SU266457A1 - - Google Patents
Info
- Publication number
- SU266457A1 SU266457A1 SU1269707A SU1269707A SU266457A1 SU 266457 A1 SU266457 A1 SU 266457A1 SU 1269707 A SU1269707 A SU 1269707A SU 1269707 A SU1269707 A SU 1269707A SU 266457 A1 SU266457 A1 SU 266457A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- fuel
- additive
- running
- diketones
- rings
- Prior art date
Links
- 239000000446 fuel Substances 0.000 claims description 25
- 239000000654 additive Substances 0.000 claims description 15
- 230000000996 additive effect Effects 0.000 claims description 14
- 239000002480 mineral oil Substances 0.000 claims description 3
- 235000010446 mineral oil Nutrition 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 238000002485 combustion reaction Methods 0.000 claims description 2
- 150000002170 ethers Chemical class 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- MBEVSMZJMIQVBG-UHFFFAOYSA-N 2-(hydroxymethyl)guanidine Chemical compound NC(N)=NCO MBEVSMZJMIQVBG-UHFFFAOYSA-N 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical group [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 230000003749 cleanliness Effects 0.000 description 3
- 230000006835 compression Effects 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 239000002283 diesel fuel Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- -1 aluminum alkoxides Chemical class 0.000 description 1
- 150000004718 beta keto acids Chemical class 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 210000000080 chela (arthropods) Anatomy 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 238000001303 quality assessment method Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU266457A1 true SU266457A1 (enrdf_load_html_response) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4609376A (en) | Anti-wear additives in alkanol fuels | |
| JP2011527716A (ja) | 炭化水素燃料を投入した内燃機関の燃費を改善する組成物及び方法 | |
| US2906613A (en) | Suppression of fuel icing | |
| CA1173045A (fr) | Succinimides n-substitues, leur preparation et leur utilisation comme additifs pour carburants | |
| US4259254A (en) | Method of preparing lubricant additives | |
| US4167486A (en) | Lubricant composition containing a lubricity agent | |
| CA2506199A1 (en) | Liquid phenolic sulphur-containing antioxidants | |
| SU266457A1 (enrdf_load_html_response) | ||
| US2844448A (en) | Fuels containing a deposit-control additive | |
| US4177768A (en) | Fuel compositions | |
| US4198931A (en) | Diesel fuel | |
| US4880437A (en) | Fuel compositions containing maleic derivatives of 2,5-dimercapto-1,3,4-thiadiazole | |
| US4394134A (en) | Reducing fuel consumption with a fluorinated compound | |
| EP0116197A2 (en) | Ignition improver for an alcohol based fuel for compression ignition engines | |
| US4208292A (en) | Phosphomolybdate compounds and their use as lubricant additives | |
| US4738686A (en) | Cetane number | |
| US2378466A (en) | Diesel fuel and method of improving diesel fuel ignition | |
| US4303414A (en) | Azido additives for liquid hydrocarbon motor fuels | |
| RU2027742C1 (ru) | Композиционная смесь для очистки рабочих поверхностей камеры сгорания и газовыхлопного тракта двигателей внутреннего сгорания от нагаров и способ их очистки | |
| US3654152A (en) | Process for making detergent inhibiting additives | |
| SU334869A1 (enrdf_load_html_response) | ||
| WO1994009093A1 (en) | Fuel compositions containing reaction products of aromatic triazoles and fatty acids as antiwear additives | |
| EP0243495A1 (en) | Diesel fuel composition. | |
| RU2325434C2 (ru) | Смазочное масло для силовых турбин | |
| US2876750A (en) | Fuel containing anti-icing additives |