SE415252B - Sett att framstella nya oxifenylbutazonderivat - Google Patents
Sett att framstella nya oxifenylbutazonderivatInfo
- Publication number
- SE415252B SE415252B SE7508543A SE7508543A SE415252B SE 415252 B SE415252 B SE 415252B SE 7508543 A SE7508543 A SE 7508543A SE 7508543 A SE7508543 A SE 7508543A SE 415252 B SE415252 B SE 415252B
- Authority
- SE
- Sweden
- Prior art keywords
- oxifenyl
- butazon
- derivatives
- make new
- new
- Prior art date
Links
- HFHZKZSRXITVMK-UHFFFAOYSA-N oxyphenbutazone Chemical class O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=C(O)C=C1 HFHZKZSRXITVMK-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/28—Two oxygen or sulfur atoms
- C07D231/30—Two oxygen or sulfur atoms attached in positions 3 and 5
- C07D231/32—Oxygen atoms
- C07D231/34—Oxygen atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Cosmetics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2436882A DE2436882A1 (de) | 1974-07-29 | 1974-07-29 | Neue oxyphenylbutazon-derivate und ihre herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7508543L SE7508543L (sv) | 1976-01-30 |
| SE415252B true SE415252B (sv) | 1980-09-22 |
Family
ID=5922046
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7508543A SE415252B (sv) | 1974-07-29 | 1975-07-28 | Sett att framstella nya oxifenylbutazonderivat |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3968219A (enExample) |
| JP (1) | JPS5136452A (enExample) |
| AT (1) | AT344689B (enExample) |
| AU (1) | AU8332175A (enExample) |
| BE (1) | BE831855A (enExample) |
| CA (1) | CA1062264A (enExample) |
| CH (2) | CH617926A5 (enExample) |
| CS (1) | CS197252B2 (enExample) |
| DD (1) | DD122533A5 (enExample) |
| DE (1) | DE2436882A1 (enExample) |
| DK (1) | DK137009C (enExample) |
| ES (1) | ES439810A1 (enExample) |
| FR (1) | FR2280374A1 (enExample) |
| GB (1) | GB1519498A (enExample) |
| HU (1) | HU170518B (enExample) |
| IE (1) | IE41639B1 (enExample) |
| IL (1) | IL47768A (enExample) |
| NL (1) | NL7509060A (enExample) |
| SE (1) | SE415252B (enExample) |
| SU (1) | SU593662A3 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9915184D0 (en) * | 1999-06-29 | 1999-09-01 | Viral As A | Compounds |
| IL142037A0 (en) * | 2001-03-15 | 2002-03-10 | Agis Ind 1983 Ltd | Pharmaceutical compositions containing a non-steroidal anti-inflammatory drug |
| WO2005107748A2 (en) * | 2004-05-12 | 2005-11-17 | A-Viral Asa | Method of tonic treatment with oxyphenbutazone derivatives |
| US8729108B2 (en) * | 2008-06-17 | 2014-05-20 | Christopher J Dannaker | Waterborne topical compositions for the delivery of active ingredients such as azelaic acid |
| KR101707704B1 (ko) | 2010-03-26 | 2017-02-16 | 갈데르마 리써어치 앤드 디벨로프먼트 | 홍반의 유효하고 안전한 치료를 위한 개선된 방법 및 조성물 |
| BR112014009210A2 (pt) | 2011-10-19 | 2017-04-18 | Galderma Sa | método para a redução da vermelhidão facial cutânea |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR5404M (enExample) * | 1965-09-08 | 1967-09-25 | ||
| FR2054447B1 (enExample) * | 1969-07-03 | 1973-06-08 | Synthelabo |
-
1974
- 1974-07-29 DE DE2436882A patent/DE2436882A1/de not_active Withdrawn
-
1975
- 1975-07-17 CS CS755081A patent/CS197252B2/cs unknown
- 1975-07-23 AU AU83321/75A patent/AU8332175A/en not_active Expired
- 1975-07-23 IE IE1650/75A patent/IE41639B1/en unknown
- 1975-07-23 IL IL47768A patent/IL47768A/xx unknown
- 1975-07-24 SU SU752157426A patent/SU593662A3/ru active
- 1975-07-25 DD DD187483A patent/DD122533A5/xx unknown
- 1975-07-28 GB GB31409/75A patent/GB1519498A/en not_active Expired
- 1975-07-28 SE SE7508543A patent/SE415252B/xx unknown
- 1975-07-28 AT AT583675A patent/AT344689B/de not_active IP Right Cessation
- 1975-07-28 HU HUSC528A patent/HU170518B/hu unknown
- 1975-07-28 US US05/599,397 patent/US3968219A/en not_active Expired - Lifetime
- 1975-07-29 BE BE158718A patent/BE831855A/xx unknown
- 1975-07-29 ES ES439810A patent/ES439810A1/es not_active Expired
- 1975-07-29 FR FR7523604A patent/FR2280374A1/fr active Granted
- 1975-07-29 CH CH989675A patent/CH617926A5/de not_active IP Right Cessation
- 1975-07-29 DK DK344375A patent/DK137009C/da active
- 1975-07-29 JP JP50092462A patent/JPS5136452A/ja active Pending
- 1975-07-29 CA CA232,437A patent/CA1062264A/en not_active Expired
- 1975-07-29 NL NL7509060A patent/NL7509060A/xx not_active Application Discontinuation
-
1979
- 1979-05-17 CH CH460679A patent/CH617927A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AT344689B (de) | 1978-08-10 |
| DK137009B (da) | 1978-01-02 |
| IL47768A (en) | 1979-10-31 |
| IL47768A0 (en) | 1975-10-15 |
| US3968219A (en) | 1976-07-06 |
| DK344375A (da) | 1976-01-30 |
| ES439810A1 (es) | 1977-04-16 |
| CA1062264A (en) | 1979-09-11 |
| CH617927A5 (enExample) | 1980-06-30 |
| NL7509060A (nl) | 1976-02-02 |
| ATA583675A (de) | 1977-12-15 |
| IE41639B1 (en) | 1980-02-13 |
| FR2280374A1 (fr) | 1976-02-27 |
| AU8332175A (en) | 1977-01-27 |
| BE831855A (fr) | 1976-01-29 |
| DK137009C (da) | 1978-05-22 |
| FR2280374B1 (enExample) | 1980-04-30 |
| HU170518B (enExample) | 1977-06-28 |
| CH617926A5 (enExample) | 1980-06-30 |
| DD122533A5 (enExample) | 1976-10-12 |
| JPS5136452A (enExample) | 1976-03-27 |
| SU593662A3 (ru) | 1978-02-15 |
| SE7508543L (sv) | 1976-01-30 |
| CS197252B2 (en) | 1980-04-30 |
| IE41639L (en) | 1976-01-29 |
| GB1519498A (en) | 1978-07-26 |
| DE2436882A1 (de) | 1976-02-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE420718B (sv) | Sett att framstella nya dekapeptidamidderivat med ovalationsinducerande aktivitet | |
| SE425244B (sv) | Sett att framstella 4-hydroxi-3-kinolin-karboxamidderivat | |
| SE7711848L (sv) | Sett att framstella nya 5-metyl-7-hydroxi-isoflavonderivat | |
| SE430887B (sv) | Sett att framstella vissa substituerade fenylguanidiner | |
| SE410600B (sv) | Sett att framstella nya arylaminopyrimidinderivat | |
| SE417507B (sv) | Sett att framstella 2-arylamino-2-imidazolinderivat | |
| SE408300B (sv) | Sett att framstella nya dipeptidderivat | |
| SE7602729L (sv) | Sett att framstella nya indolylalkylpiperidiner | |
| SE420602B (sv) | Sett att framstella pyrazin-3-metoxi-2-karboxamidderivat | |
| SE7511328L (sv) | Sett att framstella nya pyridinderivat | |
| SE425312B (sv) | Sett att framstella morfolinderivat | |
| SE424991B (sv) | Sett att framstella nya 5-fenyl-oxazolidinoner | |
| SE431983B (sv) | Sett att framstella 15-etylendioxiprostansyraderivat | |
| SE425850B (sv) | Sett att framstella abietamidderivat. | |
| SE427655B (sv) | Sett att framstella abietamidderivat | |
| SE7509209L (sv) | Sett att framstella nya kinolinderivat | |
| SE415252B (sv) | Sett att framstella nya oxifenylbutazonderivat | |
| SE7508779L (sv) | Sett att framstella prostaninsyraderivat | |
| SE428471B (sv) | Sett att framstella imidazolderivat | |
| SE412233B (sv) | Sett att framstella nya fenotiazinderivat | |
| SE7609666L (sv) | Sett att framstella nya 5-aminometyltiazolderivat | |
| SE7506571L (sv) | Sett att framstella nya bufatrienolidramnosideter | |
| SE408170B (sv) | Sett att framstella nya substituerade nitrobensofenonderivat | |
| SE420722B (sv) | Sett att framstella benshydryloxi-alkylaminderivat | |
| SE439303B (sv) | Sett att framstella nya aminoetanolderivat |