PL58999B1 - - Google Patents
Download PDFInfo
- Publication number
- PL58999B1 PL58999B1 PL117031A PL11703166A PL58999B1 PL 58999 B1 PL58999 B1 PL 58999B1 PL 117031 A PL117031 A PL 117031A PL 11703166 A PL11703166 A PL 11703166A PL 58999 B1 PL58999 B1 PL 58999B1
- Authority
- PL
- Poland
- Prior art keywords
- phosphoric acid
- raw material
- decomposition
- silica
- raw materials
- Prior art date
Links
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 73
- 235000011007 phosphoric acid Nutrition 0.000 claims description 41
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 36
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 32
- 238000000034 method Methods 0.000 claims description 26
- 239000002994 raw material Substances 0.000 claims description 22
- 239000000377 silicon dioxide Substances 0.000 claims description 16
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 15
- 229910052698 phosphorus Inorganic materials 0.000 claims description 15
- 239000011574 phosphorus Substances 0.000 claims description 15
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 11
- 238000000354 decomposition reaction Methods 0.000 claims description 10
- 239000001506 calcium phosphate Substances 0.000 claims description 9
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 claims description 8
- YYRMJZQKEFZXMX-UHFFFAOYSA-L calcium bis(dihydrogenphosphate) Chemical compound [Ca+2].OP(O)([O-])=O.OP(O)([O-])=O YYRMJZQKEFZXMX-UHFFFAOYSA-L 0.000 claims description 6
- 229910000150 monocalcium phosphate Inorganic materials 0.000 claims description 6
- 235000019691 monocalcium phosphate Nutrition 0.000 claims description 6
- 238000005119 centrifugation Methods 0.000 claims description 4
- 238000001914 filtration Methods 0.000 claims description 4
- 239000013049 sediment Substances 0.000 claims description 4
- 235000011132 calcium sulphate Nutrition 0.000 claims description 3
- 229910052925 anhydrite Inorganic materials 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 235000011149 sulphuric acid Nutrition 0.000 claims 2
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 claims 1
- 229910001424 calcium ion Inorganic materials 0.000 claims 1
- 239000001175 calcium sulphate Substances 0.000 claims 1
- PASHVRUKOFIRIK-UHFFFAOYSA-L calcium sulfate dihydrate Chemical compound O.O.[Ca+2].[O-]S([O-])(=O)=O PASHVRUKOFIRIK-UHFFFAOYSA-L 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000002367 phosphate rock Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 4
- 229910019142 PO4 Inorganic materials 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 2
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 2
- 229940038472 dicalcium phosphate Drugs 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000004566 building material Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL58999B1 true PL58999B1 (enExample) | 1969-10-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US10662072B2 (en) | Method for producing calcium sulfate | |
| DE2218382C3 (de) | Verfahren zur Herstellung von reinem Calciumsulfat beim Phosphorsäurenaßaufschluß | |
| US1836672A (en) | Method of leaching phosphate rock | |
| US3418077A (en) | Phosphoric acid | |
| PL155815B1 (pl) | Sposób wydzielania lantanowców z fosfogipsu | |
| CA1264408A (en) | Continuous process for preparing phosphoric acid and calcium sulphate | |
| US3552918A (en) | Process for the production of phosphoric acid | |
| US3528771A (en) | Phosphoric acid clarification | |
| US3124419A (en) | Purification of phosphoric acid | |
| Manar | Increasing the filtration rate of phosphor-gypsum by using mineral additives | |
| US2567227A (en) | Production of calcium phosphate | |
| CA1186132A (en) | Production of phosphoric acid and additional products from phosphate ore | |
| US2885264A (en) | Hemihydrate process for phosphoric acid manufacture | |
| PL58999B1 (enExample) | ||
| US3984525A (en) | Manufacture of phosphoric acid | |
| SU1223838A3 (ru) | Способ получени фосфорной кислоты | |
| US3388966A (en) | Ammonium phosphate preparation | |
| PL124240B1 (en) | Method of manufacture of mixed fertilizers | |
| US1916429A (en) | Method of producing mixed fertilizers | |
| GB2026996A (en) | Monocalcium Phosphate and Phosphoric Acid Production | |
| US2036244A (en) | Method of producing phosphates | |
| US3049416A (en) | Production of phosphate fertilizers | |
| GB2094282A (en) | Phosphoric acid manufacture | |
| RU2145571C1 (ru) | Способ получения фосфорной кислоты | |
| SU1147694A1 (ru) | Способ получени фосфорной кислоты |