SU466661A3 - Способ получени производных аминотриазина - Google Patents
Способ получени производных аминотриазинаInfo
- Publication number
- SU466661A3 SU466661A3 SU1745173A SU1745173A SU466661A3 SU 466661 A3 SU466661 A3 SU 466661A3 SU 1745173 A SU1745173 A SU 1745173A SU 1745173 A SU1745173 A SU 1745173A SU 466661 A3 SU466661 A3 SU 466661A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- general formula
- mol
- alcohol
- hydrogen
- branched
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 7
- QQOWHRYOXYEMTL-UHFFFAOYSA-N triazin-4-amine Chemical class N=C1C=CN=NN1 QQOWHRYOXYEMTL-UHFFFAOYSA-N 0.000 title claims description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 7
- 150000007524 organic acids Chemical class 0.000 claims description 6
- 150000007522 mineralic acids Chemical class 0.000 claims description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 5
- -1 Ci-C4-alkyl Chemical group 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 238000005809 transesterification reaction Methods 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 150000003138 primary alcohols Chemical class 0.000 claims description 2
- 150000003333 secondary alcohols Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 4
- 239000001257 hydrogen Substances 0.000 claims 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 4
- 125000003277 amino group Chemical group 0.000 claims 2
- 238000009835 boiling Methods 0.000 claims 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 2
- 230000003993 interaction Effects 0.000 claims 2
- 239000011541 reaction mixture Substances 0.000 claims 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims 1
- ACIAHEMYLLBZOI-ZZXKWVIFSA-N Unsaturated alcohol Chemical compound CC\C(CO)=C/C ACIAHEMYLLBZOI-ZZXKWVIFSA-N 0.000 claims 1
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 150000001412 amines Chemical class 0.000 claims 1
- 230000005494 condensation Effects 0.000 claims 1
- 238000009833 condensation Methods 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 31
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 12
- 229920000877 Melamine resin Polymers 0.000 description 11
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N iso-butyl alcohol Natural products CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 11
- 239000002244 precipitate Substances 0.000 description 11
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 229940035429 isobutyl alcohol Drugs 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- SZNYYWIUQFZLLT-UHFFFAOYSA-N 2-methyl-1-(2-methylpropoxy)propane Chemical compound CC(C)COCC(C)C SZNYYWIUQFZLLT-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- VZXTWGWHSMCWGA-UHFFFAOYSA-N 1,3,5-triazine-2,4-diamine Chemical compound NC1=NC=NC(N)=N1 VZXTWGWHSMCWGA-UHFFFAOYSA-N 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N Butanol Natural products CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N isopropyl alcohol Natural products CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N n-propyl alcohol Natural products CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- NIXKBAZVOQAHGC-UHFFFAOYSA-N phenylmethanesulfonic acid Chemical compound OS(=O)(=O)CC1=CC=CC=C1 NIXKBAZVOQAHGC-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- NIFIFKQPDTWWGU-UHFFFAOYSA-N pyrite Chemical compound [Fe+2].[S-][S-] NIFIFKQPDTWWGU-UHFFFAOYSA-N 0.000 description 1
- 229910052683 pyrite Inorganic materials 0.000 description 1
- 239000011028 pyrite Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000011269 tar Substances 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
Landscapes
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Phenolic Resins Or Amino Resins (AREA)
- Paints Or Removers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT95271A AT306042B (de) | 1971-02-05 | 1971-02-05 | Verfahren zur Herstellung von Aminotriazinderivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU466661A3 true SU466661A3 (ru) | 1975-04-05 |
Family
ID=3503596
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1745173A SU466661A3 (ru) | 1971-02-05 | 1972-02-04 | Способ получени производных аминотриазина |
Country Status (5)
| Country | Link |
|---|---|
| JP (1) | JPS563347B1 (https=) |
| ES (1) | ES399499A1 (https=) |
| HU (1) | HU163762B (https=) |
| IT (1) | IT951112B (https=) |
| SU (1) | SU466661A3 (https=) |
-
1972
- 1972-02-03 JP JP1189272A patent/JPS563347B1/ja active Pending
- 1972-02-03 IT IT6732872A patent/IT951112B/it active
- 1972-02-04 HU HUOE000169 patent/HU163762B/hu unknown
- 1972-02-04 SU SU1745173A patent/SU466661A3/ru active
- 1972-02-04 ES ES399499A patent/ES399499A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT951112B (it) | 1973-06-30 |
| HU163762B (https=) | 1973-10-27 |
| JPS563347B1 (https=) | 1981-01-24 |
| ES399499A1 (es) | 1974-11-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Woods et al. | Dihydropyrane addition products | |
| US3558597A (en) | Process for the production of sugar esters | |
| US2729660A (en) | Phosphite esters as esterification catalysts | |
| US2526554A (en) | Preparation of beta-hydroxy carboxylic acid esters by alcoholysis of linear polyesters derived from beta-lactones | |
| US2448890A (en) | Condensation products of polyht | |
| US3577438A (en) | Method of producing oxetane esters | |
| SU466661A3 (ru) | Способ получени производных аминотриазина | |
| US2694687A (en) | Vinyloxyalkylmelamines | |
| US2010154A (en) | Ether acid ester of polyhydric alcohols | |
| US3806508A (en) | Process for the preparation of a pure aminotriazine derivative | |
| US2694732A (en) | Process for making beta-aliphaticoxypropionaldehyde | |
| IE53063B1 (en) | Preparation of a bis-allyl or bis-butenyl carbonate of a dihydric alcohol | |
| US3069475A (en) | Process for the production of | |
| US2818424A (en) | Esters of halogenated phenoxy acetic acids and alpha-hydroxyaliphatic acids | |
| US2326006A (en) | Synthetic resin from polyacetoacetates of polyhydric alcohols and formaldehyde | |
| US2421597A (en) | Unsaturated cyclic ethers | |
| US2557667A (en) | Reaction products of a cyanuric triester and a polyhydric alcohol and methods of preparing the same | |
| US2161213A (en) | Substituted malonig esters | |
| US2426902A (en) | Higher alkyl esters of chloromaleic acid | |
| Dudley et al. | Cyanuric chloride derivatives. VII. Transesterification reactions of alkoxy-s-triazines. Polyammelide ethers | |
| US2229651A (en) | Process of alcoholysis | |
| US2504151A (en) | Process of preparing methyl betafurfuryloxypropionate | |
| US3475343A (en) | Process for producing solvent for paint and lacquer | |
| SU602503A1 (ru) | Тетракис-(гидроксиалкиленокси)титан как катализатор переэтерификации и поликонденсации и способ его получени | |
| US4334075A (en) | Oxazoline diesters |