PT65509B - Trifluormethylphenoxy-phenylharnstoff verfahren zu ihrer herstellung und ihre verwendung als herbizide - Google Patents
Trifluormethylphenoxy-phenylharnstoff verfahren zu ihrer herstellung und ihre verwendung als herbizideInfo
- Publication number
- PT65509B PT65509B PT65509A PT6550976A PT65509B PT 65509 B PT65509 B PT 65509B PT 65509 A PT65509 A PT 65509A PT 6550976 A PT6550976 A PT 6550976A PT 65509 B PT65509 B PT 65509B
- Authority
- PT
- Portugal
- Prior art keywords
- trifluoromethylphenoxy
- herbicides
- phenyl
- production
- urea method
- Prior art date
Links
- MHLGYQMLODBMAC-UHFFFAOYSA-N 1-phenoxy-1-phenyl-3-(trifluoromethyl)urea Chemical compound FC(F)(F)NC(N(C1=CC=CC=C1)OC1=CC=CC=C1)=O MHLGYQMLODBMAC-UHFFFAOYSA-N 0.000 title 1
- 239000004009 herbicide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/01—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by replacing functional groups bound to a six-membered aromatic ring by hydroxy groups, e.g. by hydrolysis
- C07C37/045—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by replacing functional groups bound to a six-membered aromatic ring by hydroxy groups, e.g. by hydrolysis by substitution of a group bound to the ring by nitrogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/32—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C275/34—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C275/36—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with at least one of the oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. N-aryloxyphenylureas
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752538178 DE2538178A1 (de) | 1975-08-27 | 1975-08-27 | Trifluormethylphenoxy-phenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PT65509A PT65509A (de) | 1976-09-01 |
| PT65509B true PT65509B (de) | 1978-02-15 |
Family
ID=5954982
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PT65509A PT65509B (de) | 1975-08-27 | 1976-08-24 | Trifluormethylphenoxy-phenylharnstoff verfahren zu ihrer herstellung und ihre verwendung als herbizide |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4087272A (pt) |
| JP (1) | JPS5231048A (pt) |
| BE (1) | BE845528A (pt) |
| BR (1) | BR7605619A (pt) |
| DD (1) | DD127564A5 (pt) |
| DE (1) | DE2538178A1 (pt) |
| DK (1) | DK387276A (pt) |
| FR (1) | FR2322132A1 (pt) |
| IL (1) | IL50342A0 (pt) |
| NL (1) | NL7609451A (pt) |
| PT (1) | PT65509B (pt) |
| SE (1) | SE7609459L (pt) |
| ZA (1) | ZA765133B (pt) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4309212A (en) * | 1977-10-26 | 1982-01-05 | Sumitomo Chemical Company, Limited | Herbicidal compositions and methods employing urea derivatives |
| DE2964935D1 (en) * | 1978-02-21 | 1983-04-07 | Sumitomo Chemical Co | A hydroxy-urea, process for producing the same and a process for producing a phenyl-substituted n-methoxy-n-methyl-urea |
| JPS54122252A (en) * | 1978-03-13 | 1979-09-21 | Sumitomo Chem Co Ltd | Substitued phenylurea derivative, its preparation, and herbicide containing the same |
| US4262152A (en) * | 1979-05-02 | 1981-04-14 | Rohm And Haas Company | Preparation of trifluoromethylphenyl nitrophenylethers |
| US4259510A (en) * | 1979-05-02 | 1981-03-31 | Rohm And Haas Company | Preparation of trifluoromethylphenyl nitrophenylethers |
| US4294986A (en) * | 1979-06-25 | 1981-10-13 | American Cyanamid Co. | Novel para-phenylalkoxy phenylurea and thiourea compounds and herbicidal use thereof |
| DE3064249D1 (en) * | 1979-07-03 | 1983-08-25 | Ciba Geigy Ag | Thio-urea derivatives and isothio-urea derivatives, process for their preparation, compositions containing these compounds and their use in combating pests |
| US4376646A (en) * | 1980-03-18 | 1983-03-15 | Ciba-Geigy Corporation | Herbicidal N-[4-(3'-alkoxyphenoxy)-phenyl]-N'-methylureas |
| US4484008A (en) * | 1982-09-30 | 1984-11-20 | Ppg Industries, Inc. | Process improvement for diphenyl ether production |
| US8431699B2 (en) * | 2009-02-27 | 2013-04-30 | Vertichem Corporation | Method for manufacture of 2-oxoimidazolidines |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE593743A (pt) * | 1959-08-05 | |||
| US3901687A (en) * | 1973-08-31 | 1975-08-26 | Scott & Sons Co O M | Process for the selective control of weeds in kentucky bluegrass |
| DE2411320A1 (de) * | 1974-03-09 | 1975-09-18 | Bayer Ag | (trifluormethylphenoxy)-phenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
-
1975
- 1975-08-27 DE DE19752538178 patent/DE2538178A1/de active Pending
-
1976
- 1976-08-02 US US05/710,828 patent/US4087272A/en not_active Expired - Lifetime
- 1976-08-24 PT PT65509A patent/PT65509B/pt unknown
- 1976-08-24 IL IL50342A patent/IL50342A0/xx unknown
- 1976-08-25 DD DD194464A patent/DD127564A5/xx unknown
- 1976-08-25 NL NL7609451A patent/NL7609451A/xx not_active Application Discontinuation
- 1976-08-26 BR BR7605619A patent/BR7605619A/pt unknown
- 1976-08-26 ZA ZA765133A patent/ZA765133B/xx unknown
- 1976-08-26 DK DK387276A patent/DK387276A/da unknown
- 1976-08-26 JP JP51101219A patent/JPS5231048A/ja active Pending
- 1976-08-26 SE SE7609459A patent/SE7609459L/xx not_active Application Discontinuation
- 1976-08-26 BE BE170083A patent/BE845528A/xx unknown
- 1976-08-27 FR FR7625899A patent/FR2322132A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5231048A (en) | 1977-03-09 |
| DE2538178A1 (de) | 1977-03-10 |
| ZA765133B (en) | 1977-08-31 |
| IL50342A0 (en) | 1976-10-31 |
| US4087272A (en) | 1978-05-02 |
| PT65509A (de) | 1976-09-01 |
| BE845528A (fr) | 1977-02-28 |
| FR2322132A1 (fr) | 1977-03-25 |
| NL7609451A (nl) | 1977-03-01 |
| DK387276A (da) | 1977-02-28 |
| BR7605619A (pt) | 1977-08-09 |
| SE7609459L (sv) | 1977-02-28 |
| DD127564A5 (pt) | 1977-10-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PT67083B (de) | Phenoxy-amino-propanole und verfahren zu ihrer herstellung | |
| ATA326177A (de) | Patronenhuelse und verfahren zu ihrer herstellung | |
| PT67107B (de) | Neue 1-aryloxy-2-hydroxy-3-alkylenaminopropane und verfahren zu ihrer herstellung | |
| PT65980A (de) | Basisch substituierte indolderivate und verfahren zu ihrer herstellung | |
| PT68272A (de) | Basische thioather und verfahren zu ihrer herstellung | |
| PT69008A (de) | N-substituierte omega-aminoalkanoyl-omega-amino-alkansauren und verfahren zu ihrer herstellung | |
| ATE2217T1 (de) | Tetrazolyloxycarbonsaeureamide, verfahren zu ihrer herstellung und ihre verwendung als herbizide. | |
| ATA811977A (de) | Baublock und verfahren zu dessen herstellung | |
| PT65509B (de) | Trifluormethylphenoxy-phenylharnstoff verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| PT66934A (de) | Dihydro-oxo-nicotinsaeuren und verfahren zu ihrer herstellung | |
| PT70394A (de) | N-phenylharnstoffe verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| PT66925B (de) | Substituierte benzoylureidodiphenylather verfahren zu ihrer herstellung und ihre verwendung als insektizide | |
| AT360274B (de) | Mykofungizides produkt und verfahren zu seiner herstellung | |
| PT68856A (de) | Substituierte 1-phenyl-2-pyrrolidin-2-yl-ethanole und verfahren zu ihrer herstellung | |
| PT66561B (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung | |
| PT65095B (de) | Antrachinon-bis-amidine und verfahren zu ihrer herstellung | |
| ATE915T1 (de) | N,n-dimethyl-o-pyrazolyl-carbaminsaeureester, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel. | |
| PT67124B (de) | (1-phenyl-2-triazolyl-athyl)-tioather-derivate verfahren zu ihrer herstellung und ihre verwendung als fungizide und wachstumsregulatoren | |
| PT66144A (de) | Acylierte imidazolyl-o-,n-acetale,verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| PT65578B (de) | N-(1,2,4-triazin-5-on-4-yl)-glycin-derivate verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| AT356540B (de) | Block und verfahren zu seiner herstellung | |
| PT65498A (de) | Schaedlingsbekaempfungsmittel und verfahren zu seiner herstellung | |
| PT66599B (de) | 3.5.5.-trimethylhexanoyl-ferrocen und verfahren zu seiner herstellung | |
| PT68015B (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung | |
| PT68215A (de) | N,n-dialkyl-0-pyrimidinyl-carbaminsaureester verfahren zu ihrer herstellung und ihre verwendung als insektizide |