PL76014B1 - - Google Patents
Download PDFInfo
- Publication number
- PL76014B1 PL76014B1 PL1969131872A PL13187269A PL76014B1 PL 76014 B1 PL76014 B1 PL 76014B1 PL 1969131872 A PL1969131872 A PL 1969131872A PL 13187269 A PL13187269 A PL 13187269A PL 76014 B1 PL76014 B1 PL 76014B1
- Authority
- PL
- Poland
- Prior art keywords
- acid
- parts
- sulfuric acid
- concentration
- methylisopropyl
- Prior art date
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 28
- 239000002253 acid Substances 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 6
- FMMTYPMNEMQQSY-UHFFFAOYSA-N n-(3-methylbutan-2-ylideneamino)aniline Chemical compound CC(C)C(C)=NNC1=CC=CC=C1 FMMTYPMNEMQQSY-UHFFFAOYSA-N 0.000 claims description 5
- 150000007857 hydrazones Chemical class 0.000 claims description 4
- -1 methylisopropyl Chemical group 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine group Chemical group NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 238000007363 ring formation reaction Methods 0.000 claims description 3
- XWSCUGSMTLANIZ-UHFFFAOYSA-N 4-chloro-n-(3-methylbutan-2-ylideneamino)aniline Chemical compound CC(C)C(C)=NNC1=CC=C(Cl)C=C1 XWSCUGSMTLANIZ-UHFFFAOYSA-N 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 6
- FLHJIAFUWHPJRT-UHFFFAOYSA-N 2,3,3-trimethylindole Chemical compound C1=CC=C2C(C)(C)C(C)=NC2=C1 FLHJIAFUWHPJRT-UHFFFAOYSA-N 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 238000010586 diagram Methods 0.000 description 3
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine group Chemical group N1=CCC2=CC=CC=C12 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 2
- 229940067157 phenylhydrazine Drugs 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- YSYJXCYULHQEBQ-UHFFFAOYSA-N 3-methylbutan-2-ylidenehydrazine Chemical compound CC(C)C(C)=NN YSYJXCYULHQEBQ-UHFFFAOYSA-N 0.000 description 1
- GSKATGIMEUGNJN-UHFFFAOYSA-N 5-chloro-2,3,3-trimethylindole Chemical compound C1=C(Cl)C=C2C(C)(C)C(C)=NC2=C1 GSKATGIMEUGNJN-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 238000005325 percolation Methods 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Developing Agents For Electrophotography (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US70707368A | 1968-02-21 | 1968-02-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL76014B1 true PL76014B1 (index.php) | 1975-02-28 |
Family
ID=24840239
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1969131872A PL76014B1 (index.php) | 1968-02-21 | 1969-02-21 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3639420A (index.php) |
| JP (1) | JPS5011913B1 (index.php) |
| BE (1) | BE728210A (index.php) |
| CH (1) | CH521339A (index.php) |
| CS (1) | CS157664B2 (index.php) |
| DE (1) | DE1906832B2 (index.php) |
| ES (1) | ES363850A1 (index.php) |
| FR (1) | FR2002316A1 (index.php) |
| GB (1) | GB1243265A (index.php) |
| NL (1) | NL6901762A (index.php) |
| PL (1) | PL76014B1 (index.php) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4037004A1 (de) * | 1990-11-21 | 1992-05-27 | Bayer Ag | Verfahren zur herstellung von indolen |
| US5288877A (en) * | 1991-07-03 | 1994-02-22 | Ppg Industries, Inc. | Continuous process for preparing indolenine compounds |
-
1968
- 1968-02-21 US US707073A patent/US3639420A/en not_active Expired - Lifetime
-
1969
- 1969-01-21 CH CH83869A patent/CH521339A/de not_active IP Right Cessation
- 1969-02-04 NL NL6901762A patent/NL6901762A/xx unknown
- 1969-02-10 BE BE728210D patent/BE728210A/xx unknown
- 1969-02-12 DE DE691906832A patent/DE1906832B2/de not_active Withdrawn
- 1969-02-19 FR FR6904210A patent/FR2002316A1/fr not_active Withdrawn
- 1969-02-20 ES ES363850A patent/ES363850A1/es not_active Expired
- 1969-02-20 JP JP44012207A patent/JPS5011913B1/ja active Pending
- 1969-02-21 PL PL1969131872A patent/PL76014B1/pl unknown
- 1969-02-21 GB GB9439/69A patent/GB1243265A/en not_active Expired
- 1969-02-21 CS CS126669A patent/CS157664B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1906832A1 (de) | 1969-11-27 |
| US3639420A (en) | 1972-02-01 |
| CH521339A (de) | 1972-04-15 |
| CS157664B2 (index.php) | 1974-09-16 |
| ES363850A1 (es) | 1971-01-01 |
| GB1243265A (en) | 1971-08-18 |
| JPS5011913B1 (index.php) | 1975-05-07 |
| BE728210A (index.php) | 1969-08-11 |
| DE1906832B2 (de) | 1979-03-01 |
| FR2002316A1 (index.php) | 1969-10-17 |
| NL6901762A (index.php) | 1969-08-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Gilman et al. | The preparation of n-butyllithium | |
| SU1223842A3 (ru) | Способ получени производных бензофенонгидразонов | |
| Lieber et al. | Synthesis and Isomerization of Substituted 5-Amino-1, 2, 3-triazoles1 | |
| US2224964A (en) | Manufacture of aromatic sulphones | |
| US2192197A (en) | Dinitro-alkyl-phenol | |
| EP0273528A1 (en) | Benzophenones and their preparation | |
| US2069560A (en) | Tertiary alkyl-cyclohexyl phenols and process of preparing same | |
| PL76014B1 (index.php) | ||
| CA1077045A (en) | Process for the manufacture of 5-amino-1,2,3-thiadiazole | |
| Calaway et al. | Utilization of aryloxy ketones in the synthesis of quinolines by the pfitzinger reaction | |
| Cox | Liquid crystal properties of methyl substituted stilbenes | |
| US4000150A (en) | Perfluoroalkyl isoxazoles | |
| US3201481A (en) | Method of preparing 4-nitrostilbenes | |
| US1807693A (en) | Georg kalischer and heinz scheyer | |
| US2465293A (en) | Synthesis of 4-hydroxycoumarins | |
| US2926193A (en) | 4-chloro-alpha-dimethylamino-6-phenyl-o-cresol | |
| US2344459A (en) | Method of preparing i | |
| US2017815A (en) | Preparation of | |
| US4405528A (en) | Method of preparing 4-(α-alkyl-α-cyano-methyl)2,6-di-substituted phenols | |
| US3737449A (en) | Production of hydroxybenzonitriles | |
| US2489669A (en) | Preparation of 1-alkyl-3-benzoyl-4-hydroxy-4-phenyl-piperidines | |
| US2621189A (en) | Chromanone compounds | |
| US2877273A (en) | Improving color stability of alkyl phenols | |
| US2933450A (en) | Heat-exchange fluid compositions | |
| US4348525A (en) | Composition and a process for the preparation of [hydroxy(organosulfonyloxy)iodo]arenes and their use in a regiospecific synthesis of diaryliodonium salts |