US6489268B1 - Highly selective herbicidal phenoxypropionic acid alkoxycarbonyl anilid compounds and method of preparing the same - Google Patents
Highly selective herbicidal phenoxypropionic acid alkoxycarbonyl anilid compounds and method of preparing the same Download PDFInfo
- Publication number
- US6489268B1 US6489268B1 US10/048,172 US4817202A US6489268B1 US 6489268 B1 US6489268 B1 US 6489268B1 US 4817202 A US4817202 A US 4817202A US 6489268 B1 US6489268 B1 US 6489268B1
- Authority
- US
- United States
- Prior art keywords
- compound
- formula
- group
- hydrogen atom
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 64
- 230000002363 herbicidal effect Effects 0.000 title claims abstract description 25
- 238000000034 method Methods 0.000 title claims abstract description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 48
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 26
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 24
- 239000000203 mixture Substances 0.000 claims abstract description 24
- -1 hydroxy, carboxyl Chemical group 0.000 claims abstract description 18
- 240000007594 Oryza sativa Species 0.000 claims abstract description 16
- 235000007164 Oryza sativa Nutrition 0.000 claims abstract description 16
- 235000009566 rice Nutrition 0.000 claims abstract description 15
- 125000005843 halogen group Chemical group 0.000 claims abstract description 10
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 6
- 125000001424 substituent group Chemical group 0.000 claims abstract description 4
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims abstract description 3
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 3
- 125000006193 alkinyl group Chemical group 0.000 claims abstract description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract description 3
- 241000192043 Echinochloa Species 0.000 claims description 19
- 230000006378 damage Effects 0.000 claims description 6
- 239000004094 surface-active agent Substances 0.000 claims description 6
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000005280 halo alkyl sulfonyloxy group Chemical group 0.000 claims description 3
- 125000005526 alkyl sulfate group Chemical group 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 239000013589 supplement Substances 0.000 claims description 2
- 239000004009 herbicide Substances 0.000 abstract description 12
- 244000058871 Echinochloa crus-galli Species 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 34
- 0 *N(C(=O)C(C)Oc1ccc(OC2=Nc3ccc(Cl)cc3O2)cc1)c1ccccc1.CC Chemical compound *N(C(=O)C(C)Oc1ccc(OC2=Nc3ccc(Cl)cc3O2)cc1)c1ccccc1.CC 0.000 description 24
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 20
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 238000009472 formulation Methods 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000004480 active ingredient Substances 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 241000196324 Embryophyta Species 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000004615 ingredient Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 7
- 238000004440 column chromatography Methods 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- 239000003480 eluent Substances 0.000 description 7
- 238000005160 1H NMR spectroscopy Methods 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 229940052303 ethers for general anesthesia Drugs 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 235000011181 potassium carbonates Nutrition 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- KXKVLQRXCPHEJC-UHFFFAOYSA-N COC(C)=O Chemical compound COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 244000152970 Digitaria sanguinalis Species 0.000 description 3
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 241001148659 Panicum dichotomiflorum Species 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 3
- 238000003306 harvesting Methods 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- ZUMWXUUFEYJXRS-UHFFFAOYSA-N CC.[H]N(C(=O)C(C)Oc1ccc(OC2=Nc3ccc(Cl)cc3O2)cc1)c1ccccc1 Chemical compound CC.[H]N(C(=O)C(C)Oc1ccc(OC2=Nc3ccc(Cl)cc3O2)cc1)c1ccccc1 ZUMWXUUFEYJXRS-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 241000219146 Gossypium Species 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 229910006124 SOCl2 Inorganic materials 0.000 description 2
- 244000098338 Triticum aestivum Species 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- RMRFFCXPLWYOOY-UHFFFAOYSA-N allyl radical Chemical compound [CH2]C=C RMRFFCXPLWYOOY-UHFFFAOYSA-N 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 229960004132 diethyl ether Drugs 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- OVXMBIVWNJDDSM-UHFFFAOYSA-N (benzhydrylideneamino) 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate Chemical compound COC1=CC(OC)=NC(OC=2C(=C(OC=3N=C(OC)C=C(OC)N=3)C=CC=2)C(=O)ON=C(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 OVXMBIVWNJDDSM-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- LVVQTPZQNHQLOM-UHFFFAOYSA-N 2,6-dichloro-1,3-benzoxazole Chemical compound C1=C(Cl)C=C2OC(Cl)=NC2=C1 LVVQTPZQNHQLOM-UHFFFAOYSA-N 0.000 description 1
- WNTGYJSOUMFZEP-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-UHFFFAOYSA-N 0.000 description 1
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 description 1
- YHKBGVDUSSWOAB-UHFFFAOYSA-N 2-chloro-3-{2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]-4-fluorophenyl}propanoic acid Chemical compound O=C1N(C(F)F)C(C)=NN1C1=CC(CC(Cl)C(O)=O)=C(Cl)C=C1F YHKBGVDUSSWOAB-UHFFFAOYSA-N 0.000 description 1
- CYEJMVLDXAUOPN-UHFFFAOYSA-N 2-dodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC=C1O CYEJMVLDXAUOPN-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- ANCDHBXLDURTHN-UHFFFAOYSA-N 2-phenoxypropanamide Chemical class NC(=O)C(C)OC1=CC=CC=C1 ANCDHBXLDURTHN-UHFFFAOYSA-N 0.000 description 1
- UPMXNNIRAGDFEH-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzonitrile Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- XKJMBINCVNINCA-UHFFFAOYSA-N Alfalone Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XKJMBINCVNINCA-UHFFFAOYSA-N 0.000 description 1
- 239000003666 Amidosulfuron Substances 0.000 description 1
- CTTHWASMBLQOFR-UHFFFAOYSA-N Amidosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)=N1 CTTHWASMBLQOFR-UHFFFAOYSA-N 0.000 description 1
- QGQSRQPXXMTJCM-UHFFFAOYSA-N Benfuresate Chemical compound CCS(=O)(=O)OC1=CC=C2OCC(C)(C)C2=C1 QGQSRQPXXMTJCM-UHFFFAOYSA-N 0.000 description 1
- 239000005472 Bensulfuron methyl Substances 0.000 description 1
- 239000005484 Bifenox Substances 0.000 description 1
- 239000005489 Bromoxynil Substances 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N CC(=O)OC(C)C Chemical compound CC(=O)OC(C)C JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- YKYONYBAUNKHLG-UHFFFAOYSA-N CCCOC(C)=O Chemical compound CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000269333 Caudata Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- OFSLKOLYLQSJPB-UHFFFAOYSA-N Cyclosulfamuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)NC=2C(=CC=CC=2)C(=O)C2CC2)=N1 OFSLKOLYLQSJPB-UHFFFAOYSA-N 0.000 description 1
- 239000005502 Cyhalofop-butyl Substances 0.000 description 1
- TYIYMOAHACZAMQ-CQSZACIVSA-N Cyhalofop-butyl Chemical group C1=CC(O[C@H](C)C(=O)OCCCC)=CC=C1OC1=CC=C(C#N)C=C1F TYIYMOAHACZAMQ-CQSZACIVSA-N 0.000 description 1
- PQKBPHSEKWERTG-UHFFFAOYSA-N Fenoxaprop ethyl Chemical group C1=CC(OC(C)C(=O)OCC)=CC=C1OC1=NC2=CC=C(Cl)C=C2O1 PQKBPHSEKWERTG-UHFFFAOYSA-N 0.000 description 1
- LLQPHQFNMLZJMP-UHFFFAOYSA-N Fentrazamide Chemical compound N1=NN(C=2C(=CC=CC=2)Cl)C(=O)N1C(=O)N(CC)C1CCCCC1 LLQPHQFNMLZJMP-UHFFFAOYSA-N 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- STECJAGHUSJQJN-USLFZFAMSA-N LSM-4015 Chemical compound C1([C@@H](CO)C(=O)OC2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-USLFZFAMSA-N 0.000 description 1
- 239000005573 Linuron Substances 0.000 description 1
- SUSRORUBZHMPCO-UHFFFAOYSA-N MC-4379 Chemical compound C1=C([N+]([O-])=O)C(C(=O)OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 SUSRORUBZHMPCO-UHFFFAOYSA-N 0.000 description 1
- 239000005574 MCPA Substances 0.000 description 1
- 239000005583 Metribuzin Substances 0.000 description 1
- 239000005584 Metsulfuron-methyl Substances 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 239000005591 Pendimethalin Substances 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- BGNQYGRXEXDAIQ-UHFFFAOYSA-N Pyrazosulfuron-ethyl Chemical group C1=NN(C)C(S(=O)(=O)NC(=O)NC=2N=C(OC)C=C(OC)N=2)=C1C(=O)OCC BGNQYGRXEXDAIQ-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 239000005623 Thifensulfuron-methyl Substances 0.000 description 1
- QHTQREMOGMZHJV-UHFFFAOYSA-N Thiobencarb Chemical compound CCN(CC)C(=O)SCC1=CC=C(Cl)C=C1 QHTQREMOGMZHJV-UHFFFAOYSA-N 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000005415 aminobenzoic acids Chemical class 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- XOEMATDHVZOBSG-UHFFFAOYSA-N azafenidin Chemical compound C1=C(OCC#C)C(Cl)=CC(Cl)=C1N1C(=O)N2CCCCC2=N1 XOEMATDHVZOBSG-UHFFFAOYSA-N 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- XMQFTWRPUQYINF-UHFFFAOYSA-N bensulfuron-methyl Chemical group COC(=O)C1=CC=CC=C1CS(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 XMQFTWRPUQYINF-UHFFFAOYSA-N 0.000 description 1
- ZOMSMJKLGFBRBS-UHFFFAOYSA-N bentazone Chemical compound C1=CC=C2NS(=O)(=O)N(C(C)C)C(=O)C2=C1 ZOMSMJKLGFBRBS-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- FUHMZYWBSHTEDZ-UHFFFAOYSA-M bispyribac-sodium Chemical compound [Na+].COC1=CC(OC)=NC(OC=2C(=C(OC=3N=C(OC)C=C(OC)N=3)C=CC=2)C([O-])=O)=N1 FUHMZYWBSHTEDZ-UHFFFAOYSA-M 0.000 description 1
- HKPHPIREJKHECO-UHFFFAOYSA-N butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- JBCZYGUJZVGOKA-UHFFFAOYSA-N ethyl 3-[2-(4-hydroxyphenoxy)propanoylamino]benzoate Chemical compound CCOC(=O)C1=CC=CC(NC(=O)C(C)OC=2C=CC(O)=CC=2)=C1 JBCZYGUJZVGOKA-UHFFFAOYSA-N 0.000 description 1
- 229940035423 ethyl ether Drugs 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- VZDNXXPBYLGWOS-UHFFFAOYSA-N methyl 3-aminobenzoate Chemical compound COC(=O)C1=CC=CC(N)=C1 VZDNXXPBYLGWOS-UHFFFAOYSA-N 0.000 description 1
- FOXFZRUHNHCZPX-UHFFFAOYSA-N metribuzin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1N FOXFZRUHNHCZPX-UHFFFAOYSA-N 0.000 description 1
- RSMUVYRMZCOLBH-UHFFFAOYSA-N metsulfuron methyl Chemical group COC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(C)=NC(OC)=N1 RSMUVYRMZCOLBH-UHFFFAOYSA-N 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- DEDOPGXGGQYYMW-UHFFFAOYSA-N molinate Chemical compound CCSC(=O)N1CCCCCC1 DEDOPGXGGQYYMW-UHFFFAOYSA-N 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- CHIFOSRWCNZCFN-UHFFFAOYSA-N pendimethalin Chemical compound CCC(CC)NC1=C([N+]([O-])=O)C=C(C)C(C)=C1[N+]([O-])=O CHIFOSRWCNZCFN-UHFFFAOYSA-N 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229960003975 potassium Drugs 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- LFULEKSKNZEWOE-UHFFFAOYSA-N propanil Chemical compound CCC(=O)NC1=CC=C(Cl)C(Cl)=C1 LFULEKSKNZEWOE-UHFFFAOYSA-N 0.000 description 1
- 125000006412 propinylene group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- USSIUIGPBLPCDF-KEBDBYFISA-N pyriminobac-methyl Chemical group CO\N=C(/C)C1=CC=CC(OC=2N=C(OC)C=C(OC)N=2)=C1C(=O)OC USSIUIGPBLPCDF-KEBDBYFISA-N 0.000 description 1
- FFSSWMQPCJRCRV-UHFFFAOYSA-N quinclorac Chemical compound ClC1=CN=C2C(C(=O)O)=C(Cl)C=CC2=C1 FFSSWMQPCJRCRV-UHFFFAOYSA-N 0.000 description 1
- MGLWZSOBALDPEK-UHFFFAOYSA-N simetryn Chemical compound CCNC1=NC(NCC)=NC(SC)=N1 MGLWZSOBALDPEK-UHFFFAOYSA-N 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229910002029 synthetic silica gel Inorganic materials 0.000 description 1
- AHTPATJNIAFOLR-UHFFFAOYSA-N thifensulfuron-methyl Chemical group S1C=CC(S(=O)(=O)NC(=O)NC=2N=C(OC)N=C(C)N=2)=C1C(=O)OC AHTPATJNIAFOLR-UHFFFAOYSA-N 0.000 description 1
- YMXOXAPKZDWXLY-QWRGUYRKSA-N tribenuron methyl Chemical group COC(=O)[C@H]1CCCC[C@@H]1S(=O)(=O)NC(=O)N(C)C1=NC(C)=NC(OC)=N1 YMXOXAPKZDWXLY-QWRGUYRKSA-N 0.000 description 1
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000001238 wet grinding Methods 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/58—Benzoxazoles; Hydrogenated benzoxazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/74—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,3
- A01N43/76—1,3-Oxazoles; Hydrogenated 1,3-oxazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/45—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups
- C07C233/53—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
- C07C233/54—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring having the carbon atom of the carboxamide group bound to a hydrogen atom or to a carbon atom of a saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C235/18—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated having at least one of the singly-bound oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. phenoxyacetamides
- C07C235/24—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated having at least one of the singly-bound oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. phenoxyacetamides having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
Definitions
- the present invention relates to high selective herbicidal phenoxypropionic acid alkoxycarbonyl anilid compounds represented in formula 1, method of preparing thereof, their use to control barnyard grass produced from rice, and a composition as suitable herbicides,
- R is a hydrogen atom, methyl or ethyl group
- R 1 is a hydrogen atom, C 1 -C 6 alkyl, C 1 -C 6 alkyl substituted with 1 to 3 of the group consisting of hydroxy, carboxyl, and a halogen atom, C 3 -C 6 cycloalkyl, C 3 -C 4 alkenyl, C 3 -C 4 alkinyl, or C 2 -C 4 alkoxyalkyl group;
- n is an integer of 1 or 2 and when n is 2, R 1 can be a combination of other substituents.
- (R 1 ) m is a hydrogen atom, a halogen atom, CF 3 , NO 2 , CN or alkyl group;
- A is O, S or NH
- R 2 is a hydrogen atom or alkyl group
- R 3 and R 4 are a hydrogen atom, C 1 ⁇ C 6 alkyl, C 1 ⁇ C 6 hydroxyalkyl, C 3 ⁇ C 6 cycloalkyl, C 1 ⁇ C 4 alkoxy, or phenyl substituted with 1 to 3 substituents selected from the group consisting of C 1 ⁇ C 4 alkyl group, C 1 ⁇ C 6 alkoxy group, a halogen atom and CF 3 .
- R 6 is a hydrogen or a halogen atom
- R 7 is a hydrogen atom or alkyl group
- R 5 and Z are the same as defined above.
- Japanese Patent publication 2-11580 disclosed the compounds represented in the following formula 5,
- L is lower alkyl group, a halogen atom, methoxy, methoxyphenoxy, benzyloxy, methylthio, methylvinyl group; and n is an integer of 0 to 3.
- Japanese Patent publication 53-40767 and 54-112828 also disclosed that phenoxypropionic acid amide derivatives show herbicidal activities.
- the present invention is characterized by novel phenoxypropionic acid alkoxy-carbonyl anilid and its derivatives represented in formula 1 with an excellent herbicidal activity as well as selectively stable toward rice.
- R, R 1 , and n are the same as previously defined.
- the compounds of formula 1 according to the present invention may be specified as the following Table 1.
- the compounds of formula 1 according to the present invention can be synthesized by a conventional method represented in the following scheme 1, reacting a compound of formula 7 with a compound of formula 8.
- X 1 which is a leaving group, is OH, Cl, Br or phenoxy group; R, R 1 and n are the same as previously defined.
- condensation reaction can be performed by using binder such as triphenylphosphine or 1,3-cyclocarbodiimide and an organic base such as triethylamine or pyridine. It is prefer to carry this reaction at the temperature of 0-100° C. in an inert solvent such as ethers like tetrahydrofuran, ethyethyl acetate, acetonitrile, toluene, xylene, hexane, methylene chloride, carbon tetrachloride, dichloroethane or the like. The product is obtained by evaporating a solvent and performing column chromatograph.
- binder such as triphenylphosphine or 1,3-cyclocarbodiimide
- organic base such as triethylamine or pyridine. It is prefer to carry this reaction at the temperature of 0-100° C. in an inert solvent such as ethers like tetrahydrofuran, ethyethyl
- Another method for preparing the compounds (1) represented in the following scheme 2 is an alkylation of a compound of formula 9 with compounds of formula 10.
- X′′ which is a leaving group, is Cl, Br, I, benzenesulfonyloxy, toluenesulfonyloxy, methanesulfonyloxy or lower alkyl sulfate group; R, R 1 and n are the same as previously defined.
- a strong base which is enough to pull out a hydrogen from anilide, NH.
- the strong base used in this invention is NaOH, KOH, LiOH, NaH, n-BuLi or LDA. It is prefer to carry this reaction at the temperature of ⁇ 78-50° C. in an inert solvent such as ethers like ethylether, dioxane or tetrahydrofuran or hydrocarbons like hexane.
- Another method for preparing the compounds (1) represented in the following scheme 3 is a condensation reaction of a compound of formula 11 with a compound of formula 12 in the presence of a base.
- Y′ is a halogen atom, alkylsulfonyloxy, haloalkylsulfonyloxy, benzenesulfonyloxy or toluenesulfonyloxy group; R, R 1 and n are the same as previously defined.
- alkali metal hydroxides such as sodium hydroxide or potassium hydroxide
- alkali metal carbonates such as sodium carbonate or potassium carbonate
- alkali metal hydrogencarbonates such as sodium hydrogencarbonate or potassium hydrogencarbonzate
- organic bases such as triethylamine, N,N-dimethylaniline, pyridine or 1,8-diazabicyclo[5,4,0]undec-7-ene.
- phase transition catalyst such as tetra-n-butylammonium bromide or 18-crown-6-[1,4,7,10,13,16-hexaoctacyclooctadecane] can be added to complete a reaction rapidly, if necessary. And also one or more than two solvents can be combined and used, if deemed necessary.
- an inert organic solvent for example; ketones such as acetone; aromatic hydrocarbons such as toluene, xylene or chlorobenzene; aliphatic hydrocarbons such as petroleum ether or ligroin; ethers such as diethylether, tetrahydrofuran or dioxane; nitriles such as acetonitrile or propionitrile; or amides such as N,N-dimethylformamide, N,N-dimethylacetamide, N-methylpyrrolidone.
- ketones such as acetone
- aromatic hydrocarbons such as toluene, xylene or chlorobenzene
- aliphatic hydrocarbons such as petroleum ether or ligroin
- ethers such as diethylether, tetrahydrofuran or dioxane
- nitriles such as acetonitrile or propionitrile
- amides such as N,N-dimethyl
- Another method for preparing the compound (1) represented in the following scheme 4 is a condensation reaction of a compound of formula 13 with a compound of formula 14 in the presence of a base.
- Y 1 , R, R 1 and n are the same as previously defined.
- inorganic bases for example; alkali metal hydroxides such as sodium hydroxide or potassium hydroxide, alkali metal carbonates such as sodium carbonate or potassium carbonate, alkali metal hydrogencarbonates such as sodium hydrogencarbonate or potassium hydrogencarbonate or organic bases such as triethylamine, N,N-dimethylaniline, pyridine, picoline, quinoline, or 1,8-diazabicyclo[5,4,0]undec-7-ene.
- alkali metal hydroxides such as sodium hydroxide or potassium hydroxide
- alkali metal carbonates such as sodium carbonate or potassium carbonate
- alkali metal hydrogencarbonates such as sodium hydrogencarbonate or potassium hydrogencarbonate or organic bases
- triethylamine N,N-dimethylaniline, pyridine, picoline, quinoline, or 1,8-diazabicyclo[5,4,0]undec-7-ene.
- phase transition catalyst such as tetra-n-butylammonium bromide or 18-crown-6[1,4,7,10,13,16-hexaoctacyclooctadecane] can be used, if necessary. And also one or more than two solvents can be combined and used, if deemed necessary.
- an inert organic solvent for example; ketones such as acetone or butanone; aromatic hydrocarbons such as benzene, toluene, xylene or chlorobenzene; aliphatic hydrocarbons such as petroleum ether, or ligroin; ethers such as diethylether, tetrahydrofuran or dioxane; nitriles such as acetonitrile or propionitrile; or amides such as N,N-dimethylformamide, N,N-dimethyl acetamide or N-methylpyrrolidone.
- ketones such as acetone or butanone
- aromatic hydrocarbons such as benzene, toluene, xylene or chlorobenzene
- aliphatic hydrocarbons such as petroleum ether, or ligroin
- ethers such as diethylether, tetrahydrofuran or dioxane
- nitriles such as aceton
- 3-aminobenzoic acid ethylester(165.19 mg, 1 mmol), triphenylphosphine(393.4 mg, 1.5 mmol), triethylamine(0.15 ml, 1 mmol) and carbon tetrachloride(1 ml) were added sequentially to 2-[4-(6-chloro-2-benzoxazoyloxy)-phenoxy]propionic acid (346.7 mg, 1 mmol) dissolved in 10 ml of tetrahydrofuran.
- the reaction mixture was heated at reflux for 6 hours.
- the reaction mixture was cooled to room temperature and acidified with 5% hydrochloric acid, followed by addition of water.
- the acidified reaction mixture was extracted three times with ethyl acetate.
- the combined organic solvent layer was dried over magnesium sulfate, filtered and concentrated under reduced pressure.
- the compounds according to the present invention should be formulated in such a suitable type such as wettable powder, emulsions, granules, suspensions and solutions by combining a carrier, a surfactant, a dispersing agent or a supplement agent. Many of these may be applied directly or after diluted with suitable media.
- Formulations can be prepared at spray volume of from hundreds liters to thousands liters per hectare.
- the formulations contain about 0.1% to 99% by weight of active ingredient(s) wherein 0.1% to 20% of surfactant(s) or 0% to 99.9% of solid or liquid diluent(s) are recommended to be added.
- the formulations will contain these ingredients in the following approximate proportions shown in Table 3.
- the proportion of active ingredients is depending on the intended use. Higher ratios of a surfactant to active ingredients are sometimes desirable and are achieved by incorporation into the formulation or tank mixing.
- Solid diluents with high absorption are preferred for wettable powders.
- Liquid diluents and solvents are preferably stable against phase separation at 0° C. All the formulations may contain a small amount of additives to prevent forming, caking, corrosion and growth of microorganisms.
- solutions can be made only by blending ingredients and fine solids by blending and pulverizing with hammer-mill.
- Suspensions can be made by wet-milling and granules can be made by spraying the active ingredients on performed granular carrier.
- Formulation 1 Wettable powders
- the ingredients are thoroughly blended, re-blended after spraying liquid surfactant on the solid ingredients and hammer-milled until all the solids are essentially under 100 ⁇ m.
- Active ingredient 20 wt % Dodecylphenol polyethylene glycol ether 2 wt % Sodium ligninsulfonate 4 wt % Sodium silicon aluminate 6 wt % Montmorillonite 68 wt %
- Formulation 2 Wettable powders
- the ingredients are blended, hammer-milled until all the solids are under 25 ⁇ m and packaged.
- Active ingredient 80 wt % Sodium alkyl naphthalenesulfonate 2 wt % Sodium ligninsulfonate 2 wt % synthetic amorphous silica 3 wt % Kaolinite 13 wt %
- the ingredients are mixed and homogeneously dissolved to give emulsions.
- Active ingredient (Example 3 Compound) 30 wt % Cyclohexanone 20 wt % Polyoxyethylene alkylaryl ether 11 wt % Calcium alkylbenzenesulfonate 4 wt % Methylnaphthalene 35 wt %
- the ingredients were thoroughly blended. 20 Weight part of water was added to 100 weight part of the ingredient mixture. The ingredient mixture was granulated with a size of 14 to 32 mesh by using extrusive granulator and dried.
- Active ingredient 5 wt % Sodium laurylalcoholsulfonate 2 wt % Sodium ligninsulfonate 5 wt % Carboxymethyl cellulose 2 wt % Potassium sulfate 16 wt % Plaster 70 wt %
- the formulations according to this invention were sprayed with diluting to a certain concentration.
- the compounds according to the present invention represent high activity as leaf treatment herbicides for rice and especially effective in rice due to an excellent control of barnyard grass.
- the active ingredients can be used from 30 g to 1 kg per hectare, preferably from 50 g to 400 g.
- the amount of the compounds of the present invention depends on amount and size of weeds and formulations.
- the herbicides of the present invention can be used as alone or in combination with other herbicides, insecticides or bactericides.
- agents selected from the group consisting of bentazon, quinclorac, propanil, simetryn, 2,4-D, fenoxaprop-ethyl, linuron, MCPA, azafenidin, carfentrazone, molinate, thiobencarb, pendimethalin, bensulfuron-methyl, pyrazosulfuron-ethyl, metsulfuron-methyl, thifensulfuron-methyl, tribenuron-methyl, trifluralin, amidosulfuron, bromoxynil, butachlor, mecoprop, metribuzin, bifenox, benfuresate, isoproturon, cyhalofop-butyl, mefenaset, fentrazamide, pyriminobac-methyl, bispyribac sodium, azimsulfruon, cyclosulfamuron and pyanchor.
- agents selected from the group consisting of benta
- the active compound(s) of formula 1 according to the invention exhibited an excellent selectivity toward the plants and herbicidal activity against weeds.
- herbicidal activity of the compounds in table 5 is represented in the following tables 6, 7 and 8.
- the compounds of the present invention exhibit an excellent selectivity toward rice and herbicidal activity against barnyard grass. And also it is proved that the compounds are very stable for the beans, potatos, vegetables and useful to control weeds.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Abstract
Description
| TABLE 1 | |
| (1) | |
|
|
|
| Substituted | |||||
| R | n | position of CO2R1 | R1 | ||
| H | 1 | 3 | H | ||
| H | 1 | 3 | CH3 | ||
| H | 1 | 3 | CH2CH2Cl | ||
| H | 1 | 3 | CH2CH3 | ||
| H | 1 | 3 | CH2CH2CH3 | ||
| H | 1 | 3 | CH(CH3)2 | ||
| H | 1 | 3 | (CH2)3CH3 | ||
| H | 1 | 4 | H | ||
| H | 1 | 4 | CH3 | ||
| H | 1 | 4 | CH2CH3 | ||
| H | 1 | 4 | CH2CH2Cl | ||
| H | 1 | 4 | CH2CH2CH3 | ||
| H | 1 | 4 | CH(CH3)2 | ||
| H | 1 | 4 | (CH2)3CH3 | ||
| H | 1 | 2 | H | ||
| H | 1 | 2 | CH3 | ||
| H | 1 | 2 | CH2CH3 | ||
| H | 1 | 2 | CH2CH2Cl | ||
| H | 1 | 2 | CH2CH2CH3 | ||
| H | 1 | 2 | CH(CH3)2 | ||
| H | 1 | 2 | (CH2)3CH3 | ||
| H | 2 | 3, 4 | CH3 | ||
| H | 2 | 3, 4 | CH2CH3 | ||
| H | 2 | 2, 3 | CH3 | ||
| CH3 | 1 | 2 | H | ||
| CH3 | 1 | 2 | CH3 | ||
| CH3 | 1 | 3 | H | ||
| CH3 | 1 | 3 | CH3 | ||
| CH3 | 1 | 3 | CH2CH3 | ||
| CH3 | 1 | 3 | CH2CH2Cl | ||
| CH3 | 1 | 3 | CH2CH2CH3 | ||
| CH3 | 1 | 3 | CH(CH3)2 | ||
| CH3 | 1 | 3 | (CH2)3CH3 | ||
| CH2CH3 | 1 | 3 | CH(CH3)2 | ||
| CH3 | 1 | 4 | H | ||
| CH3 | 1 | 4 | CH3 | ||
| CH3 | 1 | 4 | CH2CH3 | ||
| CH3 | 1 | 4 | CH2CH2CH3 | ||
| CH3 | 1 | 4 | (CH2)3CH3 | ||
| CH3 | 1 | 4 | CH(CH3)2 | ||
| CH3 | 2 | 2, 3 | CH3 | ||
| CH3 | 2 | 2, 3 | CH2CH3 | ||
| CH3 | 2 | 3, 4 | CH3 | ||
| CH3 | 2 | 3, 4 | CH2CH3 | ||
| H | 1 | 3 | cyclopropyl | ||
| H | 1 | 4 | cyclopropyl | ||
| H | 1 | 3 | cyclopropylmethyl | ||
| H | 1 | 4 | cyclopropylmethyl | ||
| H | 1 | 3 | cyclohexyl | ||
| H | 1 | 3 | CH2CH═CH2 | ||
| H | 1 | 3 | CH2—C≡CH | ||
| H | 1 | 4 | CH2CH═CH2 | ||
| H | 1 | 4 | CH2C≡CH | ||
| H | 1 | 3 | CH2CH2OCH3 | ||
| H | 1 | 4 | CH2CH2OCH3 | ||
| H | 1 | 3 | CH2CH2OH | ||
| H | 1 | 4 | CH2CH2OH | ||
| H | 1 | 3 | CH2CO2H | ||
| H | 1 | 3 | CH2CO2CH3 | ||
| H | 1 | 4 | CH2CO2H | ||
| H | 1 | 4 | CH2CO2CH3 | ||
| H | 1 | 3 | CH2CO2Et | ||
| H | 1 | 4 | CH2CO2Et | ||
| TABLE 2 |
|
|
| Example | X1 | X2 | X3 | 1H-NMR(CDCl3) | m.p. (° C.) |
| Example 8 | H |
|
H | 1.03(3H, t), 1.67(3H, d), 1.78(2H, m), 4.29(2H, t), 4.8(1H, q), 7.05˜8.04(11H, m), 8.29(1H, br) | 104-106 |
| Example 9 | H |
|
H | 1.37(6H, d), 1.67(3H, d), 4.8(1H, q), 5.25(1H, m), 7.02˜8.01(11H, m), 8.3(1H, br) | 104-105 |
| Example 10 | H | H |
|
1.67(3H, d), 3.91(3H, s), 4.8(1H, q), 7.02˜7.46(7H, m), 7.68(2H, d), 8.04(2H, d), 8.3(1H, br) | 183-184 |
| Example 11 | H | H |
|
1.41(3H, t), 1.67(3H, d), 4.38(2H, q), 4.8(1H, q), 7.02˜7.46(7H, m), 7.68(2H, d), 8.04(2H, d), 8.3(1H, br) | 136-138 |
| TABLE 3 | ||
| Weight % | ||
| Formulations | Active ingredient | Diluent | Surfactant |
| Wettable powders | 10˜90 | 0˜74 | 1˜10 |
| Suspension | 3˜50 | 40˜95 | 0˜15 |
| Emulsions · Solution | 3˜50 | 40˜95 | 0˜15 |
| Granules | 0.1˜95 | 5˜99.9 | 1˜15 |
| Active ingredient (Example 3 Compound) | 20 | wt % | ||
| Dodecylphenol polyethylene glycol ether | 2 | wt % | ||
| Sodium ligninsulfonate | 4 | wt % | ||
| Sodium silicon aluminate | 6 | wt % | ||
| Montmorillonite | 68 | wt % | ||
| Active ingredient (Example 3 Compound) | 80 | wt % | ||
| Sodium alkyl naphthalenesulfonate | 2 | wt % | ||
| Sodium ligninsulfonate | 2 | wt % | ||
| synthetic amorphous silica | 3 | wt % | ||
| Kaolinite | 13 | wt % | ||
| Active ingredient (Example 3 Compound) | 30 | wt % | ||
| Cyclohexanone | 20 | wt % | ||
| Polyoxyethylene alkylaryl ether | 11 | wt % | ||
| Calcium alkylbenzenesulfonate | 4 | wt % | ||
| Methylnaphthalene | 35 | wt % | ||
| Active ingredient (Example 3 Compound) | 5 | wt % | ||
| Sodium laurylalcoholsulfonate | 2 | wt % | ||
| Sodium ligninsulfonate | 5 | wt % | ||
| Carboxymethyl cellulose | 2 | wt % | ||
| Potassium sulfate | 16 | wt % | ||
| Plaster | 70 | wt % | ||
| TABLE 4 | ||
| ABRV. | SCIENTIFIC NAME | ENGLISH NAME |
| ZEAMX | Zea mays L. | Corn |
| GLXMA | Glydne max (L.) MERR | Soy bean |
| GOSHI | Gossypium | Cotton |
| TRZAW | Triticum aestivum L. | Wheat |
| ORYSA | Oryza sativa L. cv. Dongjin | Rice |
| SORBI | Andropogon sorghum | Common sorgum |
| ECHCG | Echinochloa crus-galli Beauv. var. | Barnyard grass |
| caudata Kitagawa | ||
| DIGSA | Digitaria Sanguinalis (L.) SCOP | Large crabgrass |
| PANDI | Panicum dichotomiflorum Michx | Fall panicum |
| TABLE 5 |
|
|
| Compound No. | R | X1 | X2 | X3 |
| 1 | H | H |
|
H |
| 2 | H | H |
|
H |
| 3 | CH3 | H |
|
H |
| 4 | H | H | H |
|
| 5 | H | H | H |
|
| 6 | H | H |
|
H |
| 7 | H | H |
|
H |
| control | H | H | 3-CH3 | H |
| TABLE 6 | |||||
| Compound | Treated amount (g/ha) | ORYSA | ECHCG | ||
| 1 | 15 | 0 | 0 | ||
| 30 | 0 | 80 | |||
| 60 | 0 | 100 | |||
| 125 | 0 | 100 | |||
| 250 | 10 | 100 | |||
| 500 | 20 | 100 | |||
| 1000 | 30 | 100 | |||
| 2 | 15 | 0 | 8 | ||
| 30 | 0 | 100 | |||
| 60 | 0 | 100 | |||
| 125 | 0 | 100 | |||
| 250 | 15 | 100 | |||
| 500 | 35 | 100 | |||
| 1000 | 45 | 100 | |||
| 3 | 15 | 0 | 0 | ||
| 30 | 0 | 0 | |||
| 60 | 0 | 20 | |||
| 125 | 0 | 90 | |||
| 250 | 0 | 100 | |||
| 500 | 0 | 100 | |||
| 1000 | 0 | 100 | |||
| TABLE 7 | |||
| Treated amount (kg/ha) | |||
| Compound | Weeds | 0.1 | 0.025 | ||
| 4 | ZEAMX | 0 | 0 | ||
| GLXMA | 0 | 0 | |||
| GOSHI | 0 | 0 | |||
| TRZAW | 0 | 0 | |||
| ORYSA | 30 | 0 | |||
| SORBI | 100 | 70 | |||
| ECHCG | 100 | 100 | |||
| DIGSA | 100 | 100 | |||
| PANDI | 100 | 80 | |||
| 5 | ZEAMX | 30 | 0 | ||
| GLXMA | 20 | 0 | |||
| GOSHI | 0 | 0 | |||
| TRZAW | 20 | 0 | |||
| ORYSA | 40 | 0 | |||
| SORBI | 100 | 95 | |||
| ECHCG | 100 | 95 | |||
| DIGSA | 100 | 100 | |||
| PANDI | 100 | 95 | |||
| TABLE 8 | ||
| Treated amount (kg/ha) | ||
| Compound | Weeds | 1 | 025 | 0.063 | 0.016 | 0.004 |
| 2 | ZEMAX | 100 | 100 | 20 | 0 | 0 |
| GLXMA | 0 | 0 | 0 | 0 | 0 | |
| GOSHI | 0 | 0 | 0 | 0 | 0 | |
| TRZAW | 40 | 20 | 0 | 0 | 0 | |
| ORYSA | 40 | 40 | 0 | 0 | 0 | |
| SORBI | 100 | 100 | 100 | 100 | 40 | |
| ECHCG | 100 | 100 | 100 | 100 | 90 | |
| DIGSA | 100 | 100 | 100 | 100 | 95 | |
| PANDI | 100 | 100 | 100 | 100 | 95 | |
Claims (19)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR99-31855 | 1999-08-03 | ||
| KR19990031855 | 1999-08-03 | ||
| PCT/KR2000/000834 WO2001008479A2 (en) | 1999-08-03 | 2000-07-31 | High selective herbicidal phenoxypropionic acid alkoxycarbonyl anilid compounds and method of preparing thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US6489268B1 true US6489268B1 (en) | 2002-12-03 |
Family
ID=19606127
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US10/048,172 Expired - Lifetime US6489268B1 (en) | 1999-08-03 | 2000-07-31 | Highly selective herbicidal phenoxypropionic acid alkoxycarbonyl anilid compounds and method of preparing the same |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US6489268B1 (en) |
| EP (1) | EP1206187B1 (en) |
| JP (1) | JP3889967B2 (en) |
| KR (1) | KR100398083B1 (en) |
| CN (1) | CN100334949C (en) |
| AR (1) | AR022352A1 (en) |
| AT (1) | ATE250855T1 (en) |
| AU (1) | AU759366B2 (en) |
| BR (1) | BR0012933B1 (en) |
| CA (1) | CA2378795C (en) |
| DE (1) | DE60005694T2 (en) |
| DK (1) | DK1206187T3 (en) |
| ES (1) | ES2211573T3 (en) |
| WO (1) | WO2001008479A2 (en) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20050043180A1 (en) * | 2001-11-01 | 2005-02-24 | Kim Dae Whang | Optically active herbicidal (r)-phenoxypropionic acid-n-methyl-n-2-fluorophenyl amides |
| CN108084108B (en) * | 2017-12-28 | 2020-12-29 | 青岛清原化合物有限公司 | 5-chlorobenzoxazole derivative and preparation method, herbicidal composition and application thereof |
Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2245471A1 (en) | 1971-09-17 | 1973-03-22 | Gulf Research Development Co | METHODS FOR IMPROVING THE RESISTANCE OF CROPS TO PRE-emergence weed killer |
| US4130413A (en) | 1976-09-10 | 1978-12-19 | Hoechst Aktiengesellschaft | Heterocyclic phenyl ethers and herbicides containing same |
| US4531969A (en) | 1977-12-24 | 1985-07-30 | Hoechst Aktiengesellschaft | Herbicidal esters of D-1-(phenoxy-4-phenoxy)propionic acid |
| JPH0211580A (en) | 1988-06-30 | 1990-01-16 | Kumiai Chem Ind Co Ltd | Phenoxypropionic acid amide derivative and herbicide |
| US4968343A (en) | 1985-09-16 | 1990-11-06 | The Dow Chemical Company | Fluoroalkyl anilide derivatives of 2-(4-aryloxyphenoxy)alkanoic or alkenoic acids as selective herbicides |
| EP0527016A1 (en) | 1991-08-01 | 1993-02-10 | E.I. Du Pont De Nemours And Company | Herbicidal quinoxalinyloxy ethers |
| US5254527A (en) | 1977-12-24 | 1993-10-19 | Hoechst Aktiengesellschaft | Optically active herbicidal ethyl-2-(4-(6-chloro-benzoxazol-2-yloxy)-phenoxy)-propionate |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4531959A (en) * | 1984-10-04 | 1985-07-30 | Corning Glass Works | Method and apparatus for coating optical fibers |
| DE3821600A1 (en) * | 1988-06-27 | 1989-12-28 | Bayer Ag | HETEROARYLOXYACETIC ACID-N-ISOPROPYLANILIDE |
| JP2688973B2 (en) * | 1989-02-13 | 1997-12-10 | 三菱化学株式会社 | Paddy field herbicide composition |
-
2000
- 2000-07-31 BR BRPI0012933-0A patent/BR0012933B1/en not_active IP Right Cessation
- 2000-07-31 DE DE60005694T patent/DE60005694T2/en not_active Expired - Lifetime
- 2000-07-31 EP EP00948384A patent/EP1206187B1/en not_active Expired - Lifetime
- 2000-07-31 ES ES00948384T patent/ES2211573T3/en not_active Expired - Lifetime
- 2000-07-31 AU AU61868/00A patent/AU759366B2/en not_active Expired
- 2000-07-31 CN CNB008112339A patent/CN100334949C/en not_active Expired - Lifetime
- 2000-07-31 AT AT00948384T patent/ATE250855T1/en not_active IP Right Cessation
- 2000-07-31 DK DK00948384T patent/DK1206187T3/en active
- 2000-07-31 CA CA002378795A patent/CA2378795C/en not_active Expired - Lifetime
- 2000-07-31 JP JP2001513227A patent/JP3889967B2/en not_active Expired - Lifetime
- 2000-07-31 US US10/048,172 patent/US6489268B1/en not_active Expired - Lifetime
- 2000-07-31 WO PCT/KR2000/000834 patent/WO2001008479A2/en not_active Ceased
- 2000-08-02 KR KR10-2000-0044837A patent/KR100398083B1/en not_active Expired - Lifetime
- 2000-08-02 AR ARP000103995A patent/AR022352A1/en active IP Right Grant
Patent Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2245471A1 (en) | 1971-09-17 | 1973-03-22 | Gulf Research Development Co | METHODS FOR IMPROVING THE RESISTANCE OF CROPS TO PRE-emergence weed killer |
| US4130413A (en) | 1976-09-10 | 1978-12-19 | Hoechst Aktiengesellschaft | Heterocyclic phenyl ethers and herbicides containing same |
| US4531969A (en) | 1977-12-24 | 1985-07-30 | Hoechst Aktiengesellschaft | Herbicidal esters of D-1-(phenoxy-4-phenoxy)propionic acid |
| US5254527A (en) | 1977-12-24 | 1993-10-19 | Hoechst Aktiengesellschaft | Optically active herbicidal ethyl-2-(4-(6-chloro-benzoxazol-2-yloxy)-phenoxy)-propionate |
| US4968343A (en) | 1985-09-16 | 1990-11-06 | The Dow Chemical Company | Fluoroalkyl anilide derivatives of 2-(4-aryloxyphenoxy)alkanoic or alkenoic acids as selective herbicides |
| JPH0211580A (en) | 1988-06-30 | 1990-01-16 | Kumiai Chem Ind Co Ltd | Phenoxypropionic acid amide derivative and herbicide |
| EP0527016A1 (en) | 1991-08-01 | 1993-02-10 | E.I. Du Pont De Nemours And Company | Herbicidal quinoxalinyloxy ethers |
Non-Patent Citations (6)
| Title |
|---|
| English-Language Abstract of JP 2-11580. |
| G. Snatzke et al., Determination of the Optical Purity of Substituted N-phenylpropionamides by NMR Spectroscopy. Org. Magn. Resonance, May 1, 1973 (9), 413-14 (Eng.) Columbus OH USA: Chemical Abstracts vol. 80, p. 262, col. 2, the Abstract No. 2990y. |
| I. Hermecz et al., Nitrogen Bridgehead Compounds. Part 85, Synthesis and Reactivity of 3, 4-dihydro-1H, 6H. [1,4] oxazino[3,4.b]quiazolin-6-ones, J. Heterocycl. Chem. 1993, 30(5), 1413-20 (Eng). Columbus OH USA: Chemical Abstracts vol. 120, p. 1039, col. 2, the abstract No. 245002b. |
| M. A. Sayed et al., Synthesis and Some Reactions of 2-(chloroethyl)-3, 1-nenzoxazin-4(H). One Indian J. Chem. Sect. B, Mar. 1, 1991 OB (10); 980-3 (Eng). Columbus OH USA: Chemical Abstracts vol. 115, p. 859, col. 1, the abstract No. 256110h. |
| P. Singh et al., Study in Nitrogen Mustards, Part III. Synthesis of some 2-alkyl-3-aryl-4 (3)-quinazolinone Derivatives with Nitrogen Mustard Moiety as Possible Antitumor Agents, J. Indian Chem. Soc., May 1, 1979 6 (1) 77-80 (Eng). Columbus OH USA: Chemical Abstracts vol. 92, p. 669, col. 1, the abstract No. 58712z. |
| Snatzke, G-et al. -Synthesis of Optically active alpha-halopropion-anilides-Chem- Ber-, Oct. 1, 1973, 6 (6), 2072-5 (Ger-)- Columbus OH USA: Chemical Abstracts vol. 79, p. 399, col. 2, the abstract No. 65754z. |
Also Published As
| Publication number | Publication date |
|---|---|
| KR20010049975A (en) | 2001-06-15 |
| KR100398083B1 (en) | 2003-09-19 |
| CA2378795C (en) | 2008-09-23 |
| BR0012933B1 (en) | 2013-03-05 |
| CA2378795A1 (en) | 2001-02-08 |
| DK1206187T3 (en) | 2004-01-26 |
| CN100334949C (en) | 2007-09-05 |
| DE60005694D1 (en) | 2003-11-06 |
| JP3889967B2 (en) | 2007-03-07 |
| ATE250855T1 (en) | 2003-10-15 |
| EP1206187A2 (en) | 2002-05-22 |
| CN1402614A (en) | 2003-03-12 |
| BR0012933A (en) | 2003-07-22 |
| AU6186800A (en) | 2001-02-19 |
| DE60005694T2 (en) | 2004-08-19 |
| ES2211573T3 (en) | 2004-07-16 |
| AR022352A1 (en) | 2002-09-04 |
| EP1206187B1 (en) | 2003-10-01 |
| AU759366B2 (en) | 2003-04-10 |
| WO2001008479A2 (en) | 2001-02-08 |
| JP2003505476A (en) | 2003-02-12 |
| WO2001008479A3 (en) | 2001-08-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1100332B1 (en) | Herbicidal phenoxypropionic acid n-alkyl-n-2-fluorophenyl amide compounds | |
| US20050043180A1 (en) | Optically active herbicidal (r)-phenoxypropionic acid-n-methyl-n-2-fluorophenyl amides | |
| AU2002212806A1 (en) | Optically active herbicidal (R)-phenoxypropionic acid-N-methyl-N-2-fluorophenyl amides | |
| US6600048B2 (en) | Herbicidal phenoxypropionic acid N-alkyl-N-2-fluorophenyl amide compounds | |
| US6489268B1 (en) | Highly selective herbicidal phenoxypropionic acid alkoxycarbonyl anilid compounds and method of preparing the same | |
| KR100419853B1 (en) | Optically active herbicidal (R)-phenoxypropionic acid-N-methyl-N-2-fluorophenyl amides | |
| RU2264392C2 (en) | Optically active herbicide (r)-phenoxypropionic acid n-methyl-n-2-fluorophenylamide, method for control of barnyard- grass and herbicide composition | |
| KR100419856B1 (en) | Herbicidal phenoxypropion amides | |
| KR20010106604A (en) | Herbicidal haloxyfop amides | |
| JP2001011061A (en) | Benzoxazole derivatives, their production method and herbicides | |
| PL205136B1 (en) | Optically active herbicidal (r)-phenoxypropionic acid-n-methyl-n-2-fluorophenyl amides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AS | Assignment |
Owner name: DONGBU HANNONG CHEMICAL CO., LTD., KOREA, REPUBLIC Free format text: ASSIGNMENT OF ASSIGNORS INTEREST;ASSIGNORS:KIM, DAE WHANG;CHANG, HAE SUNG;KO, YOUNG KWAN;AND OTHERS;REEL/FRAME:012758/0209 Effective date: 20020121 |
|
| STCF | Information on status: patent grant |
Free format text: PATENTED CASE |
|
| FPAY | Fee payment |
Year of fee payment: 4 |
|
| FEPP | Fee payment procedure |
Free format text: PAYOR NUMBER ASSIGNED (ORIGINAL EVENT CODE: ASPN); ENTITY STATUS OF PATENT OWNER: LARGE ENTITY |
|
| FPAY | Fee payment |
Year of fee payment: 8 |
|
| FPAY | Fee payment |
Year of fee payment: 12 |
|
| AS | Assignment |
Owner name: DONGBU FARM HANNONG CO., LTD., KOREA, REPUBLIC OF Free format text: ASSIGNMENT OF ASSIGNORS INTEREST;ASSIGNOR:DONGBU HITEK CO., LTD.;REEL/FRAME:037475/0828 Effective date: 20150810 Owner name: DONGBU HITEK CO., LTD., KOREA, REPUBLIC OF Free format text: CHANGE OF NAME;ASSIGNOR:DONGBU HANNONG CHEMICAL CO.,LTD.;REEL/FRAME:037509/0089 Effective date: 20070503 |



































