SE123291C1 - - Google Patents
Info
- Publication number
- SE123291C1 SE123291C1 SE123291DA SE123291C1 SE 123291 C1 SE123291 C1 SE 123291C1 SE 123291D A SE123291D A SE 123291DA SE 123291 C1 SE123291 C1 SE 123291C1
- Authority
- SE
- Sweden
- Prior art keywords
- mole
- copper
- dye
- sulfonic acid
- dyes
- Prior art date
Links
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 12
- 229910052802 copper Inorganic materials 0.000 claims description 12
- 239000010949 copper Substances 0.000 claims description 12
- JRBJSXQPQWSCCF-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine Chemical group C1=C(N)C(OC)=CC(C=2C=C(OC)C(N)=CC=2)=C1 JRBJSXQPQWSCCF-UHFFFAOYSA-N 0.000 claims description 5
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims 1
- 238000010257 thawing Methods 0.000 claims 1
- 239000000975 dye Substances 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 4
- DBNPDRYVYQWGFW-UHFFFAOYSA-N N.[Cu]=O Chemical compound N.[Cu]=O DBNPDRYVYQWGFW-UHFFFAOYSA-N 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- -1 diphenyl compound Chemical class 0.000 description 3
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000004627 regenerated cellulose Substances 0.000 description 2
- 235000002639 sodium chloride Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- HUWXDEQWWKGHRV-UHFFFAOYSA-N 3,3'-Dichlorobenzidine Chemical group C1=C(Cl)C(N)=CC=C1C1=CC=C(N)C(Cl)=C1 HUWXDEQWWKGHRV-UHFFFAOYSA-N 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000019646 color tone Nutrition 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000000982 direct dye Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
Landscapes
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE123291T |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE123291C1 true SE123291C1 (cs) | 1948-01-01 |
Family
ID=41922382
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE123291D SE123291C1 (cs) |
Country Status (1)
| Country | Link |
|---|---|
| SE (1) | SE123291C1 (cs) |
-
0
- SE SE123291D patent/SE123291C1/sv unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2817659A (en) | Polyazo dyestuffs | |
| SE123291C1 (cs) | ||
| US2683707A (en) | Complex chromium compounds of | |
| US2222749A (en) | Disazo dyestuffs and their manufacture | |
| US1821938A (en) | New azo dyestuffs | |
| US2748107A (en) | Glucoside azo dyestuffs | |
| US1850838A (en) | Manufacture of acid dyestuff of the phenonaphthosafranine series and the products | |
| US1677534A (en) | Metal compound of azo dyestuff and process of making same | |
| US1237183A (en) | Process for the manufacture of copper compounds of orthooxyazo dye-stuffs. | |
| US3169951A (en) | Chromhjm-containing azo dyestuffs | |
| US1869064A (en) | Manufacture of disazodyestuffs for dyeing and printing wool | |
| US2875193A (en) | New direct-dyeing azo-dyestuffs and process for their manufacture | |
| US2636030A (en) | Copper-containing disazo dyestuffs | |
| US2966483A (en) | Green polyazo-dyestuffs | |
| US1854846A (en) | Monoazo-dyestuffs and their manufacture | |
| US2405835A (en) | Acid disazo dyestuffs and a process for their manufacture | |
| US1219954A (en) | Ortho-oxy-monoazo dyes. | |
| US1856796A (en) | Azo-dyestuffs containing chromium and process of making same | |
| US1233433A (en) | Copper compounds of orthooxyazo dyestuffs and a process of making same. | |
| US1416621A (en) | Manufacture of diazotizable trisazo dyes | |
| US2203818A (en) | Azo dyestuffs | |
| US2544068A (en) | Chromable azo dyestuffs | |
| US2468172A (en) | Chromable azo dyestuffs | |
| US684065A (en) | Blue azo dye and process of making same. | |
| US2551887A (en) | Metallizable monoazo dyestuffs |