PL66415B1 - - Google Patents
Download PDFInfo
- Publication number
- PL66415B1 PL66415B1 PL99531A PL9953162A PL66415B1 PL 66415 B1 PL66415 B1 PL 66415B1 PL 99531 A PL99531 A PL 99531A PL 9953162 A PL9953162 A PL 9953162A PL 66415 B1 PL66415 B1 PL 66415B1
- Authority
- PL
- Poland
- Prior art keywords
- ammonium
- ammonium phosphate
- fertilizer
- solid component
- mixed
- Prior art date
Links
- 239000004254 Ammonium phosphate Substances 0.000 claims description 33
- 235000019289 ammonium phosphates Nutrition 0.000 claims description 33
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 claims description 33
- 229910000148 ammonium phosphate Inorganic materials 0.000 claims description 31
- 239000003337 fertilizer Substances 0.000 claims description 29
- 239000007787 solid Substances 0.000 claims description 29
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 15
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 10
- 239000004615 ingredient Substances 0.000 claims description 8
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 8
- 229910052921 ammonium sulfate Inorganic materials 0.000 claims description 6
- 235000011130 ammonium sulphate Nutrition 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 238000005550 wet granulation Methods 0.000 claims description 6
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 5
- 239000004202 carbamide Substances 0.000 claims description 4
- BFNBIHQBYMNNAN-UHFFFAOYSA-N Ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 claims description 2
- 150000003863 ammonium salts Chemical class 0.000 claims 1
- KKEOZWYTZSNYLJ-UHFFFAOYSA-O triazanium;nitrate;sulfate Chemical compound [NH4+].[NH4+].[NH4+].[O-][N+]([O-])=O.[O-]S([O-])(=O)=O KKEOZWYTZSNYLJ-UHFFFAOYSA-O 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 20
- 238000005469 granulation Methods 0.000 description 17
- 230000003179 granulation Effects 0.000 description 17
- 239000008187 granular material Substances 0.000 description 14
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 8
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical compound [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 7
- 229910052698 phosphorus Inorganic materials 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 239000002426 superphosphate Substances 0.000 description 6
- LFVGISIMTYGQHF-UHFFFAOYSA-N Ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 description 5
- DVARTQFDIMZBAA-UHFFFAOYSA-O Ammonium nitrate Chemical compound [NH4+].[O-][N+]([O-])=O DVARTQFDIMZBAA-UHFFFAOYSA-O 0.000 description 5
- 229910000387 ammonium dihydrogen phosphate Inorganic materials 0.000 description 4
- 239000001166 ammonium sulphate Substances 0.000 description 4
- 235000019837 monoammonium phosphate Nutrition 0.000 description 4
- 239000006012 monoammonium phosphate Substances 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000001103 potassium chloride Substances 0.000 description 4
- 235000011164 potassium chloride Nutrition 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- PPBAJDRXASKAGH-UHFFFAOYSA-O azanium;urea Chemical compound [NH4+].NC(N)=O PPBAJDRXASKAGH-UHFFFAOYSA-O 0.000 description 3
- XKUUMWKWUZRRPD-UHFFFAOYSA-N heptan-2-amine;sulfuric acid Chemical compound [O-]S([O-])(=O)=O.CCCCCC(C)[NH3+].CCCCCC(C)[NH3+] XKUUMWKWUZRRPD-UHFFFAOYSA-N 0.000 description 3
- 150000002830 nitrogen compounds Chemical class 0.000 description 3
- 239000002367 phosphate rock Substances 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 239000002994 raw material Substances 0.000 description 3
- ZRIUUUJAJJNDSS-UHFFFAOYSA-N Ammonium phosphates Chemical class [NH4+].[NH4+].[NH4+].[O-]P([O-])([O-])=O ZRIUUUJAJJNDSS-UHFFFAOYSA-N 0.000 description 2
- 239000005696 Diammonium phosphate Substances 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K [O-]P([O-])([O-])=O Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910000388 diammonium phosphate Inorganic materials 0.000 description 2
- 235000019838 diammonium phosphate Nutrition 0.000 description 2
- 238000005755 formation reaction Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 235000015097 nutrients Nutrition 0.000 description 2
- VSIIXMUUUJUKCM-UHFFFAOYSA-D pentacalcium;fluoride;triphosphate Chemical compound [F-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O VSIIXMUUUJUKCM-UHFFFAOYSA-D 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 150000003018 phosphorus compounds Chemical class 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N Phosphite Chemical compound [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- DZHMRSPXDUUJER-UHFFFAOYSA-N [amino(hydroxy)methylidene]azanium;dihydrogen phosphate Chemical compound NC(N)=O.OP(O)(O)=O DZHMRSPXDUUJER-UHFFFAOYSA-N 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000000875 corresponding Effects 0.000 description 1
- 231100000078 corrosive Toxicity 0.000 description 1
- 231100001010 corrosive Toxicity 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(II) oxide Inorganic materials [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- -1 nitrogen containing compound Chemical class 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001105 regulatory Effects 0.000 description 1
- 230000000717 retained Effects 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL66415B1 true PL66415B1 (de) | 1972-06-30 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL189832B1 (pl) | Sposób wytwarzania granulek złożonego nawozu sztucznego | |
| US4610715A (en) | Process for preparing fertilizers releasing nitrogen slowly | |
| US3076700A (en) | Fertilizer compositions and process | |
| US3333939A (en) | Discrete fertilizer granule containing a urea compound, sulfur and a phosphate plant food | |
| US3307934A (en) | Method of making a granulated peat fertilizer | |
| CN104803736A (zh) | 一种无蒸汽生产复合肥料的工艺方法 | |
| US4411683A (en) | Process of preparing solid controlled release fertilizer composition | |
| US20050144997A1 (en) | Extended-release nitrogen-containing granular fertilizer | |
| US3186827A (en) | Manufacture of granular fertilizers | |
| Young et al. | Fertilizer Technology, TVA Process for Production of Granular Diammonium Phosphate | |
| US3313614A (en) | Method of making ammonium phoshatecontaining fertilizer | |
| US2770539A (en) | Process for producing a mixed fertilizer | |
| US2680679A (en) | Manufacture of fertilizers | |
| Jackson et al. | Trace elements in fertilizers, solubility status of zinc carriers intermixed with NPK fertilizers | |
| US2077171A (en) | Process for production of fertilizers | |
| PL66415B1 (de) | ||
| US3326666A (en) | Suspension fertilizers from concentrated superphosphates | |
| US3415638A (en) | Process for preparing ammonium phosphate | |
| US4008314A (en) | Manufacture of solid ammonium phosphate | |
| US3214259A (en) | Method of producing free-flowing fertilizer | |
| US3165395A (en) | Method for the production of granular high-nitrogen and mixed fertilizers | |
| Nielsson et al. | Nitric phosphates, manufacture from phosphate rock, nitric acid ammonia, and potassium or other soluble sulfates | |
| US3150955A (en) | Process for producing a free-flowing multi-layer ureaform coated fertilizer | |
| US3301658A (en) | Fertilizer | |
| US2673795A (en) | Phosphate fertilizers |