SE7406873L - Kalciumnitrathaltigt sprengemne. - Google Patents
Kalciumnitrathaltigt sprengemne.Info
- Publication number
- SE7406873L SE7406873L SE7406873A SE7406873A SE7406873L SE 7406873 L SE7406873 L SE 7406873L SE 7406873 A SE7406873 A SE 7406873A SE 7406873 A SE7406873 A SE 7406873A SE 7406873 L SE7406873 L SE 7406873L
- Authority
- SE
- Sweden
- Prior art keywords
- kalcium
- nitrate
- exposure
- nitrate exposure
- water
- Prior art date
Links
- 229910002651 NO3 Inorganic materials 0.000 title 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 title 1
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 abstract 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract 2
- 239000002360 explosive Substances 0.000 abstract 1
- 239000000446 fuel Substances 0.000 abstract 1
- 230000001590 oxidative effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US456083A US3899374A (en) | 1974-03-29 | 1974-03-29 | Calcium nitrate explosive composition |
| SE7406873A SE7406873L (sv) | 1974-03-29 | 1974-05-22 | Kalciumnitrathaltigt sprengemne. |
| ZA00743305A ZA743305B (en) | 1974-03-29 | 1974-05-22 | Calcium nitrate explosive composition |
| FR7417958A FR2272052A1 (enExample) | 1974-03-29 | 1974-05-22 | |
| NL7406912A NL7406912A (nl) | 1974-03-29 | 1974-05-22 | Explosief mengsel op basis van anorganische oxyderende zouten, alsmede werkwijze voor het bereiden daarvan. |
| JP49056783A JPS50148514A (enExample) | 1974-03-29 | 1974-05-22 | |
| DE19742424886 DE2424886A1 (de) | 1974-03-29 | 1974-05-22 | Explosive calciumnitrat-komposition |
| BR4189/74A BR7404189A (pt) | 1974-03-29 | 1974-05-22 | Composicao explosiva e processo para sua preparacao |
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US456083A US3899374A (en) | 1974-03-29 | 1974-03-29 | Calcium nitrate explosive composition |
| SE7406873A SE7406873L (sv) | 1974-03-29 | 1974-05-22 | Kalciumnitrathaltigt sprengemne. |
| ZA00743305A ZA743305B (en) | 1974-03-29 | 1974-05-22 | Calcium nitrate explosive composition |
| FR7417958A FR2272052A1 (enExample) | 1974-03-29 | 1974-05-22 | |
| NL7406912A NL7406912A (nl) | 1974-03-29 | 1974-05-22 | Explosief mengsel op basis van anorganische oxyderende zouten, alsmede werkwijze voor het bereiden daarvan. |
| JP49056783A JPS50148514A (enExample) | 1974-03-29 | 1974-05-22 | |
| DE19742424886 DE2424886A1 (de) | 1974-03-29 | 1974-05-22 | Explosive calciumnitrat-komposition |
| BR4189/74A BR7404189A (pt) | 1974-03-29 | 1974-05-22 | Composicao explosiva e processo para sua preparacao |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE7406873L true SE7406873L (sv) | 1975-11-24 |
Family
ID=27570190
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7406873A SE7406873L (sv) | 1974-03-29 | 1974-05-22 | Kalciumnitrathaltigt sprengemne. |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3899374A (enExample) |
| JP (1) | JPS50148514A (enExample) |
| BR (1) | BR7404189A (enExample) |
| DE (1) | DE2424886A1 (enExample) |
| FR (1) | FR2272052A1 (enExample) |
| NL (1) | NL7406912A (enExample) |
| SE (1) | SE7406873L (enExample) |
| ZA (1) | ZA743305B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4091213A (en) * | 1975-12-12 | 1978-05-23 | Bristol-Myers Company | 7-Cyclizedamino-3-heterothiomethyl cephalosporin derivatives |
| US4364782A (en) * | 1980-09-12 | 1982-12-21 | Ireco Chemicals | Permissible slurry explosive |
| US4356044A (en) * | 1981-03-23 | 1982-10-26 | Ireco Chemicals | Emulsion explosives containing high concentrations of calcium nitrate |
| US4453989A (en) * | 1982-04-05 | 1984-06-12 | Atlas Powder Company | Solid sensitizers for water-in-oil emulsion explosives |
| US4439254A (en) * | 1982-04-05 | 1984-03-27 | Atlas Powder Company | Solid sensitizers in water gel explosives and method |
| US4416711A (en) * | 1982-12-17 | 1983-11-22 | Ireco Chemicals | Perchlorate slurry explosive |
| JPS6021891A (ja) * | 1983-07-15 | 1985-02-04 | 日本油脂株式会社 | 爆薬組成物 |
| US4693765A (en) * | 1986-05-22 | 1987-09-15 | Stromquist Donald M | Gel type slurry explosive and matrix and method for making same |
| US4701227A (en) * | 1987-02-05 | 1987-10-20 | Loverro Jr Nicholas P | Ammonium nitrate explosive compositions |
| US5007973A (en) * | 1989-10-12 | 1991-04-16 | Atlas Powder Company | Multicomponent explosives |
| US4978400A (en) * | 1989-11-17 | 1990-12-18 | General Sciences, Inc. | Synergistic composite pyrotechnic material |
| US4980000A (en) * | 1990-01-17 | 1990-12-25 | Atlas Powder Company | Nitrostarch emulsion explosives production process |
| US5051142A (en) * | 1990-01-17 | 1991-09-24 | Atlas Powder Company | Emulsion explosive containing nitrostarch |
| US5089652A (en) * | 1990-01-17 | 1992-02-18 | Atlas Powder Company | Nitrate ester preparation |
| US6334917B1 (en) * | 1998-10-23 | 2002-01-01 | Autoliv Asp, Inc. | Propellant compositions for gas generating apparatus |
| US6238500B1 (en) * | 1999-07-26 | 2001-05-29 | Trw Inc. | Smokeless gas generating material |
| US20080245450A1 (en) * | 2007-01-23 | 2008-10-09 | Bioenergy Systems, Llc | Explosive Compositions Containing Glycerin |
| US8101032B1 (en) * | 2007-05-18 | 2012-01-24 | University Of Central Florida Research Foundation, Inc. | Ethanol based gel fuel for a hybrid rocket engine |
| CN114594226B (zh) * | 2022-03-08 | 2022-12-06 | 武汉理工大学 | 内爆毁伤威力评估装置及方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3660181A (en) * | 1969-05-01 | 1972-05-02 | Intermountain Res & Eng | Blasting slurry compositions containing calcium nitrate and method of preparation |
| US3816191A (en) * | 1970-05-04 | 1974-06-11 | Dow Chemical Co | Method of making calcium nitrate explosive composition |
| US3713917A (en) * | 1970-11-16 | 1973-01-30 | Ireco Chemicals | Blasting slurry compositions contain-ing calcium nitrate and method of preparation |
| US3787254A (en) * | 1971-06-01 | 1974-01-22 | Ireco Chemicals | Explosive compositions containing calcium nitrate |
-
1974
- 1974-03-29 US US456083A patent/US3899374A/en not_active Expired - Lifetime
- 1974-05-22 BR BR4189/74A patent/BR7404189A/pt unknown
- 1974-05-22 DE DE19742424886 patent/DE2424886A1/de active Pending
- 1974-05-22 FR FR7417958A patent/FR2272052A1/fr not_active Withdrawn
- 1974-05-22 ZA ZA00743305A patent/ZA743305B/xx unknown
- 1974-05-22 NL NL7406912A patent/NL7406912A/xx unknown
- 1974-05-22 SE SE7406873A patent/SE7406873L/ not_active Application Discontinuation
- 1974-05-22 JP JP49056783A patent/JPS50148514A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US3899374A (en) | 1975-08-12 |
| NL7406912A (nl) | 1975-11-25 |
| ZA743305B (en) | 1975-06-25 |
| JPS50148514A (enExample) | 1975-11-28 |
| FR2272052A1 (enExample) | 1975-12-19 |
| BR7404189A (pt) | 1976-02-03 |
| DE2424886A1 (de) | 1975-12-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE7406873L (sv) | Kalciumnitrathaltigt sprengemne. | |
| NL7506311A (nl) | Ontwikkelmengsel. | |
| BR7507741A (pt) | Rocadeira portatil | |
| SE403101B (sv) | Pyroteknisk gasgenerator | |
| SE380696B (sv) | Sett att alstra en pseudoslumpbitfoljd och anordning for utforande av settet. | |
| BE826504A (fr) | Generateur de mots pseudo-aleatoires | |
| SE7404930L (sv) | Absorptionskropp. | |
| NL167760C (nl) | Verbrandingsinrichting. | |
| ES229804Y (es) | Farol. | |
| NL7511882A (nl) | Bolafsluiter. | |
| TR19176A (tr) | Entegre edilmis,koemuer hidrokarbonizasyonu ve yanmis koemuersue madde gazlastirilmasi | |
| NL7502635A (nl) | Ontstekingsinrichting. | |
| NL7510387A (nl) | Carburator. | |
| FR2333765A1 (fr) | Perchlorethylene stabilise | |
| NO145108C (no) | Anordning ved boreredskap. | |
| NL7608506A (nl) | Olie- en vochtwerende fluorhoudende samen- stellingen. | |
| SE7504039L (sv) | Forradsblandning. | |
| NL163474C (nl) | Stokloos anker. | |
| NL7507246A (nl) | Anker. | |
| NL7511391A (nl) | Afsluiter of klep. | |
| NL179759C (nl) | Onderwater-ontstekingsinrichting. | |
| NL161838B (nl) | Combinatieslot. | |
| NL7511071A (nl) | Electronische ontsteker. | |
| NL7513226A (nl) | Gaslaser. | |
| BE829689A (fr) | Fusee percutante |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAV | Patent application has lapsed |
Ref document number: 7406873-5 |