PL192069A1 - Urzadzenie do magazynowania rur wiertniczych - Google Patents
Urzadzenie do magazynowania rur wiertniczychInfo
- Publication number
- PL192069A1 PL192069A1 PL19206976A PL19206976A PL192069A1 PL 192069 A1 PL192069 A1 PL 192069A1 PL 19206976 A PL19206976 A PL 19206976A PL 19206976 A PL19206976 A PL 19206976A PL 192069 A1 PL192069 A1 PL 192069A1
- Authority
- PL
- Poland
- Prior art keywords
- storage
- drilling pipes
- drilling
- pipes
- Prior art date
Links
- IHPYMWDTONKSCO-UHFFFAOYSA-N 2,2'-piperazine-1,4-diylbisethanesulfonic acid Chemical compound OS(=O)(=O)CCN1CCN(CCS(O)(=O)=O)CC1 IHPYMWDTONKSCO-UHFFFAOYSA-N 0.000 title 1
- 239000007990 PIPES buffer Substances 0.000 title 1
- 238000005553 drilling Methods 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL19206976A PL107118B1 (pl) | 1976-08-28 | 1976-08-28 | Urzadzenie do magazynowania rur wiertniczych |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL19206976A PL107118B1 (pl) | 1976-08-28 | 1976-08-28 | Urzadzenie do magazynowania rur wiertniczych |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL192069A1 true PL192069A1 (pl) | 1978-03-13 |
| PL107118B1 PL107118B1 (pl) | 1980-01-31 |
Family
ID=19978361
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL19206976A PL107118B1 (pl) | 1976-08-28 | 1976-08-28 | Urzadzenie do magazynowania rur wiertniczych |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL107118B1 (pl) |
-
1976
- 1976-08-28 PL PL19206976A patent/PL107118B1/pl not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| PL107118B1 (pl) | 1980-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO149326C (no) | Innretning for utlegning av roerledninger | |
| BE850870A (fr) | Support pour tuyaux | |
| PL196919A1 (pl) | Urzadzenie wiertnicze | |
| SE414807B (sv) | Jordborrningsanordning | |
| IT1076866B (it) | Dilatatore meccanico per tubi | |
| SE7714221L (sv) | Anordning for tamponger | |
| MX145715A (es) | Pieza aislante para tuberias | |
| FR2349094A1 (fr) | Tuyau | |
| SE7703635L (sv) | Anordning vid angpannor | |
| SE7708363L (sv) | Bergborranordning | |
| SE433315B (sv) | Anordning for strenggjutning | |
| SE428654B (sv) | Anordning for automatisk tetsvetsning av ror | |
| SE7700446L (sv) | Anordning for borrning | |
| JPS5331280A (en) | Drilling device for pipes | |
| BE861174A (fr) | Tuyeres | |
| PL192069A1 (pl) | Urzadzenie do magazynowania rur wiertniczych | |
| AT358506B (de) | Tiefbohr-vorrichtung | |
| PL196748A1 (pl) | Urzadzenie do magazynowania rur wiertniczych | |
| SE7609799L (sv) | Anordning vid borrverktyg | |
| PL199359A1 (pl) | Urzadzenie do poszukiwania przesmyku | |
| SE413939B (sv) | Anordning for utlosning av snabb punkteld | |
| BE859829A (nl) | Isolatiestuk voor buisleidingen | |
| DD132695A1 (de) | Speichereinrichtung | |
| SE7707495L (sv) | Lageranordning | |
| BE857551A (fr) | Tuyau |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RECP | Rectifications of patent specification | ||
| LAPS | Decisions on the lapse of the protection rights |
Effective date: 20071011 |