TH176451A - EGFR / C- MET, a specific antibody against two targets. - Google Patents
EGFR / C- MET, a specific antibody against two targets.Info
- Publication number
- TH176451A TH176451A TH1501002742A TH1501002742A TH176451A TH 176451 A TH176451 A TH 176451A TH 1501002742 A TH1501002742 A TH 1501002742A TH 1501002742 A TH1501002742 A TH 1501002742A TH 176451 A TH176451 A TH 176451A
- Authority
- TH
- Thailand
- Prior art keywords
- met
- egfr
- targets
- specific antibody
- antibody against
- Prior art date
Links
- 102000052116 epidermal growth factor receptor activity proteins Human genes 0.000 title 1
- 108700015053 epidermal growth factor receptor activity proteins Proteins 0.000 title 1
- YOHYSYJDKVYCJI-UHFFFAOYSA-N n-[3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide Chemical compound FC(F)(F)C1=CC=CC(NC=2N=CN=C(NC=3C=C(NC(=O)C4CC4)C=CC=3)C=2)=C1 YOHYSYJDKVYCJI-UHFFFAOYSA-N 0.000 title 1
- 239000003814 drug Substances 0.000 claims abstract 2
- 229940079593 drug Drugs 0.000 claims abstract 2
- 150000001413 amino acids Chemical class 0.000 claims 2
- 230000035772 mutation Effects 0.000 claims 2
- 231100000350 mutagenesis Toxicity 0.000 claims 1
- 230000035755 proliferation Effects 0.000 claims 1
- 108090000623 proteins and genes Proteins 0.000 claims 1
Abstract
สิทธิบัตรยา Drug patent
Claims (1)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| TH176451A true TH176451A (en) | 2018-06-07 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BR112015024553A2 (en) | multispecific antibody, isolated antibody, isolated nucleic acid, host cell, antibody production method, immunoconjugate, pharmaceutical formulation, antibody use and method of treating individuals with disorder | |
| EP3362782A4 (en) | DEVICE FOR READING AN IVD ASSAY | |
| BR112015022763A2 (en) | oxygen sensors | |
| BR112015031540A2 (en) | hyperbranch polymers | |
| BR112019000963A2 (en) | process for the preparation of phenylmalonic acid dinitriles | |
| TH176451A (en) | EGFR / C- MET, a specific antibody against two targets. | |
| EP3916607A4 (en) | SYSTEM WITH TAMPERING DETECTIVITY | |
| TH176248A (en) | IL-21 antibodies | |
| TH180425A (en) | Conjugated drug antibody (ADC), which binds to the 158P1D7 protein. | |
| TH1701000239A (en) | New Tenofovir Disoproxil Salt | |
| TH179210A (en) | Anti-PDL1 Antibody Formula | |
| TH179003A (en) | ||
| TH182884A (en) | Immune regulating agents | |
| TH176529A (en) | Antibody specific to FcRn | |
| TH166762A (en) | Hot dip galvanized steel sheet | |
| TH180268A (en) | antibody | |
| TH180751A (en) | Antibody-CD52 Antibody | |
| TH1501002903A (en) | Targeting the BCL11A terminal-controlled component for new inductance. | |
| TH181126A (en) | PD-1 Antibody, a fragment that binds to that antigen of that antibody. And the medical use of antibodies | |
| TH1601001699A (en) | Ceftholosen's solid form | |
| TH178608A (en) | ||
| TH177286A (en) | Steel plate | |
| TH176892A (en) | Monochloral antibody neutralized human anti-IL-33. | |
| TH181568A (en) | Composition and methods for EPO-targeted antibodies | |
| TH1701003631A (en) | Quinazoline derivatives used to treat HIV |