PL43060B1 - - Google Patents
Download PDFInfo
- Publication number
- PL43060B1 PL43060B1 PL43060A PL4306059A PL43060B1 PL 43060 B1 PL43060 B1 PL 43060B1 PL 43060 A PL43060 A PL 43060A PL 4306059 A PL4306059 A PL 4306059A PL 43060 B1 PL43060 B1 PL 43060B1
- Authority
- PL
- Poland
- Prior art keywords
- bulb
- shaft
- filler
- foam
- carbonate
- Prior art date
Links
- 239000006260 foam Substances 0.000 claims description 10
- 239000000945 filler Substances 0.000 claims description 7
- 229910000514 dolomite Inorganic materials 0.000 claims description 4
- 239000010459 dolomite Substances 0.000 claims description 4
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 claims description 4
- 229910000021 magnesium carbonate Inorganic materials 0.000 claims description 4
- 239000001095 magnesium carbonate Substances 0.000 claims description 4
- 229920001187 thermosetting polymer Polymers 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 3
- 229920005989 resin Polymers 0.000 claims description 2
- 239000011347 resin Substances 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims 1
- 238000004581 coalescence Methods 0.000 claims 1
- 229910052749 magnesium Inorganic materials 0.000 claims 1
- 239000011777 magnesium Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 7
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229920003986 novolac Polymers 0.000 description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000010891 electric arc Methods 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- 238000009413 insulation Methods 0.000 description 2
- KSSJBGNOJJETTC-UHFFFAOYSA-N COC1=C(C=CC=C1)N(C1=CC=2C3(C4=CC(=CC=C4C=2C=C1)N(C1=CC=C(C=C1)OC)C1=C(C=CC=C1)OC)C1=CC(=CC=C1C=1C=CC(=CC=13)N(C1=CC=C(C=C1)OC)C1=C(C=CC=C1)OC)N(C1=CC=C(C=C1)OC)C1=C(C=CC=C1)OC)C1=CC=C(C=C1)OC Chemical compound COC1=C(C=CC=C1)N(C1=CC=2C3(C4=CC(=CC=C4C=2C=C1)N(C1=CC=C(C=C1)OC)C1=C(C=CC=C1)OC)C1=CC(=CC=C1C=1C=CC(=CC=13)N(C1=CC=C(C=C1)OC)C1=C(C=CC=C1)OC)N(C1=CC=C(C=C1)OC)C1=C(C=CC=C1)OC)C1=CC=C(C=C1)OC KSSJBGNOJJETTC-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 229960004011 methenamine Drugs 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL43060B1 true PL43060B1 (cg-RX-API-DMAC10.html) | 1960-02-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4636765A (en) | Fuse with corrugated filament | |
| JP5675859B2 (ja) | ヒューズ | |
| US3166656A (en) | Cartridge fuse | |
| PL43060B1 (cg-RX-API-DMAC10.html) | ||
| US3253179A (en) | Electric incandescent lamp and manufacture thereof | |
| NO132854B (cg-RX-API-DMAC10.html) | ||
| US2906908A (en) | Spark plug | |
| US1816194A (en) | Method of forming resistor units | |
| US3562162A (en) | Electrical insulating material and method of making | |
| US1480225A (en) | Electrical cut-out | |
| US2325416A (en) | Arc extinguishing means | |
| US4216406A (en) | Electric lamp wherein the terminal socket cap contains a foamed cap cement which functions to prevent explosions and/or burning a hole through the cap | |
| SE188357C1 (cg-RX-API-DMAC10.html) | ||
| US1484816A (en) | Thermostatic circuit-controlling device | |
| US2358407A (en) | Method of making arc confining structures | |
| US2013289A (en) | Fuse plug | |
| SU492949A1 (ru) | Быстродействующий плавкий предохранитель | |
| SU1198603A1 (ru) | Плавкий предохранитель | |
| US1623819A (en) | Fuse plug | |
| US1059903A (en) | Insulator with fuse. | |
| US822336A (en) | Thermal cut-out for electric circuits. | |
| DE658714C (de) | Gasgefuellte, elektrische Gluehlampe | |
| JP5999655B2 (ja) | リード端子付ヒューズ | |
| US2009089A (en) | Indicating plug fuse | |
| JPS54150875A (en) | Gas-filled incandescent lamp |