US3419391A - Silver halide color photography utilizing magenta-dye-forming couplers - Google Patents
Silver halide color photography utilizing magenta-dye-forming couplers Download PDFInfo
- Publication number
- US3419391A US3419391A US458455A US45845565A US3419391A US 3419391 A US3419391 A US 3419391A US 458455 A US458455 A US 458455A US 45845565 A US45845565 A US 45845565A US 3419391 A US3419391 A US 3419391A
- Authority
- US
- United States
- Prior art keywords
- group
- coupler
- couplers
- pyrazolone
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- -1 Silver halide Chemical class 0.000 title description 118
- 229910052709 silver Inorganic materials 0.000 title description 26
- 239000004332 silver Substances 0.000 title description 26
- 239000010410 layer Substances 0.000 description 49
- 239000000975 dye Substances 0.000 description 35
- 239000000543 intermediate Substances 0.000 description 26
- 125000000217 alkyl group Chemical group 0.000 description 21
- 239000000047 product Substances 0.000 description 21
- 238000005859 coupling reaction Methods 0.000 description 20
- 239000000839 emulsion Substances 0.000 description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 20
- 230000008878 coupling Effects 0.000 description 19
- 238000010168 coupling process Methods 0.000 description 19
- 125000004104 aryloxy group Chemical group 0.000 description 17
- 239000003795 chemical substances by application Substances 0.000 description 16
- 238000000034 method Methods 0.000 description 16
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 15
- 125000000623 heterocyclic group Chemical group 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 14
- 239000007787 solid Substances 0.000 description 14
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 12
- 230000008901 benefit Effects 0.000 description 11
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 125000003118 aryl group Chemical group 0.000 description 10
- 230000009257 reactivity Effects 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 238000000576 coating method Methods 0.000 description 9
- 229920000159 gelatin Polymers 0.000 description 9
- 239000008273 gelatin Substances 0.000 description 9
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 230000008569 process Effects 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 108010010803 Gelatin Proteins 0.000 description 8
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 235000019322 gelatine Nutrition 0.000 description 8
- 235000011852 gelatine desserts Nutrition 0.000 description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 125000003368 amide group Chemical group 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 238000011161 development Methods 0.000 description 7
- 230000003647 oxidation Effects 0.000 description 7
- 238000007254 oxidation reaction Methods 0.000 description 7
- 125000001424 substituent group Chemical group 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 235000019441 ethanol Nutrition 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 6
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 125000001624 naphthyl group Chemical group 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 125000004076 pyridyl group Chemical group 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 4
- 239000000084 colloidal system Substances 0.000 description 4
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 125000004957 naphthylene group Chemical group 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 4
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 4
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical compound [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 4
- 229940076133 sodium carbonate monohydrate Drugs 0.000 description 4
- 125000004149 thio group Chemical group *S* 0.000 description 4
- 238000012546 transfer Methods 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- IKJFYINYNJYDTA-UHFFFAOYSA-N dibenzothiophene sulfone Chemical group C1=CC=C2S(=O)(=O)C3=CC=CC=C3C2=C1 IKJFYINYNJYDTA-UHFFFAOYSA-N 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229920002451 polyvinyl alcohol Polymers 0.000 description 3
- 125000005554 pyridyloxy group Chemical group 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000002356 single layer Substances 0.000 description 3
- 235000010265 sodium sulphite Nutrition 0.000 description 3
- 125000000547 substituted alkyl group Chemical group 0.000 description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- 238000004383 yellowing Methods 0.000 description 3
- LOTKRQAVGJMPNV-UHFFFAOYSA-N 1-fluoro-2,4-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C([N+]([O-])=O)=C1 LOTKRQAVGJMPNV-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000012937 correction Methods 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- PYLWMHQQBFSUBP-UHFFFAOYSA-N monofluorobenzene Chemical compound FC1=CC=CC=C1 PYLWMHQQBFSUBP-UHFFFAOYSA-N 0.000 description 2
- 125000005186 naphthyloxy group Chemical group C1(=CC=CC2=CC=CC=C12)O* 0.000 description 2
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- WSDQIHATCCOMLH-UHFFFAOYSA-N phenyl n-(3,5-dichlorophenyl)carbamate Chemical compound ClC1=CC(Cl)=CC(NC(=O)OC=2C=CC=CC=2)=C1 WSDQIHATCCOMLH-UHFFFAOYSA-N 0.000 description 2
- 229920002401 polyacrylamide Polymers 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 125000001174 sulfone group Chemical group 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- 229960000834 vinyl ether Drugs 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 description 1
- WMASLRCNNKMRFP-UHFFFAOYSA-N 1-fluoro-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(F)=C1 WMASLRCNNKMRFP-UHFFFAOYSA-N 0.000 description 1
- HRBLHUVHOWWBEN-UHFFFAOYSA-N 1-n,4-n-diethylbenzene-1,4-diamine;hydrochloride Chemical compound Cl.CCNC1=CC=C(NCC)C=C1 HRBLHUVHOWWBEN-UHFFFAOYSA-N 0.000 description 1
- PXJHVKRLFWZUNV-UHFFFAOYSA-N 1-n,4-n-dimethylbenzene-1,4-diamine;hydron;dichloride Chemical compound Cl.Cl.CNC1=CC=C(NC)C=C1 PXJHVKRLFWZUNV-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- KSYTWDUNKAIFLK-UHFFFAOYSA-N 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl chloride Chemical compound CCC(C)(C)C1=CC=C(OCC(Cl)=O)C(C(C)(C)CC)=C1 KSYTWDUNKAIFLK-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- JKFYKCYQEWQPTM-UHFFFAOYSA-N 2-azaniumyl-2-(4-fluorophenyl)acetate Chemical compound OC(=O)C(N)C1=CC=C(F)C=C1 JKFYKCYQEWQPTM-UHFFFAOYSA-N 0.000 description 1
- HZAVRDCVORDTGP-UHFFFAOYSA-N 2-oxo-3-phenoxybutanedioic acid Chemical compound C1=CC=C(C=C1)OC(C(=O)C(=O)O)C(=O)O HZAVRDCVORDTGP-UHFFFAOYSA-N 0.000 description 1
- IOMZCWUHFGMSEJ-UHFFFAOYSA-N 4-(azaniumylamino)benzenesulfonate Chemical compound NNC1=CC=C(S(O)(=O)=O)C=C1 IOMZCWUHFGMSEJ-UHFFFAOYSA-N 0.000 description 1
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical class NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- BPXDURBMSGRKDB-UHFFFAOYSA-N 4-hydroxy-1,4-dihydropyrazol-5-one Chemical compound OC1C=NNC1=O BPXDURBMSGRKDB-UHFFFAOYSA-N 0.000 description 1
- KECCFSZFXLAGJS-UHFFFAOYSA-N 4-methylsulfonylphenol Chemical compound CS(=O)(=O)C1=CC=C(O)C=C1 KECCFSZFXLAGJS-UHFFFAOYSA-N 0.000 description 1
- XBTWVJKPQPQTDW-UHFFFAOYSA-N 4-n,4-n-diethyl-2-methylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C(C)=C1 XBTWVJKPQPQTDW-UHFFFAOYSA-N 0.000 description 1
- IJJSFSXLZYFTKV-UHFFFAOYSA-N 4-n-methylbenzene-1,4-diamine;hydrochloride Chemical compound Cl.CNC1=CC=C(N)C=C1 IJJSFSXLZYFTKV-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Chemical group CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- KZTYYGOKRVBIMI-UHFFFAOYSA-N S-phenyl benzenesulfonothioate Natural products C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- 229910021612 Silver iodide Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 229920002494 Zein Polymers 0.000 description 1
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 1
- MVAVVPYSQJLNQM-UHFFFAOYSA-N [Na].N1=NC(C=C1)=O Chemical compound [Na].N1=NC(C=C1)=O MVAVVPYSQJLNQM-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 108091005647 acylated proteins Proteins 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical compound NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000002511 behenyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- FLIBMGVZWTZQOM-UHFFFAOYSA-N benzene;sulfuric acid Chemical compound OS(O)(=O)=O.C1=CC=CC=C1 FLIBMGVZWTZQOM-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- IFVTZJHWGZSXFD-UHFFFAOYSA-N biphenylene Chemical group C1=CC=C2C3=CC=CC=C3C2=C1 IFVTZJHWGZSXFD-UHFFFAOYSA-N 0.000 description 1
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical class CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- UHYPYGJEEGLRJD-UHFFFAOYSA-N cadmium(2+);selenium(2-) Chemical compound [Se-2].[Cd+2] UHYPYGJEEGLRJD-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229920003064 carboxyethyl cellulose Polymers 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- RDULEYWUGKOCMR-UHFFFAOYSA-N ethyl 2-chloro-3-oxobutanoate Chemical compound CCOC(=O)C(Cl)C(C)=O RDULEYWUGKOCMR-UHFFFAOYSA-N 0.000 description 1
- 229940044631 ferric chloride hexahydrate Drugs 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000008423 fluorobenzenes Chemical class 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- ZQBFAOFFOQMSGJ-UHFFFAOYSA-N hexafluorobenzene Substances FC1=C(F)C(F)=C(F)C(F)=C1F ZQBFAOFFOQMSGJ-UHFFFAOYSA-N 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- RSAZYXZUJROYKR-UHFFFAOYSA-N indophenol Chemical compound C1=CC(O)=CC=C1N=C1C=CC(=O)C=C1 RSAZYXZUJROYKR-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- NQXWGWZJXJUMQB-UHFFFAOYSA-K iron trichloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].Cl[Fe+]Cl NQXWGWZJXJUMQB-UHFFFAOYSA-K 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000002101 lytic effect Effects 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- KHPXUQMNIQBQEV-UHFFFAOYSA-N oxaloacetic acid Chemical compound OC(=O)CC(=O)C(O)=O KHPXUQMNIQBQEV-UHFFFAOYSA-N 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical group O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- JOVOSQBPPZZESK-UHFFFAOYSA-N phenylhydrazine hydrochloride Chemical compound Cl.NNC1=CC=CC=C1 JOVOSQBPPZZESK-UHFFFAOYSA-N 0.000 description 1
- 229940038531 phenylhydrazine hydrochloride Drugs 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 229940045105 silver iodide Drugs 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000011091 sodium acetates Nutrition 0.000 description 1
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 125000001443 terpenyl group Chemical group 0.000 description 1
- LPWCRLGKYWVLHQ-UHFFFAOYSA-N tetradecanoyl chloride Chemical compound CCCCCCCCCCCCCC(Cl)=O LPWCRLGKYWVLHQ-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
- 239000005019 zein Substances 0.000 description 1
- 229940093612 zein Drugs 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/32—Colour coupling substances
- G03C7/36—Couplers containing compounds with active methylene groups
- G03C7/38—Couplers containing compounds with active methylene groups in rings
- G03C7/384—Couplers containing compounds with active methylene groups in rings in pyrazolone rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/28—Two oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/28—Two oxygen or sulfur atoms
- C07D231/30—Two oxygen or sulfur atoms attached in positions 3 and 5
- C07D231/32—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/44—Oxygen and nitrogen or sulfur and nitrogen atoms
- C07D231/52—Oxygen atom in position 3 and nitrogen atom in position 5, or vice versa
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Indole Compounds (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US458455A US3419391A (en) | 1965-05-24 | 1965-05-24 | Silver halide color photography utilizing magenta-dye-forming couplers |
| GB16311/66A GB1140898A (en) | 1965-05-24 | 1966-04-14 | Colour photographic development employing pyrazolones as colour couplers |
| DE19661547692 DE1547692C (de) | 1965-05-24 | 1966-05-23 | Verwendung von 2-Äqui valent-Farbkupplern zum Herstellen purpurroter Farbstoffbilder in farbphotographischen Aufzeichnungsmaterialien durch Farbentwicklung |
| FR62489A FR1480766A (fr) | 1965-05-24 | 1966-05-23 | Nouveaux coupleurs chromogènes utilisables en photographie |
| BE681457D BE681457A (pm) | 1965-05-24 | 1966-05-23 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US458455A US3419391A (en) | 1965-05-24 | 1965-05-24 | Silver halide color photography utilizing magenta-dye-forming couplers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3419391A true US3419391A (en) | 1968-12-31 |
Family
ID=23820853
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US458455A Expired - Lifetime US3419391A (en) | 1965-05-24 | 1965-05-24 | Silver halide color photography utilizing magenta-dye-forming couplers |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3419391A (pm) |
| BE (1) | BE681457A (pm) |
| GB (1) | GB1140898A (pm) |
Cited By (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3516831A (en) * | 1967-04-27 | 1970-06-23 | Eastman Kodak Co | Multicolor photographic elements containing both 4-equivalent and 2-equivalent color-forming couplers |
| US3935015A (en) * | 1973-02-22 | 1976-01-27 | Fuji Photo Film Co., Ltd. | Silver halide color photographic materials containing 3-anilino-5-pyrazolane couplers |
| WO1982002198A1 (en) * | 1980-12-29 | 1982-07-08 | Kodak Co Eastman | A method for preparing 2-pyrazolin-5-ones from 1,2,4-oxadiazoles |
| JPS57138636A (en) * | 1981-02-19 | 1982-08-27 | Konishiroku Photo Ind Co Ltd | Silver halide color photographic material |
| JPS57155537A (en) * | 1981-03-20 | 1982-09-25 | Konishiroku Photo Ind Co Ltd | Color photographic sensitive silver halide material |
| US4374253A (en) * | 1981-09-28 | 1983-02-15 | Eastman Kodak Company | Method for preparing 1-aryl-3-arylamino-2-pyrazolin-5-ones from N-aryl-3-arylamino-3-oximinopropionamides |
| US4401752A (en) * | 1981-11-23 | 1983-08-30 | Eastman Kodak Company | Aryloxy substituted photographic couplers and photographic elements and processes employing same |
| EP0112162A2 (en) | 1982-12-13 | 1984-06-27 | Konica Corporation | Light-sensitive silver halide photographic material |
| EP0124795A2 (en) | 1983-04-11 | 1984-11-14 | Fuji Photo Film Co., Ltd. | Silver halide photographic emulsion |
| EP0147854A2 (en) | 1983-12-29 | 1985-07-10 | Fuji Photo Film Co., Ltd. | Silver halide photographic light-sensitive materials |
| US4609620A (en) * | 1982-03-11 | 1986-09-02 | Ciba Geigy Ag | Pyrazolone compounds and a process for their manufacture |
| EP0201033A2 (en) | 1985-04-30 | 1986-11-12 | Konica Corporation | A method for processing silver halide color photographic materials |
| EP0202616A2 (en) | 1985-05-16 | 1986-11-26 | Konica Corporation | Method for color-developing a silver halide photographic light-sensitive material |
| EP0204530A2 (en) | 1985-05-31 | 1986-12-10 | Konica Corporation | Method for forming direct positive color image |
| EP0228914A2 (en) | 1985-12-28 | 1987-07-15 | Konica Corporation | Method of processing lightsensitive silver halide color photographic material |
| US4692529A (en) * | 1980-10-17 | 1987-09-08 | Konishiroku Photo Industry Co., Ltd. | Method for synthesizing a magenta coupler by selectively etherifying 4-hydroxy-5-pyrazolone |
| US5354646A (en) * | 1986-03-26 | 1994-10-11 | Konishiroku Photo Industry Co., Ltd. | Method capable of rapidly processing a silver halide color photographic light-sensitive material |
| EP0658806A1 (en) * | 1993-10-22 | 1995-06-21 | Eastman Kodak Company | Photographic elements containing aryloxypyrazolone couplers and sulfur containing stabilizers |
| US5427898A (en) * | 1992-12-04 | 1995-06-27 | Eastman Kodak Company | Yellow couplers having an arloxy coupling-off group which contains an ortho polarizable functional group |
| EP0686873A1 (en) | 1994-06-08 | 1995-12-13 | Eastman Kodak Company | Color photographic element containing new epoxy scavengers for residual magenta coupler |
| EP0711804A2 (de) | 1994-11-14 | 1996-05-15 | Ciba-Geigy Ag | Kryptolichtschutzmittel |
| EP0720047A3 (pm) * | 1994-12-30 | 1996-07-24 | Eastman Kodak Co | |
| EP0720048A3 (pm) * | 1994-12-30 | 1996-07-24 | Eastman Kodak Co | |
| FR2788140A1 (fr) * | 1998-12-30 | 2000-07-07 | Eastman Kodak Co | Element photographique contenant un coupleur aryloxypyrazolone stable et procede employant un tel coupleur |
| FR2788141A1 (fr) * | 1998-12-30 | 2000-07-07 | Eastman Kodak Co | Element photographique contenant un coupleur aryloxypyrazolone stable et procede employant un tel coupleur |
| US6150078A (en) * | 1998-12-30 | 2000-11-21 | Eastman Kodak Company | Photographic element containing pyrazolone PUG releasing coupler and imaging process employing same |
| US6153369A (en) * | 1998-12-30 | 2000-11-28 | Eastman Kodak Company | Photographic element containing pyrazolone pug releasing coupler and imaging process employing same |
| US6165229A (en) * | 1996-03-22 | 2000-12-26 | L'oreal | Imidazoloazole-containing compositions for dyeing keratin fibers; their use in dyeing as couplers; dyeing process |
| US6179882B1 (en) | 1996-03-22 | 2001-01-30 | L'oreal | Keratin fibre dye composition containing pyrazolopyrimidinoxo compounds, use thereof as dye couplers, and dyeing methods |
| US6210447B1 (en) | 1996-03-22 | 2001-04-03 | L'oreal | Compositions containing pyrazolin-3,5-dione couplers for use in keratin fiber dyeing methods and kits |
| US6231623B1 (en) | 1996-03-22 | 2001-05-15 | L'oreal S.A. | Methods of dyeing keratin fibers with compositions containing pyrazolo-azole couplers |
| US6238440B1 (en) | 1996-03-22 | 2001-05-29 | L'oreal S.A. | Keratin fibre dye compositions containing pyrrolo-azole compounds, use thereof as couplers, and dyeing method |
| WO2001068043A2 (fr) | 2000-03-14 | 2001-09-20 | L'oreal | Compositions pour la teinture des fibres keratiniques contenant des derives de paraphenylenediamine a groupement pyrrolidinyle |
| US6322775B1 (en) | 1996-03-22 | 2001-11-27 | L'oreal S.A. | Cosmetic compositions containing pyrazolin-4,5-diones, novel pyrazolin-4,5-diones, preparation methods therefor and uses thereof |
| US6379397B2 (en) | 1997-12-16 | 2002-04-30 | L'oreal S.A. | Compositions for dyeing keratinous fibers comprising pyrazoloazoles; their use in dyeing as oxidation base and dyeing process; and novel pyrazoloazoles |
| US6391063B1 (en) | 1998-11-20 | 2002-05-21 | L'oreal | Composition for the oxidation dyeing of keratin fibers and dyeing process using this composition |
| US6395042B1 (en) | 1998-11-20 | 2002-05-28 | L'oréal | Composition for the oxidation dyeing of keratin fibers and dyeing process using this composition |
| US6702863B1 (en) | 1999-06-22 | 2004-03-09 | Lion Corporation | Hairdye composition |
| US20040064902A1 (en) * | 2000-12-06 | 2004-04-08 | Stephane Sabelle | Oxidatiton dyeing composition based on 1-(4-aminophenyl) pyrrolidines substituted in position 2 and 5 |
| US20040074013A1 (en) * | 2000-12-06 | 2004-04-22 | Eric Terranova | Oxidation dyeing composition based on 1-(4-aminophenyl) pyrrolidines substituted in positions 3 and 4, and dyeing method using same |
| US20040077852A1 (en) * | 2002-07-05 | 2004-04-22 | Stephane Sabelle | Para-phenylenediamine derivatives containing a pyrrolidyl group, and use of these derivatives for coloring keratin fibers |
| US20040083559A1 (en) * | 2000-12-06 | 2004-05-06 | Stephane Sabelle | Dyeing composition based on 1-(4-aminophenyl)pyrrolidines substituted at least in positions 2 and 3 |
| US20040088799A1 (en) * | 2000-12-06 | 2004-05-13 | Stephane Sabelle | Oxidation dyeing composition based on 1-(4-aminophenyl) pyrrolidines substituted in position 2 |
| US20040123401A1 (en) * | 2002-09-09 | 2004-07-01 | Stephane Sabelle | Bis-para-phenylenediamine derivatives comprising a pyrrolidyl group and use of these derivatives for dyeing keratin fibres |
| US6890362B2 (en) | 2000-03-06 | 2005-05-10 | L'oreal, S.A. | Oxidation dyeing composition for keratinous fibers and dyeing method using same |
| US6893470B1 (en) | 1998-01-13 | 2005-05-17 | L'oreal S.A. | Keratinous fibre oxidation dyeing composition containing a laccase and dyeing method using same |
| US6946005B2 (en) | 2002-03-27 | 2005-09-20 | L'oreal S.A. | Pyrrolidinyl-substituted para-phenylenediamine derivatives substituted with a cationic radical, and use of these derivatives for dyeing keratin fibers |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7230025B2 (en) | 2002-09-26 | 2007-06-12 | Pfizer, Inc. | Pyrazole derivatives |
| CA2497333A1 (en) * | 2002-09-26 | 2004-04-08 | Pfizer Inc. | Pyrazole derivatives as reverse transcriptase inhibitors |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3227550A (en) * | 1962-09-07 | 1966-01-04 | Eastman Kodak Co | Photographic color reproduction process and element |
| US3227551A (en) * | 1959-04-06 | 1966-01-04 | Eastman Kodak Co | Photographic color reproduction process and element |
-
1965
- 1965-05-24 US US458455A patent/US3419391A/en not_active Expired - Lifetime
-
1966
- 1966-04-14 GB GB16311/66A patent/GB1140898A/en not_active Expired
- 1966-05-23 BE BE681457D patent/BE681457A/xx unknown
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3227551A (en) * | 1959-04-06 | 1966-01-04 | Eastman Kodak Co | Photographic color reproduction process and element |
| US3227550A (en) * | 1962-09-07 | 1966-01-04 | Eastman Kodak Co | Photographic color reproduction process and element |
Cited By (60)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3516831A (en) * | 1967-04-27 | 1970-06-23 | Eastman Kodak Co | Multicolor photographic elements containing both 4-equivalent and 2-equivalent color-forming couplers |
| US3935015A (en) * | 1973-02-22 | 1976-01-27 | Fuji Photo Film Co., Ltd. | Silver halide color photographic materials containing 3-anilino-5-pyrazolane couplers |
| US4692529A (en) * | 1980-10-17 | 1987-09-08 | Konishiroku Photo Industry Co., Ltd. | Method for synthesizing a magenta coupler by selectively etherifying 4-hydroxy-5-pyrazolone |
| WO1982002198A1 (en) * | 1980-12-29 | 1982-07-08 | Kodak Co Eastman | A method for preparing 2-pyrazolin-5-ones from 1,2,4-oxadiazoles |
| US4345085A (en) * | 1980-12-29 | 1982-08-17 | Eastman Kodak Company | Method for preparing 2-pyrazolin-5-ones from 1,2,4-oxadiazoles |
| JPS57138636A (en) * | 1981-02-19 | 1982-08-27 | Konishiroku Photo Ind Co Ltd | Silver halide color photographic material |
| JPS57155537A (en) * | 1981-03-20 | 1982-09-25 | Konishiroku Photo Ind Co Ltd | Color photographic sensitive silver halide material |
| US4374253A (en) * | 1981-09-28 | 1983-02-15 | Eastman Kodak Company | Method for preparing 1-aryl-3-arylamino-2-pyrazolin-5-ones from N-aryl-3-arylamino-3-oximinopropionamides |
| US4401752A (en) * | 1981-11-23 | 1983-08-30 | Eastman Kodak Company | Aryloxy substituted photographic couplers and photographic elements and processes employing same |
| US4609620A (en) * | 1982-03-11 | 1986-09-02 | Ciba Geigy Ag | Pyrazolone compounds and a process for their manufacture |
| EP0112162A2 (en) | 1982-12-13 | 1984-06-27 | Konica Corporation | Light-sensitive silver halide photographic material |
| EP0124795A2 (en) | 1983-04-11 | 1984-11-14 | Fuji Photo Film Co., Ltd. | Silver halide photographic emulsion |
| EP0147854A2 (en) | 1983-12-29 | 1985-07-10 | Fuji Photo Film Co., Ltd. | Silver halide photographic light-sensitive materials |
| EP0201033A2 (en) | 1985-04-30 | 1986-11-12 | Konica Corporation | A method for processing silver halide color photographic materials |
| EP0202616A2 (en) | 1985-05-16 | 1986-11-26 | Konica Corporation | Method for color-developing a silver halide photographic light-sensitive material |
| EP0204530A2 (en) | 1985-05-31 | 1986-12-10 | Konica Corporation | Method for forming direct positive color image |
| EP0228914A2 (en) | 1985-12-28 | 1987-07-15 | Konica Corporation | Method of processing lightsensitive silver halide color photographic material |
| US5354646A (en) * | 1986-03-26 | 1994-10-11 | Konishiroku Photo Industry Co., Ltd. | Method capable of rapidly processing a silver halide color photographic light-sensitive material |
| US5427898A (en) * | 1992-12-04 | 1995-06-27 | Eastman Kodak Company | Yellow couplers having an arloxy coupling-off group which contains an ortho polarizable functional group |
| EP0658806A1 (en) * | 1993-10-22 | 1995-06-21 | Eastman Kodak Company | Photographic elements containing aryloxypyrazolone couplers and sulfur containing stabilizers |
| US6365334B1 (en) | 1993-10-22 | 2002-04-02 | Eastman Kodak Company | Photographic elements containing aryloxypyrazolone couplers and sulfur containing stabilizers |
| EP0686873A1 (en) | 1994-06-08 | 1995-12-13 | Eastman Kodak Company | Color photographic element containing new epoxy scavengers for residual magenta coupler |
| EP0711804A2 (de) | 1994-11-14 | 1996-05-15 | Ciba-Geigy Ag | Kryptolichtschutzmittel |
| EP0720048A3 (pm) * | 1994-12-30 | 1996-07-24 | Eastman Kodak Co | |
| US5576167A (en) * | 1994-12-30 | 1996-11-19 | Eastman Kodak Company | Photographic element containing a stable aryloxypyrazolone coupler and process employing same |
| US5670306A (en) * | 1994-12-30 | 1997-09-23 | Eastman Kodak Company | Photographic element containing pyrazolone pug releasing coupler and imaging process employing same |
| EP0720047A3 (pm) * | 1994-12-30 | 1996-07-24 | Eastman Kodak Co | |
| US6551360B2 (en) | 1996-03-22 | 2003-04-22 | Laurent Vidal | Pyrazoline-3,5-dione-containing compositions for dyeing keratin fibres; their use in dyeing as couplers; dyeing process |
| US6379395B1 (en) | 1996-03-22 | 2002-04-30 | L'oreal S.A. | Pyrazolopyrimidinoxo-containing compositions for dyeing keratin fibres; their use in dyeing as couplers; dyeing processes |
| US6165229A (en) * | 1996-03-22 | 2000-12-26 | L'oreal | Imidazoloazole-containing compositions for dyeing keratin fibers; their use in dyeing as couplers; dyeing process |
| US6179882B1 (en) | 1996-03-22 | 2001-01-30 | L'oreal | Keratin fibre dye composition containing pyrazolopyrimidinoxo compounds, use thereof as dye couplers, and dyeing methods |
| US6210447B1 (en) | 1996-03-22 | 2001-04-03 | L'oreal | Compositions containing pyrazolin-3,5-dione couplers for use in keratin fiber dyeing methods and kits |
| US6231623B1 (en) | 1996-03-22 | 2001-05-15 | L'oreal S.A. | Methods of dyeing keratin fibers with compositions containing pyrazolo-azole couplers |
| US6238440B1 (en) | 1996-03-22 | 2001-05-29 | L'oreal S.A. | Keratin fibre dye compositions containing pyrrolo-azole compounds, use thereof as couplers, and dyeing method |
| US6322775B1 (en) | 1996-03-22 | 2001-11-27 | L'oreal S.A. | Cosmetic compositions containing pyrazolin-4,5-diones, novel pyrazolin-4,5-diones, preparation methods therefor and uses thereof |
| US6855827B2 (en) | 1997-12-16 | 2005-02-15 | L'oréal | Compositions for dyeing keratinous fibers comprising pyrazoloazoles; their use in dyeing as oxidation base and dyeing process; and novel pyrazoloazoles |
| US6379397B2 (en) | 1997-12-16 | 2002-04-30 | L'oreal S.A. | Compositions for dyeing keratinous fibers comprising pyrazoloazoles; their use in dyeing as oxidation base and dyeing process; and novel pyrazoloazoles |
| US6893470B1 (en) | 1998-01-13 | 2005-05-17 | L'oreal S.A. | Keratinous fibre oxidation dyeing composition containing a laccase and dyeing method using same |
| US6391063B1 (en) | 1998-11-20 | 2002-05-21 | L'oreal | Composition for the oxidation dyeing of keratin fibers and dyeing process using this composition |
| US6395042B1 (en) | 1998-11-20 | 2002-05-28 | L'oréal | Composition for the oxidation dyeing of keratin fibers and dyeing process using this composition |
| US6153369A (en) * | 1998-12-30 | 2000-11-28 | Eastman Kodak Company | Photographic element containing pyrazolone pug releasing coupler and imaging process employing same |
| FR2788141A1 (fr) * | 1998-12-30 | 2000-07-07 | Eastman Kodak Co | Element photographique contenant un coupleur aryloxypyrazolone stable et procede employant un tel coupleur |
| US6280919B1 (en) | 1998-12-30 | 2001-08-28 | Eastman Kodak Company | Photographic element containing a stable aryloxypyrazolone coupler and process employing the same |
| US6156490A (en) * | 1998-12-30 | 2000-12-05 | Eastman Kodak Company | Photographic element containing a stable aryloxypyrazolone coupler and process employing same |
| US6150078A (en) * | 1998-12-30 | 2000-11-21 | Eastman Kodak Company | Photographic element containing pyrazolone PUG releasing coupler and imaging process employing same |
| FR2788140A1 (fr) * | 1998-12-30 | 2000-07-07 | Eastman Kodak Co | Element photographique contenant un coupleur aryloxypyrazolone stable et procede employant un tel coupleur |
| US6702863B1 (en) | 1999-06-22 | 2004-03-09 | Lion Corporation | Hairdye composition |
| US6890362B2 (en) | 2000-03-06 | 2005-05-10 | L'oreal, S.A. | Oxidation dyeing composition for keratinous fibers and dyeing method using same |
| US20030093866A1 (en) * | 2000-03-14 | 2003-05-22 | Laurent Vidal | Dyeing compositions for keratinous fibres containing paraphenylenediamine derivatives with pyrrolidinyl group |
| WO2001068043A2 (fr) | 2000-03-14 | 2001-09-20 | L'oreal | Compositions pour la teinture des fibres keratiniques contenant des derives de paraphenylenediamine a groupement pyrrolidinyle |
| US7179301B2 (en) | 2000-03-14 | 2007-02-20 | L'oreal S.A. | Dyeing compositions for keratinous fibers containing paraphenylenediamine derivatives with pyrrolidinyl group |
| US20040083559A1 (en) * | 2000-12-06 | 2004-05-06 | Stephane Sabelle | Dyeing composition based on 1-(4-aminophenyl)pyrrolidines substituted at least in positions 2 and 3 |
| US20040088799A1 (en) * | 2000-12-06 | 2004-05-13 | Stephane Sabelle | Oxidation dyeing composition based on 1-(4-aminophenyl) pyrrolidines substituted in position 2 |
| US20040074013A1 (en) * | 2000-12-06 | 2004-04-22 | Eric Terranova | Oxidation dyeing composition based on 1-(4-aminophenyl) pyrrolidines substituted in positions 3 and 4, and dyeing method using same |
| US20040064902A1 (en) * | 2000-12-06 | 2004-04-08 | Stephane Sabelle | Oxidatiton dyeing composition based on 1-(4-aminophenyl) pyrrolidines substituted in position 2 and 5 |
| US6946005B2 (en) | 2002-03-27 | 2005-09-20 | L'oreal S.A. | Pyrrolidinyl-substituted para-phenylenediamine derivatives substituted with a cationic radical, and use of these derivatives for dyeing keratin fibers |
| US20040077852A1 (en) * | 2002-07-05 | 2004-04-22 | Stephane Sabelle | Para-phenylenediamine derivatives containing a pyrrolidyl group, and use of these derivatives for coloring keratin fibers |
| US7132534B2 (en) | 2002-07-05 | 2006-11-07 | L'oreal | Para-phenylenediamine derivatives containing a pyrrolidyl group, and use of these derivatives for coloring keratin fibers |
| US20040123401A1 (en) * | 2002-09-09 | 2004-07-01 | Stephane Sabelle | Bis-para-phenylenediamine derivatives comprising a pyrrolidyl group and use of these derivatives for dyeing keratin fibres |
| US6923835B2 (en) | 2002-09-09 | 2005-08-02 | L'oreal S.A. | Bis-para-phenylenediamine derivatives comprising a pyrrolidyl group and use of these derivatives for dyeing keratin fibres |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1140898A (en) | 1969-01-22 |
| BE681457A (pm) | 1966-10-31 |
| DE1547692A1 (de) | 1970-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3419391A (en) | Silver halide color photography utilizing magenta-dye-forming couplers | |
| US3458315A (en) | Cyan couplers for color photography | |
| US3476563A (en) | Photographic silver halide elements containing two equivalent cyan couplers | |
| US3519429A (en) | Silver halide emulsions containing a stabilizer pyrazolone coupler | |
| US3701783A (en) | Certain mercaptan-forming couplers | |
| US3311476A (en) | Two-equivalent couplers for color photography | |
| US3725067A (en) | Silver halide emulsion containing 1-h-pyrazolo(3,2-c)-s-triazole color couplers | |
| US4367282A (en) | Silver halide color photographic light-sensitive material | |
| US3644498A (en) | Yellow dye forming couplers for color photography | |
| US4163670A (en) | Color photographic material | |
| US3432300A (en) | 6-hydroxy chromans used as stabilizing agents in a color photographic element | |
| US3615506A (en) | Silver halide emulsions containing 3-cyclicamino-5-pyrazolone color couplers | |
| US4310619A (en) | Color photographic material and process incorporating a novel magenta coupler | |
| US4241168A (en) | Photographic coupler | |
| US3364022A (en) | Direct positive photographic color reproduction process and element utilizing thio-substituted hydroquinones as development inhibitors | |
| US2808329A (en) | Photographic color correction using colored and uncolored couplers | |
| US3935015A (en) | Silver halide color photographic materials containing 3-anilino-5-pyrazolane couplers | |
| US3928044A (en) | Magenta coupler-containing photographic silver halide materials | |
| JPS6323535B2 (pm) | ||
| US4277559A (en) | Novel magenta-forming color couplers and their use in photography | |
| US4113488A (en) | Method for improving the light fastness of color photographic dye images | |
| US4032346A (en) | Silver halide emulsion containing two-equivalent magenta coupler | |
| US4133686A (en) | Color photographic light-sensitive element | |
| US4237217A (en) | Silver halide emulsion containing two-equivalent magenta coupler | |
| US4179293A (en) | Color photographic light-sensitive material |