SE449233B - Monopoler elektrolysor av filterpresstyp - Google Patents
Monopoler elektrolysor av filterpresstypInfo
- Publication number
- SE449233B SE449233B SE7802385A SE7802385A SE449233B SE 449233 B SE449233 B SE 449233B SE 7802385 A SE7802385 A SE 7802385A SE 7802385 A SE7802385 A SE 7802385A SE 449233 B SE449233 B SE 449233B
- Authority
- SE
- Sweden
- Prior art keywords
- anode
- cathode
- plates
- diaphragm
- plate
- Prior art date
Links
- 229910052751 metal Inorganic materials 0.000 claims description 39
- 239000002184 metal Substances 0.000 claims description 39
- 125000006850 spacer group Chemical group 0.000 claims description 36
- -1 polypropylene Polymers 0.000 claims description 21
- 238000000576 coating method Methods 0.000 claims description 20
- 239000000463 material Substances 0.000 claims description 17
- 239000011248 coating agent Substances 0.000 claims description 16
- 239000012811 non-conductive material Substances 0.000 claims description 16
- 239000010407 anodic oxide Substances 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 239000004743 Polypropylene Substances 0.000 claims description 10
- 229920001155 polypropylene Polymers 0.000 claims description 10
- 229910000975 Carbon steel Inorganic materials 0.000 claims description 9
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 9
- 239000010962 carbon steel Substances 0.000 claims description 9
- 229910052719 titanium Inorganic materials 0.000 claims description 9
- 239000010936 titanium Substances 0.000 claims description 9
- 239000013536 elastomeric material Substances 0.000 claims description 7
- 238000005868 electrolysis reaction Methods 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 4
- QNRATNLHPGXHMA-XZHTYLCXSA-N (r)-(6-ethoxyquinolin-4-yl)-[(2s,4s,5r)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;hydrochloride Chemical compound Cl.C([C@H]([C@H](C1)CC)C2)CN1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OCC)C=C21 QNRATNLHPGXHMA-XZHTYLCXSA-N 0.000 claims description 3
- 239000002033 PVDF binder Substances 0.000 claims description 3
- 239000003792 electrolyte Substances 0.000 claims description 3
- 229920002981 polyvinylidene fluoride Polymers 0.000 claims description 3
- 229910001508 alkali metal halide Inorganic materials 0.000 claims description 2
- 150000008045 alkali metal halides Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 13
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 11
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 7
- 238000010276 construction Methods 0.000 description 6
- 239000000835 fiber Substances 0.000 description 6
- 239000000945 filler Substances 0.000 description 6
- 150000004706 metal oxides Chemical class 0.000 description 6
- 150000002739 metals Chemical class 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000004033 plastic Substances 0.000 description 6
- 229920003023 plastic Polymers 0.000 description 6
- 229910052697 platinum Inorganic materials 0.000 description 6
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000010425 asbestos Substances 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229920002313 fluoropolymer Polymers 0.000 description 5
- 229910000510 noble metal Inorganic materials 0.000 description 5
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 5
- 239000004810 polytetrafluoroethylene Substances 0.000 description 5
- 229910052895 riebeckite Inorganic materials 0.000 description 5
- 229920003051 synthetic elastomer Polymers 0.000 description 5
- 239000005061 synthetic rubber Substances 0.000 description 5
- 239000004408 titanium dioxide Substances 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 4
- 229910045601 alloy Inorganic materials 0.000 description 4
- 239000000956 alloy Substances 0.000 description 4
- 239000001913 cellulose Substances 0.000 description 4
- 229920002678 cellulose Polymers 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 229910052742 iron Inorganic materials 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 4
- 229910052726 zirconium Inorganic materials 0.000 description 4
- 244000043261 Hevea brasiliensis Species 0.000 description 3
- 229910001069 Ti alloy Inorganic materials 0.000 description 3
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 239000008199 coating composition Substances 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 239000004811 fluoropolymer Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- YBMRDBCBODYGJE-UHFFFAOYSA-N germanium dioxide Chemical compound O=[Ge]=O YBMRDBCBODYGJE-UHFFFAOYSA-N 0.000 description 3
- 229910044991 metal oxide Inorganic materials 0.000 description 3
- 229920003052 natural elastomer Polymers 0.000 description 3
- 229920001194 natural rubber Polymers 0.000 description 3
- 229910052758 niobium Inorganic materials 0.000 description 3
- 239000010955 niobium Substances 0.000 description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 3
- 238000003825 pressing Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 229910052715 tantalum Inorganic materials 0.000 description 3
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 3
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- CETPSERCERDGAM-UHFFFAOYSA-N ceric oxide Chemical compound O=[Ce]=O CETPSERCERDGAM-UHFFFAOYSA-N 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 238000010304 firing Methods 0.000 description 2
- 150000002222 fluorine compounds Chemical class 0.000 description 2
- 229910052741 iridium Inorganic materials 0.000 description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 230000010287 polarization Effects 0.000 description 2
- 239000011819 refractory material Substances 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
- 229910001925 ruthenium oxide Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- 229910052582 BN Inorganic materials 0.000 description 1
- PZNSFCLAULLKQX-UHFFFAOYSA-N Boron nitride Chemical compound N#B PZNSFCLAULLKQX-UHFFFAOYSA-N 0.000 description 1
- 229910002971 CaTiO3 Inorganic materials 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 229910052581 Si3N4 Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- NRTOMJZYCJJWKI-UHFFFAOYSA-N Titanium nitride Chemical compound [Ti]#N NRTOMJZYCJJWKI-UHFFFAOYSA-N 0.000 description 1
- 229910001093 Zr alloy Inorganic materials 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 238000005275 alloying Methods 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 239000010405 anode material Substances 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 1
- 229910001634 calcium fluoride Inorganic materials 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- AOWKSNWVBZGMTJ-UHFFFAOYSA-N calcium titanate Chemical compound [Ca+2].[O-][Ti]([O-])=O AOWKSNWVBZGMTJ-UHFFFAOYSA-N 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- XFWJKVMFIVXPKK-UHFFFAOYSA-N calcium;oxido(oxo)alumane Chemical compound [Ca+2].[O-][Al]=O.[O-][Al]=O XFWJKVMFIVXPKK-UHFFFAOYSA-N 0.000 description 1
- 239000010406 cathode material Substances 0.000 description 1
- 229910000422 cerium(IV) oxide Inorganic materials 0.000 description 1
- 229910001902 chlorine oxide Inorganic materials 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000000748 compression moulding Methods 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 238000010041 electrostatic spinning Methods 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229940119177 germanium dioxide Drugs 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910000449 hafnium oxide Inorganic materials 0.000 description 1
- WIHZLLGSGQNAGK-UHFFFAOYSA-N hafnium(4+);oxygen(2-) Chemical compound [O-2].[O-2].[Hf+4] WIHZLLGSGQNAGK-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- SZVJSHCCFOBDDC-UHFFFAOYSA-N iron(II,III) oxide Inorganic materials O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000011236 particulate material Substances 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- YSZJKUDBYALHQE-UHFFFAOYSA-N rhenium trioxide Chemical compound O=[Re](=O)=O YSZJKUDBYALHQE-UHFFFAOYSA-N 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229910021332 silicide Inorganic materials 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- HQVNEWCFYHHQES-UHFFFAOYSA-N silicon nitride Chemical compound N12[Si]34N5[Si]62N3[Si]51N64 HQVNEWCFYHHQES-UHFFFAOYSA-N 0.000 description 1
- 229910052596 spinel Inorganic materials 0.000 description 1
- 239000011029 spinel Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- 229920005613 synthetic organic polymer Polymers 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 229910003452 thorium oxide Inorganic materials 0.000 description 1
- PMTRSEDNJGMXLN-UHFFFAOYSA-N titanium zirconium Chemical compound [Ti].[Zr] PMTRSEDNJGMXLN-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B9/00—Cells or assemblies of cells; Constructional parts of cells; Assemblies of constructional parts, e.g. electrode-diaphragm assemblies; Process-related cell features
- C25B9/70—Assemblies comprising two or more cells
- C25B9/73—Assemblies comprising two or more cells of the filter-press type
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9189/77A GB1595193A (en) | 1977-03-04 | 1977-03-04 | Diaphragm cell |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7802385L SE7802385L (sv) | 1978-09-05 |
| SE449233B true SE449233B (sv) | 1987-04-13 |
Family
ID=9867127
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7802385A SE449233B (sv) | 1977-03-04 | 1978-03-02 | Monopoler elektrolysor av filterpresstyp |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4204939A (it) |
| JP (1) | JPS6031913B2 (it) |
| AR (1) | AR214774A1 (it) |
| AT (1) | AT353812B (it) |
| AU (1) | AU514448B2 (it) |
| BE (1) | BE864363A (it) |
| BR (1) | BR7801308A (it) |
| CA (1) | CA1107685A (it) |
| CH (1) | CH631746A5 (it) |
| DD (1) | DD134123A5 (it) |
| DE (1) | DE2809333C2 (it) |
| ES (1) | ES467549A1 (it) |
| FR (1) | FR2382519A1 (it) |
| GB (1) | GB1595193A (it) |
| IT (1) | IT1092982B (it) |
| MY (1) | MY8300021A (it) |
| NL (1) | NL7802371A (it) |
| PL (1) | PL125027B1 (it) |
| PT (1) | PT67736A (it) |
| SE (1) | SE449233B (it) |
| SU (1) | SU805955A3 (it) |
| ZA (1) | ZA781077B (it) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IN156372B (it) * | 1980-05-15 | 1985-07-06 | Ici Plc | |
| DE3170397D1 (en) * | 1980-07-30 | 1985-06-13 | Ici Plc | Electrode for use in electrolytic cell |
| DE3236988A1 (de) * | 1981-10-28 | 1983-06-01 | IMI Marston Ltd., Wolverhampton, Staffordshire | Bipolare elektrochemische zelle |
| ATE15818T1 (de) * | 1981-11-24 | 1985-10-15 | Ici Plc | Elektrolytische filterpressenzelle. |
| DE3219704A1 (de) * | 1982-05-26 | 1983-12-01 | Uhde Gmbh, 4600 Dortmund | Membran-elektrolysezelle |
| DE3808495A1 (de) * | 1988-03-15 | 1989-09-28 | Metallgesellschaft Ag | Membranelektrolysevorrichtung |
| US5322604A (en) * | 1992-11-02 | 1994-06-21 | Olin Corporation | Electrolytic cell and electrodes therefor |
| US5340457A (en) * | 1993-04-29 | 1994-08-23 | Olin Corporation | Electrolytic cell |
| US20030017081A1 (en) * | 1994-02-10 | 2003-01-23 | Affymetrix, Inc. | Method and apparatus for imaging a sample on a device |
| NL1005081C2 (nl) * | 1997-01-24 | 1998-07-27 | Zilvold Tieleman Hydro Technie | Inrichting voor het uitvoeren van een elektrolyse, een hierin toepasbaar celelement, werkwijze voor het uitvoeren van een elektrolyse in een dergelijke inrichting, werkwijze voor het bereiden van chloordioxide, reactor voor het uitvoeren van een dergelijke werkwijze en een installatie voor het bereiden van chloordioxide. |
| DE19816334A1 (de) * | 1998-04-11 | 1999-10-14 | Krupp Uhde Gmbh | Elektrolyseapparat zur Herstellung von Halogengasen |
| JP5207529B2 (ja) * | 2008-06-30 | 2013-06-12 | クロリンエンジニアズ株式会社 | 硫酸電解槽及び硫酸電解槽を用いた硫酸リサイクル型洗浄システム |
| US8864962B2 (en) | 2008-07-15 | 2014-10-21 | Next Hydrogen Corporation | Electrolyser module |
| CA2637865A1 (en) * | 2008-07-15 | 2010-01-15 | 1755610 Ontario Inc. | Electrolyser module |
| WO2011020172A1 (en) * | 2009-08-19 | 2011-02-24 | Next Hydrogen Corporation | Proton exchange membrane water electrolyser cell module design |
| GB2490159A (en) * | 2011-04-20 | 2012-10-24 | Jake Gould | A mesh separator located between the cathode and anode of an electrolysis cell for the electrolysis of water |
| US9187833B2 (en) | 2012-09-13 | 2015-11-17 | Next Hydrogen Corporation | Internally-reinforced water electrolyser module |
| US9133553B2 (en) | 2012-09-13 | 2015-09-15 | Next Hydrogen Corporation | Externally-reinforced water electrolyzer module |
| ITPD20130280A1 (it) * | 2013-10-09 | 2015-04-10 | Idropan Dell Orto Depuratori S R L | Apparecchiatura per il trattamento di un fluido |
| CN109809532A (zh) * | 2019-03-13 | 2019-05-28 | 杭州睿清环保科技有限公司 | 一种超低功耗的污水处理电化学反应器 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH288156A (de) * | 1949-11-03 | 1953-01-15 | Montedison Spa | Elektrodensystem für Bipolarelektrolyseure. |
| DE2100214A1 (de) * | 1970-01-13 | 1971-07-22 | Ici Ltd | Elektrode |
| US3941675A (en) * | 1971-09-28 | 1976-03-02 | Friedrich Uhde Gmbh | Bipolar multiple electrolytic cell comprising a diaphragm and electrode for same |
| US3864236A (en) * | 1972-09-29 | 1975-02-04 | Hooker Chemicals Plastics Corp | Apparatus for the electrolytic production of alkali |
| FR2297672A1 (fr) * | 1975-01-14 | 1976-08-13 | Rech Tech Et Indles | Electrolyseur |
| JPS51119681A (en) * | 1975-04-15 | 1976-10-20 | Asahi Glass Co Ltd | A cell frame for an electrolizer |
| US4124478A (en) * | 1977-02-07 | 1978-11-07 | Tsien Hsue C | Thin sheet apparatus and a fluid flow device |
-
1977
- 1977-03-04 GB GB9189/77A patent/GB1595193A/en not_active Expired
-
1978
- 1978-02-23 ZA ZA00781077A patent/ZA781077B/xx unknown
- 1978-02-23 US US05/880,878 patent/US4204939A/en not_active Expired - Lifetime
- 1978-02-27 BE BE185522A patent/BE864363A/xx unknown
- 1978-03-01 IT IT20815/78A patent/IT1092982B/it active
- 1978-03-02 AU AU33776/78A patent/AU514448B2/en not_active Expired
- 1978-03-02 SE SE7802385A patent/SE449233B/sv not_active IP Right Cessation
- 1978-03-03 DE DE2809333A patent/DE2809333C2/de not_active Expired
- 1978-03-03 CA CA298,174A patent/CA1107685A/en not_active Expired
- 1978-03-03 FR FR7806150A patent/FR2382519A1/fr active Granted
- 1978-03-03 SU SU782587749A patent/SU805955A3/ru active
- 1978-03-03 PT PT67736A patent/PT67736A/pt unknown
- 1978-03-03 PL PL1978205061A patent/PL125027B1/pl unknown
- 1978-03-03 NL NL7802371A patent/NL7802371A/xx not_active Application Discontinuation
- 1978-03-03 AR AR271303A patent/AR214774A1/es active
- 1978-03-03 ES ES467549A patent/ES467549A1/es not_active Expired
- 1978-03-03 BR BR7801308A patent/BR7801308A/pt unknown
- 1978-03-04 JP JP53024068A patent/JPS6031913B2/ja not_active Expired
- 1978-03-06 DD DD78203992A patent/DD134123A5/xx unknown
- 1978-03-06 AT AT157578A patent/AT353812B/de not_active IP Right Cessation
- 1978-03-06 CH CH242278A patent/CH631746A5/de not_active IP Right Cessation
-
1983
- 1983-12-30 MY MY21/83A patent/MY8300021A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2382519A1 (fr) | 1978-09-29 |
| IT1092982B (it) | 1985-07-12 |
| JPS53124198A (en) | 1978-10-30 |
| JPS6031913B2 (ja) | 1985-07-25 |
| ZA781077B (en) | 1979-01-31 |
| AT353812B (de) | 1979-12-10 |
| SE7802385L (sv) | 1978-09-05 |
| FR2382519B1 (it) | 1984-03-23 |
| DD134123A5 (de) | 1979-02-07 |
| PT67736A (en) | 1978-04-01 |
| US4204939A (en) | 1980-05-27 |
| IT7820815A0 (it) | 1978-03-01 |
| CA1107685A (en) | 1981-08-25 |
| PL205061A1 (pl) | 1978-11-06 |
| PL125027B1 (en) | 1983-03-31 |
| AU3377678A (en) | 1979-09-06 |
| CH631746A5 (de) | 1982-08-31 |
| ES467549A1 (es) | 1980-12-16 |
| MY8300021A (en) | 1983-12-31 |
| AR214774A1 (es) | 1979-07-31 |
| BR7801308A (pt) | 1978-09-26 |
| DE2809333C2 (de) | 1986-10-09 |
| DE2809333A1 (de) | 1978-09-07 |
| ATA157578A (de) | 1979-05-15 |
| GB1595193A (en) | 1981-08-12 |
| AU514448B2 (en) | 1981-02-12 |
| BE864363A (fr) | 1978-08-28 |
| NL7802371A (nl) | 1978-09-06 |
| SU805955A3 (ru) | 1981-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4252628A (en) | Membrane cell | |
| SE449233B (sv) | Monopoler elektrolysor av filterpresstyp | |
| US4126534A (en) | Monopolar electrolytic cell electrodes | |
| FI71356B (fi) | Elektrodstruktur foer anvaendning i elektrolytisk cell | |
| US3242059A (en) | Electrolytic process for production of chlorine and caustic | |
| US4105514A (en) | Process for electrolysis in a membrane cell employing pressure actuated uniform spacing | |
| JPS6041717B2 (ja) | 隔膜型電解槽用陽極−膜装置 | |
| US3960697A (en) | Diaphragm cell having uniform and minimum spacing between the anodes and cathodes | |
| US4115237A (en) | Electrolytic cell having membrane enclosed anodes | |
| CA1189022A (en) | Electrode with support member and elongated members parallel thereto | |
| JPS60218490A (ja) | 電極および電解槽 | |
| CA1040135A (en) | Electrolytic diaphragm cell | |
| US4752369A (en) | Electrochemical cell with improved energy efficiency | |
| CA1105411A (en) | Riserless flexible electrode assembly | |
| US4236989A (en) | Electrolytic cell | |
| US4256562A (en) | Unitary filter press cell circuit | |
| CA1131170A (en) | Diaphragm cell | |
| GB2031026A (en) | Diaphragm cell for brine electrolysis | |
| JPS59104487A (ja) | フイルタ−プレス型電解槽 | |
| US4154665A (en) | Diaphragm cell | |
| USRE30864E (en) | Process for electrolysis in a membrane cell employing pressure actuated uniform spacing | |
| NO791627L (no) | Stroemfordelingsanordning for elektrolyseceller | |
| GB1581349A (en) | Electrode | |
| SE9600044A0 (en) | Electrode |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7802385-0 Effective date: 19900125 Format of ref document f/p: F |