SU423265A3 - Гербицид - Google Patents
ГербицидInfo
- Publication number
- SU423265A3 SU423265A3 SU1644206A SU1644206A SU423265A3 SU 423265 A3 SU423265 A3 SU 423265A3 SU 1644206 A SU1644206 A SU 1644206A SU 1644206 A SU1644206 A SU 1644206A SU 423265 A3 SU423265 A3 SU 423265A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- dimethyl
- urea
- benzothiazolyl
- methyl
- herbicide
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title description 8
- 239000004009 herbicide Substances 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 description 7
- 229920000742 Cotton Polymers 0.000 description 4
- -1 1,1-dimethyl-3- (2-aminobenzothiazolyl) urea Chemical compound 0.000 description 3
- JJGMSGOXJDRQAH-UHFFFAOYSA-N 1,1-dimethyl-3-(5-methyl-1,3-benzothiazol-2-yl)urea Chemical compound CN(C(=O)NC=1SC2=C(N1)C=C(C=C2)C)C JJGMSGOXJDRQAH-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- IGMUUGLXLKXSSI-UHFFFAOYSA-N 1,1-dimethyl-3-(4-methyl-1,3-benzothiazol-2-yl)urea Chemical compound CN(C(=O)NC=1SC2=C(N1)C(=CC=C2)C)C IGMUUGLXLKXSSI-UHFFFAOYSA-N 0.000 description 1
- AMIJSEIHRANBNZ-UHFFFAOYSA-N 3-(1,3-benzothiazol-2-yl)-1,1-dimethylurea Chemical compound C1=CC=C2SC(NC(=O)N(C)C)=NC2=C1 AMIJSEIHRANBNZ-UHFFFAOYSA-N 0.000 description 1
- UUAGOYCKPQLXCI-UHFFFAOYSA-N 3-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-1,1-dimethylurea Chemical compound CN(C(=O)NC=1SC2=C(N1)C(=CC=C2Cl)C)C UUAGOYCKPQLXCI-UHFFFAOYSA-N 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical class COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- RUJWVDYSEVDBRZ-UHFFFAOYSA-N CN(C(=O)NC=1SC2=C(N1)C=CC(=C2)OC)C Chemical compound CN(C(=O)NC=1SC2=C(N1)C=CC(=C2)OC)C RUJWVDYSEVDBRZ-UHFFFAOYSA-N 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- RRVIAQKBTUQODI-UHFFFAOYSA-N Methabenzthiazuron Chemical compound C1=CC=C2SC(N(C)C(=O)NC)=NC2=C1 RRVIAQKBTUQODI-UHFFFAOYSA-N 0.000 description 1
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical class CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 1
- NRPZEHBHKLYRLM-UHFFFAOYSA-N NC=1SC2=C(N1)C(=CC=C2)NC(=O)N Chemical class NC=1SC2=C(N1)C(=CC=C2)NC(=O)N NRPZEHBHKLYRLM-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 235000013330 chicken meat Nutrition 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2710170A | 1970-04-09 | 1970-04-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU423265A3 true SU423265A3 (ru) | 1974-04-05 |
Family
ID=21835688
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1644206A SU423265A3 (ru) | 1970-04-09 | 1971-04-08 | Гербицид |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3714177A (enExample) |
| AT (1) | AT307140B (enExample) |
| AU (1) | AU2702071A (enExample) |
| BE (1) | BE765477A (enExample) |
| BG (1) | BG19078A3 (enExample) |
| BR (1) | BR7102082D0 (enExample) |
| CA (1) | CA933169A (enExample) |
| CH (1) | CH556137A (enExample) |
| DE (1) | DE2116956A1 (enExample) |
| ES (1) | ES389886A1 (enExample) |
| FR (1) | FR2089397A5 (enExample) |
| GB (1) | GB1338778A (enExample) |
| HU (1) | HU163689B (enExample) |
| IL (1) | IL36462A (enExample) |
| NL (1) | NL7104895A (enExample) |
| PL (1) | PL81481B1 (enExample) |
| RO (1) | RO62176A (enExample) |
| SU (1) | SU423265A3 (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3807985A (en) * | 1970-12-10 | 1974-04-30 | Monsanto Co | Benzothiazolinylidene substituted ureas |
| US3818024A (en) * | 1972-02-16 | 1974-06-18 | Velsicol Chemical Corp | Benzothiazol substituted thiadiazolidines |
| JPS5637205B2 (enExample) * | 1973-02-05 | 1981-08-29 | ||
| JPS5614643B2 (enExample) * | 1973-07-02 | 1981-04-06 | ||
| US3932434A (en) * | 1974-08-30 | 1976-01-13 | Eli Lilly And Company | N-2-(6-hydroxybenzothiazolyl)-N'-phenyl (or substituted phenyl) ureas |
| US4033750A (en) * | 1974-09-14 | 1977-07-05 | Nippon Soda Company Limited | Herbicidal composition |
| JPS5747885B2 (enExample) * | 1974-10-31 | 1982-10-13 | ||
| US4169093A (en) * | 1978-05-25 | 1979-09-25 | Morton-Norwich Products, Inc. | 2-Amino-5-phenylmethoxy-6-methoxybenzothiazole hydrochloride |
| CN103833673A (zh) * | 2012-11-23 | 2014-06-04 | 中国中化股份有限公司 | 一种制备4-甲基-2-氨基苯并噻唑的方法 |
-
1970
- 1970-04-09 US US00027101A patent/US3714177A/en not_active Expired - Lifetime
-
1971
- 1971-03-22 IL IL36462A patent/IL36462A/xx unknown
- 1971-03-26 AU AU27020/71A patent/AU2702071A/en not_active Expired
- 1971-03-29 CA CA108987A patent/CA933169A/en not_active Expired
- 1971-03-31 CH CH463371A patent/CH556137A/xx not_active IP Right Cessation
- 1971-04-03 ES ES389886A patent/ES389886A1/es not_active Expired
- 1971-04-06 BG BG17272A patent/BG19078A3/xx unknown
- 1971-04-07 BR BR2082/71A patent/BR7102082D0/pt unknown
- 1971-04-07 DE DE19712116956 patent/DE2116956A1/de active Pending
- 1971-04-08 SU SU1644206A patent/SU423265A3/ru active
- 1971-04-08 BE BE765477A patent/BE765477A/xx unknown
- 1971-04-08 HU HUEO275A patent/HU163689B/hu unknown
- 1971-04-08 FR FR7112489A patent/FR2089397A5/fr not_active Expired
- 1971-04-08 RO RO7100066524A patent/RO62176A/ro unknown
- 1971-04-08 AT AT300271A patent/AT307140B/de not_active IP Right Cessation
- 1971-04-09 PL PL1971147447A patent/PL81481B1/pl unknown
- 1971-04-13 NL NL7104895A patent/NL7104895A/xx unknown
- 1971-04-19 GB GB2608971*A patent/GB1338778A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH556137A (de) | 1974-11-29 |
| AT307140B (de) | 1973-05-10 |
| BR7102082D0 (pt) | 1973-04-12 |
| RO62176A (fr) | 1977-10-15 |
| CA933169A (en) | 1973-09-04 |
| NL7104895A (enExample) | 1971-10-12 |
| ES389886A1 (es) | 1974-03-16 |
| IL36462A0 (en) | 1971-05-26 |
| IL36462A (en) | 1974-09-10 |
| GB1338778A (en) | 1973-11-28 |
| BE765477A (fr) | 1971-10-08 |
| US3714177A (en) | 1973-01-30 |
| DE2116956A1 (de) | 1971-10-21 |
| FR2089397A5 (enExample) | 1972-01-07 |
| HU163689B (enExample) | 1973-10-27 |
| PL81481B1 (enExample) | 1975-08-30 |
| BG19078A3 (enExample) | 1975-04-30 |
| AU2702071A (en) | 1972-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU423265A3 (ru) | Гербицид | |
| GB916574A (en) | 4-halo-2-butynyl carbamates and derivatives, processes for preparing same and pesticidal compositions containing same | |
| US3502720A (en) | N-(2-methyl-4-chlorophenyl)-formamidines | |
| EP0163236B1 (de) | Benzoxazolyl- und Benzthiazolyl-aminosäuren, ihre Herstellung und Verwendung im Pflanzenschutz | |
| GB987381A (en) | Amidinophenylcarbamates and their use as pesticides of insecticidal and acaricidal activity | |
| GB955287A (en) | Herbicides and methods of using same | |
| US3378437A (en) | Acaricidal agents | |
| US2435274A (en) | Control of insects | |
| US4005217A (en) | Treatment of helminth infections with substituted phenyl-thiourea derivatives | |
| US2307700A (en) | Alpha-phenyl cinnamic nitrile as an insecticide | |
| US2656357A (en) | 1-piperazyl-4-methylthioxanthones and method of preparing same | |
| US2862967A (en) | N-alkyl-n-(alkylated-benzyl)dihaloacetamides and preparation thereof | |
| SU526272A3 (ru) | Гербицидное средство | |
| Mathison et al. | Synthesis and hypotensive properties of tetrahydroisoquinolines | |
| US2365936A (en) | Poly-beta-cyanoethyl indene as an insecticide | |
| GB1325244A (en) | Amidothionophosphonic acid esters a process for their preparation and their use as herbicides | |
| US2720523A (en) | Pregnadiene compounds | |
| US3978222A (en) | Fungicidally active 3-amino-propionic acid chloroanilides | |
| US2885320A (en) | Cycloheximide thiosemicarbazone | |
| SU579844A3 (ru) | Гербицидный состав | |
| US3022308A (en) | Decahydrobenzopyridine quaternaries | |
| US3772330A (en) | 2-phenylamino-delta1-pyrrolines | |
| JPS63216808A (ja) | 衣料用防虫剤 | |
| US2285184A (en) | Pest control | |
| US2173386A (en) | Insecticide |