PL194784A1 - Wymiennik ciepla zwlaszcza z rurami niemetalowymi - Google Patents
Wymiennik ciepla zwlaszcza z rurami niemetalowymiInfo
- Publication number
- PL194784A1 PL194784A1 PL19478476A PL19478476A PL194784A1 PL 194784 A1 PL194784 A1 PL 194784A1 PL 19478476 A PL19478476 A PL 19478476A PL 19478476 A PL19478476 A PL 19478476A PL 194784 A1 PL194784 A1 PL 194784A1
- Authority
- PL
- Poland
- Prior art keywords
- heat exchanger
- metal pipes
- pipes
- metal
- exchanger
- Prior art date
Links
- IHPYMWDTONKSCO-UHFFFAOYSA-N 2,2'-piperazine-1,4-diylbisethanesulfonic acid Chemical compound OS(=O)(=O)CCN1CCN(CCS(O)(=O)=O)CC1 IHPYMWDTONKSCO-UHFFFAOYSA-N 0.000 title 1
- 239000007990 PIPES buffer Substances 0.000 title 1
- 229910052755 nonmetal Inorganic materials 0.000 title 1
- 150000002843 nonmetals Chemical class 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL19478476A PL194784A1 (pl) | 1976-12-27 | 1976-12-27 | Wymiennik ciepla zwlaszcza z rurami niemetalowymi |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL19478476A PL194784A1 (pl) | 1976-12-27 | 1976-12-27 | Wymiennik ciepla zwlaszcza z rurami niemetalowymi |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL194784A1 true PL194784A1 (pl) | 1978-07-03 |
Family
ID=19980083
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL19478476A PL194784A1 (pl) | 1976-12-27 | 1976-12-27 | Wymiennik ciepla zwlaszcza z rurami niemetalowymi |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL194784A1 (pl) |
-
1976
- 1976-12-27 PL PL19478476A patent/PL194784A1/pl not_active IP Right Cessation
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO141668C (no) | Roerbunn for varmeutveksler. | |
| NL181603C (nl) | Warmteuitwisselaar. | |
| AT368622B (de) | Waermeaustauscher | |
| NL7707748A (nl) | Warmteoverdrachtwand. | |
| SE7701692L (sv) | Tubstod for vermevexlare | |
| DK27377A (da) | Varmeveksler | |
| NL7713447A (nl) | Warmtewisselaar. | |
| NL7612360A (nl) | Warmtepijp. | |
| NL7701310A (nl) | Warmtewisselaar. | |
| MX4372E (es) | Intercambiador termico mejorado | |
| NL7708889A (nl) | Warmtewisselaarcombinatie met gemeenschappelijk rookkanaal. | |
| AT351062B (de) | Waermetauscher | |
| NO771002L (no) | Varmeveksler. | |
| NL7714217A (nl) | Warmtewisselaar. | |
| NL189215C (nl) | Warmtewisselaar. | |
| AT339934B (de) | Warmetauscher | |
| NL7708697A (nl) | Warmte-uitwisselaar. | |
| NO770750L (no) | Varmeveksler. | |
| NL7707862A (nl) | Warmtewisselaar. | |
| PL194784A1 (pl) | Wymiennik ciepla zwlaszcza z rurami niemetalowymi | |
| SE7600671L (sv) | Vermevexlare | |
| PL202411A1 (pl) | Wymiennik ciepla zwlaszcza z rurami niemetalowymi | |
| NO773423L (no) | Varmeveksler. | |
| SE7700803L (sv) | Vermevexlare, serskilt radiator | |
| PT66331A (de) | Waermetauscher |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| LAPS | Decisions on the lapse of the protection rights |
Effective date: 20090527 |