PH27005A - Nitroalkane based emulsion explosive composition - Google Patents
Nitroalkane based emulsion explosive composition Download PDFInfo
- Publication number
- PH27005A PH27005A PH39584A PH39584A PH27005A PH 27005 A PH27005 A PH 27005A PH 39584 A PH39584 A PH 39584A PH 39584 A PH39584 A PH 39584A PH 27005 A PH27005 A PH 27005A
- Authority
- PH
- Philippines
- Prior art keywords
- emulsion
- explosive composition
- emulsifier
- weight
- explosive
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 97
- 239000000839 emulsion Substances 0.000 title claims description 78
- 239000002360 explosive Substances 0.000 title claims description 55
- 125000004971 nitroalkyl group Chemical group 0.000 title claims description 16
- 239000000446 fuel Substances 0.000 claims description 42
- 239000003995 emulsifying agent Substances 0.000 claims description 37
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 claims description 28
- 229920005652 polyisobutylene succinic anhydride Polymers 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 14
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 claims description 13
- -1 nitroalkane compound Chemical class 0.000 claims description 12
- JSZOAYXJRCEYSX-UHFFFAOYSA-N 1-nitropropane Chemical compound CCC[N+]([O-])=O JSZOAYXJRCEYSX-UHFFFAOYSA-N 0.000 claims description 7
- 239000007800 oxidant agent Substances 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical group OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 claims description 6
- 229920000642 polymer Polymers 0.000 claims description 6
- 239000000047 product Substances 0.000 claims description 6
- 150000005690 diesters Chemical class 0.000 claims description 5
- 230000001804 emulsifying effect Effects 0.000 claims description 5
- 150000005691 triesters Chemical class 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 4
- 150000002430 hydrocarbons Chemical class 0.000 claims description 4
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 claims description 3
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 claims description 3
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 claims description 3
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 claims description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 3
- 239000005642 Oleic acid Substances 0.000 claims description 3
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 3
- 150000005673 monoalkenes Chemical class 0.000 claims description 3
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 claims description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 3
- 229920000768 polyamine Polymers 0.000 claims description 3
- 229920005862 polyol Polymers 0.000 claims description 3
- 150000003077 polyols Chemical class 0.000 claims description 3
- 229940014800 succinic anhydride Drugs 0.000 claims description 3
- 239000001117 sulphuric acid Substances 0.000 claims description 3
- 235000011149 sulphuric acid Nutrition 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 229910001963 alkali metal nitrate Inorganic materials 0.000 claims description 2
- 229910001964 alkaline earth metal nitrate Inorganic materials 0.000 claims description 2
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims 1
- 239000012071 phase Substances 0.000 description 27
- CUNWUEBNSZSNRX-RKGWDQTMSA-N (2r,3r,4r,5s)-hexane-1,2,3,4,5,6-hexol;(z)-octadec-9-enoic acid Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O CUNWUEBNSZSNRX-RKGWDQTMSA-N 0.000 description 13
- 229960005078 sorbitan sesquioleate Drugs 0.000 description 13
- NWGKJDSIEKMTRX-BFWOXRRGSA-N [(2r)-2-[(3r,4s)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)C1OC[C@H](O)[C@H]1O NWGKJDSIEKMTRX-BFWOXRRGSA-N 0.000 description 12
- 239000011521 glass Substances 0.000 description 12
- 238000002156 mixing Methods 0.000 description 10
- 239000000463 material Substances 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 230000035945 sensitivity Effects 0.000 description 8
- 239000001993 wax Substances 0.000 description 8
- 229910052782 aluminium Inorganic materials 0.000 description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 238000005422 blasting Methods 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 239000003996 polyglycerol polyricinoleate Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 238000005474 detonation Methods 0.000 description 4
- 239000003517 fume Substances 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 230000035939 shock Effects 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001540 azides Chemical class 0.000 description 3
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 239000012188 paraffin wax Substances 0.000 description 3
- 238000005096 rolling process Methods 0.000 description 3
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 239000005662 Paraffin oil Substances 0.000 description 2
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 239000005864 Sulphur Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000004200 microcrystalline wax Substances 0.000 description 2
- 235000019808 microcrystalline wax Nutrition 0.000 description 2
- 239000004005 microsphere Substances 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 235000019809 paraffin wax Nutrition 0.000 description 2
- 235000019271 petrolatum Nutrition 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 2
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 229920002907 Guar gum Polymers 0.000 description 1
- AOMUHOFOVNGZAN-UHFFFAOYSA-N N,N-bis(2-hydroxyethyl)dodecanamide Chemical compound CCCCCCCCCCCC(=O)N(CCO)CCO AOMUHOFOVNGZAN-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- NWGKJDSIEKMTRX-AAZCQSIUSA-N Sorbitan monooleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O NWGKJDSIEKMTRX-AAZCQSIUSA-N 0.000 description 1
- 239000004147 Sorbitan trioleate Substances 0.000 description 1
- PRXRUNOAOLTIEF-ADSICKODSA-N Sorbitan trioleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCC\C=C/CCCCCCCC PRXRUNOAOLTIEF-ADSICKODSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 229920001222 biopolymer Polymers 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000004067 bulking agent Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 230000002844 continuous effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000000586 desensitisation Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- 239000000665 guar gum Substances 0.000 description 1
- 229960002154 guar gum Drugs 0.000 description 1
- 235000010417 guar gum Nutrition 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000004530 micro-emulsion Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- URXNVXOMQQCBHS-UHFFFAOYSA-N naphthalene;sodium Chemical compound [Na].C1=CC=CC2=CC=CC=C21 URXNVXOMQQCBHS-UHFFFAOYSA-N 0.000 description 1
- VLZLOWPYUQHHCG-UHFFFAOYSA-N nitromethylbenzene Chemical compound [O-][N+](=O)CC1=CC=CC=C1 VLZLOWPYUQHHCG-UHFFFAOYSA-N 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 230000001473 noxious effect Effects 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000011236 particulate material Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000000518 rheometry Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000004449 solid propellant Substances 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 229950004959 sorbitan oleate Drugs 0.000 description 1
- 235000019337 sorbitan trioleate Nutrition 0.000 description 1
- 229960000391 sorbitan trioleate Drugs 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000012956 testing procedure Methods 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
- C06B47/145—Water in oil emulsion type explosives in which a carbonaceous fuel forms the continuous phase
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B25/00—Compositions containing a nitrated organic compound
- C06B25/36—Compositions containing a nitrated organic compound the compound being a nitroparaffin
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Colloid Chemistry (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA000584954A CA1325723C (en) | 1988-12-05 | 1988-12-05 | Nitroalkane-based emulsion explosive composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH27005A true PH27005A (en) | 1993-02-01 |
Family
ID=4139228
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH39584A PH27005A (en) | 1988-12-05 | 1989-11-24 | Nitroalkane based emulsion explosive composition |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4936931A (es) |
| EP (1) | EP0372739A3 (es) |
| AU (1) | AU615595B2 (es) |
| CA (1) | CA1325723C (es) |
| GB (1) | GB2225572A (es) |
| MX (1) | MX170219B (es) |
| NO (1) | NO894838L (es) |
| NZ (1) | NZ231479A (es) |
| PH (1) | PH27005A (es) |
| ZA (1) | ZA899055B (es) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4997494A (en) * | 1990-07-16 | 1991-03-05 | Ici Canada Inc. | Chemically gassed emulsion explosive |
| NO303441B1 (no) * | 1993-11-18 | 1998-07-13 | Sasol Chem Ind Pty | Emulsjonsprengstoff |
| AU710644B2 (en) * | 1994-12-20 | 1999-09-23 | Sasol Chemical Industries Limited | Emulsifier |
| US5920030A (en) * | 1996-05-02 | 1999-07-06 | Mining Services International | Methods of blasting using nitrogen-free explosives |
| DE19847868C2 (de) | 1998-10-16 | 2003-09-25 | Clariant Gmbh | Sprengstoffe, enthaltend modifizierte Copolymere aus Polyisobutylen und Maleinsäureanhydrid als Emulgatoren |
| US20030024619A1 (en) * | 2001-06-29 | 2003-02-06 | Coolbaugh Thomas Smith | Explosive emulsion compositions containing modified copolymers of isoprene, butadiene, and/or styrene |
| CA2403703A1 (en) | 2002-09-17 | 2004-03-17 | Eti Holdings Corp. | Method of gassing emulsion explosives and explosives produced thereby |
| CN103553852B (zh) * | 2013-10-25 | 2015-09-09 | 湖北同一石油化工有限公司 | 一种乳化炸药用乳化剂及其制备方法 |
| US11953306B2 (en) | 2018-03-16 | 2024-04-09 | Dyno Nobel Asia Pacific Pty Limited | External homogenization systems and methods related thereto |
Family Cites Families (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US28060A (en) * | 1860-05-01 | Musical reed | ||
| US3447978A (en) * | 1967-08-03 | 1969-06-03 | Atlas Chem Ind | Ammonium nitrate emulsion blasting agent and method of preparing same |
| US3674578A (en) * | 1970-02-17 | 1972-07-04 | Du Pont | Water-in-oil emulsion type blasting agent |
| US3770522A (en) * | 1970-08-18 | 1973-11-06 | Du Pont | Emulsion type explosive composition containing ammonium stearate or alkali metal stearate |
| US3715247A (en) * | 1970-09-03 | 1973-02-06 | Ici America Inc | Water-in-oil emulsion explosive containing entrapped gas |
| US3765964A (en) * | 1972-10-06 | 1973-10-16 | Ici America Inc | Water-in-oil emulsion type explosive compositions having strontium-ion detonation catalysts |
| USRE28060E (en) | 1973-10-05 | 1974-07-02 | Water-in-oil emulsion type blasting agent | |
| AU515896B2 (en) * | 1976-11-09 | 1981-05-07 | Atlas Powder Company | Water-in-oil explosive |
| US4104092A (en) * | 1977-07-18 | 1978-08-01 | Atlas Powder Company | Emulsion sensitized gelled explosive composition |
| US4111727A (en) * | 1977-09-19 | 1978-09-05 | Clay Robert B | Water-in-oil blasting composition |
| US4149917A (en) * | 1977-11-03 | 1979-04-17 | Atlas Powder Company | Cap sensitive emulsions without any sensitizer other than occluded air |
| US4149916A (en) * | 1977-11-03 | 1979-04-17 | Atlas Powder Company | Cap sensitive emulsions containing perchlorates and occluded air and method |
| US4138281A (en) * | 1977-11-04 | 1979-02-06 | Olney Robert S | Production of explosive emulsions |
| US4141767A (en) * | 1978-03-03 | 1979-02-27 | Ireco Chemicals | Emulsion blasting agent |
| JPS5575992A (en) * | 1978-11-28 | 1980-06-07 | Nippon Oils & Fats Co Ltd | Waterrinnoil type emulsion explosive composition |
| US4218272A (en) * | 1978-12-04 | 1980-08-19 | Atlas Powder Company | Water-in-oil NCN emulsion blasting agent |
| CA1096173A (en) * | 1978-12-08 | 1981-02-24 | Rejean Binet | Water-in -oil emulsion blasting agent |
| US4216040A (en) * | 1979-01-19 | 1980-08-05 | Ireco Chemicals | Emulsion blasting composition |
| NZ192888A (en) * | 1979-04-02 | 1982-03-30 | Canadian Ind | Water-in-oil microemulsion explosive compositions |
| US4231821A (en) * | 1979-05-21 | 1980-11-04 | Ireco Chemicals | Emulsion blasting agent sensitized with perlite |
| GB2080280B (en) * | 1980-07-21 | 1983-12-07 | Ici Ltd | Emulsion blasting agent containing urea perchlorate |
| US4394199A (en) * | 1981-09-08 | 1983-07-19 | Agnus Chemical Company | Explosive emulsion composition |
| US4453989A (en) * | 1982-04-05 | 1984-06-12 | Atlas Powder Company | Solid sensitizers for water-in-oil emulsion explosives |
| GB8407300D0 (en) * | 1984-03-21 | 1984-04-26 | Ici Plc | Surfactants |
| IE59303B1 (en) * | 1985-08-21 | 1994-02-09 | Ici Australia Ltd | Composition |
| US4708753A (en) * | 1985-12-06 | 1987-11-24 | The Lubrizol Corporation | Water-in-oil emulsions |
| MW787A1 (en) * | 1986-02-28 | 1987-10-14 | Ici Australia Ltd | Explosive composition |
| US4867813A (en) * | 1988-08-26 | 1989-09-19 | W. R. Grace & Co. - Conn. | Salt-phase sensitized water-containing explosives |
-
1988
- 1988-12-05 CA CA000584954A patent/CA1325723C/en not_active Expired - Fee Related
-
1989
- 1989-11-20 EP EP19890311984 patent/EP0372739A3/en not_active Withdrawn
- 1989-11-22 NZ NZ231479A patent/NZ231479A/en unknown
- 1989-11-22 GB GB8926428A patent/GB2225572A/en not_active Withdrawn
- 1989-11-24 PH PH39584A patent/PH27005A/en unknown
- 1989-11-27 AU AU45554/89A patent/AU615595B2/en not_active Ceased
- 1989-11-28 ZA ZA899055A patent/ZA899055B/xx unknown
- 1989-11-29 US US07/442,695 patent/US4936931A/en not_active Expired - Fee Related
- 1989-12-04 NO NO89894838A patent/NO894838L/no unknown
- 1989-12-04 MX MX018571A patent/MX170219B/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CA1325723C (en) | 1994-01-04 |
| MX170219B (es) | 1993-08-11 |
| NO894838L (no) | 1990-06-06 |
| NO894838D0 (no) | 1989-12-04 |
| EP0372739A2 (en) | 1990-06-13 |
| EP0372739A3 (en) | 1991-08-07 |
| GB2225572A (en) | 1990-06-06 |
| AU4555489A (en) | 1990-06-07 |
| AU615595B2 (en) | 1991-10-03 |
| ZA899055B (en) | 1990-09-26 |
| NZ231479A (en) | 1992-08-26 |
| US4936931A (en) | 1990-06-26 |
| GB8926428D0 (en) | 1990-01-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1102138A (en) | Emulsion blasting agent and method of preparation thereof | |
| US4104092A (en) | Emulsion sensitized gelled explosive composition | |
| US3765964A (en) | Water-in-oil emulsion type explosive compositions having strontium-ion detonation catalysts | |
| US4383873A (en) | Sensitive low water emulsion explosive compositions | |
| US4149917A (en) | Cap sensitive emulsions without any sensitizer other than occluded air | |
| GB2042495A (en) | Emulsion blasting composition | |
| EP0028908B1 (en) | Emulsion explosive composition | |
| JPS6366799B2 (es) | ||
| US4371408A (en) | Low water emulsion explosive compositions optionally containing inert salts | |
| US4356044A (en) | Emulsion explosives containing high concentrations of calcium nitrate | |
| NZ205848A (en) | Emulsion explosive composition containing polycyclic hydrocarbon structure as stabiliser | |
| US3790415A (en) | Chemical foaming and sensitizing of water-bearing explosives with hydrogen peroxide | |
| GB2086363A (en) | Emulsion explosives containing a reduced amount of water | |
| US4936931A (en) | Nitroalkane-based emulsion explosive composition | |
| US4398976A (en) | Water-in-oil emulsion explosive composition | |
| US4936932A (en) | Aromatic hydrocarbon-based emulsion explosive composition | |
| US4308081A (en) | Water-in-oil emulsion blasting agent | |
| US4664729A (en) | Water-in-oil explosive emulsion composition | |
| NZ197739A (en) | Water-in-oil emulsion blasting agents wherein the discontinuous phase consists of urea perchlorte | |
| US4509998A (en) | Emulsion blasting agent with amine-based emulsifier | |
| US6022428A (en) | Gassed emulsion explosive | |
| US20020124917A1 (en) | Preparation of emulsions by pH adjustments | |
| CA1139106A (en) | Water-in-oil emulsion compositions | |
| UA58528C2 (uk) | Патронована вибухова емульсія | |
| CA3217755A1 (en) | Composition for forming a hydrogen peroxide based emulsion explosive |