SE185254C1 - - Google Patents
Info
- Publication number
- SE185254C1 SE185254C1 SE185254DA SE185254C1 SE 185254 C1 SE185254 C1 SE 185254C1 SE 185254D A SE185254D A SE 185254DA SE 185254 C1 SE185254 C1 SE 185254C1
- Authority
- SE
- Sweden
- Prior art keywords
- hydroxypyrrolidine
- group
- water
- benzylate
- benzene
- Prior art date
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 9
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 239000000047 product Substances 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 230000007062 hydrolysis Effects 0.000 claims description 2
- 238000006460 hydrolysis reaction Methods 0.000 claims description 2
- 230000001225 therapeutic effect Effects 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 2
- 239000001257 hydrogen Substances 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 150000002431 hydrogen Chemical group 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- 239000000203 mixture Substances 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 238000009835 boiling Methods 0.000 description 7
- IDBNECMSCRAUNU-UHFFFAOYSA-N 1-ethylpyrrolidin-3-ol Chemical compound CCN1CCC(O)C1 IDBNECMSCRAUNU-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- FLVFPAIGVBQGET-UHFFFAOYSA-N 1-methylpyrrolidin-3-ol Chemical compound CN1CCC(O)C1 FLVFPAIGVBQGET-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- YQMXOIAIYXXXEE-UHFFFAOYSA-N 1-benzylpyrrolidin-3-ol Chemical compound C1C(O)CCN1CC1=CC=CC=C1 YQMXOIAIYXXXEE-UHFFFAOYSA-N 0.000 description 3
- BDYHVRNNEOTPPQ-UHFFFAOYSA-N 1-butan-2-ylpyrrolidin-3-ol Chemical compound CCC(C)N1CCC(O)C1 BDYHVRNNEOTPPQ-UHFFFAOYSA-N 0.000 description 3
- WKBINTOKVMWIIP-UHFFFAOYSA-N 1-butylpyrrolidin-3-ol Chemical compound CCCCN1CCC(O)C1 WKBINTOKVMWIIP-UHFFFAOYSA-N 0.000 description 3
- CWLUFVAFWWNXJZ-UHFFFAOYSA-N 1-hydroxypyrrolidine Chemical compound ON1CCCC1 CWLUFVAFWWNXJZ-UHFFFAOYSA-N 0.000 description 3
- NFHKZAUDRWRXMZ-UHFFFAOYSA-N 2-chloro-2,2-diphenylacetyl chloride Chemical compound C=1C=CC=CC=1C(Cl)(C(=O)Cl)C1=CC=CC=C1 NFHKZAUDRWRXMZ-UHFFFAOYSA-N 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- JIJMHLNVPUQWOG-UHFFFAOYSA-N 1-(2-methylpropyl)pyrrolidin-3-ol Chemical compound CC(C)CN1CCC(O)C1 JIJMHLNVPUQWOG-UHFFFAOYSA-N 0.000 description 2
- MYFPIRLHESHOGR-UHFFFAOYSA-N 1-propan-2-ylpyrrolidin-3-ol Chemical compound CC(C)N1CCC(O)C1 MYFPIRLHESHOGR-UHFFFAOYSA-N 0.000 description 2
- FOETXFLONXERFX-UHFFFAOYSA-N 1-tert-butylpyrrolidin-3-ol Chemical compound CC(C)(C)N1CCC(O)C1 FOETXFLONXERFX-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- UKXSKSHDVLQNKG-UHFFFAOYSA-N benzilic acid Chemical compound C=1C=CC=CC=1C(O)(C(=O)O)C1=CC=CC=C1 UKXSKSHDVLQNKG-UHFFFAOYSA-N 0.000 description 2
- 125000005587 carbonate group Chemical group 0.000 description 2
- -1 diphenyl chloroacetyl Chemical group 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 235000011118 potassium hydroxide Nutrition 0.000 description 2
- JHHZLHWJQPUNKB-UHFFFAOYSA-N pyrrolidin-3-ol Chemical compound OC1CCNC1 JHHZLHWJQPUNKB-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- CKNNDWZSFAPUJS-UHFFFAOYSA-N 1,4-dichlorobutan-2-ol Chemical compound ClCC(O)CCCl CKNNDWZSFAPUJS-UHFFFAOYSA-N 0.000 description 1
- UFSBJJSYHNIZNV-UHFFFAOYSA-N 1-hydroxypyrrolidine;hydrochloride Chemical compound Cl.ON1CCCC1 UFSBJJSYHNIZNV-UHFFFAOYSA-N 0.000 description 1
- GGZXJZZUBNDABX-UHFFFAOYSA-N 1-propylpyrrolidin-3-ol Chemical compound CCCN1CCC(O)C1 GGZXJZZUBNDABX-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UATJOMSPNYCXIX-UHFFFAOYSA-N Trinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 UATJOMSPNYCXIX-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 239000002269 analeptic agent Substances 0.000 description 1
- 230000003555 analeptic effect Effects 0.000 description 1
- VEFXTGTZJOWDOF-UHFFFAOYSA-N benzene;hydrate Chemical compound O.C1=CC=CC=C1 VEFXTGTZJOWDOF-UHFFFAOYSA-N 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
Landscapes
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE185254T |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE185254C1 true SE185254C1 (enExample) | 1963-01-01 |
Family
ID=41972739
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE185254D SE185254C1 (enExample) |
Country Status (1)
| Country | Link |
|---|---|
| SE (1) | SE185254C1 (enExample) |
-
0
- SE SE185254D patent/SE185254C1/sv unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6241702B2 (enExample) | ||
| US2567351A (en) | Process for the manufacture of benzhydryl ethers | |
| US2437390A (en) | Z-oxazolidone compounds and proc | |
| US2895996A (en) | Purification of neopentylglycol by steam sublimation | |
| Myers et al. | Phosphonic Acids. II. Synthesis of γ-Ketophosphonic Acids from Methyl Ketones via Mannich Bases1, 2 | |
| US3105854A (en) | Meta-substituted phenoxyethylamines | |
| US2970166A (en) | Preparation of trimethyl phosphite and triethyl phosphite | |
| US2759972A (en) | 2-amino and acylamino-1-(hydrocarbylsulphonylphenyl)-1, 3-propanediols | |
| US2368494A (en) | Reactions of tertiary olefins with aldehydes | |
| US2297921A (en) | Cyclic acetals | |
| SE185254C1 (enExample) | ||
| JPS5949207B2 (ja) | ジエンの製造方法 | |
| DE1104965B (de) | Verfahren zur Herstellung von Derivaten des Urazols | |
| Walborsky | Dimethyleneketene: An Attempted Synthesis | |
| US2554576A (en) | Unsaturated sulfones | |
| US2374327A (en) | Esters of gamme-acetyl-gamme-methylpimelic acid | |
| US2940971A (en) | Tetrahydrooxazenones | |
| CH365073A (fr) | Procédé de préparation du benzilate de 3-hydroxy-pyrrolidines | |
| US2290281A (en) | Substituted amine derivatives | |
| US2235884A (en) | Ethers of trimethyl-hydroquinone and process of preparing the same | |
| US4482433A (en) | Purification | |
| US1790096A (en) | Tertiary amines containing the 1-amino-2-hydroxypropyl residue | |
| BAILEY et al. | Pyrolysis of Esters. XII. Ketone Cleavage of Acetoacetic Esters by Pyrolysis1, 2 | |
| US2678321A (en) | Dialkylaminoalkyl amides of alpha, alpha-diaryltoluic acids and their salts | |
| US3193581A (en) | Process of preparing 1-phenyl-2-aminopropane |