloxone and phentermine | |
| gabapentin and naloxone and dexmethylphenidate | |
| gabapentin and naloxone and dextroamphetamine | |
| gabapentin and naloxone and dexedrine | |
| gabapentin and naloxone and Adderall | |
| gabapentin and naloxone and methylphenidate | |
| gabapentin and naloxone and modafanil | |
| gabapentin and naloxone and lisdexamfetamine | |
| gabapentin and nalorphine and phentermine | |
| gabapentin and nalorphine and dexmethylphenidate | |
| gabapentin and nalorphine and dextroamphetamine | |
| gabapentin and nalorphine and dexedrine | |
| gabapentin and nalorphine and Adderall | |
| gabapentin and nalorphine and methylphenidate | |
| gabapentin and nalorphine and modafanil | |
| gabapentin and nalorphine and lisdexamfetamine | |
| gabapentin and levallorphan and phentermine | |
| gabapentin and levallorphan and dexmethylphenidate | |
| gabapentin and levallorphan and dextroamphetamine | |
| gabapentin and levallorphan and dexedrine | |
| gabapentin and levallorphan and Adderall | |
| gabapentin and levallorphan and methylphenidate | |
| gabapentin and levallorphan and modafanil | |
| gabapentin and levallorphan and lisdexamfetamine | |
| gabapentin and buprenorphine and phentermine | |
| gabapentin and buprenorphine and dexmethylphenidate | |
| gabapentin and buprenorphine and dextroamphetamine | |
| gabapentin and buprenorphine and dexedrine | |
| gabapentin and buprenorphine and Adderall | |
| gabapentin and buprenorphine and methylphenidate | |
| gabapentin and buprenorphine and modafanil | |
| gabapentin and buprenorphine and lisdexamfetamine | |
| gabapentin and extended release naltrexone and phentermine | |
| gabapentin and extended release naltrexone and dexmethylphenidate | |
| gabapentin and extended release naltrexone and dextroamphetamine | |
| gabapentin and extended release naltrexone and dexedrine | |
| gabapentin and extended release naltrexone and Adderall | |
| gabapentin and extended release naltrexone and methylphenidate | |
| gabapentin and extended release naltrexone and modafanil | |
| gabapentin and extended release naltrexone and lisdexamfetamine | |
| gabapentin and tan-67 and phentermine | |
| gabapentin and tan-67 and dexmethylphenidate | |
| gabapentin and tan-67 and dextroamphetamine | |
| gabapentin and tan-67 and dexedrine | |
| gabapentin and tan-67 and Adderall | |
| gabapentin and tan-67 and methylphenidate | |
| gabapentin and tan-67 and modafanil | |
| gabapentin and tan-67 and lisdexamfetamine | |
| gabapentin and snc80 and phentermine | |
| gabapentin and snc80 and dexmethylphenidate | |
| gabapentin and snc80 and dextroamphetamine | |
| gabapentin and snc80 and dexedrine | |
| gabapentin and snc80 and Adderall | |
| gabapentin and snc80 and methylphenidate | |
| gabapentin and snc80 and modafanil | |
| gabapentin and snc80 and lisdexamfetamine | |
| pregabalin and naltrexone and phentermine | |
| pregabalin and naltrexone and dexmethylphenidate | |
| pregabalin and naltrexone and dextroamphetamine | |
| pregabalin and naltrexone and dexedrine | |
| pregabalin and naltrexone and Adderall | |
| pregabalin and naltrexone and methylphenidate | |
| pregabalin and naltrexone and modafanil | |
| pregabalin and naltrexone and lisdexamfetamine | |
| pregabalin and naloxone and phentermine | |
| pregabalin and naloxone and dexmethylphenidate | |
| pregabalin and naloxone and dextroamphetamine | |
| pregabalin and naloxone and dexedrine | |
| pregabalin and naloxone and Adderall | |
| pregabalin and naloxone and methylphenidate | |
| pregabalin and naloxone and modafanil | |
| pregabalin and naloxone and lisdexamfetamine | |
| pregabalin and nalorphine and phentermine | |
| pregabalin and nalorphine and dexmethylphenidate | |
| pregabalin and nalorphine and dextroamphetamine | |
| pregabalin and nalorphine and dexedrine | |
| pregabalin and nalorphine and Adderall | |
| pregabalin and nalorphine and methylphenidate | |
| pregabalin and nalorphine and modafanil | |
| pregabalin and nalorphine and lisdexamfetamine | |
| pregabalin and levallorphan and phentermine | |
| pregabalin and levallorphan and dexmethylphenidate | |
| pregabalin and levallorphan and dextroamphetamine | |
| pregabalin and levallorphan and dexedrine | |
| pregabalin and levallorphan and Adderall | |
| pregabalin and levallorphan and methylphenidate | |
| pregabalin and levallorphan and modafanil | |
| pregabalin and levallorphan and lisdexamfetamine | |
| pregabalin and buprenorphine and phentermine | |
| pregabalin and buprenorphine and dexmethylphenidate | |
| pregabalin and buprenorphine and dextroamphetamine | |
| pregabalin and buprenorphine and dexedrine | |
| pregabalin and buprenorphine and Adderall | |
| pregabalin and buprenorphine and methylphenidate | |
| pregabalin and buprenorphine and modafanil | |
| pregabalin and buprenorphine and lisdexamfetamine | |
| pregabalin and extended release naltrexone and phentermine | |
| pregabalin and extended release naltrexone and dexmethylphenidate | |
| pregabalin and extended release naltrexone and dextroamphetamine | |
| pregabalin and extended release naltrexone and dexedrine | |
| pregabalin and extended release naltrexone and Adderall | |
| pregabalin and extended release naltrexone and methylphenidate | |
| pregabalin and extended release naltrexone and modafanil | |
| pregabalin and extended release naltrexone and lisdexamfetamine | |
| pregabalin and tan-67 and phentermine | |
| pregabalin and tan-67 and dexmethylphenidate | |
| pregabalin and tan-67 and dextroamphetamine | |
| pregabalin and tan-67 and dexedrine | |
| pregabalin and tan-67 and Adderall | |
| pregabalin and tan-67 and methylphenidate | |
| pregabalin and tan-67 and modafanil | |
| pregabalin and tan-67 and lisdexamfetamine | |
| pregabalin and snc80 and phentermine | |
| pregabalin and snc80 and dexmethylphenidate | |
| pregabalin and snc80 and dextroamphetamine | |
| pregabalin and snc80 and dexedrine | |
| pregabalin and snc80 and Adderall | |
| pregabalin and snc80 and methylphenidate | |
| pregabalin and snc80 and modafanil | |
| pregabalin and snc80 and lisdexamfetamine | |
| baclofen and naltrexone and n-acetylcysteine | |
| baclofen and naltrexone and d-cycloserine | |
| baclofen and naltrexone and ceftriaxone | |
| baclofen and naloxone and n-acetylcysteine | |
| baclofen and naloxone and d-cycloserine | |
| baclofen and naloxone and ceftriaxone | |
| baclofen and nalorphine and n-acetylcysteine | |
| baclofen and nalorphine and d-cycloserine | |
| baclofen and nalorphine and ceftriaxone | |
| baclofen and levallorphan and n-acetylcysteine | |
| baclofen and levallorphan and d-cycloserine | |
| baclofen and levallorphan and ceftriaxone | |
| baclofen and buprenorphine and n-acetylcysteine | |
| baclofen and buprenorphine and d-cycloserine | |
| baclofen and buprenorphine and ceftriaxone | |
| baclofen and extended release naltrexone and n-acetylcysteine | |
| baclofen and extended release naltrexone and d-cycloserine | |
| baclofen and extended release naltrexone and ceftriaxone | |
| baclofen and tan-67 and n-acetylcysteine | |
| baclofen and tan-67 and d-cycloserine | |
| baclofen and tan-67 and ceftriaxone | |
| baclofen and snc80 and n-acetylcysteine | |
| baclofen and snc80 and d-cycloserine | |
| baclofen and snc80 and ceftriaxone | |
| lesogaberan and naltrexone and n-acetylcysteine | |
| lesogaberan and naltrexone and d-cycloserine | |
| lesogaberan and naltrexone and ceftriaxone | |
| lesogaberan and naloxone and n-acetylcysteine | |
| lesogaberan and naloxone and d-cycloserine | |
| lesogaberan and naloxone and ceftriaxone | |
| lesogaberan and nalorphine and n-acetylcysteine | |
| lesogaberan and nalorphine and d-cycloserine | |
| lesogaberan and nalorphine and ceftriaxone | |
| lesogaberan and levallorphan and n-acetylcysteine | |
| lesogaberan and levallorphan and d-cycloserine | |
| lesogaberan and levallorphan and ceftriaxone | |
| lesogaberan and buprenorphine and n-acetylcysteine | |
| lesogaberan and buprenorphine and d-cycloserine | |
| lesogaberan and buprenorphine and ceftriaxone | |
| lesogaberan and extended release naltrexone and n-acetylcysteine | |
| lesogaberan and extended release naltrexone and d-cycloserine | |
| lesogaberan and extended release naltrexone and ceftriaxone | |
| lesogaberan and tan-67 and n-acetylcysteine | |
| lesogaberan and tan-67 and d-cycloserine | |
| lesogaberan and tan-67 and ceftriaxone | |
| lesogaberan and snc80 and n-acetylcysteine | |
| lesogaberan and snc80 and d-cycloserine | |
| lesogaberan and snc80 and ceftriaxone | |
| gabapentin and naltrexone and n-acetylcysteine | |
| gabapentin and naltrexone and d-cycloserine | |
| gabapentin and naltrexone and ceftriaxone | |
| gabapentin and naloxone and n-acetylcysteine | |
| gabapentin and naloxone and d-cycloserine | |
| gabapentin and naloxone and ceftriaxone | |
| gabapentin and nalorphine and n-acetylcysteine | |
| gabapentin and nalorphine and d-cycloserine | |
| gabapentin and nalorphine and ceftriaxone | |
| gabapentin and levallorphan and n-acetylcysteine | |
| gabapentin and levallorphan and d-cycloserine | |
| gabapentin and levallorphan and ceftriaxone | |
| gabapentin and buprenorphine and n-acetylcysteine | |
| gabapentin and buprenorphine and d-cycloserine | |
| gabapentin and buprenorphine and ceftriaxone | |
| gabapentin and extended release naltrexone and n-acetylcysteine | |
| gabapentin and extended release naltrexone and d-cycloserine | |
| gabapentin and extended release naltrexone and ceftriaxone | |
| gabapentin and tan-67 and n-acetylcysteine | |
| gabapentin and tan-67 and d-cycloserine | |
| gabapentin and tan-67 and ceftriaxone | |
| gabapentin and snc80 and n-acetylcysteine | |
| gabapentin and snc80 and d-cycloserine | |
| gabapentin and snc80 and ceftriaxone | |
| pregabalin and naltrexone and n-acetylcysteine | |
| pregabalin and naltrexone and d-cycloserine | |
| pregabalin and naltrexone and ceftriaxone | |
| pregabalin and naloxone and n-acetylcysteine | |
| pregabalin and naloxone and d-cycloserine | |
| pregabalin and naloxone and ceftriaxone | |
| pregabalin and nalorphine and n-acetylcysteine | |
| pregabalin and nalorphine and d-cycloserine | |
| pregabalin and nalorphine and ceftriaxone | |
| pregabalin and levallorphan and n-acetylcysteine | |
| pregabalin and levallorphan and d-cycloserine | |
| pregabalin and levallorphan and ceftriaxone | |
| pregabalin and buprenorphine and n-acetylcysteine | |
| pregabalin and buprenorphine and d-cycloserine | |
| pregabalin and buprenorphine and ceftriaxone | |
| pregabalin and extended release naltrexone and n-acetylcysteine | |
| pregabalin and extended release naltrexone and d-cycloserine | |
| pregabalin and extended release naltrexone and ceftriaxone | |
| pregabalin and tan-67 and n-acetylcysteine | |
| pregabalin and tan-67 and d-cycloserine | |
| pregabalin and tan-67 and ceftriaxone | |
| pregabalin and snc80 and n-acetylcysteine | |
| pregabalin and snc80 and d-cycloserine | |
| pregabalin and snc80 and ceftriaxone | |
| TABLE 4 |
| Palatable food intake following drug injections |
| as a percent of intake after saline injections |
| Naltrexone- | |||
| Naltrexone | Baclofen | Baclofen |
| low | high | low | high | low | high | |
| Group | dose | dose | dose | dose | dose | dose |
| 1-H Intake (%) |
| Binge Sugar | 158 | 92 | 131 | 96 | 115 | 51 |
| Binge Fat | 70 | 59 | 106 | 38 | 110 | 26 |
| Binge Sugar-Fat | 74 | 75 | 100 | 37 | 106 | 44 |
| 12-H Intake (%) |
| Binge Sugar | 92 | 85 | 88 | 90 | 85 | 82 |
| Binge Fat | 85 | 91 | 93 | 56 | 83 | 59 |
| Binge Sugar-Fat | 92 | 109 | 85 | 75 | 94 | 89 |
| TABLE 5 |
| Palatable food intake following drug injections (Kcals) |
| Naltrexone | Baclofen | Naltrexone-Baclofen |
| Group | Saline | low dose | high dose | low dose | high dose | low dose | high dose |
| 1-H Palatable Food Intake (Kcal) |
| Binge Sugar | 2.8 ± 0.5 | 4.4 ± 0.7a | 2.6 ± 0.4a | 3.6 ± 0.8 | 2.7 ± 0.5 | 3.2 ± 0.6b | 1.4 ± 0.4b |
| Binge Fat | 16.8 ± 3.0c,h,i | 11.7 ± 1.9 | 9.9 ± 2.0 | 17.9 ± 2.4d | 6.5 ± 2.0c,d | 18.5 ± 2.3g | 4.3 ± 1.4g,h |
| Binge Sugar-Fat | 23.5 ± 2.7k,m | 17.3 ± 1.7 | 17.6 ± 3.5 | 23.5 ± 3.9j | 8.6 ± 1.6j,k | 24.9 ± 1.9n | 10.4 ± 2.5m,n |
| 12-H Palatable Food Intake (Kcal) |
| Binge Sugar | 12.8 ± 2.3 | 18.7 ± 2.4r | 10.8 ± 1.8r | 11.3 ± 2.5 | 11.4 ± 2.4 | 10.8 ± 2.3 | 10.4 ± 2.8 |
| Binge Fat | 58.6 ± 6.3e,i | 49.9 ± 3.6 | 53.3 ± 4.5 | 54.5 ± 4.5f | 32.6 ± 4.9e,f | 48.7 ± 3.8 | 34.8 ± 3.1i |
| Binge Sugar-Fat | 76.4 ± 5.8p | 70.6 ± 3.4 | 83.3 ± 8.1 | 64.9 ± 6.6 | 57.4 ± 4.1p | 71.8 ± 6.5 | 67.9 ± 4.5 |
| TABLE 6 |
| Chow intake following drug injections (Kcals) |
| Naltrexone | Baclofen | Naltrexone-Baclofen |
| Group | Saline | low dose | high dose | low dose | high dose | low dose | high dose |
| 1-H Chow Intake (Kcal) |
| Binge Sugar | 18.2 ± 1.7 | 25.5 ± 3.2 | 20.1 ± 1.3 | 23.0 ± 1.5 | 19.3 ± 3.4 | 23.0 ± 1.8d | 15.7 ± 1.7d |
| Binge Fat | 11.3 ± 1.3g | 8.5 ± 1.1 | 10.1 ± 1.2 | 12.2 ± 1.7 | 10.6 ± 1.0 | 13.1 ± 0.8h | 8.1 ± 0.7g,h |
| Binge Sugar-Fat | 8.2 ± 1.4 | 6.6 ± 1.0 | 7.1 ± 0.9 | 11.3 ± 1.7i | 6.3 ± 1.0i | 10.1 ± 1.1 | 7.5 ± 1.6 |
| 12-H Chow Intake (Kcal) |
| Binge Sugar | 58.5 ± 2.7a,b,c,e,f | 73.7 ± 5.1a | 78.6 ± 4.7b | 73.5 ± 4.5c | 62.5 ± 3.8 | 77.0 ± 3.2e | 75.4 ± 4.5f |
| Binge Fat | 38.0 ± 3.4 | 34.1 ± 4.3 | 37.0 ± 3.4 | 34.1 ± 3.3 | 35.0 ± 5.0 | 35.1 ± 3.8 | 33.3 ± 3.3 |
| Binge Sugar-Fat | 23.6 ± 2.5 | 26.4 ± 1.9 | 27.4 ± 2.6 | 24.6 ± 2.2 | 24.1 ± 3.1 | 26.3 ± 2.2 | 24.8 ± 1.9 |
| TABLE 7 |
| Total caloric intake following drug injections (Kcals) |
| Naltrexone | Baclofen | Naltrexone-Baclofen |
| Group | Saline | low dose | high dose | low dose | high dose | low dose | high dose |
| 1-H Total Caloric Intake (Kcal) |
| Binge Sugar | 20.9 ± 2.2a | 29.9 ± 3.9a | 22.6 ± 1.7 | 26.7 ± 2.3 | 21.9 ± 4.4 | 26.2 ± 2.4b | 17.1 ± 2.1b |
| Binge Fat | 28.2 ± 3.4e,h | 20.2 ± 3.0 | 19.9 ± 3.2 | 30.1 ± 4.1f | 17.0 ± 3.0e,f | 31.6 ± 3.1i | 12.4 ± 2.1h,i |
| Binge Sugar-Fat | 31.7 ± 4.1k,n | 23.9 ± 2.7 | 24.8 ± 4.4 | 34.8 ± 5.6m | 15.0 ± 2.6k,m | 35.0 ± 3.0o | 17.9 ± 4.0n,o |
| 12-H Total Caloric Intake (Kcal) |
| Binge Sugar | 71.3 ± 5.0c,d | 85.4 ± 7.5 | 89.4 ± 6.4 | 84.8 ± 7.0 | 74.0 ± 6.3 | 87.9 ± 5.5c | 85.9 ± 7.3d |
| Binge Fat | 96.6 ± 9.6 g,j | 84.0 ± 7.9 | 90.3 ± 8.3 | 88.6 ± 7.8 | 67.7 ± 9.9g | 83.7 ± 7.5 | 68.1 ± 6.4j |
| Binge Sugar-Fat | 100.0 ± 8.3 | 97.0 ± 5.7 | 110.7 ± 10.7 | 89.5 ± 8.8 | 81.4 ± 7.3 | 98.1 ± 8.7 | 92.7 ± 6.3 |
Claims (7)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US14/358,418 US9610285B2 (en) | 2011-11-16 | 2012-11-16 | Compositions for controlling food intake and uses therefor |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201161560356P | 2011-11-16 | 2011-11-16 | |
| US14/358,418 US9610285B2 (en) | 2011-11-16 | 2012-11-16 | Compositions for controlling food intake and uses therefor |
| PCT/US2012/065486 WO2013074906A1 (en) | 2011-11-16 | 2012-11-16 | Compositions for controlling food intake and uses therefor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| US20140315938A1 US20140315938A1 (en) | 2014-10-23 |
| US9610285B2 true US9610285B2 (en) | 2017-04-04 |
Family
ID=48430182
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US14/358,418 Active 2033-03-30 US9610285B2 (en) | 2011-11-16 | 2012-11-16 | Compositions for controlling food intake and uses therefor |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US9610285B2 (en) |
| WO (1) | WO2013074906A1 (en) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US12303604B1 (en) | 2024-10-16 | 2025-05-20 | Currax Pharmaceuticals Llc | Pharmaceutical formulations comprising naltrexone and/or bupropion |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2020014302A1 (en) * | 2018-07-11 | 2020-01-16 | Rosenberg Leon I | Therapeutic combinations for treatment of cns disorders |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20020044968A1 (en) | 1996-10-28 | 2002-04-18 | General Mills, Inc. | Embedding and encapsulation of sensitive components into a matrix to obtain discrete controlled release particles |
| US20070072899A1 (en) | 2005-09-26 | 2007-03-29 | Johnson Kirk W | Method for treating drug and behavioral addictions |
| US20070099947A1 (en) * | 2005-11-03 | 2007-05-03 | Alkermes, Inc. | Methods and compositions for the treatment of brain reward system disorders by combination therapy |
| US20070129283A1 (en) | 2005-11-23 | 2007-06-07 | Mckinney Anthony A | Compositions and methods for reducing food cravings |
| US20080293777A1 (en) | 2007-05-23 | 2008-11-27 | Erlanson Daniel A | Weight Loss Treatment |
-
2012
- 2012-11-16 US US14/358,418 patent/US9610285B2/en active Active
- 2012-11-16 WO PCT/US2012/065486 patent/WO2013074906A1/en not_active Ceased
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20020044968A1 (en) | 1996-10-28 | 2002-04-18 | General Mills, Inc. | Embedding and encapsulation of sensitive components into a matrix to obtain discrete controlled release particles |
| US20070072899A1 (en) | 2005-09-26 | 2007-03-29 | Johnson Kirk W | Method for treating drug and behavioral addictions |
| US20070099947A1 (en) * | 2005-11-03 | 2007-05-03 | Alkermes, Inc. | Methods and compositions for the treatment of brain reward system disorders by combination therapy |
| US20070129283A1 (en) | 2005-11-23 | 2007-06-07 | Mckinney Anthony A | Compositions and methods for reducing food cravings |
| US20080293777A1 (en) | 2007-05-23 | 2008-11-27 | Erlanson Daniel A | Weight Loss Treatment |
Non-Patent Citations (16)
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US12303604B1 (en) | 2024-10-16 | 2025-05-20 | Currax Pharmaceuticals Llc | Pharmaceutical formulations comprising naltrexone and/or bupropion |
Also Published As
| Publication number | Publication date |
|---|---|
| WO2013074906A1 (en) | 2013-05-23 |
| US20140315938A1 (en) | 2014-10-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Bray et al. | Drug treatment of the overweight patient | |
| CN1320886C (en) | Method for treating obesity | |
| Ioannides-Demos et al. | Pharmacotherapy for obesity | |
| Bray et al. | Pharmacological treatment of the overweight patient | |
| Ioannides-Demos et al. | Safety of drug therapies used for weight loss and treatment of obesity | |
| CA2260892A1 (en) | Appetite suppression | |
| EP2523557B1 (en) | Methods of providing weight loss therapy in patients with major depression | |
| JP6336592B2 (en) | Pharmaceutical composition for treating pruritus conditions mediated through histamine H4 receptor | |
| US20240074993A1 (en) | Methods of treating or preventing an attention disorder, cognitive disorder, and/or dementia associated with a neurodegenerative disorder | |
| Makowski et al. | Naltrexone/bupropion: an investigational combination for weight loss and maintenance | |
| US9610285B2 (en) | Compositions for controlling food intake and uses therefor | |
| US6617361B2 (en) | Behavior chemotherapy | |
| US8435963B2 (en) | Weight loss compositions and uses thereof | |
| Overall | Behavioral pharmacotherapeutics | |
| US20150110865A1 (en) | Cns stimulant and opioid receptor antagonist combination as a non-addictive, non-aversive and synergistic anti-obesity treatment | |
| EP1347778B1 (en) | Behavior chemotherapy | |
| WO2006115743A2 (en) | Use of selective chloride channel modulators to treat alcohol and/or stimulant substance abuse | |
| Rubino et al. | A review of topiramate and phentermine: a combined therapeutic approach for obesity | |
| JP2020525548A (en) | Peripherally localized dual-acting kappa and delta opioid agonists for analgesia in painful conditions with inflammatory response | |
| US20210015779A1 (en) | Therapeutic compositions and methods | |
| Wilding | Pharmacological approaches for treating obesity | |
| Krasuski | Dr. Jack’s MedQuik Guide | |
| US20130150375A1 (en) | GEPIRONE-ER TREATMENT OF MAJOR DEPRESSION IN PATIENTS TAKING NON-STEROIDAL ANTI-INFLAMMATORY DRUGS (NSAIDs) | |
| HK1059399B (en) | Behavior chemotherapy | |
| KR20140090203A (en) | Therapeutic combination of memantine and baclofen and pharmaceutical composition containing them |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AS | Assignment |
Owner name: UNIVERSITY OF FLORIDA RESEARCH FOUNDATION, INCORPO Free format text: ASSIGNMENT OF ASSIGNORS INTEREST;ASSIGNORS:AVENA, NICOLE M.;GOLD, MARK S.;SIGNING DATES FROM 20150217 TO 20150223;REEL/FRAME:035085/0193 |
|
| STCF | Information on status: patent grant |
Free format text: PATENTED CASE |
|
| MAFP | Maintenance fee payment |
Free format text: PAYMENT OF MAINTENANCE FEE, 4TH YR, SMALL ENTITY (ORIGINAL EVENT CODE: M2551); ENTITY STATUS OF PATENT OWNER: SMALL ENTITY Year of fee payment: 4 |
|
| MAFP | Maintenance fee payment |
Free format text: PAYMENT OF MAINTENANCE FEE, 8TH YR, SMALL ENTITY (ORIGINAL EVENT CODE: M2552); ENTITY STATUS OF PATENT OWNER: SMALL ENTITY Year of fee payment: 8 |