US2490745A - Cellulose carboxylic ester silver halide emulsions sensitized with benzothiazole and benzoselenazole quaternary salts - Google Patents
Cellulose carboxylic ester silver halide emulsions sensitized with benzothiazole and benzoselenazole quaternary salts Download PDFInfo
- Publication number
- US2490745A US2490745A US2126A US212648A US2490745A US 2490745 A US2490745 A US 2490745A US 2126 A US2126 A US 2126A US 212648 A US212648 A US 212648A US 2490745 A US2490745 A US 2490745A
- Authority
- US
- United States
- Prior art keywords
- silver halide
- quaternary salts
- quaternary
- group
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- -1 carboxylic ester silver halide Chemical class 0.000 title description 59
- 239000000839 emulsion Substances 0.000 title description 54
- 150000003839 salts Chemical group 0.000 title description 52
- 229910052709 silver Inorganic materials 0.000 title description 35
- 239000004332 silver Substances 0.000 title description 35
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 title description 17
- 229920002678 cellulose Polymers 0.000 title description 13
- 239000001913 cellulose Substances 0.000 title description 13
- AIGNCQCMONAWOL-UHFFFAOYSA-N 1,3-benzoselenazole Chemical compound C1=CC=C2[se]C=NC2=C1 AIGNCQCMONAWOL-UHFFFAOYSA-N 0.000 title description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 36
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 18
- 125000000217 alkyl group Chemical group 0.000 description 13
- DXYYSGDWQCSKKO-UHFFFAOYSA-N 2-methylbenzothiazole Chemical compound C1=CC=C2SC(C)=NC2=C1 DXYYSGDWQCSKKO-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000000975 dye Substances 0.000 description 12
- 238000010438 heat treatment Methods 0.000 description 11
- 229920002301 cellulose acetate Polymers 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 8
- 150000001450 anions Chemical class 0.000 description 8
- 150000001555 benzenes Chemical class 0.000 description 8
- 230000001235 sensitizing effect Effects 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 125000002252 acyl group Chemical group 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 150000001733 carboxylic acid esters Chemical class 0.000 description 5
- 150000001805 chlorine compounds Chemical group 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- ORPVVAKYSXQCJI-UHFFFAOYSA-N 1-bromo-2-nitrobenzene Chemical class [O-][N+](=O)C1=CC=CC=C1Br ORPVVAKYSXQCJI-UHFFFAOYSA-N 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- CASOXVQOUDGNOW-UHFFFAOYSA-N 2-phenylsulfanyl-1,3-benzothiazole Chemical compound N=1C2=CC=CC=C2SC=1SC1=CC=CC=C1 CASOXVQOUDGNOW-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 229910021607 Silver chloride Inorganic materials 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 150000004694 iodide salts Chemical group 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 3
- OLRAQUYFOQYXNS-UHFFFAOYSA-N 1,3-benzoselenazol-2-amine Chemical compound C1=CC=C2[se]C(N)=NC2=C1 OLRAQUYFOQYXNS-UHFFFAOYSA-N 0.000 description 2
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 2
- QUTPYNJBIHTIGA-UHFFFAOYSA-N 1-nitro-2-[(2-nitrophenyl)diselanyl]benzene Chemical class [O-][N+](=O)C1=CC=CC=C1[Se][Se]C1=CC=CC=C1[N+]([O-])=O QUTPYNJBIHTIGA-UHFFFAOYSA-N 0.000 description 2
- NXCKJENHTITELM-UHFFFAOYSA-N 1-nitro-2-[(2-nitrophenyl)disulfanyl]benzene Chemical class [O-][N+](=O)C1=CC=CC=C1SSC1=CC=CC=C1[N+]([O-])=O NXCKJENHTITELM-UHFFFAOYSA-N 0.000 description 2
- DGMXMWBHUAEUQK-UHFFFAOYSA-N 6-chloro-2-methyl-1,3-benzothiazole Chemical compound C1=C(Cl)C=C2SC(C)=NC2=C1 DGMXMWBHUAEUQK-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical group [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 230000000397 acetylating effect Effects 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 150000004820 halides Chemical group 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 229910052711 selenium Chemical group 0.000 description 2
- CQLFBEKRDQMJLZ-UHFFFAOYSA-M silver acetate Chemical compound [Ag+].CC([O-])=O CQLFBEKRDQMJLZ-UHFFFAOYSA-M 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- ALUQMCBDQKDRAK-UHFFFAOYSA-N 2,3,3a,4-tetrahydro-1,3-benzothiazole Chemical class C1C=CC=C2SCNC21 ALUQMCBDQKDRAK-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- JKFYKCYQEWQPTM-UHFFFAOYSA-N 2-azaniumyl-2-(4-fluorophenyl)acetate Chemical compound OC(=O)C(N)C1=CC=C(F)C=C1 JKFYKCYQEWQPTM-UHFFFAOYSA-N 0.000 description 1
- VFMAPIFSXMBTQP-UHFFFAOYSA-N 2-bromo-4-chloro-1-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1Br VFMAPIFSXMBTQP-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- GAOGPNYSGYFOHS-UHFFFAOYSA-N 2-chloro-1,3-benzoselenazole Chemical compound C1=CC=C2[se]C(Cl)=NC2=C1 GAOGPNYSGYFOHS-UHFFFAOYSA-N 0.000 description 1
- BSQLQMLFTHJVKS-UHFFFAOYSA-N 2-chloro-1,3-benzothiazole Chemical class C1=CC=C2SC(Cl)=NC2=C1 BSQLQMLFTHJVKS-UHFFFAOYSA-N 0.000 description 1
- VFTRETRNVMSOMY-UHFFFAOYSA-N 2-ethylsulfanyl-1,3-benzoselenazole Chemical compound C1=CC=C2[se]C(SCC)=NC2=C1 VFTRETRNVMSOMY-UHFFFAOYSA-N 0.000 description 1
- HKIQFQKRAQSUJI-UHFFFAOYSA-N 2-ethylsulfanyl-1,3-benzothiazole Chemical group C1=CC=C2SC(SCC)=NC2=C1 HKIQFQKRAQSUJI-UHFFFAOYSA-N 0.000 description 1
- UTBVIMLZIRIFFR-UHFFFAOYSA-N 2-methylthio-1,3-benzothiazole Chemical compound C1=CC=C2SC(SC)=NC2=C1 UTBVIMLZIRIFFR-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- SGYIRNXZLWJMCR-UHFFFAOYSA-M 3-methyl-1,3-benzothiazol-3-ium;iodide Chemical compound [I-].C1=CC=C2[N+](C)=CSC2=C1 SGYIRNXZLWJMCR-UHFFFAOYSA-M 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- XCALAYIRFYALSX-UHFFFAOYSA-N 5-chloro-2-methyl-1,3-benzothiazole Chemical compound ClC1=CC=C2SC(C)=NC2=C1 XCALAYIRFYALSX-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- 229920008347 Cellulose acetate propionate Polymers 0.000 description 1
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- VPHOETYICCKMIU-UHFFFAOYSA-N N-phenyl-1,3-benzoselenazol-2-amine Chemical compound N(C1=NC2=CC=CC=C2[Se]1)C1=CC=CC=C1 VPHOETYICCKMIU-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910021612 Silver iodide Inorganic materials 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 150000003974 aralkylamines Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 235000012745 brilliant blue FCF Nutrition 0.000 description 1
- 150000001649 bromium compounds Chemical group 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- SMWDFEZZVXVKRB-UHFFFAOYSA-O hydron;quinoline Chemical compound [NH+]1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-O 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- HCUVVJINIWWCCR-UHFFFAOYSA-N n-(4-chlorophenyl)ethanethioamide Chemical compound CC(=S)NC1=CC=C(Cl)C=C1 HCUVVJINIWWCCR-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QDTDFSFRIDFTCF-UHFFFAOYSA-N n-phenyl-1,3-benzothiazol-2-amine Chemical compound N=1C2=CC=CC=C2SC=1NC1=CC=CC=C1 QDTDFSFRIDFTCF-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N phenyl acetate Chemical group CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Inorganic materials [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003139 primary aliphatic amines Chemical class 0.000 description 1
- 150000003142 primary aromatic amines Chemical class 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000005619 secondary aliphatic amines Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 229940071536 silver acetate Drugs 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 229940045105 silver iodide Drugs 0.000 description 1
- RHUVFRWZKMEWNS-UHFFFAOYSA-M silver thiocyanate Chemical compound [Ag+].[S-]C#N RHUVFRWZKMEWNS-UHFFFAOYSA-M 0.000 description 1
- SRRKNRDXURUMPP-UHFFFAOYSA-N sodium disulfide Chemical compound [Na+].[Na+].[S-][S-] SRRKNRDXURUMPP-UHFFFAOYSA-N 0.000 description 1
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 description 1
- 229910001488 sodium perchlorate Inorganic materials 0.000 description 1
- VPQBLCVGUWPDHV-UHFFFAOYSA-N sodium selenide Chemical compound [Na+].[Na+].[Se-2] VPQBLCVGUWPDHV-UHFFFAOYSA-N 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- CBDKQYKMCICBOF-UHFFFAOYSA-N thiazoline Chemical compound C1CN=CS1 CBDKQYKMCICBOF-UHFFFAOYSA-N 0.000 description 1
- 150000003567 thiocyanates Chemical group 0.000 description 1
- ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/06—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein with non-macromolecular additives
- G03C1/08—Sensitivity-increasing substances
- G03C1/09—Noble metals or mercury; Salts or compounds thereof; Sulfur, selenium or tellurium, or compounds thereof, e.g. for chemical sensitising
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/04—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein with macromolecular additives; with layer-forming substances
Definitions
- benzothiazole, benzoselenazole, benzoxazole, napthothiazole, simple thiazole and thiazoline quaternary salts when incorporated in gelatino-silver-halide emulsions for example in a concentration of from 2 to 8 mg. per 100 cc. of emulsion, act as antifoggants for the emulsions.
- pyridinium and quinolinium quaternary salts act to supersensitize cyanine dyes in photographic silver halide emulsions.
Landscapes
- Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- General Physics & Mathematics (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Paper (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE486662D BE486662A (enExample) | 1948-01-13 | ||
| US2126A US2490745A (en) | 1948-01-13 | 1948-01-13 | Cellulose carboxylic ester silver halide emulsions sensitized with benzothiazole and benzoselenazole quaternary salts |
| FR1001730D FR1001730A (fr) | 1948-01-13 | 1949-01-12 | émulsions photographiques perfectionnées |
| GB1021/49A GB656942A (en) | 1948-01-13 | 1949-01-13 | Improvements in sensitive photographic emulsions |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2126A US2490745A (en) | 1948-01-13 | 1948-01-13 | Cellulose carboxylic ester silver halide emulsions sensitized with benzothiazole and benzoselenazole quaternary salts |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US2490745A true US2490745A (en) | 1949-12-06 |
Family
ID=21699339
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US2126A Expired - Lifetime US2490745A (en) | 1948-01-13 | 1948-01-13 | Cellulose carboxylic ester silver halide emulsions sensitized with benzothiazole and benzoselenazole quaternary salts |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US2490745A (enExample) |
| BE (1) | BE486662A (enExample) |
| FR (1) | FR1001730A (enExample) |
| GB (1) | GB656942A (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2680686A (en) * | 1949-02-01 | 1954-06-08 | Gevaert Photo Producten | Sensitized and supersensitized photographic emulsions |
| US2759821A (en) * | 1952-06-04 | 1956-08-21 | Eastman Kodak Co | X-ray film |
| US3042521A (en) * | 1957-12-26 | 1962-07-03 | Gen Aniline & Film Corp | Antifoggants and stabilizers for photographic silver halide emulsion |
| FR2198169A1 (enExample) * | 1972-09-04 | 1974-03-29 | Fuji Photo Film Co Ltd | |
| US5389510A (en) * | 1993-12-16 | 1995-02-14 | Eastman Kodak Company | Photographic elements containing alkynylamine dopants |
| US5413905A (en) * | 1993-12-16 | 1995-05-09 | Eastman Kodak Company | Photographic sensitivity increasing alkynylamine compounds and photographic elements |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3026201A (en) * | 1959-02-02 | 1962-03-20 | Gen Aniline & Film Corp | Antifoggants and stabilizers for photographic silver halide emulsions |
| IT1204319B (it) * | 1986-04-28 | 1989-03-01 | Minnesota Mining & Mfg | Emulsione agli alogenuri d'argento contenente un sale di n-alchenil-tiazolio 2-non-sostituito come stabilizzatore dell'immagine latente ed elementi fotografici che contengono detta emulsione |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2110491A (en) * | 1936-04-16 | 1938-03-08 | Eastman Kodak Co | Photographic emulsions |
| US2131038A (en) * | 1932-05-26 | 1938-09-27 | Eastman Kodak Co | Photographic emulsion containing alkyl quaternary salts of thiazoles and the like asantifoggants |
| GB496049A (en) * | 1937-04-19 | 1938-11-21 | Ig Farbenindustrie Ag | Improved manufacture of light-sensitive photographic preparations |
| US2271623A (en) * | 1939-03-30 | 1942-02-03 | Eastman Kodak Co | Photographic emulsion |
| US2334864A (en) * | 1942-02-02 | 1943-11-23 | Eastman Kodak Co | Photographic emulsion |
-
0
- BE BE486662D patent/BE486662A/xx unknown
-
1948
- 1948-01-13 US US2126A patent/US2490745A/en not_active Expired - Lifetime
-
1949
- 1949-01-12 FR FR1001730D patent/FR1001730A/fr not_active Expired
- 1949-01-13 GB GB1021/49A patent/GB656942A/en not_active Expired
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2131038A (en) * | 1932-05-26 | 1938-09-27 | Eastman Kodak Co | Photographic emulsion containing alkyl quaternary salts of thiazoles and the like asantifoggants |
| US2110491A (en) * | 1936-04-16 | 1938-03-08 | Eastman Kodak Co | Photographic emulsions |
| GB496049A (en) * | 1937-04-19 | 1938-11-21 | Ig Farbenindustrie Ag | Improved manufacture of light-sensitive photographic preparations |
| US2271623A (en) * | 1939-03-30 | 1942-02-03 | Eastman Kodak Co | Photographic emulsion |
| US2334864A (en) * | 1942-02-02 | 1943-11-23 | Eastman Kodak Co | Photographic emulsion |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2680686A (en) * | 1949-02-01 | 1954-06-08 | Gevaert Photo Producten | Sensitized and supersensitized photographic emulsions |
| US2759821A (en) * | 1952-06-04 | 1956-08-21 | Eastman Kodak Co | X-ray film |
| US3042521A (en) * | 1957-12-26 | 1962-07-03 | Gen Aniline & Film Corp | Antifoggants and stabilizers for photographic silver halide emulsion |
| FR2198169A1 (enExample) * | 1972-09-04 | 1974-03-29 | Fuji Photo Film Co Ltd | |
| US5389510A (en) * | 1993-12-16 | 1995-02-14 | Eastman Kodak Company | Photographic elements containing alkynylamine dopants |
| US5413905A (en) * | 1993-12-16 | 1995-05-09 | Eastman Kodak Company | Photographic sensitivity increasing alkynylamine compounds and photographic elements |
Also Published As
| Publication number | Publication date |
|---|---|
| BE486662A (enExample) | |
| GB656942A (en) | 1951-09-05 |
| FR1001730A (fr) | 1952-02-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2131038A (en) | Photographic emulsion containing alkyl quaternary salts of thiazoles and the like asantifoggants | |
| US2342546A (en) | Production and use of dyestuffs | |
| US2955939A (en) | Holopolar cyanine dyes and photographic emulsions containing them | |
| US2490745A (en) | Cellulose carboxylic ester silver halide emulsions sensitized with benzothiazole and benzoselenazole quaternary salts | |
| US3397986A (en) | Photographic emulsion stabilized with bis (p-acylamidophenyl) disulfides | |
| US2983610A (en) | Sensitization of photographic emulsions | |
| US3042521A (en) | Antifoggants and stabilizers for photographic silver halide emulsion | |
| US3734738A (en) | Silver halide emulsions containing reactive quaternary salts nucleating agents | |
| US2981624A (en) | Antifoggants and stabilizers for photographic silver halide emulsion | |
| US3629274A (en) | Merocyanine dyes and photographic materials prepared therewith | |
| US3268334A (en) | Polymethine dyes | |
| US3767413A (en) | Emulsion containing internally fogged photosensitive silver halide grains formed with an aqueous silver salt solution containing alkali metal iodide in thioether | |
| US3161520A (en) | Fog reduction in photographic silver halide emulsions | |
| US3718470A (en) | Surface development process utilizing an internal image silver halide emulsion containing a composite nucleating agent-spectral sensitizing polymethine dye | |
| US2728667A (en) | Molecular compounds of mercury salts with benzothiazoles as fog inhibitors in a silver halide emulsion | |
| US3854956A (en) | Dyestuffs and spectral sensitizers for silver halide | |
| US2948615A (en) | Antifoggants and stabilizers for photographic silver halide emulsions | |
| US3481742A (en) | Silver halide photographic emulsion | |
| US3424586A (en) | Silver halide emulsions sensitized with cyanine dyes containing a hydroxypropyl sulfonic acid radical | |
| US2177635A (en) | Photographic emulsion | |
| US3698910A (en) | Light-sensitive silver halide photographic material | |
| US3401404A (en) | Merocyanine dye-sensitized photographic materials comprising silver halide emulsion layers containing azo-dyes | |
| US3440053A (en) | Silver halide photographic emulsions containing allopolar cyanine dyes | |
| US3660102A (en) | Silver halide emulsions sensitized with methine dyes containing a thiosulfatoalkyl group | |
| US3672906A (en) | Silver halide emulsions sensitized with methine dyes containing a cyclopentanone nucleus |