US10189811B2 - Method for preparing the anhydrous crystalline form of isoniazid-derived hydrazone, thus produced cristalline polymorph of the anhydrous form, use thereof for the treatment of Alzheimer's disease, parkinsonism and other neurodegenerative disorders, and pharmaceutical composition - Google Patents
Method for preparing the anhydrous crystalline form of isoniazid-derived hydrazone, thus produced cristalline polymorph of the anhydrous form, use thereof for the treatment of Alzheimer's disease, parkinsonism and other neurodegenerative disorders, and pharmaceutical composition Download PDFInfo
- Publication number
- US10189811B2 US10189811B2 US15/106,181 US201415106181A US10189811B2 US 10189811 B2 US10189811 B2 US 10189811B2 US 201415106181 A US201415106181 A US 201415106181A US 10189811 B2 US10189811 B2 US 10189811B2
- Authority
- US
- United States
- Prior art keywords
- inhhq
- anhydrous
- crystalline polymorph
- stretching
- anhydrous form
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 4
- 238000000034 method Methods 0.000 title abstract description 14
- 208000024827 Alzheimer disease Diseases 0.000 title abstract description 10
- 150000007857 hydrazones Chemical class 0.000 title abstract description 8
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 title abstract description 7
- 229960003350 isoniazid Drugs 0.000 title abstract description 6
- 208000027089 Parkinsonian disease Diseases 0.000 title abstract 2
- 206010034010 Parkinsonism Diseases 0.000 title abstract 2
- 208000015122 neurodegenerative disease Diseases 0.000 title description 6
- 230000003993 interaction Effects 0.000 claims description 16
- 239000013078 crystal Substances 0.000 claims description 13
- 238000002329 infrared spectrum Methods 0.000 claims description 8
- 238000002441 X-ray diffraction Methods 0.000 claims description 4
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 4
- 238000000921 elemental analysis Methods 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 238000012856 packing Methods 0.000 claims description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- QQUJBYPCLIELSF-UHFFFAOYSA-N N-[(8-hydroxyquinolin-2-yl)methylideneamino]pyridine-4-carboxamide Chemical compound N1=C2C(O)=CC=CC2=CC=C1C=NNC(=O)C1=CC=NC=C1 QQUJBYPCLIELSF-UHFFFAOYSA-N 0.000 abstract description 6
- 230000009102 absorption Effects 0.000 description 11
- 238000010521 absorption reaction Methods 0.000 description 11
- 229910014033 C-OH Inorganic materials 0.000 description 10
- 229910014570 C—OH Inorganic materials 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 10
- 238000003775 Density Functional Theory Methods 0.000 description 8
- 102000003802 alpha-Synuclein Human genes 0.000 description 7
- 108090000185 alpha-Synuclein Proteins 0.000 description 7
- 239000003814 drug Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 208000018737 Parkinson disease Diseases 0.000 description 6
- 238000001069 Raman spectroscopy Methods 0.000 description 6
- DZHSAHHDTRWUTF-SIQRNXPUSA-N amyloid-beta polypeptide 42 Chemical compound C([C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(O)=O)[C@@H](C)CC)C(C)C)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C(C)C)C1=CC=CC=C1 DZHSAHHDTRWUTF-SIQRNXPUSA-N 0.000 description 6
- 239000010949 copper Substances 0.000 description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 5
- 238000005033 Fourier transform infrared spectroscopy Methods 0.000 description 5
- 238000001237 Raman spectrum Methods 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 229910052802 copper Inorganic materials 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- 230000004770 neurodegeneration Effects 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- QCDFBFJGMNKBDO-UHFFFAOYSA-N Clioquinol Chemical compound C1=CN=C2C(O)=C(I)C=C(Cl)C2=C1 QCDFBFJGMNKBDO-UHFFFAOYSA-N 0.000 description 4
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 4
- 238000004057 DFT-B3LYP calculation Methods 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 201000010099 disease Diseases 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- -1 samarium(III) compound Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 3
- SLBPIHCMXPQAIQ-UHFFFAOYSA-N 8-hydroxyquinoline-2-carbaldehyde Chemical compound C1=C(C=O)N=C2C(O)=CC=CC2=C1 SLBPIHCMXPQAIQ-UHFFFAOYSA-N 0.000 description 3
- 206010012289 Dementia Diseases 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 238000005452 bending Methods 0.000 description 3
- 230000008499 blood brain barrier function Effects 0.000 description 3
- 210000001218 blood-brain barrier Anatomy 0.000 description 3
- 238000004364 calculation method Methods 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910021645 metal ion Inorganic materials 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229960003540 oxyquinoline Drugs 0.000 description 3
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- 208000037259 Amyloid Plaque Diseases 0.000 description 2
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 238000001157 Fourier transform infrared spectrum Methods 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- HOKKHZGPKSLGJE-GSVOUGTGSA-N N-Methyl-D-aspartic acid Chemical compound CN[C@@H](C(O)=O)CC(O)=O HOKKHZGPKSLGJE-GSVOUGTGSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 238000004220 aggregation Methods 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 229960005228 clioquinol Drugs 0.000 description 2
- 230000003920 cognitive function Effects 0.000 description 2
- 238000004590 computer program Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 230000003406 mycobactericidal effect Effects 0.000 description 2
- 210000002682 neurofibrillary tangle Anatomy 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000005457 optimization Methods 0.000 description 2
- JJVNINGBHGBWJH-UHFFFAOYSA-N ortho-vanillin Chemical compound COC1=CC=CC(C=O)=C1O JJVNINGBHGBWJH-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- 238000001845 vibrational spectrum Methods 0.000 description 2
- 238000012584 2D NMR experiment Methods 0.000 description 1
- WHBMMWSBFZVSSR-UHFFFAOYSA-N 3-hydroxybutyric acid Chemical compound CC(O)CC(O)=O WHBMMWSBFZVSSR-UHFFFAOYSA-N 0.000 description 1
- SJZRECIVHVDYJC-UHFFFAOYSA-N 4-hydroxybutyric acid Chemical compound OCCCC(O)=O SJZRECIVHVDYJC-UHFFFAOYSA-N 0.000 description 1
- 150000004325 8-hydroxyquinolines Chemical class 0.000 description 1
- 208000000044 Amnesia Diseases 0.000 description 1
- 206010003694 Atrophy Diseases 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 102100026816 DNA-dependent metalloprotease SPRTN Human genes 0.000 description 1
- 101710175461 DNA-dependent metalloprotease SPRTN Proteins 0.000 description 1
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical group CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- 101100208721 Mus musculus Usp5 gene Proteins 0.000 description 1
- 206010061323 Optic neuropathy Diseases 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 238000004617 QSAR study Methods 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- QQUJBYPCLIELSF-VCHYOVAHSA-N [H]N(/N=C/C1=NC2=C(C=CC=C2O)C=C1)C(=O)C1=CC=NC=C1 Chemical compound [H]N(/N=C/C1=NC2=C(C=CC=C2O)C=C1)C(=O)C1=CC=NC=C1 QQUJBYPCLIELSF-VCHYOVAHSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 231100000215 acute (single dose) toxicity testing Toxicity 0.000 description 1
- 238000011047 acute toxicity test Methods 0.000 description 1
- 125000000539 amino acid group Chemical group 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 229940041181 antineoplastic drug Drugs 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000037444 atrophy Effects 0.000 description 1
- 238000005284 basis set Methods 0.000 description 1
- 230000003542 behavioural effect Effects 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000544 cholinesterase inhibitor Substances 0.000 description 1
- 208000030251 communication disease Diseases 0.000 description 1
- 238000000205 computational method Methods 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 230000001054 cortical effect Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000012926 crystallographic analysis Methods 0.000 description 1
- 238000002447 crystallographic data Methods 0.000 description 1
- 238000013480 data collection Methods 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 238000002050 diffraction method Methods 0.000 description 1
- 238000002224 dissection Methods 0.000 description 1
- 238000009509 drug development Methods 0.000 description 1
- IOIFRTZBJMZZFO-UHFFFAOYSA-N dysprosium(3+) Chemical compound [Dy+3] IOIFRTZBJMZZFO-UHFFFAOYSA-N 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- JHFPQYFEJICGKC-UHFFFAOYSA-N erbium(3+) Chemical compound [Er+3] JHFPQYFEJICGKC-UHFFFAOYSA-N 0.000 description 1
- LNBHUCHAFZUEGJ-UHFFFAOYSA-N europium(3+) Chemical compound [Eu+3] LNBHUCHAFZUEGJ-UHFFFAOYSA-N 0.000 description 1
- 238000004661 exchange-correlation potential Methods 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 229910001447 ferric ion Inorganic materials 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 238000005570 heteronuclear single quantum coherence Methods 0.000 description 1
- SCKNFLZJSOHWIV-UHFFFAOYSA-N holmium(3+) Chemical compound [Ho+3] SCKNFLZJSOHWIV-UHFFFAOYSA-N 0.000 description 1
- 238000000126 in silico method Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 238000009830 intercalation Methods 0.000 description 1
- 230000002687 intercalation Effects 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000000797 iron chelating agent Substances 0.000 description 1
- 229940075525 iron chelating agent Drugs 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 231100000863 loss of memory Toxicity 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- 125000001360 methionine group Chemical group N[C@@H](CCSC)C(=O)* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 description 1
- 230000000926 neurological effect Effects 0.000 description 1
- 210000002569 neuron Anatomy 0.000 description 1
- 230000002981 neuropathic effect Effects 0.000 description 1
- 239000002547 new drug Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 238000010606 normalization Methods 0.000 description 1
- 238000006384 oligomerization reaction Methods 0.000 description 1
- 238000000238 one-dimensional nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- 208000020911 optic nerve disease Diseases 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000036542 oxidative stress Effects 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000000634 powder X-ray diffraction Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 208000020016 psychiatric disease Diseases 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 230000002000 scavenging effect Effects 0.000 description 1
- 230000021148 sequestering of metal ion Effects 0.000 description 1
- 238000004467 single crystal X-ray diffraction Methods 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- HKCRVXUAKWXBLE-UHFFFAOYSA-N terbium(3+) Chemical class [Tb+3] HKCRVXUAKWXBLE-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- AWSFICBXMUKWSK-UHFFFAOYSA-N ytterbium(3+) Chemical compound [Yb+3] AWSFICBXMUKWSK-UHFFFAOYSA-N 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/14—Drugs for disorders of the nervous system for treating abnormal movements, e.g. chorea, dyskinesia
- A61P25/16—Anti-Parkinson drugs
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07B—GENERAL METHODS OF ORGANIC CHEMISTRY; APPARATUS THEREFOR
- C07B2200/00—Indexing scheme relating to specific properties of organic compounds
- C07B2200/13—Crystalline forms, e.g. polymorphs
Definitions
- the present invention regards the preparation method of the anhydrous crystalline form of an isoniazid-derived hydrazone (namely, 8-hydroxyquinoline-2-carboxaldehyde isonicotinoyl hydrazone, or INHHQ), the polymorph produced and its use, in any pharmaceutical composition, for the treatment of Alzheimer's and Parkinson's diseases, as well as other neurodegenerative disorders.
- an isoniazid-derived hydrazone namely, 8-hydroxyquinoline-2-carboxaldehyde isonicotinoyl hydrazone, or INHHQ
- AD Alzheimer's disease
- Alois Alzheimer the german neuropathologist Alois Alzheimer
- Dementia is characterized by progressive loss of memory and cognitive functions, among other diagnostic criteria, being most of them present in the Diagnostic and Statistical Manual of Mental Disorders and described on the National Institute of Neurological and Communicative Disorders Association.
- the disease has two general classifications: 1) late onset, which occurs with the highest incidence at about 60 years of age, and 2) early onset, occurring around 40 years. In the US and Great Britain, it represents about 50% of cases of dementia, being estimated that it is the fourth leading cause of deaths of elderly in these countries.
- the neuropathological aspect patients show diffuse cortical atrophy, presence of senile plaques and neurofibrillary tangles, neurovascular degeneration and neuronal loss.
- senile plaques are characterized mainly by the presence of fibrillar deposits of ⁇ -amyloid peptide (A ⁇ ), consisting of approx. 40 amino-acid residues. It has been observed high concentration of physiological metal ions such as Zn 2+ and Cu 2+ , in these plaques, which is considered indicative that the interaction of A ⁇ with these biometais is at the heart of events that lead to aggregation and toxicity of this peptide.
- the ferric ions in turn, have also been related to the aggregation of neurofibrillary tangles, in addition to contributing to the oxidative processes that occur in the nerve cells of the body. Something similar occurs in Parkinson's disease with the protein ⁇ -synuclein.
- the already approved drugs for the treatment of AD are intended to combat deficits associated with reduced cerebral function and fall into two classes: acetylcholinesterase inhibitors and inhibitors of NMDA (N-Methyl-D-Aspartate) receptors.
- NMDA N-Methyl-D-Aspartate
- Such drugs seem to act in enhancing the remain of the cognitive function, however, are not able to prevent the progression of the disease, being, therefore, important the development of new therapeutic agents that hold the advance of neurodegeneration as well as, as far as possible, promote their regression.
- an interesting approach is to obtain compounds that inhibit, specifically, abnormal metal-protein interactions.
- This class of drugs is known as MPACs (metal-protein attenuating compounds) and relate to the allocation and distribution normalization of physiological metal ions.
- CQ or PBT1 clioquinol
- 8-hydroxyquinoline-2-carboxaldehyde isonicotinoyl hydrazone was first described in a series of publications from the year 2009, in which its interactions with some rare earths ions, namely, dysprosium(III), europium(III), holmium(III), neodymium(III), and ytterbium(III) were examined. Erbium(III) and terbium(III) complexes were reported in 2010, while the samarium(III) compound was described in 2011.
- the anhydrous crystalline form described herein is characterized by its melting point, elemental analysis, crystal structure (single-crystal diffraction), powder diffraction pattern, and vibrational spectra.
- FIG. 1 ORTEP representation of the compound INHHQ, showing the identification scheme of the constituent atoms;
- FIG. 2 Perspective views of INHHQ showing: (a) the hydrogen-bonding network, (b) the ⁇ - ⁇ and the O1-H12 . . . ⁇ stacking interactions and (c) the 3D crystalline packing along the crystallographic axis a;
- FIG. 3 Simulated and experimental X-ray diffractograms for INHHQ
- FIG. 4 Most stable calculated structure in the gas-phase (Conf. 5). Level of theory: B3LYP/6-311+G (d,p);
- FIG. 5 FTIR (above) and Raman (below) spectra of INHHQ
- FIG. 6 2D 1 H ⁇ 15 N HSQC contour plots showing that the addition of INHHQ (4 eq.) to a mixture containing the ⁇ -amyloid peptide and Zn(II) (1 eq.) leads to a partial intensity recovery for all A ⁇ signals, which can be considered as an indicative that the hydrazone INHHQ weakens Zn(II)-A ⁇ interactions;
- FIG. 7 1 H NMR spectra showing that the addition of INHHQ (4 eq.) to a mixture containing ⁇ -synuclein and Cu(II)/Cu(I) (1 eq.) leads to the recovery of the original methionine signals' position; it is worth noting that methionine residues are the interaction point of copper with ⁇ -synuclein, which constitutes an indicative that INHHQ weakens Cu(II) or Cu(I)- ⁇ -synuclein interactions.
- a hydrazone derived from the mycobactericidal agent isoniazid was produced, characterized in its crystalline form and successfully tested in modulating in vitro the interaction between ⁇ -amyloid peptide (or ⁇ -synuclein) and the physiological metals copper and zinc, which can have great impact on the treatment of Alzheimer's and Parkinson's diseases, as well as in other related diseases.
- the isonicotinoyl hydrazone of 8-hydroxyquinoline-2-carboxaldehyde (or INHHQ) was synthesized, completely characterized in its anhydrous crystalline form and successfully tested in modulating the in vitro interaction between ⁇ -amyloid peptide (or ⁇ -synuclein) and the physiological metals copper and zinc, which can have applications in the treatment of Alzheimer's and Parkinson's diseases, amongst other neurodegenerative diseases (such as Huntington's).
- INHHQ Connected to the 8-hydroxyquinoline portion, characteristic of CQ, INHHQ also contains the mycobactericidal drug isoniazid (INH), resulting in a potentially interesting hydrazone capable of coordinating metal ions of biological importance through its various N/O-donor sites.
- INHHQ mycobactericidal drug
- isoniazid is well known as iron chelating agents.
- iron chelating agents there are no studies in the literature involving the coordination of INHHQ to any transition metal.
- Elemental analysis calculated for C 16 H 12 O 2 N 4 : C, 65.7%; H, 4.1%; N, 19.2%—found: C, 66.3%; H, 4.1%; N, 19.4%.
- the X-ray diffraction (XRD) was performed using an appropriate single-crystal of INHHQ.
- the unit cell parameters were based on all reflections. Data were collected at room temperature (293 K) using the computer program Collect being the integration and scaling of reflections made with Denzo-Scalepach system of HKL programs.
- the crystal structure was solved by direct method with SHELXS-97 and the atoms, except hydrogens, were anisotropically refined by the least squares method on F2 using the SHELXL-97 program.
- IR spectra were obtained on a Perkin-Elmer 2000 FT-IR spectrometer, using KBr sampling.
- Raman spectra of the solid sample were measured on a Perkin-Elmer 400 Station equipment, using the 785 nm line for excitation.
- INHHQ crystallizes in the orthorhombic system, space group Pbca.
- the asymmetric unit of INHHQ is shown in FIG. 1 .
- the calculated centroid-centroid distance is equal to 3.8303(9) ⁇ .
- the adjacent chains are interconnected by O1-H12 . . . ⁇ interactions ( FIG. 2 b ), being the distance H12-centroid (N4-C8-C9-C10-C11-C12) of 3.5339(17) ⁇ [symmetry code: ⁇ 1 ⁇ 2+x, y, 1 ⁇ 2 ⁇ z].
- zigzag columns run parallel to the crystallographic axis a ( FIG. 2 c ).
- the INHHQ structure was optimized in gas phase, using the DFT methodology, level of theory B3LYP/6-311+G (d,p).
- v C ⁇ O absorption is usually one of the most representative in an infrared spectrum and is also likely its most intense spectral feature. It appears in a wavenumber region relatively free of other vibrations (1800-1600 cm ⁇ 1 ). On the other hand, this mode gives only weak or very weak absorptions in Raman spectroscopy. In our study, as expected, v C ⁇ O vibration originates one of the strongest bands of the infrared spectrum, at 1656 cm ⁇ 1 , which is in excellent agreement with the calculated value of 1658 cm ⁇ 1 (DFT calculations show a coupling between v C ⁇ O and ⁇ NH vibrations).
- This mode was assigned at 1663 cm ⁇ 1 by Liu and Yang.
- the C ⁇ N stretchings of azomethine groups show absorptions close to that of carbonyl stretching. This fact can difficult an accurate assignment.
- the C ⁇ N stretching bands of alkylated Schiff bases are usually found in the range 1674-1649 cm ⁇ 1 , inside the common region of v C ⁇ O absorption. If conjugations of the C ⁇ N moiety with phenyl groups are present, the stretching frequency shifts to 1650-1600 cm ⁇ 1 .
- two frequencies involving azomethine C ⁇ N vibrations were calculated (1569/1556 cm ⁇ 1 ), both of them coupled to v C ⁇ C of the quinoline ring and, to a lesser extent, to the phenol v C—OH.
- OH and NH groups are very characteristic and their stretching vibrations are observed, in many cases, around 3500-3300 cm ⁇ 1 .
- This absorption is highly influenced by chemical environment, mainly when OH or NH groups are involved in hydrogen bonding. This can occur within the same molecule (intramolecular H bonding) or with adjacent molecules (intermolecular H bonding).
- intramolecular H bonding causes a thinning of the band and makes its position unaffected by concentration changes.
- INHHQ In the IR spectrum of INHHQ, we observed a sharp band of medium intensity located at 3396 cm ⁇ 1 , assigned to v OH.
- the C—OH stretching mode was assigned to the medium intensity infrared band at 1232 cm ⁇ 1 .
- This vibration is Raman inactive and had its frequency calculated at 1205 cm ⁇ 1 .
- a coupled mode involving this movement was also predicted at 1276 cm ⁇ 1 [experimental: 1299 (infrared) cm ⁇ 1 and 1304 (Raman) cm ⁇ 1 ].
- Another important vibration concerning the phenol group is the in-plane bending, which typically appears in the region 1440-1260 cm ⁇ 1 , attributed to the weak infrared band (medium in the Raman spectrum) at 1371 cm ⁇ 1 . Coupled modes are observed in FTIR at 1465, 1280, 1252 and 1202 cm ⁇ 1 . Theoretical and experimental frequencies show good agreement (Table 4).
- This hydrazonic compound has the ability, as proved by 1D and 2D NMR experiments, of compete with the ⁇ -amyloid peptide (or ⁇ -synuclein), key-targets, respectively, in Alzheimer's and Parkinson's diseases, by physiological ions such as Zn 2+ Cu 2+ and Cu + , which can cause their precipitation or oligomerization and contribute to worsen the oxidative stress condition observed in the brains of patients suffering from these neurodegenerative disorders.
- INHHQ does not interact directly with the ⁇ -amyloid peptide and ⁇ -synuclein, nonetheless inhibits the interactions between these targets and metals through a mechanism that probably involves metal ion sequestering.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- General Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Hospice & Palliative Care (AREA)
- Psychiatry (AREA)
- Psychology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Abstract
The present invention relates to the method for preparing the anhydrous crystalline form of isoniazid-derived hydrazone (8-hydroxyquinoline-2-carboxaldehyde isonicotinoyl hydrazone), to the thus produced polymorph and to the use thereof for the treatment of Alzheimer's disease and parkinsonism, inter alia, and to a pharmaceutical composition.
Description
The present invention regards the preparation method of the anhydrous crystalline form of an isoniazid-derived hydrazone (namely, 8-hydroxyquinoline-2-carboxaldehyde isonicotinoyl hydrazone, or INHHQ), the polymorph produced and its use, in any pharmaceutical composition, for the treatment of Alzheimer's and Parkinson's diseases, as well as other neurodegenerative disorders.
With the general increase in life expectancy recorded in recent times, especially in developed countries, the prevalence of certain neurodegenerative diseases has been observed. Alzheimer's disease (AD), first characterized in 1906 by the german neuropathologist Alois Alzheimer, is currently the most common one. It is a primarily age-related disease and the most common cause of dementia in older people. Dementia is characterized by progressive loss of memory and cognitive functions, among other diagnostic criteria, being most of them present in the Diagnostic and Statistical Manual of Mental Disorders and described on the National Institute of Neurological and Communicative Disorders Association.
The disease has two general classifications: 1) late onset, which occurs with the highest incidence at about 60 years of age, and 2) early onset, occurring around 40 years. In the US and Great Britain, it represents about 50% of cases of dementia, being estimated that it is the fourth leading cause of deaths of elderly in these countries. Regarding the neuropathological aspect, patients show diffuse cortical atrophy, presence of senile plaques and neurofibrillary tangles, neurovascular degeneration and neuronal loss.
These senile plaques are characterized mainly by the presence of fibrillar deposits of β-amyloid peptide (Aβ), consisting of approx. 40 amino-acid residues. It has been observed high concentration of physiological metal ions such as Zn2+ and Cu2+, in these plaques, which is considered indicative that the interaction of Aβ with these biometais is at the heart of events that lead to aggregation and toxicity of this peptide. The ferric ions, in turn, have also been related to the aggregation of neurofibrillary tangles, in addition to contributing to the oxidative processes that occur in the nerve cells of the body. Something similar occurs in Parkinson's disease with the protein α-synuclein.
The already approved drugs for the treatment of AD are intended to combat deficits associated with reduced cerebral function and fall into two classes: acetylcholinesterase inhibitors and inhibitors of NMDA (N-Methyl-D-Aspartate) receptors. Such drugs seem to act in enhancing the remain of the cognitive function, however, are not able to prevent the progression of the disease, being, therefore, important the development of new therapeutic agents that hold the advance of neurodegeneration as well as, as far as possible, promote their regression. In this sense, an interesting approach is to obtain compounds that inhibit, specifically, abnormal metal-protein interactions. This class of drugs is known as MPACs (metal-protein attenuating compounds) and relate to the allocation and distribution normalization of physiological metal ions.
A classic example is the clioquinol (CQ or PBT1), a substance belonging to the group of 8-hydroxyquinolines, which, however, was abandoned due to certain unwanted side effects, such as subacute myelo-optic neuropathy.
8-hydroxyquinoline-2-carboxaldehyde isonicotinoyl hydrazone (or INHHQ) was first described in a series of publications from the year 2009, in which its interactions with some rare earths ions, namely, dysprosium(III), europium(III), holmium(III), neodymium(III), and ytterbium(III) were examined. Erbium(III) and terbium(III) complexes were reported in 2010, while the samarium(III) compound was described in 2011. In those works, its rare earths complexes, and not INHHQ itself, were proposed as potential anticancer drugs, since they bind to DNA through an intercalation mechanism, besides they possess antioxidant properties, scavenging hydroxyl and superoxide radicals. Although the method of preparation described by the authors of those papers, Liu & Yang, is similar to the one employed by us, some experimental details are different. Mainly, the use of acid catalysis (drops of concentrated hydrochloric acid) allow us to reduce the reflux period to just an hour. On the other hand, and more important yet, the use of methanol PA ACS (99.8%) in the recrystallization step, instead of the methanol:water 80:20 used by the Chinese authors, lead to the preparation of the anhydrous crystalline form of the compound, which is completely original. Although this is not commented in the original articles, data suggest that the Chinese authors worked with an hydrated form of INHHQ, different from the one obtained by us, which can be clearly seen in the major differences between the melting points of the compounds, as well as between the vibrational (FTIR and Raman) spectra of both samples. Besides, application of INHHQ in the treatment of neurodegenerative diseases is completely new.
The anhydrous crystalline form described herein is characterized by its melting point, elemental analysis, crystal structure (single-crystal diffraction), powder diffraction pattern, and vibrational spectra.
The present invention will hereinafter be illustrated with reference to the attached figures, which represent:
In the search for new MPACs, more effective and safer for patients, a hydrazone derived from the mycobactericidal agent isoniazid was produced, characterized in its crystalline form and successfully tested in modulating in vitro the interaction between β-amyloid peptide (or α-synuclein) and the physiological metals copper and zinc, which can have great impact on the treatment of Alzheimer's and Parkinson's diseases, as well as in other related diseases.
The isonicotinoyl hydrazone of 8-hydroxyquinoline-2-carboxaldehyde (or INHHQ) was synthesized, completely characterized in its anhydrous crystalline form and successfully tested in modulating the in vitro interaction between β-amyloid peptide (or α-synuclein) and the physiological metals copper and zinc, which can have applications in the treatment of Alzheimer's and Parkinson's diseases, amongst other neurodegenerative diseases (such as Huntington's).
Connected to the 8-hydroxyquinoline portion, characteristic of CQ, INHHQ also contains the mycobactericidal drug isoniazid (INH), resulting in a potentially interesting hydrazone capable of coordinating metal ions of biological importance through its various N/O-donor sites. Furthermore, linking two molecules that have, individually, specific activity, creating a single species, has been an attractive approach to rational drug development, since a combination of the two original activities can be expected of the hybrid molecule. Besides, isoniazid-derived hydrazones are well known as iron chelating agents. However, to the best of our knowledge, there are no studies in the literature involving the coordination of INHHQ to any transition metal.
In the context of the treatment of AD and Parkinson's disease, the coordination capacity of the ligand to essential transition metals (such as copper, zinc and iron) must be better understood. As a first approach to this problem, we present the results of a spectroscopic vibrational (FTIR/Raman) and a single-crystal X-ray diffraction structural study on the 8-hydroxyquinoline-2-carboxaldehyde isonicotinoyl hydrazone, obtained through the process herein described and claimed, including its crystal structure, vibrational spectra and their full assignment by computational methods based on the Density Functional Theory (DFT).
To 25 mL of a 8-hydroxyquinoline-2-carboxaldehyde (1.04 g, 6.0 mmol) solution in ethanol, 25 mL of ethanolic solution of isoniazid (0.82 g, 6.0 mmol) were dropwise added. Two drops of concentrated hydrochloric acid were added as a catalyst for the reaction. After refluxing for 1 h, the mixture was cooled to room temperature and the yellow precipitate obtained was filtered and vacuum dried. Next, the product was recrystallized in hot methanol methanol PA ACS (99.8%). A pale yellow crystalline solid was obtained after cooling and dried at room temperature. After few days, single-crystals of INHHQ were isolated from the mother liquor. Total yield of the process: 0.98 g (56%).
Characterization:
m.p.: 246-249° C.
Elemental analysis: calculated for C16H12O2N4: C, 65.7%; H, 4.1%; N, 19.2%—found: C, 66.3%; H, 4.1%; N, 19.4%.
Main IR bands (KBr, cm−1): 3396 (v OH); 3183 (v NH); 1656 (v C═O+β NH); 1647 (v C═N azomethine group); 1556 (v C═N e v C═C from the quinolinic ring) and 1545 (v C═C e v C═N from the pyridinic ring).
X-Ray Diffraction Analysis
The X-ray diffraction (XRD) was performed using an appropriate single-crystal of INHHQ. The sample was measured on a diffractometer Enraf-Nonius Kappa-CCD with Mo Kα (λ=0.71073 Å) radiation. The unit cell parameters were based on all reflections. Data were collected at room temperature (293 K) using the computer program Collect being the integration and scaling of reflections made with Denzo-Scalepach system of HKL programs. The crystal structure was solved by direct method with SHELXS-97 and the atoms, except hydrogens, were anisotropically refined by the least squares method on F2 using the SHELXL-97 program. All aromatic and hydroxyl group's hydrogen atoms were placed in the calculated positions (C—H: 0.98 Å, O—H: 0.82 Å). Shift factors were taken as U(H)isot=1.2/1.5 Uhost. The H atoms attached to the C7 carbon and N2 nitrogen were located in the Fourier difference map and refined freely. The computer programs ORTEP-3 and Mercury (version 2.3) were used to draw the structures. On the other hand, powder X-ray diffraction experiments were performed in a Bruker D8 Discover XRD equipment using copper radiation. Experimental conditions: tension of 40 kV and current of 40 mA. The Bragg-Brentano geometry was used.
Spectroscopic Analyses
IR spectra were obtained on a Perkin-Elmer 2000 FT-IR spectrometer, using KBr sampling. On the other hand, the Raman spectra of the solid sample were measured on a Perkin-Elmer 400 Station equipment, using the 785 nm line for excitation.
DFT Calculations
The first step was to conduct a search of the conformational space of 8-hydroxyquinoline-2-carboxaldehyde isonicotinoyl hydrazone using the semi-empirical PM3 method, as implemented in the SPARTAN'02 software, with the following set of parameters: Max-Confs=100; window=10 kcal mol−1; model=PM3. A total of 12 different conformations were found. The lowest energy conformation was of 41.387 kcal mol−1. From this distribution, 5 conformations were selected for analysis by DFT. These conformations will be called, from now on, from Conf. 1 to Conf. 5.
After the selection of these five conformations, a complete geometry optimization, without limitation, using the default convergence criteria and calculation of harmonic vibrational frequencies, was performed in gas phase, for each, using the Gaussian program package 03 Gauss. The three parameters of the exchange-correlation potential proposed by Becke with local and non-local correlations provided by Lee, Yang, and Parr (B3LYP functional) were selected with the basis set of triple zeta valence 6-311+G (d,p). Thermal contributions to the Gibbs free energy and other state functions were calculated at 298.15 K and 1 atm. The vibrational frequencies were scaled by a factor of 0.9381 for a better comparison with the experimental data.
Molecular Structure
Crystallographic Analysis
The main crystal parameters used, as well as data of information collected and structural refinement parameters are summarized in Table 1. INHHQ crystallizes in the orthorhombic system, space group Pbca. The asymmetric unit of INHHQ is shown in FIG. 1 . The compound adopts an (E) configuration with respect to the C7=N3 bond of the hydrazonic group. The INHHQ molecule is almost planarin solid state (rms deviation=0.2701° for all atoms, except H) and shows an intramolecular H bond involving the phenolic hydroxyl and the quinolinic nitrogen group: the O1-H donor interacts with N4 [O1 . . . N4=2,689 Å] receptor. In this process, a pseudo five-membered ring is formed. The distances and bond angles (Table 2) are not significantly different from those observed in similar compounds. The crystal packing is maintained by intermolecular H bonds involving the carbonyl oxygen O2 (acceptor) of a molecule and the N2-H group of the following molecule [moderate N2 . . . O2i=2,966 Å, symmetry codes: (i) −x+½, y−½, z], connecting the molecules of INHHQ in zigzag chains running parallel to the crystallographic b axis (FIG. 2a ). The molecules in each chain are interconnected by cross-stacking π-π interactions involving the quinoline rings. The calculated centroid-centroid distance is equal to 3.8303(9) Å. The adjacent chains are interconnected by O1-H12 . . . π interactions (FIG. 2b ), being the distance H12-centroid (N4-C8-C9-C10-C11-C12) of 3.5339(17) Å [symmetry code: −½+x, y, ½−z]. As a result of this last interaction, zigzag columns run parallel to the crystallographic axis a (FIG. 2c ).
| TABLE 1 |
| Selected crystallographic data for INHHQ |
| Empirical formula | C16H12O2N4 |
| Molecular weight | 292.30 |
| Collecting temperature | 293(2) K |
| Wave length | 0.71073 Å |
| Crystalline system | Orthorhombic |
| Space group | Pbca |
| Unit cell dimensions | a = 17.0761(4) Å |
| b = 8.25480(10) Å | |
| c = 19.3549(4) Å | |
| Cell volume | 2728.26(9) Å3 |
| Z | 8 |
| ρ(calculated) | 1.423 g cm−3 |
| Absorption coefficient | 0.098 mm−1 |
| F(000) | 1216 |
| Crystal size utilized | 0.484 × 0.236 × 0.171 mm3 |
| θ range used in collect | 2.94 a 27.48° |
| Index ranges | −22.19; −10.10; −25.23 |
| Collected reflections | 27142 |
| Unique | 3100 [R(int) = 0.1167] |
| Completeness to θ = 27.48° | 99.0% |
| Absorption correction | None |
| Refinement method | “Full-matrix least-squares on F2” |
| Computational programs a | COLLECT, HKL Denzo and Scalepack, |
| SHELXS-97, SHELXL-97 | |
| Data/restraints/parameters | 3100/0/208 |
| Goodness-of-fit on F2 | 1.042 |
| Final Rindexes [I > 2σ (I)] | R1 = 0.0517, wR2 = 0.1188 |
| R index (all data) | R1 = 0.0968, wR2 = 0.1427 |
| Largest diff. peak and hole | 0.198 and −0.234 e Å−3 |
| a Used for data collection, data processing, structure solution, and structure refinement, respectively. | |
| TABLE 2 |
| Main distances and bond angles, experimental and theoretical (Conf. 5), for |
| INHHQ. The crystallographic identification scheme of the atoms was followed |
| Distances (Å) | Experimental | Calculated | Distances (Å) | Experimental | Calculated |
| O2—C6 | 1.2268(18) | 1.211 | N4—C12 | 1.362(2) | 1.355 |
| N2—C6 | 1.345(2) | 1.388 | N3—C7 | 1.270(2) | 1.280 |
| N2—N3 | 1.3862(18) | 1.353 | O1—C13 | 1.358(2) | 1.351 |
| N4—C8 | 1.319(2) | 1.325 | N1—C1 | 1.333(2) | 1.335 |
| Angles (°) | Angles (°) | ||||
| C6—N2—N3 | 118.44(13) | 120.9 | N2—C6—C5 | 115.04(13) | 114.0 |
| C8—N4—C12 | 117.83(13) | 118.6 | C1—N1—C2 | 116.20(15) | 117.2 |
| C7—N3—N2 | 115.54(13) | 117.4 | O1—C13—C12 | 118.65(15) | 118.8 |
| Dihedral angles (°) | Dihedral angles (°) | ||||
| C8—C7—N3—N2 | −177.63 | 179.7 | N3—N2—C6—C5 | −178.62 | −178.6 |
| C7—N3—N2—C6 | −163.79 | −175.4 | N2—C6—C5—C3 | 144.93 | −151.6 |
Moreover, an analysis of the INHHQ diffraction peaks was performed using Bragg-Brentano geometry (Table 3). The ultimate goal is to characterize, unambiguously, the obtained polymorph. The crystal structure-based simulated diffractogram in the range of 5<2θ<70°, was also calculated. FIG. 3 displays the superposition of the experimental (red) and simulated (blue) diffractograms.
| TABLE 3 |
| Information on the diffraction peaks of INHHQ for 2θranging |
| from 10.5 to 70.5° |
| Interplanar | Structure |
| Plane (h, k, l) | Multiplicity | distance (Å) | 2 theta | factor |
| h | k | l | m | d | (°) | F2 |
| 1 | 0 | 0 | 2 | 8.34877 | 10.58783 | 1128.338 |
| 0 | 1 | 0 | 2 | 7.07920 | 12.49361 | 331.562 |
| 0 | 1 | 1 | 4 | 5.94931 | 14.87873 | 4309.398 |
| 1 | 0 | −2 | 2 | 5.93863 | 14.90564 | 3564.964 |
| 1 | −1 | −1 | 4 | 5.50433 | 16.08920 | 1058.563 |
| 0 | 0 | 2 | 2 | 5.48852 | 16.13588 | 185.920 |
| 1 | 1 | 0 | 4 | 5.39942 | 16.40394 | 3734.208 |
| 1 | −1 | −2 | 4 | 4.54974 | 19.49495 | 3562.456 |
| 1 | 1 | 1 | 4 | 4.37713 | 20.27167 | 81.922 |
| 2 | 0 | −2 | 2 | 4.37659 | 20.27421 | 2544.993 |
| 0 | 1 | 2 | 4 | 4.33757 | 20.45853 | 131.263 |
| 2 | 0 | 0 | 2 | 4.17439 | 21.26742 | 743.827 |
| 2 | −1 | −1 | 4 | 3.87923 | 22.90666 | 5227.304 |
| 1 | 0 | 2 | 2 | 3.87110 | 22.95541 | 2615.373 |
| 2 | −1 | −2 | 4 | 3.72262 | 23.88427 | 1558.836 |
| 2 | 1 | 0 | 4 | 3.59579 | 24.73979 | 177.345 |
| 0 | 2 | 0 | 2 | 3.53960 | 25.13890 | 1609.181 |
| 1 | −1 | −3 | 4 | 3.53090 | 25.20189 | 4821.653 |
| 1 | 1 | 2 | 4 | 3.39646 | 26.21681 | 4682.200 |
| 0 | 2 | 1 | 4 | 3.36879 | 26.43604 | 783.016 |
| 1 | −2 | −1 | 4 | 3.28146 | 27.15290 | 1838.082 |
| 1 | 2 | 0 | 4 | 3.25881 | 27.34522 | 1594.341 |
| 2 | −1 | −3 | 4 | 3.25355 | 27.39035 | 1187.558 |
| 0 | 1 | 3 | 4 | 3.25049 | 27.41659 | 1027.571 |
| 3 | 0 | −2 | 2 | 3.08971 | 28.87348 | 81.686 |
| 2 | 1 | 1 | 4 | 3.08859 | 28.88417 | 2178.500 |
| 1 | −2 | −2 | 4 | 3.04049 | 29.35123 | 126085.008 |
| 1 | 0 | −4 | 2 | 3.03231 | 29.43221 | 46210.547 |
| 1 | 2 | 1 | 4 | 2.98732 | 29.88574 | 3959.848 |
| 0 | 2 | 2 | 4 | 2.97465 | 30.01599 | 23814.010 |
| 2 | 0 | −4 | 2 | 2.96931 | 30.07124 | 20257.656 |
| 3 | −1 | −2 | 4 | 2.83175 | 31.56923 | 1316.031 |
| 2 | −2 | −1 | 4 | 2.81367 | 31.77739 | 2147.033 |
| 3 | −1 | −1 | 4 | 2.78865 | 32.07025 | 962.328 |
| 1 | −1 | −4 | 4 | 2.78737 | 32.08534 | 5017.017 |
| 2 | 0 | 2 | 2 | 2.78466 | 32.11737 | 5954.872 |
| 3 | 0 | 0 | 2 | 2.78292 | 32.13796 | 198029.766 |
| 2 | −2 | −2 | 4 | 2.75217 | 32.50702 | 166846.703 |
| 0 | 0 | 4 | 2 | 2.74426 | 32.60332 | 78569.977 |
| 2 | −1 | −4 | 4 | 2.73820 | 32.67747 | 7683.784 |
| 2 | 2 | 0 | 4 | 2.69971 | 33.15667 | 5524.309 |
| 3 | −1 | −3 | 4 | 2.69759 | 33.18355 | 5725.885 |
| 1 | 1 | 3 | 4 | 2.69411 | 33.22766 | 3144.983 |
| 1 | −2 | −3 | 4 | 2.67192 | 33.51166 | 5080.103 |
| 1 | 2 | 2 | 4 | 2.61222 | 34.30092 | 184684.922 |
| 3 | 0 | −4 | 2 | 2.61018 | 34.32857 | 75081.414 |
| 2 | 1 | 2 | 4 | 2.59139 | 34.58541 | 10269.332 |
| 3 | 1 | 0 | 4 | 2.58999 | 34.60470 | 3123.402 |
| 0 | 1 | 4 | 4 | 2.55873 | 35.04100 | 3632.206 |
| 2 | −2 | −3 | 4 | 2.54551 | 35.22898 | 128.840 |
| 0 | 2 | 3 | 4 | 2.54404 | 35.24991 | 2518.650 |
| 2 | 2 | 1 | 4 | 2.46414 | 36.43237 | 9364.604 |
| 3 | −1 | −4 | 4 | 2.44902 | 36.66531 | 6171.995 |
| 0 | 3 | 0 | 2 | 2.35973 | 38.10499 | 2742.504 |
| 3 | −2 | −2 | 4 | 2.32767 | 38.65065 | 49774.492 |
| 1 | 0 | 4 | 2 | 2.32176 | 38.75283 | 27728.582 |
| 4 | 0 | −2 | 2 | 2.31874 | 38.80530 | 8126.180 |
| 3 | 1 | 1 | 4 | 2.31772 | 38.82317 | 7422.130 |
| 0 | 3 | 1 | 4 | 2.30703 | 39.01032 | 1802.321 |
| 3 | −2 | −1 | 4 | 2.30355 | 39.07167 | 4033.272 |
| 1 | −2 | −4 | 4 | 2.30283 | 39.08438 | 4588.360 |
| 2 | −1 | −5 | 4 | 2.30097 | 39.11728 | 4454.373 |
| 1 | −3 | −1 | 4 | 2.27839 | 39.52090 | 11520.123 |
| 2 | −2 | −4 | 4 | 2.27487 | 39.58469 | 7746.600 |
| 1 | −1 | −5 | 4 | 2.27151 | 39.64563 | 598.446 |
| 1 | 3 | 0 | 4 | 2.27077 | 39.65907 | 2802.268 |
| 3 | −2 | −3 | 4 | 2.25142 | 40.01449 | 3656.189 |
| 1 | 2 | 3 | 4 | 2.24939 | 40.05204 | 2882.448 |
| 1 | 1 | 4 | 4 | 2.20614 | 40.87197 | 4367.143 |
| 4 | −1 | −2 | 4 | 2.20355 | 40.92216 | 1606.162 |
| 1 | −3 | −2 | 4 | 2.19295 | 41.12888 | 5896.017 |
| 2 | 2 | 2 | 4 | 2.18856 | 41.21509 | 90978.344 |
| 4 | 0 | −4 | 2 | 2.18829 | 41.22042 | 43250.957 |
| 3 | 2 | 0 | 4 | 2.18772 | 41.23171 | 13279.063 |
| 4 | −1 | −3 | 4 | 2.18705 | 41.24487 | 37423.781 |
| 2 | 1 | 3 | 4 | 2.18427 | 41.29979 | 20309.209 |
| 1 | 3 | 1 | 4 | 2.17275 | 41.52890 | 27249.758 |
| 0 | 2 | 4 | 4 | 2.16879 | 41.60831 | 20608.090 |
| 3 | −1 | −5 | 4 | 2.16859 | 41.61228 | 15481.041 |
| 0 | 3 | 2 | 4 | 2.16786 | 41.62688 | 3233.373 |
| 4 | −1 | −1 | 4 | 2.13480 | 42.30230 | 2642.791 |
| 3 | 0 | 2 | 2 | 2.13258 | 42.34844 | 20.261 |
| 2 | −3 | −1 | 4 | 2.10312 | 42.97079 | 2666.499 |
| 3 | −2 | −4 | 4 | 2.10076 | 43.02150 | 1828.689 |
| 0 | 1 | 5 | 4 | 2.09689 | 43.10495 | 17605.400 |
| 4 | −1 | −4 | 4 | 2.09069 | 43.23919 | 2405.904 |
| 4 | 0 | 0 | 2 | 2.08719 | 43.31522 | 1974.789 |
| 2 | −3 | −2 | 4 | 2.07706 | 43.53728 | 2901.627 |
| 2 | 3 | 0 | 4 | 2.05423 | 44.04625 | 3037.751 |
| 3 | 1 | 2 | 4 | 2.04194 | 44.32549 | 1874.683 |
| 1 | −3 | −3 | 4 | 2.04191 | 44.32613 | 1474.088 |
| 2 | 0 | −6 | 2 | 2.03690 | 44.44102 | 2853.471 |
| 3 | 2 | 1 | 4 | 2.01612 | 44.92393 | 1408.763 |
| 1 | 3 | 2 | 4 | 2.01489 | 44.95273 | 793.879 |
| 2 | −2 | −5 | 4 | 2.00506 | 45.18528 | 8021.569 |
| 4 | 1 | 0 | 4 | 2.00199 | 45.25840 | 3930.259 |
| 1 | −2 | −5 | 4 | 1.98548 | 45.65592 | 1014.055 |
| 2 | −3 | −3 | 4 | 1.98380 | 45.69690 | 16302.775 |
| 0 | 3 | 3 | 4 | 1.98310 | 45.71378 | 11086.845 |
| 3 | 0 | −6 | 2 | 1.97954 | 45.80066 | 5989.497 |
| 1 | 0 | −6 | 2 | 1.97817 | 45.83434 | 9677.354 |
| 2 | −1 | −6 | 4 | 1.95748 | 46.34679 | 2033.378 |
| 2 | 3 | 1 | 4 | 1.94455 | 46.67316 | 3814.112 |
| 4 | −1 | −5 | 4 | 1.94222 | 46.73259 | 2465.540 |
| 1 | 2 | 4 | 4 | 1.94138 | 46.75385 | 1044.347 |
| 4 | −2 | −2 | 4 | 1.93962 | 46.79894 | 71647.414 |
| 2 | 0 | 4 | 2 | 1.93555 | 46.90307 | 22593.117 |
| 4 | −2 | −3 | 4 | 1.92834 | 47.08917 | 2359.305 |
| 2 | 2 | 3 | 4 | 1.92643 | 47.13862 | 3496.081 |
| 3 | −2 | −5 | 4 | 1.91564 | 47.42022 | 3565.626 |
| 3 | −1 | −6 | 4 | 1.90641 | 47.66401 | 3852.061 |
| 1 | −1 | −6 | 4 | 1.90518 | 47.69668 | 126.165 |
| 4 | −2 | −1 | 4 | 1.89223 | 48.04363 | 2471.013 |
| 3 | −3 | −2 | 4 | 1.87535 | 48.50388 | 728.923 |
| 2 | 1 | 4 | 4 | 1.86703 | 48.73407 | 2582.125 |
| 0 | 2 | 5 | 4 | 1.86568 | 48.77150 | 687.112 |
| 3 | −3 | −1 | 4 | 1.86266 | 48.85561 | 371.683 |
| 1 | −3 | −4 | 4 | 1.86228 | 48.86626 | 3642.781 |
| 4 | −2 | −4 | 4 | 1.86131 | 48.89351 | 961.915 |
| 1 | 1 | 5 | 4 | 1.85776 | 48.99309 | 2897.553 |
| 2 | −3 | −4 | 4 | 1.84740 | 49.28595 | 2366.935 |
| 5 | 0 | −2 | 2 | 1.83827 | 49.54725 | 191.546 |
| 4 | 1 | 1 | 4 | 1.83748 | 49.56990 | 893.848 |
| 3 | −3 | −3 | 4 | 1.83478 | 49.64793 | 34517.039 |
| 1 | 3 | 3 | 4 | 1.83368 | 49.67962 | 3586.474 |
| 4 | 0 | −6 | 2 | 1.83168 | 49.73747 | 1341.276 |
| 0 | 0 | 6 | 2 | 1.82951 | 49.80075 | 5427.721 |
| 5 | 0 | −4 | 2 | 1.82704 | 49.87241 | 2611.138 |
| 3 | 2 | 2 | 4 | 1.82666 | 49.88361 | 15035.101 |
| 2 | 3 | 2 | 4 | 1.80028 | 50.66584 | 852.734 |
| 3 | 3 | 0 | 4 | 1.79981 | 50.68000 | 7635.262 |
| 4 | 2 | 0 | 4 | 1.79790 | 50.73774 | 31.252 |
| 5 | −1 | −3 | 4 | 1.79778 | 50.74113 | 3492.466 |
| 3 | 1 | 3 | 4 | 1.79572 | 50.80350 | 1004.864 |
| 0 | 3 | 4 | 4 | 1.78922 | 51.00132 | 203.157 |
| 5 | −1 | −2 | 4 | 1.77926 | 51.30747 | 668.832 |
| 4 | −1 | −6 | 4 | 1.77329 | 51.49295 | 1637.459 |
| 0 | 1 | 6 | 4 | 1.77131 | 51.55465 | 738.791 |
| 0 | 4 | 0 | 2 | 1.76980 | 51.60187 | 118322.898 |
| 5 | −1 | −4 | 4 | 1.76908 | 51.62454 | 2002.556 |
| 2 | −2 | −6 | 4 | 1.76545 | 51.73845 | 267467.688 |
| 4 | −2 | −5 | 4 | 1.75423 | 52.09423 | 1767.949 |
| 3 | −3 | −4 | 4 | 1.75045 | 52.21513 | 447.095 |
| 0 | 4 | 1 | 4 | 1.74724 | 52.31836 | 2620.549 |
| 1 | −4 | −1 | 4 | 1.73470 | 52.72556 | 2457.296 |
| 1 | 4 | 0 | 4 | 1.73133 | 52.83614 | 1390.317 |
| 3 | −2 | −6 | 4 | 1.72771 | 52.95534 | 624.514 |
| 1 | −2 | −6 | 4 | 1.72680 | 52.98560 | 2870.138 |
| 5 | −1 | −1 | 4 | 1.71763 | 53.29042 | 3992.833 |
| 4 | 0 | 2 | 2 | 1.71625 | 53.33669 | 171.427 |
| 3 | 3 | 1 | 4 | 1.70057 | 53.86813 | 4463.794 |
| 5 | −1 | −5 | 4 | 1.69944 | 53.90672 | 1663.483 |
| 2 | 2 | 4 | 4 | 1.69823 | 53.94829 | 3506.858 |
| 1 | −4 | −2 | 4 | 1.69608 | 54.02211 | 2307.989 |
| 2 | −3 | −5 | 4 | 1.69392 | 54.09682 | 2349.578 |
| 1 | 2 | 5 | 4 | 1.69125 | 54.18921 | 1409.942 |
| 2 | −1 | −7 | 4 | 1.69108 | 54.19489 | 787.935 |
| 1 | 4 | 1 | 4 | 1.68669 | 54.34788 | 882.257 |
| 0 | 4 | 2 | 4 | 1.68440 | 54.42786 | 182.510 |
| 1 | −3 | −5 | 4 | 1.68206 | 54.50961 | 4158.873 |
| 3 | −1 | −7 | 4 | 1.68013 | 54.57753 | 2978.968 |
| 4 | 2 | 1 | 4 | 1.67591 | 54.72649 | 1026.918 |
| 5 | 0 | 0 | 2 | 1.66975 | 54.94516 | 2190.528 |
| 4 | 1 | 2 | 4 | 1.66794 | 55.01012 | 1131.238 |
| 1 | 3 | 4 | 4 | 1.65500 | 55.47716 | 297.480 |
| 4 | −3 | −2 | 4 | 1.65390 | 55.51703 | 92.102 |
| 2 | −4 | −1 | 4 | 1.65348 | 55.53225 | 2628.066 |
| 4 | −3 | −3 | 4 | 1.64689 | 55.77391 | 1703.457 |
| 2 | 3 | 3 | 4 | 1.64570 | 55.81771 | 14933.787 |
| 5 | −2 | −3 | 4 | 1.64562 | 55.82063 | 904.931 |
| 5 | 0 | −6 | 2 | 1.64485 | 55.84915 | 11045.036 |
| 3 | 2 | 3 | 4 | 1.64404 | 55.87900 | 537.543 |
| 1 | 0 | 6 | 2 | 1.64248 | 55.93667 | 4104.017 |
| 2 | −4 | −2 | 4 | 1.64073 | 56.00177 | 6555.738 |
| 3 | −3 | −5 | 4 | 1.63896 | 56.06742 | 3117.231 |
| 1 | −1 | −7 | 4 | 1.63562 | 56.19224 | 7479.478 |
| 5 | −2 | −2 | 4 | 1.63138 | 56.35117 | 139974.406 |
| 2 | 4 | 0 | 4 | 1.62941 | 56.42557 | 2336.839 |
| 3 | 0 | 4 | 2 | 1.62858 | 56.45687 | 79060.617 |
| 4 | −2 | −6 | 4 | 1.62677 | 56.52512 | 231.031 |
| 0 | 2 | 6 | 4 | 1.62525 | 56.58301 | 200.360 |
| 5 | 1 | 0 | 4 | 1.62516 | 56.58630 | 1372.377 |
| 4 | −3 | −1 | 4 | 1.62423 | 56.62165 | 941.537 |
| 5 | −2 | −4 | 4 | 1.62352 | 56.64860 | 977.446 |
| 1 | −4 | −3 | 4 | 1.62324 | 56.65939 | 3828.351 |
| 2 | 1 | 5 | 4 | 1.62060 | 56.76011 | 661.635 |
| 1 | 4 | 2 | 4 | 1.60956 | 57.18482 | 2848.325 |
| 0 | 3 | 5 | 4 | 1.60734 | 57.27112 | 4687.052 |
| 4 | −1 | −7 | 4 | 1.60639 | 57.30817 | 785.019 |
| 4 | −3 | −4 | 4 | 1.60455 | 57.38024 | 979.594 |
| 5 | −1 | −6 | 4 | 1.60217 | 57.47322 | 229.132 |
| 1 | 1 | 6 | 4 | 1.59998 | 57.55912 | 756.968 |
| 2 | −4 | −3 | 4 | 1.59358 | 57.81228 | 6432.516 |
| 0 | 4 | 3 | 4 | 1.59322 | 57.82655 | 993.033 |
| 3 | 1 | 4 | 4 | 1.58712 | 58.06987 | 1480.846 |
| 5 | −2 | −1 | 4 | 1.58349 | 58.21592 | 1232.501 |
| 3 | 3 | 2 | 4 | 1.58219 | 58.26825 | 878.980 |
| 2 | 4 | 1 | 4 | 1.57302 | 58.64091 | 2737.882 |
| 5 | −2 | −5 | 4 | 1.56920 | 58.79766 | 1757.640 |
| 4 | 3 | 0 | 4 | 1.56339 | 59.03785 | 1224.589 |
| 2 | −2 | −7 | 4 | 1.56261 | 59.07000 | 858.527 |
| 3 | −2 | −7 | 4 | 1.55396 | 59.43196 | 388.934 |
| 6 | 0 | −4 | 2 | 1.54485 | 59.81773 | 40226.578 |
| 4 | 2 | 2 | 4 | 1.54429 | 59.84161 | 132527.313 |
| 2 | −3 | −6 | 4 | 1.54191 | 59.94356 | 919.952 |
| 3 | −4 | −2 | 4 | 1.53571 | 60.21080 | 3337.484 |
| 4 | −3 | −5 | 4 | 1.53442 | 60.26657 | 2142.301 |
| 0 | 1 | 7 | 4 | 1.53103 | 60.41363 | 4066.389 |
| 3 | −4 | −1 | 4 | 1.52872 | 60.51473 | 530.741 |
| 1 | −4 | −4 | 4 | 1.52851 | 60.52394 | 23281.965 |
| 3 | 0 | −8 | 2 | 1.52498 | 60.67867 | 13248.033 |
| 2 | −4 | −4 | 4 | 1.52025 | 60.88755 | 1880.706 |
| 1 | −2 | −7 | 4 | 1.51854 | 60.96338 | 1753.461 |
| 6 | 0 | −2 | 2 | 1.51698 | 61.03271 | 2012.546 |
| 3 | −3 | −6 | 4 | 1.51658 | 61.05053 | 1466.016 |
| 5 | 1 | 1 | 4 | 1.51638 | 61.05931 | 161.170 |
| 2 | 0 | −8 | 2 | 1.51616 | 61.06934 | 3710.299 |
| 1 | −3 | −6 | 4 | 1.51596 | 61.07813 | 2665.123 |
| 3 | −4 | −3 | 4 | 1.51319 | 61.20197 | 419.151 |
| 1 | 4 | 3 | 4 | 1.51257 | 61.22953 | 10115.472 |
| 6 | −1 | −3 | 4 | 1.51024 | 61.33418 | 363.616 |
| 5 | 2 | 0 | 4 | 1.51016 | 61.33806 | 617.463 |
| 6 | −1 | −4 | 4 | 1.50933 | 61.37515 | 989.558 |
| 4 | 1 | 3 | 4 | 1.50872 | 61.40297 | 297.840 |
| 2 | 2 | 5 | 4 | 1.50649 | 61.50344 | 588.937 |
| 2 | 3 | 4 | 4 | 1.49652 | 61.95818 | 590.113 |
| 4 | −2 | −7 | 4 | 1.49506 | 62.02536 | 423.413 |
| 2 | 4 | 2 | 4 | 1.49366 | 62.09007 | 106.506 |
| 3 | 4 | 0 | 4 | 1.49339 | 62.10246 | 123565.250 |
| 1 | 3 | 5 | 4 | 1.49174 | 62.17898 | 478.546 |
| 5 | −2 | −6 | 4 | 1.49166 | 62.18267 | 105324.078 |
| 5 | −1 | −7 | 4 | 1.49157 | 62.18692 | 1581.715 |
| 3 | −1 | −8 | 4 | 1.49078 | 62.22328 | 974.226 |
| 1 | 2 | 6 | 4 | 1.48989 | 62.26457 | 134633.219 |
| 0 | 4 | 4 | 4 | 1.48733 | 62.38401 | 83526.117 |
| 4 | 0 | −8 | 2 | 1.48466 | 62.50882 | 50996.125 |
| 6 | −1 | −2 | 4 | 1.48331 | 62.57221 | 539.855 |
| 2 | −1 | −8 | 4 | 1.48254 | 62.60831 | 1032.783 |
| 4 | 3 | 1 | 4 | 1.48118 | 62.67218 | 6016.078 |
| 6 | −1 | −5 | 4 | 1.48072 | 62.69367 | 7655.220 |
| 3 | 2 | 4 | 4 | 1.47949 | 62.75186 | 5174.257 |
| 3 | −4 | −4 | 4 | 1.46483 | 63.45251 | 92852.609 |
| 1 | 0 | −8 | 2 | 1.46062 | 63.65703 | 34382.762 |
| 5 | −3 | −3 | 4 | 1.46015 | 63.67986 | 19231.883 |
| 3 | 3 | 3 | 4 | 1.45904 | 63.73375 | 2083.547 |
| 6 | 0 | −6 | 2 | 1.45886 | 63.74255 | 104.403 |
| 2 | 0 | 6 | 2 | 1.45666 | 63.85023 | 5589.541 |
| 4 | −1 | −8 | 4 | 1.45305 | 64.02798 | 501.111 |
| 5 | −3 | −2 | 4 | 1.45017 | 64.17003 | 1181.973 |
| 4 | −3 | −6 | 4 | 1.44693 | 64.33096 | 2199.269 |
| 0 | 3 | 6 | 4 | 1.44586 | 64.38455 | 3392.815 |
| 5 | −3 | −4 | 4 | 1.44464 | 64.44527 | 603.990 |
| 3 | 4 | 1 | 4 | 1.43522 | 64.91979 | 856.294 |
| 0 | 2 | 7 | 4 | 1.43374 | 64.99512 | 3941.112 |
| 6 | −1 | −1 | 4 | 1.43271 | 65.04772 | 9958.013 |
| 5 | 0 | 2 | 2 | 1.43178 | 65.09530 | 464.878 |
| 2 | −4 | −5 | 4 | 1.43122 | 65.12385 | 1343.613 |
| 1 | −1 | −8 | 4 | 1.43049 | 65.16140 | 2849.458 |
| 6 | −1 | −6 | 4 | 1.42884 | 65.24586 | 1632.203 |
| 2 | 1 | 6 | 4 | 1.42677 | 65.35220 | 113.830 |
| 1 | −4 | −5 | 4 | 1.42405 | 65.49281 | 2715.529 |
| 5 | 2 | 1 | 4 | 1.42169 | 65.61510 | 2686.276 |
| 6 | −2 | −3 | 4 | 1.41663 | 65.87928 | 845.347 |
| 5 | −3 | −1 | 4 | 1.41622 | 65.90063 | 1809.560 |
| 6 | −2 | −4 | 4 | 1.41588 | 65.91867 | 654.705 |
| 0 | 5 | 0 | 2 | 1.41584 | 65.92052 | 1197.549 |
| 4 | 2 | 3 | 4 | 1.41537 | 65.94542 | 244.526 |
| 3 | 1 | 5 | 4 | 1.41356 | 66.04055 | 4426.744 |
| 1 | 4 | 4 | 4 | 1.40751 | 66.36081 | 21200.830 |
| 4 | −4 | −2 | 4 | 1.40684 | 66.39668 | 396.245 |
| 5 | −3 | −5 | 4 | 1.40597 | 66.44291 | 29.975 |
| 5 | 0 | −8 | 2 | 1.40574 | 66.45520 | 3142.987 |
| 0 | 5 | 1 | 4 | 1.40421 | 66.53712 | 7893.484 |
| 5 | 1 | 2 | 4 | 1.40336 | 66.58237 | 970.894 |
| 1 | 1 | 7 | 4 | 1.40288 | 66.60856 | 170.244 |
| 4 | −4 | −3 | 4 | 1.40251 | 66.62790 | 1310.150 |
| 2 | 4 | 3 | 4 | 1.40178 | 66.66737 | 2531.638 |
| 2 | −3 | −7 | 4 | 1.40123 | 66.69715 | 8505.064 |
| 5 | −2 | −7 | 4 | 1.40118 | 66.69978 | 401.337 |
| 3 | −2 | −8 | 4 | 1.40053 | 66.73479 | 5147.162 |
| 1 | −5 | −1 | 4 | 1.39767 | 66.88894 | 1543.957 |
| 3 | −4 | −5 | 4 | 1.39761 | 66.89248 | 1963.978 |
| 1 | 5 | 0 | 4 | 1.39591 | 66.98464 | 1123.055 |
| 3 | −3 | −7 | 4 | 1.39498 | 67.03543 | 1584.166 |
| 6 | −2 | −2 | 4 | 1.39432 | 67.07096 | 6423.831 |
| 2 | −2 | −8 | 4 | 1.39368 | 67.10576 | 2221.480 |
| 4 | 0 | 4 | 2 | 1.39233 | 67.17963 | 9756.798 |
| 6 | −2 | −5 | 4 | 1.39218 | 67.18803 | 123.361 |
| 6 | 0 | 0 | 2 | 1.39146 | 67.22715 | 61458.719 |
| 4 | −4 | −1 | 4 | 1.38844 | 67.39312 | 1208.544 |
| 4 | 3 | 2 | 4 | 1.38797 | 67.41877 | 146.200 |
| 5 | −1 | −8 | 4 | 1.37882 | 67.92709 | 1203.279 |
| 0 | 4 | 5 | 4 | 1.37785 | 67.98154 | 710.651 |
| 1 | −5 | −2 | 4 | 1.37724 | 68.01559 | 3062.095 |
| 4 | −4 | −4 | 4 | 1.37608 | 68.08057 | 27359.787 |
| 1 | 5 | 1 | 4 | 1.37219 | 68.30019 | 694.557 |
| 0 | 0 | 8 | 2 | 1.37213 | 68.30382 | 15200.482 |
| 0 | 5 | 2 | 4 | 1.37096 | 68.37016 | 828.054 |
| 1 | −3 | −7 | 4 | 1.36918 | 68.47118 | 3214.390 |
| 4 | −2 | −8 | 4 | 1.36910 | 68.47589 | 45.553 |
| 4 | 1 | 4 | 4 | 1.36616 | 68.64389 | 519.685 |
| 6 | 1 | 0 | 4 | 1.36534 | 68.69093 | 1607.419 |
| 5 | 3 | 0 | 4 | 1.36303 | 68.82355 | 2112.606 |
| 3 | 4 | 2 | 4 | 1.36190 | 68.88850 | 1753.492 |
| 6 | −1 | −7 | 4 | 1.36065 | 68.96085 | 2649.621 |
| 2 | 3 | 5 | 4 | 1.36033 | 68.97921 | 2510.422 |
| 2 | −5 | −1 | 4 | 1.35414 | 69.33989 | 3657.629 |
| 6 | −2 | −1 | 4 | 1.35205 | 69.46230 | 243.801 |
| 4 | −3 | −7 | 4 | 1.35190 | 69.47100 | 6915.945 |
| 1 | −2 | −8 | 4 | 1.35018 | 69.57237 | 1099.760 |
| 4 | 4 | 0 | 4 | 1.34986 | 69.59140 | 705.399 |
| 5 | −3 | −6 | 4 | 1.34938 | 69.61938 | 756.755 |
| 6 | −2 | −6 | 4 | 1.34879 | 69.65417 | 2227.248 |
| 1 | 3 | 6 | 4 | 1.34807 | 69.69667 | 318.911 |
| 2 | −5 | −2 | 4 | 1.34710 | 69.75419 | 61.678 |
| 0 | 1 | 8 | 4 | 1.34706 | 69.75684 | 1471.690 |
| 2 | 2 | 6 | 4 | 1.34705 | 69.75717 | 576.139 |
| 2 | 5 | 0 | 4 | 1.34082 | 70.12915 | 2349.962 |
| 3 | 3 | 4 | 4 | 1.34035 | 70.15689 | 35.647 |
| 1 | −5 | −3 | 4 | 1.33737 | 70.33644 | 2229.274 |
| 2 | −4 | −6 | 4 | 1.33596 | 70.42175 | 3337.051 |
| 3 | 2 | 5 | 4 | 1.33592 | 70.42439 | 156.499 |
Gas-Phase DFT Calculations
The INHHQ structure was optimized in gas phase, using the DFT methodology, level of theory B3LYP/6-311+G (d,p).
As described above, a total of 5 conformations with the smallest PM3 energy differences were selected to perform a DFT optimization and frequency calculations. Cis-trans isomerism was contemplated in this treatment. Energy values found for each of these structures indicated that there are, in fact, only 3 different conformations. Conf. 5 is the one with the lowest free energy (ΔG) when compared to the other conformations. However, the energy differences between the structures are not appreciable, especially between the Conf. 1/2 with respect to the Conf. 5 (only 0.06 kcal mol−1), indicating that, indeed, all five conformations are possible, particularly Conf. 5. This last one was chosen for further deeper studies.
It is shown (Table 2) that there is excellent agreement between the structural parameters found in the calculations (Conf. 5) and the refined X-ray structure and that, in turn, there is no significant difference between FIGS. 1 and 4 . Crystallography shows that the phenolic hydrogen points in the direction of the quinolinic nitrogen, since a connection involving these H atoms is formed, producing a 2.691 Å donor-acceptor distance, in perfect agreement with the X-ray data (O1 . . . N4=2.689 Å).
Vibrational Analyses
The experimental FTIR and Raman spectra of INHHQ, in the solid state, are shown in FIG. 5 . The observed and calculated frequencies, as well as an attempt to assign the main bands, are given in Table 4.
| TABLE 4 |
| Assignment of the FTIR and Raman spectra of INHHQ (scale factor: 0.9381) |
| Theoretical (cm−1) | ||
| B3LYP/6-311 + G(d, p) |
| Experimental (cm−1) | Unscaled | Scaled | ||
| FTIRRaman | (cm−1) | (cm−1) | IR Intensity | Vibrational Assignment |
| 3396 | m | 3400 | br | 3662 | 3435 | 104.3584 | v OH |
| 3208 | sh | 3205 | w | — |
| 3183 | w | — | 3502 | 3285 | 5.5099 | v NH |
| 3148 | sh | — | 3211/3205 | 3012/3007 | 1.8906/3.2991 | v CH(Quin + Py)ip |
| 3073 | sh | 3081 | w | 3198 | 3000 | 9.2441 | v CH(Quin)ip |
| 3059 | sh | 3055 | w | 3185/3178 | 2988/2981 | 18.7464/9.9528 | v CH(Quin + Py)op |
| 3042 | w | — | — |
| 3028 | sh | 3030 | w | — |
| 3016 | w | — | — |
| — | 2996 | w | — |
| 2959 | sh | — | — | |||
| 2923 | w | — | — | |||
| 2852 | w | — | 3048 | 2859 | 40.4835 | vCH(Azomethine) |
| 2835 | sh | — | — |
| 1656 | s | 1660 | sh | 1767 | 1658 | 350.6350 | vC═O + βNH |
| 1647 | vs | 1646 | w | 1673 | 1569 | 20.7477 | v C═N(Azomethine) + |
| v C═C(Quin) + βC—OH | |||||||
| 1604 | w | 1603 | vs | 1659 | 1556 | 2.3397 | v C═N(Azomethine) + |
| v C═C(Quin) + βC—OH | |||||||
| 1595 | w | 1595 | s | 1634 | 1533 | 5.5690 | v C═C(Quin) |
| 1556 | m | 1555 | w | 1597 | 1498 | 18.4149 | v C═N(Quin) + vC═C(Quin) |
| 1545 | m | — | 1630 | 1529 | 14.2312 | v C═C(Py) + vC═N(Py) |
| 1507 | m | 1507 | w | 1555 | 1459 | 371.3416 | βNH + βCH(Quin) |
| 1490 | w | 1488 | vw | — | |||
| 1465 | m | 1468 | w | 1541 | 1446 | 168.8474 | Ring stretch(Quin) + |
| βC—OH + β NH | |||||||
| 1437 | m | 1435 | s | 1519 | 1425 | 6.8860 | βCH(Py) |
| 1407 | w | — | — |
| 1394 | sh | 1396 | m | — | |||
| 1371 | w | 1371 | m | 1495 | 1402 | 176.2051 | β C—OH + β NH + |
| β CH(Quin) | |||||||
| 1330 | m | 1329 | m | — | |||
| 1299 | s | 1304 | m | 1360 | 1276 | 34.4059 | β CH(Quin + Azomethine) + |
| v C═N(Quin) + v C—OH | |||||||
| 1280 | m | 1279 | sh | 1347 | 1264 | 31.7632 | β NH + β |
| CH(Azomethine + Py) + | |||||||
| β C—OH |
| 1270 | sh | — | — |
| 1252 | m | 1252 | s | 1309 | 1228 | 15.0576 | β CH(Quin + |
| Azomethyne) + β C—OH |
| 1232 | m | — | 1284 | 1205 | 117.6910 | v C—OH + β CH(Quin + |
| Azomethine) |
| 1217 | w | 1220 | w | 1278 | 1199 | 32.0853 | v C═N(Py) + vC═C(Py) + |
| β NH | |||||||
| 1204 | w | 1204 | vw | 1267 | 1189 | 56.8637 | β CH(Azomethine + |
| Quin) + β C—OH | |||||||
| 1170 | w | 1172 | sh | 1253 | 1175 | 303.5474 | βCH(Py) + βNH |
| 1156 | m | 1156 | m | 1172 | 1099 | 380.9402 | v N—N + βCH(Py + |
| Quin) | |||||||
| 1136 | w | 1133 | w | 1112 | 1043 | 10.8679 | βCH(Py) |
| 1122 | sh | — | — |
| 1105 | w | 1105 | vw | — | |||
| 1090 | w | 1093 | vw | 1109 | 1040 | 19.7634 | βCH(Py + Quin) |
| 1072 | w | 1076 | w | 1092 | 1024 | 9.3109 | βCH(Py) |
| — | 1063 | vw | 1079 | 1012 | 11.9293 | βCH(Quin) + δ NNC |
| 1044 | vw | 1044 | vw | 1068 | 1002 | 1.6514 | βCH(Quin) |
| 1007 | vw | — | — |
| 992 | vw | 992 | w | 1010 | 947 | 1.7715 | Ring breath(Py) |
| 981 | vw | — | 1008 | 946 | 1.5921 | γCH(Py) |
| 950 | vw | 952 | w | 959 | 900 | 14.8080 | γCH(Azomethine) |
| 931 | w | 932 | w | 914 | 857 | 2.9777 | Ring-deformation(Quin + |
| Py) | |||||||
| 895 | w | 897 | vw | — |
| 881 | vw | — | — |
| 867 | w | 869 | w | 898 | 842 | 0.0665 | γCH(Quin) |
| 856 | m | 855 | sh | 880 | 826 | 11.8041 | Ring-deformation(Quin + |
| Py) | |||||||
| 837 | m | 835 | vw | 892 | 837 | 2.8606 | γCH(Py) |
| — | 812 | vw | 804 | 754 | 2.0048 | γ C═C—C(Quin) + |
| γ C═N—C(Quin) |
| 792 | vw | 780 | w | 789 | 740 | 5.7350 | β C═C—C(Quin + |
| Azomethine) | |||||||
| 766 | s | 768 | vw | 767 | 720 | 9.2858 | γCH(Py) |
| 720 | m | 720 | m | 734 | 689 | 18.7702 | Ring-deformation(Quin) |
| 696 | w | 696 | vw | 763 | 716 | 38.2602 | γ CH(Quin) |
| 677 | s | — | 719 | 674 | 19.3631 | β C═N—C(Py) + |
| β C═C—C(Quin) |
| 670 | sh | 668 | w | 698 | 655 | 2.0785 | γ C═C—C(Quin) + |
| β C═N—C(Py) | |||||||
| 656 | w | 657 | w | 693 | 650 | 58.0279 | Ring-deformation(Py) |
| 644 | sh | — | 681 | 639 | 1.5003 | Ring-deformation(Py) |
| 616 | vw | — | 627 | 588 | 2.3638 | Ring-deformation(Quin) |
| 587 | m | — | 604 | 567 | 90.9456 | γ OH |
| 575 | w | — | — |
| 547 | sh | 553 | w | 588 | 552 | 10.5255 | β C═C—C(Quin) |
| 532 | sh | 533 | vw | 559 | 524 | 1.6705 | β C═C—C(Quin) + γ NH |
| 522 | w | 523 | vw | 551 | 517 | 14.1393 | γCH(Quin) + |
| β C═C—C(Quin) + | |||||||
| β C—OH | |||||||
| 482 | w | 485 | w | 539/534 | 506/501 | 16.0281/30.1104 | γ NH + γ C═C—C(Quin) |
| Quin: quinoline ring; Py: pyridine ring; vs: very strong; s: strong; m: medium; w: weak; vw: very weak; br: broad; sh: shoulder; ip: in-phase; op: out-of-phase; v: stretching; β: in-plane bending; γ: out-of-plane bending. | |||||||
Carbonylic C═O Stretching
The v C═O absorption is usually one of the most representative in an infrared spectrum and is also likely its most intense spectral feature. It appears in a wavenumber region relatively free of other vibrations (1800-1600 cm−1). On the other hand, this mode gives only weak or very weak absorptions in Raman spectroscopy. In our study, as expected, v C═O vibration originates one of the strongest bands of the infrared spectrum, at 1656 cm−1, which is in excellent agreement with the calculated value of 1658 cm−1 (DFT calculations show a coupling between v C═O and β NH vibrations).
This mode was assigned at 1663 cm−1 by Liu and Yang.
Azomethine C═N Stretching
The C═N stretchings of azomethine groups show absorptions close to that of carbonyl stretching. This fact can difficult an accurate assignment. For example, the C═N stretching bands of alkylated Schiff bases are usually found in the range 1674-1649 cm−1, inside the common region of v C═O absorption. If conjugations of the C═N moiety with phenyl groups are present, the stretching frequency shifts to 1650-1600 cm−1. In this work, two frequencies involving azomethine C═N vibrations were calculated (1569/1556 cm−1), both of them coupled to v C═C of the quinoline ring and, to a lesser extent, to the phenol v C—OH. These values are in good agreement with the experimental frequencies observed in the infrared, at 1647 (vs) and 1604 (w) cm−1, and Raman spectra, at 1646 (w) and 1603 (vs) cm−1, respectively.
Liu and Yang, though, attributed this mode to a single band at 1613 cm−1 in the IR spectrum, which was not observed in our study.
OH and NH Stretching Vibrations
OH and NH groups are very characteristic and their stretching vibrations are observed, in many cases, around 3500-3300 cm−1. This absorption, however, is highly influenced by chemical environment, mainly when OH or NH groups are involved in hydrogen bonding. This can occur within the same molecule (intramolecular H bonding) or with adjacent molecules (intermolecular H bonding). The presence of intramolecular H bonding causes a thinning of the band and makes its position unaffected by concentration changes. In the IR spectrum of INHHQ, we observed a sharp band of medium intensity located at 3396 cm−1, assigned to v OH. A similar absorption, at 3418 cm−1, was reported by Krishnakumar and Ramasamy in the infrared spectrum of 8-hydroxyquinoline (8-HQ). On the other hand, intermolecular hydrogen bonding usually leads to a broadening of the band, as can be seen in the case of the v NH absorption of INHHQ, which was attributed to the weak IR band at 3183 cm−1. In a previous study on the isonicotinoyl hydrazone of 2-hydroxy-3-methoxybenzaldehyde, published by us, v NH vibration was observed as a weak band at 3157 cm−1. Here, we found serious discrepancies concerning the assignments made by Liu and Yang, since these authors attributed an absorption of higher frequency (reported by them at 3576 cm−1) to the NH stretching mode, whereas the lower frequency band at 3193 cm−1 was credited to the OH stretching movement.
Phenol C—OH Vibrations
In this work, the C—OH stretching mode was assigned to the medium intensity infrared band at 1232 cm−1. This vibration is Raman inactive and had its frequency calculated at 1205 cm−1. A coupled mode involving this movement was also predicted at 1276 cm−1 [experimental: 1299 (infrared) cm−1 and 1304 (Raman) cm−1]. Another important vibration concerning the phenol group is the in-plane bending, which typically appears in the region 1440-1260 cm−1, attributed to the weak infrared band (medium in the Raman spectrum) at 1371 cm−1. Coupled modes are observed in FTIR at 1465, 1280, 1252 and 1202 cm−1. Theoretical and experimental frequencies show good agreement (Table 4).
Biological Activity Studies
This hydrazonic compound has the ability, as proved by 1D and 2D NMR experiments, of compete with the β-amyloid peptide (or α-synuclein), key-targets, respectively, in Alzheimer's and Parkinson's diseases, by physiological ions such as Zn2+ Cu2+ and Cu+, which can cause their precipitation or oligomerization and contribute to worsen the oxidative stress condition observed in the brains of patients suffering from these neurodegenerative disorders. INHHQ does not interact directly with the β-amyloid peptide and α-synuclein, nonetheless inhibits the interactions between these targets and metals through a mechanism that probably involves metal ion sequestering.
In silico pharmacological analyses (mandatory studies in the development of new therapeutic agents, whose aim is to predict pharmacokinetic properties of novel molecules with a potential pharmacological action) show that the Lipinski's parameters presented by INHHQ (Table 5), calculated via 1D-QSAR method, are in agreement to ideal values, suggesting that this compound constitutes an excellent candidate to new drug, with good oral absorption and cellular permeability. The model also indicates that INHHQ possesses structural features which can allow it crossing the blood-brain barrier (BBB), resulting in therapeutic actions inside the patients' brains.
| TABLE 5 |
| Lipinski parameters calculated for |
| INHHQ, along with reference values |
| Ref. Oral | Ref. BBB | ||
| Parameters | INHHQ | | Crossing |
| HBD |
| 2 | ≤5 | ≤3 | |
| HBA | 6 | ≤10 | ≤7 |
| MW | 292 | ≤500 | ≤400 |
| log P | 2.34 | −1 a 5 | −1 a 5 |
| log D (pH = 7.4) | 2.27 | −1 a 5 | −1 a 5 |
| log S | −3.36 | −4 a 2 | −4 a 2 |
| PSA | 66.077 Å | ≤140 Å | ≤90 Å |
| Rotatable bonds | 4 | ≤10 | ≤10 |
Furthermore, both the INHHQ molecule itself and its potential metabolites were shown, in theoretical comparison with the toxic fragments of over 3000 commercially available drugs, completely non-toxic.
In fact, the intraperitoneal injection of up to 300 mg kg−1 of the compound, using 10% DMSO/saline solution as vehicle of injection, in Wistar male rats (acute toxicity test) showed that INHHQ was apparently not toxic to the animals throughout the 72 h of the experiment: no animals died and there were no behavioral changes noted in the injected rats. Also, after the animals' sacrifice, there were no macroscopic abnormalities observed during its organs dissection.
Claims (6)
1. A crystalline polymorph of the anhydrous form, comprising:
I—the crystal structure of FIG. 1 :
II—crystal packing comprising one or more of the following features:
(a) maintained by intermolecular H bonds involving the carbonyl oxygen O2 (acceptor) of a molecule and the N2-H group of the following molecule [moderate N2 . . . O2i=2,966 Å, symmetry codes: (i) −x+½, y−½, z], connecting the molecules of INHHQ in zigzag chains; or
(b) molecules in each chain interconnected by cross-stacking π-π interactions involving the quinoline rings, being the calculated centroid-centroid distance equal to 3.8303(9) Å, and the adjacent chains interconnected by O1-H12 . . . π interactions; or
(c) as a result of the mentioned O1-H12 . . . π interactions, zigzag columns run parallel to the crystallographic axis a; and
III—the following characteristics:
2. The crystalline polymorph of the anhydrous form according to claim 1 , presenting X-ray diffraction peaks (2θ ranging from 10.5 to 70.5°) as follows:
3. The crystalline polymorph of the anhydrous form according to claim 1 , further comprising the infrared spectrum FIG. 5 .
4. The crystalline polymorph of the anhydrous form according to claim 1 , presenting the next IR vibrational frequencies:
C═O stretching at 1656 cm−1; and
azomethine C═N stretching at 1647 cm−1 and 1604 cm−1; and
OH stretching at 3396 cm−1; and
NH stretching at 3183 cm−1.
5. The crystalline polymorph of the anhydrous form according to claim 4 , further comprising the infrared spectrum FIG. 5 .
6. A pharmaceutical composition comprising the anhydrous crystalline polymorph as described in claim 1 , 2 , 3 , 4 , or 5 , further comprising, at least one of a diluent, an excipient, and any pharmaceutically acceptable vehicle.
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BR102013033006 | 2013-12-20 | ||
| BR102013033006A BR102013033006A2 (en) | 2013-12-20 | 2013-12-20 | method of preparing the anhydrous crystalline form of isoniazid-derived hydrazone, the crystalline polymorph of the produced anhydrous form, its use for the treatment of alzheimer's, parkinson's and other neurodegenerative disorders and pharmaceutical composition |
| PCT/BR2014/000186 WO2015089599A1 (en) | 2013-12-20 | 2014-06-06 | Method for preparing the anhydrous crystalline form of isoniazid-derived hydrazone, thus produced crystalline polymorph of the anhydrous form, use thereof for the treatment of alzheimer's disease, parkinsonism and other neurodegenerative disorders, and pharmaceutical composition |
Related Parent Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PCT/BR2014/000186 A-371-Of-International WO2015089599A1 (en) | 2013-12-20 | 2014-06-06 | Method for preparing the anhydrous crystalline form of isoniazid-derived hydrazone, thus produced crystalline polymorph of the anhydrous form, use thereof for the treatment of alzheimer's disease, parkinsonism and other neurodegenerative disorders, and pharmaceutical composition |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US16/209,104 Division US10316019B2 (en) | 2013-12-20 | 2018-12-04 | Method for preparing the anhydrous crystalline form of isoniazid-derived hydrazone, thus produced crystalline polymorph of the anyhydrous form, use thereof for the treatment of alzheimer's disease, parkinsonism and other neurodegenerative disorders, and pharamceutical composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| US20170158665A1 US20170158665A1 (en) | 2017-06-08 |
| US10189811B2 true US10189811B2 (en) | 2019-01-29 |
Family
ID=53401816
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US15/106,181 Active US10189811B2 (en) | 2013-12-20 | 2014-06-06 | Method for preparing the anhydrous crystalline form of isoniazid-derived hydrazone, thus produced cristalline polymorph of the anhydrous form, use thereof for the treatment of Alzheimer's disease, parkinsonism and other neurodegenerative disorders, and pharmaceutical composition |
| US16/209,104 Active US10316019B2 (en) | 2013-12-20 | 2018-12-04 | Method for preparing the anhydrous crystalline form of isoniazid-derived hydrazone, thus produced crystalline polymorph of the anyhydrous form, use thereof for the treatment of alzheimer's disease, parkinsonism and other neurodegenerative disorders, and pharamceutical composition |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US16/209,104 Active US10316019B2 (en) | 2013-12-20 | 2018-12-04 | Method for preparing the anhydrous crystalline form of isoniazid-derived hydrazone, thus produced crystalline polymorph of the anyhydrous form, use thereof for the treatment of alzheimer's disease, parkinsonism and other neurodegenerative disorders, and pharamceutical composition |
Country Status (4)
| Country | Link |
|---|---|
| US (2) | US10189811B2 (en) |
| EP (1) | EP3085691A4 (en) |
| BR (1) | BR102013033006A2 (en) |
| WO (1) | WO2015089599A1 (en) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR102020005423A2 (en) * | 2020-03-18 | 2021-09-28 | Faculdades Catolicas | N-ACYL HYDRAZONE COMPOUNDS, USE IN THE TREATMENT OF AMYLOID AND NON-AMYLOID DEGENERATIVE AGGREGOPATIES, AND PHARMACEUTICAL COMPOSITION |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH349599A (en) * | 1956-11-22 | 1960-10-31 | Geistlich Soehne Ag | Process for the production of new antituberculotics |
-
2013
- 2013-12-20 BR BR102013033006A patent/BR102013033006A2/en not_active Application Discontinuation
-
2014
- 2014-06-06 US US15/106,181 patent/US10189811B2/en active Active
- 2014-06-06 EP EP14872636.7A patent/EP3085691A4/en not_active Withdrawn
- 2014-06-06 WO PCT/BR2014/000186 patent/WO2015089599A1/en not_active Ceased
-
2018
- 2018-12-04 US US16/209,104 patent/US10316019B2/en active Active
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH349599A (en) * | 1956-11-22 | 1960-10-31 | Geistlich Soehne Ag | Process for the production of new antituberculotics |
Non-Patent Citations (12)
| Title |
|---|
| L. Viana de Freitas et al., 116 Spectrochimica Acta Part A: Molecular and Biomolecular Spectroscopy, 41-48 (2013). * |
| Machine Translation of CH 349,599 (1960). * |
| Solid State Characterization of Pharmaceuticals 427-450 (R.A. Storey et al., eds., 2011). * |
| Y.C. Liu et al., 44 European Journal of Medicinal Chemistry, 5080-5089 (2009). * |
| Y-C Liu et al., 103 Journal of Inorganic Biochemistry, 1014-1022 (2009). * |
| Y-C Liu et al., 12 Inorganic Chemistry Communications, 704-706 (2009). * |
| Y-C Liu et al., 147 Journal of Biochemistry, 381-391 (2010). * |
| Y-C Liu et al., 22 BioMetals, 733-751 (2009). * |
| Y-C Liu et al., 64 Applied Spectroscopy, 980-985 (2010). * |
| Y-C Liu et al., 64 Australian Journal of Chemistry, 345-354 (2011). * |
| Y-C Liu et al., Journal of Inorganic Biochemistry (Jul. 9, 2009). * |
| Y-C-Liu et al., 694 Journal of Organometallic Chemistry, 3091-3101 (2009). * |
Also Published As
| Publication number | Publication date |
|---|---|
| BR102013033006A2 (en) | 2016-09-06 |
| US20190106408A1 (en) | 2019-04-11 |
| EP3085691A1 (en) | 2016-10-26 |
| US20170158665A1 (en) | 2017-06-08 |
| WO2015089599A1 (en) | 2015-06-25 |
| US10316019B2 (en) | 2019-06-11 |
| EP3085691A4 (en) | 2017-05-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Shokrollahi et al. | Promising anti-cancer potency of 4, 5, 6, 7-tetrahydrobenzo [d] thiazole-based Schiff-bases | |
| JP6889825B2 (en) | Tetradentate chelate monoquinoline derivative and its production method, application as a metal ion regulator for neurodegenerative diseases | |
| Hansen et al. | Rhenium (V) oxo complexes relevant to technetium renal imaging agents derived from mercaptoacetylglycylglycylaminobenzoic acid isomers. Structural and molecular mechanics studies | |
| Sovari et al. | Rhenium (I) derivatives of aminoquinoline and imidazolopiperidine-based ligands: synthesis, in vitro and in silico biological evaluation against Plasmodium falciparum | |
| US10316019B2 (en) | Method for preparing the anhydrous crystalline form of isoniazid-derived hydrazone, thus produced crystalline polymorph of the anyhydrous form, use thereof for the treatment of alzheimer's disease, parkinsonism and other neurodegenerative disorders, and pharamceutical composition | |
| Umar et al. | New amyloid beta-disaggregating agents: Synthesis, pharmacological evaluation, crystal structure and molecular docking of N-(4-((7-chloroquinolin-4-yl) oxy)-3-ethoxybenzyl) amines | |
| Braymer et al. | Characterization of pyridinylimine and pyridinylmethylamine derivatives and their corresponding metal complexes | |
| Zelinskii et al. | Synthesis, structure and reactivity of iron (II) clathrochelates with terminal formyl (acetal) groups | |
| Basheer et al. | Investigation on DNA/Protein interaction of thiosemicarbazone based octahedral nickel (II) and iron (III) complexes | |
| Rocha et al. | A new perfluoromethyl aminoenone derivative and the role of the hydrogen bonding in the intra-and intermolecular interactions | |
| De Freitas et al. | Synthesis and structural characterization of a 8-hydroxyquinoline derivative coordinated to Zn (II) | |
| Fawzi et al. | Multitargeted molecular docking and dynamics simulation studies of 1, 3, 4-thiadiazoles synthesised from (R)-carvone against specific tumour protein markers: An In-silico study of two diastereoisomers | |
| El Safadi et al. | Cyclen-based chelators for the inhibition of Aβ aggregation: Synthesis, anti-oxidant and aggregation evaluation | |
| Zelinskii et al. | The molecular design of cage metal complexes for biological applications: pathways of the synthesis, and X-ray structures of a series of new N 2-, S 2-and O 2-alicyclic iron (ii) di-and tetrachloroclathrochelates | |
| Lundin et al. | Synthesis and hypodentate Cu (II) complexes of new tripodal tetraamine ligands incorporating a long pendant arm | |
| Jadoo et al. | Novel coumarin rhenium (I) and-(V) complexes: Formation, DFT and DNA binding studies | |
| Danish et al. | Synthesis, characterization, In-silico and In-vitro investigation of sulfonamide based esters | |
| Islam et al. | Computational, Hirshfeld surface, and molecular docking analysis of 2-(((4-methoxyphenyl) imino) methyl)-4-nitrophenol: In-vitro anticancer, antimicrobial, anti-inflammatory, and antioxidant studies | |
| Rodríguez et al. | The crystal structure and characterization of a co-product in the synthesis of a Schiff base give evidence of its zwitterionic nature in the solid state | |
| Gong et al. | Synthesis, crystal structure, spectroscopic characterization, DFT calculations, Hirshfeld surface analysis, biological activity studies, molecular docking investigation, and ADMET properties evaluation of a novel 3-substituted coumarin derivative | |
| Manna et al. | Linear bis-urea anion receptors with halo-methylphenyl mixed substitution: Evidences of F− induced atmospheric CO2 capture | |
| Ahmad et al. | Copper (II) complex as SARS-CoV-2 Nirmatrelvir inhibitor: Synthesis, crystal structure, anticancer and antiviral properties | |
| Huang et al. | Synthesis and characterization of 8-aminoquinolines, substituted by electron donating groups, as high-affinity copper chelators for the treatment of Alzheimer's disease | |
| Bilkan et al. | Experimental and theoretical investigation of novel ferrocene-based sulfisoxazole derivatives and their palladium (II) complex: Synthesis, spectroscopic characterization, DFT analysis, molecular docking, and in silico evaluation | |
| Liu et al. | Design, synthesis, and biological evaluation of 7H-thiazolo [3, 2-b]-1, 2, 4-triazin-7-one derivatives as dual binding site acetylcholinesterase inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AS | Assignment |
Owner name: FACULDADES CATOLICAS, ASSOCIACAO SEM FINS LUCRATIV Free format text: ASSIGNMENT OF ASSIGNORS INTEREST;ASSIGNORS:REY, NICOLAS ADRIAN;DE FREITAS, LEONARDO VIANA;REEL/FRAME:039088/0183 Effective date: 20160617 |
|
| STCF | Information on status: patent grant |
Free format text: PATENTED CASE |
|
| MAFP | Maintenance fee payment |
Free format text: PAYMENT OF MAINTENANCE FEE, 4TH YR, SMALL ENTITY (ORIGINAL EVENT CODE: M2551); ENTITY STATUS OF PATENT OWNER: SMALL ENTITY Year of fee payment: 4 |

