US3909270A - Dichroic reversible photosensitive materials - Google Patents
Dichroic reversible photosensitive materials Download PDFInfo
- Publication number
- US3909270A US3909270A US392302A US39230273A US3909270A US 3909270 A US3909270 A US 3909270A US 392302 A US392302 A US 392302A US 39230273 A US39230273 A US 39230273A US 3909270 A US3909270 A US 3909270A
- Authority
- US
- United States
- Prior art keywords
- alkali metal
- ion
- crystal
- alkali
- accordance
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000463 material Substances 0.000 title claims abstract description 41
- 230000002441 reversible effect Effects 0.000 title claims abstract description 14
- 239000013078 crystal Substances 0.000 claims abstract description 61
- 229910001508 alkali metal halide Inorganic materials 0.000 claims abstract description 41
- 150000008045 alkali metal halides Chemical class 0.000 claims abstract description 41
- 229910001413 alkali metal ion Inorganic materials 0.000 claims abstract description 38
- 150000002500 ions Chemical class 0.000 claims abstract description 29
- 229910021645 metal ion Inorganic materials 0.000 claims abstract description 23
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 18
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 18
- 238000010893 electron trap Methods 0.000 claims abstract description 14
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 claims description 48
- 235000013024 sodium fluoride Nutrition 0.000 claims description 24
- 239000011775 sodium fluoride Substances 0.000 claims description 24
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 12
- HBBGRARXTFLTSG-UHFFFAOYSA-N Lithium ion Chemical group [Li+] HBBGRARXTFLTSG-UHFFFAOYSA-N 0.000 claims description 10
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 claims description 10
- 229910001416 lithium ion Inorganic materials 0.000 claims description 10
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 9
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 claims description 9
- PQXKHYXIUOZZFA-UHFFFAOYSA-M lithium fluoride Chemical compound [Li+].[F-] PQXKHYXIUOZZFA-UHFFFAOYSA-M 0.000 claims description 8
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 6
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 6
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 claims description 6
- 239000011777 magnesium Substances 0.000 claims description 6
- 229910052749 magnesium Inorganic materials 0.000 claims description 6
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 claims description 6
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 claims description 6
- JAAGVIUFBAHDMA-UHFFFAOYSA-M rubidium bromide Chemical compound [Br-].[Rb+] JAAGVIUFBAHDMA-UHFFFAOYSA-M 0.000 claims description 6
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 claims description 6
- 239000011780 sodium chloride Substances 0.000 claims description 6
- -1 netal halide Chemical class 0.000 claims description 5
- 235000011164 potassium chloride Nutrition 0.000 claims description 5
- 239000001103 potassium chloride Substances 0.000 claims description 5
- 229910001428 transition metal ion Inorganic materials 0.000 claims description 5
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 claims description 4
- 239000011651 chromium Substances 0.000 claims description 4
- 229910001425 magnesium ion Inorganic materials 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 3
- 229910052788 barium Inorganic materials 0.000 claims description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052790 beryllium Inorganic materials 0.000 claims description 3
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 claims description 3
- LYQFWZFBNBDLEO-UHFFFAOYSA-M caesium bromide Chemical compound [Br-].[Cs+] LYQFWZFBNBDLEO-UHFFFAOYSA-M 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 239000011575 calcium Substances 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 3
- 229910052742 iron Inorganic materials 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 235000003270 potassium fluoride Nutrition 0.000 claims description 3
- 239000011698 potassium fluoride Substances 0.000 claims description 3
- 235000009518 sodium iodide Nutrition 0.000 claims description 3
- 229910052712 strontium Inorganic materials 0.000 claims description 3
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 3
- 229910052719 titanium Inorganic materials 0.000 claims description 3
- 239000010936 titanium Substances 0.000 claims description 3
- 229910052720 vanadium Inorganic materials 0.000 claims description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 229910001423 beryllium ion Inorganic materials 0.000 claims description 2
- PWOSZCQLSAMRQW-UHFFFAOYSA-N beryllium(2+) Chemical compound [Be+2] PWOSZCQLSAMRQW-UHFFFAOYSA-N 0.000 claims description 2
- 229910052804 chromium Inorganic materials 0.000 claims description 2
- 229910001430 chromium ion Inorganic materials 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 229910001427 strontium ion Inorganic materials 0.000 claims description 2
- PWYYWQHXAPXYMF-UHFFFAOYSA-N strontium(2+) Chemical compound [Sr+2] PWYYWQHXAPXYMF-UHFFFAOYSA-N 0.000 claims description 2
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims 1
- 230000003287 optical effect Effects 0.000 abstract description 4
- 238000003860 storage Methods 0.000 abstract description 2
- 241000251468 Actinopterygii Species 0.000 abstract 1
- 238000010521 absorption reaction Methods 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 10
- 238000000034 method Methods 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 4
- 238000010894 electron beam technology Methods 0.000 description 4
- 230000000737 periodic effect Effects 0.000 description 4
- 206010034972 Photosensitivity reaction Diseases 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 230000036211 photosensitivity Effects 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 229940058494 beryllium Drugs 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- AHLATJUETSFVIM-UHFFFAOYSA-M rubidium fluoride Chemical compound [F-].[Rb+] AHLATJUETSFVIM-UHFFFAOYSA-M 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910001415 sodium ion Inorganic materials 0.000 description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910052693 Europium Inorganic materials 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- 229910052772 Samarium Inorganic materials 0.000 description 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 229910001515 alkali metal fluoride Inorganic materials 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910001512 metal fluoride Inorganic materials 0.000 description 1
- 150000001457 metallic cations Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium atom Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 230000002747 voluntary effect Effects 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/72—Photosensitive compositions not covered by the groups G03C1/005 - G03C1/705
- G03C1/725—Photosensitive compositions not covered by the groups G03C1/005 - G03C1/705 containing inorganic compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/10—Esters; Ether-esters
- C08K5/101—Esters; Ether-esters of monocarboxylic acids
- C08K5/103—Esters; Ether-esters of monocarboxylic acids with polyalcohols
Definitions
- This invention relates to dichroic reversible photosensitive materials and a method for the preparation thereof. More particularly, it concerns dichroic reversible photosensitive materials which consist of the crystals of an alkali metal halide which contain an alkali metal ion having smaller ion radius than that of the alkali metal in said alkali metal halide and also one or more kinds of other metal ions than alkali metal ion which possess an ability to act as an electron trap; which have M-center, and a method for the preparation therof.
- the M-center oriented to the direction of 1 l), e.g., that of sodium fluoride shows a maximum absorption band at 505 mp. to the light polarized to the direction of (l and an absorption band at 340 M,u. to the light polarized to the direction of (1 1 0).
- the band at long wave length side between two absorption bands is called as the first absorption band and one at short Wave length side as the second absorption band.
- M-center possesses a property of being not reoriented by the light of first absorption band but reoriented by the light of second absorption band to the direction of polarization, e.g., the M-center oriented to the direction of (1T0) is reoriented to the direction of (1 l0) by irradiation of the light at second absorption band polarized to the direction of (110). Accordingly, it will be possible to write and read an information in using such property of M-center.
- the crystals having M-center will possess a capacity of an analogue record for voluntary pattern such as characters, figures and the like as well as of a digital record as mentioned above. They will, therefore, be usable for a photosensitive material as equivalent to photographic 'films. Furthermore, a great advantage to use M-center as above is that crystals having M-center become a reversible photosensitive material which is capable of recording and erasing an information repeatedly. Therefore the crystals'are promising as a memory element.
- a reversible photosensitive material which consists of the crystals of an alkali metal halide intermixed with one kind of a specific metallic cation in which M-center is formed, and as a result of further studies on using a new theory developed by them, have succeeded to obtain new dichroic reversible photosensitive materials having a remarkably improved photosensitivity which consist of the crystals of an alkali metal halide intermixed with one kind of alkali metal ion having smaller ion. radius than the alkali metal in said alkali metal halide used as the base mate- I rial and one or more kinds of metal ions other than the alkali metal ion which possess an ability to act as an electron trap, which have M-center.
- the alkali metal halide crystal to be used as the base material of this invention means the crystals of salts of an alkali metal such as lithium, sodium, potassium, rubidium or cesium, with a halogen such as chlorine, bromine, fluorine or iodine.
- the most preferred example of the alkali metal halide may be sodium fluoride.
- Preferred examples may be sodium chloride, sodium bromide, potassium chloride, potassium fluoride, potassium bromide, lithium fluoride, rubidium fluoride, rubidium bromide and the like.
- cesium fluoride, cesium bromide, sodium iodide and the like may be mentioned as other examples to be used in this invention.
- the alkali metal ion in the compound producing an alkali metal ion having smaller ion radius than that of the alkali metal in the alkali metal halide means, for instance, lithium ion to sodium ion, or sodium or lithium ion to potassium ion or the like.
- the compound producing an alkali metal ion having smaller ion radius than that of the alkali metal in the alkali metal halide is one producing an alkali metal ion as mentioned above, preferably a halide compound of the same kind of halogen as that of the alkali metal halide used.
- the metal ion in the compound producing metal ion other than the alkali metal ion which possesses an ability to act as an electron trap means the ion derived from metals as mentioned below.
- an alkali earth metal such as beryllium, magnesium, calcium, strontium or barium.
- a metal belonging to the group I B of the periodic table such as copper or silver.
- a metal belonging to the group II B of the periodic table such as zinc, cadmium or mercury.
- a metal belonging to the group III B of the periodic table such as gallium, indium or thallium.
- a transition metal such as iron, cobalt, nickel, titanium, vanadium, chronium or magnesium.
- a rare earth metal such as samarium or europium.
- the compound producing metal ion other than alkali metal ion which possesses an ability to act as an electron trap means the compound producing the metal ions as mentioned above.
- Preferable one is a halide compound of the same kind of halogen as that of the alkali metal halide to be used.
- an appropriate amount of alkali metal halide crystal is firstly melted, e,g., in a melting pot or bath, to which are added one kind of compound producing alkali-metal ion and one or more kinds of compounds producing metal ions and melted. Crystals are grown and isolated in accordance with a conventional method, e.g., Kyropoulos method. See, e.g.,
- the addition amount of each of the compound producing alkali metal ion and the compounds producing metal ion may be about 0.00001 10.0 molar percentage to the crystals of alkali metal halide as the base material, preferably about 0.1 2.0 molar percentage.
- the addition amount of each of the compounds is increased over the above figure, it will be meaningless, because an amount to be practically intermixed with the alkali metal halide crystal depends upon a coefficient of segregation of the crystals used.
- applying /cm- Next, M-center is formed in the resulting crystals by a conventional method. As its examples may be mentioned a method for applying, an electron beam, X-ray or 'y-ray, an electrolytic coloring method and the like.
- M-center it is desired to make M-center at a concentration as high as possible, preferably a concentration of about l cm 18 cm.
- concentration as high as possible, preferably a concentration of about l cm 18 cm.
- alkali metal halide crystal there are various combinations of the alkali metal halide crystal, another alkali metal ion and other metal ions as the components of the materials in this invention.
- sodium fluoride as the alkali metal halide crystal, there may be mentioned as follows.
- NaF Li Ag NaF Li Pd NaF Li Mg, NaF Li Be, NaF Li Sr, NaF Mg Cr, NaFzLi-Mg-Cr, NaFzLi-Ag-Be-Cr, NaF Li Tl Mg Ni, etc.
- potassium chloride as the base material, there may be mentioned as follows.
- KCl Nu Ag KCl Li Ag, KCI Na Mg, KCl Li Be, KCl Li Sr, KCl Na Mg -Cr, KClzLi-Mg-Cr, KCl:Na-Fe-Mg, KClzLi-Cr-Be-Ag, KCI2Na-Ag-Be-Cr, KCl Nu Tl Mg Ni etc.
- M-center will migrate one latice length and combine with another M-center or F- center to form other color centers during repeated writings and eliminations, by which the M-center disappeares.
- the crystals to be obtained by this invention have few such possibility, because at least two kinds of impure materials which have a different action to each other are fixed in the crystals. Therefore, they will be usable as a photosensitive material having a long life, i.e., a reversible photosensitive mate rial.
- the crystals of this invention may be cleaved to make a thin plate which can be used as a reversible ultramicrofiche, to which a graphic description is copied through a polarizer. Besides, they may be used as an optical storage element for optical memory system, the material for pattern information filing system and the like.
- a dichroic reversible photosensitive material which consists of an alkali metal halide crystal having M-centers, said crystal containing an alkali metal ion having a smaller ion radius than that of the alkali metal in said alkali metal halide and one or more metal ions which possess the ability to act as an electron trap selected from the group consisting of alkali earth metal ions and transition metal ions.
- alkali metal halide crystal is crystal of sodium fluoride, sodium chloride, sodium bromide, sodium iodide, potassium fluoride, potassium chloride, potassium bromide, lithium fluoride, rubidium bromide, cesium fluoride or cesium bromide.
- crystal contains said alkali metal ion and said alkali earth metal ions or a mixture of said alkali earth metal ions and transition metal ions.
- alkali earth metal ion is an ion of beryllium, magnesium, calcium, strontium or barium.
- transition metal ion is an ion of iron, cobalt, nickel, titanium, vanadium, chromium or magnesium.
- the alkali metal halide crystal is sodium fluoride crystal
- the alkali metal ion having smaller ion radius than that of tha alkali metal of said alkali metal halide is lithium ion
- the metal ion other than alkali metal ion which possesses an ability to act as as electron trap is magnesium ion.
- the alkali metal halide crystal is sodium fluoride crystal
- the alkali metal ion having smaller ion radius than that of the alkali metal of said alkali metal halide is lithium ion
- the metal ion other than alkali metal ion which possesses an ability to act as as electron trap is beryl lium ion.
- the alkali metal halide crystal is sodium fluoride crystal
- the alkali metal ion having smaller ion radius than that of the alkali metal of said alkali netal halide is lithium ion
- the metal ion other than alkali metal ion which possesses an ability to act as an electron trap is strontium ion.
- the alkali metal halide crystal is sodium fluoride crystal
- the alkali metal ion having smaller ion radius than that of the alkali metal of said alkali metal halide is lithium ion
- the metal ions other than alkali metal ion which possess an ability to act as an electron trap are magnesium ion and chromium ion.
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Optical Record Carriers And Manufacture Thereof (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7286608A JPS5031824B2 (esLanguage) | 1972-08-31 | 1972-08-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3909270A true US3909270A (en) | 1975-09-30 |
Family
ID=13891714
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US392302A Expired - Lifetime US3909270A (en) | 1972-08-31 | 1973-08-28 | Dichroic reversible photosensitive materials |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US3909270A (esLanguage) |
| JP (1) | JPS5031824B2 (esLanguage) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0375534A3 (en) * | 1988-12-20 | 1990-11-28 | Fujitsu Limited | Photomask and manufacturing method therefor |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5550518B2 (esLanguage) * | 1973-11-26 | 1980-12-18 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3580688A (en) * | 1968-02-26 | 1971-05-25 | Irwin Schneider | Information storage with optic materials |
| US3720926A (en) * | 1971-03-31 | 1973-03-13 | I Schneider | Information storage using m color centers in alkali fluorides |
| US3761267A (en) * | 1971-03-10 | 1973-09-25 | Eastman Kodak Co | Photographic element containing monodispersed unfogged dye sensitizedsilver halide grains metal ions sensitized internally and the use theeof in reversal process |
| US3814601A (en) * | 1972-07-21 | 1974-06-04 | I Schneider | Grainless photographic medium and method of making same |
-
1972
- 1972-08-31 JP JP7286608A patent/JPS5031824B2/ja not_active Expired
-
1973
- 1973-08-28 US US392302A patent/US3909270A/en not_active Expired - Lifetime
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3580688A (en) * | 1968-02-26 | 1971-05-25 | Irwin Schneider | Information storage with optic materials |
| US3761267A (en) * | 1971-03-10 | 1973-09-25 | Eastman Kodak Co | Photographic element containing monodispersed unfogged dye sensitizedsilver halide grains metal ions sensitized internally and the use theeof in reversal process |
| US3720926A (en) * | 1971-03-31 | 1973-03-13 | I Schneider | Information storage using m color centers in alkali fluorides |
| US3814601A (en) * | 1972-07-21 | 1974-06-04 | I Schneider | Grainless photographic medium and method of making same |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0375534A3 (en) * | 1988-12-20 | 1990-11-28 | Fujitsu Limited | Photomask and manufacturing method therefor |
| US5147742A (en) * | 1988-12-20 | 1992-09-15 | Fujitsu Limited | Photomask and fabrication of the same |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5031824B2 (esLanguage) | 1975-10-15 |
| JPS4948329A (esLanguage) | 1974-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Friauf | The crystal structure of magnesium di-zincide | |
| US3909270A (en) | Dichroic reversible photosensitive materials | |
| GB1468746A (en) | Imaging materials | |
| US4029510A (en) | Multi-solution photographic processing method using multi-component developer compositions | |
| Feltham et al. | Colour centres in alkaline earth fluorides | |
| Tubbs | High Resolution Image Recording on Photosensitive Halide Layers | |
| Gliemeroth et al. | Phototropic glass | |
| JP3421393B2 (ja) | 透過放射線像を記録及び再現する方法 | |
| Schulman | Effects of Impurities on the Coloration of Solids by Ionizing Radiations | |
| Phillips | Properties of cathodochromic sodalite | |
| GB1565502A (en) | Photographic materials | |
| Morsar | A Comparative Study of Latent Image Formation | |
| US2840464A (en) | Method of separating fission products from fused bismuth-containing uranium | |
| US3714057A (en) | Iodide activated thallium chloride scintillator | |
| JPS641410B2 (esLanguage) | ||
| US2709134A (en) | Photo-sensitive ionic crystal mixture | |
| GB1283038A (en) | Photosensitive recording material containing lead iodine or lead bromide | |
| GB1402794A (en) | Method of stabilizing silver halide photographic material | |
| US3834903A (en) | Imagewise exposing a metal halide layer with laser to form permanent metal image | |
| SU1019490A1 (ru) | Регистрирующий слой носител фотооптической записи | |
| SU400137A1 (ru) | Способ получения кристаллов фотохромного | |
| Alger et al. | F Centers in Pure and Hydride-Containing Alkali Halide Crystals | |
| SU1094059A1 (ru) | Фотохромный слой носител оптической записи | |
| RU2054696C1 (ru) | Материал, чувствительный к ионизирующему излучению | |
| Swinth et al. | Low-flux neutron imaging |