US20160069168A1 - Novel large hydrophobe quaternary ammonium surfactants - Google Patents
Novel large hydrophobe quaternary ammonium surfactants Download PDFInfo
- Publication number
- US20160069168A1 US20160069168A1 US14/935,109 US201514935109A US2016069168A1 US 20160069168 A1 US20160069168 A1 US 20160069168A1 US 201514935109 A US201514935109 A US 201514935109A US 2016069168 A1 US2016069168 A1 US 2016069168A1
- Authority
- US
- United States
- Prior art keywords
- surfactant
- concentration
- unsubstituted
- further embodiments
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000004094 surface-active agent Substances 0.000 title claims description 963
- 125000001453 quaternary ammonium group Chemical group 0.000 title description 7
- 239000000203 mixture Substances 0.000 claims abstract description 184
- 238000000034 method Methods 0.000 claims abstract description 66
- 238000011084 recovery Methods 0.000 claims abstract description 30
- 125000000217 alkyl group Chemical group 0.000 claims description 294
- 150000001875 compounds Chemical class 0.000 claims description 179
- 125000004404 heteroalkyl group Chemical group 0.000 claims description 137
- 125000002947 alkylene group Chemical group 0.000 claims description 71
- 239000003208 petroleum Substances 0.000 claims description 71
- 125000003118 aryl group Chemical group 0.000 claims description 64
- 239000001257 hydrogen Substances 0.000 claims description 64
- 229910052739 hydrogen Inorganic materials 0.000 claims description 64
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 55
- 239000000463 material Substances 0.000 claims description 51
- 239000000839 emulsion Substances 0.000 claims description 50
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 43
- 239000011343 solid material Substances 0.000 claims description 40
- 239000002253 acid Substances 0.000 claims description 39
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 38
- 229930195733 hydrocarbon Natural products 0.000 claims description 35
- 150000002430 hydrocarbons Chemical class 0.000 claims description 34
- 239000004215 Carbon black (E152) Substances 0.000 claims description 31
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 23
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 17
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 16
- 239000005977 Ethylene Substances 0.000 claims description 16
- 125000000732 arylene group Chemical group 0.000 claims description 9
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 9
- 239000011435 rock Substances 0.000 claims description 9
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 5
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 5
- 239000003921 oil Substances 0.000 abstract description 89
- 239000010779 crude oil Substances 0.000 abstract description 27
- 150000003856 quaternary ammonium compounds Chemical class 0.000 abstract description 4
- -1 alkoxy carboxylates Chemical class 0.000 description 116
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 40
- 239000003513 alkali Substances 0.000 description 38
- 239000006184 cosolvent Substances 0.000 description 34
- 239000003795 chemical substances by application Substances 0.000 description 32
- 235000002639 sodium chloride Nutrition 0.000 description 27
- 238000005063 solubilization Methods 0.000 description 27
- 230000007928 solubilization Effects 0.000 description 27
- 150000003839 salts Chemical class 0.000 description 25
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 24
- 125000001424 substituent group Chemical group 0.000 description 23
- 0 [1*]OCC([5*])OC[N+](C[2*])(C[3*])C[4*] Chemical compound [1*]OCC([5*])OC[N+](C[2*])(C[3*])C[4*] 0.000 description 22
- 150000001768 cations Chemical class 0.000 description 21
- 239000011734 sodium Substances 0.000 description 21
- 229910052751 metal Inorganic materials 0.000 description 18
- 239000002184 metal Substances 0.000 description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 16
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 16
- 229910052708 sodium Inorganic materials 0.000 description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 15
- 125000000129 anionic group Chemical group 0.000 description 14
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 13
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 229920003169 water-soluble polymer Polymers 0.000 description 12
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- 125000001072 heteroaryl group Chemical group 0.000 description 11
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 11
- COBPKKZHLDDMTB-UHFFFAOYSA-N 2-[2-(2-butoxyethoxy)ethoxy]ethanol Chemical group CCCCOCCOCCOCCO COBPKKZHLDDMTB-UHFFFAOYSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 125000004474 heteroalkylene group Chemical group 0.000 description 10
- 239000004530 micro-emulsion Substances 0.000 description 10
- 239000012071 phase Substances 0.000 description 10
- 239000000344 soap Substances 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 239000006260 foam Substances 0.000 description 9
- 239000007789 gas Substances 0.000 description 9
- 150000002431 hydrogen Chemical group 0.000 description 9
- 229920006395 saturated elastomer Polymers 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 description 9
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 8
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 8
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 8
- 229910019142 PO4 Inorganic materials 0.000 description 8
- 125000005228 aryl sulfonate group Chemical group 0.000 description 8
- 229960003237 betaine Drugs 0.000 description 8
- 230000002708 enhancing effect Effects 0.000 description 8
- 238000009472 formulation Methods 0.000 description 8
- 125000005842 heteroatom Chemical group 0.000 description 8
- 239000007924 injection Substances 0.000 description 8
- 238000002347 injection Methods 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 235000021317 phosphate Nutrition 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 8
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 7
- 239000012267 brine Substances 0.000 description 7
- 150000007942 carboxylates Chemical class 0.000 description 7
- 238000005755 formation reaction Methods 0.000 description 7
- 230000001965 increasing effect Effects 0.000 description 7
- 239000010452 phosphate Substances 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Substances [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- 150000008055 alkyl aryl sulfonates Chemical group 0.000 description 6
- 230000008859 change Effects 0.000 description 6
- 150000002009 diols Chemical class 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- XZPVPNZTYPUODG-UHFFFAOYSA-M sodium;chloride;dihydrate Chemical compound O.O.[Na+].[Cl-] XZPVPNZTYPUODG-UHFFFAOYSA-M 0.000 description 6
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 6
- 230000002195 synergetic effect Effects 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 5
- 125000004979 cyclopentylene group Chemical group 0.000 description 5
- 125000005549 heteroarylene group Chemical group 0.000 description 5
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 5
- 125000001624 naphthyl group Chemical group 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 229920002401 polyacrylamide Polymers 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 125000006528 (C2-C6) alkyl group Chemical group 0.000 description 4
- SZNYYWIUQFZLLT-UHFFFAOYSA-N 2-methyl-1-(2-methylpropoxy)propane Chemical compound CC(C)COCC(C)C SZNYYWIUQFZLLT-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 4
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 150000004996 alkyl benzenes Chemical class 0.000 description 4
- 150000008051 alkyl sulfates Chemical class 0.000 description 4
- 150000008052 alkyl sulfonates Chemical class 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 229940077388 benzenesulfonate Drugs 0.000 description 4
- 125000002091 cationic group Chemical group 0.000 description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- 125000001183 hydrocarbyl group Chemical group 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 239000012188 paraffin wax Substances 0.000 description 4
- 230000000087 stabilizing effect Effects 0.000 description 4
- 239000004907 Macro-emulsion Substances 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 229940093476 ethylene glycol Drugs 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 230000005484 gravity Effects 0.000 description 3
- 125000005647 linker group Chemical group 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 150000002894 organic compounds Chemical class 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- CTYRPMDGLDAWRQ-UHFFFAOYSA-N phenyl hydrogen sulfate Chemical class OS(=O)(=O)OC1=CC=CC=C1 CTYRPMDGLDAWRQ-UHFFFAOYSA-N 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 3
- 239000013535 sea water Substances 0.000 description 3
- 230000003381 solubilizing effect Effects 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 description 2
- HNNQYHFROJDYHQ-UHFFFAOYSA-N 3-(4-ethylcyclohexyl)propanoic acid 3-(3-ethylcyclopentyl)propanoic acid Chemical compound CCC1CCC(CCC(O)=O)C1.CCC1CCC(CCC(O)=O)CC1 HNNQYHFROJDYHQ-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- CPUBQVNRTRJOSW-UHFFFAOYSA-N C.CC(C)CC(O)CC(C)C Chemical compound C.CC(C)CC(O)CC(C)C CPUBQVNRTRJOSW-UHFFFAOYSA-N 0.000 description 2
- HXQPUEQDBSPXTE-UHFFFAOYSA-N CC(C)CC(O)CC(C)C Chemical compound CC(C)CC(O)CC(C)C HXQPUEQDBSPXTE-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000003158 alcohol group Chemical group 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical class [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000004956 cyclohexylene group Chemical group 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000013505 freshwater Substances 0.000 description 2
- 239000000446 fuel Substances 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 150000002596 lactones Chemical class 0.000 description 2
- 239000010687 lubricating oil Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000003345 natural gas Substances 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 230000002250 progressing effect Effects 0.000 description 2
- 125000001436 propyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 229920001059 synthetic polymer Polymers 0.000 description 2
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- TVFWYUWNQVRQRG-UHFFFAOYSA-N 2,3,4-tris(2-phenylethenyl)phenol Chemical compound C=1C=CC=CC=1C=CC1=C(C=CC=2C=CC=CC=2)C(O)=CC=C1C=CC1=CC=CC=C1 TVFWYUWNQVRQRG-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- XHZPRMZZQOIPDS-UHFFFAOYSA-N 2-Methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid Chemical compound OS(=O)(=O)CC(C)(C)NC(=O)C=C XHZPRMZZQOIPDS-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- FEBUJFMRSBAMES-UHFFFAOYSA-N 2-[(2-{[3,5-dihydroxy-2-(hydroxymethyl)-6-phosphanyloxan-4-yl]oxy}-3,5-dihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-4-yl)oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl phosphinite Chemical compound OC1C(O)C(O)C(CO)OC1OCC1C(O)C(OC2C(C(OP)C(O)C(CO)O2)O)C(O)C(OC2C(C(CO)OC(P)C2O)O)O1 FEBUJFMRSBAMES-UHFFFAOYSA-N 0.000 description 1
- AZYICGMHYYVGBY-UHFFFAOYSA-N 2-[2-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol Chemical group CCCCOCCOCCOCCOCCOCCO AZYICGMHYYVGBY-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZRTMYULJZWCRNL-UHFFFAOYSA-N C.C.CCCCOCCC Chemical compound C.C.CCCCOCCC ZRTMYULJZWCRNL-UHFFFAOYSA-N 0.000 description 1
- GKVCNFINKCFPTL-UHFFFAOYSA-M CC(=O)COC(C)C.CC(=O)OC(C)C.CC(C)OCC(O)CS(=O)(=O)[O-].CCCCOC(C)C.COC(C)C.COC(C)C.COC(C)C Chemical compound CC(=O)COC(C)C.CC(=O)OC(C)C.CC(C)OCC(O)CS(=O)(=O)[O-].CCCCOC(C)C.COC(C)C.COC(C)C.COC(C)C GKVCNFINKCFPTL-UHFFFAOYSA-M 0.000 description 1
- AJSNIWUHRQAZOS-UHFFFAOYSA-N CC(C)COCCOCCOCCO Chemical compound CC(C)COCCOCCOCCO AJSNIWUHRQAZOS-UHFFFAOYSA-N 0.000 description 1
- FNLJKPCVLIALMX-ZSJDYOACSA-J CCCCCCCCCCCCCCCCOCC(CCCCCCCCCCCCCC)O[PH](=O)CCC(O)CCl.CCCCCCCCCCCCCCCCOCC(CCCCCCCCCCCCCC)O[PH](=O)CCC(O)C[N+](CCO)(CCO)CC(=O)[O-].O.O=C(CN(CCO)CCO)O[Na].O=C(CN(CCO)CCO)O[Na].O=C(O)CN(CCO)CCO.O[Na].[2H]I.[2H]I.[Na]Cl Chemical compound CCCCCCCCCCCCCCCCOCC(CCCCCCCCCCCCCC)O[PH](=O)CCC(O)CCl.CCCCCCCCCCCCCCCCOCC(CCCCCCCCCCCCCC)O[PH](=O)CCC(O)C[N+](CCO)(CCO)CC(=O)[O-].O.O=C(CN(CCO)CCO)O[Na].O=C(CN(CCO)CCO)O[Na].O=C(O)CN(CCO)CCO.O[Na].[2H]I.[2H]I.[Na]Cl FNLJKPCVLIALMX-ZSJDYOACSA-J 0.000 description 1
- OBWNLZYKDZWVHH-UHFFFAOYSA-N CCCCCCCCCCCCCCCCOCC(CCCCCCCCCCCCCC)O[PH](=O)CCC(O)CCl.CCCCCCCCCCCCCCCCOCC(CCCCCCCCCCCCCC)O[PH](=O)CCC(O)C[N+](CCO)(CCO)CCO.ClCC1CO1.OCCN(CCO)CCO.[Cl-].[H]CC(O)CC[PH](=O)OC(CCCCCCCCCCCCCC)COCCCCCCCCCCCCCCCC Chemical compound CCCCCCCCCCCCCCCCOCC(CCCCCCCCCCCCCC)O[PH](=O)CCC(O)CCl.CCCCCCCCCCCCCCCCOCC(CCCCCCCCCCCCCC)O[PH](=O)CCC(O)C[N+](CCO)(CCO)CCO.ClCC1CO1.OCCN(CCO)CCO.[Cl-].[H]CC(O)CC[PH](=O)OC(CCCCCCCCCCCCCC)COCCCCCCCCCCCCCCCC OBWNLZYKDZWVHH-UHFFFAOYSA-N 0.000 description 1
- NKBWHRMIYKMDDN-UHFFFAOYSA-N CCCOCC(C)C Chemical compound CCCOCC(C)C NKBWHRMIYKMDDN-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 241001020574 Gigantactis ios Species 0.000 description 1
- 238000007869 Guerbet synthesis reaction Methods 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229920002305 Schizophyllan Polymers 0.000 description 1
- 235000015076 Shorea robusta Nutrition 0.000 description 1
- 244000166071 Shorea robusta Species 0.000 description 1
- 229910007161 Si(CH3)3 Inorganic materials 0.000 description 1
- 238000010795 Steam Flooding Methods 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- 241000364021 Tulsa Species 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005237 alkyleneamino group Chemical group 0.000 description 1
- 125000005238 alkylenediamino group Chemical group 0.000 description 1
- 125000005530 alkylenedioxy group Chemical group 0.000 description 1
- 125000005529 alkyleneoxy group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910052925 anhydrite Inorganic materials 0.000 description 1
- 239000013011 aqueous formulation Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229920001222 biopolymer Polymers 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004976 cyclobutylene group Chemical group 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004980 cyclopropylene group Chemical group 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000009881 electrostatic interaction Effects 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000006588 heterocycloalkylene group Chemical group 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000693 micelle Substances 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 125000004572 morpholin-3-yl group Chemical group N1C(COCC1)* 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 239000003129 oil well Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003348 petrochemical agent Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 229910052705 radium Inorganic materials 0.000 description 1
- HCWPIIXVSYCSAN-UHFFFAOYSA-N radium atom Chemical compound [Ra] HCWPIIXVSYCSAN-UHFFFAOYSA-N 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000005320 surfactant adsorption Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- UWHCKJMYHZGTIT-UHFFFAOYSA-N tetraethylene glycol Chemical group OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 1
- 125000004192 tetrahydrofuran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical group OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000000230 xanthan gum Substances 0.000 description 1
- 229920001285 xanthan gum Polymers 0.000 description 1
- 229940082509 xanthan gum Drugs 0.000 description 1
- 235000010493 xanthan gum Nutrition 0.000 description 1
Images
Classifications
-
- E—FIXED CONSTRUCTIONS
- E21—EARTH OR ROCK DRILLING; MINING
- E21B—EARTH OR ROCK DRILLING; OBTAINING OIL, GAS, WATER, SOLUBLE OR MELTABLE MATERIALS OR A SLURRY OF MINERALS FROM WELLS
- E21B43/00—Methods or apparatus for obtaining oil, gas, water, soluble or meltable materials or a slurry of minerals from wells
- E21B43/16—Enhanced recovery methods for obtaining hydrocarbons
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K8/00—Compositions for drilling of boreholes or wells; Compositions for treating boreholes or wells, e.g. for completion or for remedial operations
- C09K8/58—Compositions for enhanced recovery methods for obtaining hydrocarbons, i.e. for improving the mobility of the oil, e.g. displacing fluids
- C09K8/584—Compositions for enhanced recovery methods for obtaining hydrocarbons, i.e. for improving the mobility of the oil, e.g. displacing fluids characterised by the use of specific surfactants
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K23/00—Use of substances as emulsifying, wetting, dispersing, or foam-producing agents
- C09K23/18—Quaternary ammonium compounds
Definitions
- EOR Enhanced Oil Recovery
- 40-60% of the reservoir's original oil can typically be extracted compared with only 20-40% using primary and secondary recovery (e.g. by water injection or natural gas injection).
- Enhanced oil recovery may also be referred to as improved oil recovery or tertiary recovery (as opposed to primary and secondary recovery).
- Enhanced oil recovery may be achieved by a variety of methods including miscible gas injection (which includes carbon dioxide flooding), chemical injection (which includes polymer flooding, alkaline flooding and surfactant flooding), microbial injection, or thermal recovery (which includes cyclic steam, steam flooding, and fire flooding).
- miscible gas injection which includes carbon dioxide flooding
- chemical injection which includes polymer flooding, alkaline flooding and surfactant flooding
- microbial injection or thermal recovery (which includes cyclic steam, steam flooding, and fire flooding).
- thermal recovery which includes cyclic steam, steam flooding, and fire flooding.
- Dilute solutions of surfactants such as petroleum sulfonates may be injected to lower the interfacial tension or capillary pressure that impedes oil droplets from moving through a reservoir.
- Special formulations of oil, water and surfactant microemulsions have also proven useful. Application of these methods is usually limited by the cost of the chemicals and their adsorption and loss onto the rock of the oil containing formation.
- Some unrefined petroleum contains carboxylic acids having, for example, C 11 to C 20 alkyl chains, including napthenic acid mixtures.
- the recovery of such “reactive” oils may be performed using alkali (e.g. NaOH or Na 2 CO 3 ) in a surfactant composition.
- the alkali reacts with the acid in the reactive oil to form soap.
- These soaps serve as an additional source of surfactants enabling the use of much lower level of surfactants initially added to affect enhanced oil recovery (EOR).
- EOR enhanced oil recovery
- the added alkali causes precipitation of cations, such as Ca +2 or Mg +2 .
- an expensive chelant such as EDTA may be required in the surfactant composition.
- expensive water softening processes may be used.
- Embodiments of the quaternary ammonium compounds represent a cost effective alternative to commonly used EOR surfactants (e.g. surfactants derived from Guerbet alcohols).
- EOR surfactants e.g. surfactants derived from Guerbet alcohols.
- the compounds described herein may improve the water wettability of the surface material in a well therefore increasing the efficiency of oil production.
- the compounds provided herein may further have a stabilizing effect on the foam and therefore the foam level. For instance, in the presence of a compound disclosed herein the stability of foam pumped into the well during the process of oil recovery may be increased when compared to the absence of the compound. In some embodiments, the compounds provided herein may decrease the water drainage from the surface of the bubble.
- the level of foam pumped into the well may increase in the presence of the compound provided herein.
- the compounds described herein may improve the effectiveness of co-surfactants (e.g. alkoxy carboxylates, alkoxy sulfates, sulfonate compounds such as ABS or IOS) to a surprising degree.
- co-surfactants e.g. alkoxy carboxylates, alkoxy sulfates, sulfonate compounds such as ABS or IOS
- the combination may be more stable and effective when compared to the stability and effectiveness of the sulfonate compounds in the absence of the compounds provided herein.
- R 1 is R 12 -substituted or unsubstituted C 8 -C 150 alkyl, R 6 -substituted or unsubstituted heteroalkyl, R 6 -substituted or unsubstituted aryl or R 6 -substituted or unsubstituted cycloalkyl.
- R 6 is R 7 -substituted or unsubstituted C 1 -C 50 alkyl, R 7 -substituted or unsubstituted heteroalkyl, R 7 -substituted or unsubstituted aryl or R 7 -substituted or unsubstituted cycloalkyl.
- R 7 is R 8 -substituted or unsubstituted C 1 -C 50 alkyl, R 8 -substituted or unsubstituted heteroalkyl, R 8 -substituted or unsubstituted aryl or R 8 -substituted or unsubstituted cycloalkyl.
- R 8 is R 9 -substituted or unsubstituted C 1 -C 50 alkyl, R 9 -substituted or unsubstituted heteroalkyl, R 9 -substituted or unsubstituted aryl or R 9 -substituted or unsubstituted cycloalkyl.
- R 9 is R 10 -substituted or unsubstituted C 1 -C 50 alkyl, R 10 -substituted or unsubstituted heteroalkyl, R 10 -substituted or unsubstituted heteroalkyl, R 10 -substituted or unsubstituted aryl or R 10 -substituted or unsubstituted cycloalkyl.
- R 10 is R 11 -substituted or unsubstituted C 1 -C 50 alkyl, R 11 -substituted or unsubstituted heteroalkyl, R 11 -substituted or unsubstituted aryl or R 11 -substituted or unsubstituted cycloalkyl.
- R 11 is unsubstituted C 1 -C 50 alkyl, unsubstituted heteroalkyl, unsubstituted aryl or unsubstituted cycloalkyl.
- R 12 is unsubstituted heteroalkyl, unsubstituted aryl, unsubstitued heteroaryl, unsubstitued heterocycloalkyl or unsubstituted cycloalkyl.
- R 2 , R 3 , and R 4 are independently unsubstituted alkyl, unsubstituted cycloalkyl, unsubstituted aryl, —O, —C(O)OR 13 , or —S(O) m R 13 .
- R 13 is hydrogen, unsubstituted alkyl or unsubstituted cycloalkyl.
- m is 3 or 4.
- R 5 is independently hydrogen or unsubstituted C 1 -C 6 alkyl.
- L 1 , L 2 , L 3 , and L 4 are independently a bond, substituted or unsubstituted alkylene, substituted or unsubstituted heteroalkylene, substituted or unsubstituted cycloalkylene, or substituted or unsubstituted arylene, and n is an integer from 10 to 210.
- FIG. 1 Solubilization ratios using the surfactant formulation 0.4% C28-45PO-60EO Carboxylate, 0.4% C15-18 IOS, 0.2% Quaternary Ammonium Surfactant with Oil #1 (10%) at 100° C.
- the black arrow in the histogram pointing from left to right indicates the aqueous stability at 50,000 ppm (TDS).
- FIG. 2 Solubilization ratios using the surfactant formulation 0.4% C28-45PO-60EO Carboxylate, 0.4% C15-18 IOS, 0.2% Quaternary Ammonium Surfactant with Oil #1 (50%) at 100° C.
- the black arrow in the histogram pointing from left to right indicates the aqueous stability at 50,000 ppm (TDS).
- FIG. 3 Activity map for active Oil #1 using formulation 0.4% C28-45PO-60EO Carboxylate, 0.4% C15-18 IOS, 0.2% Quaternary Ammonium Surfactant with Oil #1 at 100° C.
- FIG. 4 Solubilization ratios using the surfactant formulation 0.4% C28-45PO-60EO Carboxylate, 0.4% C15-18 IOS, 0.2% Betaine Surfactant with Oil #1 (10%) at 100° C.
- the black arrow in the histogram pointing from left to right indicates the aqueous stability at 66,000 ppm (TDS).
- FIG. 5 Solubilization ratios using the surfactant formulation 0.4% C28-45PO-60EO Carboxylate, 0.4% C15-18 IOS, 0.2% Betaine Surfactant with Oil #1 (50%) at 100° C.
- the black arrow in the histogram pointing from left to right indicates the aqueous stability at 66,000 ppm (TDS).
- FIG. 6 Activity map for active Oil #1 using formulation 0.4% C28-45PO-60EO Carboxylate, 0.4% C15-18 IOS, 0.2% Betaine Surfactant with Oil #1 at 100° C.
- substituent groups are specified by their conventional chemical formulae, written from left to right, they equally encompass the chemically identical substituents that would result from writing the structure from right to left, e.g., —CH 2 O— is equivalent to —OCH 2 —.
- alkyl by itself or as part of another substituent, means, unless otherwise stated, a straight (i.e. unbranched) or branched chain which may be fully saturated, mono- or polyunsaturated and can include di- and multivalent radicals, having the number of carbon atoms designated (i.e. C 1 -C 10 means one to ten carbons).
- saturated hydrocarbon radicals include, but are not limited to, groups such as methyl, ethyl, n-propyl, isopropyl, n-butyl, t-butyl, isobutyl, sec-butyl, homologs and isomers of, for example, n-pentyl, n-hexyl, n-heptyl, n-octyl, and the like.
- An unsaturated alkyl group is one having one or more double bonds or triple bonds.
- unsaturated alkyl groups include, but are not limited to, vinyl, 2-propenyl, crotyl, 2-isopentenyl, 2-(butadienyl), 2,4-pentadienyl, 3-(1,4-pentadienyl), ethynyl, 1- and 3-propynyl, 3-butynyl, and the higher homologs and isomers.
- Alkyl groups which are limited to hydrocarbon groups are termed “homoalkyl”.
- An alkoxy is an alkyl attached to the remainder of the molecule via an oxygen linker (—O—).
- alkylene by itself or as part of another substituent means a divalent radical derived from an alkyl, as exemplified, but not limited, by —CH 2 CH 2 CH 2 CH 2 —, and further includes those groups described below as “heteroalkylene.”
- an alkyl (or alkylene) group will have from 1 to 24 carbon atoms, with those groups having 10 or fewer carbon atoms being preferred in the present invention.
- a “lower alkyl” or “lower alkylene” is a shorter chain alkyl or alkylene group, generally having eight or fewer carbon atoms.
- heteroalkyl by itself or in combination with another term, means, unless otherwise stated, a stable straight or branched chain or combinations thereof, consisting of at least one carbon atom and at least one heteroatom selected from the group consisting of O, N, P, Si and S, and wherein the nitrogen and sulfur atoms may optionally be oxidized. and the nitrogen heteroatom may optionally be quaternized.
- the heteroatom(s) O, N, P and S and Si may be placed at any interior position of the heteroalkyl group or at the position at which the alkyl group is attached to the remainder of the molecule.
- Examples include, but are not limited to, —CH 2 —CH 2 —O—CH 3 , —CH 2 —CH 2 —NH—CH 3 , —CH 2 —CH 2 —N(CH 3 )—CH 3 , —CH 2 —S—CH 2 —CH 3 , —CH 2 —CH 2 , —S(O)—CH 3 , —CH 2 —CH 2 —S(O) 2 —CH 3 , —CH ⁇ CH—O—CH 3 , —Si(CH 3 ) 3 , —CH 2 —CH ⁇ N—OCH 3 , —CH ⁇ CH—N(CH 3 )—CH 3 , —O—CH 3 , —O—CH 2 , —CH 3 , and —CN.
- heteroalkylene by itself or as part of another substituent means a divalent radical derived from heteroalkyl, as exemplified, but not limited by, —CH 2 —CH 2 —S—CH 2 —CH 2 — and —CH 2 —S—CH 2 —CH 2 —NH—CH 2 —.
- heteroatoms can also occupy either or both of the chain termini (e.g., alkyleneoxy, alkylenedioxy, alkyleneamino, alkylenediamino, and the like).
- cycloalkyl and “heterocycloalkyl,” by themselves or in combination with other terms, represent, unless otherwise stated, cyclic versions of “alkyl” and “heteroalkyl”, respectively. Additionally, for heterocycloalkyl, a heteroatom can occupy the position at which the heterocycle is attached to the remainder of the molecule. Examples of cycloalkyl include, but are not limited to, cyclopropyl, cyclobutyl, cyclopentyl, cyclohexyl, 1-cyclohexenyl, 3-cyclohexenyl, cycloheptyl, and the like.
- heterocycloalkyl examples include, but are not limited to, 1-(1,2,5,6-tetrahydropyridyl), 1-piperidinyl, 2-piperidinyl, 3-piperidinyl, 4-morpholinyl, 3-morpholinyl, tetrahydrofuran-2-yl, tetrahydrofuran-3-yl, tetrahydrothien-2-yl, tetrahydrothien-3-yl, 1-piperazinyl, 2-piperazinyl, and the like.
- a “cycloalkylene” and a “heterocycloalkylene,” alone or as part of another substituent means a divalent radical derived from a cycloalkyl and heterocycloalkyl, respectively.
- aryl means, unless otherwise stated, a polyunsaturated, aromatic, hydrocarbon substituent which can be a single ring or multiple rings (preferably from 1 to 3 rings) which are fused together (i.e. a fused ring aryl) or linked covalently.
- a fused ring aryl refers to multiple rings fused together wherein at least one of the fused rings is an aryl ring.
- heteroaryl refers to aryl groups (or rings) that contain from one to four heteroatoms selected from N, O, and S, wherein the nitrogen and sulfur atoms are optionally oxidized, and the nitrogen atom(s) are optionally quaternized.
- heteroaryl includes fused ring heteroaryl groups (i.e. multiple rings fused together wherein at least one of the fused rings is a heteroaromatic ring).
- a 5,6-fused ring heteroarylene refers to two rings fused together, wherein one ring has 5 members and the other ring has 6 members, and wherein at least one ring is a heteroaryl ring.
- a 6,6-fused ring heteroarylene refers to two rings fused together, wherein one ring has 6 members and the other ring has 6 members, and wherein at least one ring is a heteroaryl ring.
- a 6,5-fused ring heteroarylene refers to two rings fused together, wherein one ring has 6 members and the other ring has 5 members, and wherein at least one ring is a heteroaryl ring.
- a heteroaryl group can be attached to the remainder of the molecule through a carbon or heteroatom.
- Non-limiting examples of aryl and heteroaryl groups include phenyl, 1-naphthyl, 2-naphthyl, 4-biphenyl, 1-pyrrolyl, 2-pyrrolyl, 3-pyrrolyl, 3-pyrazolyl, 2-imidazolyl, 4-imidazolyl, pyrazinyl, 2-oxazolyl, 4-oxazolyl, 2-phenyl-4-oxazolyl, 5-oxazolyl, 3-isoxazolyl, 4-isoxazolyl, 5-isoxazolyl, 2-thiazolyl, 4-thiazolyl, 5-thiazolyl, 2-furyl, 3-furyl, 2-thienyl, 3-thienyl, 2-pyridyl, 3-pyridyl, 4-pyridyl, 2-pyrimidyl, 4-pyrimidyl, 5-benzothiazolyl, purinyl, 2-benzimidazolyl, 5-indolyl, 1-isoquinoly
- arylene and heteroarylene alone or as part of another substituent means a divalent radical derived from an aryl and heteroaryl, respectively.
- oxo as used herein means an oxygen that is double bonded to a carbon atom.
- R-substituted e.g. R 7 -substituted
- R 7 substituent of a compound provided herein
- the substituent is substituted with one or more of the named R groups (e.g. R 7 ) as appropriate.
- the substituent is substituted with only one of the named R groups.
- Each R-group as provided in the formulae provided herein can appear more than once. Where an R-group appears more than once each R group can be optionally different.
- contacting refers to materials or compounds being sufficiently close in proximity to react or interact.
- the term “contacting” includes placing an aqueous composition (e. g. chemical, surfactant or polymer) within a hydrocarbon material bearing formation using any suitable manner known in the art (e.g., pumping, injecting, pouring, releasing, displacing, spotting or circulating the chemical into a well, well bore or hydrocarbon bearing formation).
- unrefined petroleum and “crude oil” are used interchangeably and in keeping with the plain ordinary usage of those terms.
- “Unrefined petroleum” and “crude oil” may be found in a variety of petroleum reservoirs (also referred to herein as a “reservoir,” “oil field deposit” “deposit” and the like) and in a variety of forms including oleaginous materials, oil shales (i.e. organic-rich fine-grained sedimentary rock), tar sands, light oil deposits, heavy oil deposits, and the like.
- “Crude oils” or “unrefined petroleums” generally refer to a mixture of naturally occurring hydrocarbons that may be refined into diesel, gasoline, heating oil, jet fuel, kerosene, and other products called fuels or petrochemicals. Crude oils or unrefined petroleums are named according to their contents and origins, and are classified according to their per unit weight (specific gravity). Heavier crudes generally yield more heat upon burning, but have lower gravity as defined by the American Petroleum Institute (API) and market price in comparison to light (or sweet) crude oils. Crude oil may also be characterized by its Equivalent Alkane Carbon Number (EACN).
- EACN Equivalent Alkane Carbon Number
- Crude oils vary widely in appearance and viscosity from field to field. They range in color, odor, and in the properties they contain. While all crude oils are mostly hydrocarbons, the differences in properties, especially the variation in molecular structure, determine whether a crude oil is more or less easy to produce, pipeline, and refine. The variations may even influence its suitability for certain products and the quality of those products. Crude oils are roughly classified into three groups, according to the nature of the hydrocarbons they contain. (i) Paraffin based crude oils contain higher molecular weight paraffins, which are solid at room temperature, but little or no asphaltic (bituminous) matter. They can produce high-grade lubricating oils.
- Asphaltene based crude oils contain large proportions of asphaltic matter, and little or no paraffin. Some are predominantly naphthenes and so yield lubricating oils that are sensitive to temperature changes than the paraffin-based crudes.
- Mixed based crude oils contain both paraffin and naphthenes, as well as aromatic hydrocarbons. Most crude oils fit this latter category.
- Reactive crude oil as referred to herein is crude oil containing natural organic acidic components (also referred to herein as unrefined petroleum acid) or their precursors such as esters or lactones. These reactive crude oils can generate soaps (carboxylates) when reacted with alkali. More terms used interchangeably for crude oil throughout this disclosure are hydrocarbon material or active petroleum material.
- An “oil bank” or “oil cut” as referred to herein, is the crude oil that does not contain the injected chemicals and is pushed by the injected fluid during an enhanced oil recovery process.
- nonactive oil refers to an oil that is not substantially reactive or crude oil not containing significant amounts of natural organic acidic components or their precursors such as esters or lactones such that significant amounts of soaps are generated when reacted with alkali.
- a nonactive oil as referred to herein includes oils having an acid number of less than 0.5 mg KOH/g of oil.
- Unrefined petroleum acids as referred to herein are carboxylic acids contained in active petroleum material (reactive crude oil).
- the unrefined petroleum acids contain C 11 to C 20 alkyl chains, including napthenic acid mixtures.
- the recovery of such “reactive” oils may be performed using alkali (e.g. NaOH or Na 2 CO 3 ) in a surfactant composition.
- the alkali reacts with the acid in the reactive oil to form soap in situ.
- soaps serve as a source of surfactants minimizing the levels of added surfactants, thus enabling efficient oil recovery from the reservoir.
- polymer refers to a molecule having a structure that essentially includes the multiple repetitions of units derived, actually or conceptually, from molecules of low relative molecular mass.
- the polymer is an oligomer.
- bonded refers to having at least one of covalent bonding, hydrogen bonding, ionic bonding, Van Der Waals interactions, pi interactions, London forces or electrostatic interactions.
- productivity refers to the capacity of a well to produce hydrocarbons (e.g. unrefined petroleum); that is, the ratio of the hydrocarbon flow rate to the pressure drop, where the pressure drop is the difference between the average reservoir pressure and the flowing bottom hole well pressure (i.e., flow per unit of driving force).
- oil solubilization ratio is defined as the volume of oil solubilized divided by the volume of surfactant in microemulsion. All the surfactant is presumed to be in the microemulsion phase. The oil solubilization ratio is applied for Winsor type I and type III behavior. The volume of oil solubilized is found by reading the change between initial aqueous level and excess oil (top) interface level. The oil solubilization ratio is calculated as follows:
- ⁇ o oil solubilization ratio
- V o volume of oil solubilized
- V s volume of surfactant
- water solubilization ratio is defined as the volume of water solubilized divided by the volume of surfactant in microemulsion. All the surfactant is presumed to be in the microemulsion phase. The water solubilization ratio is applied for Winsor type III and type II behavior. The volume of water solubilized is found by reading the change between initial aqueous level and excess water (bottom) interface level. The water solubilization parameter is calculated as follows:
- ⁇ W water solubilization ratio
- V W volume of water solubilized
- the optimum solubilization ratio occurs where the oil and water solubilization ratios are equal.
- the coarse nature of phase behavior screening often does not include a data point at optimum, so the solubilization ratio curves are drawn for the oil and water solubilization ratio data and the intersection of these two curves is defined as the optimum.
- solubility in general refers to the property of a solute, which can be a solid, liquid or gas, to dissolve in a solid, liquid or gaseous solvent thereby forming a homogenous solution of the solute in the solvent.
- Solubility occurs under dynamic equilibrium, which means that solubility results from the simultaneous and opposing processes of dissolution and phase joining (e.g. precipitation of solids).
- the solubility equilibrium occurs when the two processes proceed at a constant rate.
- the solubility of a given solute in a given solvent typically depends on temperature. For many solids dissolved in liquid water, the solubility increases with temperature.
- solubility and solubilization is the property of oil to dissolve in water and vice versa.
- Viscosity refers to a fluid's internal resistance to flow or being deformed by shear or tensile stress. In other words, viscosity may be defined as thickness or internal friction of a liquid. Thus, water is “thin”, having a lower viscosity, while oil is “thick”, having a higher viscosity. More generally, the less viscous a fluid is, the greater its ease of fluidity.
- salinity refers to concentration of salt dissolved in a aqueous phases. Examples for such salts are without limitation, sodium chloride, magnesium and calcium sulfates, and bicarbonates. In more particular, the term salinity as it pertains to the present invention refers to the concentration of salts in brine and surfactant solutions.
- aqueous solution or aqueous formulation refers to a solution in which the solvent is water.
- emulsion, emulsion solution or emulsion formulation refers to a mixture of two or more liquids which are normally immiscible.
- a non-limiting example for an emulsion is a mixtures of oil and water.
- a “co-solvent” refers to a compound having the ability to increase the solubility of a solute (e.g. a surfactant as disclosed herein) in the presence of an unrefined petroleum acid.
- the co-solvents provided herein have a hydrophobic portion (alkyl or aryl chain), a hydrophilic portion (e.g. an alcohol) and optionally an alkoxy portion.
- Co-solvents as provided herein include alcohols (e.g. C 1 -C 6 alcohols, C 1 -C 6 diols), alkoxy alcohols (e.g.
- alcohol is used according to its ordinary meaning and refers to an organic compound containing an —OH groups attached to a carbon atom.
- diol is used according to its ordinary meaning and refers to an organic compound containing two —OH groups attached to two different carbon atoms.
- alkoxy alcohol is used according to its ordinary meaning and refers to an organic compound containing an alkoxy linker attached to a —OH group
- a “microemulsion” as referred to herein is a thermodynamically stable mixture of oil, water, and a stabilizing agents such as a surfactant or a co-solvent that may also include additional components such as alkali agents, polymers (e.g. water-soluble polymers) and a salt.
- a “macroemulsion” as referred to herein is a thermodynamically unstable mixture of oil and water that may also include additional components.
- An “emulsion” as referred to herein may be a microemulsion or a macroemulsion.
- the compounds provided herein may be used with broad oil concentrations, at a wide range of salinities, at high reservoir temperatures and over a broad pH range.
- the quaternary ammonium compounds of the present invention represent a cost effective alternative to commonly used EOR surfactants (e.g. surfactants derived from Guerbet alcohols).
- EOR surfactants e.g. surfactants derived from Guerbet alcohols.
- the compounds described herein may improve the water wettability of the surface material in a well.
- the compounds provided herein may further have an effect on foam stability and foam level.
- the stability of foam pumped into the well during the process of oil recovery is increased when compared to the absence of the compound.
- the level of foam pumped into the well may increase in the presence of the compound provided herein.
- the compounds described herein may also significantly improve the effectiveness of co-surfactants (e.g. sulfonate compounds such as ABS or IOS) to a surprising degree. Where sulfonate compounds are combined with the compounds provided herein, the combination may be more stable and effective when compared to the stability and effectiveness of the sulfonate compounds in the absence of the compounds provided herein (e.g. a compound of formula (I), (II), or (III)). Further, the compounds improve the water wettability of the solid material (e.g. rock, regolith) in contact with unrefined petroleum in a well.
- the solid material e.g. rock, regolith
- R 1 is R 12 -substituted or unsubstituted C 8 -C 150 alkyl, R 6 -substituted or unsubstituted heteroalkyl, R 6 -substituted or unsubstituted aryl or R 6 -substituted or unsubstituted cycloalkyl.
- R 6 is R 7 -substituted or unsubstituted C 1 -C 50 alkyl, R 7 -substituted or unsubstituted heteroalkyl, R 7 -substituted or unsubstituted aryl or R 7 -substituted or unsubstituted cycloalkyl.
- R 7 is R 8 -substituted or unsubstituted C 1 -C 50 alkyl, R 8 -substituted or unsubstituted heteroalkyl, R 8 -substituted or unsubstituted aryl or R 8 -substituted or unsubstituted cycloalkyl.
- R 8 is R 9 -substituted or unsubstituted C 1 -C 50 alkyl, R 9 -substituted or unsubstituted heteroalkyl, R 9 -substituted or unsubstituted aryl or R 9 -substituted or unsubstituted cycloalkyl.
- R 9 is R 10 -substituted or unsubstituted C 1 -C 50 alkyl, R 10 -substituted or unsubstituted heteroalkyl, R 10 -substituted or unsubstituted heteroalkyl, R 10 -substituted or unsubstituted aryl or R 10 -substituted or unsubstituted cycloalkyl.
- R 10 is R 11 -substituted or unsubstituted C 1 -C 50 alkyl, R 11 -substituted or unsubstituted heteroalkyl, R 11 -substituted or unsubstituted aryl or R 11 -substituted or unsubstituted cycloalkyl.
- R 11 is unsubstituted C 1 -C 50 alkyl, unsubstituted heteroalkyl, unsubstituted aryl or unsubstituted cycloalkyl.
- R 12 is unsubstituted hetreroalkyl, unsubstituted aryl or unsubstituted cycloalkyl.
- R 2 , R 3 , and R 4 are independently unsubstituted alkyl, unsubstituted cycloalkyl, unsubstituted aryl, —OR 13 , —C(O)OR 13 , or —S(O) m R 13 .
- R 13 is hydrogen, unsubstituted alkyl or unsubstituted cycloalkyl.
- m is 3 or 4.
- R 5 is independently hydrogen or unsubstituted C 1 -C 6 alkyl.
- L 1 , L 2 , L 3 , and L 4 are independently a bond, substituted or unsubstituted alkylene, substituted or unsubstituted heteroalkylene, substituted or unsubstituted cycloalkylene, substituted or unsubstituted hetercycloalkylene, substituted or unsubstituted heteroarylene or substituted or unsubstituted arylene, and n is an integer from 10 to 210.
- each of R 5 , R 6 , R 7 , R 8 , R 9 , R 10 , R 11 , R 12 and R 13 can appear more than once and can be optionally different.
- R 5 appears four times and can be optionally different.
- R 5 appears six times and can be optionally different.
- the symbol n is an integer from 10 to 210. In other embodiments, the symbol n is an integer from 15 to 210. In other embodiments, the symbol n is an integer from 20 to 210. In other embodiments, the symbol n is an integer from 25 to 210. In other embodiments, the symbol n is an integer from 30 to 210. In other embodiments, the symbol n is an integer from 35 to 210. In other embodiments, the symbol n is an integer from 40 to 210. In other embodiments, the symbol n is an integer from 45 to 210. In other embodiments, the symbol n is an integer from 50 to 210. In other embodiments, the symbol n is an integer from 55 to 210.
- the symbol n is an integer from 60 to 210. In other embodiments, the symbol n is an integer from 65 to 210. In other embodiments, the symbol n is an integer from 70 to 210. In other embodiments, the symbol n is an integer from 10 to 100. In other embodiments, the symbol n is an integer from 20 to 100. In other embodiments, the symbol n is an integer from 25 to 100. In other embodiments, the symbol n is an integer from 30 to 100. In other embodiments, the symbol n is an integer from 35 to 100. In other embodiments, the symbol n is an integer from 40 to 100. In other embodiments, the symbol n is an integer from 45 to 100. In other embodiments, the symbol n is an integer from 50 to 100.
- the symbol n is an integer from 55 to 100. In other embodiments, the symbol n is an integer from 60 to 100. In other embodiments, the symbol n is an integer from 65 to 100. In other embodiments, the symbol n is an integer from 70 to 100. In some embodiments, n is 45 to 110. In some further embodiments, n is 50 to 105. In some other further embodiments, n is 50. In some further other embodiments, n is 95. In some related embodiments, R 1 is R 12 -substituted or unsubstituted C 20 -C 150 alkyl. In other related embodiments, R 1 is R 12 -substituted or unsubstituted C 22 -C 150 alkyl.
- R 1 is R 12 -substituted or unsubstituted C 24 -C 150 alkyl. In other related embodiments, R 1 is R 12 -substituted or unsubstituted C 20 -C 50 alkyl. In other related embodiments, R 1 is R 12 -substituted or unsubstituted C 22 -C 50 alkyl. In other related embodiments, R 1 is R 12 -substituted or unsubstituted C 24 -C 50 alkyl.
- R 1 is branched unsubstituted C 10 -C 50 alkyl, branched unsubstituted C 10 -C 50 heteroalkyl, (C 6 H 5 —CH 2 CH 2 ) 3 C 6 H 2 —, (C 6 H 5 —CH 2 CH 2 ) 2 C 6 H 3 —, (C 6 H 5 —CH 2 CH 2 ) 1 C 6 H 4 —, or R 6 -substituted or unsubstituted naphthyl.
- the naphthyl is a mono-, di-, or tri-alkyl naphthyl or any combination thereof.
- the alkyl is a saturated alkyl.
- n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 105).
- R 1 may be substituted or unsubstituted alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 10 -C 150 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 12 -C 50 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 14 -C 150 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 16 -C 150 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 18 -C 150 alkyl.
- R 1 is R 12 -substituted or unsubstituted C 20 -C 150 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 22 -C 150 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 24 -C 150 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 10 -C 100 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 12 -C 100 alkyl.
- R 1 is R 12 -substituted or unsubstituted C 14 -C 100 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 16 -C 100 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 18 -C 100 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 20 -C 100 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 22 -C 100 alkyl.
- R 1 is R 12 -substituted or unsubstituted C 24 -C 100 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 10 -C 50 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 12 -C 50 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 14 -C 50 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 16 -C 50 alkyl.
- R 1 is R 12 -substituted or unsubstituted C 18 -C 50 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 20 -C 50 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 22 -C 50 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 24 -C 50 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is R 12 -substituted or unsubstituted C 10 -C 40 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 12 -C 40 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 14 -C 40 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 16 -C 40 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 18 -C 40 alkyl.
- R 1 is R 12 -substituted or unsubstituted C 20 -C 40 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 22 -C 40 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 24 -C 40 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is R 12 -substituted or unsubstituted C 10 -C 36 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 12 -C 36 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 14 -C 36 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 16 -C 36 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 18 -C 36 alkyl.
- R 1 is R 12 -substituted or unsubstituted C 20 -C 36 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 22 -C 36 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 24 -C 36 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is R 12 -substituted or unsubstituted C 10 -C 28 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 12 -C 28 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 14 -C 28 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 16 -C 28 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 18 -C 28 alkyl.
- R 1 is R 12 -substituted or unsubstituted C 20 -C 28 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 22 -C 28 alkyl. In some embodiments, R 1 is R 12 -substituted or unsubstituted C 24 -C 28 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is branched unsubstituted C 12 -C 100 alkyl. In other embodiments, R 1 is linear unsubstituted C 12 -C 100 alkyl. In some embodiments, R 1 is branched unsubstituted C 16 -C 100 alkyl. In other embodiments, R 1 is linear unsubstituted C 16 -C 100 alkyl. In some embodiments, R 1 is branched unsubstituted C 18 -C 100 alkyl. In other embodiments, R 1 is linear unsubstituted C 18 -C 100 alkyl. In some embodiments, R 1 is branched unsubstituted C 20 -C 100 alkyl.
- R 1 is linear unsubstituted C 20 -C 100 alkyl. In some embodiments, R 1 is branched unsubstituted C 22 -C 100 alkyl. In other embodiments, R 1 is linear unsubstituted C 22 -C 100 alkyl. In some embodiments, R 1 is branched unsubstituted C 24 -C 100 alkyl. In other embodiments, R 1 is linear unsubstituted C 24 -C 100 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is branched unsubstituted C 12 -C 50 alkyl. In other embodiments, R 1 is linear unsubstituted C 12 -C 50 alkyl. In some embodiments, R 1 is branched unsubstituted C 16 -C 50 alkyl. In other embodiments, R 1 is linear unsubstituted C 16 -C 50 alkyl. In some embodiments, R 1 is branched unsubstituted C 18 -C 50 alkyl. In other embodiments, R 1 is linear unsubstituted C 18 -C 50 alkyl. In some embodiments, R 1 is branched unsubstituted C 20 -C 50 alkyl.
- R 1 is linear unsubstituted C 20 -C 50 alkyl. In some embodiments, R 1 is branched unsubstituted C 22 -C 50 alkyl. In other embodiments, R 1 is linear unsubstituted C 22 -C 50 alkyl. In some embodiments, R 1 is branched unsubstituted C 24 -C 50 alkyl. In other embodiments, R 1 is linear unsubstituted C 24 -C 50 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is branched unsubstituted C 12 -C 40 alkyl. In other embodiments, R 1 is linear unsubstituted C 12 -C 40 alkyl. In some embodiments, R 1 is branched unsubstituted C 16 -C 40 alkyl. In other embodiments, R 1 is linear unsubstituted C 16 -C 40 alkyl. In some embodiments, R 1 is branched unsubstituted C 18 -C 40 alkyl. In other embodiments, R 1 is linear unsubstituted C 18 -C 40 alkyl. In some embodiments, R 1 is branched unsubstituted C 20 -C 40 alkyl.
- R 1 is linear unsubstituted C 20 -C 40 alkyl. In some embodiments, R 1 is branched unsubstituted C 22 -C 40 alkyl. In other embodiments, R 1 is linear unsubstituted C 22 -C 40 alkyl. In some embodiments, R 1 is branched unsubstituted C 24 -C 40 alkyl. In other embodiments, R 1 is linear unsubstituted C 24 -C 40 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is branched unsubstituted C 12 -C 36 alkyl. In other embodiments, R 1 is linear unsubstituted C 12 -C 36 alkyl. In some embodiments, R 1 is branched unsubstituted C 16 -C 36 alkyl. In other embodiments, R 1 is linear unsubstituted C 16 -C 36 alkyl. In some embodiments, R 1 is branched unsubstituted C 18 -C 36 alkyl. In other embodiments, R 1 is linear unsubstituted C 18 -C 36 alkyl. In some embodiments, R 1 is branched unsubstituted C 20 -C 36 alkyl.
- R 1 is linear unsubstituted C 20 -C 36 alkyl. In some embodiments, R 1 is branched unsubstituted C 22 -C 36 alkyl. In other embodiments, R 1 is linear unsubstituted C 22 -C 36 alkyl. In some embodiments, R 1 is branched unsubstituted C 24 -C 36 alkyl. In other embodiments, R 1 is linear unsubstituted C 24 -C 36 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is branched unsubstituted C 12 -C 28 alkyl. In other embodiments, R 1 is linear unsubstituted C 12 -C 28 alkyl. In some embodiments, R 1 is branched unsubstituted C 16 -C 28 alkyl. In other embodiments, R 1 is linear unsubstituted C 16 -C 28 alkyl. In some embodiments, R 1 is branched unsubstituted C 18 -C 28 alkyl. In other embodiments, R 1 is linear unsubstituted C 18 -C 28 alkyl. In some embodiments, R 1 is branched unsubstituted C 20 -C 28 alkyl.
- R 1 is linear unsubstituted C 20 -C 28 alkyl. In some embodiments, R′ is branched unsubstituted C 22 -C 28 alkyl. In other embodiments, R 1 is linear unsubstituted C 22 -C 28 alkyl. In some embodiments, R 1 is branched unsubstituted C 24 -C 28 alkyl. In other embodiments, R 1 is linear unsubstituted C 24 -C 28 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is a linear or branched unsubstituted alkyl (e.g. branched unsubstituted C 12 -C 100 alkyl)
- the alkyl is a saturated alkyl (e.g. a linear or branched unsubstituted saturated alkyl or branched unsubstituted C 12 -C 100 saturated alkyl).
- R 1 may be linear or branched unsubstituted saturated alkyl.
- R 1 is branched unsubstituted C 12 -C 100 saturated alkyl. In other embodiments, R 1 is linear unsubstituted C 12 -C 100 saturated alkyl. In some embodiments, R 1 is branched unsubstituted C 16 -C 100 saturated alkyl. In other embodiments, R 1 is linear unsubstituted C 16 -C 100 saturated alkyl. In some embodiments, R 1 is branched unsubstituted C 24 -C 36 saturated alkyl. In other embodiments, R 1 is linear unsubstituted C 24 -C 36 saturated alkyl. In other embodiments, R 1 is linear unsubstituted C 24 -C 28 saturated alkyl.
- R 1 is branched unsubstituted C 24 -C 28 saturated alkyl.
- R 1 is formed using the Guerbet reaction.
- R 1 is a linear or branched unsubstituted alkyl (e.g. branched unsubstituted C 10 -C 20 alkyl)
- the alkyl is an unsaturated alkyl (e.g. a linear or branched unsubstituted unsaturated alkyl or branched unsubstituted C 10 -C 20 unsaturated alkyl).
- An unsaturated alkyl as provided herein can be mono- or polyunsaturated and can include di- and multivalent radicals.
- R 1 may be linear or branched unsubstituted unsaturated alkyl. In some embodiments, R 1 is branched unsubstituted C 10 -C 20 unsaturated alkyl. In other embodiments, R 1 is linear unsubstituted C 10 -C 20 unsaturated alkyl. In some embodiments, R 1 is branched unsubstituted C 16 -C 20 unsaturated alkyl. In other embodiments, R 1 is linear unsubstituted C 16 -C 20 unsaturated alkyl. In some embodiments, R 1 is branched unsubstituted C 12 -C 18 unsaturated alkyl.
- R 1 is linear unsubstituted C 12 -C 18 unsaturated alkyl. In some embodiments, R 1 is linear unsubstituted Cis unsaturated alkyl. In other embodiments, R 1 is branched unsubstituted C 18 unsaturated alkyl. In one embodiment, R 1 is linear unsubstituted Cis mono-unsaturated alkyl. In another embodiment, R 1 is linear unsubstituted C 18 poly-unsaturated alkyl. In one embodiment, R 1 is branched unsubstituted C 18 mono-unsaturated alkyl. In another embodiment, R 1 is branched unsubstituted C 18 poly-unsaturated alkyl.
- R 1 is branched unsubstituted C 12 -C 100 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 12 -C 100 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 16 -C 100 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 16 -C 100 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 18 -C 100 heteroalkyl.
- R 1 is linear unsubstituted C 18 -C 100 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 20 -C 100 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 20 -C 100 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 22 -C 100 heteroalkyl.
- R 1 is linear unsubstituted C 22 -C 100 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 24 -C 100 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 24 -C 100 heteroalkyl. In some related embodiments, the heteroalkyl is a saturated heteroalkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is branched unsubstituted C 12 -C 50 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 12 -C 50 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 16 -C 50 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 16 -C 50 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 18 -C 50 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 18 -C 50 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 20 -C 50 heteroalkyl.
- R 1 is linear unsubstituted C 20 -C 50 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 22 -C 50 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 22 -C 50 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 24 -C 50 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 24 -C 50 heteroalkyl. In some related embodiments, the heteroalkyl is a saturated heteroalkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is branched unsubstituted C 12 -C 40 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 12 -C 40 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 16 -C 40 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 16 -C 40 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 18 -C 40 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 18 -C 40 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 20 -C 40 heteroalkyl.
- R 1 is linear unsubstituted C 20 -C 40 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 22 -C 40 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 22 -C 40 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 24 -C 40 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 24 -C 40 heteroalkyl. In some related embodiments, the heteroalkyl is a saturated heteroalkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is branched unsubstituted C 12 -C 36 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 12 -C 36 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 16 -C 36 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 16 -C 36 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 18 -C 36 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 18 -C 36 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 20 -C 36 heteroalkyl.
- R 1 is linear unsubstituted C 20 -C 36 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 22 -C 36 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 22 -C 36 heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 24 -C 36 heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 24 -C 36 heteroalkyl. In some related embodiments, the heteroalkyl is a saturated heteroalkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- R 1 is a linear or branched unsubstituted heteroalkyl (e.g. branched unsubstituted C 12 -C 100 heteroalkyl)
- the heteroalkyl is a saturated heteroalkyl (e.g. a linear or branched unsubstituted saturated heteroalkyl or branched unsubstituted C 12 -C 100 saturated heteroalkyl).
- R 1 may be linear or branched unsubstituted saturated heteroalkyl.
- R 1 is branched unsubstituted C 12 -C 100 saturated heteroalkyl.
- R 1 is linear unsubstituted C 12 -C 100 saturated heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 16 -C 100 saturated heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 16 -C 100 saturated heteroalkyl. In some embodiments, R 1 is branched unsubstituted C 24 -C 36 saturated heteroalkyl. In other embodiments, R 1 is linear unsubstituted C 24 -C 36 saturated heteroalkyl.
- R 1 is R 6 -substituted phenyl.
- R 6 may be R 1 -substituted or unsubstituted C 1 -C 50 alkyl (e.g. C 2 -C 6 alkyl).
- R 6 is R 7 -substituted methyl.
- R 6 may be branched R 7 -substituted C 1 -C 50 alkyl (e.g. branched C 2 -C 6 alkyl).
- R 6 is branched R 7 -substituted propyl.
- R 7 is R 8 -substituted or unsubstituted alkyl (e.g.
- R 7 is independently unsubstituted C 1 -C 4 alkyl (e.g. methyl) or R 8 -substituted aryl (e.g. R 8 -substituted phenyl).
- R 8 is R 9 -substituted or unsubstituted alkyl or R 9 -substituted or unsubstituted cycloalkyl.
- R 1 is having the formula:
- a compound as described herein may include multiple instances of R 1 , R 2 , R 3 , R 4 , R 5 , R 6 , R 7 , R 8 , R 9 , R 10 , R 11 , R 12 , R 13 , R 14 , R 15 , R 16 , R 17 , R 18 , R 19 , R 20 , R 21 and/or other variables.
- each variable may optional be different and be appropriately labeled to distinguish each group for greater clarity.
- R 1 , R 2 , R 3 , R 4 , R 5 , R 6 , R 7 , R 8 , R 9 , R 10 , R 11 , R 12 , R 13 , R 14 , R 15 , R 16 , R 17 , R 18 , R 19 , R 20 , and/or R 21 may be referred to, for example, as R 1.1 , R 1.2 , R 1.3 , R 1.4 , R 2.1 , R 2.2 , R 2.3 , R 2.4 , R 3.1 , R 3.2 , R 3.3 , R 4 , R 4.1 , R 4.2 , R 4.3 , R 4.4 , R 5.1 , R 5.2 , R 5.3 , R 5.4 , R 6.1 , R 6.2 , R 6.3 , R 6.4 , R 7.1 , R 7.2 , R 7.3 , R 7.4 , R 8.1 , R 8.2 ,
- R 7.1 , R 7.2 , R 7.3 , R 8.1 , R 8.2 , and R 8.3 are defined as R 7 and R 8 above.
- R 7.1 is R 8.1 -substituted or unsubstituted C 1 -C 50 alkyl, (e.g. a branched and/or saturated alkyl), R 8.1 -substituted or unsubstituted aryl, or R 8.1 -substituted or unsubstituted cycloalkyl.
- R 7.2 may be R 8.2 -substituted or unsubstituted C 1 -C 50 alkyl, (e.g.
- R 7.3 may be R 8.3 -substituted or unsubstituted C 1 -C 50 alkyl, (e.g. a branched and/or saturated alkyl), R 8.3 -substituted or unsubstituted aryl, or R 8.3 -substituted or unsubstituted cycloalkyl.
- R 7.1 , R 7.2 and R 7.3 are independently unsubstituted C 1 -C 25 alkyl (e.g. a branched and/or saturated alkyl). In other embodiments, R 7.1 , R 7.2 and R 7.3 are independently branched unsubstituted C 1 -C 25 saturated alkyl. In some embodiments, R 8.1 is R 9.1 -substituted or unsubstituted C 1 -C 50 alkyl, (e.g. a branched and/or saturated alkyl), R 9.1 -substituted or unsubstituted aryl, or R 9.1 -substituted or unsubstituted cycloalkyl.
- R 8.2 may be R 9.2 -substituted or unsubstituted C 1 -C 50 alkyl, (e.g. a branched and/or saturated alkyl), R 9.2 -substituted or unsubstituted aryl, or R 9.2 -substituted or unsubstituted cycloalkyl.
- R 8.3 may be R 9.3 -substituted or unsubstituted C 1 -C 50 alkyl, (e.g. a branched and/or saturated alkyl), R 9.3 -substituted or unsubstituted aryl, or R 9.3 -substituted or unsubstituted cycloalkyl.
- R 9.1 , R 9.2 and R 9.3 may be independently substituted or unsubstituted alkyl, substituted or unsubstituted heteroalkyl, substituted or unsubstituted aryl, or substituted or unsubstituted cycloalkyl.
- R 8.1 , R 8.2 and R 8.3 are independently C 1 -C 25 alkyl.
- R 8.1 , R 8.2 and R 8.3 are independently branched unsubstituted C 1 -C 25 saturated alkyl.
- the symbols a, b, and c are independently integers from 1 to 15. In some embodiments, a, b, and c are independently integers from 1 to 10.
- a, b, and c are independently integers from 1 to 10. In some embodiments, a, b, and c are 1. Each R 7.1 , R 7.2 , R 7.3 , R 8.1 , R 8.2 and R 8.3 are optionally different.
- R 2 , R 3 , and R 4 may be the same or different and may each independently be unsubstituted alkyl, unsubstituted cycloalkyl, unsubstituted aryl, or —OR 13 , —C(O)OR 3 , or —S(O) m R 13 .
- R 2 , R 3 , and R 4 are the same or different and are each independently unsubstituted alkyl, unsubstituted cycloalkyl, unsubstituted aryl, or —OR 13 , —C(O)OR 3 , or —S(O) m R 3 .
- R 2 , R 3 , and R 4 are independently substituted or unsubstituted C 1 -C 20 (e.g. C 1 -C 6 ) alkyl, substituted or unsubstituted C 3 -C 8 (e.g., C 5 -C 7 ) cykloalkyl, or substituted or unsubstituted C 5 -C 10 (e.g. C 5 -C 6 ) aryl.
- R 13 may independently be hydrogen, unsubstituted alkyl or unsubstituted cycloalkyl.
- R 2 , R 3 , and R 4 are unsubstituted C 1 -C 6 alkyl.
- R 2 , R 3 , and R 4 are unsubstituted C 1 -C 4 alkyl. In some further embodiments, R 2 , R 3 , and R 4 are methyl. In some other further embodiments, R 2 , R 3 , and R 4 are ethyl. In some embodiments, R 2 , R 3 , and R 4 are —OR 13 , wherein R 13 is hydrogen. In some embodiments, R 2 , R 3 , and R 4 are independently —OR 13 , or —C(O)OR 13 . In some further embodiments, R 13 is hydrogen. R 2 , R 3 , and R 4 may be the same or independently different.
- R 2 , R 3 , and R 4 are different.
- R 2 and R 4 are —OR 13 and R 3 is —C(O)OR 13 , wherein R 13 is hydrogen.
- R 2 and R 4 are —OH and R 3 is —C(O)OH.
- R 2 and R 4 are —OR 13 and R 3 is —S(O) m R 13 , wherein R 13 is hydrogen and m is 3.
- R 2 and R 4 are —OH and R 3 is —S(O) 3 H.
- —C(O)O— with an appropriate accompanying counterion e.g. Na + , K + , Ca 2+ , Mg 2+
- an acceptable salt of —S(O) 3 H would include —S(O) 3 ⁇ with an appropriate accompanying counterion (e.g. Na + , K + , Ca 2+ , Mg 2+ ).
- a compound of formula (I), (II), or (III) as disclosed herein, wherein R 2 , R 3 , and R 4 are independently —C(O)OH or —S(O) 3 H may include a compound of formula (I), (II), or (III), wherein R 2 , R 3 , and R 4 are independently —C(O)O ⁇ or —S(O) 3 ⁇ .
- L 1 , L 2 , L 3 , and L 4 may be the same or may be independently different and may each independently be a bond, substituted or unsubstituted alkylene, substituted or unsubstituted heteroalkylene, substituted or unsubstituted cycloalkylene, or substituted or unsubstituted arylene.
- L 1 , L 2 , L 3 , and L 4 are the same or different and are each independently a bond, substituted or unsubstituted alkylene, substituted or unsubstituted heteroalkylene, substituted or unsubstituted cycloalkylene, or substituted or unsubstituted arylene.
- L 1 , L 2 , L 3 , and L 4 are independently substituted or unsubstituted C 1 -C 20 (e.g., C 1 -C 8 ) alkylene, substituted or unsubstituted 2 to 20 membered (e.g., 2 to 8 membered) heteroalkylene, substituted or unsubstituted 2 to 20 membered (e.g., 2 to 8 membered) cycloalkylene, or substituted or unsubstituted C 5 -C 20 arylene (e.g. C 6 arylene).
- L 1 , L 2 , L 3 , and L 4 may be the same or may be different.
- L 1 , L 2 , L 3 , and L 4 are independently different.
- L 1 is substituted alkylene and L 2 , L 3 and L 4 are unsubstituted alkylene.
- L 1 may be substituted C 1 -C 5 alkylene (e.g. substituted C 3 alkylene) and L 2 , L 3 and L 4 are unsubstituted C 1 -C 6 alkylene (e.g. C 2 alkylene).
- L 1 is substituted propylene.
- L 1 has the formula
- L 1 is substituted C 3 alkylene (e.g. as described in formula (V)) and L 2 , L 3 and L 4 are C 2 alkylene (i.e. ethylene).
- L 1 is substituted C 3 alkylene (e.g. as described in formula (V))
- L 2 and L 4 are C 2 alkylene (i.e. ethylene)
- L 3 is methylene.
- L 1 is substituted C 3 alkylene (i.e. substituted propylene) and L 2 , L 3 and L 4 are a bond.
- R 2 , R 3 , and R 4 may be —OR 13 , wherein R 13 is hydrogen.
- R 2 , R 3 , and R 4 are —OH.
- L 2 , L 3 , and L 4 may be independently unsubstituted C 1 -C 4 alkylene.
- R 2 , R 3 , and R 4 are —OH and L 2 , L 3 , and L 4 are independently unsubstituted C 1 -C 4 alkylene.
- L 2 , L 3 , and L 4 are ethylene.
- R 2 and R 4 are independently —OR 13 and R 3 is —C(O)OR 13 .
- R 13 is hydrogen and L 2 , L 3 , and L 4 are independently unsubstituted C 1 -C 4 alkylene (e.g. unsubstituted methylene or ethylene).
- L 2 and L 4 are ethylene and L 3 is methylene.
- R 2 and R 4 are independently —OR 13 and R 3 is —S(O) 3 R 13 .
- R 13 is hydrogen and L 2 , L 3 , and L 4 are independently unsubstituted C 1 -C 4 alkylene (e.g. methylene or ethylene).
- R 5 is independently hydrogen or unsubstituted C 1 -C 5 alkyl. In some embodiments, R 5 is branched unsubstituted C 1 -C 5 saturated alkyl. In some embodiments, R 5 is hydrogen or unsubstituted C 1 or C 2 alkyl. In some related embodiments, R 5 is hydrogen or branched unsubstituted C 1 or C 2 saturated alkyl. In some embodiments, R 5 is hydrogen or a branched unsubstituted C 1 saturated alkyl. In other embodiments, R 5 is C 2 -C 6 alkyl. In some embodiments, R 5 is a branched unsubstituted C 2 -C 6 saturated alkyl.
- R 5 is not C 2 alkyl. In other embodiments, R 5 is C 1 alkyl or C 3 -C 6 alkyl. In some embodiments, R 5 is a branched unsubstituted C 3 -C 6 saturated alkyl. In other embodiments, R 5 is hydrogen.
- R 5 substituents with the fewest number of carbons are present toward the side of the compound of formula (I) bound to the L 1 substituent.
- the compound of formula (I) will be increasingly hydrophilic in progressing from the R 1 substituent to the side of the compound of formula (I) bound to the L 1 substituent.
- side of the compound of formula (I) bound to the L 1 substituent refers to the side of the compound indicated by asterisks in the below structure of formula (I):
- the symbol n is an integer from 21 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 32 alkyl, the symbol n is an integer from 25 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 32 alkyl, the symbol n is an integer from 30 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 32 alkyl, the symbol n is an integer from 35 to 210.
- the symbol n is an integer from 40 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 32 alkyl, the symbol n is an integer from 45 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 32 alkyl, the symbol n is an integer from 50 to 210.
- the symbol n is an integer from 55 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 32 alkyl, the symbol n is an integer from 60 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 32 alkyl, the symbol n is an integer from 25 to 100. In other embodiments, where R 1 is unsubstituted C 25 -C 32 alkyl, the symbol n is an integer from 30 to 100. In other embodiments, where R 1 is unsubstituted C 25 -C 32 alkyl, the symbol n is an integer from 35 to 100.
- n is an integer from 40 to 100. In other embodiments, where R 1 is unsubstituted C 25 -C 32 alkyl, the symbol n is an integer from 45 to 100. In some further embodiments, n is 50. In other embodiments, where R 1 is unsubstituted C 25 -C 32 alkyl, the symbol n is an integer from 50 to 100. In some further embodiments, n is 95. In other embodiments, where R 1 is unsubstituted C 25 -C 32 alkyl, the symbol n is an integer from 55 to 100.
- L 1 , L 2 , L 3 , L 4 , R 2 , R 3 , R 4 and R 5 may be any of the embodiments described above (e.g. L 2 , L 3 , and L 4 may be independently unsubstituted C 1 -C 3 alkylene (e.g. methylene or ethylene), L 1 may be substituted C3 alkylene (e.g. the compound of formula (V)), R 2 , R 3 , and R 4 may be independently —OH or —C(O)OH, and R 5 may be independently hydrogen or unsubstituted C 1 -C 3 alkyl).
- L 2 , L 3 , and L 4 may be independently unsubstituted C 1 -C 3 alkylene (e.g. methylene or ethylene)
- L 1 may be substituted C3 alkylene (e.g. the compound of formula (V))
- R 2 , R 3 , and R 4 may be independently —OH or —C(O)OH
- the symbol n is an integer from 21 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 25 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 30 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 35 to 210.
- R 1 is unsubstituted C 25 -C 35 heteroalkyl
- the symbol n is an integer from 40 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 45 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 50 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 55 to 210.
- the symbol n is an integer from 60 to 210. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 25 to 100. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 30 to 100. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 35 to 100. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 40 to 100.
- n is an integer from 45 to 100. In some further embodiments, n is 50. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 50 to 100. In some further embodiments, n is 95. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 55 to 100. In other embodiments, where R 1 is unsubstituted C 25 -C 35 heteroalkyl, the symbol n is an integer from 60 to 100.
- L 1 , L 2 , L 3 , L 4 , R 2 , R 3 , R 4 and R 5 may be any of the embodiments described above (e.g. L 2 , L 3 , and L 4 may be independently unsubstituted C 1 -C 3 alkylene (e.g. methylene or ethylene), L 1 may be substituted C3 alkylene (e.g. the compound of formula (V)), R 2 , R 3 , and R 4 may be independently —OH or —C(O)OH, and R 5 may be independently hydrogen or unsubstituted C 1 -C 3 alkyl).
- L 2 , L 3 , and L 4 may be independently unsubstituted C 1 -C 3 alkylene (e.g. methylene or ethylene)
- L 1 may be substituted C3 alkylene (e.g. the compound of formula (V))
- R 2 , R 3 , and R 4 may be independently —OH or —C(O)OH
- the compound provided herein has the formula:
- o is an integer from 20 to 100
- p is an integer from 10 to 80
- R 5 is unsubstituted C 1 -C 3 alkyl (e.g. methyl or ethyl).
- R 5 is methyl.
- R 1 is branched C 15 -C 40 heteroalkyl, o is 10 to 40 and p is 5 to 30.
- p is 10 to 100. In some related embodiments, p is 10 to 90. In some related embodiments, p is 10 to 80. In some related embodiments, p is 10 to 70. In some related embodiments, p is 10 to 60. In some further related embodiments, o is 20 to 60. In other further related embodiments, o is 25 to 50. In other further related embodiments, o is 30 to 45. In other further related embodiments, o is 35 to 40. In other further related embodiments, o is more than 15, 25 or 30.
- L 1 , L 2 , L 3 , L 4 , R 2 , R 3 , R 4 and R 5 may be any of the embodiments described above (e.g.
- L 2 , L 3 , and L 4 may be independently unsubstituted C 1 -C 3 alkylene (e.g. methylene or ethylene), L 1 may be substituted C3 alkylene (e.g. the compound of formula (V)), R 2 , R 3 , and R 4 may be independently —OH or —C(O)OH, and R 5 may be independently hydrogen or unsubstituted C 1 -C 3 alkyl).
- C 1 -C 3 alkylene e.g. methylene or ethylene
- L 1 may be substituted C3 alkylene (e.g. the compound of formula (V))
- R 2 , R 3 , and R 4 may be independently —OH or —C(O)OH
- R 5 may be independently hydrogen or unsubstituted C 1 -C 3 alkyl).
- p is 15 to 100. In some related embodiments, p is 15 to 90. In some related embodiments, p is 15 to 80. In some related embodiments, p is 15 to 70. In some related embodiments, p is 15 to 60. In some further related embodiments, o is 20 to 60. In other further related embodiments, o is 25 to 50. In other further related embodiments, o is 30 to 45. In other further related embodiments, o is 35 to 40. In other further related embodiments, o is more than 15, 20 or 30.
- L 1 , L 2 , L 3 , L 4 , R 2 , R 3 , R 4 and R 5 may be any of the embodiments described above (e.g.
- L 2 , L 3 , and L 4 may be independently unsubstituted C 1 -C 3 alkylene (e.g. methylene or ethylene), L 1 may be substituted C3 alkylene (e.g. the compound of formula (V)), R 2 , R 3 , and R 4 may be independently —OH or —C(O)OH, and R 5 may be independently hydrogen or unsubstituted C 1 -C 3 alkyl).
- C 1 -C 3 alkylene e.g. methylene or ethylene
- L 1 may be substituted C3 alkylene (e.g. the compound of formula (V))
- R 2 , R 3 , and R 4 may be independently —OH or —C(O)OH
- R 5 may be independently hydrogen or unsubstituted C 1 -C 3 alkyl).
- the compound provided herein has the formula:
- p is an integer from 10 to 100
- o is an integer from 20 to 80
- q is an integer from 0 to 60
- R 5 is unsubstituted C 1 -C 3 alkyl.
- R 5 is ethyl or propyl. In some further embodiments, R 5 is ethyl.
- p is 10 to 100. In some related embodiments, p is 10 to 90. In some related embodiments, p is 10 to 80. In some related embodiments, p is 10 to 70. In some related embodiments, p is 10 to 60. In some further related embodiments, o is 20 to 60. In other further related embodiments, o is 25 to 50. In other further related embodiments, o is 30 to 45. In other further related embodiments, o is 35 to 40. In other further related embodiments, o is more than 15, 20 or 30. In other further embodiments, q is 0 to 50. In some other further embodiments, q is 5 to 50. In some other further embodiments, q is 10 to 50.
- L 1 , L 2 , L 3 , L 4 , R 2 , R 3 , R 4 and R 5 may be any of the embodiments described above (e.g. L 2 , L 3 , and L 4 may be independently unsubstituted C 1 -C 3 alkylene (e.g. methylene or ethylene), L 1 may be substituted C 3 alkylene (e.g. the compound of formula (V)), R 2 , R 3 , and R 4 may be independently —OH or —C(O)OH, and R 5 may be independently hydrogen or unsubstituted C 1 -C 3 alkyl).
- p is 15 to 100. In some related embodiments, p is 15 to 90. In some related embodiments, p is 15 to 80. In some related embodiments, p is 15 to 70. In some related embodiments, p is 15 to 60. In some further related embodiments, o is 5 to 60. In other further related embodiments, o is 10 to 50. In other further related embodiments, o is 15 to 45. In other further related embodiments, o is 20 to 40. In other further related embodiments, o is more than 10, 15, or 20. In other further embodiments, q is 0 to 50. In some other further embodiments, q is 5 to 50. In some other further embodiments, q is 10 to 50.
- L 1 , L 2 , L 3 , L 4 , R 2 , R 3 , R 4 and R 5 may be any of the embodiments described above (e.g. L 2 , L 3 , and L 4 may be independently unsubstituted C 1 -C 3 alkylene (e.g. methylene or ethylene), L 1 may be substituted C 3 alkylene (e.g. the compound of formula (V)), R 2 , R 3 , and R 4 may be independently —OH or —C(O)OH, and R 5 may be independently hydrogen or unsubstituted C 1 -C 3 alkyl).
- an aqueous composition including a co-surfactant and a compound as described herein (e.g. a compound of formula (I), (II), or (III)) is provided.
- a co-surfactant as used herein, is a compound within the aqueous composition that functions as a surface active agent when the aqueous composition is in contact with a crude oil (e.g. an unrefined petroleum).
- the co-surfactant, along with the compound of formula (I), (II) or (III) may act to lower the interfacial tension and/or surface tension of the unrefined petroleum.
- the co-surfactant and the compound of formula (I), (II) or (III) are present in synergistic surface active amounts.
- a “synergistic surface active amount,” as used herein, means that a compound of formula (I), (II) or (III) and the co-surfactant are present in amounts in which the oil surface activity (interfacial tension lowering effect and/or surface tension lowering effect on crude oil when the aqueous composition is added to the crude oil) of the compound and co-surfactant combined is greater than the additive oil surface activity of the co-surfactant individually and the compound individually.
- the oil surface activity of the compound and co-surfactant combination is 10%, 20%, 30%, 40%, 50%, 60%, 70%, 80%, 90% or 100% more than the additive oil surface activity of the co-surfactant individually and the compound individually. In some embodiments, the oil surface activity of the compound and co-surfactant combination is 2, 3, 4, 5, 6, 7, 8, 9 or 10 times more than the additive oil surface activity of the co-surfactant individually and the compound individually.
- the compound and co-surfactant are present in a surfactant stabilizing amount.
- a “surfactant stabilizing amount” means that the compound and the co-surfactant are present in an amount in which the co-surfactant degrades at a slower rate in the presence of the compound than in the absence of the compound, and/or the compound degrades at a slower rate in the presence of the co-surfactant than in the absence of the co-surfactant.
- the rate of degradation may be 10%, 20%, 30%, 40%, 50%, 60%, 70%, 80%, 90% or 100% slower. In some embodiments, the rate of degradation is 2, 3, 4, 5, 6, 7, 8, 9 or 10 times slower.
- the compound and co-surfactant are present in a synergistic solubilizing amount.
- a “synergistic solubilizing amount” means that the compound and the co-surfactant are present in an amount in which the compound is more soluble in the presence of the co-surfactant than in the absence of the co-surfactant, and/or the co-surfactant is more soluble in the presence of the compound than in the absence of the compound.
- the solubilization may be 10%, 20%, 30%, 40%, 50%, 60%, 70%, 80%, 90% or 100% higher. In some embodiment, the solubilization is 2, 3, 4, 5, 6, 7, 8, 9 or 10 times higher.
- the compound is present in an amount sufficient to increase the solubility of the co-surfactant in the aqueous composition relative to the absence of the compound.
- the solubility of the co-surfactant in the aqueous composition is higher than in the absence of the compound.
- the co-surfactant is present in an amount sufficient to increase the solubility of the compound in the aqueous composition relative to the absence of the co-surfactant.
- the solubility of the compound in the aqueous solution is higher than in the absence of the co-surfactant.
- the aqueous composition provided herein including embodiments thereof includes a co-surfactant.
- the co-surfactant provided herein may be any appropriate co-surfactant useful in the field of enhanced oil recovery.
- a plurality of co-surfactant types is in the aqueous composition.
- the co-surfactant is a single co-surfactant type in the aqueous composition.
- the aqueous composition includes a plurality of different co-surfactants. Where the aqueous composition includes a plurality of different co-surfactants the aqueous composition may include a co-surfactant blend.
- a “co-surfactant blend” as provided herein is a mixture of a plurality of co-surfactant types.
- the co-surfactant blend includes a first co-surfactant type (e.g. an alkoxy carboxylate surfactant), a second surfactant type (e.g. an internal olefin sulfonate) or a third co-surfactant type (sulfate surfactant).
- the first, second and third co-surfactant type may be independently different (e.g. anionic or cationic co-surfactants; or two anionic co-surfactants having a different hydrocarbon chain length but are otherwise the same).
- the terms “co-surfactant” and “co-surfactant type(s)” have the same meaning and can be used interchangeably.
- the plurality of different co-surfactants includes an anionic co-surfactant, a non-ionic co-surfactant, a zwitterionic co-surfactant or a cationic co-surfactant.
- the co-surfactant is an anionic surfactant, a non-ionic surfactant, a zwitterionic co-surfactant.
- Zwitterionic or “zwitterion” as used herein refers to a neutral molecule with a positive (or cationic) and a negative (or anionic) electrical charge at different locations within the same molecule. Examples for zwitterionics are without limitation betains and sultains.
- the co-surfactant provided herein may be any appropriate anionic co-surfactant.
- the co-surfactant is an anionic co-surfactant.
- the anionic co-surfactant is an anionic co-surfactant blend.
- the aqueous composition includes a plurality (i.e. more than one) of anionic co-surfactant types.
- the anionic co-surfactant is an alkoxy carboxylate co-surfactant, an alkoxy sulfate co-surfactant, an alkoxy sulfonate co-surfactant, an alkyl sulfonate co-surfactant, an aryl sulfonate co-surfactant or an olefin sulfonate co-surfactant.
- alkoxy carboxylate co-surfactant is a compound having an alkyl or aryl attached to one or more alkoxylene groups (typically —CH 2 —CH(ethyl)-O—, —CH 2 —CH(methyl)-O—, or —CH 2 —CH 2 —O—) which, in turn is attached to —COO— or acid or salt thereof including metal cations such as sodium.
- alkoxy carboxylate co-surfactant has the formula:
- R 1C is substituted or unsubstituted C 8 -C 150 alkyl or substituted or unsubstituted aryl
- R 2C is independently hydrogen or unsubstituted C 1 -C 6 alkyl
- R 3C is independently hydrogen or unsubstituted C 1 -C 6 alkyl
- n is an integer from 2 to 210
- z is an integer from 1 to 6
- M + is a monovalent, divalent or trivalent cation.
- R 1C is unsubstituted linear or branched C 8 -C 36 alkyl.
- R 1C is (C 6 H 5 —CH 2 CH 2 ) 3 C 6 H 2 -(TSP), (C 6 H 5 —CH 2 CH 2 ) 2 C 6 H 3 — (DSP), (C 6 H 5 —CH 2 CH 2 ) 1 C 6 H 4 — (MSP), or substituted or unsubstituted naphthyl.
- the alkoxy carboxylate is C 28 -25PO-25EO-carboxylate (i.e.
- the co-surfactant is an alkoxy sulfate co-surfactant.
- An alkoxy sulfate co-surfactant as provided herein is a co-surfactant having an alkyl or aryl attached to one or more alkoxylene groups (typically —CH 2 —CH(ethyl)-O—, —CH 2 —CH(methyl)-O—, or —CH 2 —CH 2 —O—) which, in turn is attached to —SO 3 ⁇ or acid or salt thereof including metal cations such as sodium.
- the alkoxy sulfate co-surfactant has the formula R A —(BO) e —(PO) f -(EO) g —SO 3 ⁇ or acid or salt (including metal cations such as sodium) thereof, wherein R A is C 8 -C 30 alkyl, BO is —CH 2 —CH(ethyl)-O—, PO is —CH 2 —CH(methyl)-O—, and EO is —CH 2 —CH 2 —O—.
- the symbols e, f and g are integers from 0 to 25 wherein at least one is not zero.
- the alkoxy sulfate co-surfactant is C 15 -13PO-sulfate (i.e. an unsubstituted Cis alkyl attached to 13 —CH 2 —CH(methyl)-O— linkers, in turn attached to —SO 3 ⁇ or acid or salt thereof including metal cations such as sodium).
- the alkoxy sulfate co-surfactant has the formula
- R 1D and R 2D are independently substituted or unsubstituted C 8 -C 150 alkyl or substituted or unsubstituted aryl.
- R 3D is independently hydrogen or unsubstituted C 1 -C 6 alkyl.
- z is an integer from 2 to 210.
- X ⁇ is
- R 1D is branched unsubstituted C 8 -C 150 .
- R 1D is branched or linear unsubstituted C 12 -C 100 alkyl, (C 6 H 5 —CH 2 CH 2 ) 3 C 6 H 2 -(TSP), (C 6 H 5 —CH 2 CH 2 ) 2 C 6 H 3 — (DSP), (C 6 H 5 —CH 2 CH 2 ) 1 C 6 H 4 — (MSP), or substituted or unsubstituted naphthyl.
- the alkoxy sulfate is C 16 -C 16 -epoxide-15PO-10EO-sulfate (i.e. a linear unsubstituted C 16 alkyl attached to an oxygen, which in turn is attached to a branched unsubstituted C 16 alkyl, which in turn is attached to 15 —CH 2 —CH(methyl)-O— linkers, in turn attached to 10 —CH 2 —CH 2 —O— linkers, in turn attached to —SO 3 ⁇ or acid or salt thereof including metal cations such as sodium.
- C 16 -C 16 -epoxide-15PO-10EO-sulfate i.e. a linear unsubstituted C 16 alkyl attached to an oxygen, which in turn is attached to a branched unsubstituted C 16 alkyl, which in turn is attached to 15 —CH 2 —CH(methyl)-O— linkers, in turn attached to 10 —CH 2 —CH 2 —O
- the alkoxy sulfate co-surfactant provided herein may be an aryl alkoxy sulfate co-surfactant.
- An aryl alkoxy co-surfactant as provided herein is an alkoxy co-surfactant having an aryl attached to one or more alkoxylene groups (typically —CH 2 —CH(ethyl)-O—, —CH 2 —CH(methyl)-O—, or —CH 2 —CH 2 —O—) which, in turn is attached to —SO 3 — or acid or salt thereof including metal cations such as sodium.
- the aryl alkoxy sulfate co-surfactant is (C 6 H 5 —CH 2 CH 2 ) 3 C 6 H 2 -7PO-10EO-sulfate (i.e. tri-styrylphenol attached to 7 —CH 2 —CH(methyl)-O— linkers, in turn attached to 10 —CH 2 —CH 2 —O— linkers, in turn attached to —SO 3 ⁇ or acid or salt thereof including metal cations such as sodium).
- the co-surfactant is an unsubstituted alkyl sulfate or an unsubstituted alkyl sulfonate co-surfactant.
- An alkyl sulfate co-surfactant as provided herein is a co-surfactant having an alkyl group attached to —O—SO 3 ⁇ or acid or salt thereof including metal cations such as sodium.
- An alkyl sulfonate co-surfactant as provided herein is a co-surfactant having an alkyl group attached to —SO 3 ⁇ or acid or salt thereof including metal cations such as sodium.
- the co-surfactant is an unsubstituted aryl sulfate co-surfactant or an unsubstituted aryl sulfonate co-surfactant.
- An aryl sulfate co-surfactant as provided herein is a co-surfactant having an aryl group attached to —O—SO 3 ⁇ or acid or salt thereof including metal cations such as sodium.
- An aryl sulfonate co-surfactant as provided herein is a co-surfactant having an aryl group attached to —SO 3 ⁇ or acid or salt thereof including metal cations such as sodium.
- the co-surfactant is an alkyl aryl sulfonate.
- Non-limiting examples of alkyl sulfate co-surfactants, aryl sulfate co-surfactants, alkyl sulfonate co-surfactants, aryl sulfonate co-surfactants and alkyl aryl sulfonate co-surfactants useful in the embodiments provided herein are alkyl aryl sulfonates (ARS) (e.g. alkyl benzene sulfonate (ABS)), alkane sulfonates, petroleum sulfonates, and alkyl diphenyl oxide (di)sulfonates.
- ARS alkyl aryl sulfonates
- ABS alkyl benzene sulfonate
- alkane sulfonates e.g. alkyl benzene sulfonate (ABS)
- alkane sulfonates e.g. alkyl benzene s
- Additional co-surfactants useful in the embodiments provided herein are alcohol sulfates, alcohol phosphates, alkoxy phosphate, sulfosuccinate esters, alcohol ethoxylates, alkyl phenol ethoxylates, quaternary ammonium salts, betains and sultains.
- the co-surfactant as provided herein may be a combination of one or more anionic, non-ionic, cationic or zwitterionic co-surfactants.
- the co-surfactant is an internal olefin sulfonate (IOS), an alfa olefin sulfonate (AOS), an alkyl aryl sulfonate (ARS), an alkane sulfonate, a petroleum sulfonate, an alkyl diphenyl oxide (di)sulfonate, an alcohol sulfate, an alkoxy sulfate, an alkoxy sulfonate, an alcohol phosphate, an alkoxy phosphate, a sulfosuccinate ester, an alcohol ethoxylate, an alkyl phenol ethoxylate, a quaternary ammonium salt, a betaine or sultaine.
- the co-surfactant as provided herein may
- the co-surfactant may be a combination of two or more of the following compounds: an internal olefin sulfonate (IOS), an alfa olefin sulfonate (AOS), an alkyl aryl sulfonate (ARS) (e.g. an alkyl benzene sulfonate (ABS)), an alkane sulfonate, a petroleum sulfonate, an alkyl diphenyl oxide (di)sulfonate, an alcohol sulfate, an alkoxy sulfate (e.g.
- IOS internal olefin sulfonate
- AOS alfa olefin sulfonate
- ARS alkyl aryl sulfonate
- alkane sulfonate e.g. an alkyl benzene sulfonate (ABS)
- di alkyl diphenyl
- an alkyl alkoxy sulfate an alkoxy sulfonate, an alcohol phosphate, an alkoxy phosphate, a sulfosuccinate ester, an alcohol ethoxylate, an alkyl phenol ethoxylate, a quaternary ammonium salt, a betaine, a sultaine and a soap (or its carboxylic acid).
- surfactants are commercially available as blends of related molecules (e.g. IOS and ABS surfactants).
- the co-surfactant may be a blend of a plurality of related surfactant molecules (as described herein and as generally known in the art).
- the co-surfactant is a C 10 -C 30 internal olefin sulfate (IOS) or a C 8 -C 30 alkyl benzene sulfonate (ABS).
- the co-surfactant is a combination of a C 10 -C 30 internal olefin sulfate (IOS) and a C 8 -C 30 alkyl benzene sulfonate (ABS).
- the C 10 -C 30 of IOS is a branched unsubstituted C 10 -C 30 saturated alkyl.
- the IOS is a C 15 -C 18 internal olefin sulfate.
- the IOS is a C 19 -C 23 internal olefin sulfate.
- the IOS is a C 20 -C 24 internal olefin sulfate.
- the IOS is a C 15 -C 18 internal olefin sulfate.
- the C 8 -C 30 of ABS is a branched unsubstituted C 8 -C 30 saturated alkyl.
- the surfactant is an unsubstituted alkyl alkoxy sulfate having an alkyl attached to one or more alkoxylene groups (typically —CH 2 —CH(ethyl)-O—, —CH 2 —CH(methyl)-O—, or —CH 2 —CH 2 —O—) which, in turn is attached to —SO 3 ⁇ or acid or salt thereof including metal cations such as sodium.
- alkoxylene groups typically —CH 2 —CH(ethyl)-O—, —CH 2 —CH(methyl)-O—, or —CH 2 —CH 2 —O—
- the alkyl alkoxy sulfate has the formula R A —(BO) e —(PO) f -(EO) g —SO 3 ⁇ or acid or salt (including metal cations such as sodium) thereof, wherein BO is —CH 2 —CH(ethyl)-O—, PO is —CH 2 —CH(methyl)-O—, and —CH 2 —CH 2 —O—.
- the symbols e, f and g are integers from 0 to 25 wherein at least one is not zero.
- the alkyl alkoxy sulfate is C 15 -13PO-Sulfate (i.e.
- the surfactant is an unsubstituted alkyl sulfate.
- Additional useful co-surfactants are surfactants known to be used in enhanced oil recovery methods, including those discussed in D. B. Levitt, A. C. Jackson, L. Britton and G. A. Pope, “Identification and Evaluation of High-Performance EOR Surfactants,” SPE 100089, conference contribution for the SPE Symposium on Improved Oil Recovery Annual Meeting, Tulsa, Okla., Apr. 24-26, 2006.
- the total surfactant concentration (i.e. the compound of formula (I), (II) or (III) and one or more co-surfactants) in the aqueous composition is from about 0.05% w/w to about 10% w/w. In other embodiments, the total surfactant concentration in the aqueous composition is from about 0.25% to about 10%. In other embodiments, the total surfactant concentration in the aqueous composition is about 0.5%. In other embodiments, the total surfactant concentration in the aqueous composition is about 1.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 1.25%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 1.5%.
- the total surfactant concentration in the aqueous composition is from about 1.75%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 2.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 2.5%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 3.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 3.5%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 4.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 4.5%.
- the total surfactant concentration in the aqueous composition is from about 5.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 5.5%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 6.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 6.5%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 7.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 7.5%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 8.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 9.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 10%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.05% (all percentages of the compounds of formula (I), (II) or (III), so-solvents and co-surfactants within the aqueous compositions and emulsion compositions here are w/w percentages).
- the concentration of the co-surfactant is about 0.05%.
- the concentration of the co-surfactant is about 0.10%.
- the concentration of the co-surfactant is about 0.15%.
- the concentration of the co-surfactant is about 0.20%.
- the concentration of the co-surfactant is about 0.25%.
- the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%.
- the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%.
- the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.1%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 1.50%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 2%. In some further embodiments, the concentration of the co-surfactant is about 0.05%.
- the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%.
- the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%.
- the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 3%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 4%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the concentration of the compound of formula (I), (II) or (III) is about 5%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%.
- the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%.
- the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- the aqueous composition further includes a viscosity enhancing water-soluble polymer.
- the viscosity enhancing water-soluble polymer may be a biopolymer such as xanthan gum or scleroglucan, a synthetic polymer such as polyacrylamide, hydrolyzed polyacrylamide or co-polymers of acrylamide and acrylic acid, 2-acrylamido 2-methyl propane sulfonate or N-vinyl pyrrolidone, a synthetic polymer such as polyethylene oxide, or any other high molecular weight polymer soluble in water or brine.
- the viscosity enhancing water-soluble polymer is polyacrylamide or a co-polymer of polyacrylamide.
- the viscosity enhancing water-soluble polymer is a partially (e.g. 20%, 25%, 30%, 35%, 40%, 45%) hydrolyzed anionic polyacrylamide. In some further embodiment, the viscosity enhancing water-soluble polymer has a molecular weight of approximately about 8 ⁇ 10 6 . In some other further embodiment, the viscosity enhancing water-soluble polymer has a molecular weight of approximately about 18 ⁇ 10 6 .
- Non-limiting examples of commercially available polymers useful for the invention including embodiments provided herein are Florpaam 3330S and Florpaam 3360S. Molecular weights of the polymers may range from about 10,000 daltons to about 20,000,000 daltons.
- the viscosity enhancing water-soluble polymer is used in the range of about 500 to about 5000 ppm concentration, such as from about 1000 to 2000 ppm (e.g. in order to match or exceed the reservoir oil viscosity under the reservoir conditions of temperature and pressure).
- the aqueous composition further includes an alkali agent.
- An alkali agent as provided herein is a basic, ionic salt of an alkali metal (e.g. lithium, sodium, potassium) or alkaline earth metal element (e.g. magnesium, calcium, barium, radium).
- the alkali agent is NaOH, KOH, LiOH, Na 2 CO 3 , NaHCO 3 , Na-metaborate, Na silicate, Na orthosilicate, Na acetate or NH 4 OH.
- the aqueous composition may include seawater, or fresh water from an aquifer, river or lake.
- the aqueous composition includes hard brine water or soft brine water.
- the water is soft brine water. In some further embodiments, the water is hard brine water.
- the aqueous composition may include an alkaline agent. In soft brine water the alkaline agent provides for enhanced soap generation from the active oils, lower surfactant adsorption to the solid material (e.g. rock) in the reservoir and increased solubility of viscosity enhancing water soluble polymers.
- the alkali agent is present in the aqueous composition at a concentration from about 0.1% w/w to about 10% w/w. The combined amount of alkali agent and compound provided herein (e.g.
- the total concentration of alkali agent i.e. the total amount of alkali agent within the aqueous compositions and emulsion compositions provided herein
- the total alkali agent concentration in the aqueous composition is from about 0.25% w/w to about 5% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 0.5% w/w.
- the total alkali agent concentration in the aqueous composition is about 0.75% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 1% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 1.25% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 1.50% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 1.75% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 2% w/w.
- the total alkali agent concentration in the aqueous composition is about 2.25% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 2.5% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 2.75% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 3% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 3.25% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 3.5% w/w.
- the total alkali agent concentration in the aqueous composition is about 3.75% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 4% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 4.25% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 4.5% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 4.75% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 5.0% w/w.
- the aqueous composition may include a surfactant, a co-surfactant and a co-solvent.
- the aqueous composition includes a co-solvent.
- the co-solvent is TEGBE (triethylene glycol mono butyl ether).
- TEGBE is present at a concentration from about 0.01% to about 2%.
- TEGBE is present at a concentration from about 0.05% to about 1.5%.
- TEGBE is present at a concentration from about 0.2% to about 1.25%.
- TEGBE is present at a concentration from about 0.25% to about 1%.
- TEGBE is present at a concentration from about 0.5% to about 0.75%. In some embodiments, TEGBE is present at a concentration of about 0.25%. In other embodiments, TEGBE is present at a concentration of about 1%.
- the co-solvent is an alcohol, alcohol ethoxylate, glycol ether, glycols, or glycerol.
- the co-solvent has the formula
- R 1A is unsubstituted C 1 -C 6 alkylene, unsubstituted phenylene, unsubstituted cyclohexylene, unsubstituted cyclopentylene or methyl-substituted cyclopenlene.
- R 2A is independently hydrogen, methyl or ethyl.
- R 3A is independently hydrogen or
- R 4A is independently hydrogen, methyl or ethyl, n is an integer from 0 to 30, and m is an integer from 0 to 30. In one embodiment, n is an integer from 0 to 25. In one embodiment, n is an integer from 0 to 20. In one embodiment, n is an integer from 0 to 15. In one embodiment, n is an integer from 0 to 10. In one embodiment, n is an integer from 0 to 5. In one embodiment, n is 1. In other embodiments, n is 3. In one embodiment, n is 5. In one embodiment, m is an integer from 0 to 25. In one embodiment, m is an integer from 0 to 20. In one embodiment, m is an integer from 0 to 15.
- m is an integer from 0 to 10. In one embodiment, m is an integer from 0 to 5. In one embodiment, m is 1. In other embodiments, m is 3. In one embodiment, m is 5.
- each of R 2A and R 4A can appear more than once and can be optionally different. For example, in one embodiment where n is 2, R 2A appears twice and can be optionally different. In other embodiments, where m is 3, R 4A appears three times and can be optionally different.
- R 1A may be linear or branched unsubstituted alkylene.
- R 1A of formula (IX) is linear unsubstituted C 1 -C 6 alkylene.
- R 1A of formula (IX) is branched unsubstituted C 1 -C 6 alkylene.
- R 1A of formula (IX) is linear unsubstituted C 2 -C 6 alkylene.
- R 1A of formula (IX) is branched unsubstituted C 2 -C 6 alkylene.
- R 1A of formula (IX) is linear unsubstituted C 3 -C 6 alkylene.
- R 1A of formula (IX) is branched unsubstituted C 3 -C 6 alkylene. In other embodiments, R 1A of formula (IX) is linear unsubstituted C 4 -C 6 alkylene. In other embodiments, R 1A of formula (IX) is branched unsubstituted C 4 -C 6 alkylene. In other embodiments, R 1A of formula (IX) is linear unsubstituted C 4 -alkylene. In other embodiments, R 1A of formula (IX) is branched unsubstituted C 4 -alkylene.
- R 1A is linear or branched unsubstituted alkylene (e.g. branched unsubstituted C 1 -C 6 alkylene)
- the alkylene is a saturated alkylene (e.g. a linear or branched unsubstituted saturated alkylene or branched unsubstituted C 1 -C 6 saturated alkylene).
- R 1A is linear or branched unsubstituted saturated alkylene.
- R 1A of formula (IX) is linear unsubstituted saturated C 1 -C 6 alkylene. In one embodiment, R 1A of formula (IX) is branched unsubstituted saturated C 1 -C 6 alkylene. In other embodiments, R 1A of formula (IX) is linear unsubstituted saturated C 2 -C 6 alkylene. In other embodiments, R 1A of formula (IX) is branched unsubstituted saturated C 2 -C 6 alkylene. In other embodiments, R 1A of formula (IX) is linear unsubstituted saturated C 3 -C 6 alkylene.
- R 1A of formula (IX) is branched unsubstituted saturated C 3 -C 6 alkylene. In other embodiments, R 1A of formula (IX) is linear unsubstituted saturated C 4 -C 6 alkylene. In other embodiments, R 1A of formula (IX) is branched unsubstituted saturated C 4 -C 6 alkylene. In other embodiments, R 1A of formula (IX) is linear unsubstituted saturated C 4 -alkylene. In other embodiments, R 1A of formula (IX) is branched unsubstituted saturated C 4 -alkylene.
- R 1A of formula (IX) is substituted or unsubstituted cycloalkylene or unsubstituted arylene.
- R 1A of formula (IX) is R 7A -substituted or unsubstituted cyclopropylene, wherein R 7A is C 1 -C 3 alkyl.
- R 1A of formula (IX) is R 8A -substituted or unsubstituted cyclobutylene, wherein R 8A is C 1 -C 2 alkyl.
- R 1A of formula (IX) is R 9A -substituted or unsubstituted cyclopentylene, wherein R 9A is C 1 -alkyl.
- R 1A of formula (IX) is R 10A -substituted or unsubstituted cyclopentylene, wherein R 10A is unsubstituted cyclohexyl.
- R 1A of formula (IX) is unsubstituted phenylene, unsubstituted cyclohexylene, unsubstituted cyclopentylene or methyl-substituted cyclopentylene.
- —R 1A —R 3A of formula (IX) is C 1 -C 6 alkyl, unsubstituted phenyl, unsubstituted cyclohexyl, unsubstituted cyclopentyl or a methyl-substituted cycloalkyl.
- the co-solvent has the structure of formula
- R 11A is C 1 -C 6 alkyl, unsubstituted phenyl, unsubstituted cyclohexyl, unsubstituted cyclopentyl or a methyl-substituted cycloalkyl.
- n and m are independently 1 to 20. In other embodiments, n and m are independently 1 to 15. In other embodiments, n and m are independently 1 to 10. In one embodiment, n and m are independently 1 to 6. In one embodiment, n and m are independently 1.
- the co-solvent included in the aqueous compositions provided herein may be a monohydric or a dihydric alkoxy alcohol (e.g. C 1 -C 6 alkoxy alcohol or C 1 -C 6 alkoxy diol). Where the co-solvent is a monohydric alcohol, the co-solvent has the formula (IX) and R 3A is hydrogen. Where the co-solvent is a diol, the co-solvent has the formula (IX) and R 3A is
- R 1A is linear unsubstituted C 4 alkylene and n is 3.
- the co-solvent is triethyleneglycol butyl ether. In other embodiments, the co-solvent is tetraethylene glycol. In further embodiments, m is 3. In one embodiment, R 1A is linear unsubstituted C 4 alkylene and n is 5. In one embodiment, the co-solvent is pentaethyleneglycol n-butyl ether. In further embodiments, m is 5. In one embodiment, R 1A is branched unsubstituted C 4 alkylene and n is 1. In one embodiment, the co-solvent is ethyleneglycol iso-butyl ether.
- m is 1.
- R 1A is branched unsubstituted C 4 alkylene and n is 3.
- the co-solvent is triethyleneglycol iso-butyl ether.
- m is 3.
- the co-solvent is ethylene glycol or propylene glycol.
- the co-solvent is ethylene glycol alkoxylate or propylene glycol alkoxylate.
- the co-solvent is propylene glycol diethoxylate or propylene glycoltriethoxylate.
- the co-solvent is propylene glycol tetraethoxylate.
- R 3A may be hydrogen or
- R 3A is
- the co-solvent provided herein may be an alcohol or diol (C 1 -C 6 alcohol or C 1 -C 6 diol). Where the co-solvent is an alcohol, the co-solvent has a structure of formula (I), where R 3A is hydrogen and n is 0. Where the co-solvent is a diol, the co-solvent has a structure of formula (IX), where R 3A is
- R 1A is linear or branched unsubstituted C 1 -C 6 alkylene. In other embodiments, R 1A is linear or branched unsubstituted C 2 -C 6 alkylene. In one embodiment, R 1A is linear or branched unsubstituted C 2 -C 6 alkylene. In one embodiment R 1A is linear or branched unsubstituted C 3 -C 6 alkylene. In other embodiments, R 1A is linear or branched unsubstituted C 4 -C 6 alkylene. In one embodiment, R 1A is linear or branched unsubstituted C 4 -alkylene. In one embodiment, R 1A is branched unsubstituted butylene. In one embodiment, the co-solvent has the structure of formula
- the co-solvent has the structure of formula
- the co-solvent has the structure of formula
- the co-solvent has the formula
- R 1B is independently hydrogen or unsubstituted C 1 -C 6 alkyl
- R 2B is independently hydrogen or unsubstituted C 1 -C 2 alkyl
- n is an integer from 1 to 30.
- R 1B is unsubstituted C 2 -C 6 alkyl.
- R 1B is unsubstituted C 4 -C 6 alkyl.
- R 1B is unsubstituted C 1 -C 5 alkyl.
- R 1B is unsubstituted C 1 -C 4 alkyl.
- R 1B is unsubstituted C 1 -C 3 alkyl.
- R 1B is unsubstituted C 1 -C 2 alkyl. In some embodiments, R 1B is unsubstituted C 2 alkyl. In other embodiments, R 1B is ethyl. In some embodiments, R 1B is methyl. In some embodiment, R 1B is hydrogen.
- R 1B may be linear or branched unsubstituted alkyl.
- R 1B of formula (X) is linear unsubstituted C 1 -C 6 alkyl.
- R 1B of formula (X) is branched unsubstituted C 1 -C 6 alkyl.
- R 1B of formula (X) is linear unsubstituted C 1 -C 5 alkyl.
- R 1B of formula (X) is branched unsubstituted C 1 -C 5 alkyl.
- R 1B of formula (X) is linear unsubstituted C 1 -C 4 alkyl.
- R 1B of formula (X) is branched unsubstituted C 1 -C 4 alkyl. In other embodiments, R 1B of formula (X) is linear unsubstituted C 1 -C 3 alkyl. In other embodiments, R 1B of formula (X) is branched unsubstituted C 1 -C 3 alkyl. In other embodiments, R 1B of formula (X) is linear unsubstituted ethyl. In other embodiments, R 1B of formula (X) is branched unsubstituted ethyl.
- R 1B is linear or branched unsubstituted alkyl (e.g. branched unsubstituted C 1 -C 6 alkyl)
- the alkyl is a saturated alkyl (e.g. a linear or branched unsubstituted saturated alkyl or branched unsubstituted C 1 -C 6 saturated alkyl).
- R 1B is linear or branched unsubstituted saturated alkyl.
- R 1B of formula (X) is linear unsubstituted saturated C 1 -C 6 alkyl. In one embodiment, R 1B of formula (X) is branched unsubstituted saturated C 1 -C 6 alkyl.
- R 1B of formula (X) is linear unsubstituted saturated C 1 -C 5 alkyl. In other embodiments, R 1B of formula (X) is branched unsubstituted saturated C 1 -C 5 alkyl. In other embodiments, R 1B of formula (X) is linear unsubstituted saturated C 1 -C 4 alkyl. In other embodiments, R 1B of formula (X) is branched unsubstituted saturated C 1 -C 4 alkyl. In other embodiments, R 1B of formula (X) is linear unsubstituted saturated C 1 -C 3 alkyl.
- R 1B of formula (X) is branched unsubstituted saturated C 1 -C 3 alkyl. In other embodiments, R 1B of formula (X) is linear unsubstituted saturated ethyl. In other embodiments, R 1B of formula (X) is branched unsubstituted saturated ethyl.
- n is an integer from 1 to 30. In one embodiment, n is an integer from 1 to 25. In one embodiment, n is an integer from 1 to 20. In one embodiment, n is an integer from 1 to 15. In one embodiment, n is an integer from 1 to 10. In one embodiment, n is an integer from 1 to 5. In some embodiment, n is 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, or 30. In one embodiment, n is 3. In other embodiments, n is 5. In one embodiment, n is 6. In one embodiment, n is 16.
- R 1B is hydrogen.
- n is as defined in an embodiment above (e.g. n is at least 1, or at least 15, e.g. 5 to 20).
- R 1B is hydrogen and n is 16.
- R 1B is methyl.
- n is as defined in an embodiment above (e.g. n is at least 1, or at least 10, e.g. 5 to 20). Thus, in some embodiments, R 1B is methyl and n is 16.
- the co-solvent has the formula:
- R 1B is defined as above (e.g. unsubstituted C 1 -C 6 alkyl), R 2B is methyl or ethyl, o is an integer from 0 to 10 and p is an integer from 1 to 20. In some embodiments, R 2B is methyl. In other embodiments, R 2B is ethyl. In formula (XA) R 2B can appear more than once and can be optionally different. For example, in some embodiments where o is 3, R 2B appears three times and can be optionally different. In other embodiments, where o is 6, R 2B appears 6 times and can be optionally different.
- o is 0 to 10. In some related embodiments, o is 0 to 8. In some related embodiments, o is 0 to 6. In some related embodiments, o is 0 to 4. In some related embodiments, o is 0 to 2. In still further related embodiments, o is 0. In some further related embodiment, p is 1 to 20. In some further related embodiment, p is 1 to 18. In some further related embodiment, p is 1 to 16. In some further related embodiment, p is 1 to 14. In some further related embodiment, p is 1 to 12. In some further related embodiment, p is 1 to 10. In some further related embodiment, p is 1 to 8. In some further related embodiment, p is 1 to 6. In some further related embodiment, p is 1 to 4.
- R 1 and R 2 may be any of the embodiments described above (e.g. R 1B maybe linear unsubstituted C 1 -C 6 alkyl, R 2B maybe linear unsubstituted C 1 -C 2 alkyl). Thus, in some embodiment, R 1B is hydrogen, o is 0 and p is 16.
- o is 1 to 10. In some related embodiments, o is 1 to 8. In some related embodiments, o is 1 to 6. In some related embodiments, o is 1 to 4. In some related embodiments, o is 1 to 2. In some further related embodiment, p is 1 to 20. In some further related embodiment, p is 1 to 18. In some further related embodiment, p is 1 to 16. In some further related embodiment, p is 1 to 14. In some further related embodiment, p is 1 to 12. In some further related embodiment, p is 1 to 10. In some further related embodiment, p is 1 to 8. In some further related embodiment, p is 1 to 6. In some further related embodiment, p is 1 to 4. In some further related embodiment, p is 1 to 2.
- R 1B and R 2B may be any of the embodiments described above (e.g. R 1B maybe linear unsubstituted C 1 -C 6 alkyl, R 2B maybe linear unsubstituted C 1 -C 2 alkyl).
- o is 2 to 10. In some related embodiments, o is 2 to 8. In some related embodiments, o is 2 to 6. In some related embodiments, o is 2 to 4. In some further related embodiment, p is 1 to 20. In some further related embodiment, p is 1 to 18. In some further related embodiment, p is 1 to 16. In some further related embodiment, p is 1 to 14. In some further related embodiment, p is 1 to 12. In some further related embodiment, p is 1 to 10. In some further related embodiment, p is 1 to 8. In some further related embodiment, p is 1 to 6. In some further related embodiment, p is 1 to 4. In some further related embodiment, p is 1 to 2. In still some further related embodiment, p is more than 1. R 1B and R 2B may be any of the embodiments described above (e.g. R 1B maybe linear unsubstituted C 1 -C 6 alkyl, R 2B maybe linear unsubstituted C 1 -C 2 alkyl).
- o is 4 to 10. In some related embodiments, o is 4 to 8. In some related embodiments, o is 4 to 6. In some further related embodiment, p is 1 to 20. In some further related embodiment, p is 1 to 18. In some further related embodiment, p is 1 to 16. In some further related embodiment, p is 1 to 14. In some further related embodiment, p is 1 to 12. In some further related embodiment, p is 1 to 10. In some further related embodiment, p is 1 to 8. In some further related embodiment, p is 1 to 6. In some further related embodiment, p is 1 to 4. In some further related embodiment, p is 1 to 2. In still some further related embodiment, p is more than 1.
- R 1B and R 2B may be any of the embodiments described above (e.g. R 1B maybe linear unsubstituted C 1 -C 6 alkyl, R 2B maybe linear unsubstituted C 1 -C 2 alkyl).
- o is 6 to 10. In some related embodiments, o is 6 to 8. In some further related embodiment, p is 1 to 20. In some further related embodiment, p is 1 to 18. In some further related embodiment, p is 1 to 16. In some further related embodiment, p is 1 to 14. In some further related embodiment, p is 1 to 12. In some further related embodiment, p is 1 to 10. In some further related embodiment, p is 1 to 8. In some further related embodiment, p is 1 to 6. In some further related embodiment, p is 1 to 4. In some further related embodiment, p is 1 to 2. In still some further related embodiment, p is more than 1.
- R 1B and R 2B may be any of the embodiments described above (e.g. R 1B maybe linear unsubstituted C 1 -C 6 alkyl, R 2B maybe linear unsubstituted C 1 -C 2 alkyl).
- o is 8 to 10.
- p is 1 to 20. In some further related embodiment, p is 1 to 18. In some further related embodiment, p is 1 to 16. In some further related embodiment, p is 1 to 14. In some further related embodiment, p is 1 to 12. In some further related embodiment, p is 1 to 10. In some further related embodiment, p is 1 to 8. In some further related embodiment, p is 1 to 6. In some further related embodiment, p is 1 to 4. In some further related embodiment, p is 1 to 2. In still some further related embodiment, p is more than 1.
- R 1B and R 2B may be any of the embodiments described above (e.g. R 1B maybe linear unsubstituted C 1 -C 6 alkyl, R 2B maybe linear unsubstituted C 1 -C 2 alkyl).
- R 2B may be independently hydrogen or unsubstituted C 1 -C 2 alkyl.
- R 2B is hydrogen or unsubstituted C 1 or C 2 alkyl.
- R 2B is hydrogen or branched unsubstituted C 1 or C 2 saturated alkyl.
- R 2B is hydrogen or a branched unsubstituted C 1 saturated alkyl.
- R 2B is independently hydrogen or methyl.
- R 2B is independently hydrogen or ethyl.
- R 2B is independently hydrogen, methyl or ethyl.
- R 2B is hydrogen.
- R 2B is methyl. In some embodiments, R 2B is ethyl. In formula (X) R 2B can appear more than once and can be optionally different. For example, in some embodiments where n is 3, R 2B appears three times and can be optionally different. In other embodiments, where n is 6, R 2B appears six times and can be optionally different.
- R 2B substituents with the fewest number of carbons are present to the side of the compound of formula (X) or (XA) bound to the —OH group.
- the compound of formula (X) or (XA) will be increasingly hydrophilic in progressing from the R 1B substituent to the side of the compound of formula (X) or (XA) bound to the —OH group.
- side of the compound of formula (X) or (XA) bound to the —OH group refers to the side of the compound indicated by asterisks in the below structures:
- R 2B is hydrogen.
- n is as defined in an embodiment above (e.g. n is at least 1, or at least 20, e.g. 5 to 15).
- R 2B is hydrogen and n is 16.
- R 2B is methyl.
- n is as defined in an embodiment above (e.g. n is at least 1, or at least 20, e.g. 5 to 15).
- R 2B is methyl and n is 16.
- the aqueous composition includes a gas.
- the gas may be combined with the aqueous composition to reduce its mobility by decreasing the liquid flow in the pores of the solid material (e.g. rock).
- the gas may be supercritical carbon dioxide, nitrogen, natural gas or mixtures of these and other gases.
- the aqueous composition may include the compound of formula (I), (II), or (III) and a co-surfactant.
- the aqueous composition includes the compound of formula (I), (II), or (III) and at least one co-surfactant (i.e. more than one).
- the aqueous composition includes the compound of formula (I), (II), or (III) and a first co-surfactant and a second co-surfactant.
- the compound is a betaine surfactant (i.e. a compound as described herein for example in formula (I), (II), and (III) or Example 2), wherein R 1 is branched unsubstituted C 32 heteroalkyl, o is 35, p is 15, L 1 has the formula
- L 2 and L 4 are ethylene, L 3 is methylene, R 2 and R 4 are —OH, R 3 is —C(O)OH (or C(O)O—), the first co-surfactant is C 15 -C 18 IOS and the second co-surfactant is C28-45PO-60EO (as described in WO/2012/027757).
- the compound is a quaternary ammonium surfactant (i.e. a compound as described herein for example in formula (I), (II), and (III) or Example 1), wherein R 1 is branched unsubstituted C 32 heteroalkyl, o is 35, p is 15, L 1 has the formula
- the compound is present at about 0.2% w/w. In one embodiment, the first co-surfactant is present at about 0.4% w/w. In some further embodiment, the second-co-surfactant is present at about 0.4% w/w.
- the aqueous composition has a pH of less than about 13.0. In other embodiments, the aqueous composition has a pH of less than about 12. In other embodiments, the aqueous composition has a pH of less than about 11. In other embodiments, the aqueous composition has a pH of less than about 10. In other embodiments, the aqueous composition has a pH of less than about 9.0. In other embodiments, the aqueous composition has a pH of less than about 8.0. In other embodiments, the aqueous composition has a pH of less than about 7.0.
- the aqueous composition has a salinity of at least 10,000 ppm. In other embodiments, the aqueous composition has a salinity of at least 50,000 ppm. In other embodiments, the aqueous composition has a salinity of at least 100,000 ppm.
- the total range of salinity (total dissolved solids in the brine) is 100 ppm to saturated brine (about 260,000 ppm).
- the aqueous composition may include seawater, brine or fresh water from an aquifer, river or lake.
- the aqueous combination may further include salt to increase the salinity. In some embodiments, the salt is NaCl, KCl, CaCl 2 , MgCl 2 , CaSO 4 or Na 2 CO 3 .
- the temperature of the aqueous composition is at least 40° C. In other embodiments, the temperature of the aqueous composition is at least 100° C. In some embodiments, the aqueous composition has a viscosity of between 20 mPa ⁇ s and 100 mPa ⁇ s. The viscosity of the aqueous solution may be increased from 0.3 mPa ⁇ s to 1, 2, 10, 20, 100 or even 1000 mPa ⁇ s by including a water-soluble polymer. As mentioned above, the apparent viscosity of the aqueous composition may be increased with a gas (e.g. a foam forming gas) as an alternative to the water-soluble polymer.
- a gas e.g. a foam forming gas
- an emulsion composition including an unrefined petroleum phase a compound as described herein (e.g. a compound of formula (I), (II), or (III)).
- the emulsion composition includes the components set forth in the aqueous composition provided above.
- the emulsion composition further includes a co-surfactant (e.g. wherein the compound and the co-surfactant are present in synergistic surface active amount, a surfactant stabilizing amount, and/or a synergistic solubilizing amount).
- the emulsion composition includes a co-surfactant and a co-solvent.
- the emulsion composition may include a combination of one or more co-surfactants and one or more co-solvents.
- the viscosity of the emulsion composition is less than the viscosity in the absence of the compound.
- the viscosity of the emulsion composition is less than 3 times the viscosity of an unrefined petroleum (e.g. the unrefined petroleum which makes up the unrefined petroleum phase of the emulsion composition).
- the viscosity of the emulsion composition is less than 30 mPa s.
- the viscosity of the emulsion composition is less than 200 mPa s.
- the interfacial tension of the emulsion composition is less than the interfacial tension in the absence of the compound.
- the emulsion composition is a microemulsion.
- a “microemulsion” as referred to herein is a thermodynamically stable mixture of oil, water and surfactants that may also include additional components such as co-solvents, electrolytes, alkali and polymers.
- a “macroemulsion” as referred to herein is a thermodynamically unstable mixture of oil and water that may also include additional components.
- the emulsion composition provided herein may be an oil-in-water emulsion, wherein the surfactant forms aggregates (e.g.
- the surfactant forms part of the aqueous part of the emulsion.
- the surfactant forms part of the oil phase of the emulsion.
- the surfactant forms part of an interface between the aqueous phase and the oil phase of the emulsion.
- the oil and water solubilization ratios are insensitive to the combined concentration of divalent metal cations (e.g. Ca +2 and Mg +2 ) within the aqueous phase. In other embodiments, the oil and water solubilization ratios are insensitive to the salinity of the water or to all of the specific electrolytes contained in the water.
- the term “insensitive” used in the context of this paragraph means that the solubilization ratio tends not to change (e.g. tends to remain constant) as the concentration of divalent metal cations and/or salinity of water changes.
- the change in the solubilization ratios are less than 5%, 10%, 20%, 30%, 40%, or 50% over a divalent metal cation concentration range of 10 ppm, 100 ppm, 1000 ppm or 10,000 ppm. In another embodiment, the change in the solubilization ratios are less than 5%, 10%, 20%, 30%, 40%, or 50% over a salinity concentration range of 10 ppm, 100 ppm, 1000 ppm or 10,000 ppm.
- a method of displacing a hydrocarbon material in contact with a solid material includes contacting a hydrocarbon material with the compound described herein (e.g. a compound of formula (I), (II), or (III)), wherein the hydrocarbon material is in contact with a solid material.
- the hydrocarbon material is allowed to separate from the solid material thereby displacing the hydrocarbon material in contact with the solid material.
- the hydrocarbon material is allowed to separate from the solid material thereby displacing the hydrocarbon material in contact with the solid material.
- the solid material is contacted with the compound.
- a “hydrocarbon material,” as provided herein, is a hydrophobic material containing alkyl chains.
- the compound may be present in an aqueous composition or an emulsion composition as described above.
- the hydrocarbon material is unrefined petroleum (e.g. in a petroleum reservoir).
- the solid material may be a natural solid material (i.e. a solid found in nature such as rock).
- the natural solid material may be found in a petroleum reservoir.
- the method is an enhanced oil recovery method.
- Enhanced oil recovery methods are well known in the art. A general treatise on enhanced oil recovery methods is Basic Concepts in Enhanced Oil Recovery Processes edited by M. Baviere (published for SCI by Elsevier Applied Science, London and New York, 1991).
- the displacing of the unrefined petroleum in contact with the solid material is accomplished by contacting the unrefined with a compound provided herein (e.g.
- the unrefined petroleum may be in an oil reservoir.
- the compound provided herein e.g. a compound of formula (I), (II), or (III)
- the compound is pumped into the reservoir in accordance with known enhanced oil recovery parameters.
- the compound may be pumped into the reservoir as part of the aqueous compositions provided herein and, upon contacting the unrefined petroleum, form an emulsion composition provided herein.
- the compound is present in an in amount sufficient to increase the water wettability of the solid material relative to the absence of the compound.
- water wettability refers to the ability of a surface of being spreadable with water.
- the natural solid material is rock or regolith.
- the natural solid material may be a geological formation such as clastics or carbonates.
- the natural solid material may be either consolidated or unconsolidated material or mixtures thereof.
- the hydrocarbon material may be trapped or confined by “bedrock” above or below the natural solid material.
- the hydrocarbon material may be found in fractured bedrock or porous natural solid material.
- the regolith is soil.
- the compound forms part of an aqueous composition comprising one or more co-surfactants and the hydrocarbon material is an unrefined petroleum material.
- an emulsion forms after the contacting.
- the emulsion thus formed may be the emulsion composition as described above.
- the method includes allowing an unrefined petroleum acid within the unrefined petroleum material to enter into the emulsion (e.g. emulsion composition), thereby converting the unrefined petroleum acid into a surfactant.
- the unrefined petroleum acid converts into a surfactant it is mobilized and therefore separates from the solid material.
- a method of converting an unrefined petroleum acid into a surfactant includes contacting a petroleum material with an aqueous composition thereby forming an emulsion in contact with the petroleum material, wherein the aqueous composition includes the compound described herein (e.g. a compound of formula (I), (II), or (III)) and a co-surfactant.
- the aqueous composition may further include a co-surfactant.
- the aqueous composition is the aqueous composition described above.
- the emulsion is the emulsion composition described above.
- An unrefined petroleum acid within said unrefined petroleum material is allowed to enter into the emulsion, thereby converting the unrefined petroleum acid into a surfactant.
- the reactive petroleum material is in a petroleum reservoir.
- the unrefined petroleum acid is a naphthenic acid.
- the unrefined petroleum acid is a mixture of naphthenic acid.
- Oil #1 used for examples disclosed in Figures 1 to 6.
- R 1 is R 12 -substituted or unsubstituted C 8 -C 150 alkyl, R 6 -substituted or unsubstituted heteroalkyl, R 6 -substituted or unsubstituted aryl or R 6 -substituted or unsubstituted cycloalkyl;
- R 6 is R 7 -substituted or unsubstituted C 1 -C 50 alkyl, R 7 -substituted or unsubstituted heteroalkyl, R 7 -substituted or unsubstituted aryl or R 7 -substituted or unsubstituted cycloalkyl;
- R 7 is R 8 -substituted or unsubstituted C 1 -C 50 alkyl, R 8 -substituted or unsubstituted heteroalkyl, R 8 -substituted or unsubstit
- R 1 is branched or linear unsubstituted C 10 -C 100 alkyl, R 6 -substituted or unsubstituted C 10 -C 100 heteroalkyl, or R 6 -substituted phenyl.
- R 1 is branched unsubstituted C 10 -C 50 alkyl, branched unsubstituted C 10 -C 50 heteroalkyl, (C 6 H 5 —CH 2 CH 2 ) 3 C 6 H 2 —, (C 6 H 5 —CH 2 CH 2 ) 2 C 6 H 3 —, (C 6 H 5 —CH 2 CH 2 ) 1 C 6 H 4 —, or R 6 -substituted or unsubstituted naphthyl.
- R 5 is independently hydrogen or unsubstituted C 1 -C 2 alkyl.
- An aqueous composition comprising a co-surfactant and the compound of one of embodiments 1 to 22.
- aqueous composition of embodiments 23 or 24, wherein said co-surfactant is an internal olefin sulfonate (IOS), an alfa olefin sulfonate (AOS), an alkyl aryl sulfonate (ARS), an alkane sulfonate, a petroleum sulfonate, an alkyl diphenyl oxide (di)sulfonate, an alcohol sulfate, an alkoxy sulfate, an alkoxy sulfonate, an alcohol phosphate, an alkoxy phosphate, a sulfosuccinate ester, an alcohol ethoxylate, an alkyl phenol ethoxylate, a betaine or sultaine.
- IOS internal olefin sulfonate
- AOS alfa olefin sulfonate
- ARS alkyl aryl sulfonate
- IOS internal olefin sulfate
- aqueous composition of any one of embodiments 23-26 further comprising a co-solvent.
- aqueous composition of any one of embodiments 23-27, further comprising an alkali agent further comprising an alkali agent.
- composition of any one of embodiments 23-28, wherein said alkali agent is NaOH, KOH, LiOH, Na 2 CO 3 , NaHCO 3 , Na-metaborate, Na silicate, Na orthosilicate, or NH 4 OH.
- aqueous composition of any one of embodiments 23-29 further comprising a gas.
- aqueous composition of any one of embodiments 23-30, wherein the temperature of said aqueous composition is approximately about 100° C.
- aqueous composition of any one of embodiments 23-31 having a salinity of at least 10,000 ppm.
- aqueous composition of any one of embodiments 23-32 having a salinity of at least 50,000 ppm.
- aqueous composition of any one of embodiments 23-33 having a salinity of at least 100,000 ppm.
- An emulsion composition comprising an unrefined petroleum phase and the compound of one of embodiments 1 to 22.
- the emulsion composition of embodiment 36 further comprising a co-surfactant.
- emulsion composition of any one of embodiments 36-39, wherein the emulsion composition is a microemulsion.
- a method of displacing a hydrocarbon material in contact with a solid material comprising:
- a method of converting an unrefined petroleum acid into a surfactant comprising:
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Geology (AREA)
- Mining & Mineral Resources (AREA)
- Physics & Mathematics (AREA)
- Environmental & Geological Engineering (AREA)
- Fluid Mechanics (AREA)
- Geochemistry & Mineralogy (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Abstract
Provided herein, inter alia, are novel compositions and methods having application in the field of enhanced oil recovery. In particular, the quaternary ammonium compounds and mixtures thereof presented herein can be used, inter alia, for the recovery of a large range of crude oil compositions from challenging reservoirs.
Description
- This application claims the benefit of U.S. Provisional Application No. 61/635,796 filed Apr. 19, 2012, which is hereby incorporated in its entirety and for all purposes.
- Enhanced Oil Recovery (abbreviated EOR) refers to techniques for increasing the amount of unrefined petroleum, or crude oil that may be extracted from an oil reservoir (e.g. an oil field). Using EOR, 40-60% of the reservoir's original oil can typically be extracted compared with only 20-40% using primary and secondary recovery (e.g. by water injection or natural gas injection). Enhanced oil recovery may also be referred to as improved oil recovery or tertiary recovery (as opposed to primary and secondary recovery).
- Enhanced oil recovery may be achieved by a variety of methods including miscible gas injection (which includes carbon dioxide flooding), chemical injection (which includes polymer flooding, alkaline flooding and surfactant flooding), microbial injection, or thermal recovery (which includes cyclic steam, steam flooding, and fire flooding). The injection of various chemicals, usually as dilute aqueous solutions, has been used to improve oil recovery. Injection of alkaline or caustic solutions into reservoirs with oil that has organic acids naturally occurring in the oil will result in the production of soap that may lower the interfacial tension enough to increase production. Injection of a dilute solution of a water soluble polymer to increase the viscosity of the injected water can increase the amount of oil recovered in some formations.
- Dilute solutions of surfactants such as petroleum sulfonates may be injected to lower the interfacial tension or capillary pressure that impedes oil droplets from moving through a reservoir. Special formulations of oil, water and surfactant microemulsions have also proven useful. Application of these methods is usually limited by the cost of the chemicals and their adsorption and loss onto the rock of the oil containing formation.
- Some unrefined petroleum contains carboxylic acids having, for example, C11 to C20 alkyl chains, including napthenic acid mixtures. The recovery of such “reactive” oils may be performed using alkali (e.g. NaOH or Na2CO3) in a surfactant composition. The alkali reacts with the acid in the reactive oil to form soap. These soaps serve as an additional source of surfactants enabling the use of much lower level of surfactants initially added to affect enhanced oil recovery (EOR). However, when the available water supply is hard, the added alkali causes precipitation of cations, such as Ca+2 or Mg+2. In order to prevent such precipitation an expensive chelant such as EDTA may be required in the surfactant composition. Alternatively, expensive water softening processes may be used.
- The quaternary ammonium surfactant compositions provided herein address these and other needs in the art. Embodiments of the quaternary ammonium compounds represent a cost effective alternative to commonly used EOR surfactants (e.g. surfactants derived from Guerbet alcohols). The compounds described herein may improve the water wettability of the surface material in a well therefore increasing the efficiency of oil production. The compounds provided herein may further have a stabilizing effect on the foam and therefore the foam level. For instance, in the presence of a compound disclosed herein the stability of foam pumped into the well during the process of oil recovery may be increased when compared to the absence of the compound. In some embodiments, the compounds provided herein may decrease the water drainage from the surface of the bubble. In some embodiments, the level of foam pumped into the well may increase in the presence of the compound provided herein. In some embodiments, the compounds described herein may improve the effectiveness of co-surfactants (e.g. alkoxy carboxylates, alkoxy sulfates, sulfonate compounds such as ABS or IOS) to a surprising degree. In some embodiments, where the sulfonate compounds are combined with the compounds provided herein, the combination may be more stable and effective when compared to the stability and effectiveness of the sulfonate compounds in the absence of the compounds provided herein.
- In a first aspect, a compound having the formula
- is provided.
- In formula (I) R1 is R12-substituted or unsubstituted C8-C150 alkyl, R6-substituted or unsubstituted heteroalkyl, R6-substituted or unsubstituted aryl or R6-substituted or unsubstituted cycloalkyl. R6 is R7-substituted or unsubstituted C1-C50 alkyl, R7-substituted or unsubstituted heteroalkyl, R7-substituted or unsubstituted aryl or R7-substituted or unsubstituted cycloalkyl. R7 is R8-substituted or unsubstituted C1-C50 alkyl, R8-substituted or unsubstituted heteroalkyl, R8-substituted or unsubstituted aryl or R8-substituted or unsubstituted cycloalkyl. R8 is R9-substituted or unsubstituted C1-C50 alkyl, R9-substituted or unsubstituted heteroalkyl, R9-substituted or unsubstituted aryl or R9-substituted or unsubstituted cycloalkyl. R9 is R10-substituted or unsubstituted C1-C50 alkyl, R10-substituted or unsubstituted heteroalkyl, R10-substituted or unsubstituted heteroalkyl, R10-substituted or unsubstituted aryl or R10-substituted or unsubstituted cycloalkyl. R10 is R11-substituted or unsubstituted C1-C50 alkyl, R11-substituted or unsubstituted heteroalkyl, R11-substituted or unsubstituted aryl or R11-substituted or unsubstituted cycloalkyl. R11 is unsubstituted C1-C50 alkyl, unsubstituted heteroalkyl, unsubstituted aryl or unsubstituted cycloalkyl. R12 is unsubstituted heteroalkyl, unsubstituted aryl, unsubstitued heteroaryl, unsubstitued heterocycloalkyl or unsubstituted cycloalkyl. R2, R3, and R4 are independently unsubstituted alkyl, unsubstituted cycloalkyl, unsubstituted aryl, —O, —C(O)OR13, or —S(O)mR13. R13 is hydrogen, unsubstituted alkyl or unsubstituted cycloalkyl. m is 3 or 4. R5 is independently hydrogen or unsubstituted C1-C6 alkyl. L1, L2, L3, and L4 are independently a bond, substituted or unsubstituted alkylene, substituted or unsubstituted heteroalkylene, substituted or unsubstituted cycloalkylene, or substituted or unsubstituted arylene, and n is an integer from 10 to 210.
-
FIG. 1 . Solubilization ratios using the surfactant formulation 0.4% C28-45PO-60EO Carboxylate, 0.4% C15-18 IOS, 0.2% Quaternary Ammonium Surfactant with Oil #1 (10%) at 100° C. The black arrow in the histogram pointing from left to right indicates the aqueous stability at 50,000 ppm (TDS). -
FIG. 2 . Solubilization ratios using the surfactant formulation 0.4% C28-45PO-60EO Carboxylate, 0.4% C15-18 IOS, 0.2% Quaternary Ammonium Surfactant with Oil #1 (50%) at 100° C. The black arrow in the histogram pointing from left to right indicates the aqueous stability at 50,000 ppm (TDS). -
FIG. 3 . Activity map foractive Oil # 1 using formulation 0.4% C28-45PO-60EO Carboxylate, 0.4% C15-18 IOS, 0.2% Quaternary Ammonium Surfactant withOil # 1 at 100° C. -
FIG. 4 . Solubilization ratios using the surfactant formulation 0.4% C28-45PO-60EO Carboxylate, 0.4% C15-18 IOS, 0.2% Betaine Surfactant with Oil #1 (10%) at 100° C. The black arrow in the histogram pointing from left to right indicates the aqueous stability at 66,000 ppm (TDS). -
FIG. 5 . Solubilization ratios using the surfactant formulation 0.4% C28-45PO-60EO Carboxylate, 0.4% C15-18 IOS, 0.2% Betaine Surfactant with Oil #1 (50%) at 100° C. The black arrow in the histogram pointing from left to right indicates the aqueous stability at 66,000 ppm (TDS). -
FIG. 6 . Activity map foractive Oil # 1 using formulation 0.4% C28-45PO-60EO Carboxylate, 0.4% C15-18 IOS, 0.2% Betaine Surfactant withOil # 1 at 100° C. - The abbreviations used herein have their conventional meaning within the chemical and biological arts.
- Where substituent groups are specified by their conventional chemical formulae, written from left to right, they equally encompass the chemically identical substituents that would result from writing the structure from right to left, e.g., —CH2O— is equivalent to —OCH2—.
- The term “alkyl,” by itself or as part of another substituent, means, unless otherwise stated, a straight (i.e. unbranched) or branched chain which may be fully saturated, mono- or polyunsaturated and can include di- and multivalent radicals, having the number of carbon atoms designated (i.e. C1-C10 means one to ten carbons). Examples of saturated hydrocarbon radicals include, but are not limited to, groups such as methyl, ethyl, n-propyl, isopropyl, n-butyl, t-butyl, isobutyl, sec-butyl, homologs and isomers of, for example, n-pentyl, n-hexyl, n-heptyl, n-octyl, and the like. An unsaturated alkyl group is one having one or more double bonds or triple bonds. Examples of unsaturated alkyl groups include, but are not limited to, vinyl, 2-propenyl, crotyl, 2-isopentenyl, 2-(butadienyl), 2,4-pentadienyl, 3-(1,4-pentadienyl), ethynyl, 1- and 3-propynyl, 3-butynyl, and the higher homologs and isomers. Alkyl groups which are limited to hydrocarbon groups are termed “homoalkyl”. An alkoxy is an alkyl attached to the remainder of the molecule via an oxygen linker (—O—).
- The term “alkylene” by itself or as part of another substituent means a divalent radical derived from an alkyl, as exemplified, but not limited, by —CH2CH2CH2CH2—, and further includes those groups described below as “heteroalkylene.” Typically, an alkyl (or alkylene) group will have from 1 to 24 carbon atoms, with those groups having 10 or fewer carbon atoms being preferred in the present invention. A “lower alkyl” or “lower alkylene” is a shorter chain alkyl or alkylene group, generally having eight or fewer carbon atoms.
- The term “heteroalkyl,” by itself or in combination with another term, means, unless otherwise stated, a stable straight or branched chain or combinations thereof, consisting of at least one carbon atom and at least one heteroatom selected from the group consisting of O, N, P, Si and S, and wherein the nitrogen and sulfur atoms may optionally be oxidized. and the nitrogen heteroatom may optionally be quaternized. The heteroatom(s) O, N, P and S and Si may be placed at any interior position of the heteroalkyl group or at the position at which the alkyl group is attached to the remainder of the molecule. Examples include, but are not limited to, —CH2—CH2—O—CH3, —CH2—CH2—NH—CH3, —CH2—CH2—N(CH3)—CH3, —CH2—S—CH2—CH3, —CH2—CH2, —S(O)—CH3, —CH2—CH2—S(O)2—CH3, —CH═CH—O—CH3, —Si(CH3)3, —CH2—CH═N—OCH3, —CH═CH—N(CH3)—CH3, —O—CH3, —O—CH2, —CH3, and —CN. Up to two heteroatoms may be consecutive, such as, for example, —CH2—NH—OCH3. Similarly, the term “heteroalkylene” by itself or as part of another substituent means a divalent radical derived from heteroalkyl, as exemplified, but not limited by, —CH2—CH2—S—CH2—CH2— and —CH2—S—CH2—CH2—NH—CH2—. For heteroalkylene groups, heteroatoms can also occupy either or both of the chain termini (e.g., alkyleneoxy, alkylenedioxy, alkyleneamino, alkylenediamino, and the like). Still further, for alkylene and heteroalkylene linking groups, no orientation of the linking group is implied by the direction in which the formula of the linking group is written. For example, the formula —C(O)2R′— represents both —C(O)2R′— and —R′C(O)2—.
- The terms “cycloalkyl” and “heterocycloalkyl,” by themselves or in combination with other terms, represent, unless otherwise stated, cyclic versions of “alkyl” and “heteroalkyl”, respectively. Additionally, for heterocycloalkyl, a heteroatom can occupy the position at which the heterocycle is attached to the remainder of the molecule. Examples of cycloalkyl include, but are not limited to, cyclopropyl, cyclobutyl, cyclopentyl, cyclohexyl, 1-cyclohexenyl, 3-cyclohexenyl, cycloheptyl, and the like. Examples of heterocycloalkyl include, but are not limited to, 1-(1,2,5,6-tetrahydropyridyl), 1-piperidinyl, 2-piperidinyl, 3-piperidinyl, 4-morpholinyl, 3-morpholinyl, tetrahydrofuran-2-yl, tetrahydrofuran-3-yl, tetrahydrothien-2-yl, tetrahydrothien-3-yl, 1-piperazinyl, 2-piperazinyl, and the like. A “cycloalkylene” and a “heterocycloalkylene,” alone or as part of another substituent means a divalent radical derived from a cycloalkyl and heterocycloalkyl, respectively.
- The term “aryl” means, unless otherwise stated, a polyunsaturated, aromatic, hydrocarbon substituent which can be a single ring or multiple rings (preferably from 1 to 3 rings) which are fused together (i.e. a fused ring aryl) or linked covalently. A fused ring aryl refers to multiple rings fused together wherein at least one of the fused rings is an aryl ring. The term “heteroaryl” refers to aryl groups (or rings) that contain from one to four heteroatoms selected from N, O, and S, wherein the nitrogen and sulfur atoms are optionally oxidized, and the nitrogen atom(s) are optionally quaternized. Thus, the term “heteroaryl” includes fused ring heteroaryl groups (i.e. multiple rings fused together wherein at least one of the fused rings is a heteroaromatic ring). A 5,6-fused ring heteroarylene refers to two rings fused together, wherein one ring has 5 members and the other ring has 6 members, and wherein at least one ring is a heteroaryl ring. Likewise, a 6,6-fused ring heteroarylene refers to two rings fused together, wherein one ring has 6 members and the other ring has 6 members, and wherein at least one ring is a heteroaryl ring. And a 6,5-fused ring heteroarylene refers to two rings fused together, wherein one ring has 6 members and the other ring has 5 members, and wherein at least one ring is a heteroaryl ring. A heteroaryl group can be attached to the remainder of the molecule through a carbon or heteroatom. Non-limiting examples of aryl and heteroaryl groups include phenyl, 1-naphthyl, 2-naphthyl, 4-biphenyl, 1-pyrrolyl, 2-pyrrolyl, 3-pyrrolyl, 3-pyrazolyl, 2-imidazolyl, 4-imidazolyl, pyrazinyl, 2-oxazolyl, 4-oxazolyl, 2-phenyl-4-oxazolyl, 5-oxazolyl, 3-isoxazolyl, 4-isoxazolyl, 5-isoxazolyl, 2-thiazolyl, 4-thiazolyl, 5-thiazolyl, 2-furyl, 3-furyl, 2-thienyl, 3-thienyl, 2-pyridyl, 3-pyridyl, 4-pyridyl, 2-pyrimidyl, 4-pyrimidyl, 5-benzothiazolyl, purinyl, 2-benzimidazolyl, 5-indolyl, 1-isoquinolyl, 5-isoquinolyl, 2-quinoxalinyl, 5-quinoxalinyl, 3-quinolyl, and 6-quinolyl. Substituents for each of the above noted aryl and heteroaryl ring systems are selected from the group of acceptable substituents described below. An “arylene” and a “heteroarylene,” alone or as part of another substituent means a divalent radical derived from an aryl and heteroaryl, respectively.
- The term “oxo” as used herein means an oxygen that is double bonded to a carbon atom.
- Where a substituent of a compound provided herein is “R-substituted” (e.g. R7-substituted), it is meant that the substituent is substituted with one or more of the named R groups (e.g. R7) as appropriate. In some embodiments, the substituent is substituted with only one of the named R groups.
-
- Each R-group as provided in the formulae provided herein can appear more than once. Where an R-group appears more than once each R group can be optionally different.
- The term “contacting” as used herein, refers to materials or compounds being sufficiently close in proximity to react or interact. For example, in methods of contacting a hydrocarbon material bearing formation and/or a well bore, the term “contacting” includes placing an aqueous composition (e. g. chemical, surfactant or polymer) within a hydrocarbon material bearing formation using any suitable manner known in the art (e.g., pumping, injecting, pouring, releasing, displacing, spotting or circulating the chemical into a well, well bore or hydrocarbon bearing formation).
- The terms “unrefined petroleum” and “crude oil” are used interchangeably and in keeping with the plain ordinary usage of those terms. “Unrefined petroleum” and “crude oil” may be found in a variety of petroleum reservoirs (also referred to herein as a “reservoir,” “oil field deposit” “deposit” and the like) and in a variety of forms including oleaginous materials, oil shales (i.e. organic-rich fine-grained sedimentary rock), tar sands, light oil deposits, heavy oil deposits, and the like. “Crude oils” or “unrefined petroleums” generally refer to a mixture of naturally occurring hydrocarbons that may be refined into diesel, gasoline, heating oil, jet fuel, kerosene, and other products called fuels or petrochemicals. Crude oils or unrefined petroleums are named according to their contents and origins, and are classified according to their per unit weight (specific gravity). Heavier crudes generally yield more heat upon burning, but have lower gravity as defined by the American Petroleum Institute (API) and market price in comparison to light (or sweet) crude oils. Crude oil may also be characterized by its Equivalent Alkane Carbon Number (EACN).
- Crude oils vary widely in appearance and viscosity from field to field. They range in color, odor, and in the properties they contain. While all crude oils are mostly hydrocarbons, the differences in properties, especially the variation in molecular structure, determine whether a crude oil is more or less easy to produce, pipeline, and refine. The variations may even influence its suitability for certain products and the quality of those products. Crude oils are roughly classified into three groups, according to the nature of the hydrocarbons they contain. (i) Paraffin based crude oils contain higher molecular weight paraffins, which are solid at room temperature, but little or no asphaltic (bituminous) matter. They can produce high-grade lubricating oils. (ii) Asphaltene based crude oils contain large proportions of asphaltic matter, and little or no paraffin. Some are predominantly naphthenes and so yield lubricating oils that are sensitive to temperature changes than the paraffin-based crudes. (iii) Mixed based crude oils contain both paraffin and naphthenes, as well as aromatic hydrocarbons. Most crude oils fit this latter category.
- “Reactive” crude oil as referred to herein is crude oil containing natural organic acidic components (also referred to herein as unrefined petroleum acid) or their precursors such as esters or lactones. These reactive crude oils can generate soaps (carboxylates) when reacted with alkali. More terms used interchangeably for crude oil throughout this disclosure are hydrocarbon material or active petroleum material. An “oil bank” or “oil cut” as referred to herein, is the crude oil that does not contain the injected chemicals and is pushed by the injected fluid during an enhanced oil recovery process. A “nonactive oil,” as used herein, refers to an oil that is not substantially reactive or crude oil not containing significant amounts of natural organic acidic components or their precursors such as esters or lactones such that significant amounts of soaps are generated when reacted with alkali. A nonactive oil as referred to herein includes oils having an acid number of less than 0.5 mg KOH/g of oil.
- “Unrefined petroleum acids” as referred to herein are carboxylic acids contained in active petroleum material (reactive crude oil). The unrefined petroleum acids contain C11 to C20 alkyl chains, including napthenic acid mixtures. The recovery of such “reactive” oils may be performed using alkali (e.g. NaOH or Na2CO3) in a surfactant composition. The alkali reacts with the acid in the reactive oil to form soap in situ. These in situ generated soaps serve as a source of surfactants minimizing the levels of added surfactants, thus enabling efficient oil recovery from the reservoir.
- The term “polymer” refers to a molecule having a structure that essentially includes the multiple repetitions of units derived, actually or conceptually, from molecules of low relative molecular mass. In some embodiments, the polymer is an oligomer.
- The term “bonded” refers to having at least one of covalent bonding, hydrogen bonding, ionic bonding, Van Der Waals interactions, pi interactions, London forces or electrostatic interactions.
- The term “productivity” as applied to a petroleum or oil well refers to the capacity of a well to produce hydrocarbons (e.g. unrefined petroleum); that is, the ratio of the hydrocarbon flow rate to the pressure drop, where the pressure drop is the difference between the average reservoir pressure and the flowing bottom hole well pressure (i.e., flow per unit of driving force).
- The term “oil solubilization ratio” is defined as the volume of oil solubilized divided by the volume of surfactant in microemulsion. All the surfactant is presumed to be in the microemulsion phase. The oil solubilization ratio is applied for Winsor type I and type III behavior. The volume of oil solubilized is found by reading the change between initial aqueous level and excess oil (top) interface level. The oil solubilization ratio is calculated as follows:
-
- wherein
σo=oil solubilization ratio;
Vo=volume of oil solubilized;
Vs=volume of surfactant. - The term “water solubilization ratio” is defined as the volume of water solubilized divided by the volume of surfactant in microemulsion. All the surfactant is presumed to be in the microemulsion phase. The water solubilization ratio is applied for Winsor type III and type II behavior. The volume of water solubilized is found by reading the change between initial aqueous level and excess water (bottom) interface level. The water solubilization parameter is calculated as follows:
-
- wherein
σW=water solubilization ratio;
VW=volume of water solubilized. - The optimum solubilization ratio occurs where the oil and water solubilization ratios are equal. The coarse nature of phase behavior screening often does not include a data point at optimum, so the solubilization ratio curves are drawn for the oil and water solubilization ratio data and the intersection of these two curves is defined as the optimum. The following is true for the optimum solubilization ratio:
- σ*=optimum solubilization ratio.
- The term “solubility” or “solubilization” in general refers to the property of a solute, which can be a solid, liquid or gas, to dissolve in a solid, liquid or gaseous solvent thereby forming a homogenous solution of the solute in the solvent. Solubility occurs under dynamic equilibrium, which means that solubility results from the simultaneous and opposing processes of dissolution and phase joining (e.g. precipitation of solids). The solubility equilibrium occurs when the two processes proceed at a constant rate. The solubility of a given solute in a given solvent typically depends on temperature. For many solids dissolved in liquid water, the solubility increases with temperature. In liquid water at high temperatures, the solubility of ionic solutes tends to decrease due to the change of properties and structure of liquid water. In more particular, solubility and solubilization as referred to herein is the property of oil to dissolve in water and vice versa.
- “Viscosity” refers to a fluid's internal resistance to flow or being deformed by shear or tensile stress. In other words, viscosity may be defined as thickness or internal friction of a liquid. Thus, water is “thin”, having a lower viscosity, while oil is “thick”, having a higher viscosity. More generally, the less viscous a fluid is, the greater its ease of fluidity.
- The term “salinity” as used herein, refers to concentration of salt dissolved in a aqueous phases. Examples for such salts are without limitation, sodium chloride, magnesium and calcium sulfates, and bicarbonates. In more particular, the term salinity as it pertains to the present invention refers to the concentration of salts in brine and surfactant solutions.
- The term “aqueous solution or aqueous formulation” refers to a solution in which the solvent is water. The term “emulsion, emulsion solution or emulsion formulation” refers to a mixture of two or more liquids which are normally immiscible. A non-limiting example for an emulsion is a mixtures of oil and water.
- A “co-solvent” refers to a compound having the ability to increase the solubility of a solute (e.g. a surfactant as disclosed herein) in the presence of an unrefined petroleum acid. In some embodiments, the co-solvents provided herein have a hydrophobic portion (alkyl or aryl chain), a hydrophilic portion (e.g. an alcohol) and optionally an alkoxy portion. Co-solvents as provided herein include alcohols (e.g. C1-C6 alcohols, C1-C6 diols), alkoxy alcohols (e.g. C1-C6 alkoxy alcohols, C1-C6 alkoxy diols, and phenyl alkoxy alcohols), glycol ether, glycol and glycerol. The term “alcohol” is used according to its ordinary meaning and refers to an organic compound containing an —OH groups attached to a carbon atom. The term “diol” is used according to its ordinary meaning and refers to an organic compound containing two —OH groups attached to two different carbon atoms. The term “alkoxy alcohol” is used according to its ordinary meaning and refers to an organic compound containing an alkoxy linker attached to a —OH group
- A “microemulsion” as referred to herein is a thermodynamically stable mixture of oil, water, and a stabilizing agents such as a surfactant or a co-solvent that may also include additional components such as alkali agents, polymers (e.g. water-soluble polymers) and a salt. In contrast, a “macroemulsion” as referred to herein is a thermodynamically unstable mixture of oil and water that may also include additional components. An “emulsion” as referred to herein may be a microemulsion or a macroemulsion.
- While the making and using of various embodiments of the present invention are discussed in detail below, it should be appreciated that the present invention provides many applicable inventive concepts that can be embodied in a wide variety of specific contexts. The specific embodiments discussed herein are merely illustrative of specific ways to make and use the invention and do not limit the scope of the invention.
- Provided herein, inter alia, are large hydrophobe quaternary ammonium compounds and methods of using the same for a variety of applications including enhanced oil recovery. The compounds provided herein may be used with broad oil concentrations, at a wide range of salinities, at high reservoir temperatures and over a broad pH range. The quaternary ammonium compounds of the present invention represent a cost effective alternative to commonly used EOR surfactants (e.g. surfactants derived from Guerbet alcohols). The compounds described herein may improve the water wettability of the surface material in a well. The compounds provided herein may further have an effect on foam stability and foam level. For instance, in the presence of a compound disclosed herein the stability of foam pumped into the well during the process of oil recovery is increased when compared to the absence of the compound. Further, the level of foam pumped into the well may increase in the presence of the compound provided herein. The compounds described herein may also significantly improve the effectiveness of co-surfactants (e.g. sulfonate compounds such as ABS or IOS) to a surprising degree. Where sulfonate compounds are combined with the compounds provided herein, the combination may be more stable and effective when compared to the stability and effectiveness of the sulfonate compounds in the absence of the compounds provided herein (e.g. a compound of formula (I), (II), or (III)). Further, the compounds improve the water wettability of the solid material (e.g. rock, regolith) in contact with unrefined petroleum in a well.
- In a first aspect, a compound having the formula:
- is provided.
In formula (I) R1 is R12-substituted or unsubstituted C8-C150 alkyl, R6-substituted or unsubstituted heteroalkyl, R6-substituted or unsubstituted aryl or R6-substituted or unsubstituted cycloalkyl. R6 is R7-substituted or unsubstituted C1-C50 alkyl, R7-substituted or unsubstituted heteroalkyl, R7-substituted or unsubstituted aryl or R7-substituted or unsubstituted cycloalkyl. R7 is R8-substituted or unsubstituted C1-C50 alkyl, R8-substituted or unsubstituted heteroalkyl, R8-substituted or unsubstituted aryl or R8-substituted or unsubstituted cycloalkyl. R8 is R9-substituted or unsubstituted C1-C50 alkyl, R9-substituted or unsubstituted heteroalkyl, R9-substituted or unsubstituted aryl or R9-substituted or unsubstituted cycloalkyl. R9 is R10-substituted or unsubstituted C1-C50 alkyl, R10-substituted or unsubstituted heteroalkyl, R10-substituted or unsubstituted heteroalkyl, R10-substituted or unsubstituted aryl or R10-substituted or unsubstituted cycloalkyl. R10 is R11-substituted or unsubstituted C1-C50 alkyl, R11-substituted or unsubstituted heteroalkyl, R11-substituted or unsubstituted aryl or R11-substituted or unsubstituted cycloalkyl. R11 is unsubstituted C1-C50 alkyl, unsubstituted heteroalkyl, unsubstituted aryl or unsubstituted cycloalkyl. R12 is unsubstituted hetreroalkyl, unsubstituted aryl or unsubstituted cycloalkyl. R2, R3, and R4 are independently unsubstituted alkyl, unsubstituted cycloalkyl, unsubstituted aryl, —OR13, —C(O)OR13, or —S(O)mR13. R13 is hydrogen, unsubstituted alkyl or unsubstituted cycloalkyl. m is 3 or 4. R5 is independently hydrogen or unsubstituted C1-C6 alkyl. L1, L2, L3, and L4 are independently a bond, substituted or unsubstituted alkylene, substituted or unsubstituted heteroalkylene, substituted or unsubstituted cycloalkylene, substituted or unsubstituted hetercycloalkylene, substituted or unsubstituted heteroarylene or substituted or unsubstituted arylene, and n is an integer from 10 to 210. In formula (I) each of R5, R6, R7, R8, R9, R10, R11, R12 and R13, can appear more than once and can be optionally different. For example, in some embodiments where n is 4, R5 appears four times and can be optionally different. In other embodiments, where n is 6, R5 appears six times and can be optionally different. - In other embodiments, the symbol n is an integer from 10 to 210. In other embodiments, the symbol n is an integer from 15 to 210. In other embodiments, the symbol n is an integer from 20 to 210. In other embodiments, the symbol n is an integer from 25 to 210. In other embodiments, the symbol n is an integer from 30 to 210. In other embodiments, the symbol n is an integer from 35 to 210. In other embodiments, the symbol n is an integer from 40 to 210. In other embodiments, the symbol n is an integer from 45 to 210. In other embodiments, the symbol n is an integer from 50 to 210. In other embodiments, the symbol n is an integer from 55 to 210. In other embodiments, the symbol n is an integer from 60 to 210. In other embodiments, the symbol n is an integer from 65 to 210. In other embodiments, the symbol n is an integer from 70 to 210. In other embodiments, the symbol n is an integer from 10 to 100. In other embodiments, the symbol n is an integer from 20 to 100. In other embodiments, the symbol n is an integer from 25 to 100. In other embodiments, the symbol n is an integer from 30 to 100. In other embodiments, the symbol n is an integer from 35 to 100. In other embodiments, the symbol n is an integer from 40 to 100. In other embodiments, the symbol n is an integer from 45 to 100. In other embodiments, the symbol n is an integer from 50 to 100. In other embodiments, the symbol n is an integer from 55 to 100. In other embodiments, the symbol n is an integer from 60 to 100. In other embodiments, the symbol n is an integer from 65 to 100. In other embodiments, the symbol n is an integer from 70 to 100. In some embodiments, n is 45 to 110. In some further embodiments, n is 50 to 105. In some other further embodiments, n is 50. In some further other embodiments, n is 95. In some related embodiments, R1 is R12-substituted or unsubstituted C20-C150 alkyl. In other related embodiments, R1 is R12-substituted or unsubstituted C22-C150 alkyl. In other related embodiments, R1 is R12-substituted or unsubstituted C24-C150 alkyl. In other related embodiments, R1 is R12-substituted or unsubstituted C20-C50 alkyl. In other related embodiments, R1 is R12-substituted or unsubstituted C22-C50 alkyl. In other related embodiments, R1 is R12-substituted or unsubstituted C24-C50 alkyl.
- In some embodiments, R1 is branched unsubstituted C10-C50 alkyl, branched unsubstituted C10-C50 heteroalkyl, (C6H5—CH2CH2)3C6H2—, (C6H5—CH2CH2)2C6H3—, (C6H5—CH2CH2)1C6H4—, or R6-substituted or unsubstituted naphthyl. In some embodiments, the naphthyl is a mono-, di-, or tri-alkyl naphthyl or any combination thereof. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 105).
- R1 may be substituted or unsubstituted alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C10-C150 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C12-C50 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C14-C150 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C16-C150 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C18-C150 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C20-C150 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C22-C150 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C24-C150 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C10-C100 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C12-C100 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C14-C100 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C16-C100 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C18-C100 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C20-C100 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C22-C100 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C24-C100 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C10-C50 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C12-C50 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C14-C50 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C16-C50 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C18-C50 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C20-C50 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C22-C50 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C24-C50 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, R1 is R12-substituted or unsubstituted C10-C40 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C12-C40 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C14-C40 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C16-C40 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C18-C40 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C20-C40 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C22-C40 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C24-C40 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, R1 is R12-substituted or unsubstituted C10-C36 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C12-C36 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C14-C36 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C16-C36 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C18-C36 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C20-C36 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C22-C36 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C24-C36 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, R1 is R12-substituted or unsubstituted C10-C28 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C12-C28 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C14-C28 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C16-C28 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C18-C28 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C20-C28 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C22-C28 alkyl. In some embodiments, R1 is R12-substituted or unsubstituted C24-C28 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, R1 is branched unsubstituted C12-C100 alkyl. In other embodiments, R1 is linear unsubstituted C12-C100 alkyl. In some embodiments, R1 is branched unsubstituted C16-C100 alkyl. In other embodiments, R1 is linear unsubstituted C16-C100 alkyl. In some embodiments, R1 is branched unsubstituted C18-C100 alkyl. In other embodiments, R1 is linear unsubstituted C18-C100 alkyl. In some embodiments, R1 is branched unsubstituted C20-C100 alkyl. In other embodiments, R1 is linear unsubstituted C20-C100 alkyl. In some embodiments, R1 is branched unsubstituted C22-C100 alkyl. In other embodiments, R1 is linear unsubstituted C22-C100 alkyl. In some embodiments, R1 is branched unsubstituted C24-C100 alkyl. In other embodiments, R1 is linear unsubstituted C24-C100 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, R1 is branched unsubstituted C12-C50 alkyl. In other embodiments, R1 is linear unsubstituted C12-C50 alkyl. In some embodiments, R1 is branched unsubstituted C16-C50 alkyl. In other embodiments, R1 is linear unsubstituted C16-C50 alkyl. In some embodiments, R1 is branched unsubstituted C18-C50 alkyl. In other embodiments, R1 is linear unsubstituted C18-C50 alkyl. In some embodiments, R1 is branched unsubstituted C20-C50 alkyl. In other embodiments, R1 is linear unsubstituted C20-C50 alkyl. In some embodiments, R1 is branched unsubstituted C22-C50 alkyl. In other embodiments, R1 is linear unsubstituted C22-C50 alkyl. In some embodiments, R1 is branched unsubstituted C24-C50 alkyl. In other embodiments, R1 is linear unsubstituted C24-C50 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, R1 is branched unsubstituted C12-C40 alkyl. In other embodiments, R1 is linear unsubstituted C12-C40 alkyl. In some embodiments, R1 is branched unsubstituted C16-C40 alkyl. In other embodiments, R1 is linear unsubstituted C16-C40 alkyl. In some embodiments, R1 is branched unsubstituted C18-C40 alkyl. In other embodiments, R1 is linear unsubstituted C18-C40 alkyl. In some embodiments, R1 is branched unsubstituted C20-C40 alkyl. In other embodiments, R1 is linear unsubstituted C20-C40 alkyl. In some embodiments, R1 is branched unsubstituted C22-C40 alkyl. In other embodiments, R1 is linear unsubstituted C22-C40 alkyl. In some embodiments, R1 is branched unsubstituted C24-C40 alkyl. In other embodiments, R1 is linear unsubstituted C24-C40 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, R1 is branched unsubstituted C12-C36 alkyl. In other embodiments, R1 is linear unsubstituted C12-C36 alkyl. In some embodiments, R1 is branched unsubstituted C16-C36 alkyl. In other embodiments, R1 is linear unsubstituted C16-C36 alkyl. In some embodiments, R1 is branched unsubstituted C18-C36 alkyl. In other embodiments, R1 is linear unsubstituted C18-C36 alkyl. In some embodiments, R1 is branched unsubstituted C20-C36 alkyl. In other embodiments, R1 is linear unsubstituted C20-C36 alkyl. In some embodiments, R1 is branched unsubstituted C22-C36 alkyl. In other embodiments, R1 is linear unsubstituted C22-C36 alkyl. In some embodiments, R1 is branched unsubstituted C24-C36 alkyl. In other embodiments, R1 is linear unsubstituted C24-C36 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, R1 is branched unsubstituted C12-C28 alkyl. In other embodiments, R1 is linear unsubstituted C12-C28 alkyl. In some embodiments, R1 is branched unsubstituted C16-C28 alkyl. In other embodiments, R1 is linear unsubstituted C16-C28 alkyl. In some embodiments, R1 is branched unsubstituted C18-C28 alkyl. In other embodiments, R1 is linear unsubstituted C18-C28 alkyl. In some embodiments, R1 is branched unsubstituted C20-C28 alkyl. In other embodiments, R1 is linear unsubstituted C20-C28 alkyl. In some embodiments, R′ is branched unsubstituted C22-C28 alkyl. In other embodiments, R1 is linear unsubstituted C22-C28 alkyl. In some embodiments, R1 is branched unsubstituted C24-C28 alkyl. In other embodiments, R1 is linear unsubstituted C24-C28 alkyl. In some related embodiments, the alkyl is a saturated alkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, where R1 is a linear or branched unsubstituted alkyl (e.g. branched unsubstituted C12-C100 alkyl), the alkyl is a saturated alkyl (e.g. a linear or branched unsubstituted saturated alkyl or branched unsubstituted C12-C100 saturated alkyl). A “saturated alkyl,” as used herein, refers to an alkyl consisting only of hydrogen and carbon atoms and are boded exclusively by single bonds. Thus, in some embodiments, R1 may be linear or branched unsubstituted saturated alkyl. In some embodiments, R1 is branched unsubstituted C12-C100 saturated alkyl. In other embodiments, R1 is linear unsubstituted C12-C100 saturated alkyl. In some embodiments, R1 is branched unsubstituted C16-C100 saturated alkyl. In other embodiments, R1 is linear unsubstituted C16-C100 saturated alkyl. In some embodiments, R1 is branched unsubstituted C24-C36 saturated alkyl. In other embodiments, R1 is linear unsubstituted C24-C36 saturated alkyl. In other embodiments, R1 is linear unsubstituted C24-C28 saturated alkyl.
- In other embodiments, R1 is branched unsubstituted C24-C28 saturated alkyl.
- In some embodiments, R1 is formed using the Guerbet reaction.
- In some embodiments, where R1 is a linear or branched unsubstituted alkyl (e.g. branched unsubstituted C10-C20 alkyl), the alkyl is an unsaturated alkyl (e.g. a linear or branched unsubstituted unsaturated alkyl or branched unsubstituted C10-C20 unsaturated alkyl). An “unsaturated alkyl,” as used herein, refers to an alkyl having one or more double bonds or triple bonds. An unsaturated alkyl as provided herein can be mono- or polyunsaturated and can include di- and multivalent radicals. Thus, in some embodiments, R1 may be linear or branched unsubstituted unsaturated alkyl. In some embodiments, R1 is branched unsubstituted C10-C20 unsaturated alkyl. In other embodiments, R1 is linear unsubstituted C10-C20 unsaturated alkyl. In some embodiments, R1 is branched unsubstituted C16-C20 unsaturated alkyl. In other embodiments, R1 is linear unsubstituted C16-C20 unsaturated alkyl. In some embodiments, R1 is branched unsubstituted C12-C18 unsaturated alkyl. In other embodiments, R1 is linear unsubstituted C12-C18 unsaturated alkyl. In some embodiments, R1 is linear unsubstituted Cis unsaturated alkyl. In other embodiments, R1 is branched unsubstituted C18 unsaturated alkyl. In one embodiment, R1 is linear unsubstituted Cis mono-unsaturated alkyl. In another embodiment, R1 is linear unsubstituted C18 poly-unsaturated alkyl. In one embodiment, R1 is branched unsubstituted C18 mono-unsaturated alkyl. In another embodiment, R1 is branched unsubstituted C18 poly-unsaturated alkyl.
- In some embodiments, R1 is branched unsubstituted C12-C100 heteroalkyl. In other embodiments, R1 is linear unsubstituted C12-C100 heteroalkyl. In some embodiments, R1 is branched unsubstituted C16-C100 heteroalkyl. In other embodiments, R1 is linear unsubstituted C16-C100 heteroalkyl. In some embodiments, R1 is branched unsubstituted C18-C100 heteroalkyl.
- In other embodiments, R1 is linear unsubstituted C18-C100 heteroalkyl. In some embodiments, R1 is branched unsubstituted C20-C100 heteroalkyl. In other embodiments, R1 is linear unsubstituted C20-C100 heteroalkyl. In some embodiments, R1 is branched unsubstituted C22-C100 heteroalkyl.
- In other embodiments, R1 is linear unsubstituted C22-C100 heteroalkyl. In some embodiments, R1 is branched unsubstituted C24-C100 heteroalkyl. In other embodiments, R1 is linear unsubstituted C24-C100 heteroalkyl. In some related embodiments, the heteroalkyl is a saturated heteroalkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, R1 is branched unsubstituted C12-C50 heteroalkyl. In other embodiments, R1 is linear unsubstituted C12-C50 heteroalkyl. In some embodiments, R1 is branched unsubstituted C16-C50 heteroalkyl. In other embodiments, R1 is linear unsubstituted C16-C50 heteroalkyl. In some embodiments, R1 is branched unsubstituted C18-C50 heteroalkyl. In other embodiments, R1 is linear unsubstituted C18-C50 heteroalkyl. In some embodiments, R1 is branched unsubstituted C20-C50 heteroalkyl. In other embodiments, R1 is linear unsubstituted C20-C50 heteroalkyl. In some embodiments, R1 is branched unsubstituted C22-C50 heteroalkyl. In other embodiments, R1 is linear unsubstituted C22-C50 heteroalkyl. In some embodiments, R1 is branched unsubstituted C24-C50 heteroalkyl. In other embodiments, R1 is linear unsubstituted C24-C50 heteroalkyl. In some related embodiments, the heteroalkyl is a saturated heteroalkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, R1 is branched unsubstituted C12-C40 heteroalkyl. In other embodiments, R1 is linear unsubstituted C12-C40 heteroalkyl. In some embodiments, R1 is branched unsubstituted C16-C40 heteroalkyl. In other embodiments, R1 is linear unsubstituted C16-C40 heteroalkyl. In some embodiments, R1 is branched unsubstituted C18-C40 heteroalkyl. In other embodiments, R1 is linear unsubstituted C18-C40 heteroalkyl. In some embodiments, R1 is branched unsubstituted C20-C40 heteroalkyl. In other embodiments, R1 is linear unsubstituted C20-C40 heteroalkyl. In some embodiments, R1 is branched unsubstituted C22-C40 heteroalkyl. In other embodiments, R1 is linear unsubstituted C22-C40 heteroalkyl. In some embodiments, R1 is branched unsubstituted C24-C40 heteroalkyl. In other embodiments, R1 is linear unsubstituted C24-C40 heteroalkyl. In some related embodiments, the heteroalkyl is a saturated heteroalkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, R1 is branched unsubstituted C12-C36 heteroalkyl. In other embodiments, R1 is linear unsubstituted C12-C36 heteroalkyl. In some embodiments, R1 is branched unsubstituted C16-C36 heteroalkyl. In other embodiments, R1 is linear unsubstituted C16-C36 heteroalkyl. In some embodiments, R1 is branched unsubstituted C18-C36 heteroalkyl. In other embodiments, R1 is linear unsubstituted C18-C36 heteroalkyl. In some embodiments, R1 is branched unsubstituted C20-C36 heteroalkyl. In other embodiments, R1 is linear unsubstituted C20-C36 heteroalkyl. In some embodiments, R1 is branched unsubstituted C22-C36 heteroalkyl. In other embodiments, R1 is linear unsubstituted C22-C36 heteroalkyl. In some embodiments, R1 is branched unsubstituted C24-C36 heteroalkyl. In other embodiments, R1 is linear unsubstituted C24-C36 heteroalkyl. In some related embodiments, the heteroalkyl is a saturated heteroalkyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 25; or at least 35, e.g. 35 to 100).
- In some embodiments, where R1 is a linear or branched unsubstituted heteroalkyl (e.g. branched unsubstituted C12-C100 heteroalkyl), the heteroalkyl is a saturated heteroalkyl (e.g. a linear or branched unsubstituted saturated heteroalkyl or branched unsubstituted C12-C100 saturated heteroalkyl). A “saturated heteroalkyl,” as used herein, refers to an heteroalkyl consisting only of hydrogen, carbon atoms and heteroatoms, which are bonded exclusively by single bonds. Thus, in some embodiments, R1 may be linear or branched unsubstituted saturated heteroalkyl. In some embodiments, R1 is branched unsubstituted C12-C100 saturated heteroalkyl.
- In other embodiments, R1 is linear unsubstituted C12-C100 saturated heteroalkyl. In some embodiments, R1 is branched unsubstituted C16-C100 saturated heteroalkyl. In other embodiments, R1 is linear unsubstituted C16-C100 saturated heteroalkyl. In some embodiments, R1 is branched unsubstituted C24-C36 saturated heteroalkyl. In other embodiments, R1 is linear unsubstituted C24-C36 saturated heteroalkyl.
- In some embodiments, R1 is R6-substituted phenyl. R6 may be R1-substituted or unsubstituted C1-C50 alkyl (e.g. C2-C6 alkyl). In some embodiments, R6 is R7-substituted methyl. R6 may be branched R7-substituted C1-C50 alkyl (e.g. branched C2-C6 alkyl). In some embodiments, R6 is branched R7-substituted propyl. In some embodiments, R7 is R8-substituted or unsubstituted alkyl (e.g. unsubstituted methyl), R8-substituted or unsubstituted aryl (e.g. substituted or unsubstituted phenyl), or R8-substituted or unsubstituted cycloalkyl. In some further embodiments, R7 is independently unsubstituted C1-C4 alkyl (e.g. methyl) or R8-substituted aryl (e.g. R8-substituted phenyl). In some further embodiments, R8 is R9-substituted or unsubstituted alkyl or R9-substituted or unsubstituted cycloalkyl. In some embodiments, R1 is having the formula:
- In some embodiments, a compound as described herein may include multiple instances of R1, R2, R3, R4, R5, R6, R7, R8, R9, R10, R11, R12, R13, R14, R15, R16, R17, R18, R19, R20, R21 and/or other variables. In such embodiments, each variable may optional be different and be appropriately labeled to distinguish each group for greater clarity. For example, where each R1, R2, R3, R4, R5, R6, R7, R8, R9, R10, R11, R12, R13, R14, R15, R16, R17, R18, R19, R20, and/or R21, is different, they may be referred to, for example, as R1.1, R1.2, R1.3, R1.4, R2.1, R2.2, R2.3, R2.4, R3.1, R3.2, R3.3, R4, R4.1, R4.2, R4.3, R4.4, R5.1, R5.2, R5.3, R5.4, R6.1, R6.2, R6.3, R6.4, R7.1, R7.2, R7.3, R7.4, R8.1, R8.2, R8.3, R8.4, R9.1, R9.2, R9.3, R9.4, R10.1, R10.2, R10.3, R10.4, R11.1, R11.2, R11.3, R11.4, R12.1, R12.2, R12.3, R12.4, R13.1, R13.2, R13.3, R13.4, R14.1, R14.2, R14.3, R14.4, R15.1, R15.2, R15.3, R15.4, R16.1, R16.2, R16.3, R16.4, R17.1, R17.2, R17.3, R17.4, R18.1, R18.2, R18.3, R18.4, R19.1, R19.2, R19.3, R19.4, R20.1, R20.2, R20.3, R20.4, R21.1, R21.2, R21.3, and/or R21.4, respectively, wherein the definition ofR1 is assumed by R1.1, R1.2, R1.3, and/or R1.4, the definition of R2 is assumed by R2.1, R2.2, R2.3, and/or R2.4, the definition of R3 is assumed by R3.1, R3.2, R3.3, and/or R3.4, the definition of R4 is assumed by R4.1, R4.2, R4.3, and/or R4.4, the definition of R5 is assumed by R5.1, R5.2, R5.3, and/or R5.4, the definition of R6 is assumed by R6.1, R6.2, R6.3, and/or R6.4, the definition of R7 is assumed by R7.1, R7.2, R7.3, and/or R7.4, the definition of R8 is assumed by R8.1, R8.2, R8.3, and/or R8.4, the definition of R9 is assumed by R9.1, R9.2, R9.3, and/or R9.4, the definition of R10 is assumed by R10.1, R10.2, R10.3, and/or R10.4, the definition of R11 is assumed by R11.1, R11.2, R11.3, and/or R11.4, the definition of R12 is assumed by R12.1, R12.2, R12.3, and/or R12.4, the definition of R13 is assumed by R13.1, R13.2, R13.3, and/or R13.4, the definition of R14 is assumed by R14.1, R14.2, R14.3, and/or R14.4, the definition of R15 is assumed by R15.1, R15.2, R15.3, and/or R15.4, the definition of R16 is assumed by R16.1, R16.2, R16.3, and/or R16.4, the definition of R17 is assumed by R17.1, R17.2, R17.3, and/or R17.4, the definition of R18 is assumed by R18.1, R18.2, R18.3, and/or R18.4, the definition of R19 is assumed by R19.1, R19.2, R19.3, and/or R19.4, the definition of R20 is assumed by R20.1, R20.2, R20.3, and/or R20.4, the definition of R21 is assumed by R21.1, R21.2, R21.3, and/or R21.4. The variables used within a definition of R1, R2, R3, R4, R6, R7, R8, R9, R10, R11, R12, R13, R14, R15, R16, R17, R18, R19, R20, and/or R21, and/or other variables that appear at multiple instances and are different may similarly be appropriately labeled to distinguish each group for greater clarity.
- In formula (IV), R7.1, R7.2, R7.3, R8.1, R8.2, and R8.3 are defined as R7 and R8 above. For example, in some embodiments, R7.1 is R8.1-substituted or unsubstituted C1-C50 alkyl, (e.g. a branched and/or saturated alkyl), R8.1-substituted or unsubstituted aryl, or R8.1-substituted or unsubstituted cycloalkyl. R7.2 may be R8.2-substituted or unsubstituted C1-C50 alkyl, (e.g. a branched and/or saturated alkyl), R8.2-substituted or unsubstituted aryl, or R8.2-substituted or unsubstituted cycloalkyl. R7.3 may be R8.3-substituted or unsubstituted C1-C50 alkyl, (e.g. a branched and/or saturated alkyl), R8.3-substituted or unsubstituted aryl, or R8.3-substituted or unsubstituted cycloalkyl. In some embodiments, R7.1, R7.2 and R7.3 are independently unsubstituted C1-C25 alkyl (e.g. a branched and/or saturated alkyl). In other embodiments, R7.1, R7.2 and R7.3 are independently branched unsubstituted C1-C25 saturated alkyl. In some embodiments, R8.1 is R9.1-substituted or unsubstituted C1-C50 alkyl, (e.g. a branched and/or saturated alkyl), R9.1-substituted or unsubstituted aryl, or R9.1-substituted or unsubstituted cycloalkyl. R8.2 may be R9.2-substituted or unsubstituted C1-C50 alkyl, (e.g. a branched and/or saturated alkyl), R9.2-substituted or unsubstituted aryl, or R9.2-substituted or unsubstituted cycloalkyl. R8.3 may be R9.3-substituted or unsubstituted C1-C50 alkyl, (e.g. a branched and/or saturated alkyl), R9.3-substituted or unsubstituted aryl, or R9.3-substituted or unsubstituted cycloalkyl. R9.1, R9.2 and R9.3 may be independently substituted or unsubstituted alkyl, substituted or unsubstituted heteroalkyl, substituted or unsubstituted aryl, or substituted or unsubstituted cycloalkyl. In some embodiments, R8.1, R8.2 and R8.3 are independently C1-C25 alkyl. In other embodiments, R8.1, R8.2 and R8.3 are independently branched unsubstituted C1-C25 saturated alkyl. The symbols a, b, and c are independently integers from 1 to 15. In some embodiments, a, b, and c are independently integers from 1 to 10. In some embodiments, a, b, and c are independently integers from 1 to 10. In some embodiments, a, b, and c are 1. Each R7.1, R7.2, R7.3, R8.1, R8.2 and R8.3 are optionally different.
- In formula (I), (II), or (III) R2, R3, and R4 may be the same or different and may each independently be unsubstituted alkyl, unsubstituted cycloalkyl, unsubstituted aryl, or —OR13, —C(O)OR3, or —S(O)mR13. In some embodiments, R2, R3, and R4 are the same or different and are each independently unsubstituted alkyl, unsubstituted cycloalkyl, unsubstituted aryl, or —OR13, —C(O)OR3, or —S(O)mR3. In some embodiments, R2, R3, and R4 are independently substituted or unsubstituted C1-C20 (e.g. C1-C6) alkyl, substituted or unsubstituted C3-C8 (e.g., C5-C7) cykloalkyl, or substituted or unsubstituted C5-C10 (e.g. C5-C6) aryl. R13 may independently be hydrogen, unsubstituted alkyl or unsubstituted cycloalkyl. In some embodiments, R2, R3, and R4 are unsubstituted C1-C6 alkyl. In some embodiments, R2, R3, and R4 are unsubstituted C1-C4 alkyl. In some further embodiments, R2, R3, and R4 are methyl. In some other further embodiments, R2, R3, and R4 are ethyl. In some embodiments, R2, R3, and R4 are —OR13, wherein R13 is hydrogen. In some embodiments, R2, R3, and R4 are independently —OR13, or —C(O)OR13. In some further embodiments, R13 is hydrogen. R2, R3, and R4 may be the same or independently different. In some embodiments, R2, R3, and R4 are different. In some embodiments, R2 and R4 are —OR13 and R3 is —C(O)OR13, wherein R13 is hydrogen. Thus, in some embodiments, R2 and R4 are —OH and R3 is —C(O)OH. In other embodiments, R2 and R4 are —OR13 and R3 is —S(O)mR13, wherein R13 is hydrogen and m is 3. Thus, in some embodiments, R2 and R4 are —OH and R3 is —S(O)3H. A person of skill in the art will immediately recognize that the compounds provided herein include acceptable salts thereof. For example, where the compound includes a —C(O)OH group, a person having ordinary skill in the art will understand that —C(O)O— with an appropriate accompanying counterion (e.g. Na+, K+, Ca2+, Mg2+) is an acceptable salt. Likewise, an acceptable salt of —S(O)3H would include —S(O)3 − with an appropriate accompanying counterion (e.g. Na+, K+, Ca2+, Mg2+). Thus, a compound of formula (I), (II), or (III) as disclosed herein, wherein R2, R3, and R4 are independently —C(O)OH or —S(O)3H may include a compound of formula (I), (II), or (III), wherein R2, R3, and R4 are independently —C(O)O− or —S(O)3 −.
- L1, L2, L3, and L4 may be the same or may be independently different and may each independently be a bond, substituted or unsubstituted alkylene, substituted or unsubstituted heteroalkylene, substituted or unsubstituted cycloalkylene, or substituted or unsubstituted arylene. In some embodiments, L1, L2, L3, and L4 are the same or different and are each independently a bond, substituted or unsubstituted alkylene, substituted or unsubstituted heteroalkylene, substituted or unsubstituted cycloalkylene, or substituted or unsubstituted arylene. In some embodiments, L1, L2, L3, and L4 are independently substituted or unsubstituted C1-C20 (e.g., C1-C8) alkylene, substituted or unsubstituted 2 to 20 membered (e.g., 2 to 8 membered) heteroalkylene, substituted or unsubstituted 2 to 20 membered (e.g., 2 to 8 membered) cycloalkylene, or substituted or unsubstituted C5-C20 arylene (e.g. C6 arylene). L1, L2, L3, and L4 may be the same or may be different. In some embodiments, L1, L2, L3, and L4 are independently different. In some embodiments, L1 is substituted alkylene and L2, L3 and L4 are unsubstituted alkylene. For example, L1 may be substituted C1-C5 alkylene (e.g. substituted C3 alkylene) and L2, L3 and L4 are unsubstituted C1-C6 alkylene (e.g. C2 alkylene). In some embodiments, L1 is substituted propylene. In some further embodiments, L1 has the formula
- In some embodiments, L1 is substituted C3 alkylene (e.g. as described in formula (V)) and L2, L3 and L4 are C2 alkylene (i.e. ethylene). In other embodiments, L1 is substituted C3 alkylene (e.g. as described in formula (V)), L2 and L4 are C2 alkylene (i.e. ethylene) and L3 is methylene. In some embodiments, L1 is substituted C3 alkylene (i.e. substituted propylene) and L2, L3 and L4 are a bond.
- As described herein, R2, R3, and R4 may be —OR13, wherein R13 is hydrogen. Thus, in some embodiments, R2, R3, and R4 are —OH. When R2, R3, and R4 are —OH, L2, L3, and L4 may be independently unsubstituted C1-C4 alkylene. Thus, in some embodiments, R2, R3, and R4 are —OH and L2, L3, and L4 are independently unsubstituted C1-C4 alkylene. In some further embodiments, L2, L3, and L4 are ethylene. In other embodiments, R2 and R4 are independently —OR13 and R3 is —C(O)OR13. In some further embodiments, R13 is hydrogen and L2, L3, and L4 are independently unsubstituted C1-C4 alkylene (e.g. unsubstituted methylene or ethylene). In some further embodiments, L2 and L4 are ethylene and L3 is methylene. In some embodiments, R2 and R4 are independently —OR13 and R3 is —S(O)3R13. In some further embodiments, R13 is hydrogen and L2, L3, and L4 are independently unsubstituted C1-C4 alkylene (e.g. methylene or ethylene).
- In some embodiments, R5 is independently hydrogen or unsubstituted C1-C5 alkyl. In some embodiments, R5 is branched unsubstituted C1-C5 saturated alkyl. In some embodiments, R5 is hydrogen or unsubstituted C1 or C2 alkyl. In some related embodiments, R5 is hydrogen or branched unsubstituted C1 or C2 saturated alkyl. In some embodiments, R5 is hydrogen or a branched unsubstituted C1 saturated alkyl. In other embodiments, R5 is C2-C6 alkyl. In some embodiments, R5 is a branched unsubstituted C2-C6 saturated alkyl. In some embodiments, R5 is not C2 alkyl. In other embodiments, R5 is C1 alkyl or C3-C6 alkyl. In some embodiments, R5 is a branched unsubstituted C3-C6 saturated alkyl. In other embodiments, R5 is hydrogen.
- In some embodiments, where multiple R5 substituents are present and at least two R5 substituents are different, R5 substituents with the fewest number of carbons are present toward the side of the compound of formula (I) bound to the L1 substituent. In this embodiment, the compound of formula (I) will be increasingly hydrophilic in progressing from the R1 substituent to the side of the compound of formula (I) bound to the L1 substituent. The term “side of the compound of formula (I) bound to the L1 substituent” refers to the side of the compound indicated by asterisks in the below structure of formula (I):
- In some embodiments of the compound of formula (I), (II), (III), or embodiments thereof disclosed herein, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 21 to 210. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 25 to 210. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 30 to 210. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 35 to 210. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 40 to 210. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 45 to 210. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 50 to 210.
- In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 55 to 210. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 60 to 210. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 25 to 100. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 30 to 100. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 35 to 100. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 40 to 100. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 45 to 100. In some further embodiments, n is 50. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 50 to 100. In some further embodiments, n is 95. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 55 to 100. In other embodiments, where R1 is unsubstituted C25-C32 alkyl, the symbol n is an integer from 60 to 100. L1, L2, L3, L4, R2, R3, R4 and R5 may be any of the embodiments described above (e.g. L2, L3, and L4 may be independently unsubstituted C1-C3 alkylene (e.g. methylene or ethylene), L1 may be substituted C3 alkylene (e.g. the compound of formula (V)), R2, R3, and R4 may be independently —OH or —C(O)OH, and R5 may be independently hydrogen or unsubstituted C1-C3 alkyl).
- In some embodiments of the compound of formula (I), (II), (III), or embodiments thereof disclosed herein, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 21 to 210. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 25 to 210. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 30 to 210. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 35 to 210. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 40 to 210. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 45 to 210. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 50 to 210. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 55 to 210. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 60 to 210. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 25 to 100. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 30 to 100. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 35 to 100. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 40 to 100. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 45 to 100. In some further embodiments, n is 50. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 50 to 100. In some further embodiments, n is 95. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 55 to 100. In other embodiments, where R1 is unsubstituted C25-C35 heteroalkyl, the symbol n is an integer from 60 to 100. L1, L2, L3, L4, R2, R3, R4 and R5 may be any of the embodiments described above (e.g. L2, L3, and L4 may be independently unsubstituted C1-C3 alkylene (e.g. methylene or ethylene), L1 may be substituted C3 alkylene (e.g. the compound of formula (V)), R2, R3, and R4 may be independently —OH or —C(O)OH, and R5 may be independently hydrogen or unsubstituted C1-C3 alkyl).
- In some embodiments, the compound provided herein has the formula:
- In formula (II) o is an integer from 20 to 100, p is an integer from 10 to 80, and R5 is unsubstituted C1-C3 alkyl (e.g. methyl or ethyl). In some further embodiments, R5 is methyl. In some further embodiments, R1 is branched C15-C40 heteroalkyl, o is 10 to 40 and p is 5 to 30.
- In some embodiments, p is 10 to 100. In some related embodiments, p is 10 to 90. In some related embodiments, p is 10 to 80. In some related embodiments, p is 10 to 70. In some related embodiments, p is 10 to 60. In some further related embodiments, o is 20 to 60. In other further related embodiments, o is 25 to 50. In other further related embodiments, o is 30 to 45. In other further related embodiments, o is 35 to 40. In other further related embodiments, o is more than 15, 25 or 30. L1, L2, L3, L4, R2, R3, R4 and R5 may be any of the embodiments described above (e.g. L2, L3, and L4 may be independently unsubstituted C1-C3 alkylene (e.g. methylene or ethylene), L1 may be substituted C3 alkylene (e.g. the compound of formula (V)), R2, R3, and R4 may be independently —OH or —C(O)OH, and R5 may be independently hydrogen or unsubstituted C1-C3 alkyl).
- In some embodiments, p is 15 to 100. In some related embodiments, p is 15 to 90. In some related embodiments, p is 15 to 80. In some related embodiments, p is 15 to 70. In some related embodiments, p is 15 to 60. In some further related embodiments, o is 20 to 60. In other further related embodiments, o is 25 to 50. In other further related embodiments, o is 30 to 45. In other further related embodiments, o is 35 to 40. In other further related embodiments, o is more than 15, 20 or 30. L1, L2, L3, L4, R2, R3, R4 and R5 may be any of the embodiments described above (e.g. L2, L3, and L4 may be independently unsubstituted C1-C3 alkylene (e.g. methylene or ethylene), L1 may be substituted C3 alkylene (e.g. the compound of formula (V)), R2, R3, and R4 may be independently —OH or —C(O)OH, and R5 may be independently hydrogen or unsubstituted C1-C3 alkyl).
- In some embodiments, the compound provided herein has the formula:
- In formula (III) p is an integer from 10 to 100, o is an integer from 20 to 80, q is an integer from 0 to 60, and R5 is unsubstituted C1-C3 alkyl. In some further embodiments, R5 is ethyl or propyl. In some further embodiments, R5 is ethyl.
- In some embodiments, p is 10 to 100. In some related embodiments, p is 10 to 90. In some related embodiments, p is 10 to 80. In some related embodiments, p is 10 to 70. In some related embodiments, p is 10 to 60. In some further related embodiments, o is 20 to 60. In other further related embodiments, o is 25 to 50. In other further related embodiments, o is 30 to 45. In other further related embodiments, o is 35 to 40. In other further related embodiments, o is more than 15, 20 or 30. In other further embodiments, q is 0 to 50. In some other further embodiments, q is 5 to 50. In some other further embodiments, q is 10 to 50. In some other further embodiments, q is 15 to 50. In some other further embodiments, q is 20 to 50. In some other further embodiments, q is 25 to 50. L1, L2, L3, L4, R2, R3, R4 and R5 may be any of the embodiments described above (e.g. L2, L3, and L4 may be independently unsubstituted C1-C3 alkylene (e.g. methylene or ethylene), L1 may be substituted C3 alkylene (e.g. the compound of formula (V)), R2, R3, and R4 may be independently —OH or —C(O)OH, and R5 may be independently hydrogen or unsubstituted C1-C3 alkyl).
- In some embodiments, p is 15 to 100. In some related embodiments, p is 15 to 90. In some related embodiments, p is 15 to 80. In some related embodiments, p is 15 to 70. In some related embodiments, p is 15 to 60. In some further related embodiments, o is 5 to 60. In other further related embodiments, o is 10 to 50. In other further related embodiments, o is 15 to 45. In other further related embodiments, o is 20 to 40. In other further related embodiments, o is more than 10, 15, or 20. In other further embodiments, q is 0 to 50. In some other further embodiments, q is 5 to 50. In some other further embodiments, q is 10 to 50. In some other further embodiments, q is 15 to 50. In some other further embodiments, q is 20 to 50. In some other further embodiments, q is 25 to 50. L1, L2, L3, L4, R2, R3, R4 and R5 may be any of the embodiments described above (e.g. L2, L3, and L4 may be independently unsubstituted C1-C3 alkylene (e.g. methylene or ethylene), L1 may be substituted C3 alkylene (e.g. the compound of formula (V)), R2, R3, and R4 may be independently —OH or —C(O)OH, and R5 may be independently hydrogen or unsubstituted C1-C3 alkyl).
- In another aspect, an aqueous composition including a co-surfactant and a compound as described herein (e.g. a compound of formula (I), (II), or (III)) is provided. A co-surfactant, as used herein, is a compound within the aqueous composition that functions as a surface active agent when the aqueous composition is in contact with a crude oil (e.g. an unrefined petroleum). The co-surfactant, along with the compound of formula (I), (II) or (III), may act to lower the interfacial tension and/or surface tension of the unrefined petroleum. In some embodiments, the co-surfactant and the compound of formula (I), (II) or (III) are present in synergistic surface active amounts. A “synergistic surface active amount,” as used herein, means that a compound of formula (I), (II) or (III) and the co-surfactant are present in amounts in which the oil surface activity (interfacial tension lowering effect and/or surface tension lowering effect on crude oil when the aqueous composition is added to the crude oil) of the compound and co-surfactant combined is greater than the additive oil surface activity of the co-surfactant individually and the compound individually. In some cases, the oil surface activity of the compound and co-surfactant combination is 10%, 20%, 30%, 40%, 50%, 60%, 70%, 80%, 90% or 100% more than the additive oil surface activity of the co-surfactant individually and the compound individually. In some embodiments, the oil surface activity of the compound and co-surfactant combination is 2, 3, 4, 5, 6, 7, 8, 9 or 10 times more than the additive oil surface activity of the co-surfactant individually and the compound individually.
- In another embodiment, the compound and co-surfactant are present in a surfactant stabilizing amount. A “surfactant stabilizing amount” means that the compound and the co-surfactant are present in an amount in which the co-surfactant degrades at a slower rate in the presence of the compound than in the absence of the compound, and/or the compound degrades at a slower rate in the presence of the co-surfactant than in the absence of the co-surfactant. The rate of degradation may be 10%, 20%, 30%, 40%, 50%, 60%, 70%, 80%, 90% or 100% slower. In some embodiments, the rate of degradation is 2, 3, 4, 5, 6, 7, 8, 9 or 10 times slower.
- In another embodiment, the compound and co-surfactant are present in a synergistic solubilizing amount. A “synergistic solubilizing amount” means that the compound and the co-surfactant are present in an amount in which the compound is more soluble in the presence of the co-surfactant than in the absence of the co-surfactant, and/or the co-surfactant is more soluble in the presence of the compound than in the absence of the compound. The solubilization may be 10%, 20%, 30%, 40%, 50%, 60%, 70%, 80%, 90% or 100% higher. In some embodiment, the solubilization is 2, 3, 4, 5, 6, 7, 8, 9 or 10 times higher. In some embodiments, the compound is present in an amount sufficient to increase the solubility of the co-surfactant in the aqueous composition relative to the absence of the compound. In other words, in the presence of a sufficient amount of the compound, the solubility of the co-surfactant in the aqueous composition is higher than in the absence of the compound. In other embodiments, the co-surfactant is present in an amount sufficient to increase the solubility of the compound in the aqueous composition relative to the absence of the co-surfactant. Thus, in the presence of a sufficient amount of the co-surfactant the solubility of the compound in the aqueous solution is higher than in the absence of the co-surfactant.
- The aqueous composition provided herein including embodiments thereof includes a co-surfactant. The co-surfactant provided herein may be any appropriate co-surfactant useful in the field of enhanced oil recovery. In other embodiments, a plurality of co-surfactant types is in the aqueous composition. In some embodiments, the co-surfactant is a single co-surfactant type in the aqueous composition. In other embodiments, the aqueous composition includes a plurality of different co-surfactants. Where the aqueous composition includes a plurality of different co-surfactants the aqueous composition may include a co-surfactant blend. A “co-surfactant blend” as provided herein is a mixture of a plurality of co-surfactant types. In some embodiments, the co-surfactant blend includes a first co-surfactant type (e.g. an alkoxy carboxylate surfactant), a second surfactant type (e.g. an internal olefin sulfonate) or a third co-surfactant type (sulfate surfactant). The first, second and third co-surfactant type may be independently different (e.g. anionic or cationic co-surfactants; or two anionic co-surfactants having a different hydrocarbon chain length but are otherwise the same). Therefore, a person having ordinary skill in the art will immediately recognize that the terms “co-surfactant” and “co-surfactant type(s)” have the same meaning and can be used interchangeably. In some embodiments, the plurality of different co-surfactants includes an anionic co-surfactant, a non-ionic co-surfactant, a zwitterionic co-surfactant or a cationic co-surfactant. In some embodiments, the co-surfactant is an anionic surfactant, a non-ionic surfactant, a zwitterionic co-surfactant. “Zwitterionic” or “zwitterion” as used herein refers to a neutral molecule with a positive (or cationic) and a negative (or anionic) electrical charge at different locations within the same molecule. Examples for zwitterionics are without limitation betains and sultains.
- The co-surfactant provided herein may be any appropriate anionic co-surfactant. In some embodiments, the co-surfactant is an anionic co-surfactant. In some embodiments, the anionic co-surfactant is an anionic co-surfactant blend. Where the anionic co-surfactant is an anionic co-surfactant blend the aqueous composition includes a plurality (i.e. more than one) of anionic co-surfactant types. In some embodiments, the anionic co-surfactant is an alkoxy carboxylate co-surfactant, an alkoxy sulfate co-surfactant, an alkoxy sulfonate co-surfactant, an alkyl sulfonate co-surfactant, an aryl sulfonate co-surfactant or an olefin sulfonate co-surfactant. An “alkoxy carboxylate co-surfactant” as provided herein is a compound having an alkyl or aryl attached to one or more alkoxylene groups (typically —CH2—CH(ethyl)-O—, —CH2—CH(methyl)-O—, or —CH2—CH2—O—) which, in turn is attached to —COO— or acid or salt thereof including metal cations such as sodium. In some embodiments, the alkoxy carboxylate co-surfactant has the formula:
- In formula (VI) or (VII) R1C is substituted or unsubstituted C8-C150 alkyl or substituted or unsubstituted aryl, R2C is independently hydrogen or unsubstituted C1-C6 alkyl, R3C is independently hydrogen or unsubstituted C1-C6 alkyl, n is an integer from 2 to 210, z is an integer from 1 to 6 and M+ is a monovalent, divalent or trivalent cation. In some embodiments, R1C is unsubstituted linear or branched C8-C36 alkyl. In some embodiments, R1C is (C6H5—CH2CH2)3C6H2-(TSP), (C6H5—CH2CH2)2C6H3— (DSP), (C6H5—CH2CH2)1C6H4— (MSP), or substituted or unsubstituted naphthyl. In some embodiments, the alkoxy carboxylate is C28-25PO-25EO-carboxylate (i.e. unsubstituted C28 alkyl attached to 25 —CH2—CH(methyl)-O-linkers, attached in turn to 25 —CH2—CH2—O— linkers, attached in turn to —COO− or acid or salt thereof including metal cations such as sodium).
- In some embodiments, the co-surfactant is an alkoxy sulfate co-surfactant. An alkoxy sulfate co-surfactant as provided herein is a co-surfactant having an alkyl or aryl attached to one or more alkoxylene groups (typically —CH2—CH(ethyl)-O—, —CH2—CH(methyl)-O—, or —CH2—CH2—O—) which, in turn is attached to —SO3 − or acid or salt thereof including metal cations such as sodium. In some embodiment, the alkoxy sulfate co-surfactant has the formula RA—(BO)e—(PO)f-(EO)g—SO3 − or acid or salt (including metal cations such as sodium) thereof, wherein RA is C8-C30 alkyl, BO is —CH2—CH(ethyl)-O—, PO is —CH2—CH(methyl)-O—, and EO is —CH2—CH2—O—. The symbols e, f and g are integers from 0 to 25 wherein at least one is not zero. In some embodiment, the alkoxy sulfate co-surfactant is C15-13PO-sulfate (i.e. an unsubstituted Cis alkyl attached to 13 —CH2—CH(methyl)-O— linkers, in turn attached to —SO3 − or acid or salt thereof including metal cations such as sodium).
- In other embodiments, the alkoxy sulfate co-surfactant has the formula
- In formula (VIII) R1D and R2D are independently substituted or unsubstituted C8-C150 alkyl or substituted or unsubstituted aryl. R3D is independently hydrogen or unsubstituted C1-C6 alkyl. z is an integer from 2 to 210. X− is
- and M+ is a monovalent, divalent or trivalent cation. In some embodiments, R1D is branched unsubstituted C8-C150. In other embodiments, R1D is branched or linear unsubstituted C12-C100 alkyl, (C6H5—CH2CH2)3C6H2-(TSP), (C6H5—CH2CH2)2C6H3— (DSP), (C6H5—CH2CH2)1C6H4— (MSP), or substituted or unsubstituted naphthyl. In some embodiments, the alkoxy sulfate is C16-C16-epoxide-15PO-10EO-sulfate (i.e. a linear unsubstituted C16 alkyl attached to an oxygen, which in turn is attached to a branched unsubstituted C16 alkyl, which in turn is attached to 15 —CH2—CH(methyl)-O— linkers, in turn attached to 10 —CH2—CH2—O— linkers, in turn attached to —SO3 − or acid or salt thereof including metal cations such as sodium.
- The alkoxy sulfate co-surfactant provided herein may be an aryl alkoxy sulfate co-surfactant. An aryl alkoxy co-surfactant as provided herein is an alkoxy co-surfactant having an aryl attached to one or more alkoxylene groups (typically —CH2—CH(ethyl)-O—, —CH2—CH(methyl)-O—, or —CH2—CH2—O—) which, in turn is attached to —SO3— or acid or salt thereof including metal cations such as sodium. In some embodiments, the aryl alkoxy sulfate co-surfactant is (C6H5—CH2CH2)3C6H2-7PO-10EO-sulfate (i.e. tri-styrylphenol attached to 7 —CH2—CH(methyl)-O— linkers, in turn attached to 10 —CH2—CH2—O— linkers, in turn attached to —SO3 − or acid or salt thereof including metal cations such as sodium).
- In some embodiments, the co-surfactant is an unsubstituted alkyl sulfate or an unsubstituted alkyl sulfonate co-surfactant. An alkyl sulfate co-surfactant as provided herein is a co-surfactant having an alkyl group attached to —O—SO3 − or acid or salt thereof including metal cations such as sodium. An alkyl sulfonate co-surfactant as provided herein is a co-surfactant having an alkyl group attached to —SO3 − or acid or salt thereof including metal cations such as sodium. In some embodiments, the co-surfactant is an unsubstituted aryl sulfate co-surfactant or an unsubstituted aryl sulfonate co-surfactant. An aryl sulfate co-surfactant as provided herein is a co-surfactant having an aryl group attached to —O—SO3 − or acid or salt thereof including metal cations such as sodium. An aryl sulfonate co-surfactant as provided herein is a co-surfactant having an aryl group attached to —SO3 − or acid or salt thereof including metal cations such as sodium. In some embodiments, the co-surfactant is an alkyl aryl sulfonate. Non-limiting examples of alkyl sulfate co-surfactants, aryl sulfate co-surfactants, alkyl sulfonate co-surfactants, aryl sulfonate co-surfactants and alkyl aryl sulfonate co-surfactants useful in the embodiments provided herein are alkyl aryl sulfonates (ARS) (e.g. alkyl benzene sulfonate (ABS)), alkane sulfonates, petroleum sulfonates, and alkyl diphenyl oxide (di)sulfonates. Additional co-surfactants useful in the embodiments provided herein are alcohol sulfates, alcohol phosphates, alkoxy phosphate, sulfosuccinate esters, alcohol ethoxylates, alkyl phenol ethoxylates, quaternary ammonium salts, betains and sultains.
- The co-surfactant as provided herein may be a combination of one or more anionic, non-ionic, cationic or zwitterionic co-surfactants. In some embodiments, the co-surfactant is an internal olefin sulfonate (IOS), an alfa olefin sulfonate (AOS), an alkyl aryl sulfonate (ARS), an alkane sulfonate, a petroleum sulfonate, an alkyl diphenyl oxide (di)sulfonate, an alcohol sulfate, an alkoxy sulfate, an alkoxy sulfonate, an alcohol phosphate, an alkoxy phosphate, a sulfosuccinate ester, an alcohol ethoxylate, an alkyl phenol ethoxylate, a quaternary ammonium salt, a betaine or sultaine. The co-surfactant as provided herein, may also be a soap.
- Without limitation, the co-surfactant may be a combination of two or more of the following compounds: an internal olefin sulfonate (IOS), an alfa olefin sulfonate (AOS), an alkyl aryl sulfonate (ARS) (e.g. an alkyl benzene sulfonate (ABS)), an alkane sulfonate, a petroleum sulfonate, an alkyl diphenyl oxide (di)sulfonate, an alcohol sulfate, an alkoxy sulfate (e.g. an alkyl alkoxy sulfate) an alkoxy sulfonate, an alcohol phosphate, an alkoxy phosphate, a sulfosuccinate ester, an alcohol ethoxylate, an alkyl phenol ethoxylate, a quaternary ammonium salt, a betaine, a sultaine and a soap (or its carboxylic acid). A person having ordinary skill in the art will immediately recognize that many surfactants are commercially available as blends of related molecules (e.g. IOS and ABS surfactants). Thus, where a co-surfactant is present within a composition provided herein, a person of ordinary skill would understand that the co-surfactant may be a blend of a plurality of related surfactant molecules (as described herein and as generally known in the art). In some embodiments, the co-surfactant is a C10-C30 internal olefin sulfate (IOS) or a C8-C30 alkyl benzene sulfonate (ABS). In other embodiments, the co-surfactant is a combination of a C10-C30 internal olefin sulfate (IOS) and a C8-C30 alkyl benzene sulfonate (ABS). In some embodiments, the C10-C30 of IOS is a branched unsubstituted C10-C30 saturated alkyl. In some embodiment, the IOS is a C15-C18 internal olefin sulfate. In some embodiment, the IOS is a C19-C23 internal olefin sulfate. In some embodiment, the IOS is a C20-C24 internal olefin sulfate. In some embodiment, the IOS is a C15-C18 internal olefin sulfate. In other embodiments, the C8-C30 of ABS is a branched unsubstituted C8-C30 saturated alkyl.
- In some embodiments, the surfactant is an unsubstituted alkyl alkoxy sulfate having an alkyl attached to one or more alkoxylene groups (typically —CH2—CH(ethyl)-O—, —CH2—CH(methyl)-O—, or —CH2—CH2—O—) which, in turn is attached to —SO3 − or acid or salt thereof including metal cations such as sodium. In some embodiment, the alkyl alkoxy sulfate has the formula RA—(BO)e—(PO)f-(EO)g—SO3 − or acid or salt (including metal cations such as sodium) thereof, wherein BO is —CH2—CH(ethyl)-O—, PO is —CH2—CH(methyl)-O—, and —CH2—CH2—O—. The symbols e, f and g are integers from 0 to 25 wherein at least one is not zero. In some embodiment, the alkyl alkoxy sulfate is C15-13PO-Sulfate (i.e. an unsubstituted C15 alkyl attached to 13 —CH2—CH(methyl)-O— linkers, in turn attached to —SO3 − or acid or salt thereof including metal cations such as sodium. In some embodiments, the surfactant is an unsubstituted alkyl sulfate.
- Useful co-surfactants are disclosed, for example, in U.S. Pat. Nos. 3,811,504, 3,811,505, 3,811,507, 3,890,239, 4,463,806, 6,022,843, 6,225,267, 7,629,299; WIPO Patent Application WO/2008/079855 and WO/2012/027757, as well as U.S. Patent Application Nos. 2005/0199395, 2006/0185845, 2006/018486, 2009/0270281, 2011/0046024, 2011/0100402, 2011/0190175, 2007/0191633, 2010/004843. 2011/0201531, 2011/0190174, 2011/0071057, 2011/0059873, 2011/0059872, 2011/0048721, 2010/0319920, and 2010/0292110. Additional useful co-surfactants are surfactants known to be used in enhanced oil recovery methods, including those discussed in D. B. Levitt, A. C. Jackson, L. Britton and G. A. Pope, “Identification and Evaluation of High-Performance EOR Surfactants,” SPE 100089, conference contribution for the SPE Symposium on Improved Oil Recovery Annual Meeting, Tulsa, Okla., Apr. 24-26, 2006.
- In some embodiment, the total surfactant concentration (i.e. the compound of formula (I), (II) or (III) and one or more co-surfactants) in the aqueous composition is from about 0.05% w/w to about 10% w/w. In other embodiments, the total surfactant concentration in the aqueous composition is from about 0.25% to about 10%. In other embodiments, the total surfactant concentration in the aqueous composition is about 0.5%. In other embodiments, the total surfactant concentration in the aqueous composition is about 1.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 1.25%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 1.5%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 1.75%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 2.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 2.5%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 3.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 3.5%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 4.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 4.5%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 5.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 5.5%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 6.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 6.5%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 7.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 7.5%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 8.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 9.0%. In other embodiments, the total surfactant concentration in the aqueous composition is from about 10%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.05% (all percentages of the compounds of formula (I), (II) or (III), so-solvents and co-surfactants within the aqueous compositions and emulsion compositions here are w/w percentages). In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.1%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 1.50%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 2%. In some further embodiments, the concentration of the co-surfactant is about 0.05%.
- In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 3%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 4%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In some embodiments, the concentration of the compound of formula (I), (II) or (III) is about 5%. In some further embodiments, the concentration of the co-surfactant is about 0.05%. In some further embodiments, the concentration of the co-surfactant is about 0.10%. In some further embodiments, the concentration of the co-surfactant is about 0.15%. In some further embodiments, the concentration of the co-surfactant is about 0.20%. In some further embodiments, the concentration of the co-surfactant is about 0.25%. In some further embodiments, the concentration of the co-surfactant is about 0.30%. In some further embodiments, the concentration of the co-surfactant is about 0.35%. In some further embodiments, the concentration of the co-surfactant is about 0.40%. In some further embodiments, the concentration of the co-surfactant is about 0.45%. In some further embodiments, the concentration of the co-surfactant is about 0.50%. In some further embodiments, the concentration of the co-surfactant is about 0.55%. In some further embodiments, the concentration of the co-surfactant is about 0.60%. In some further embodiments, the concentration of the co-surfactant is about 0.65%. In some further embodiments, the concentration of the co-surfactant is about 0.70%. In some further embodiments, the concentration of the co-surfactant is about 0.75%. In some further embodiments, the concentration of the co-surfactant is about 0.80%. In some further embodiments, the concentration of the co-surfactant is about 0.85%. In some further embodiments, the concentration of the co-surfactant is about 0.90%. In some further embodiments, the concentration of the co-surfactant is about 0.95%. In some further embodiments, the concentration of the co-surfactant is about 1.0%. In some further embodiments, the concentration of the co-surfactant is about 1.25%. In some further embodiments, the concentration of the co-surfactant is about 1.5%. In some further embodiments, the concentration of the co-surfactant is about 1.75%. In some further embodiments, the concentration of the co-surfactant is about 2%. In some further embodiments, the concentration of the co-surfactant is about 3%. In some further embodiments, the concentration of the co-surfactant is about 4%. In some further embodiments, the concentration of the co-surfactant is about 5%.
- In one embodiment, the aqueous composition further includes a viscosity enhancing water-soluble polymer. In one embodiment, the viscosity enhancing water-soluble polymer may be a biopolymer such as xanthan gum or scleroglucan, a synthetic polymer such as polyacrylamide, hydrolyzed polyacrylamide or co-polymers of acrylamide and acrylic acid, 2-acrylamido 2-methyl propane sulfonate or N-vinyl pyrrolidone, a synthetic polymer such as polyethylene oxide, or any other high molecular weight polymer soluble in water or brine. In one embodiment, the viscosity enhancing water-soluble polymer is polyacrylamide or a co-polymer of polyacrylamide. In one embodiment, the viscosity enhancing water-soluble polymer is a partially (e.g. 20%, 25%, 30%, 35%, 40%, 45%) hydrolyzed anionic polyacrylamide. In some further embodiment, the viscosity enhancing water-soluble polymer has a molecular weight of approximately about 8×106. In some other further embodiment, the viscosity enhancing water-soluble polymer has a molecular weight of approximately about 18×106. Non-limiting examples of commercially available polymers useful for the invention including embodiments provided herein are Florpaam 3330S and Florpaam 3360S. Molecular weights of the polymers may range from about 10,000 daltons to about 20,000,000 daltons. In some embodiments, the viscosity enhancing water-soluble polymer is used in the range of about 500 to about 5000 ppm concentration, such as from about 1000 to 2000 ppm (e.g. in order to match or exceed the reservoir oil viscosity under the reservoir conditions of temperature and pressure).
- In some embodiments, the aqueous composition further includes an alkali agent. An alkali agent as provided herein is a basic, ionic salt of an alkali metal (e.g. lithium, sodium, potassium) or alkaline earth metal element (e.g. magnesium, calcium, barium, radium). In some embodiments, the alkali agent is NaOH, KOH, LiOH, Na2CO3, NaHCO3, Na-metaborate, Na silicate, Na orthosilicate, Na acetate or NH4OH. The aqueous composition may include seawater, or fresh water from an aquifer, river or lake. In some embodiments, the aqueous composition includes hard brine water or soft brine water. In some further embodiments, the water is soft brine water. In some further embodiments, the water is hard brine water. Where the aqueous composition includes soft brine water, the aqueous composition may include an alkaline agent. In soft brine water the alkaline agent provides for enhanced soap generation from the active oils, lower surfactant adsorption to the solid material (e.g. rock) in the reservoir and increased solubility of viscosity enhancing water soluble polymers. The alkali agent is present in the aqueous composition at a concentration from about 0.1% w/w to about 10% w/w. The combined amount of alkali agent and compound provided herein (e.g. compound of formula (I) or (II)) present in the aqueous composition provided herein is approximately equal to or less than about 10% w/w. In some embodiments, the total concentration of alkali agent (i.e. the total amount of alkali agent within the aqueous compositions and emulsion compositions provided herein) in is from about 0.05% w/w to about 5% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is from about 0.25% w/w to about 5% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 0.5% w/w.
- In other embodiments, the total alkali agent concentration in the aqueous composition is about 0.75% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 1% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 1.25% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 1.50% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 1.75% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 2% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 2.25% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 2.5% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 2.75% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 3% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 3.25% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 3.5% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 3.75% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 4% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 4.25% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 4.5% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 4.75% w/w. In other embodiments, the total alkali agent concentration in the aqueous composition is about 5.0% w/w.
- The aqueous composition may include a surfactant, a co-surfactant and a co-solvent. Thus, in some embodiments, the aqueous composition includes a co-solvent. In some embodiments, the co-solvent is TEGBE (triethylene glycol mono butyl ether). In some embodiments, TEGBE is present at a concentration from about 0.01% to about 2%. In some embodiments, TEGBE is present at a concentration from about 0.05% to about 1.5%. In some embodiments, TEGBE is present at a concentration from about 0.2% to about 1.25%. In some embodiments, TEGBE is present at a concentration from about 0.25% to about 1%. In some embodiments, TEGBE is present at a concentration from about 0.5% to about 0.75%. In some embodiments, TEGBE is present at a concentration of about 0.25%. In other embodiments, TEGBE is present at a concentration of about 1%. In some embodiments, the co-solvent is an alcohol, alcohol ethoxylate, glycol ether, glycols, or glycerol.
- In some embodiments, the co-solvent has the formula
- In formula (IX), R1A is unsubstituted C1-C6 alkylene, unsubstituted phenylene, unsubstituted cyclohexylene, unsubstituted cyclopentylene or methyl-substituted cyclopenlene. R2A is independently hydrogen, methyl or ethyl. R3A is independently hydrogen or
- R4A is independently hydrogen, methyl or ethyl, n is an integer from 0 to 30, and m is an integer from 0 to 30. In one embodiment, n is an integer from 0 to 25. In one embodiment, n is an integer from 0 to 20. In one embodiment, n is an integer from 0 to 15. In one embodiment, n is an integer from 0 to 10. In one embodiment, n is an integer from 0 to 5. In one embodiment, n is 1. In other embodiments, n is 3. In one embodiment, n is 5. In one embodiment, m is an integer from 0 to 25. In one embodiment, m is an integer from 0 to 20. In one embodiment, m is an integer from 0 to 15. In one embodiment, m is an integer from 0 to 10. In one embodiment, m is an integer from 0 to 5. In one embodiment, m is 1. In other embodiments, m is 3. In one embodiment, m is 5. In formula (IX) each of R2A and R4A can appear more than once and can be optionally different. For example, in one embodiment where n is 2, R2A appears twice and can be optionally different. In other embodiments, where m is 3, R4A appears three times and can be optionally different.
- R1A may be linear or branched unsubstituted alkylene. In one embodiment, R1A of formula (IX) is linear unsubstituted C1-C6 alkylene. In one embodiment, R1A of formula (IX) is branched unsubstituted C1-C6 alkylene. In other embodiments, R1A of formula (IX) is linear unsubstituted C2-C6 alkylene. In other embodiments, R1A of formula (IX) is branched unsubstituted C2-C6 alkylene. In other embodiments, R1A of formula (IX) is linear unsubstituted C3-C6 alkylene. In other embodiments, R1A of formula (IX) is branched unsubstituted C3-C6 alkylene. In other embodiments, R1A of formula (IX) is linear unsubstituted C4-C6 alkylene. In other embodiments, R1A of formula (IX) is branched unsubstituted C4-C6 alkylene. In other embodiments, R1A of formula (IX) is linear unsubstituted C4-alkylene. In other embodiments, R1A of formula (IX) is branched unsubstituted C4-alkylene.
- In one embodiment, where R1A is linear or branched unsubstituted alkylene (e.g. branched unsubstituted C1-C6 alkylene), the alkylene is a saturated alkylene (e.g. a linear or branched unsubstituted saturated alkylene or branched unsubstituted C1-C6 saturated alkylene). A “saturated alkylene,” as used herein, refers to an alkylene consisting only of hydrogen and carbon atoms that are bonded exclusively by single bonds. Thus, in one embodiment, R1A is linear or branched unsubstituted saturated alkylene. In one embodiment, R1A of formula (IX) is linear unsubstituted saturated C1-C6 alkylene. In one embodiment, R1A of formula (IX) is branched unsubstituted saturated C1-C6 alkylene. In other embodiments, R1A of formula (IX) is linear unsubstituted saturated C2-C6 alkylene. In other embodiments, R1A of formula (IX) is branched unsubstituted saturated C2-C6 alkylene. In other embodiments, R1A of formula (IX) is linear unsubstituted saturated C3-C6 alkylene. In other embodiments, R1A of formula (IX) is branched unsubstituted saturated C3-C6 alkylene. In other embodiments, R1A of formula (IX) is linear unsubstituted saturated C4-C6 alkylene. In other embodiments, R1A of formula (IX) is branched unsubstituted saturated C4-C6 alkylene. In other embodiments, R1A of formula (IX) is linear unsubstituted saturated C4-alkylene. In other embodiments, R1A of formula (IX) is branched unsubstituted saturated C4-alkylene.
- In one embodiment, R1A of formula (IX) is substituted or unsubstituted cycloalkylene or unsubstituted arylene. In one embodiment, R1A of formula (IX) is R7A-substituted or unsubstituted cyclopropylene, wherein R7A is C1-C3 alkyl. In other embodiments, R1A of formula (IX) is R8A-substituted or unsubstituted cyclobutylene, wherein R8A is C1-C2 alkyl. In other embodiments, R1A of formula (IX) is R9A-substituted or unsubstituted cyclopentylene, wherein R9A is C1-alkyl. In other embodiments, R1A of formula (IX) is R10A-substituted or unsubstituted cyclopentylene, wherein R10A is unsubstituted cyclohexyl. In one embodiment, R1A of formula (IX) is unsubstituted phenylene, unsubstituted cyclohexylene, unsubstituted cyclopentylene or methyl-substituted cyclopentylene.
- In one embodiment, —R1A—R3A of formula (IX) is C1-C6 alkyl, unsubstituted phenyl, unsubstituted cyclohexyl, unsubstituted cyclopentyl or a methyl-substituted cycloalkyl.
- In one embodiment, the co-solvent has the structure of formula
- In formula (IXA), R11A is C1-C6 alkyl, unsubstituted phenyl, unsubstituted cyclohexyl, unsubstituted cyclopentyl or a methyl-substituted cycloalkyl.
- In one embodiment, n and m are independently 1 to 20. In other embodiments, n and m are independently 1 to 15. In other embodiments, n and m are independently 1 to 10. In one embodiment, n and m are independently 1 to 6. In one embodiment, n and m are independently 1.
- The co-solvent included in the aqueous compositions provided herein may be a monohydric or a dihydric alkoxy alcohol (e.g. C1-C6 alkoxy alcohol or C1-C6 alkoxy diol). Where the co-solvent is a monohydric alcohol, the co-solvent has the formula (IX) and R3A is hydrogen. Where the co-solvent is a diol, the co-solvent has the formula (IX) and R3A is
- In one embodiment, R1A is linear unsubstituted C4 alkylene and n is 3. In one embodiment, the co-solvent is triethyleneglycol butyl ether. In other embodiments, the co-solvent is tetraethylene glycol. In further embodiments, m is 3. In one embodiment, R1A is linear unsubstituted C4 alkylene and n is 5. In one embodiment, the co-solvent is pentaethyleneglycol n-butyl ether. In further embodiments, m is 5. In one embodiment, R1A is branched unsubstituted C4 alkylene and n is 1. In one embodiment, the co-solvent is ethyleneglycol iso-butyl ether. In further embodiments, m is 1. In one embodiment, R1A is branched unsubstituted C4 alkylene and n is 3. In one embodiment, the co-solvent is triethyleneglycol iso-butyl ether. In further embodiments, m is 3. In one embodiment, the co-solvent is ethylene glycol or propylene glycol. In other embodiments, the co-solvent is ethylene glycol alkoxylate or propylene glycol alkoxylate. In one embodiment, the co-solvent is propylene glycol diethoxylate or propylene glycoltriethoxylate. In one embodiment, the co-solvent is propylene glycol tetraethoxylate.
- In the structure of formula (IX), R3A may be hydrogen or
- Thus in one embodiment, R3A is
- In one embodiment, the co-solvent provided herein may be an alcohol or diol (C1-C6 alcohol or C1-C6 diol). Where the co-solvent is an alcohol, the co-solvent has a structure of formula (I), where R3A is hydrogen and n is 0. Where the co-solvent is a diol, the co-solvent has a structure of formula (IX), where R3A is
- and n and m are 0. Thus, in one embodiment, n and m are independently 0. In one embodiment, R1A is linear or branched unsubstituted C1-C6 alkylene. In other embodiments, R1A is linear or branched unsubstituted C2-C6 alkylene. In one embodiment, R1A is linear or branched unsubstituted C2-C6 alkylene. In one embodiment R1A is linear or branched unsubstituted C3-C6 alkylene. In other embodiments, R1A is linear or branched unsubstituted C4-C6 alkylene. In one embodiment, R1A is linear or branched unsubstituted C4-alkylene. In one embodiment, R1A is branched unsubstituted butylene. In one embodiment, the co-solvent has the structure of formula
- In other embodiments, the co-solvent has the structure of formula
- In one embodiment, the co-solvent has the structure of formula
- In some embodiments, the co-solvent has the formula
- In formula (X) R1B is independently hydrogen or unsubstituted C1-C6 alkyl, R2B is independently hydrogen or unsubstituted C1-C2 alkyl and n is an integer from 1 to 30. In some embodiments, R1B is unsubstituted C2-C6 alkyl. In some embodiments, R1B is unsubstituted C4-C6 alkyl. In some embodiments, R1B is unsubstituted C1-C5 alkyl. In other embodiments, R1B is unsubstituted C1-C4 alkyl. In other embodiments, R1B is unsubstituted C1-C3 alkyl. In some embodiments, R1B is unsubstituted C1-C2 alkyl. In some embodiments, R1B is unsubstituted C2 alkyl. In other embodiments, R1B is ethyl. In some embodiments, R1B is methyl. In some embodiment, R1B is hydrogen.
- R1B may be linear or branched unsubstituted alkyl. In one embodiment, R1B of formula (X) is linear unsubstituted C1-C6 alkyl. In one embodiment, R1B of formula (X) is branched unsubstituted C1-C6 alkyl. In other embodiments, R1B of formula (X) is linear unsubstituted C1-C5 alkyl. In other embodiments, R1B of formula (X) is branched unsubstituted C1-C5 alkyl. In other embodiments, R1B of formula (X) is linear unsubstituted C1-C4 alkyl. In other embodiments, R1B of formula (X) is branched unsubstituted C1-C4 alkyl. In other embodiments, R1B of formula (X) is linear unsubstituted C1-C3 alkyl. In other embodiments, R1B of formula (X) is branched unsubstituted C1-C3 alkyl. In other embodiments, R1B of formula (X) is linear unsubstituted ethyl. In other embodiments, R1B of formula (X) is branched unsubstituted ethyl.
- In one embodiment, where R1B is linear or branched unsubstituted alkyl (e.g. branched unsubstituted C1-C6 alkyl), the alkyl is a saturated alkyl (e.g. a linear or branched unsubstituted saturated alkyl or branched unsubstituted C1-C6 saturated alkyl). A “saturated alkyl,” as used herein, refers to an alkyl consisting only of hydrogen and carbon atoms that are bonded exclusively by single bonds. Thus, in one embodiment, R1B is linear or branched unsubstituted saturated alkyl. In one embodiment, R1B of formula (X) is linear unsubstituted saturated C1-C6 alkyl. In one embodiment, R1B of formula (X) is branched unsubstituted saturated C1-C6 alkyl.
- In other embodiments, R1B of formula (X) is linear unsubstituted saturated C1-C5 alkyl. In other embodiments, R1B of formula (X) is branched unsubstituted saturated C1-C5 alkyl. In other embodiments, R1B of formula (X) is linear unsubstituted saturated C1-C4 alkyl. In other embodiments, R1B of formula (X) is branched unsubstituted saturated C1-C4 alkyl. In other embodiments, R1B of formula (X) is linear unsubstituted saturated C1-C3 alkyl. In other embodiments, R1B of formula (X) is branched unsubstituted saturated C1-C3 alkyl. In other embodiments, R1B of formula (X) is linear unsubstituted saturated ethyl. In other embodiments, R1B of formula (X) is branched unsubstituted saturated ethyl.
- In formula (X) the symbol n is an integer from 1 to 30. In one embodiment, n is an integer from 1 to 25. In one embodiment, n is an integer from 1 to 20. In one embodiment, n is an integer from 1 to 15. In one embodiment, n is an integer from 1 to 10. In one embodiment, n is an integer from 1 to 5. In some embodiment, n is 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, or 30. In one embodiment, n is 3. In other embodiments, n is 5. In one embodiment, n is 6. In one embodiment, n is 16.
- In some embodiments, R1B is hydrogen. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 1, or at least 15, e.g. 5 to 20). Thus, in some embodiments, R1B is hydrogen and n is 16.
- In some embodiments, R1B is methyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 1, or at least 10, e.g. 5 to 20). Thus, in some embodiments, R1B is methyl and n is 16.
- In some embodiment, the co-solvent has the formula:
- In formula (XA) R1B is defined as above (e.g. unsubstituted C1-C6 alkyl), R2B is methyl or ethyl, o is an integer from 0 to 10 and p is an integer from 1 to 20. In some embodiments, R2B is methyl. In other embodiments, R2B is ethyl. In formula (XA) R2B can appear more than once and can be optionally different. For example, in some embodiments where o is 3, R2B appears three times and can be optionally different. In other embodiments, where o is 6, R2B appears 6 times and can be optionally different.
- In some embodiments, o is 0 to 10. In some related embodiments, o is 0 to 8. In some related embodiments, o is 0 to 6. In some related embodiments, o is 0 to 4. In some related embodiments, o is 0 to 2. In still further related embodiments, o is 0. In some further related embodiment, p is 1 to 20. In some further related embodiment, p is 1 to 18. In some further related embodiment, p is 1 to 16. In some further related embodiment, p is 1 to 14. In some further related embodiment, p is 1 to 12. In some further related embodiment, p is 1 to 10. In some further related embodiment, p is 1 to 8. In some further related embodiment, p is 1 to 6. In some further related embodiment, p is 1 to 4. In some further related embodiment, p is 1 to 2. In still some further related embodiment, p is more than 1. In some further embodiment, p is 6. In some further embodiment, p is 16. R1 and R2 may be any of the embodiments described above (e.g. R1B maybe linear unsubstituted C1-C6 alkyl, R2B maybe linear unsubstituted C1-C2 alkyl). Thus, in some embodiment, R1B is hydrogen, o is 0 and p is 16.
- In some embodiments, o is 1 to 10. In some related embodiments, o is 1 to 8. In some related embodiments, o is 1 to 6. In some related embodiments, o is 1 to 4. In some related embodiments, o is 1 to 2. In some further related embodiment, p is 1 to 20. In some further related embodiment, p is 1 to 18. In some further related embodiment, p is 1 to 16. In some further related embodiment, p is 1 to 14. In some further related embodiment, p is 1 to 12. In some further related embodiment, p is 1 to 10. In some further related embodiment, p is 1 to 8. In some further related embodiment, p is 1 to 6. In some further related embodiment, p is 1 to 4. In some further related embodiment, p is 1 to 2. In still some further related embodiment, p is more than 1. R1B and R2B may be any of the embodiments described above (e.g. R1B maybe linear unsubstituted C1-C6 alkyl, R2B maybe linear unsubstituted C1-C2 alkyl).
- In some embodiments, o is 2 to 10. In some related embodiments, o is 2 to 8. In some related embodiments, o is 2 to 6. In some related embodiments, o is 2 to 4. In some further related embodiment, p is 1 to 20. In some further related embodiment, p is 1 to 18. In some further related embodiment, p is 1 to 16. In some further related embodiment, p is 1 to 14. In some further related embodiment, p is 1 to 12. In some further related embodiment, p is 1 to 10. In some further related embodiment, p is 1 to 8. In some further related embodiment, p is 1 to 6. In some further related embodiment, p is 1 to 4. In some further related embodiment, p is 1 to 2. In still some further related embodiment, p is more than 1. R1B and R2B may be any of the embodiments described above (e.g. R1B maybe linear unsubstituted C1-C6 alkyl, R2B maybe linear unsubstituted C1-C2 alkyl).
- In some embodiments, o is 4 to 10. In some related embodiments, o is 4 to 8. In some related embodiments, o is 4 to 6. In some further related embodiment, p is 1 to 20. In some further related embodiment, p is 1 to 18. In some further related embodiment, p is 1 to 16. In some further related embodiment, p is 1 to 14. In some further related embodiment, p is 1 to 12. In some further related embodiment, p is 1 to 10. In some further related embodiment, p is 1 to 8. In some further related embodiment, p is 1 to 6. In some further related embodiment, p is 1 to 4. In some further related embodiment, p is 1 to 2. In still some further related embodiment, p is more than 1. R1B and R2B may be any of the embodiments described above (e.g. R1B maybe linear unsubstituted C1-C6 alkyl, R2B maybe linear unsubstituted C1-C2 alkyl).
- In some embodiments, o is 6 to 10. In some related embodiments, o is 6 to 8. In some further related embodiment, p is 1 to 20. In some further related embodiment, p is 1 to 18. In some further related embodiment, p is 1 to 16. In some further related embodiment, p is 1 to 14. In some further related embodiment, p is 1 to 12. In some further related embodiment, p is 1 to 10. In some further related embodiment, p is 1 to 8. In some further related embodiment, p is 1 to 6. In some further related embodiment, p is 1 to 4. In some further related embodiment, p is 1 to 2. In still some further related embodiment, p is more than 1. R1B and R2B may be any of the embodiments described above (e.g. R1B maybe linear unsubstituted C1-C6 alkyl, R2B maybe linear unsubstituted C1-C2 alkyl).
- In some embodiments, o is 8 to 10. In some further related embodiment, p is 1 to 20. In some further related embodiment, p is 1 to 18. In some further related embodiment, p is 1 to 16. In some further related embodiment, p is 1 to 14. In some further related embodiment, p is 1 to 12. In some further related embodiment, p is 1 to 10. In some further related embodiment, p is 1 to 8. In some further related embodiment, p is 1 to 6. In some further related embodiment, p is 1 to 4. In some further related embodiment, p is 1 to 2. In still some further related embodiment, p is more than 1. R1B and R2B may be any of the embodiments described above (e.g. R1B maybe linear unsubstituted C1-C6 alkyl, R2B maybe linear unsubstituted C1-C2 alkyl).
- In formula (X) or (XA) R2B may be independently hydrogen or unsubstituted C1-C2 alkyl. In some embodiments, R2B is hydrogen or unsubstituted C1 or C2 alkyl. In some related embodiments, R2B is hydrogen or branched unsubstituted C1 or C2 saturated alkyl. In some embodiments, R2B is hydrogen or a branched unsubstituted C1 saturated alkyl. In some embodiments, R2B is independently hydrogen or methyl. In other embodiments, R2B is independently hydrogen or ethyl. In some embodiments, R2B is independently hydrogen, methyl or ethyl. In some embodiments, R2B is hydrogen. In some embodiments, R2B is methyl. In some embodiments, R2B is ethyl. In formula (X) R2B can appear more than once and can be optionally different. For example, in some embodiments where n is 3, R2B appears three times and can be optionally different. In other embodiments, where n is 6, R2B appears six times and can be optionally different.
- In some embodiments, where multiple R2B substituents are present and at least two R2B substituents are different, R2B substituents with the fewest number of carbons are present to the side of the compound of formula (X) or (XA) bound to the —OH group. In this embodiment, the compound of formula (X) or (XA) will be increasingly hydrophilic in progressing from the R1B substituent to the side of the compound of formula (X) or (XA) bound to the —OH group. The term “side of the compound of formula (X) or (XA) bound to the —OH group” refers to the side of the compound indicated by asterisks in the below structures:
- In some embodiments, R2B is hydrogen. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 1, or at least 20, e.g. 5 to 15). Thus, in some embodiments, R2B is hydrogen and n is 16.
- In some embodiments, R2B is methyl. In other related embodiments, n is as defined in an embodiment above (e.g. n is at least 1, or at least 20, e.g. 5 to 15). Thus, in some embodiments, R2B is methyl and n is 16.
- In some embodiments, the aqueous composition includes a gas. For instance, the gas may be combined with the aqueous composition to reduce its mobility by decreasing the liquid flow in the pores of the solid material (e.g. rock). In some embodiments, the gas may be supercritical carbon dioxide, nitrogen, natural gas or mixtures of these and other gases.
- As described above, the aqueous composition may include the compound of formula (I), (II), or (III) and a co-surfactant. In some embodiments, the aqueous composition includes the compound of formula (I), (II), or (III) and at least one co-surfactant (i.e. more than one). In some further embodiments, the aqueous composition includes the compound of formula (I), (II), or (III) and a first co-surfactant and a second co-surfactant. In some embodiments, the compound is a betaine surfactant (i.e. a compound as described herein for example in formula (I), (II), and (III) or Example 2), wherein R1 is branched unsubstituted C32 heteroalkyl, o is 35, p is 15, L1 has the formula
- L2 and L4 are ethylene, L3 is methylene, R2 and R4 are —OH, R3 is —C(O)OH (or C(O)O—), the first co-surfactant is C15-C18 IOS and the second co-surfactant is C28-45PO-60EO (as described in WO/2012/027757). In other embodiments, the compound is a quaternary ammonium surfactant (i.e. a compound as described herein for example in formula (I), (II), and (III) or Example 1), wherein R1 is branched unsubstituted C32 heteroalkyl, o is 35, p is 15, L1 has the formula
- (V), L2, L3 and L4 are ethylene, R2, R3 and R4 are —OH, the first co-surfactant is C15-C18 IOS and the second co-surfactant is C28-45PO-60EO (as described in WO/2012/027757, formula (VI), (VII), or (VIII)). In one embodiment, the compound is present at about 0.2% w/w. In one embodiment, the first co-surfactant is present at about 0.4% w/w. In some further embodiment, the second-co-surfactant is present at about 0.4% w/w.
- In some embodiments, the aqueous composition has a pH of less than about 13.0. In other embodiments, the aqueous composition has a pH of less than about 12. In other embodiments, the aqueous composition has a pH of less than about 11. In other embodiments, the aqueous composition has a pH of less than about 10. In other embodiments, the aqueous composition has a pH of less than about 9.0. In other embodiments, the aqueous composition has a pH of less than about 8.0. In other embodiments, the aqueous composition has a pH of less than about 7.0.
- In some embodiments, the aqueous composition has a salinity of at least 10,000 ppm. In other embodiments, the aqueous composition has a salinity of at least 50,000 ppm. In other embodiments, the aqueous composition has a salinity of at least 100,000 ppm. The total range of salinity (total dissolved solids in the brine) is 100 ppm to saturated brine (about 260,000 ppm). The aqueous composition may include seawater, brine or fresh water from an aquifer, river or lake. The aqueous combination may further include salt to increase the salinity. In some embodiments, the salt is NaCl, KCl, CaCl2, MgCl2, CaSO4 or Na2CO3.
- In some embodiments, the temperature of the aqueous composition is at least 40° C. In other embodiments, the temperature of the aqueous composition is at least 100° C. In some embodiments, the aqueous composition has a viscosity of between 20 mPa·s and 100 mPa·s. The viscosity of the aqueous solution may be increased from 0.3 mPa·s to 1, 2, 10, 20, 100 or even 1000 mPa·s by including a water-soluble polymer. As mentioned above, the apparent viscosity of the aqueous composition may be increased with a gas (e.g. a foam forming gas) as an alternative to the water-soluble polymer.
- In another aspect, an emulsion composition is provided including an unrefined petroleum phase a compound as described herein (e.g. a compound of formula (I), (II), or (III)). In some embodiments, the emulsion composition includes the components set forth in the aqueous composition provided above. For example, in some embodiments, the emulsion composition further includes a co-surfactant (e.g. wherein the compound and the co-surfactant are present in synergistic surface active amount, a surfactant stabilizing amount, and/or a synergistic solubilizing amount). In some embodiments, the emulsion composition includes a co-surfactant and a co-solvent. The emulsion composition may include a combination of one or more co-surfactants and one or more co-solvents. In some embodiments, the viscosity of the emulsion composition is less than the viscosity in the absence of the compound. In some embodiments, the viscosity of the emulsion composition is less than 3 times the viscosity of an unrefined petroleum (e.g. the unrefined petroleum which makes up the unrefined petroleum phase of the emulsion composition). In other embodiments, the viscosity of the emulsion composition is less than 30 mPa s. In other embodiments, the viscosity of the emulsion composition is less than 200 mPa s. In other embodiments, the interfacial tension of the emulsion composition is less than the interfacial tension in the absence of the compound.
- In some embodiments, the emulsion composition is a microemulsion. A “microemulsion” as referred to herein is a thermodynamically stable mixture of oil, water and surfactants that may also include additional components such as co-solvents, electrolytes, alkali and polymers. In contrast, a “macroemulsion” as referred to herein is a thermodynamically unstable mixture of oil and water that may also include additional components. The emulsion composition provided herein may be an oil-in-water emulsion, wherein the surfactant forms aggregates (e.g. micelles) where the hydrophilic part of the surfactant molecule contacts the aqueous phase of the emulsion and the lipophilic part contacts the oil phase of the emulsion. Thus, in some embodiments, the surfactant forms part of the aqueous part of the emulsion. And in other embodiments, the surfactant forms part of the oil phase of the emulsion. In yet another embodiment, the surfactant forms part of an interface between the aqueous phase and the oil phase of the emulsion.
- In other embodiments, the oil and water solubilization ratios are insensitive to the combined concentration of divalent metal cations (e.g. Ca+2 and Mg+2) within the aqueous phase. In other embodiments, the oil and water solubilization ratios are insensitive to the salinity of the water or to all of the specific electrolytes contained in the water. The term “insensitive” used in the context of this paragraph means that the solubilization ratio tends not to change (e.g. tends to remain constant) as the concentration of divalent metal cations and/or salinity of water changes. In some embodiments, the change in the solubilization ratios are less than 5%, 10%, 20%, 30%, 40%, or 50% over a divalent metal cation concentration range of 10 ppm, 100 ppm, 1000 ppm or 10,000 ppm. In another embodiment, the change in the solubilization ratios are less than 5%, 10%, 20%, 30%, 40%, or 50% over a salinity concentration range of 10 ppm, 100 ppm, 1000 ppm or 10,000 ppm.
- In another aspect, a method of displacing a hydrocarbon material in contact with a solid material is provided. The method includes contacting a hydrocarbon material with the compound described herein (e.g. a compound of formula (I), (II), or (III)), wherein the hydrocarbon material is in contact with a solid material. The hydrocarbon material is allowed to separate from the solid material thereby displacing the hydrocarbon material in contact with the solid material. The hydrocarbon material is allowed to separate from the solid material thereby displacing the hydrocarbon material in contact with the solid material. In some embodiments, the solid material is contacted with the compound. A “hydrocarbon material,” as provided herein, is a hydrophobic material containing alkyl chains. The compound may be present in an aqueous composition or an emulsion composition as described above.
- In other embodiments, the hydrocarbon material is unrefined petroleum (e.g. in a petroleum reservoir). The solid material may be a natural solid material (i.e. a solid found in nature such as rock). The natural solid material may be found in a petroleum reservoir. In some embodiments, the method is an enhanced oil recovery method. Enhanced oil recovery methods are well known in the art. A general treatise on enhanced oil recovery methods is Basic Concepts in Enhanced Oil Recovery Processes edited by M. Baviere (published for SCI by Elsevier Applied Science, London and New York, 1991). For example, in an enhanced oil recovery method, the displacing of the unrefined petroleum in contact with the solid material is accomplished by contacting the unrefined with a compound provided herein (e.g. a compound of formula (I), (II) or (III)), wherein the unrefined petroleum is in contact with the solid material. The unrefined petroleum may be in an oil reservoir. The compound provided herein (e.g. a compound of formula (I), (II), or (III)) is pumped into the reservoir in accordance with known enhanced oil recovery parameters. The compound may be pumped into the reservoir as part of the aqueous compositions provided herein and, upon contacting the unrefined petroleum, form an emulsion composition provided herein.
- In some embodiments, the compound is present in an in amount sufficient to increase the water wettability of the solid material relative to the absence of the compound. The term “water wettability” as provided herein refers to the ability of a surface of being spreadable with water. In some embodiments, the natural solid material is rock or regolith. The natural solid material may be a geological formation such as clastics or carbonates. The natural solid material may be either consolidated or unconsolidated material or mixtures thereof. The hydrocarbon material may be trapped or confined by “bedrock” above or below the natural solid material. The hydrocarbon material may be found in fractured bedrock or porous natural solid material. In other embodiments, the regolith is soil. In some embodiments, the compound forms part of an aqueous composition comprising one or more co-surfactants and the hydrocarbon material is an unrefined petroleum material.
- In some embodiments, an emulsion forms after the contacting. The emulsion thus formed may be the emulsion composition as described above. In some embodiments, the method includes allowing an unrefined petroleum acid within the unrefined petroleum material to enter into the emulsion (e.g. emulsion composition), thereby converting the unrefined petroleum acid into a surfactant. In other words, where the unrefined petroleum acid converts into a surfactant it is mobilized and therefore separates from the solid material.
- In another aspect, a method of converting an unrefined petroleum acid into a surfactant is provided. The method includes contacting a petroleum material with an aqueous composition thereby forming an emulsion in contact with the petroleum material, wherein the aqueous composition includes the compound described herein (e.g. a compound of formula (I), (II), or (III)) and a co-surfactant. The aqueous composition may further include a co-surfactant. Thus, in some embodiments, the aqueous composition is the aqueous composition described above. And in some embodiments, the emulsion is the emulsion composition described above. An unrefined petroleum acid within said unrefined petroleum material is allowed to enter into the emulsion, thereby converting the unrefined petroleum acid into a surfactant. In some embodiments, the reactive petroleum material is in a petroleum reservoir. In some embodiments, as described above and as is generally known in the art, the unrefined petroleum acid is a naphthenic acid. In some embodiments, as described above and as is generally known in the art, the unrefined petroleum acid is a mixture of naphthenic acid.
- Schematic of synthesis of quaternary ammonium surfactant compound.
- Schematic of synthesis of betaine surfactant compound.
-
-
TABLE 1 Features of Oil # 1 used for examples disclosed in Figures 1 to 6.°API Crude Oil Gravity Viscosity Oil # 1 22 2.1 cP at 100° C. (diluted with 30% Cyclohexane) -
TABLE 2 Composition of brine used for examples disclosed in Figures 1 to 6. Brine Composition Formation Brine Synthetic Sea Water Na+ (ppm) 41,473 12,188 Ca2+ (ppm) 3,880 480 Mg2+ (ppm) 145 1,342 Cl− (ppm) 70,971 21,133 SO42− (ppm) 500 3,250 TDS (ppm) 116,969 38,393 - A compound having the formula:
- Wherein R1 is R12-substituted or unsubstituted C8-C150 alkyl, R6-substituted or unsubstituted heteroalkyl, R6-substituted or unsubstituted aryl or R6-substituted or unsubstituted cycloalkyl; R6 is R7-substituted or unsubstituted C1-C50 alkyl, R7-substituted or unsubstituted heteroalkyl, R7-substituted or unsubstituted aryl or R7-substituted or unsubstituted cycloalkyl; R7 is R8-substituted or unsubstituted C1-C50 alkyl, R8-substituted or unsubstituted heteroalkyl, R8-substituted or unsubstituted aryl or R8-substituted or unsubstituted cycloalkyl; R8 is R9-substituted or unsubstituted C1-C50 alkyl, R9-substituted or unsubstituted heteroalkyl, R9-substituted or unsubstituted aryl or R9-substituted or unsubstituted cycloalkyl; R9 is R10-substituted or unsubstituted C1-C50 alkyl, R10-substituted or unsubstituted heteroalkyl, R10-substituted or unsubstituted heteroalkyl, R10-substituted or unsubstituted aryl or R10-substituted or unsubstituted cycloalkyl; R10 is R11-substituted or unsubstituted C1-C50 alkyl, R11-substituted or unsubstituted heteroalkyl, R11-substituted or unsubstituted aryl or R11-substituted or unsubstituted cycloalkyl; R11 is unsubstituted C1-C50 alkyl, unsubstituted heteroalkyl, unsubstituted aryl or unsubstituted cycloalkyl; R12 is unsubstituted heteroalkyl, unsubstituted aryl or unsubstituted cycloalkyl; R2, R3, and R4 are independently unsubstituted alkyl, unsubstituted cycloalkyl, unsubstituted aryl, —OR11, —C(O)OR13, or —S(O)mR13; R13 is hydrogen, unsubstituted alkyl or unsubstituted cycloalkyl; m is 3 or 4; R5 is independently hydrogen or unsubstituted C1-C6 alkyl; L1, L2, L3, and L4 are independently a bond, substituted or unsubstituted alkylene, substituted or unsubstituted heteroalkylene, substituted or unsubstituted cycloalkylene, or substituted or unsubstituted arylene; and n is an integer from 10 to 210.
- The compound of
embodiment 1, wherein R1 is branched or linear unsubstituted C10-C100 alkyl, R6-substituted or unsubstituted C10-C100 heteroalkyl, or R6-substituted phenyl. - The compound of
embodiments 1 or 2, wherein R1 is branched unsubstituted C10-C50 alkyl, branched unsubstituted C10-C50 heteroalkyl, (C6H5—CH2CH2)3C6H2—, (C6H5—CH2CH2)2C6H3—, (C6H5—CH2CH2)1C6H4—, or R6-substituted or unsubstituted naphthyl. - The compound of any one of embodiments 1-3, wherein R1 is branched unsubstituted C16-C40 heteroalkyl.
- The compound of any one of embodiments 1-4, wherein L1 is substituted C1-C5 alkylene.
- The compound of any one of embodiments 1-5, wherein L1 is substituted propylene.
- The compound of any one of embodiments 1-6, wherein L1 is having the structure:
- The compound of any one of embodiments 1-7, wherein R2, R3, and R4 are independently —OR13 or —C(O)OR13.
- The compound of any one of embodiments 1-8, wherein R13 is hydrogen.
- The compound of any one of embodiments 1-6, wherein R2, R3, and R4 are —OH and L2, L3, and L4 are unsubstituted C1-C4 alkylene.
- The compound of any one of embodiments 1-6, wherein L2, L3, and L4 are ethylene.
- The compound of any one of embodiments 1-11, wherein R2 and R4 are independently —OR13 and R3 is —C(O)O R13.
- The compound of embodiment 8, wherein R13 is hydrogen and L2, L3, and L4 are unsubstituted C1-C4 alkylene.
- The compound of
embodiment 1, wherein R2 and R4 are independently —OR13 and R3 is —S(O)3R13. - The compound of
embodiment 10, wherein R13 is hydrogen and L2, L3, and L4 are independently unsubstituted C1-C4 alkylene. - The compound of any one of embodiments 1-15, wherein R5 is independently hydrogen or unsubstituted C1-C2 alkyl.
- The compound of any one of embodiments 1-16, wherein n is 5 to 100.
- The compound of embodiment 1 having the formula:
- wherein o is an integer from 20 to 100; p is an integer from 10 to 80; and R5 is unsubstituted C1-C3 alkyl.
- The compound of embodiment 13, wherein R5 is methyl.
- The compound of embodiments 18 or 19, wherein R1 is branched C15-C40 heteroalkyl, o is 35 to 50 and p is 15 to 65.
- The compound of embodiment 1 having the formula:
- wherein p is an integer from 10 to 100; o is an integer from 20 to 80; q is an integer from 0 to 60; and R5 is unsubstituted C1-C3 alkyl.
- The compound of embodiment 21, wherein R5 is ethyl.
- An aqueous composition comprising a co-surfactant and the compound of one of
embodiments 1 to 22. - The aqueous composition of embodiment 23, wherein said co-surfactant is an anionic surfactant, a non-ionic surfactant, or a cationic surfactant.
- The aqueous composition of embodiments 23 or 24, wherein said co-surfactant is an internal olefin sulfonate (IOS), an alfa olefin sulfonate (AOS), an alkyl aryl sulfonate (ARS), an alkane sulfonate, a petroleum sulfonate, an alkyl diphenyl oxide (di)sulfonate, an alcohol sulfate, an alkoxy sulfate, an alkoxy sulfonate, an alcohol phosphate, an alkoxy phosphate, a sulfosuccinate ester, an alcohol ethoxylate, an alkyl phenol ethoxylate, a betaine or sultaine.
- The aqueous composition of any one of embodiments 23-25, wherein said co-surfactant is a C10-C30 internal olefin sulfate (IOS).
- The aqueous composition of any one of embodiments 23-26, further comprising a co-solvent.
- The aqueous composition of any one of embodiments 23-27, further comprising an alkali agent.
- The composition of any one of embodiments 23-28, wherein said alkali agent is NaOH, KOH, LiOH, Na2CO3, NaHCO3, Na-metaborate, Na silicate, Na orthosilicate, or NH4OH.
- The aqueous composition of any one of embodiments 23-29, further comprising a gas.
- The aqueous composition of any one of embodiments 23-30, wherein the temperature of said aqueous composition is approximately about 100° C.
- The aqueous composition of any one of embodiments 23-31, having a salinity of at least 10,000 ppm.
- The aqueous composition of any one of embodiments 23-32, having a salinity of at least 50,000 ppm.
- The aqueous composition of any one of embodiments 23-33, having a salinity of at least 100,000 ppm.
- The aqueous composition of any one of embodiments 23-34, wherein said compound is present at an amount of approximately 0.2% w/w.
- An emulsion composition comprising an unrefined petroleum phase and the compound of one of
embodiments 1 to 22. - The emulsion composition of embodiment 36, further comprising a co-surfactant.
- The emulsion composition of embodiments 36 or 37, wherein the viscosity of the emulsion composition is less than the viscosity in the absence of the compound.
- The emulsion composition of any one of embodiments 36-38, wherein the interfacial tension of the emulsion composition is less than the interfacial tension in the absence of the compound.
- The emulsion composition of any one of embodiments 36-39, wherein the emulsion composition is a microemulsion.
- A method of displacing a hydrocarbon material in contact with a solid material, said method comprising:
- (i) contacting a hydrocarbon material with the compound of one of
embodiments 1 to 22, wherein said hydrocarbon material is in contact with a solid material;
(ii) allowing said hydrocarbon material to separate from said solid material thereby displacing said hydrocarbon material in contact with said solid material. - The method of embodiment 41, further comprising contacting the solid material with the compound.
- The method of embodiments 41 or 42, wherein said compound is present in an amount sufficient to increase the water wettability of said solid material relative to the absence of said compound.
- The method of any one of embodiments 41-43, wherein said hydrocarbon material is unrefined petroleum in a petroleum reservoir and said solid material is a natural solid material in a petroleum reservoir.
- The method of any one of embodiments 41-44, wherein said method is an enhanced oil recovery method.
- The method of any one of embodiments 41-45, wherein said solid material is rock or regolith.
- The method of embodiment 46, wherein said regolith is soil.
- The method of any one of embodiments 41-47, wherein said compound forms part of an aqueous composition comprising a co-surfactant and said hydrocarbon material is an unrefined petroleum material.
- The method of any one of embodiments 41-48, wherein an emulsion forms after said contacting.
- The method of any one of embodiments 41-49, wherein said method further comprises allowing an unrefined petroleum acid within said unrefined petroleum material to enter into said emulsion, thereby converting said unrefined petroleum acid into a surfactant.
- A method of converting an unrefined petroleum acid into a surfactant, said method comprising:
- (i) contacting a petroleum material with an aqueous composition thereby forming an emulsion in contact with said petroleum material, wherein said aqueous composition comprises the compound of one of
embodiments 1 to 22 and a co-surfactant;
(ii) allowing an unrefined petroleum acid within said unrefined petroleum material to enter into said emulsion, thereby converting said unrefined petroleum acid into a surfactant. - The method of embodiment 51, wherein said reactive petroleum material is in a petroleum reservoir.
Claims (43)
1. (canceled)
2. (canceled)
3. (canceled)
4. (canceled)
5. (canceled)
6. (canceled)
7. (canceled)
8. (canceled)
9. (canceled)
10. (canceled)
11. (canceled)
12. (canceled)
13. (canceled)
14. (canceled)
15. (canceled)
16. (canceled)
17. (canceled)
18. (canceled)
19. (canceled)
20. (canceled)
21. A method of displacing a hydrocarbon material in contact with a solid material, the method comprising:
(i) contacting a hydrocarbon material with a compound having the formula:
wherein
R1 is R12-substituted or unsubstituted C8-C150 alkyl, R6-substituted or unsubstituted heteroalkyl, R6-substituted or unsubstituted aryl or R6-substituted or unsubstituted cycloalkyl;
R6 is R7-substituted or unsubstituted C1-C50 alkyl, R7-substituted or unsubstituted heteroalkyl, R7-substituted or unsubstituted aryl or R7-substituted or unsubstituted cycloalkyl;
R7 is R8-substituted or unsubstituted C1-C50 alkyl, R8-substituted or unsubstituted heteroalkyl, R8-substituted or unsubstituted aryl or R8-substituted or unsubstituted cycloalkyl;
R8 is R9-substituted or unsubstituted C1-C50 alkyl, R9-substituted or unsubstituted heteroalkyl, R9-substituted or unsubstituted aryl or R9-substituted or unsubstituted cycloalkyl;
R9 is R10-substituted or unsubstituted C1-C50 alkyl, R10-substituted or unsubstituted heteroalkyl, R10-substituted or unsubstituted heteroalkyl, R10-substituted or unsubstituted aryl or R10-substituted or unsubstituted cycloalkyl;
R10 is R11-substituted or unsubstituted C1-C50 alkyl, R11-substituted or unsubstituted heteroalkyl, R11-substituted or unsubstituted aryl or R11-substituted or unsubstituted cycloalkyl;
R11 is unsubstituted C1-C50 alkyl, unsubstituted heteroalkyl, unsubstituted aryl or unsubstituted cycloalkyl;
R12 is unsubstituted heteroalkyl, unsubstituted aryl or unsubstituted cycloalkyl:
R2, R3, and R4 are independently unsubstituted alkyl, unsubstituted cycloalkyl, unsubstituted aryl, —OR13, —C(O)OR13, or —S(O)mR13;
R13 is hydrogen, unsubstituted alkyl or unsubstituted cycloalkyl;
m is 3 or 4;
R5 is independently hydrogen or unsubstituted C1-C6 alkyl;
L1, L2, L3, and L4 are independently a bond, substituted or unsubstituted alkylene, substituted or unsubstituted hetroalkylene, substituted or unsubstituted cycloalkylene, or substituted or unsubstituted arylene; and
n is an integer from 10 to 210, wherein the hydrocarbon material is in contact with a solid material;
(ii) allowing the hydrocarbon material to separate from the solid material thereby displacing the hydrocarbon material in contact with the solid material.
22. (canceled)
23. The method of claim 21 , wherein R1 is branched unsubstituted C16-C40 heteroalkyl.
24. The method of claim 21 , wherein L1 is substituted propylene.
25. The method of claim 21 , wherein R2, R3, and R4 are independently —OR13 or —C(O)OR13.
26. The method of claim 25 , wherein R13 is hydrogen.
27. The method of claim 26 , wherein R2, R3, and R4 are —OH and L2, L3, and L4 are unsubstituted C1-C4 alkylene.
28. The method of claim 27 , wherein L2, L3, and L4 are ethylene.
29. The method of claim 21 , wherein R2 and R4 are independently —OR13 and R3 is —C(O)OR13.
30. The method of claim 29 , wherein R13 is hydrogen and L2, L3, and L4 are unsubstituted C1-C4 alkylene.
31. The method of claim 21 , wherein R2 and R4 are independently —OR13 and R3 is —S(O)3R13.
32. The method of claim 21 , wherein R5 is independently hydrogen or unsubstituted C1-C2 alkyl.
33. The method of claim 21 , wherein n is 5 to 100.
35. The method of claim 21 , wherein o is greater than p.
36. The method of claim 21 , further comprising contacting the solid material with the compound.
37. The method of claim 21 , wherein the compound is present in an amount sufficient to increase the water wettability of the solid material relative to the absence of the compound.
38. The method of claim 21 , wherein the hydrocarbon material is unrefined petroleum in a petroleum reservoir and the solid material is a natural solid material in a petroleum reservoir.
39. The method of claim 38 , wherein the method is an enhanced oil recovery method.
40. The method of claim 21 , wherein the solid material is rock or regolith.
41. The method of claim 21 , wherein the compound forms part of an aqueous composition comprising a co-surfactant and the hydrocarbon material is an unrefined petroleum material.
42. The method of claim 21 , wherein an emulsion forms after the contacting.
43. The method of claim 21 , wherein the method further comprises allowing an unrefined petroleum acid within the unrefined petroleum material to enter into the emulsion, thereby converting the unrefined petroleum acid into a surfactant.
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US14/935,109 US20160069168A1 (en) | 2012-04-19 | 2015-11-06 | Novel large hydrophobe quaternary ammonium surfactants |
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US201261635796P | 2012-04-19 | 2012-04-19 | |
US13/866,807 US9206347B2 (en) | 2012-04-19 | 2013-04-19 | Quaternary ammonium surfactants |
US14/935,109 US20160069168A1 (en) | 2012-04-19 | 2015-11-06 | Novel large hydrophobe quaternary ammonium surfactants |
Related Parent Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US13/866,807 Division US9206347B2 (en) | 2012-04-19 | 2013-04-19 | Quaternary ammonium surfactants |
Publications (1)
Publication Number | Publication Date |
---|---|
US20160069168A1 true US20160069168A1 (en) | 2016-03-10 |
Family
ID=49379127
Family Applications (2)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US13/866,807 Expired - Fee Related US9206347B2 (en) | 2012-04-19 | 2013-04-19 | Quaternary ammonium surfactants |
US14/935,109 Abandoned US20160069168A1 (en) | 2012-04-19 | 2015-11-06 | Novel large hydrophobe quaternary ammonium surfactants |
Family Applications Before (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US13/866,807 Expired - Fee Related US9206347B2 (en) | 2012-04-19 | 2013-04-19 | Quaternary ammonium surfactants |
Country Status (3)
Country | Link |
---|---|
US (2) | US9206347B2 (en) |
AR (1) | AR090724A1 (en) |
WO (1) | WO2013159054A1 (en) |
Cited By (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US20150203740A1 (en) * | 2011-09-15 | 2015-07-23 | Chevron U.S.A. Inc. | Mixed carbon length synthesis of primary guerbet alcohols |
CN111440605A (en) * | 2020-03-26 | 2020-07-24 | 天津博弘化工有限责任公司 | Preparation method of microbial surface activity synergist |
Families Citing this family (8)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US9670396B2 (en) * | 2013-01-16 | 2017-06-06 | Shell Oil Company | Method, system, and composition for producing oil |
WO2014201854A1 (en) * | 2013-06-17 | 2014-12-24 | 中国石油化工股份有限公司 | Surfactant composition, and manufacturing method and application of same |
MX2017001904A (en) * | 2014-08-12 | 2017-04-27 | China Petroleum & Chem Corp | Surfactant composition and preparation method therefor and application thereof. |
US9828815B2 (en) * | 2014-09-11 | 2017-11-28 | Baker Hughes, A Ge Company, Llc | Foamed fluid compositions having high salinity using anionic surfactants and methods therefor |
TW201728616A (en) | 2015-10-09 | 2017-08-16 | 克萊瑞特國際股份有限公司 | Cashew nutshell liquid alkoxylate sulfate as a new renewable surfactant composition for enhanced oil recovery applications |
CN110709445B (en) | 2017-04-05 | 2023-08-08 | 毕克化学有限公司 | Monoepoxide-monoamine adducts as wetting and dispersing agents |
WO2019030228A1 (en) | 2017-08-08 | 2019-02-14 | Byk-Chemie Gmbh | An acid funtional compound |
CN112228018A (en) * | 2019-07-15 | 2021-01-15 | 中国石油化工股份有限公司 | CO with amidino compounds2Oil displacement method |
Family Cites Families (33)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3972855A (en) * | 1971-11-19 | 1976-08-03 | Modokemi Aktiebolag | Quaternary ammonium compounds and treatment of plastic and other materials therewith |
US3811505A (en) | 1973-01-29 | 1974-05-21 | Texaco Inc | Surfactant oil recovery process usable in formations containing water having high concentrations of polyvalent ions such as calcium and magnesium |
US3890239A (en) | 1973-02-01 | 1975-06-17 | Sun Oil Co | Surfactant compositions useful in oil recovery processes |
US3811504A (en) | 1973-02-09 | 1974-05-21 | Texaco Inc | Surfactant oil recovery process usable in formations containing water having high concentrations of polyvalent ions such as calcium and magnesium |
US3811507A (en) | 1973-03-05 | 1974-05-21 | Texaco Inc | Surfactant oil recovery process usable in formations containing water having high concentration of polyvalent ions such as calcium and magnesium |
US4463806A (en) | 1980-12-30 | 1984-08-07 | Mobil Oil Corporation | Method for surfactant waterflooding in a high brine environment |
US4738789A (en) * | 1983-06-20 | 1988-04-19 | Jones L W | Surfactant solvent composition |
JPS61137846A (en) | 1984-11-21 | 1986-06-25 | アトランテイツク・リツチフイールド・カンパニー | Alkoxylated quaternary ammonium compound |
CH685243A5 (en) * | 1992-07-17 | 1995-05-15 | Sandoz Ag | Amphotensidhaltige wax compositions, their production and use. |
US5311943A (en) | 1992-10-19 | 1994-05-17 | Shell Oil Company | Blends of propoxy and ethoxy surfactants |
US6017874A (en) | 1995-09-29 | 2000-01-25 | The Procter & Gamble Company | Liquid laundry detergents containing selected quaternary ammonium compounds |
US6022843A (en) | 1998-09-09 | 2000-02-08 | The Clorox Company | Non-phosphate, agglomerated laundry booster |
GB0002749D0 (en) | 2000-02-07 | 2000-03-29 | Unilever Plc | Detergent compositions |
US6225267B1 (en) | 2000-04-04 | 2001-05-01 | Ck Witco Corporation | Sodium sulfonate blends as emulsifiers for petroleum oils |
US20020147366A1 (en) | 2000-07-07 | 2002-10-10 | Wiggins Michael S. | Alkoxylated tertiary and quaternary amine surfactants |
AU2002318146B2 (en) | 2001-05-21 | 2007-05-10 | Monsanto Technology Llc | Pesticide concentrates containing etheramine surfactants |
US7055602B2 (en) | 2003-03-11 | 2006-06-06 | Shell Oil Company | Method and composition for enhanced hydrocarbons recovery |
US20050199395A1 (en) | 2004-03-10 | 2005-09-15 | Berger Paul D. | Oil recovery method using alkali and alkylaryl sulfonate surfactants derived from broad distribution alpha-olefins |
US20070191633A1 (en) | 2006-02-15 | 2007-08-16 | Christie Huimin Berger | Mixed anionic surfactant composition for oil recovery |
US7772162B2 (en) | 2006-03-27 | 2010-08-10 | Board Of Regents, The University Of Texas System | Use of fluorocarbon surfactants to improve the productivity of gas and gas condensate wells |
WO2008079855A2 (en) | 2006-12-21 | 2008-07-03 | Shell Oil Company | Enhanced oil recovery systems and consumer products containing secondary alcohol derivatives |
US7629299B2 (en) | 2007-01-20 | 2009-12-08 | Oil Chem Technologies | Process for recovering residual oil employing alcohol ether sulfonates |
MX2010005870A (en) | 2007-11-30 | 2010-08-02 | Univ Texas | Methods for improving the productivity of oil producing wells. |
US7985718B2 (en) | 2008-04-21 | 2011-07-26 | Basf Se | Use of surfactant mixtures for tertiary mineral oil extraction |
US20110201531A1 (en) | 2008-06-02 | 2011-08-18 | Board Of Regents, The University Of Texas System | Method for Treating Hydrocarbon-Bearing Formations with Fluorinated Epoxides |
US20100048432A1 (en) | 2008-08-22 | 2010-02-25 | Costello Michael T | Enhanced oil recovery using sulfonate mixtures |
TW201124524A (en) | 2009-08-20 | 2011-07-16 | Chevron Oronite Co | Improved enhanced oil recovery surfactant composition and method of making the same |
US8459360B2 (en) | 2009-09-02 | 2013-06-11 | Board Of Regents, The University Of Texas System | Di-functional surfactants for enhanced oil recovery |
AU2010292142B2 (en) | 2009-09-10 | 2014-11-06 | Board Of Regents, The University Of Texas System | Process of using hard brine at high alkalinity for enhanced oil recovery (EOR) applications |
US8211837B2 (en) | 2009-09-22 | 2012-07-03 | Board Of Regents, The University Of Texas System | Method of manufacture and use of large hydrophobe ether sulfate surfactants in enhanced oil recovery (EOR) applications |
CA2777755C (en) | 2009-10-20 | 2016-04-26 | Soane Energy, Llc | Tunable polymeric surfactants for mobilizing oil into water |
RU2012136632A (en) | 2010-01-28 | 2014-03-10 | Борд Оф Риджентс, Дзе Юниверсити Оф Техас Систем | Alkoxylated styrylphenol sulfate as a new surfactant composition for use in the tertiary oil recovery method |
AR082740A1 (en) | 2010-08-27 | 2012-12-26 | Univ Texas | CARBOXYL ALCOXI, WATERPROOF COMPOSITION AND HYDROCARBON MATERIAL DISPOSAL |
-
2013
- 2013-04-17 AR ARP130101263A patent/AR090724A1/en unknown
- 2013-04-19 US US13/866,807 patent/US9206347B2/en not_active Expired - Fee Related
- 2013-04-19 WO PCT/US2013/037470 patent/WO2013159054A1/en active Application Filing
-
2015
- 2015-11-06 US US14/935,109 patent/US20160069168A1/en not_active Abandoned
Cited By (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US20150203740A1 (en) * | 2011-09-15 | 2015-07-23 | Chevron U.S.A. Inc. | Mixed carbon length synthesis of primary guerbet alcohols |
US9605198B2 (en) * | 2011-09-15 | 2017-03-28 | Chevron U.S.A. Inc. | Mixed carbon length synthesis of primary Guerbet alcohols |
US9617464B2 (en) | 2011-09-15 | 2017-04-11 | Chevron U.S.A. Inc. | Mixed carbon length synthesis of primary guerbet alcohols |
CN111440605A (en) * | 2020-03-26 | 2020-07-24 | 天津博弘化工有限责任公司 | Preparation method of microbial surface activity synergist |
Also Published As
Publication number | Publication date |
---|---|
AR090724A1 (en) | 2014-12-03 |
US20130277276A1 (en) | 2013-10-24 |
US9206347B2 (en) | 2015-12-08 |
WO2013159054A1 (en) | 2013-10-24 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US9206347B2 (en) | Quaternary ammonium surfactants | |
US9783729B2 (en) | Alkoxy carboxylate surfactants | |
Tackie-Otoo et al. | Alternative chemical agents for alkalis, surfactants and polymers for enhanced oil recovery: Research trend and prospects | |
US9862877B2 (en) | Alkyl hydrophobe surfactants | |
US20130252855A1 (en) | Novel use of a mild alkaline agent in chemical eor | |
US9988346B2 (en) | Large hydrophobe surfactants | |
US10876038B2 (en) | Short hydrophobe anionic surfactants | |
US20170044423A1 (en) | Gemini epoxide surfactant compositions | |
US20220025247A1 (en) | Methods for hydrocarbon recovery using alkoxylate emulsions | |
US20150048007A1 (en) | Multivalent mineral cation tolerant alkali system for chemical eor | |
US10106725B2 (en) | Light co-solvent compositions | |
US10167421B2 (en) | Phenol-alkoxylate co-solvent surfactant composition | |
US10899693B2 (en) | Alkoxylated co-solvents | |
US9127210B2 (en) | Short chain alkylamine alkoxylate compositions | |
WO2015138444A1 (en) | Ammonia nh4x compositions for use with hard brine | |
Pope et al. | Large hydrophobe surfactants | |
Pope et al. | Quaternary ammonium surfactants |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
AS | Assignment |
Owner name: BOARD OF REGENTS, THE UNIVERSITY OF TEXAS SYSTEM, Free format text: ASSIGNMENT OF ASSIGNORS INTEREST;ASSIGNORS:WEERASOORIYA, UPALI P.;POPE, GARY A.;MOHANTY, KISHORE;SIGNING DATES FROM 20151117 TO 20151118;REEL/FRAME:037214/0730 |
|
STCB | Information on status: application discontinuation |
Free format text: ABANDONED -- FAILURE TO RESPOND TO AN OFFICE ACTION |