OA20640A - R-type Pyridyloxycarboxylic acid, salt and ester derivative thereof, and preparation method therefor, and herbicidal composition and application thereof. - Google Patents
R-type Pyridyloxycarboxylic acid, salt and ester derivative thereof, and preparation method therefor, and herbicidal composition and application thereof. Download PDFInfo
- Publication number
- OA20640A OA20640A OA1202100303 OA20640A OA 20640 A OA20640 A OA 20640A OA 1202100303 OA1202100303 OA 1202100303 OA 20640 A OA20640 A OA 20640A
- Authority
- OA
- OAPI
- Prior art keywords
- alkyl
- sait
- halogen
- alkoxy
- unsubstituted
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 42
- 230000002363 herbicidal Effects 0.000 title claims abstract description 41
- 150000002148 esters Chemical class 0.000 title claims abstract description 31
- 239000002253 acid Substances 0.000 title claims abstract description 30
- 239000011780 sodium chloride Substances 0.000 title abstract description 9
- 150000003839 salts Chemical class 0.000 title abstract description 8
- 238000002360 preparation method Methods 0.000 title abstract 2
- -1 amine salt Chemical class 0.000 claims abstract description 148
- 150000001875 compounds Chemical class 0.000 claims abstract description 131
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 105
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 103
- 150000002367 halogens Chemical class 0.000 claims abstract description 92
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 43
- 239000001257 hydrogen Substances 0.000 claims abstract description 39
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 31
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 27
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 26
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 26
- 240000007594 Oryza sativa Species 0.000 claims abstract description 24
- 235000007164 Oryza sativa Nutrition 0.000 claims abstract description 24
- 235000009566 rice Nutrition 0.000 claims abstract description 24
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 22
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 15
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 14
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 11
- 238000005516 engineering process Methods 0.000 claims abstract description 8
- 239000000575 pesticide Substances 0.000 claims abstract description 6
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical class [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 claims abstract description 6
- 125000004966 cyanoalkyl group Chemical group 0.000 claims abstract description 5
- 150000002431 hydrogen Chemical class 0.000 claims abstract 19
- 241000196324 Embryophyta Species 0.000 claims description 85
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 72
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 58
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 45
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims description 42
- 125000003545 alkoxy group Chemical group 0.000 claims description 40
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 39
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 34
- 125000001072 heteroaryl group Chemical group 0.000 claims description 33
- 238000006243 chemical reaction Methods 0.000 claims description 30
- 125000003282 alkyl amino group Chemical group 0.000 claims description 29
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 28
- 150000001412 amines Chemical class 0.000 claims description 26
- 125000003118 aryl group Chemical group 0.000 claims description 26
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 24
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 24
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 24
- 125000000623 heterocyclic group Chemical group 0.000 claims description 24
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 24
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 23
- 125000005843 halogen group Chemical group 0.000 claims description 23
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 22
- 125000004414 alkyl thio group Chemical group 0.000 claims description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 21
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 20
- 239000004009 herbicide Substances 0.000 claims description 20
- 239000002904 solvent Substances 0.000 claims description 20
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 18
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 17
- XEKOWRVHYACXOJ-UHFFFAOYSA-N acetic acid ethyl ester Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 15
- 125000001624 naphthyl group Chemical group 0.000 claims description 15
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 14
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 13
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 claims description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 12
- OETNGFVFDOSLHW-UHFFFAOYSA-N 3-morpholin-2-ylpropan-1-amine Chemical compound NCCCC1CNCCO1 OETNGFVFDOSLHW-UHFFFAOYSA-N 0.000 claims description 11
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 11
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 claims description 11
- 125000001153 fluoro group Chemical group F* 0.000 claims description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N methylene dichloride Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 11
- YNAVUWVOSKDBBP-UHFFFAOYSA-N morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 11
- 229940113083 morpholine Drugs 0.000 claims description 11
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims description 10
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 10
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 claims description 10
- 125000004649 C2-C8 alkynyl group Chemical group 0.000 claims description 10
- 125000005257 alkyl acyl group Chemical group 0.000 claims description 10
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 10
- 238000009472 formulation Methods 0.000 claims description 10
- 125000002541 furyl group Chemical group 0.000 claims description 9
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 9
- NQRYJNQNLNOLGT-UHFFFAOYSA-N piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 9
- 125000003107 substituted aryl group Chemical group 0.000 claims description 9
- 125000001544 thienyl group Chemical group 0.000 claims description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 8
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 8
- 230000001276 controlling effect Effects 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 8
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 8
- 125000004076 pyridyl group Chemical group 0.000 claims description 8
- 150000003335 secondary amines Chemical class 0.000 claims description 8
- 150000003512 tertiary amines Chemical class 0.000 claims description 8
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 8
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims description 7
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 7
- 150000003141 primary amines Chemical class 0.000 claims description 7
- JRMUNVKIHCOMHV-UHFFFAOYSA-M Tetra-n-butylammonium bromide Chemical group [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 claims description 6
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 6
- 125000005103 alkyl silyl group Chemical group 0.000 claims description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 6
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 6
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 6
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 6
- 125000006678 phenoxycarbonyl group Chemical group 0.000 claims description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 125000000335 thiazolyl group Chemical group 0.000 claims description 6
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 5
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 5
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 claims description 5
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 5
- 125000006702 (C1-C18) alkyl group Chemical group 0.000 claims description 4
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 4
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 4
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims description 4
- HPNMFZURTQLUMO-UHFFFAOYSA-N Diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 claims description 4
- UAOMVDZJSHZZME-UHFFFAOYSA-N Diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 claims description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M NaHCO3 Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 4
- 125000004694 alkoxyaminocarbonyl group Chemical group 0.000 claims description 4
- 125000004691 alkyl thio carbonyl group Chemical group 0.000 claims description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 4
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 4
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 4
- 125000004995 haloalkylthio group Chemical group 0.000 claims description 4
- 125000004415 heterocyclylalkyl group Chemical group 0.000 claims description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 4
- 125000004043 oxo group Chemical group O=* 0.000 claims description 4
- 125000004430 oxygen atoms Chemical group O* 0.000 claims description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 4
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 4
- 125000004665 trialkylsilyl group Chemical group 0.000 claims description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 4
- GIAFURWZWWWBQT-UHFFFAOYSA-N 2-(2-aminoethoxy)ethanol Chemical compound NCCOCCO GIAFURWZWWWBQT-UHFFFAOYSA-N 0.000 claims description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 claims description 3
- IOAOAKDONABGPZ-UHFFFAOYSA-N 2-amino-2-ethylpropane-1,3-diol Chemical compound CCC(N)(CO)CO IOAOAKDONABGPZ-UHFFFAOYSA-N 0.000 claims description 3
- BFBKUYFMLNOLOQ-UHFFFAOYSA-N 2-butoxyethanamine Chemical compound CCCCOCCN BFBKUYFMLNOLOQ-UHFFFAOYSA-N 0.000 claims description 3
- PJHRMQPEENZCPK-UHFFFAOYSA-N 2-methylsulfanylpropan-1-amine Chemical compound CSC(C)CN PJHRMQPEENZCPK-UHFFFAOYSA-N 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 3
- WGQKYBSKWIADBV-UHFFFAOYSA-N Benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 claims description 3
- 229960001231 Choline Drugs 0.000 claims description 3
- RPNUMPOLZDHAAY-UHFFFAOYSA-N DETA Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 claims description 3
- IUNMPGNGSSIWFP-UHFFFAOYSA-N Dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 claims description 3
- JJWLVOIRVHMVIS-UHFFFAOYSA-N Isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 claims description 3
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 claims description 3
- DYUWTXWIYMHBQS-UHFFFAOYSA-N N-prop-2-enylprop-2-en-1-amine Chemical compound C=CCNCC=C DYUWTXWIYMHBQS-UHFFFAOYSA-N 0.000 claims description 3
- VILCJCGEZXAXTO-UHFFFAOYSA-N Triethylenetetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 claims description 3
- YOUGRGFIHBUKRS-UHFFFAOYSA-N benzyl(trimethyl)azanium Chemical compound C[N+](C)(C)CC1=CC=CC=C1 YOUGRGFIHBUKRS-UHFFFAOYSA-N 0.000 claims description 3
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- HBGGBCVEFUPUNY-UHFFFAOYSA-N cyclododecanamine Chemical compound NC1CCCCCCCCCCC1 HBGGBCVEFUPUNY-UHFFFAOYSA-N 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- ROSDSFDQCJNGOL-UHFFFAOYSA-N dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 claims description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N ethanolamine Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N o-xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 3
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 239000001184 potassium carbonate Substances 0.000 claims description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 239000008096 xylene Substances 0.000 claims description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 2
- 125000006710 (C2-C12) alkenyl group Chemical group 0.000 claims description 2
- 125000006711 (C2-C12) alkynyl group Chemical group 0.000 claims description 2
- 125000006766 (C2-C6) alkynyloxy group Chemical group 0.000 claims description 2
- LYVWJKRCILVKOI-UHFFFAOYSA-N 1,1,1-trifluorobutane Chemical group [CH2]CCC(F)(F)F LYVWJKRCILVKOI-UHFFFAOYSA-N 0.000 claims description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 2
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-Amino-2-propanol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 claims description 2
- SLINHMUFWFWBMU-UHFFFAOYSA-N 1-[bis(2-hydroxypropyl)amino]propan-2-ol Chemical compound CC(O)CN(CC(C)O)CC(C)O SLINHMUFWFWBMU-UHFFFAOYSA-N 0.000 claims description 2
- 125000004778 2,2-difluoroethyl group Chemical group [H]C([H])(*)C([H])(F)F 0.000 claims description 2
- 125000005999 2-bromoethyl group Chemical group 0.000 claims description 2
- 125000003320 C2-C6 alkenyloxy group Chemical group 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate dianion Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N Diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 claims description 2
- BFSVOASYOCHEOV-UHFFFAOYSA-N Diethylethanolamine Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 claims description 2
- BMVXCPBXGZKUPN-UHFFFAOYSA-N Hexylamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 claims description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N Isobutylamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 claims description 2
- CRVGTESFCCXCTH-UHFFFAOYSA-N Methyl diethanolamine Chemical compound OCCN(C)CCO CRVGTESFCCXCTH-UHFFFAOYSA-N 0.000 claims description 2
- KMBPCQSCMCEPMU-UHFFFAOYSA-N N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine Chemical compound NCCCN(C)CCCN KMBPCQSCMCEPMU-UHFFFAOYSA-N 0.000 claims description 2
- 229940100684 PENTYLAMINE Drugs 0.000 claims description 2
- DPBLXKKOBLCELK-UHFFFAOYSA-N Pentylamine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 claims description 2
- CBXCPBUEXACCNR-UHFFFAOYSA-N Tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 claims description 2
- RKBCYCFRFCNLTO-UHFFFAOYSA-N Triisopropylamine Chemical compound CC(C)N(C(C)C)C(C)C RKBCYCFRFCNLTO-UHFFFAOYSA-N 0.000 claims description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N Trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 claims description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Tris Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 claims description 2
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 2
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 claims description 2
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000004689 alkyl amino carbonyl alkyl group Chemical group 0.000 claims description 2
- 125000005093 alkyl carbonyl alkyl group Chemical group 0.000 claims description 2
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 2
- 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 2
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminum Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 125000005122 aminoalkylamino group Chemical group 0.000 claims description 2
- 239000007864 aqueous solution Substances 0.000 claims description 2
- VBQDSLGFSUGBBE-UHFFFAOYSA-N benzyl(triethyl)azanium Chemical compound CC[N+](CC)(CC)CC1=CC=CC=C1 VBQDSLGFSUGBBE-UHFFFAOYSA-N 0.000 claims description 2
- 230000000875 corresponding Effects 0.000 claims description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 claims description 2
- 229940043279 diisopropylamine Drugs 0.000 claims description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 2
- JRBPAEWTRLWTQC-UHFFFAOYSA-N dodecan-1-amine Chemical compound CCCCCCCCCCCCN JRBPAEWTRLWTQC-UHFFFAOYSA-N 0.000 claims description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N ethyl amine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 2
- WJYIASZWHGOTOU-UHFFFAOYSA-N heptan-1-amine Chemical compound CCCCCCCN WJYIASZWHGOTOU-UHFFFAOYSA-N 0.000 claims description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N iso-propanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 2
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 claims description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 2
- 239000001187 sodium carbonate Substances 0.000 claims description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- XAMMKFSEEQGBIC-UHFFFAOYSA-N tetra(propan-2-yl)azanium Chemical compound CC(C)[N+](C(C)C)(C(C)C)C(C)C XAMMKFSEEQGBIC-UHFFFAOYSA-N 0.000 claims description 2
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 claims description 2
- PLZVEHJLHYMBBY-UHFFFAOYSA-N tetradecan-1-amine Chemical compound CCCCCCCCCCCCCCN PLZVEHJLHYMBBY-UHFFFAOYSA-N 0.000 claims description 2
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical compound CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 claims description 2
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 8
- 125000004433 nitrogen atoms Chemical group N* 0.000 claims 2
- 125000004434 sulfur atoms Chemical group 0.000 claims 2
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 claims 1
- 229910004755 ORb Inorganic materials 0.000 claims 1
- 101710016478 RNASEH2A Proteins 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 abstract description 2
- 239000002184 metal Substances 0.000 abstract description 2
- 150000004714 phosphonium salts Chemical class 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 description 882
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N DMSO-d6 Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 54
- 230000000694 effects Effects 0.000 description 22
- 125000004435 hydrogen atoms Chemical class [H]* 0.000 description 18
- 230000002401 inhibitory effect Effects 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- XBDQKXXYIPTUBI-UHFFFAOYSA-N propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- 239000000126 substance Substances 0.000 description 14
- 239000008187 granular material Substances 0.000 description 13
- 230000012010 growth Effects 0.000 description 13
- 239000007858 starting material Substances 0.000 description 11
- 239000002689 soil Substances 0.000 description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- 244000045561 useful plants Species 0.000 description 9
- 240000003424 Digitaria sanguinalis Species 0.000 description 8
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 8
- 240000002436 Echinochloa crus-galli Species 0.000 description 8
- 235000011999 Panicum crusgalli Nutrition 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 241000209140 Triticum Species 0.000 description 7
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 235000021307 wheat Nutrition 0.000 description 7
- 229920000742 Cotton Polymers 0.000 description 6
- 235000010469 Glycine max Nutrition 0.000 description 6
- 240000007842 Glycine max Species 0.000 description 6
- 240000006962 Gossypium hirsutum Species 0.000 description 6
- 240000006394 Sorghum bicolor Species 0.000 description 6
- 238000004440 column chromatography Methods 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 6
- 230000002194 synthesizing Effects 0.000 description 6
- 239000005631 2,4-D Substances 0.000 description 5
- 240000006995 Abutilon theophrasti Species 0.000 description 5
- 240000000178 Monochoria vaginalis Species 0.000 description 5
- 210000000582 Semen Anatomy 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- HEDRZPFGACZZDS-MICDWDOJSA-N cdcl3 Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 235000019260 propionic acid Nutrition 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- 239000004562 water dispersible granule Substances 0.000 description 5
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- 239000005502 Cyhalofop-butyl Substances 0.000 description 4
- TYIYMOAHACZAMQ-CQSZACIVSA-N Cyhalofop-butyl Chemical group C1=CC(O[C@H](C)C(=O)OCCCC)=CC=C1OC1=CC=C(C#N)C=C1F TYIYMOAHACZAMQ-CQSZACIVSA-N 0.000 description 4
- 235000014820 Galium aparine Nutrition 0.000 description 4
- 240000005702 Galium aparine Species 0.000 description 4
- 239000005574 MCPA Substances 0.000 description 4
- BZLVMXJERCGZMT-UHFFFAOYSA-N MeOtBu Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 4
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 4
- 241000209149 Zea Species 0.000 description 4
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 4
- 125000004429 atoms Chemical group 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 230000003197 catalytic Effects 0.000 description 4
- 235000005822 corn Nutrition 0.000 description 4
- 235000005824 corn Nutrition 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 206010002026 Amyotrophic lateral sclerosis Diseases 0.000 description 3
- MPOOECNQTZRJKI-UHFFFAOYSA-N Bispyribac-sodium Chemical compound [NaH].COC1=CC(OC)=NC(OC=2C(=C(OC=3N=C(OC)C=C(OC)N=3)C=CC=2)C(O)=O)=N1 MPOOECNQTZRJKI-UHFFFAOYSA-N 0.000 description 3
- 229920001405 Coding region Polymers 0.000 description 3
- 241000234653 Cyperus Species 0.000 description 3
- 239000005531 Flufenacet Substances 0.000 description 3
- 240000005979 Hordeum vulgare Species 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- 241000219823 Medicago Species 0.000 description 3
- 229920001850 Nucleic acid sequence Polymers 0.000 description 3
- 239000005592 Penoxsulam Substances 0.000 description 3
- SYJGKVOENHZYMQ-UHFFFAOYSA-N Penoxsulam Chemical compound N1=C2C(OC)=CN=C(OC)N2N=C1NS(=O)(=O)C1=C(OCC(F)F)C=CC=C1C(F)(F)F SYJGKVOENHZYMQ-UHFFFAOYSA-N 0.000 description 3
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 240000006694 Stellaria media Species 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 229920003013 deoxyribonucleic acid Polymers 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 150000002191 fatty alcohols Chemical class 0.000 description 3
- 239000003337 fertilizer Substances 0.000 description 3
- IANUJLZYFUDJIH-UHFFFAOYSA-N flufenacet Chemical compound C=1C=C(F)C=CC=1N(C(C)C)C(=O)COC1=NN=C(C(F)(F)F)S1 IANUJLZYFUDJIH-UHFFFAOYSA-N 0.000 description 3
- 238000010353 genetic engineering Methods 0.000 description 3
- 238000005469 granulation Methods 0.000 description 3
- 230000003179 granulation Effects 0.000 description 3
- 230000000670 limiting Effects 0.000 description 3
- 235000019713 millet Nutrition 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- JVVRCYWZTJLJSG-UHFFFAOYSA-N 4-Dimethylaminophenol Substances CN(C)C1=CC=C(O)C=C1 JVVRCYWZTJLJSG-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- OOHIAOSLOGDBCE-UHFFFAOYSA-N 6-chloro-4-N-cyclopropyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine Chemical compound CC(C)NC1=NC(Cl)=NC(NC2CC2)=N1 OOHIAOSLOGDBCE-UHFFFAOYSA-N 0.000 description 2
- 241000219318 Amaranthus Species 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- QGQSRQPXXMTJCM-UHFFFAOYSA-N Benfuresate Chemical compound CCS(=O)(=O)OC1=CC=C2OCC(C)(C)C2=C1 QGQSRQPXXMTJCM-UHFFFAOYSA-N 0.000 description 2
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butanoic acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 239000005499 Clomazone Substances 0.000 description 2
- KIEDNEWSYUYDSN-UHFFFAOYSA-N Clomazone Chemical compound O=C1C(C)(C)CON1CC1=CC=CC=C1Cl KIEDNEWSYUYDSN-UHFFFAOYSA-N 0.000 description 2
- 241000192043 Echinochloa Species 0.000 description 2
- 239000005558 Fluroxypyr Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 241000209510 Liliopsida Species 0.000 description 2
- 239000005584 Metsulfuron-methyl Substances 0.000 description 2
- WXZVAROIGSFCFJ-UHFFFAOYSA-N N,N-diethyl-2-(naphthalen-1-yloxy)propanamide Chemical compound C1=CC=C2C(OC(C)C(=O)N(CC)CC)=CC=CC2=C1 WXZVAROIGSFCFJ-UHFFFAOYSA-N 0.000 description 2
- 239000005585 Napropamide Substances 0.000 description 2
- PHNUZKMIPFFYSO-UHFFFAOYSA-N Pronamide Chemical compound C#CC(C)(C)NC(=O)C1=CC(Cl)=CC(Cl)=C1 PHNUZKMIPFFYSO-UHFFFAOYSA-N 0.000 description 2
- 239000005602 Propyzamide Substances 0.000 description 2
- BGNQYGRXEXDAIQ-UHFFFAOYSA-N Pyrazosulfuron-ethyl Chemical group C1=NN(C)C(S(=O)(=O)NC(=O)NC=2N=C(OC)C=C(OC)N=2)=C1C(=O)OCC BGNQYGRXEXDAIQ-UHFFFAOYSA-N 0.000 description 2
- 235000008484 Rorippa indica Nutrition 0.000 description 2
- 240000004053 Rorippa indica Species 0.000 description 2
- 235000007238 Secale cereale Nutrition 0.000 description 2
- 240000002057 Secale cereale Species 0.000 description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 description 2
- 240000001016 Solanum tuberosum Species 0.000 description 2
- HBPDKDSFLXWOAE-UHFFFAOYSA-N Tebuthiuron Chemical compound CNC(=O)N(C)C1=NN=C(C(C)(C)C)S1 HBPDKDSFLXWOAE-UHFFFAOYSA-N 0.000 description 2
- 231100000765 Toxin Toxicity 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atoms Chemical group C* 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 230000000749 insecticidal Effects 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 230000004807 localization Effects 0.000 description 2
- QYDYPVFESGNLHU-KHPPLWFESA-N methyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC QYDYPVFESGNLHU-KHPPLWFESA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N n-butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 150000002829 nitrogen Chemical group 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 108020004707 nucleic acids Proteins 0.000 description 2
- 150000007523 nucleic acids Chemical class 0.000 description 2
- 230000003287 optical Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 2
- 229920000053 polysorbate 80 Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 230000002829 reduced Effects 0.000 description 2
- 230000001105 regulatory Effects 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000003053 toxin Substances 0.000 description 2
- 108020003112 toxins Proteins 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- AIAYSXFWIUNXRC-PHIMTYICSA-N (1R,5S)-3-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)pyridin-3-yl]methylidene]bicyclo[3.2.1]octane-2,4-dione Chemical compound COCCOCC1=NC(C(F)(F)F)=CC=C1C(O)=C1C(=O)[C@@H](C2)CC[C@@H]2C1=O AIAYSXFWIUNXRC-PHIMTYICSA-N 0.000 description 1
- SESJCOBCXSACPH-UHFFFAOYSA-N (2,3-dichlorophenyl)methyl N-methylcarbamate Chemical compound CNC(=O)OCC1=CC=CC(Cl)=C1Cl SESJCOBCXSACPH-UHFFFAOYSA-N 0.000 description 1
- DQKWXTIYGWPGOO-UHFFFAOYSA-N (2,6-dibromo-4-cyanophenyl) octanoate Chemical compound CCCCCCCC(=O)OC1=C(Br)C=C(C#N)C=C1Br DQKWXTIYGWPGOO-UHFFFAOYSA-N 0.000 description 1
- HEJVROKEIMJTIN-UHFFFAOYSA-N (2-butan-2-yl-4,6-dinitrophenyl) (2,4-dinitrophenyl) carbonate Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O HEJVROKEIMJTIN-UHFFFAOYSA-N 0.000 description 1
- QWZIGUJYMLBQCY-UHFFFAOYSA-N (2-chloro-3,5-diiodopyridin-4-yl) acetate Chemical compound CC(=O)OC1=C(I)C=NC(Cl)=C1I QWZIGUJYMLBQCY-UHFFFAOYSA-N 0.000 description 1
- JEDYYFXHPAIBGR-UHFFFAOYSA-N (2-methyl-1-oxo-1-prop-2-enoxypropan-2-yl) 2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate Chemical compound O=C1N(C)C(C(F)(F)F)=CC(=O)N1C1=CC=C(Cl)C(C(=O)OC(C)(C)C(=O)OCC=C)=C1 JEDYYFXHPAIBGR-UHFFFAOYSA-N 0.000 description 1
- BMJYKXALMDAIEG-UHFFFAOYSA-N (2-tert-butyl-4,6-dinitrophenyl) acetate Chemical compound CC(=O)OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1C(C)(C)C BMJYKXALMDAIEG-UHFFFAOYSA-N 0.000 description 1
- ADDQHLREJDZPMT-CQSZACIVSA-N (2R)-2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]-N-(2-fluorophenyl)-N-methylpropanamide Chemical compound O=C([C@H](OC=1C=CC(OC=2OC3=CC(Cl)=CC=C3N=2)=CC=1)C)N(C)C1=CC=CC=C1F ADDQHLREJDZPMT-CQSZACIVSA-N 0.000 description 1
- GOCUAJYOYBLQRH-MRVPVSSYSA-N (2S)-2-(4-{[3-CHLORO-5-(TRIFLUOROMETHYL)PYRIDIN-2-YL]OXY}PHENOXY)PROPANOIC ACID Chemical compound C1=CC(O[C@H](C)C(O)=O)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl GOCUAJYOYBLQRH-MRVPVSSYSA-N 0.000 description 1
- GGQDJKYTNRIKQS-UHFFFAOYSA-N (4-cyano-2,6-diiodophenyl) prop-2-enyl carbonate Chemical compound IC1=CC(C#N)=CC(I)=C1OC(=O)OCC=C GGQDJKYTNRIKQS-UHFFFAOYSA-N 0.000 description 1
- OYIKARCXOQLFHF-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]methanone Chemical compound CS(=O)(=O)C1=CC(C(F)(F)F)=CC=C1C(=O)C1=C(C2CC2)ON=C1 OYIKARCXOQLFHF-UHFFFAOYSA-N 0.000 description 1
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 description 1
- UKSLKNUCVPZQCQ-GZTJUZNOSA-N (E)-1-(4-chlorophenyl)-N-(1,3-dioxolan-2-ylmethoxy)-2,2,2-trifluoroethanimine Chemical compound C=1C=C(Cl)C=CC=1/C(C(F)(F)F)=N\OCC1OCCO1 UKSLKNUCVPZQCQ-GZTJUZNOSA-N 0.000 description 1
- JLYFCTQDENRSOL-VIFPVBQESA-N (S)-dimethenamid Chemical compound COC[C@H](C)N(C(=O)CCl)C=1C(C)=CSC=1C JLYFCTQDENRSOL-VIFPVBQESA-N 0.000 description 1
- WVQBLGZPHOPPFO-LBPRGKRZSA-N (S)-metolachlor Chemical compound CCC1=CC=CC(C)=C1N([C@@H](C)COC)C(=O)CCl WVQBLGZPHOPPFO-LBPRGKRZSA-N 0.000 description 1
- RRLHZVASKJLNFJ-UPHRSURJSA-N (Z)-2,3,5,5,5-pentachloro-4-oxopent-2-enoic acid Chemical compound OC(=O)C(\Cl)=C(\Cl)C(=O)C(Cl)(Cl)Cl RRLHZVASKJLNFJ-UPHRSURJSA-N 0.000 description 1
- PYKLUAIDKVVEOS-JLHYYAGUSA-N (Z)-N-(cyanomethoxy)benzenecarboximidoyl cyanide Chemical compound N#CCO\N=C(/C#N)C1=CC=CC=C1 PYKLUAIDKVVEOS-JLHYYAGUSA-N 0.000 description 1
- OVXMBIVWNJDDSM-UHFFFAOYSA-N (benzhydrylideneamino) 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate Chemical compound COC1=CC(OC)=NC(OC=2C(=C(OC=3N=C(OC)C=C(OC)N=3)C=CC=2)C(=O)ON=C(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 OVXMBIVWNJDDSM-UHFFFAOYSA-N 0.000 description 1
- IBHCSFXTRODDNR-ZDUSSCGKSA-N (propan-2-ylideneamino) (2S)-2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate Chemical compound C1=CC(O[C@@H](C)C(=O)ON=C(C)C)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 IBHCSFXTRODDNR-ZDUSSCGKSA-N 0.000 description 1
- 229920000160 (ribonucleotides)n+m Polymers 0.000 description 1
- MCNOFYBITGAAGM-UHFFFAOYSA-N (±)-Furilazole Chemical compound C1N(C(=O)C(Cl)Cl)C(C)(C)OC1C1=CC=CO1 MCNOFYBITGAAGM-UHFFFAOYSA-N 0.000 description 1
- FCAKZZMVXCLLHM-UHFFFAOYSA-N 1,1-dimethyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]urea Chemical compound CN(C)C(=O)NC1=CC=CC(OC(F)(F)C(F)F)=C1 FCAKZZMVXCLLHM-UHFFFAOYSA-N 0.000 description 1
- MVHWKYHDYCGNQN-UHFFFAOYSA-N 1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)benzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=C(F)C=C(Cl)C=C1Cl MVHWKYHDYCGNQN-UHFFFAOYSA-N 0.000 description 1
- IHSBKMBNDURWAT-UHFFFAOYSA-N 1-(1,1,4-trimethyl-6-propan-2-yl-2,3-dihydroinden-5-yl)propan-1-one Chemical compound C1=C(C(C)C)C(C(=O)CC)=C(C)C2=C1C(C)(C)CC2 IHSBKMBNDURWAT-UHFFFAOYSA-N 0.000 description 1
- DHYXNIKICPUXJI-UHFFFAOYSA-N 1-(2,4-dichlorophenyl)-N-(2,4-difluorophenyl)-5-oxo-N-propan-2-yl-1,2,4-triazole-4-carboxamide Chemical compound C=1C=C(F)C=C(F)C=1N(C(C)C)C(=O)N(C1=O)C=NN1C1=CC=C(Cl)C=C1Cl DHYXNIKICPUXJI-UHFFFAOYSA-N 0.000 description 1
- PYCINWWWERDNKE-UHFFFAOYSA-N 1-(2-chloro-6-propylimidazo[1,2-b]pyridazin-3-yl)sulfonyl-3-(4,6-dimethoxypyrimidin-2-yl)urea Chemical compound N12N=C(CCC)C=CC2=NC(Cl)=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 PYCINWWWERDNKE-UHFFFAOYSA-N 0.000 description 1
- VJYIFXVZLXQVHO-UHFFFAOYSA-N 1-(2-chlorophenyl)sulfonyl-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)Cl)=N1 VJYIFXVZLXQVHO-UHFFFAOYSA-N 0.000 description 1
- GUGLRTKPJBGNAF-UHFFFAOYSA-N 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-methylurea Chemical compound CNC(=O)NC=1C=C(C(C)(C)C)ON=1 GUGLRTKPJBGNAF-UHFFFAOYSA-N 0.000 description 1
- KOKBUARVIJVMMM-UHFFFAOYSA-N 1-amino-3-(2,2-dimethylpropyl)-6-ethylsulfanyl-1,3,5-triazine-2,4-dione Chemical compound CCSC1=NC(=O)N(CC(C)(C)C)C(=O)N1N KOKBUARVIJVMMM-UHFFFAOYSA-N 0.000 description 1
- WLKSPGHQGFFKGE-UHFFFAOYSA-N 1-chloropropan-2-yl N-(3-chlorophenyl)carbamate Chemical compound ClCC(C)OC(=O)NC1=CC=CC(Cl)=C1 WLKSPGHQGFFKGE-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- QZEKHJXYZSJVCL-UHFFFAOYSA-N 2,2,3-trichloropropanoic acid Chemical compound OC(=O)C(Cl)(Cl)CCl QZEKHJXYZSJVCL-UHFFFAOYSA-N 0.000 description 1
- ZAWPDPLWGKAAHU-UHFFFAOYSA-N 2,2-dichloro-N-[2-oxo-2-(prop-2-enylamino)ethyl]-N-prop-2-enylacetamide Chemical compound ClC(Cl)C(=O)N(CC=C)CC(=O)NCC=C ZAWPDPLWGKAAHU-UHFFFAOYSA-N 0.000 description 1
- NEBPTMCRLHKPOB-UHFFFAOYSA-N 2,2-diphenylacetonitrile Chemical compound C=1C=CC=CC=1C(C#N)C1=CC=CC=C1 NEBPTMCRLHKPOB-UHFFFAOYSA-N 0.000 description 1
- YIVXMZJTEQBPQO-UHFFFAOYSA-N 2,4-DB Chemical compound OC(=O)CCCOC1=CC=C(Cl)C=C1Cl YIVXMZJTEQBPQO-UHFFFAOYSA-N 0.000 description 1
- PSOZMUMWCXLRKX-UHFFFAOYSA-N 2,4-dinitro-6-pentan-2-ylphenol Chemical compound CCCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O PSOZMUMWCXLRKX-UHFFFAOYSA-N 0.000 description 1
- CZRVDACSCJKRFL-UHFFFAOYSA-N 2,5-dimethyl-4-[2-methylsulfonyl-4-(trifluoromethyl)benzoyl]-1H-pyrazol-3-one Chemical compound N1N(C)C(=O)C(C(=O)C=2C(=CC(=CC=2)C(F)(F)F)S(C)(=O)=O)=C1C CZRVDACSCJKRFL-UHFFFAOYSA-N 0.000 description 1
- XJPOOEMIUDHWSO-UHFFFAOYSA-N 2,5-dimethyl-N-phenylpyrrolidine-1-carboxamide Chemical compound CC1CCC(C)N1C(=O)NC1=CC=CC=C1 XJPOOEMIUDHWSO-UHFFFAOYSA-N 0.000 description 1
- YOYAIZYFCNQIRF-UHFFFAOYSA-N 2,6-Dichlorobenzonitrile Chemical compound ClC1=CC=CC(Cl)=C1C#N YOYAIZYFCNQIRF-UHFFFAOYSA-N 0.000 description 1
- IUQJDHJVPLLKFL-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)acetate;dimethylazanium Chemical compound CNC.OC(=O)COC1=CC=C(Cl)C=C1Cl IUQJDHJVPLLKFL-UHFFFAOYSA-N 0.000 description 1
- PKAUICCNAWQPAU-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)acetic acid;N-methylmethanamine Chemical compound CNC.CC1=CC(Cl)=CC=C1OCC(O)=O PKAUICCNAWQPAU-UHFFFAOYSA-N 0.000 description 1
- LVKBXDHACCFCTA-UHFFFAOYSA-N 2-(ethylsulfonylamino)-5-fluoro-4-[4-methyl-5-oxo-3-(trifluoromethyl)-1,2,4-triazol-1-yl]benzenecarbothioamide Chemical compound C1=C(C(N)=S)C(NS(=O)(=O)CC)=CC(N2C(N(C)C(=N2)C(F)(F)F)=O)=C1F LVKBXDHACCFCTA-UHFFFAOYSA-N 0.000 description 1
- VTNQPKFIQCLBDU-UHFFFAOYSA-N 2-Chloro-N-(ethoxymethyl)-6'-ethyl-o-acetotoluidide Chemical compound CCOCN(C(=O)CCl)C1=C(C)C=CC=C1CC VTNQPKFIQCLBDU-UHFFFAOYSA-N 0.000 description 1
- YFONKFDEZLYQDH-BOURZNODSA-N 2-N-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-6-(1-fluoroethyl)-1,3,5-triazine-2,4-diamine Chemical compound CC(F)C1=NC(N)=NC(N[C@H]2C3=CC(C)=CC=C3C[C@@H]2C)=N1 YFONKFDEZLYQDH-BOURZNODSA-N 0.000 description 1
- IUFUITYPUYMIHI-UHFFFAOYSA-N 2-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-6-(2-fluoropropan-2-yl)-1,3,5-triazine-2,4-diamine Chemical compound N=1C(N)=NC(C(C)(C)F)=NC=1NC(C)COC1=CC(C)=CC(C)=C1 IUFUITYPUYMIHI-UHFFFAOYSA-N 0.000 description 1
- MAYMYMXYWIVVOK-UHFFFAOYSA-N 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoic acid Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=C(CNS(C)(=O)=O)C=2)C(O)=O)=N1 MAYMYMXYWIVVOK-UHFFFAOYSA-N 0.000 description 1
- UCDPMNSCCRBWIC-UHFFFAOYSA-N 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoylamino]-N,N-dimethylbenzamide Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)NC=2C(=CC=CC=2)C(=O)N(C)C)=N1 UCDPMNSCCRBWIC-UHFFFAOYSA-N 0.000 description 1
- IRJQWZWMQCVOLA-DNTJNYDQSA-N 2-[(E)-N-[(3,5-difluorophenyl)carbamoylamino]-C-methylcarbonimidoyl]pyridine-3-carboxylic acid Chemical compound N=1C=CC=C(C(O)=O)C=1C(/C)=N/NC(=O)NC1=CC(F)=CC(F)=C1 IRJQWZWMQCVOLA-DNTJNYDQSA-N 0.000 description 1
- PHXHZCIAPNNPTQ-JUFJSZMKSA-N 2-[1-[[(E)-3-chloroprop-2-enoxy]amino]propylidene]-5-(oxan-4-yl)cyclohexane-1,3-dione Chemical compound C1C(=O)C(=C(NOC\C=C\Cl)CC)C(=O)CC1C1CCOCC1 PHXHZCIAPNNPTQ-JUFJSZMKSA-N 0.000 description 1
- OVQJTYOXWVHPTA-UHFFFAOYSA-N 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-3-amine Chemical compound NC1=C([N+]([O-])=O)C=NN1C1=C(Cl)C=C(C(F)(F)F)C=C1Cl OVQJTYOXWVHPTA-UHFFFAOYSA-N 0.000 description 1
- IUQAXCIUEPFPSF-UHFFFAOYSA-N 2-[2-chloro-4-methylsulfonyl-3-(2,2,2-trifluoroethoxymethyl)benzoyl]cyclohexane-1,3-dione Chemical compound ClC1=C(COCC(F)(F)F)C(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O IUQAXCIUEPFPSF-UHFFFAOYSA-N 0.000 description 1
- UFAPVJDEYHLLBG-UHFFFAOYSA-N 2-[2-chloro-4-methylsulfonyl-3-(oxolan-2-ylmethoxymethyl)benzoyl]cyclohexane-1,3-dione Chemical compound ClC1=C(COCC2OCCC2)C(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O UFAPVJDEYHLLBG-UHFFFAOYSA-N 0.000 description 1
- ZHKWNOGSHWXSDY-UHFFFAOYSA-N 2-[4-[(4-chlorophenyl)methoxy]phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound C1=CC(Cl)=CC=C1COC1=CC=C(N2C(C3=C(CCCC3)C2=O)=O)C=C1 ZHKWNOGSHWXSDY-UHFFFAOYSA-N 0.000 description 1
- RCOHXZITQFQFRZ-UHFFFAOYSA-N 2-[N-[2-(3,5-dichloro-2-methoxybenzoyl)oxyethyl]anilino]ethyl 3,6-dichloro-2-methoxybenzoate Chemical compound COC1=C(Cl)C=C(Cl)C=C1C(=O)OCCN(C=1C=CC=CC=1)CCOC(=O)C1=C(Cl)C=CC(Cl)=C1OC RCOHXZITQFQFRZ-UHFFFAOYSA-N 0.000 description 1
- WUZNHSBFPPFULJ-UHFFFAOYSA-N 2-[[4-chloro-6-(cyclopropylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile Chemical compound N#CC(C)(C)NC1=NC(Cl)=NC(NC2CC2)=N1 WUZNHSBFPPFULJ-UHFFFAOYSA-N 0.000 description 1
- ZBMRKNMTMPPMMK-UHFFFAOYSA-N 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;azane Chemical compound [NH4+].CP(O)(=O)CCC(N)C([O-])=O ZBMRKNMTMPPMMK-UHFFFAOYSA-N 0.000 description 1
- WDRGQGLIUAMOOC-UHFFFAOYSA-N 2-benzamidooxyacetic acid Chemical compound OC(=O)CONC(=O)C1=CC=CC=C1 WDRGQGLIUAMOOC-UHFFFAOYSA-N 0.000 description 1
- IVDRCZNHVGQBHZ-UHFFFAOYSA-N 2-butoxyethyl 2-(3,5,6-trichloropyridin-2-yl)oxyacetate Chemical group CCCCOCCOC(=O)COC1=NC(Cl)=C(Cl)C=C1Cl IVDRCZNHVGQBHZ-UHFFFAOYSA-N 0.000 description 1
- ZGGSVBWJVIXBHV-UHFFFAOYSA-N 2-chloro-1-(4-nitrophenoxy)-4-(trifluoromethyl)benzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(C(F)(F)F)C=C1Cl ZGGSVBWJVIXBHV-UHFFFAOYSA-N 0.000 description 1
- GNHDVXLWBQYPJE-UHFFFAOYSA-N 2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-N-[methyl(propan-2-yl)sulfamoyl]benzamide Chemical compound C1=C(Cl)C(C(=O)NS(=O)(=O)N(C)C(C)C)=CC(N2C(N(C)C(=CC2=O)C(F)(F)F)=O)=C1F GNHDVXLWBQYPJE-UHFFFAOYSA-N 0.000 description 1
- DDBMQDADIHOWIC-UHFFFAOYSA-N 2-chloro-6-nitro-3-phenoxyaniline Chemical compound C1=C([N+]([O-])=O)C(N)=C(Cl)C(OC=2C=CC=CC=2)=C1 DDBMQDADIHOWIC-UHFFFAOYSA-N 0.000 description 1
- UDRNNGBAXFCBLJ-UHFFFAOYSA-N 2-chloro-N-(2,3-dimethylphenyl)-N-propan-2-ylacetamide Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC(C)=C1C UDRNNGBAXFCBLJ-UHFFFAOYSA-N 0.000 description 1
- KZNDFYDURHAESM-UHFFFAOYSA-N 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(propan-2-yloxymethyl)acetamide Chemical compound CCC1=CC=CC(C)=C1N(COC(C)C)C(=O)CCl KZNDFYDURHAESM-UHFFFAOYSA-N 0.000 description 1
- IRCMYGHHKLLGHV-UHFFFAOYSA-N 2-ethoxy-3,3-dimethyl-2,3-dihydro-1-benzofuran-5-yl methanesulfonate Chemical compound C1=C(OS(C)(=O)=O)C=C2C(C)(C)C(OCC)OC2=C1 IRCMYGHHKLLGHV-UHFFFAOYSA-N 0.000 description 1
- FYEWDLAVQKIKQE-UHFFFAOYSA-N 2-methyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazinane-3,5-dione Chemical compound O=C1N(C)OCC(=O)N1C1=CC=CC(C(F)(F)F)=C1 FYEWDLAVQKIKQE-UHFFFAOYSA-N 0.000 description 1
- HTTLBYITFHMYFK-UHFFFAOYSA-N 2-phenyl-3,1-benzoxazin-4-one Chemical compound N=1C2=CC=CC=C2C(=O)OC=1C1=CC=CC=C1 HTTLBYITFHMYFK-UHFFFAOYSA-N 0.000 description 1
- WCYYAQFQZQEUEN-UHFFFAOYSA-N 3,5,6-trichloropyridine-2-one Chemical compound ClC=1C=C(Cl)C(=O)NC=1Cl WCYYAQFQZQEUEN-UHFFFAOYSA-N 0.000 description 1
- YRSSHOVRSMQULE-UHFFFAOYSA-N 3,5-dichloro-4-hydroxybenzonitrile Chemical compound OC1=C(Cl)C=C(C#N)C=C1Cl YRSSHOVRSMQULE-UHFFFAOYSA-N 0.000 description 1
- YKYGJHGXTSEGDB-UHFFFAOYSA-N 3-(3-chloro-4-ethoxyphenyl)-1,1-dimethylurea Chemical compound CCOC1=CC=C(NC(=O)N(C)C)C=C1Cl YKYGJHGXTSEGDB-UHFFFAOYSA-N 0.000 description 1
- YFEUKKUPOVGUIW-UHFFFAOYSA-N 3-[3-chloro-4-[chloro(difluoro)methyl]sulfanylphenyl]-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=C(SC(F)(F)Cl)C(Cl)=C1 YFEUKKUPOVGUIW-UHFFFAOYSA-N 0.000 description 1
- WYJOEQHHWHAJRB-UHFFFAOYSA-N 3-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]oxolane Chemical compound C1=C(OC2COCC2)C([N+](=O)[O-])=CC=C1OC1=CC=C(C(F)(F)F)C=C1Cl WYJOEQHHWHAJRB-UHFFFAOYSA-N 0.000 description 1
- CASLETQIYIQFTQ-UHFFFAOYSA-N 3-[[5-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylsulfonyl]-5,5-dimethyl-4H-1,2-oxazole Chemical compound CN1N=C(C(F)(F)F)C(CS(=O)(=O)C=2CC(C)(C)ON=2)=C1OC(F)F CASLETQIYIQFTQ-UHFFFAOYSA-N 0.000 description 1
- SOPHXJOERHTMIL-UHFFFAOYSA-N 3-methyl-4,6-dinitro-2-propan-2-ylphenol Chemical compound CC(C)C1=C(C)C([N+]([O-])=O)=CC([N+]([O-])=O)=C1O SOPHXJOERHTMIL-UHFFFAOYSA-N 0.000 description 1
- NEFZKJCNHBXWLP-UHFFFAOYSA-N 4,5-dimethoxy-2-phenylpyridazin-3-one Chemical compound O=C1C(OC)=C(OC)C=NN1C1=CC=CC=C1 NEFZKJCNHBXWLP-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- BPPVUXSMLBXYGG-UHFFFAOYSA-N 4-[3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoyl]-2-methyl-1H-pyrazol-3-one Chemical compound CC1=C(C(=O)C=2C(N(C)NC=2)=O)C=CC(S(C)(=O)=O)=C1C1=NOCC1 BPPVUXSMLBXYGG-UHFFFAOYSA-N 0.000 description 1
- ADZSGNDOZREKJK-UHFFFAOYSA-N 4-amino-6-tert-butyl-3-ethylsulfanyl-1,2,4-triazin-5-one Chemical compound CCSC1=NN=C(C(C)(C)C)C(=O)N1N ADZSGNDOZREKJK-UHFFFAOYSA-N 0.000 description 1
- ORFPWVRKFLOQHK-UHFFFAOYSA-N 4-amino-N-tert-butyl-5-oxo-3-propan-2-yl-1,2,4-triazole-1-carboxamide Chemical compound CC(C)C1=NN(C(=O)NC(C)(C)C)C(=O)N1N ORFPWVRKFLOQHK-UHFFFAOYSA-N 0.000 description 1
- CYQMVKQKBFFDOO-UHFFFAOYSA-N 4-chloro-5-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one Chemical compound O=C1C(Cl)=C(N(C)C)C=NN1C1=CC=CC(C(F)(F)F)=C1 CYQMVKQKBFFDOO-UHFFFAOYSA-N 0.000 description 1
- APOAEMIYHVGWEZ-UHFFFAOYSA-N 4-chloroisoindole-1,3-dione Chemical compound ClC1=CC=CC2=C1C(=O)NC2=O APOAEMIYHVGWEZ-UHFFFAOYSA-N 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N 4H-1,2,4-triazol-3-amine Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- NUPJIGQFXCQJBK-UHFFFAOYSA-N 5-(methoxymethyl)-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC(COC)=CN=C1C1=NC(C)(C(C)C)C(=O)N1 NUPJIGQFXCQJBK-UHFFFAOYSA-N 0.000 description 1
- NYRMIJKDBAQCHC-UHFFFAOYSA-N 5-(methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3-one Chemical compound O1C(NC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 NYRMIJKDBAQCHC-UHFFFAOYSA-N 0.000 description 1
- OPEJGICLTMWFNQ-UHFFFAOYSA-N 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-(3-methylthiophen-2-yl)-4H-1,2-oxazole Chemical compound C1=CSC(C=2CC(C)(COCC=3C(=CC=CC=3F)F)ON=2)=C1C OPEJGICLTMWFNQ-UHFFFAOYSA-N 0.000 description 1
- QQOGZMUZAZWLJH-UHFFFAOYSA-N 5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-N-ethylsulfonyl-2-nitrobenzamide Chemical compound C1=C([N+]([O-])=O)C(C(=O)NS(=O)(=O)CC)=CC(OC=2C(=CC(=CC=2F)C(F)(F)F)Cl)=C1 QQOGZMUZAZWLJH-UHFFFAOYSA-N 0.000 description 1
- ODNZLRLWXRXPOH-UHFFFAOYSA-N 5-amino-4-bromo-2-phenylpyridazin-3-one Chemical compound O=C1C(Br)=C(N)C=NN1C1=CC=CC=C1 ODNZLRLWXRXPOH-UHFFFAOYSA-N 0.000 description 1
- DVOODWOZJVJKQR-UHFFFAOYSA-N 5-tert-butyl-3-(2,4-dichloro-5-prop-2-ynoxyphenyl)-1,3,4-oxadiazol-2-one Chemical group O=C1OC(C(C)(C)C)=NN1C1=CC(OCC#C)=C(Cl)C=C1Cl DVOODWOZJVJKQR-UHFFFAOYSA-N 0.000 description 1
- QHXDTLYEHWXDSO-UHFFFAOYSA-N 6-chloro-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine Chemical compound CCN(CC)C1=NC(Cl)=NC(N(CC)CC)=N1 QHXDTLYEHWXDSO-UHFFFAOYSA-N 0.000 description 1
- ZUSHSDOEVHPTCU-UHFFFAOYSA-N 6-chloro-3-phenyl-1H-pyridazin-4-one Chemical compound N1C(Cl)=CC(=O)C(C=2C=CC=CC=2)=N1 ZUSHSDOEVHPTCU-UHFFFAOYSA-N 0.000 description 1
- PMYBBBROJPQQQV-UHFFFAOYSA-N 6-chloro-4-N-(3-methoxypropyl)-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine Chemical compound COCCCNC1=NC(Cl)=NC(NC(C)C)=N1 PMYBBBROJPQQQV-UHFFFAOYSA-N 0.000 description 1
- UCOIYRGMDBGBOU-UHFFFAOYSA-N 6-chloro-4-N-propan-2-ylpyrimidine-2,4-diamine Chemical compound CC(C)NC1=CC(Cl)=NC(N)=N1 UCOIYRGMDBGBOU-UHFFFAOYSA-N 0.000 description 1
- QQRJUWIHLNBDQF-UHFFFAOYSA-N 6-chloro-5-methylsulfanylpyrimidine-2,4-diamine Chemical compound CSC1=C(N)N=C(N)N=C1Cl QQRJUWIHLNBDQF-UHFFFAOYSA-N 0.000 description 1
- HVHHQHTXTGUMSR-UHFFFAOYSA-N 6-tert-butyl-3-(dimethylamino)-4-methyl-1,2,4-triazin-5-one Chemical compound CN(C)C1=NN=C(C(C)(C)C)C(=O)N1C HVHHQHTXTGUMSR-UHFFFAOYSA-N 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- NUFNQYOELLVIPL-UHFFFAOYSA-N Acifluorfen Chemical compound C1=C([N+]([O-])=O)C(C(=O)O)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 NUFNQYOELLVIPL-UHFFFAOYSA-N 0.000 description 1
- 239000002890 Aclonifen Substances 0.000 description 1
- 241000209136 Agropyron Species 0.000 description 1
- XCSGPAVHZFQHGE-UHFFFAOYSA-N Alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 description 1
- 241000748223 Alisma Species 0.000 description 1
- MDBGGTQNNUOQRC-UHFFFAOYSA-N Allidochlor Chemical compound ClCC(=O)N(CC=C)CC=C MDBGGTQNNUOQRC-UHFFFAOYSA-N 0.000 description 1
- 241000743985 Alopecurus Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- PZZYQPZGQPZBDN-UHFFFAOYSA-N Aluminium silicate Chemical compound O=[Al]O[Si](=O)O[Al]=O PZZYQPZGQPZBDN-UHFFFAOYSA-N 0.000 description 1
- 239000003666 Amidosulfuron Substances 0.000 description 1
- CTTHWASMBLQOFR-UHFFFAOYSA-N Amidosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)=N1 CTTHWASMBLQOFR-UHFFFAOYSA-N 0.000 description 1
- 239000005468 Aminopyralid Substances 0.000 description 1
- NIXXQNOQHKNPEJ-UHFFFAOYSA-N Aminopyralid Chemical compound NC1=CC(Cl)=NC(C(O)=O)=C1Cl NIXXQNOQHKNPEJ-UHFFFAOYSA-N 0.000 description 1
- NXQDBZGWYSEGFL-UHFFFAOYSA-N Anilofos Chemical compound COP(=S)(OC)SCC(=O)N(C(C)C)C1=CC=C(Cl)C=C1 NXQDBZGWYSEGFL-UHFFFAOYSA-N 0.000 description 1
- 108020005544 Antisense RNA Proteins 0.000 description 1
- 241001666377 Apera Species 0.000 description 1
- 235000003826 Artemisia Nutrition 0.000 description 1
- 240000003325 Artemisia Species 0.000 description 1
- 235000003261 Artemisia vulgaris Nutrition 0.000 description 1
- VGPYEHKOIGNJKV-UHFFFAOYSA-N Asulam Chemical compound COC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 VGPYEHKOIGNJKV-UHFFFAOYSA-N 0.000 description 1
- MXWJVTOOROXGIU-UHFFFAOYSA-N Atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- XOEMATDHVZOBSG-UHFFFAOYSA-N Azafenidin Chemical compound C1=C(OCC#C)C(Cl)=CC(Cl)=C1N1C(=O)N2CCCCC2=N1 XOEMATDHVZOBSG-UHFFFAOYSA-N 0.000 description 1
- 239000005469 Azimsulfuron Substances 0.000 description 1
- MAHPNPYYQAIOJN-UHFFFAOYSA-N Azimsulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2N(N=CC=2C2=NN(C)N=N2)C)=N1 MAHPNPYYQAIOJN-UHFFFAOYSA-N 0.000 description 1
- AFIIBUOYKYSPKB-UHFFFAOYSA-N Aziprotryne Chemical compound CSC1=NC(NC(C)C)=NC(N=[N+]=[N-])=N1 AFIIBUOYKYSPKB-UHFFFAOYSA-N 0.000 description 1
- 241000193388 Bacillus thuringiensis Species 0.000 description 1
- 229940097012 Bacillus thuringiensis Drugs 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 239000005470 Beflubutamid Substances 0.000 description 1
- 239000005471 Benfluralin Substances 0.000 description 1
- SMDHCQAYESWHAE-UHFFFAOYSA-N Benfluralin Chemical compound CCCCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O SMDHCQAYESWHAE-UHFFFAOYSA-N 0.000 description 1
- PFJJMJDEVDLPNE-UHFFFAOYSA-N Benoxacor Chemical compound C1=CC=C2N(C(=O)C(Cl)Cl)C(C)COC2=C1 PFJJMJDEVDLPNE-UHFFFAOYSA-N 0.000 description 1
- 239000005472 Bensulfuron methyl Substances 0.000 description 1
- XMQFTWRPUQYINF-UHFFFAOYSA-N Bensulfuron methyl Chemical group COC(=O)C1=CC=CC=C1CS(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 XMQFTWRPUQYINF-UHFFFAOYSA-N 0.000 description 1
- RRNIZKPFKNDSRS-UHFFFAOYSA-N Bensulide Chemical compound CC(C)OP(=S)(OC(C)C)SCCNS(=O)(=O)C1=CC=CC=C1 RRNIZKPFKNDSRS-UHFFFAOYSA-N 0.000 description 1
- ZOMSMJKLGFBRBS-UHFFFAOYSA-N Bentazon Chemical compound C1=CC=C2NS(=O)(=O)N(C(C)C)C(=O)C2=C1 ZOMSMJKLGFBRBS-UHFFFAOYSA-N 0.000 description 1
- 239000005476 Bentazone Substances 0.000 description 1
- QHTQREMOGMZHJV-UHFFFAOYSA-N Benthiocarb Chemical compound CCN(CC)C(=O)SCC1=CC=C(Cl)C=C1 QHTQREMOGMZHJV-UHFFFAOYSA-N 0.000 description 1
- JDWQITFHZOBBFE-UHFFFAOYSA-N Benzofenap Chemical compound C=1C=C(Cl)C(C)=C(Cl)C=1C(=O)C=1C(C)=NN(C)C=1OCC(=O)C1=CC=C(C)C=C1 JDWQITFHZOBBFE-UHFFFAOYSA-N 0.000 description 1
- SLCGUGMPSUYJAY-UHFFFAOYSA-N Benzoylprop-ethyl Chemical group C=1C=C(Cl)C(Cl)=CC=1N(C(C)C(=O)OCC)C(=O)C1=CC=CC=C1 SLCGUGMPSUYJAY-UHFFFAOYSA-N 0.000 description 1
- DTCJYIIKPVRVDD-UHFFFAOYSA-N Benzthiazuron Chemical compound C1=CC=C2SC(NC(=O)NC)=NC2=C1 DTCJYIIKPVRVDD-UHFFFAOYSA-N 0.000 description 1
- 235000010662 Bidens pilosa Nutrition 0.000 description 1
- 240000001032 Bidens pilosa Species 0.000 description 1
- 239000005484 Bifenox Substances 0.000 description 1
- SUSRORUBZHMPCO-UHFFFAOYSA-N Bifenox Chemical compound C1=C([N+]([O-])=O)C(C(=O)OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 SUSRORUBZHMPCO-UHFFFAOYSA-N 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- CTSLUCNDVMMDHG-UHFFFAOYSA-N Bromacil Chemical compound CCC(C)N1C(=O)NC(C)=C(Br)C1=O CTSLUCNDVMMDHG-UHFFFAOYSA-N 0.000 description 1
- XTFNPKDYCLFGPV-OMCISZLKSA-N Bromofenoxim Chemical compound C1=C(Br)C(O)=C(Br)C=C1\C=N\OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O XTFNPKDYCLFGPV-OMCISZLKSA-N 0.000 description 1
- 239000005489 Bromoxynil Substances 0.000 description 1
- UPMXNNIRAGDFEH-UHFFFAOYSA-N Bromoxynil Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 1
- 244000157790 Buglossoides arvense Species 0.000 description 1
- 235000004256 Buglossoides arvense Nutrition 0.000 description 1
- HKPHPIREJKHECO-UHFFFAOYSA-N Butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 description 1
- SWMGXKSQWDSBKV-UHFFFAOYSA-N Buthidazole Chemical compound O=C1N(C)CC(O)N1C1=NN=C(C(C)(C)C)S1 SWMGXKSQWDSBKV-UHFFFAOYSA-N 0.000 description 1
- ZOGDSYNXUXQGHF-XIEYBQDHSA-N Butroxydim Chemical compound CCCC(=O)C1=C(C)C=C(C)C(C2CC(=O)C(\C(CC)=N\OCC)=C(O)C2)=C1C ZOGDSYNXUXQGHF-XIEYBQDHSA-N 0.000 description 1
- BYYMILHAKOURNM-UHFFFAOYSA-N Buturon Chemical compound C#CC(C)N(C)C(=O)NC1=CC=C(Cl)C=C1 BYYMILHAKOURNM-UHFFFAOYSA-N 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- RVGRUAULSDPKGF-UHFFFAOYSA-N C1CO1.CC1CO1 Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 description 1
- UYISBQRLYUMVPG-UHFFFAOYSA-N CCCONNC(=O)N=N Chemical compound CCCONNC(=O)N=N UYISBQRLYUMVPG-UHFFFAOYSA-N 0.000 description 1
- HFEJHAAIJZXXRE-UHFFFAOYSA-N Cafenstrole Chemical compound CCN(CC)C(=O)N1C=NC(S(=O)(=O)C=2C(=CC(C)=CC=2C)C)=N1 HFEJHAAIJZXXRE-UHFFFAOYSA-N 0.000 description 1
- 235000011305 Capsella bursa pastoris Nutrition 0.000 description 1
- 240000008867 Capsella bursa-pastoris Species 0.000 description 1
- 239000005490 Carbetamide Substances 0.000 description 1
- 239000005492 Carfentrazone-ethyl Substances 0.000 description 1
- MLKCGVHIFJBRCD-UHFFFAOYSA-N Carfentrazone-ethyl Chemical group C1=C(Cl)C(CC(Cl)C(=O)OCC)=CC(N2C(N(C(F)F)C(C)=N2)=O)=C1F MLKCGVHIFJBRCD-UHFFFAOYSA-N 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- DXXVCXKMSWHGTF-UHFFFAOYSA-N Chlomethoxyfen Chemical compound C1=C([N+]([O-])=O)C(OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 DXXVCXKMSWHGTF-UHFFFAOYSA-N 0.000 description 1
- HSSBORCLYSCBJR-UHFFFAOYSA-N Chloramben Chemical compound NC1=CC(Cl)=CC(C(O)=O)=C1Cl HSSBORCLYSCBJR-UHFFFAOYSA-N 0.000 description 1
- VCBRBUKGTWLJOB-UHFFFAOYSA-N Chloranocryl Chemical compound CC(=C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 VCBRBUKGTWLJOB-UHFFFAOYSA-N 0.000 description 1
- NLYNUTMZTCLNOO-UHFFFAOYSA-N Chlorbromuron Chemical compound CON(C)C(=O)NC1=CC=C(Br)C(Cl)=C1 NLYNUTMZTCLNOO-UHFFFAOYSA-N 0.000 description 1
- ULBXWWGWDPVHAO-UHFFFAOYSA-N Chlorbufam Chemical compound C#CC(C)OC(=O)NC1=CC=CC(Cl)=C1 ULBXWWGWDPVHAO-UHFFFAOYSA-N 0.000 description 1
- QZXCCPZJCKEPSA-UHFFFAOYSA-N Chlorfenac Chemical compound OC(=O)CC1=C(Cl)C=CC(Cl)=C1Cl QZXCCPZJCKEPSA-UHFFFAOYSA-N 0.000 description 1
- YJKIALIXRCSISK-UHFFFAOYSA-N Chlorfenprop-methyl Chemical group COC(=O)C(Cl)CC1=CC=C(Cl)C=C1 YJKIALIXRCSISK-UHFFFAOYSA-N 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N Chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- IUNBHEGRIBDSIH-UHFFFAOYSA-N Chloroxuron Chemical compound CN(C)C(=O)NC1=CC=CC(OC=2C=CC(Cl)=CC=2)=C1 IUNBHEGRIBDSIH-UHFFFAOYSA-N 0.000 description 1
- 239000005647 Chlorpropham Substances 0.000 description 1
- CWJSHJJYOPWUGX-UHFFFAOYSA-N Chlorpropham Chemical compound CC(C)OC(=O)NC1=CC=CC(Cl)=C1 CWJSHJJYOPWUGX-UHFFFAOYSA-N 0.000 description 1
- 239000005496 Chlorsulfuron Substances 0.000 description 1
- KZCBXHSWMMIEQU-UHFFFAOYSA-N Chlorthal Chemical compound OC(=O)C1=C(Cl)C(Cl)=C(C(O)=O)C(Cl)=C1Cl KZCBXHSWMMIEQU-UHFFFAOYSA-N 0.000 description 1
- KGKGSIUWJCAFPX-UHFFFAOYSA-N Chlorthiamide Chemical compound NC(=S)C1=C(Cl)C=CC=C1Cl KGKGSIUWJCAFPX-UHFFFAOYSA-N 0.000 description 1
- JXCGFZXSOMJFOA-UHFFFAOYSA-N Chlortoluron Chemical compound CN(C)C(=O)NC1=CC=C(C)C(Cl)=C1 JXCGFZXSOMJFOA-UHFFFAOYSA-N 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- 235000000604 Chrysanthemum parthenium Nutrition 0.000 description 1
- QMTNOLKHSWIQBE-FGTMMUONSA-N Cinmethylin Chemical compound O([C@H]1[C@]2(C)CC[C@@](O2)(C1)C(C)C)CC1=CC=CC=C1C QMTNOLKHSWIQBE-FGTMMUONSA-N 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- 239000005497 Clethodim Substances 0.000 description 1
- RKEPXZFDMPAEAN-UHFFFAOYSA-N Clomeprop Chemical compound C=1C=CC=CC=1NC(=O)C(C)OC1=CC(Cl)=C(C)C(Cl)=C1 RKEPXZFDMPAEAN-UHFFFAOYSA-N 0.000 description 1
- 239000005500 Clopyralid Substances 0.000 description 1
- HUBANNPOLNYSAD-UHFFFAOYSA-N Clopyralid Chemical compound OC(=O)C1=NC(Cl)=CC=C1Cl HUBANNPOLNYSAD-UHFFFAOYSA-N 0.000 description 1
- BIKACRYIQSLICJ-UHFFFAOYSA-N Cloransulam-methyl Chemical group N=1N2C(OCC)=NC(F)=CC2=NC=1S(=O)(=O)NC1=C(Cl)C=CC=C1C(=O)OC BIKACRYIQSLICJ-UHFFFAOYSA-N 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- DNPSYFHJYIRREW-UHFFFAOYSA-N Credazine Chemical compound CC1=CC=CC=C1OC1=CC=CN=N1 DNPSYFHJYIRREW-UHFFFAOYSA-N 0.000 description 1
- VYNOULHXXDFBLU-UHFFFAOYSA-N Cumyluron Chemical compound C=1C=CC=CC=1C(C)(C)NC(=O)NCC1=CC=CC=C1Cl VYNOULHXXDFBLU-UHFFFAOYSA-N 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N Cyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- DFCAFRGABIXSDS-UHFFFAOYSA-N Cycloate Chemical compound CCSC(=O)N(CC)C1CCCCC1 DFCAFRGABIXSDS-UHFFFAOYSA-N 0.000 description 1
- JHIVVAPYMSGYDF-UHFFFAOYSA-N Cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 1
- OFSLKOLYLQSJPB-UHFFFAOYSA-N Cyclosulfamuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)NC=2C(=CC=CC=2)C(=O)C2CC2)=N1 OFSLKOLYLQSJPB-UHFFFAOYSA-N 0.000 description 1
- 239000005501 Cycloxydim Substances 0.000 description 1
- 241001535157 Cynodon <characin> Species 0.000 description 1
- 240000008893 Cynodon dactylon Species 0.000 description 1
- FMGYKKMPNATWHP-UHFFFAOYSA-N Cyperquat Chemical compound C1=C[N+](C)=CC=C1C1=CC=CC=C1 FMGYKKMPNATWHP-UHFFFAOYSA-N 0.000 description 1
- 235000016854 Cyperus rotundus Nutrition 0.000 description 1
- 240000000628 Cyperus rotundus Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N DMA Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-N Dalapon Chemical compound CC(Cl)(Cl)C(O)=O NDUPDOJHUQKPAG-UHFFFAOYSA-N 0.000 description 1
- BIQOEDQVNIYWPQ-UHFFFAOYSA-N Delachlor Chemical compound CC(C)COCN(C(=O)CCl)C1=C(C)C=CC=C1C BIQOEDQVNIYWPQ-UHFFFAOYSA-N 0.000 description 1
- 235000017680 Descurainia sophia Nutrition 0.000 description 1
- 240000004206 Descurainia sophia Species 0.000 description 1
- 239000005503 Desmedipham Substances 0.000 description 1
- HCRWJJJUKUVORR-UHFFFAOYSA-N Desmetryn Chemical compound CNC1=NC(NC(C)C)=NC(SC)=N1 HCRWJJJUKUVORR-UHFFFAOYSA-N 0.000 description 1
- SPANOECCGNXGNR-UITAMQMPSA-N Diallat Chemical compound CC(C)N(C(C)C)C(=O)SC\C(Cl)=C\Cl SPANOECCGNXGNR-UITAMQMPSA-N 0.000 description 1
- 239000005504 Dicamba Substances 0.000 description 1
- IWEDIXLBFLAXBO-UHFFFAOYSA-N Dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 1
- WURGXGVFSMYFCG-UHFFFAOYSA-N Dichlofluanid Chemical compound CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)C1=CC=CC=C1 WURGXGVFSMYFCG-UHFFFAOYSA-N 0.000 description 1
- YRMLFORXOOIJDR-UHFFFAOYSA-N Dichlormid Chemical compound ClC(Cl)C(=O)N(CC=C)CC=C YRMLFORXOOIJDR-UHFFFAOYSA-N 0.000 description 1
- BACHBFVBHLGWSL-UHFFFAOYSA-N Diclofop methyl Chemical group C1=CC(OC(C)C(=O)OC)=CC=C1OC1=CC=C(Cl)C=C1Cl BACHBFVBHLGWSL-UHFFFAOYSA-N 0.000 description 1
- QNXAVFXEJCPCJO-UHFFFAOYSA-N Diclosulam Chemical compound N=1N2C(OCC)=NC(F)=CC2=NC=1S(=O)(=O)NC1=C(Cl)C=CC=C1Cl QNXAVFXEJCPCJO-UHFFFAOYSA-N 0.000 description 1
- WFKSADNZWSKCRZ-UHFFFAOYSA-N Diethatyl-ethyl Chemical group CCOC(=O)CN(C(=O)CCl)C1=C(CC)C=CC=C1CC WFKSADNZWSKCRZ-UHFFFAOYSA-N 0.000 description 1
- YJVUGZMEFMKALF-UHFFFAOYSA-N Difenoxuron Chemical compound C1=CC(OC)=CC=C1OC1=CC=CC(NC(=O)N(C)C)=C1 YJVUGZMEFMKALF-UHFFFAOYSA-N 0.000 description 1
- LBGPXIPGGRQBJW-UHFFFAOYSA-N Difenzoquat Chemical compound C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 LBGPXIPGGRQBJW-UHFFFAOYSA-N 0.000 description 1
- 239000005507 Diflufenican Substances 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- DHWRNDJOGMTCPB-UHFFFAOYSA-N Dimefuron Chemical compound ClC1=CC(NC(=O)N(C)C)=CC=C1N1C(=O)OC(C(C)(C)C)=N1 DHWRNDJOGMTCPB-UHFFFAOYSA-N 0.000 description 1
- 239000005508 Dimethachlor Substances 0.000 description 1
- IKYICRRUVNIHPP-UHFFFAOYSA-N Dimethametryn Chemical compound CCNC1=NC(NC(C)C(C)C)=NC(SC)=N1 IKYICRRUVNIHPP-UHFFFAOYSA-N 0.000 description 1
- JLYFCTQDENRSOL-UHFFFAOYSA-N Dimethenamid Chemical compound COCC(C)N(C(=O)CCl)C=1C(C)=CSC=1C JLYFCTQDENRSOL-UHFFFAOYSA-N 0.000 description 1
- 239000005509 Dimethenamid-P Substances 0.000 description 1
- FVCPXLWAKNJIKK-UHFFFAOYSA-N Dimexano Chemical group COC(=S)SSC(=S)OC FVCPXLWAKNJIKK-UHFFFAOYSA-N 0.000 description 1
- OWZPCEFYPSAJFR-UHFFFAOYSA-N Dinoseb Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O OWZPCEFYPSAJFR-UHFFFAOYSA-N 0.000 description 1
- IIPZYDQGBIWLBU-UHFFFAOYSA-N Dinoterb Chemical compound CC(C)(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O IIPZYDQGBIWLBU-UHFFFAOYSA-N 0.000 description 1
- QAHFOPIILNICLA-UHFFFAOYSA-N Diphenamid Chemical compound C=1C=CC=CC=1C(C(=O)N(C)C)C1=CC=CC=C1 QAHFOPIILNICLA-UHFFFAOYSA-N 0.000 description 1
- NPWMZOGDXOFZIN-UHFFFAOYSA-N Dipropetryn Chemical compound CCSC1=NC(NC(C)C)=NC(NC(C)C)=N1 NPWMZOGDXOFZIN-UHFFFAOYSA-N 0.000 description 1
- 239000005630 Diquat Substances 0.000 description 1
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N Dirurol Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
- YUBJPYNSGLJZPQ-UHFFFAOYSA-N Dithiopyr Chemical compound CSC(=O)C1=C(C(F)F)N=C(C(F)(F)F)C(C(=O)SC)=C1CC(C)C YUBJPYNSGLJZPQ-UHFFFAOYSA-N 0.000 description 1
- 239000005510 Diuron Substances 0.000 description 1
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 1
- IAUFMJOLSFEAIJ-UHFFFAOYSA-N Eglinazine Chemical compound CCNC1=NC(Cl)=NC(NCC(O)=O)=N1 IAUFMJOLSFEAIJ-UHFFFAOYSA-N 0.000 description 1
- 241000202829 Eleocharis Species 0.000 description 1
- KMHZPJNVPCAUMN-UHFFFAOYSA-N Erbon Chemical compound CC(Cl)(Cl)C(=O)OCCOC1=CC(Cl)=C(Cl)C=C1Cl KMHZPJNVPCAUMN-UHFFFAOYSA-N 0.000 description 1
- BXEHUCNTIZGSOJ-UHFFFAOYSA-N Esprocarb Chemical compound CC(C)C(C)N(CC)C(=O)SCC1=CC=CC=C1 BXEHUCNTIZGSOJ-UHFFFAOYSA-N 0.000 description 1
- DACOQFZGGLCXMA-UHFFFAOYSA-N Eterobarb Chemical compound C=1C=CC=CC=1C1(CC)C(=O)N(COC)C(=O)N(COC)C1=O DACOQFZGGLCXMA-UHFFFAOYSA-N 0.000 description 1
- PTFJIKYUEPWBMS-UHFFFAOYSA-N Ethalfluralin Chemical compound CC(=C)CN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O PTFJIKYUEPWBMS-UHFFFAOYSA-N 0.000 description 1
- KCOCSOWTADCKOL-UHFFFAOYSA-N Ethidimuron Chemical compound CCS(=O)(=O)C1=NN=C(N(C)C(=O)NC)S1 KCOCSOWTADCKOL-UHFFFAOYSA-N 0.000 description 1
- WARIWGPBHKPYON-UHFFFAOYSA-N Ethiolate Chemical compound CCSC(=O)N(CC)CC WARIWGPBHKPYON-UHFFFAOYSA-N 0.000 description 1
- 239000005512 Ethofumesate Substances 0.000 description 1
- UWVKRNOCDUPIDM-UHFFFAOYSA-N Ethoxysulfuron Chemical compound CCOC1=CC=CC=C1OS(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 UWVKRNOCDUPIDM-UHFFFAOYSA-N 0.000 description 1
- ICWUMLXQKFTJMH-UHFFFAOYSA-N Etobenzanid Chemical compound C1=CC(OCOCC)=CC=C1C(=O)NC1=CC=CC(Cl)=C1Cl ICWUMLXQKFTJMH-UHFFFAOYSA-N 0.000 description 1
- GMBRUAIJEFRHFQ-UHFFFAOYSA-N Fenchlorazole-ethyl Chemical group N1=C(C(=O)OCC)N=C(C(Cl)(Cl)Cl)N1C1=CC=C(Cl)C=C1Cl GMBRUAIJEFRHFQ-UHFFFAOYSA-N 0.000 description 1
- NRFQZTCQAYEXEE-UHFFFAOYSA-N Fenclorim Chemical compound ClC1=CC(Cl)=NC(C=2C=CC=CC=2)=N1 NRFQZTCQAYEXEE-UHFFFAOYSA-N 0.000 description 1
- LLQPHQFNMLZJMP-UHFFFAOYSA-N Fentrazamide Chemical compound N1=NN(C=2C(=CC=CC=2)Cl)C(=O)N1C(=O)N(CC)C1CCCCC1 LLQPHQFNMLZJMP-UHFFFAOYSA-N 0.000 description 1
- XXOYNJXVWVNOOJ-UHFFFAOYSA-N Fenuron Chemical compound CN(C)C(=O)NC1=CC=CC=C1 XXOYNJXVWVNOOJ-UHFFFAOYSA-N 0.000 description 1
- 241000234642 Festuca Species 0.000 description 1
- 239000005514 Flazasulfuron Substances 0.000 description 1
- HWATZEJQIXKWQS-UHFFFAOYSA-N Flazasulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CN=2)C(F)(F)F)=N1 HWATZEJQIXKWQS-UHFFFAOYSA-N 0.000 description 1
- 239000005529 Florasulam Substances 0.000 description 1
- QZXATCCPQKOEIH-UHFFFAOYSA-N Florasulam Chemical compound N=1N2C(OC)=NC=C(F)C2=NC=1S(=O)(=O)NC1=C(F)C=CC=C1F QZXATCCPQKOEIH-UHFFFAOYSA-N 0.000 description 1
- VAIZTNZGPYBOGF-UHFFFAOYSA-N Fluazifop butyl Chemical group C1=CC(OC(C)C(=O)OCCCC)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 VAIZTNZGPYBOGF-UHFFFAOYSA-N 0.000 description 1
- UOUXAYAIONPXDH-UHFFFAOYSA-M Flucarbazone-sodium Chemical compound [Na+].O=C1N(C)C(OC)=NN1C(=O)[N-]S(=O)(=O)C1=CC=CC=C1OC(F)(F)F UOUXAYAIONPXDH-UHFFFAOYSA-M 0.000 description 1
- FICWGWVVIRLNRB-UHFFFAOYSA-N Flucetosulfuron Chemical compound COCC(=O)OC(C(C)F)C1=NC=CC=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 FICWGWVVIRLNRB-UHFFFAOYSA-N 0.000 description 1
- MNFMIVVPXOGUMX-UHFFFAOYSA-N Fluchloralin Chemical compound CCCN(CCCl)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O MNFMIVVPXOGUMX-UHFFFAOYSA-N 0.000 description 1
- RXCPQSJAVKGONC-UHFFFAOYSA-N Flumetsulam Chemical compound N1=C2N=C(C)C=CN2N=C1S(=O)(=O)NC1=C(F)C=CC=C1F RXCPQSJAVKGONC-UHFFFAOYSA-N 0.000 description 1
- IRECWLYBCAZIJM-UHFFFAOYSA-N Flumiclorac pentyl Chemical group C1=C(Cl)C(OCC(=O)OCCCCC)=CC(N2C(C3=C(CCCC3)C2=O)=O)=C1F IRECWLYBCAZIJM-UHFFFAOYSA-N 0.000 description 1
- FOUWCSDKDDHKQP-UHFFFAOYSA-N Flumioxazin Chemical compound FC1=CC=2OCC(=O)N(CC#C)C=2C=C1N(C1=O)C(=O)C2=C1CCCC2 FOUWCSDKDDHKQP-UHFFFAOYSA-N 0.000 description 1
- 239000005533 Fluometuron Substances 0.000 description 1
- RZILCCPWPBTYDO-UHFFFAOYSA-N Fluometuron Chemical compound CN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 RZILCCPWPBTYDO-UHFFFAOYSA-N 0.000 description 1
- HHMCAJWVGYGUEF-UHFFFAOYSA-N Fluorodifen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O HHMCAJWVGYGUEF-UHFFFAOYSA-N 0.000 description 1
- DHAHEVIQIYRFRG-UHFFFAOYSA-N Fluoroglycofen Chemical compound C1=C([N+]([O-])=O)C(C(=O)OCC(=O)O)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 DHAHEVIQIYRFRG-UHFFFAOYSA-N 0.000 description 1
- AOQMRUTZEYVDIL-UHFFFAOYSA-N Flupoxam Chemical compound C=1C=C(Cl)C(COCC(F)(F)C(F)(F)F)=CC=1N1N=C(C(=O)N)N=C1C1=CC=CC=C1 AOQMRUTZEYVDIL-UHFFFAOYSA-N 0.000 description 1
- PXRROZVNOOEPPZ-UHFFFAOYSA-N Flupropanate Chemical compound OC(=O)C(F)(F)C(F)F PXRROZVNOOEPPZ-UHFFFAOYSA-N 0.000 description 1
- 239000005534 Flupyrsulfuron-methyl Substances 0.000 description 1
- YWBVHLJPRPCRSD-UHFFFAOYSA-N Fluridone Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC=C1 YWBVHLJPRPCRSD-UHFFFAOYSA-N 0.000 description 1
- OQZCSNDVOWYALR-UHFFFAOYSA-N Flurochloridone Chemical compound FC(F)(F)C1=CC=CC(N2C(C(Cl)C(CCl)C2)=O)=C1 OQZCSNDVOWYALR-UHFFFAOYSA-N 0.000 description 1
- MEFQWPUMEMWTJP-UHFFFAOYSA-N Fluroxypyr Chemical compound NC1=C(Cl)C(F)=NC(OCC(O)=O)=C1Cl MEFQWPUMEMWTJP-UHFFFAOYSA-N 0.000 description 1
- 239000005559 Flurtamone Substances 0.000 description 1
- ZCNQYNHDVRPZIH-JXAWBTAJSA-N Fluthiacet methyl Chemical group C1=C(Cl)C(SCC(=O)OC)=CC(\N=C/2N3CCCCN3C(=O)S\2)=C1F ZCNQYNHDVRPZIH-JXAWBTAJSA-N 0.000 description 1
- BGZZWXTVIYUUEY-UHFFFAOYSA-N Fomesafen Chemical compound C1=C([N+]([O-])=O)C(C(=O)NS(=O)(=O)C)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 BGZZWXTVIYUUEY-UHFFFAOYSA-N 0.000 description 1
- 239000005560 Foramsulfuron Substances 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 241001669573 Galeorhinus galeus Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 239000005561 Glufosinate Substances 0.000 description 1
- IAJOBQBIJHVGMQ-UHFFFAOYSA-N Glufosinate Chemical compound CP(O)(=O)CCC(N)C(O)=O IAJOBQBIJHVGMQ-UHFFFAOYSA-N 0.000 description 1
- 239000005562 Glyphosate Substances 0.000 description 1
- XDDAORKBJWWYJS-UHFFFAOYSA-N Glyphosate Chemical compound OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 description 1
- 239000005563 Halauxifen-methyl Substances 0.000 description 1
- 239000005564 Halosulfuron methyl Substances 0.000 description 1
- FMGZEUWROYGLAY-UHFFFAOYSA-N Halosulfuron-methyl Chemical group ClC1=NN(C)C(S(=O)(=O)NC(=O)NC=2N=C(OC)C=C(OC)N=2)=C1C(=O)OC FMGZEUWROYGLAY-UHFFFAOYSA-N 0.000 description 1
- MJAWMRVEIWPJRW-UHFFFAOYSA-N Haloxydine Chemical compound FC=1NC(F)=C(Cl)C(=O)C=1Cl MJAWMRVEIWPJRW-UHFFFAOYSA-N 0.000 description 1
- MFSWTRQUCLNFOM-UHFFFAOYSA-N Haloxyfop methyl Chemical group C1=CC(OC(C)C(=O)OC)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl MFSWTRQUCLNFOM-UHFFFAOYSA-N 0.000 description 1
- 239000005565 Haloxyfop-P Substances 0.000 description 1
- 240000006669 Helianthus annuus Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- DOJXGHGHTWFZHK-UHFFFAOYSA-N Hexachloroacetone Chemical compound ClC(Cl)(Cl)C(=O)C(Cl)(Cl)Cl DOJXGHGHTWFZHK-UHFFFAOYSA-N 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- CAWXEEYDBZRFPE-UHFFFAOYSA-N Hexazinone Chemical compound O=C1N(C)C(N(C)C)=NC(=O)N1C1CCCCC1 CAWXEEYDBZRFPE-UHFFFAOYSA-N 0.000 description 1
- 239000005566 Imazamox Substances 0.000 description 1
- PVSGXWMWNRGTKE-UHFFFAOYSA-N Imazapic Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC=C(C)C=C1C(O)=O PVSGXWMWNRGTKE-UHFFFAOYSA-N 0.000 description 1
- CLQMBPJKHLGMQK-UHFFFAOYSA-N Imazapyr Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC=CC=C1C(O)=O CLQMBPJKHLGMQK-UHFFFAOYSA-N 0.000 description 1
- 239000005981 Imazaquin Substances 0.000 description 1
- CABMTIJINOIHOD-UHFFFAOYSA-N Imazaquin Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC2=CC=CC=C2C=C1C(O)=O CABMTIJINOIHOD-UHFFFAOYSA-N 0.000 description 1
- XVOKUMIPKHGGTN-UHFFFAOYSA-N Imazethapyr Chemical compound OC(=O)C1=CC(CC)=CN=C1C1=NC(C)(C(C)C)C(=O)N1 XVOKUMIPKHGGTN-UHFFFAOYSA-N 0.000 description 1
- 239000005567 Imazosulfuron Substances 0.000 description 1
- NAGRVUXEKKZNHT-UHFFFAOYSA-N Imazosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2N3C=CC=CC3=NC=2Cl)=N1 NAGRVUXEKKZNHT-UHFFFAOYSA-N 0.000 description 1
- 240000007171 Imperata cylindrica Species 0.000 description 1
- PMAAYIYCDXGUAP-UHFFFAOYSA-N Indanofan Chemical compound O=C1C2=CC=CC=C2C(=O)C1(CC)CC1(C=2C=C(Cl)C=CC=2)CO1 PMAAYIYCDXGUAP-UHFFFAOYSA-N 0.000 description 1
- JUJFQMPKBJPSFZ-UHFFFAOYSA-M Iodosulfuron-methyl-sodium Chemical compound [Na+].COC(=O)C1=CC=C(I)C=C1S(=O)(=O)[N-]C(=O)NC1=NC(C)=NC(OC)=N1 JUJFQMPKBJPSFZ-UHFFFAOYSA-M 0.000 description 1
- QBEXFUOWUYCXNI-UHFFFAOYSA-N Ioxynil octanoate Chemical compound CCCCCCCC(=O)OC1=C(I)C=C(C#N)C=C1I QBEXFUOWUYCXNI-UHFFFAOYSA-N 0.000 description 1
- OWYWGLHRNBIFJP-UHFFFAOYSA-N Ipazine Chemical compound CCN(CC)C1=NC(Cl)=NC(NC(C)C)=N1 OWYWGLHRNBIFJP-UHFFFAOYSA-N 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- PSYBGEADHLUXCS-UHFFFAOYSA-N Isocil Chemical compound CC(C)N1C(=O)NC(C)=C(Br)C1=O PSYBGEADHLUXCS-UHFFFAOYSA-N 0.000 description 1
- QOBMKVRRANLSMZ-UHFFFAOYSA-N Isonoruron Chemical compound C1CC2C3C(NC(=O)N(C)C)CCC3C1C2 QOBMKVRRANLSMZ-UHFFFAOYSA-N 0.000 description 1
- NEKOXWSIMFDGMA-UHFFFAOYSA-N Isopropalin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(C)C)C=C1[N+]([O-])=O NEKOXWSIMFDGMA-UHFFFAOYSA-N 0.000 description 1
- JLLJHQLUZAKJFH-UHFFFAOYSA-N Isouron Chemical compound CN(C)C(=O)NC=1C=C(C(C)(C)C)ON=1 JLLJHQLUZAKJFH-UHFFFAOYSA-N 0.000 description 1
- 239000005570 Isoxaben Substances 0.000 description 1
- PMHURSZHKKJGBM-UHFFFAOYSA-N Isoxaben Chemical compound O1N=C(C(C)(CC)CC)C=C1NC(=O)C1=C(OC)C=CC=C1OC PMHURSZHKKJGBM-UHFFFAOYSA-N 0.000 description 1
- 239000005571 Isoxaflutole Substances 0.000 description 1
- ANFHKXSOSRDDRQ-UHFFFAOYSA-N Isoxapyrifop Chemical compound C1CCON1C(=O)C(C)OC(C=C1)=CC=C1OC1=NC=C(Cl)C=C1Cl ANFHKXSOSRDDRQ-UHFFFAOYSA-N 0.000 description 1
- UQVYUTAMNICZNI-UHFFFAOYSA-N Karbutilate Chemical compound CN(C)C(=O)NC1=CC=CC(NC(=O)OC(C)(C)C)=C1 UQVYUTAMNICZNI-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000110847 Kochia Species 0.000 description 1
- CONWAEURSVPLRM-UHFFFAOYSA-N Lactofen Chemical compound C1=C([N+]([O-])=O)C(C(=O)OC(C)C(=O)OCC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 CONWAEURSVPLRM-UHFFFAOYSA-N 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 235000009193 Lamium purpureum Nutrition 0.000 description 1
- 240000006503 Lamium purpureum Species 0.000 description 1
- 239000005572 Lenacil Substances 0.000 description 1
- 239000005573 Linuron Substances 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 240000004296 Lolium perenne Species 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- AZFKQCNGMSSWDS-UHFFFAOYSA-N MCPA-thioethyl Chemical group CCSC(=O)COC1=CC=C(Cl)C=C1C AZFKQCNGMSSWDS-UHFFFAOYSA-N 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- GZJNBGYLANALSV-UHFFFAOYSA-N Medinoterb acetate Chemical compound CC(=O)OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C(C)=C1C(C)(C)C GZJNBGYLANALSV-UHFFFAOYSA-N 0.000 description 1
- OKIBNKKYNPBDRS-UHFFFAOYSA-N Mefluidide Chemical compound CC(=O)NC1=CC(NS(=O)(=O)C(F)(F)F)=C(C)C=C1C OKIBNKKYNPBDRS-UHFFFAOYSA-N 0.000 description 1
- 239000005577 Mesosulfuron Substances 0.000 description 1
- 239000005578 Mesotrione Substances 0.000 description 1
- KPUREKXXPHOJQT-UHFFFAOYSA-N Mesotrione Chemical compound [O-][N+](=O)C1=CC(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O KPUREKXXPHOJQT-UHFFFAOYSA-N 0.000 description 1
- 230000036740 Metabolism Effects 0.000 description 1
- 239000005579 Metamitron Substances 0.000 description 1
- 239000005580 Metazachlor Substances 0.000 description 1
- RRVIAQKBTUQODI-UHFFFAOYSA-N Methabenzthiazuron Chemical compound C1=CC=C2SC(N(C)C(=O)NC)=NC2=C1 RRVIAQKBTUQODI-UHFFFAOYSA-N 0.000 description 1
- LRUUNMYPIBZBQH-UHFFFAOYSA-N Methazole Chemical compound O=C1N(C)C(=O)ON1C1=CC=C(Cl)C(Cl)=C1 LRUUNMYPIBZBQH-UHFFFAOYSA-N 0.000 description 1
- MMCJEAKINANSOL-UHFFFAOYSA-N Methiuron Chemical compound CN(C)C(=S)NC1=CC=CC(C)=C1 MMCJEAKINANSOL-UHFFFAOYSA-N 0.000 description 1
- DDUIUBPJPOKOMV-UHFFFAOYSA-N Methoprotryne Chemical compound COCCCNC1=NC(NC(C)C)=NC(SC)=N1 DDUIUBPJPOKOMV-UHFFFAOYSA-N 0.000 description 1
- BWPYBAJTDILQPY-UHFFFAOYSA-N Methoxyphenone Chemical compound C1=C(C)C(OC)=CC=C1C(=O)C1=CC=CC(C)=C1 BWPYBAJTDILQPY-UHFFFAOYSA-N 0.000 description 1
- FFCCBBNQPIMUJI-UHFFFAOYSA-N Methyl 2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-para-toluate Chemical group COC(=O)C1=CC=C(C)C=C1C1=NC(C)(C(C)C)C(=O)N1 FFCCBBNQPIMUJI-UHFFFAOYSA-N 0.000 description 1
- FMINYZXVCTYSNY-UHFFFAOYSA-N Methyldymron Chemical compound C=1C=CC=CC=1N(C)C(=O)NC(C)(C)C1=CC=CC=C1 FMINYZXVCTYSNY-UHFFFAOYSA-N 0.000 description 1
- NDNKHWUXXOFHTD-UHFFFAOYSA-N Metizoline Chemical compound CC=1SC2=CC=CC=C2C=1CC1=NCCN1 NDNKHWUXXOFHTD-UHFFFAOYSA-N 0.000 description 1
- 239000005581 Metobromuron Substances 0.000 description 1
- WLFDQEVORAMCIM-UHFFFAOYSA-N Metobromuron Chemical compound CON(C)C(=O)NC1=CC=C(Br)C=C1 WLFDQEVORAMCIM-UHFFFAOYSA-N 0.000 description 1
- WVQBLGZPHOPPFO-UHFFFAOYSA-N Metolachlor Chemical compound CCC1=CC=CC(C)=C1N(C(C)COC)C(=O)CCl WVQBLGZPHOPPFO-UHFFFAOYSA-N 0.000 description 1
- 239000005582 Metosulam Substances 0.000 description 1
- VGHPMIFEKOFHHQ-UHFFFAOYSA-N Metosulam Chemical compound N1=C2N=C(OC)C=C(OC)N2N=C1S(=O)(=O)NC1=C(Cl)C=CC(C)=C1Cl VGHPMIFEKOFHHQ-UHFFFAOYSA-N 0.000 description 1
- DSRNRYQBBJQVCW-UHFFFAOYSA-N Metoxuron Chemical compound COC1=CC=C(NC(=O)N(C)C)C=C1Cl DSRNRYQBBJQVCW-UHFFFAOYSA-N 0.000 description 1
- 239000005583 Metribuzin Substances 0.000 description 1
- FOXFZRUHNHCZPX-UHFFFAOYSA-N Metribuzin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1N FOXFZRUHNHCZPX-UHFFFAOYSA-N 0.000 description 1
- RSMUVYRMZCOLBH-UHFFFAOYSA-N Metsulfuron-methyl Chemical group COC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(C)=NC(OC)=N1 RSMUVYRMZCOLBH-UHFFFAOYSA-N 0.000 description 1
- DEDOPGXGGQYYMW-UHFFFAOYSA-N Molinate Chemical compound CCSC(=O)N1CCCCCC1 DEDOPGXGGQYYMW-UHFFFAOYSA-N 0.000 description 1
- KXGYBSNVFXBPNO-UHFFFAOYSA-N Monalide Chemical compound CCCC(C)(C)C(=O)NC1=CC=C(Cl)C=C1 KXGYBSNVFXBPNO-UHFFFAOYSA-N 0.000 description 1
- LKJPSUCKSLORMF-UHFFFAOYSA-N Monolinuron Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C=C1 LKJPSUCKSLORMF-UHFFFAOYSA-N 0.000 description 1
- DRWWMFAZIDKURY-UHFFFAOYSA-N N-(2-methylprop-2-enyl)-2,6-dinitro-N-propyl-4-(trifluoromethyl)aniline Chemical compound CCCN(CC(C)=C)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O DRWWMFAZIDKURY-UHFFFAOYSA-N 0.000 description 1
- RGKLVVDHWRAWRO-UHFFFAOYSA-N N-(3,4-dichlorophenyl)-N-(dimethylcarbamoyl)-4-methoxybenzamide Chemical compound C1=CC(OC)=CC=C1C(=O)N(C(=O)N(C)C)C1=CC=C(Cl)C(Cl)=C1 RGKLVVDHWRAWRO-UHFFFAOYSA-N 0.000 description 1
- AIMMSOZBPYFASU-UHFFFAOYSA-N N-(4,6-dimethoxypyrimidin-2-yl)-N'-[3-(2,2,2-trifluoroethoxy)pyridin-1-ium-2-yl]sulfonylcarbamimidate Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CN=2)OCC(F)(F)F)=N1 AIMMSOZBPYFASU-UHFFFAOYSA-N 0.000 description 1
- CWKFPEBMTGKLKX-UHFFFAOYSA-N N-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxamide Chemical compound C1=CC(F)=CC=C1NC(=O)C1=CC=CC(OC=2C=C(C=CC=2)C(F)(F)F)=N1 CWKFPEBMTGKLKX-UHFFFAOYSA-N 0.000 description 1
- GLBLPMUBLHYFCW-UHFFFAOYSA-N N-(5,7-dimethoxy-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-methoxy-4-(trifluoromethyl)pyridine-3-sulfonamide Chemical compound N1=C2N=C(OC)C=C(OC)N2N=C1NS(=O)(=O)C1=C(OC)N=CC=C1C(F)(F)F GLBLPMUBLHYFCW-UHFFFAOYSA-N 0.000 description 1
- BZRUVKZGXNSXMB-UHFFFAOYSA-N N-(butan-2-yl)-6-chloro-N'-ethyl-1,3,5-triazine-2,4-diamine Chemical compound CCNC1=NC(Cl)=NC(NC(C)CC)=N1 BZRUVKZGXNSXMB-UHFFFAOYSA-N 0.000 description 1
- ZJMZZNVGNSWOOM-UHFFFAOYSA-N N-(butan-2-yl)-N'-ethyl-6-methoxy-1,3,5-triazine-2,4-diamine Chemical compound CCNC1=NC(NC(C)CC)=NC(OC)=N1 ZJMZZNVGNSWOOM-UHFFFAOYSA-N 0.000 description 1
- KGMBZDZHRAFLBY-UHFFFAOYSA-N N-(butoxymethyl)-N-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide Chemical compound CCCCOCN(C(=O)CCl)C1=C(C)C=CC=C1C(C)(C)C KGMBZDZHRAFLBY-UHFFFAOYSA-N 0.000 description 1
- LKVOXDJKFRBRQV-UHFFFAOYSA-N N-(dimethyl-$l^{4}-sulfanylidene)-4-(dipropylamino)-3,5-dinitrobenzenesulfonamide Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(S(=O)(=O)N=S(C)C)C=C1[N+]([O-])=O LKVOXDJKFRBRQV-UHFFFAOYSA-N 0.000 description 1
- PJFGPJQBWSEWKX-UHFFFAOYSA-N N-[(2,4-dichlorophenoxy)-methoxyphosphinothioyl]propan-2-amine Chemical compound CC(C)NP(=S)(OC)OC1=CC=C(Cl)C=C1Cl PJFGPJQBWSEWKX-UHFFFAOYSA-N 0.000 description 1
- NTBVTCXMRYKRTB-UHFFFAOYSA-N N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]-1,1-difluoromethanesulfonamide Chemical compound COCC1=CC=CC(C(O)C=2N=C(OC)C=C(OC)N=2)=C1NS(=O)(=O)C(F)F NTBVTCXMRYKRTB-UHFFFAOYSA-N 0.000 description 1
- KDOKZLSGPVBDLS-UHFFFAOYSA-N N-[5-(1-chloro-2-methylpropan-2-yl)-1,3,4-thiadiazol-2-yl]cyclopropanecarboxamide Chemical compound S1C(C(C)(CCl)C)=NN=C1NC(=O)C1CC1 KDOKZLSGPVBDLS-UHFFFAOYSA-N 0.000 description 1
- HZDIJTXDRLNTIS-DAXSKMNVSA-N N-[[(Z)-but-2-enoxy]methyl]-2-chloro-N-(2,6-diethylphenyl)acetamide Chemical compound CCC1=CC=CC(CC)=C1N(COC\C=C/C)C(=O)CCl HZDIJTXDRLNTIS-DAXSKMNVSA-N 0.000 description 1
- VHEWQRWLIDWRMR-UHFFFAOYSA-N N-[methoxy-(4-methyl-2-nitrophenoxy)phosphinothioyl]propan-2-amine Chemical group CC(C)NP(=S)(OC)OC1=CC=C(C)C=C1[N+]([O-])=O VHEWQRWLIDWRMR-UHFFFAOYSA-N 0.000 description 1
- FFQPZWRNXKPNPX-UHFFFAOYSA-N N-benzyl-2-[4-fluoro-3-(trifluoromethyl)phenoxy]butanamide Chemical compound C=1C=CC=CC=1CNC(=O)C(CC)OC1=CC=C(F)C(C(F)(F)F)=C1 FFQPZWRNXKPNPX-UHFFFAOYSA-N 0.000 description 1
- FVLVBVSILSHUAF-UHFFFAOYSA-N N-benzyl-3,5-dimethyl-N-propan-2-ylbenzamide Chemical compound C=1C(C)=CC(C)=CC=1C(=O)N(C(C)C)CC1=CC=CC=C1 FVLVBVSILSHUAF-UHFFFAOYSA-N 0.000 description 1
- DGPBHERUGBOSFZ-UHFFFAOYSA-N N-but-3-yn-2-yl-2-chloro-N-phenylacetamide Chemical compound C#CC(C)N(C(=O)CCl)C1=CC=CC=C1 DGPBHERUGBOSFZ-UHFFFAOYSA-N 0.000 description 1
- KCNUWLJAWRWKMO-UHFFFAOYSA-N N-ethyl-N-propyl-3-propylsulfonyl-1,2,4-triazole-1-carboxamide Chemical compound CCCN(CC)C(=O)N1C=NC(S(=O)(=O)CCC)=N1 KCNUWLJAWRWKMO-UHFFFAOYSA-N 0.000 description 1
- LVKTWOXHRYGDMM-UHFFFAOYSA-N Naproanilide Chemical compound C=1C=C2C=CC=CC2=CC=1OC(C)C(=O)NC1=CC=CC=C1 LVKTWOXHRYGDMM-UHFFFAOYSA-N 0.000 description 1
- CCGPUGMWYLICGL-UHFFFAOYSA-N Neburon Chemical compound CCCCN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 CCGPUGMWYLICGL-UHFFFAOYSA-N 0.000 description 1
- 239000005586 Nicosulfuron Substances 0.000 description 1
- UMKANAFDOQQUKE-UHFFFAOYSA-N Nitralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(S(C)(=O)=O)C=C1[N+]([O-])=O UMKANAFDOQQUKE-UHFFFAOYSA-N 0.000 description 1
- XITQUSLLOSKDTB-UHFFFAOYSA-N Nitrofen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(Cl)C=C1Cl XITQUSLLOSKDTB-UHFFFAOYSA-N 0.000 description 1
- YGLMVCVJLXREAK-UHFFFAOYSA-N Noruron Chemical compound C12CCCC2C2CC(NC(=O)N(C)C)C1C2 YGLMVCVJLXREAK-UHFFFAOYSA-N 0.000 description 1
- 240000008467 Oryza sativa Japonica Group Species 0.000 description 1
- 239000005587 Oryzalin Substances 0.000 description 1
- UNAHYJYOSSSJHH-UHFFFAOYSA-N Oryzalin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(S(N)(=O)=O)C=C1[N+]([O-])=O UNAHYJYOSSSJHH-UHFFFAOYSA-N 0.000 description 1
- WFVUIONFJOAYPK-KAMYIIQDSA-N Oxabetrinil Chemical compound C=1C=CC=CC=1C(/C#N)=N\OCC1OCCO1 WFVUIONFJOAYPK-KAMYIIQDSA-N 0.000 description 1
- 239000005588 Oxadiazon Substances 0.000 description 1
- CHNUNORXWHYHNE-UHFFFAOYSA-N Oxadiazon Chemical compound C1=C(Cl)C(OC(C)C)=CC(N2C(OC(=N2)C(C)(C)C)=O)=C1Cl CHNUNORXWHYHNE-UHFFFAOYSA-N 0.000 description 1
- XRGQIRXQFSJBKJ-UHFFFAOYSA-N Oxapyrazon Chemical compound O=C1C(Br)=C(NC(=O)C(=O)O)C=NN1C1=CC=CC=C1 XRGQIRXQFSJBKJ-UHFFFAOYSA-N 0.000 description 1
- 239000005589 Oxasulfuron Substances 0.000 description 1
- FCOHEOSCARXMMS-UHFFFAOYSA-N Oxaziclomefone Chemical compound C1OC(C)=C(C=2C=CC=CC=2)C(=O)N1C(C)(C)C1=CC(Cl)=CC(Cl)=C1 FCOHEOSCARXMMS-UHFFFAOYSA-N 0.000 description 1
- 239000005590 Oxyfluorfen Substances 0.000 description 1
- OQMBBFQZGJFLBU-UHFFFAOYSA-N Oxyfluorfen Chemical compound C1=C([N+]([O-])=O)C(OCC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 OQMBBFQZGJFLBU-UHFFFAOYSA-N 0.000 description 1
- CDHBAZHPEVDWMO-UHFFFAOYSA-N Parafluron Chemical compound CN(C)C(=O)NC1=CC=C(C(F)(F)F)C=C1 CDHBAZHPEVDWMO-UHFFFAOYSA-N 0.000 description 1
- 241000044541 Paspalum vaginatum Species 0.000 description 1
- SGEJQUSYQTVSIU-UHFFFAOYSA-N Pebulate Chemical compound CCCCN(CC)C(=O)SCCC SGEJQUSYQTVSIU-UHFFFAOYSA-N 0.000 description 1
- 239000005591 Pendimethalin Substances 0.000 description 1
- CHIFOSRWCNZCFN-UHFFFAOYSA-N Pendimethalin Chemical compound CCC(CC)NC1=C([N+]([O-])=O)C=C(C)C(C)=C1[N+]([O-])=O CHIFOSRWCNZCFN-UHFFFAOYSA-N 0.000 description 1
- IZUPBVBPLAPZRR-UHFFFAOYSA-N Pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 1
- WGVWLKXZBUVUAM-UHFFFAOYSA-N Pentanochlor Chemical compound CCCC(C)C(=O)NC1=CC=C(C)C(Cl)=C1 WGVWLKXZBUVUAM-UHFFFAOYSA-N 0.000 description 1
- JZPKLLLUDLHCEL-UHFFFAOYSA-N Pentoxazone Chemical compound O=C1C(=C(C)C)OC(=O)N1C1=CC(OC2CCCC2)=C(Cl)C=C1F JZPKLLLUDLHCEL-UHFFFAOYSA-N 0.000 description 1
- 239000005593 Pethoxamid Substances 0.000 description 1
- 241000745991 Phalaris Species 0.000 description 1
- PWEOEHNGYFXZLI-UHFFFAOYSA-N Phenisopham Chemical compound C=1C=CC=CC=1N(CC)C(=O)OC1=CC=CC(NC(=O)OC(C)C)=C1 PWEOEHNGYFXZLI-UHFFFAOYSA-N 0.000 description 1
- 239000005594 Phenmedipham Substances 0.000 description 1
- QQXXYTVEGCOZRF-UHFFFAOYSA-N Phenobenzuron Chemical compound C=1C=C(Cl)C(Cl)=CC=1N(C(=O)N(C)C)C(=O)C1=CC=CC=C1 QQXXYTVEGCOZRF-UHFFFAOYSA-N 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N Phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- 239000005595 Picloram Substances 0.000 description 1
- NQQVFXUMIDALNH-UHFFFAOYSA-N Picloram Chemical compound NC1=C(Cl)C(Cl)=NC(C(O)=O)=C1Cl NQQVFXUMIDALNH-UHFFFAOYSA-N 0.000 description 1
- 239000005596 Picolinafen Substances 0.000 description 1
- UNLYSVIDNRIVFJ-UHFFFAOYSA-N Piperophos Chemical compound CCCOP(=S)(OCCC)SCC(=O)N1CCCCC1C UNLYSVIDNRIVFJ-UHFFFAOYSA-N 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 240000003443 Poa annua Species 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- YLPGTOIOYRQOHV-UHFFFAOYSA-N Pretilachlor Chemical compound CCCOCCN(C(=O)CCl)C1=C(CC)C=CC=C1CC YLPGTOIOYRQOHV-UHFFFAOYSA-N 0.000 description 1
- GPGLBXMQFQQXDV-UHFFFAOYSA-N Primisulfuron Chemical compound OC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(OC(F)F)=CC(OC(F)F)=N1 GPGLBXMQFQQXDV-UHFFFAOYSA-N 0.000 description 1
- ITVQAKZNYJEWKS-UHFFFAOYSA-N Profluralin Chemical compound [O-][N+](=O)C=1C=C(C(F)(F)F)C=C([N+]([O-])=O)C=1N(CCC)CC1CC1 ITVQAKZNYJEWKS-UHFFFAOYSA-N 0.000 description 1
- XCXCBWSRDOSZRU-UHFFFAOYSA-N Proglinazine Chemical compound CC(C)NC1=NC(Cl)=NC(NCC(O)=O)=N1 XCXCBWSRDOSZRU-UHFFFAOYSA-N 0.000 description 1
- ISEUFVQQFVOBCY-UHFFFAOYSA-N Prometon Chemical compound COC1=NC(NC(C)C)=NC(NC(C)C)=N1 ISEUFVQQFVOBCY-UHFFFAOYSA-N 0.000 description 1
- MFOUDYKPLGXPGO-UHFFFAOYSA-N Propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 1
- LFULEKSKNZEWOE-UHFFFAOYSA-N Propanil Chemical compound CCC(=O)NC1=CC=C(Cl)C(Cl)=C1 LFULEKSKNZEWOE-UHFFFAOYSA-N 0.000 description 1
- 239000005600 Propaquizafop Substances 0.000 description 1
- VXPLXMJHHKHSOA-UHFFFAOYSA-N Propham Chemical compound CC(C)OC(=O)NC1=CC=CC=C1 VXPLXMJHHKHSOA-UHFFFAOYSA-N 0.000 description 1
- 239000005601 Propoxycarbazone Substances 0.000 description 1
- 239000005603 Prosulfocarb Substances 0.000 description 1
- 239000005604 Prosulfuron Substances 0.000 description 1
- LTUNNEGNEKBSEH-UHFFFAOYSA-N Prosulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)CCC(F)(F)F)=N1 LTUNNEGNEKBSEH-UHFFFAOYSA-N 0.000 description 1
- IHHMUBRVTJMLQO-UHFFFAOYSA-N Pyraclonil Chemical compound C#CCN(C)C1=C(C#N)C=NN1C1=NN(CCCC2)C2=C1Cl IHHMUBRVTJMLQO-UHFFFAOYSA-N 0.000 description 1
- 239000005605 Pyraflufen-ethyl Substances 0.000 description 1
- APTZNLHMIGJTEW-UHFFFAOYSA-N Pyraflufen-ethyl Chemical group C1=C(Cl)C(OCC(=O)OCC)=CC(C=2C(=C(OC(F)F)N(C)N=2)Cl)=C1F APTZNLHMIGJTEW-UHFFFAOYSA-N 0.000 description 1
- FKERUJTUOYLBKB-UHFFFAOYSA-N Pyrazoxyfen Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=O)C=1C(C)=NN(C)C=1OCC(=O)C1=CC=CC=C1 FKERUJTUOYLBKB-UHFFFAOYSA-N 0.000 description 1
- 239000005606 Pyridate Substances 0.000 description 1
- JTZCTMAVMHRNTR-UHFFFAOYSA-N Pyridate Chemical compound CCCCCCCCSC(=O)OC1=CC(Cl)=NN=C1C1=CC=CC=C1 JTZCTMAVMHRNTR-UHFFFAOYSA-N 0.000 description 1
- RRKHIAYNPVQKEF-UHFFFAOYSA-N Pyriftalid Chemical compound COC1=CC(OC)=NC(SC=2C=3C(=O)OC(C)C=3C=CC=2)=N1 RRKHIAYNPVQKEF-UHFFFAOYSA-N 0.000 description 1
- USSIUIGPBLPCDF-KEBDBYFISA-N Pyriminobac-methyl Chemical group CO\N=C(/C)C1=CC=CC(OC=2N=C(OC)C=C(OC)N=2)=C1C(=O)OC USSIUIGPBLPCDF-KEBDBYFISA-N 0.000 description 1
- CNILNQMBAHKMFS-UHFFFAOYSA-M Pyrithiobac-sodium Chemical compound [Na+].COC1=CC(OC)=NC(SC=2C(=C(Cl)C=CC=2)C([O-])=O)=N1 CNILNQMBAHKMFS-UHFFFAOYSA-M 0.000 description 1
- 239000005607 Pyroxsulam Substances 0.000 description 1
- FFSSWMQPCJRCRV-UHFFFAOYSA-N Quinclorac Chemical compound ClC1=CN=C2C(C(=O)O)=C(Cl)C=CC2=C1 FFSSWMQPCJRCRV-UHFFFAOYSA-N 0.000 description 1
- 239000005608 Quinmerac Substances 0.000 description 1
- 239000005614 Quizalofop-P-ethyl Substances 0.000 description 1
- OSUHJPCHFDQAIT-UHFFFAOYSA-N Quizalofop-ethyl Chemical group C1=CC(OC(C)C(=O)OCC)=CC=C1OC1=CN=C(C=C(Cl)C=C2)C2=N1 OSUHJPCHFDQAIT-UHFFFAOYSA-N 0.000 description 1
- 239000005616 Rimsulfuron Substances 0.000 description 1
- 241000219053 Rumex Species 0.000 description 1
- 239000005617 S-Metolachlor Substances 0.000 description 1
- BUHNESFUCHPWED-UHFFFAOYSA-N S-[(4-methoxyphenyl)methyl] N,N-diethylcarbamothioate Chemical compound CCN(CC)C(=O)SCC1=CC=C(OC)C=C1 BUHNESFUCHPWED-UHFFFAOYSA-N 0.000 description 1
- LMHHRCOWPQNFTF-UHFFFAOYSA-N S-propan-2-yl azepane-1-carbothioate Chemical compound CC(C)SC(=O)N1CCCCCC1 LMHHRCOWPQNFTF-UHFFFAOYSA-N 0.000 description 1
- 229940010115 SIMETONE Drugs 0.000 description 1
- WOZQBERUBLYCEG-UHFFFAOYSA-N SWEP Chemical compound COC(=O)NC1=CC=C(Cl)C(Cl)=C1 WOZQBERUBLYCEG-UHFFFAOYSA-N 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 240000009132 Sagittaria sagittifolia Species 0.000 description 1
- 241000202758 Scirpus Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000005773 Setaria viridis Nutrition 0.000 description 1
- CSPPKDPQLUUTND-NBVRZTHBSA-N Sethoxydim Chemical compound CCO\N=C(/CCC)C1=C(O)CC(CC(C)SCC)CC1=O CSPPKDPQLUUTND-NBVRZTHBSA-N 0.000 description 1
- JXVIIQLNUPXOII-UHFFFAOYSA-N Siduron Chemical compound CC1CCCCC1NC(=O)NC1=CC=CC=C1 JXVIIQLNUPXOII-UHFFFAOYSA-N 0.000 description 1
- ODCWYMIRDDJXKW-UHFFFAOYSA-N Simazine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1 ODCWYMIRDDJXKW-UHFFFAOYSA-N 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- YZHUMGUJCQRKBT-UHFFFAOYSA-M Sodium chlorate Chemical compound [Na+].[O-]Cl(=O)=O YZHUMGUJCQRKBT-UHFFFAOYSA-M 0.000 description 1
- NNMHYFLPFNGQFZ-UHFFFAOYSA-M Sodium polyacrylate Chemical compound [Na+].[O-]C(=O)C=C NNMHYFLPFNGQFZ-UHFFFAOYSA-M 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- JNYAEWCLZODPBN-CTQIIAAMSA-N Sorbitan Chemical class OCC(O)C1OCC(O)[C@@H]1O JNYAEWCLZODPBN-CTQIIAAMSA-N 0.000 description 1
- 239000005618 Sulcotrione Substances 0.000 description 1
- XJCLWVXTCRQIDI-UHFFFAOYSA-N Sulfallate Chemical compound CCN(CC)C(=S)SCC(Cl)=C XJCLWVXTCRQIDI-UHFFFAOYSA-N 0.000 description 1
- OORLZFUTLGXMEF-UHFFFAOYSA-N Sulfentrazone Chemical compound O=C1N(C(F)F)C(C)=NN1C1=CC(NS(C)(=O)=O)=C(Cl)C=C1Cl OORLZFUTLGXMEF-UHFFFAOYSA-N 0.000 description 1
- 239000005619 Sulfosulfuron Substances 0.000 description 1
- 239000005620 Tembotrione Substances 0.000 description 1
- NBQCNZYJJMBDKY-UHFFFAOYSA-N Terbacil Chemical compound CC=1NC(=O)N(C(C)(C)C)C(=O)C=1Cl NBQCNZYJJMBDKY-UHFFFAOYSA-N 0.000 description 1
- PNRAZZZISDRWMV-UHFFFAOYSA-N Terbucarb Chemical compound CNC(=O)OC1=C(C(C)(C)C)C=C(C)C=C1C(C)(C)C PNRAZZZISDRWMV-UHFFFAOYSA-N 0.000 description 1
- 239000005621 Terbuthylazine Substances 0.000 description 1
- FZXISNSWEXTPMF-UHFFFAOYSA-N Terbuthylazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C)=N1 FZXISNSWEXTPMF-UHFFFAOYSA-N 0.000 description 1
- KDWQYMVPYJGPHS-UHFFFAOYSA-N Thenylchlor Chemical compound C1=CSC(CN(C(=O)CCl)C=2C(=CC=CC=2C)C)=C1OC KDWQYMVPYJGPHS-UHFFFAOYSA-N 0.000 description 1
- BBJPZPLAZVZTGR-UHFFFAOYSA-N Thiazafluron Chemical compound CNC(=O)N(C)C1=NN=C(C(F)(F)F)S1 BBJPZPLAZVZTGR-UHFFFAOYSA-N 0.000 description 1
- YIJZJEYQBAAWRJ-UHFFFAOYSA-N Thiazopyr Chemical compound N1=C(C(F)F)C(C(=O)OC)=C(CC(C)C)C(C=2SCCN=2)=C1C(F)(F)F YIJZJEYQBAAWRJ-UHFFFAOYSA-N 0.000 description 1
- 239000005623 Thifensulfuron-methyl Substances 0.000 description 1
- PHSUVQBHRAWOQD-UHFFFAOYSA-N Tiocarbazil Chemical compound CCC(C)N(C(C)CC)C(=O)SCC1=CC=CC=C1 PHSUVQBHRAWOQD-UHFFFAOYSA-N 0.000 description 1
- 239000005624 Tralkoxydim Substances 0.000 description 1
- DQFPEYARZIQXRM-LTGZKZEYSA-N Tralkoxydim Chemical compound C1C(=O)C(C(/CC)=N/OCC)=C(O)CC1C1=C(C)C=C(C)C=C1C DQFPEYARZIQXRM-LTGZKZEYSA-N 0.000 description 1
- 239000005625 Tri-allate Substances 0.000 description 1
- MWBPRDONLNQCFV-UHFFFAOYSA-N Tri-allate Chemical compound CC(C)N(C(C)C)C(=O)SCC(Cl)=C(Cl)Cl MWBPRDONLNQCFV-UHFFFAOYSA-N 0.000 description 1
- XOPFESVZMSQIKC-UHFFFAOYSA-N Triasulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OCCCl)=N1 XOPFESVZMSQIKC-UHFFFAOYSA-N 0.000 description 1
- YMXOXAPKZDWXLY-QWRGUYRKSA-N Tribenuron Methyl Chemical group COC(=O)[C@H]1CCCC[C@@H]1S(=O)(=O)NC(=O)N(C)C1=NC(C)=NC(OC)=N1 YMXOXAPKZDWXLY-QWRGUYRKSA-N 0.000 description 1
- 229960004319 Trichloroacetic Acid Drugs 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N Trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- REEQLXCGVXDJSQ-UHFFFAOYSA-N Triclopyr Chemical compound OC(=O)COC1=NC(Cl)=C(Cl)C=C1Cl REEQLXCGVXDJSQ-UHFFFAOYSA-N 0.000 description 1
- IBZHOAONZVJLOB-UHFFFAOYSA-N Tridiphane Chemical compound ClC1=CC(Cl)=CC(C2(CC(Cl)(Cl)Cl)OC2)=C1 IBZHOAONZVJLOB-UHFFFAOYSA-N 0.000 description 1
- HFBWPRKWDIRYNX-UHFFFAOYSA-N Trietazine Chemical compound CCNC1=NC(Cl)=NC(N(CC)CC)=N1 HFBWPRKWDIRYNX-UHFFFAOYSA-N 0.000 description 1
- IMEVJVISCHQJRM-UHFFFAOYSA-N Triflusulfuron-methyl Chemical group COC(=O)C1=CC=CC(C)=C1S(=O)(=O)NC(=O)NC1=NC(OCC(F)(F)F)=NC(N(C)C)=N1 IMEVJVISCHQJRM-UHFFFAOYSA-N 0.000 description 1
- 240000000359 Triticum dicoccon Species 0.000 description 1
- 240000002805 Triticum turgidum Species 0.000 description 1
- 239000005629 Tritosulfuron Substances 0.000 description 1
- HWKQNAWCHQMZHK-UHFFFAOYSA-N Trolnitrate Chemical compound [O-][N+](=O)OCCN(CCO[N+]([O-])=O)CCO[N+]([O-])=O HWKQNAWCHQMZHK-UHFFFAOYSA-N 0.000 description 1
- 241001166549 Veronica hederifolia Species 0.000 description 1
- 241000990144 Veronica persica Species 0.000 description 1
- 241000405217 Viola <butterfly> Species 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 241000981595 Zoysia japonica Species 0.000 description 1
- LUZZPGJQJKMMDM-JTQLQIEISA-N [(2S)-1-ethoxy-1-oxopropan-2-yl] 2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate Chemical group C1=C(Cl)C(C(=O)O[C@@H](C)C(=O)OCC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 LUZZPGJQJKMMDM-JTQLQIEISA-N 0.000 description 1
- OTSYOPHQYHLKTK-UHFFFAOYSA-N [2-(azepan-1-yl)-2-oxoethyl] N-methylsulfamate Chemical compound CNS(=O)(=O)OCC(=O)N1CCCCCC1 OTSYOPHQYHLKTK-UHFFFAOYSA-N 0.000 description 1
- MVEFZZKZBYQFPP-UHFFFAOYSA-N [3-(ethoxycarbonylamino)phenyl] N-(3-methylphenyl)carbamate Chemical group CCOC(=O)NC1=CC=CC(OC(=O)NC=2C=C(C)C=CC=2)=C1 MVEFZZKZBYQFPP-UHFFFAOYSA-N 0.000 description 1
- CYDCAYZRTPOUJJ-UHFFFAOYSA-N [3-(methoxycarbonylamino)phenyl] N-(1-chlorobutan-2-yl)carbamate Chemical compound CCC(CCl)NC(=O)OC1=CC=CC(NC(=O)OC)=C1 CYDCAYZRTPOUJJ-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- HGINCPLSRVDWNT-UHFFFAOYSA-N acrylaldehyde Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive Effects 0.000 description 1
- 230000000274 adsorptive Effects 0.000 description 1
- 238000003972 agrochemical formulation Methods 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- RQVYBGPQFYCBGX-UHFFFAOYSA-N ametryn Chemical compound CCNC1=NC(NC(C)C)=NC(SC)=N1 RQVYBGPQFYCBGX-UHFFFAOYSA-N 0.000 description 1
- KWAIHLIXESXTJL-UHFFFAOYSA-N aminocyclopyrachlor Chemical compound OC(=O)C1=C(Cl)C(N)=NC(C2CC2)=N1 KWAIHLIXESXTJL-UHFFFAOYSA-N 0.000 description 1
- 230000000692 anti-sense Effects 0.000 description 1
- 239000007798 antifreeze agent Substances 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- 229920002847 antisense RNA Polymers 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 235000009052 artemisia Nutrition 0.000 description 1
- PXWUKZGIHQRDHL-UHFFFAOYSA-N atraton Chemical compound CCNC1=NC(NC(C)C)=NC(OC)=N1 PXWUKZGIHQRDHL-UHFFFAOYSA-N 0.000 description 1
- GNZZHGJSMCDMBU-UHFFFAOYSA-N azane;5-(methoxymethyl)-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid Chemical compound [NH4+].[O-]C(=O)C1=CC(COC)=CN=C1C1=NC(C)(C(C)C)C(=O)N1 GNZZHGJSMCDMBU-UHFFFAOYSA-N 0.000 description 1
- MCOQHIWZJUDQIC-UHFFFAOYSA-N barban Chemical compound ClCC#CCOC(=O)NC1=CC=CC(Cl)=C1 MCOQHIWZJUDQIC-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium(0) Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- MKQSWTQPLLCSOB-UHFFFAOYSA-N benzyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate Chemical compound N1=C(Cl)SC(C(=O)OCC=2C=CC=CC=2)=C1C(F)(F)F MKQSWTQPLLCSOB-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000001488 breeding Effects 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- WZDDLAZXUYIVMU-UHFFFAOYSA-N bromobutide Chemical compound CC(C)(C)C(Br)C(=O)NC(C)(C)C1=CC=CC=C1 WZDDLAZXUYIVMU-UHFFFAOYSA-N 0.000 description 1
- CURLHBZYTFVCRG-UHFFFAOYSA-N butan-2-yl N-(3-chlorophenyl)carbamate Chemical compound CCC(C)OC(=O)NC1=CC=CC(Cl)=C1 CURLHBZYTFVCRG-UHFFFAOYSA-N 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- AMRQXHFXNZFDCH-VIFPVBQESA-N carbetamide Chemical compound CCNC(=O)[C@H](C)OC(=O)NC1=CC=CC=C1 AMRQXHFXNZFDCH-VIFPVBQESA-N 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- WYKYKTKDBLFHCY-UHFFFAOYSA-N chloridazon Chemical compound O=C1C(Cl)=C(N)C=NN1C1=CC=CC=C1 WYKYKTKDBLFHCY-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- NNKKTZOEKDFTBU-YBEGLDIGSA-N cinidon ethyl Chemical compound C1=C(Cl)C(/C=C(\Cl)C(=O)OCC)=CC(N2C(C3=C(CCCC3)C2=O)=O)=C1 NNKKTZOEKDFTBU-YBEGLDIGSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- SILSDTWXNBZOGF-JWGBMQLESA-N clethodim Chemical compound CCSC(C)CC1CC(O)=C(C(CC)=NOC\C=C\Cl)C(=O)C1 SILSDTWXNBZOGF-JWGBMQLESA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052803 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000003184 complementary RNA Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- GGWHBJGBERXSLL-UHFFFAOYSA-N cycloxydim Chemical compound C1C(=O)C(C(=NOCC)CCC)=C(O)CC1C1CSCCC1 GGWHBJGBERXSLL-UHFFFAOYSA-N 0.000 description 1
- WZJZMXBKUWKXTQ-UHFFFAOYSA-N desmedipham Chemical compound CCOC(=O)NC1=CC=CC(OC(=O)NC=2C=CC=CC=2)=C1 WZJZMXBKUWKXTQ-UHFFFAOYSA-N 0.000 description 1
- OPGCOAPTHCZZIW-UHFFFAOYSA-N diethyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate Chemical group CCOC(=O)C1(C)CC(C(=O)OCC)=NN1C1=CC=C(Cl)C=C1Cl OPGCOAPTHCZZIW-UHFFFAOYSA-N 0.000 description 1
- WYEHFWKAOXOVJD-UHFFFAOYSA-N diflufenican Chemical compound FC1=CC(F)=CC=C1NC(=O)C1=CC=CN=C1OC1=CC=CC(C(F)(F)F)=C1 WYEHFWKAOXOVJD-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- BWUPSGJXXPATLU-UHFFFAOYSA-N dimepiperate Chemical compound C=1C=CC=CC=1C(C)(C)SC(=O)N1CCCCC1 BWUPSGJXXPATLU-UHFFFAOYSA-N 0.000 description 1
- SCCDDNKJYDZXMM-UHFFFAOYSA-N dimethachlor Chemical compound COCCN(C(=O)CCl)C1=C(C)C=CC=C1C SCCDDNKJYDZXMM-UHFFFAOYSA-N 0.000 description 1
- SYJFEGQWDCRVNX-UHFFFAOYSA-N diquat Chemical compound C1=CC=[N+]2CC[N+]3=CC=CC=C3C2=C1 SYJFEGQWDCRVNX-UHFFFAOYSA-N 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2R)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- OSUHJPCHFDQAIT-GFCCVEGCSA-N ethyl (2R)-2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate Chemical group C1=CC(O[C@H](C)C(=O)OCC)=CC=C1OC1=CN=C(C=C(Cl)C=C2)C2=N1 OSUHJPCHFDQAIT-GFCCVEGCSA-N 0.000 description 1
- PQKBPHSEKWERTG-LLVKDONJSA-N ethyl (2R)-2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]propanoate Chemical group C1=CC(O[C@H](C)C(=O)OCC)=CC=C1OC1=NC2=CC=C(Cl)C=C2O1 PQKBPHSEKWERTG-LLVKDONJSA-N 0.000 description 1
- NSWAMPCUPHPTTC-UHFFFAOYSA-N ethyl 2-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]benzoate Chemical group CCOC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(Cl)=CC(OC)=N1 NSWAMPCUPHPTTC-UHFFFAOYSA-N 0.000 description 1
- DNUAYCRATWAJQE-UHFFFAOYSA-N ethyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate Chemical group C1=C(Cl)C(OCC(=O)OCC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F DNUAYCRATWAJQE-UHFFFAOYSA-N 0.000 description 1
- MWKVXOJATACCCH-UHFFFAOYSA-N ethyl 5,5-diphenyl-4H-1,2-oxazole-3-carboxylate Chemical group C1C(C(=O)OCC)=NOC1(C=1C=CC=CC=1)C1=CC=CC=C1 MWKVXOJATACCCH-UHFFFAOYSA-N 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 238000009313 farming Methods 0.000 description 1
- 230000035558 fertility Effects 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- PXDNXJSDGQBLKS-UHFFFAOYSA-N foramsulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=C(NC=O)C=2)C(=O)N(C)C)=N1 PXDNXJSDGQBLKS-UHFFFAOYSA-N 0.000 description 1
- 230000000855 fungicidal Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 229940097068 glyphosate Drugs 0.000 description 1
- 235000002248 green bristle grass Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- COYBRKAVBMYYSF-UHFFFAOYSA-N heptan-2-yl 2-(5-chloroquinolin-8-yl)oxyacetate Chemical group C1=CN=C2C(OCC(=O)OC(C)CCCCC)=CC=C(Cl)C2=C1 COYBRKAVBMYYSF-UHFFFAOYSA-N 0.000 description 1
- 125000005842 heteroatoms Chemical group 0.000 description 1
- RBJAKRVCYLJDPZ-UHFFFAOYSA-N hexyl 2-[5-(4-bromophenoxy)-2-nitrophenoxy]propanoate Chemical compound C1=C([N+]([O-])=O)C(OC(C)C(=O)OCCCCCC)=CC(OC=2C=CC(Br)=CC=2)=C1 RBJAKRVCYLJDPZ-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- NRXQIUSYPAHGNM-UHFFFAOYSA-N ioxynil Chemical compound OC1=C(I)C=C(C#N)C=C1I NRXQIUSYPAHGNM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 description 1
- 229940088649 isoxaflutole Drugs 0.000 description 1
- ZTMKADLOSYKWCA-UHFFFAOYSA-N lenacil Chemical compound O=C1NC=2CCCC=2C(=O)N1C1CCCCC1 ZTMKADLOSYKWCA-UHFFFAOYSA-N 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- XKJMBINCVNINCA-UHFFFAOYSA-N linuron Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XKJMBINCVNINCA-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- XIGAUIHYSDTJHW-UHFFFAOYSA-N mefenacet Chemical compound N=1C2=CC=CC=C2SC=1OCC(=O)N(C)C1=CC=CC=C1 XIGAUIHYSDTJHW-UHFFFAOYSA-N 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 230000035786 metabolism Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- VHCNQEUWZYOAEV-UHFFFAOYSA-N metamitron Chemical compound O=C1N(N)C(C)=NN=C1C1=CC=CC=C1 VHCNQEUWZYOAEV-UHFFFAOYSA-N 0.000 description 1
- STEPQTYSZVCJPV-UHFFFAOYSA-N metazachlor Chemical compound CC1=CC=CC(C)=C1N(C(=O)CCl)CN1N=CC=C1 STEPQTYSZVCJPV-UHFFFAOYSA-N 0.000 description 1
- RBNIGDFIUWJJEV-LLVKDONJSA-N methyl (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)propanoate Chemical group C=1C=C(F)C(Cl)=CC=1N([C@H](C)C(=O)OC)C(=O)C1=CC=CC=C1 RBNIGDFIUWJJEV-LLVKDONJSA-N 0.000 description 1
- CBLVUXPPNHUKDE-QBFSEMIESA-N methyl (5Z)-2,2-dimethyl-4,6-dioxo-5-[1-(prop-2-enoxyamino)butylidene]cyclohexane-1-carboxylate Chemical compound C=CCONC(/CCC)=C1/C(=O)CC(C)(C)C(C(=O)OC)C1=O CBLVUXPPNHUKDE-QBFSEMIESA-N 0.000 description 1
- DTVOKYWXACGVGO-UHFFFAOYSA-N methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-6-(trifluoromethyl)pyridine-3-carboxylate Chemical group COC(=O)C1=CC=C(C(F)(F)F)N=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 DTVOKYWXACGVGO-UHFFFAOYSA-N 0.000 description 1
- ZCNQYNHDVRPZIH-UHFFFAOYSA-N methyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate Chemical compound C1=C(Cl)C(SCC(=O)OC)=CC(N=C2N3CCCCN3C(=O)S2)=C1F ZCNQYNHDVRPZIH-UHFFFAOYSA-N 0.000 description 1
- LYPWWQLKWQNQKV-UHFFFAOYSA-N methyl 2-[5-ethyl-2-[[4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]methyl]phenoxy]propanoate Chemical compound COC(=O)C(C)OC1=CC(CC)=CC=C1COC1=CC=C(N2C(N(C)C(=CC2=O)C(F)(F)F)=O)C=C1 LYPWWQLKWQNQKV-UHFFFAOYSA-N 0.000 description 1
- ZINJLDJMHCUBIP-UHFFFAOYSA-N methyl 2-[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoylsulfamoyl]benzoate Chemical group CCOC1=NC(NC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(=O)OC)=N1 ZINJLDJMHCUBIP-UHFFFAOYSA-N 0.000 description 1
- XSKZXGDFSCCXQX-UHFFFAOYSA-N methyl 4-[(3-methoxy-4-methyl-5-oxo-1,2,4-triazole-1-carbonyl)sulfamoyl]-5-methylthiophene-3-carboxylate Chemical compound COC(=O)C1=CSC(C)=C1S(=O)(=O)NC(=O)N1C(=O)N(C)C(OC)=N1 XSKZXGDFSCCXQX-UHFFFAOYSA-N 0.000 description 1
- KDHKOPYYWOHESS-UHFFFAOYSA-N methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylate Chemical group NC1=C(Cl)C(C(=O)OC)=NC(C=2C(=C(OC)C(Cl)=CC=2)F)=C1 KDHKOPYYWOHESS-UHFFFAOYSA-N 0.000 description 1
- MYURAHUSYDVWQA-UHFFFAOYSA-N methyl N'-(4-chlorophenyl)-N,N-dimethylcarbamimidate Chemical compound COC(N(C)C)=NC1=CC=C(Cl)C=C1 MYURAHUSYDVWQA-UHFFFAOYSA-N 0.000 description 1
- ZGUYPJJFHYFLBV-UHFFFAOYSA-N methyl N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate Chemical compound COC(=O)NC=1C=C(C(C)(C)C)ON=1 ZGUYPJJFHYFLBV-UHFFFAOYSA-N 0.000 description 1
- ZTFLDKYLDUZSMN-UHFFFAOYSA-N methyl N-[4-(methoxycarbonylamino)phenyl]sulfonylcarbamate Chemical compound COC(=O)NC1=CC=C(S(=O)(=O)NC(=O)OC)C=C1 ZTFLDKYLDUZSMN-UHFFFAOYSA-N 0.000 description 1
- 229940073769 methyl oleate Drugs 0.000 description 1
- 229960002939 metizoline Drugs 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000010369 molecular cloning Methods 0.000 description 1
- BMLIZLVNXIYGCK-UHFFFAOYSA-N monuron Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C=C1 BMLIZLVNXIYGCK-UHFFFAOYSA-N 0.000 description 1
- 238000002703 mutagenesis Methods 0.000 description 1
- 231100000350 mutagenesis Toxicity 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JXTHEWSKYLZVJC-UHFFFAOYSA-N naptalam Chemical compound OC(=O)C1=CC=CC=C1C(=O)NC1=CC=CC2=CC=CC=C12 JXTHEWSKYLZVJC-UHFFFAOYSA-N 0.000 description 1
- 230000001264 neutralization Effects 0.000 description 1
- RTCOGUMHFFWOJV-UHFFFAOYSA-N nicosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CN=2)C(=O)N(C)C)=N1 RTCOGUMHFFWOJV-UHFFFAOYSA-N 0.000 description 1
- NVGOPFQZYCNLDU-UHFFFAOYSA-N norflurazon Chemical compound O=C1C(Cl)=C(NC)C=NN1C1=CC=CC(C(F)(F)F)=C1 NVGOPFQZYCNLDU-UHFFFAOYSA-N 0.000 description 1
- LLLFASISUZUJEQ-UHFFFAOYSA-N orbencarb Chemical compound CCN(CC)C(=O)SCC1=CC=CC=C1Cl LLLFASISUZUJEQ-UHFFFAOYSA-N 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 210000000056 organs Anatomy 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N oxane Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- IOXAXYHXMLCCJJ-UHFFFAOYSA-N oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoyl]benzoate Chemical compound CC1=CC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(=O)OC2COC2)=N1 IOXAXYHXMLCCJJ-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- INFDPOAKFNIJBF-UHFFFAOYSA-N paraquat Chemical compound C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 INFDPOAKFNIJBF-UHFFFAOYSA-N 0.000 description 1
- 230000036961 partial Effects 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- 239000003090 pesticide formulation Substances 0.000 description 1
- CSWIKHNSBZVWNQ-UHFFFAOYSA-N pethoxamide Chemical compound CCOCCN(C(=O)CCl)C(=C(C)C)C1=CC=CC=C1 CSWIKHNSBZVWNQ-UHFFFAOYSA-N 0.000 description 1
- IDOWTHOLJBTAFI-UHFFFAOYSA-N phenmedipham Chemical compound COC(=O)NC1=CC=CC(OC(=O)NC=2C=C(C)C=CC=2)=C1 IDOWTHOLJBTAFI-UHFFFAOYSA-N 0.000 description 1
- 230000000885 phytotoxic Effects 0.000 description 1
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001522 polyglycol ester Polymers 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 230000032361 posttranscriptional gene silencing Effects 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002335 preservative Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- AAEVYOVXGOFMJO-UHFFFAOYSA-N prometryn Chemical compound CSC1=NC(NC(C)C)=NC(NC(C)C)=N1 AAEVYOVXGOFMJO-UHFFFAOYSA-N 0.000 description 1
- JBDHZKLJNAIJNC-LLVKDONJSA-N prop-2-ynyl (2R)-2-[4-(5-chloro-3-fluoropyridin-2-yl)oxyphenoxy]propanoate Chemical group C1=CC(O[C@H](C)C(=O)OCC#C)=CC=C1OC1=NC=C(Cl)C=C1F JBDHZKLJNAIJNC-LLVKDONJSA-N 0.000 description 1
- OYJMHAFVOZPIOY-UHFFFAOYSA-N propan-2-yl 2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate Chemical compound C1=C(Cl)C(C(=O)OC(C)C)=CC(N2C(N(C)C(=CC2=O)C(F)(F)F)=O)=C1 OYJMHAFVOZPIOY-UHFFFAOYSA-N 0.000 description 1
- FKLQIONHGSFYJY-UHFFFAOYSA-N propan-2-yl 5-[4-bromo-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-chloro-4-fluorobenzoate Chemical compound C1=C(Cl)C(C(=O)OC(C)C)=CC(C=2C(=C(N(C)N=2)C(F)(F)F)Br)=C1F FKLQIONHGSFYJY-UHFFFAOYSA-N 0.000 description 1
- FROBCXTULYFHEJ-OAHLLOKOSA-N propaquizafop Chemical compound C1=CC(O[C@H](C)C(=O)OCCON=C(C)C)=CC=C1OC1=CN=C(C=C(Cl)C=C2)C2=N1 FROBCXTULYFHEJ-OAHLLOKOSA-N 0.000 description 1
- WJNRPILHGGKWCK-UHFFFAOYSA-N propazine Chemical compound CC(C)NC1=NC(Cl)=NC(NC(C)C)=N1 WJNRPILHGGKWCK-UHFFFAOYSA-N 0.000 description 1
- SMGYWIDRYSVAEE-UHFFFAOYSA-N propyl 4-[2-(4,6-dimethoxypyrimidin-2-yl)oxyanilino]benzoate Chemical group C1=CC(C(=O)OCCC)=CC=C1NC1=CC=CC=C1OC1=NC(OC)=CC(OC)=N1 SMGYWIDRYSVAEE-UHFFFAOYSA-N 0.000 description 1
- ZXDUPDQEFOYLOM-UHFFFAOYSA-O propylideneazanium Chemical group [CH2-]CC=[NH2+] ZXDUPDQEFOYLOM-UHFFFAOYSA-O 0.000 description 1
- NQLVQOSNDJXLKG-UHFFFAOYSA-N prosulfocarb Chemical compound CCCN(CCC)C(=O)SCC1=CC=CC=C1 NQLVQOSNDJXLKG-UHFFFAOYSA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- ASRAWSBMDXVNLX-UHFFFAOYSA-N pyrazolate Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=O)C=1C(C)=NN(C)C=1OS(=O)(=O)C1=CC=C(C)C=C1 ASRAWSBMDXVNLX-UHFFFAOYSA-N 0.000 description 1
- VTRWMTJQBQJKQH-UHFFFAOYSA-N pyributicarb Chemical compound COC1=CC=CC(N(C)C(=S)OC=2C=C(C=CC=2)C(C)(C)C)=N1 VTRWMTJQBQJKQH-UHFFFAOYSA-N 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching Effects 0.000 description 1
- ALZOLUNSQWINIR-UHFFFAOYSA-N quinmerac Chemical compound OC(=O)C1=C(Cl)C=CC2=CC(C)=CN=C21 ALZOLUNSQWINIR-UHFFFAOYSA-N 0.000 description 1
- 238000005215 recombination Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920002033 ribozyme Polymers 0.000 description 1
- MEFOUWRMVYJCQC-UHFFFAOYSA-N rimsulfuron Chemical compound CCS(=O)(=O)C1=CC=CN=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 MEFOUWRMVYJCQC-UHFFFAOYSA-N 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- MGLWZSOBALDPEK-UHFFFAOYSA-N simetryn Chemical compound CCNC1=NC(NCC)=NC(SC)=N1 MGLWZSOBALDPEK-UHFFFAOYSA-N 0.000 description 1
- 229940080281 sodium chlorate Drugs 0.000 description 1
- FUHMZYWBSHTEDZ-UHFFFAOYSA-M sodium;2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate Chemical compound [Na+].COC1=CC(OC)=NC(OC=2C(=C(OC=3N=C(OC)C=C(OC)N=3)C=CC=2)C([O-])=O)=N1 FUHMZYWBSHTEDZ-UHFFFAOYSA-M 0.000 description 1
- RTWIRLHWLMNVCC-UHFFFAOYSA-M sodium;2-[2-[[2-amino-4-[hydroxy(methyl)phosphoryl]butanoyl]amino]propanoylamino]propanoate Chemical compound [Na+].[O-]C(=O)C(C)NC(=O)C(C)NC(=O)C(N)CCP(C)(O)=O RTWIRLHWLMNVCC-UHFFFAOYSA-M 0.000 description 1
- VQOIVBPFDDLTSX-UHFFFAOYSA-M sodium;3-dodecylbenzenesulfonate Chemical class [Na+].CCCCCCCCCCCCC1=CC=CC(S([O-])(=O)=O)=C1 VQOIVBPFDDLTSX-UHFFFAOYSA-M 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 230000003068 static Effects 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- 230000036435 stunted growth Effects 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- PQTBTIFWAXVEPB-UHFFFAOYSA-N sulcotrione Chemical compound ClC1=CC(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O PQTBTIFWAXVEPB-UHFFFAOYSA-N 0.000 description 1
- ZDXMLEQEMNLCQG-UHFFFAOYSA-N sulfometuron methyl Chemical group COC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(C)=CC(C)=N1 ZDXMLEQEMNLCQG-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N t-BuOH Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- RJKCKKDSSSRYCB-UHFFFAOYSA-N tebutam Chemical compound CC(C)(C)C(=O)N(C(C)C)CC1=CC=CC=C1 RJKCKKDSSSRYCB-UHFFFAOYSA-N 0.000 description 1
- BCQMBFHBDZVHKU-UHFFFAOYSA-N terbumeton Chemical compound CCNC1=NC(NC(C)(C)C)=NC(OC)=N1 BCQMBFHBDZVHKU-UHFFFAOYSA-N 0.000 description 1
- IROINLKCQGIITA-UHFFFAOYSA-N terbutryn Chemical compound CCNC1=NC(NC(C)(C)C)=NC(SC)=N1 IROINLKCQGIITA-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- AHTPATJNIAFOLR-UHFFFAOYSA-N thifensulfuron-methyl Chemical group S1C=CC(S(=O)(=O)NC(=O)NC=2N=C(OC)N=C(C)N=2)=C1C(=O)OC AHTPATJNIAFOLR-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 238000002054 transplantation Methods 0.000 description 1
- WCZKTXKOKMXREO-UHFFFAOYSA-N triethylsulfanium Chemical compound CC[S+](CC)CC WCZKTXKOKMXREO-UHFFFAOYSA-N 0.000 description 1
- NRZWQKGABZFFKE-UHFFFAOYSA-N trimethylsulfonium Chemical compound C[S+](C)C NRZWQKGABZFFKE-UHFFFAOYSA-N 0.000 description 1
- PIHCREFCPDWIPY-UHFFFAOYSA-N tris[2-(2,4-dichlorophenoxy)ethyl] phosphite Chemical compound ClC1=CC(Cl)=CC=C1OCCOP(OCCOC=1C(=CC(Cl)=CC=1)Cl)OCCOC1=CC=C(Cl)C=C1Cl PIHCREFCPDWIPY-UHFFFAOYSA-N 0.000 description 1
- KVEQCVKVIFQSGC-UHFFFAOYSA-N tritosulfuron Chemical compound FC(F)(F)C1=NC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(F)(F)F)=N1 KVEQCVKVIFQSGC-UHFFFAOYSA-N 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 238000001238 wet grinding Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Abstract
The invention relates to the field of pesticide technology, and in particular to a type of Rpyridyloxycarboxylic acid and salt, ester derivative, preparation method, herbicidal composition and application thereof The Rpyridyloxycarboxylic acid is represented by formula
wherein, A, B each independently represent halogen, alkyl or cycloalkyl with or without halogen; C represents hydrogen, halogen, alkyl, haloalkyl; Q represents halogen, cyano, cyanoalkyl and the like; Y represents nitro or NR1R2; the salt is metal salt, amine salt,
Description
The invention relates to the field of pesticide technology, and in particular to a type of Rpyridyloxycarboxylic acid and sait, ester dérivative, préparation method, herbicidal composition and application thereof The R-pyridyloxycarboxylic acid is represented by formula
wherein, A, B each independently represent halogen, alkyl or cycloalkyl with or without halogen;
C represents hydrogen, halogen, alkyl, haloalkyl; Q represents halogen, cyano, cyanoalkyl and the like; Y represents nitro or NR1R2; the sait is métal sait, amine sait, sulfonium sait, phosphonium sait; the ester is 1-1 , wherein, X represents O or S; M represents alkyl, alkenyl, alkynyl and the like with or without halogen. The compound has excellent herbicidal activity and higher crop safety, especially good selectivity for key crops such as rice.
O.A.P.I. - B.P. 887, YAOUNDE (Cameroun) - Tel. (237) 222 20 57 00-Site web: http:/www.oapi.int- Email: oapi@oapi.int
R-pyridyloxycarboxylic acid and sait, ester dérivative, préparation method, herbicidal composition and application thereof
Technical Field
The invention relates to the field of pesticide technology, and in particular a type of R-pyridyloxycarboxylic acid and sait, ester dérivative, préparation method, herbicidal composition and application thereof.
Technical background
Weed control is one of the most important links in the course of achieving high-efficiency agriculture. Varions herbicides are available in the market, for example, DE2335349A1, GB1418979A, US3761486 and the like disclose a sériés of compounds represented by the
Ri X-Z-/X FM Jl JC CC general formula R2 n o R and application thereof as herbicides, but enantiomers of the compounds are not mentioned. Scientists still need to do continuously research and develop new herbicides with high efficacy, safety, économies and different modes of action due to problems such as the growing market, weed résistance, the service life and économies of pesticides as well as people’s increasing concem on environment.
Invention contents
The présent invention provides a type of R-pyridyloxycarboxylic acid and sait, ester dérivative, préparation method, herbicidal composition and application thereof. The compound has excellent herbicidal activity and higher crop safety, especially good selectivity for key crops such as rice.
The technical solution adopted by the invention is as foliows:
The présent invention provides an R-pyridyloxycarboxylic acid represented by formula I and sait, ester dérivative thereof,
wherein, A, B each independently represent halogen; or alkyl or cycloalkyl with or without halogen;
C represents hydrogen, halogen, alkyl or haloalkyl;
Q represents halogen, cyano, cyanoalkyl, hydroxyalkyl, amino, nitro, formyl; alkyl, alkenyl, i
alkynyl, cycloalkyl, alkoxy, alkylthio, alkyl carbonyl, alkoxycarbonyl, alkylaminoalkyl or alkoxyalkyl with or without halogen; or unsubstituted or substituted aryl, heteroaryl, arylalkyl, heteroarylalkyl;
Y represents nitro or NRiR2, wherein Ri représente H; alkyl, alkenyl or alkynyl optionally substituted by 1-2 Ru; -COR12, nitro, ORu, SO2Ri4, NR15R16, N=CRiyRi8, alkylcarbamoyl, dialkylcarbamoyl, trialkylsilyl or dialkylphosphono; R2 represents H; alkyl optionally substituted by 1-2 Ru; or -CORi2; or NR1R2 represents N=CR2iNR22R23, N=CR24OR25; or a 5- or 6-membered saturated or unsaturated ring with or without oxygen atom, sulfiir atom, or other nitrogen atom, which is unsubstituted or substituted by 1-2 groups independently selected from the group consisting of halogen, alkyl, alkoxy, haloalkoxy, alkylthio, haloalkylthio, amino, alkylamino, dialkylamino, alkoxycarbonyl;
wherein Ru independently represents halogen, hydroxy, alkoxy, haloalkoxy, alkylthio, haloalkylthio, amino, alkylamino, dialkylamino, alkoxycarbonyl; or unsubstituted or substituted aryl, heteroaryl;
R12 represents H, alkyl, haloalkyl, alkoxy, phenyl, phenoxy or benzyloxy;
R13 represents H, alkyl, haloalkyl, phenyl, benzyl or CHR3iC(O)OR32; R31 represents H, alkyl or alkoxy; R32 represents H, alkyl or benzyl;
R14 represents alkyl or haloalkyl;
R15 represents H, alkyl, formyl, alkylacyl, haloalkylacyl, alkoxycarbonyl, phenylcarbonyl, phenoxycarbonyl or benzyloxycarbonyl; Ri6 represents H or alkyl;
R17 represents H, alkyl; or phenyl that is unsubstituted or substituted by 1-3 groups selected from the group consisting of halogen, alkyl, alkoxy; RiS represents H or alkyl; or N=CRi7R18 ,N=\ J \ represents or \__/ ;
R2i, R24 each independently represent H or alkyl;
R22, R23 each independently represent H or alkyl; or NR22R23 represents a 5- or 6-membered saturated or unsaturated ring with or without oxygen atom, sulfiir atom, or other nitrogen atom;
R25 represents alkyl;
the sait is métal sait, amine sait, sulfonium sait or phosphonium sait;
Y
O the ester is □ -1 , wherein, X represents O or S;
Ο
II . Ο
Μ represents alkyl, alkenyl, alkynyl, cycloalkyl, cycloalkylalkyl, -alkyl-Z, Y R3, < ô ,
O R4>j'R5 iR3 Yr< γ 0 , r5 , r5 , O with or without halogen; or unsubstituted or substituted heterocyclyl, aryl, heteroaryl;
7 7% vV V4
Z represents * Ύ y o ; q , Rs , Rs , Rs , cyano, nitro, or unsubstituted or substituted heterocyclyl, aryl, heteroaryl;
R3 each independently represents alkyl, alkenyl, alkynyl, cycloalkyl, cycloalkylalkyl or unsubstituted or substituted heterocyclyl, aryl, heteroaryl, heterocyclylalkyl, arylalkyl, heteroarylalkyl;
R4, R5, Rô each independently represent hydrogen, alkyl, alkenyl, alkynyl, cycloalkyl, cycloalkylalkyl, alkoxycarbonyl or unsubstituted or substituted heterocyclyl, aryl, heteroaryl, heterocyclylalkyl, arylalkyl, heteroarylalkyl.
Preferably, A, B each independently represent halogen; or C1-C8 alkyl or C3-C8 cycloalkyl with or without halogen;
C represents hydrogen, halogen, C1-C8 alkyl or halo C1-C8 alkyl;
Q represents halogen, cyano, cyano C1-C8 alkyl, hydroxy C1-C8 alkyl, amino, nitro, formyl; C1-C8 alkyl, C2-C8 alkenyl, C2-C8 alkynyl, C3-C8 cycloalkyl, C1-C8 alkoxy, C1-C8 alkylthio, C1-C8 alkylcarbonyl, C1-C8 alkoxycarbonyl, C1-C8 alkylamino C1-C8 alkyl or C1-C8 alkoxy C1-C8 alkyl with or without halogen; or unsubstituted or substituted aryl, heteroaryl, aryl C1-C8 alkyl, heteroaryl C l -C8 alkyl;
Y represents nitro or NRiR2, wherein Ri represents H; C1-C8 alkyl, C2-C8 alkenyl or C2-C8 alkynyl optionally substituted by 1-2 Ru; -COR12, nitro, OR13, SO2R14, NR15R16, N=CR17R18, C1-C8 alkylcarbamoyl, di-Cl-C8 alkylcarbamoyl, tri-Cl-C8 alkylsilyl or di-Cl-C8 alkylphosphono; R2 represents H; C1-C8 alkyl optionally substituted by 1-2 Ru; or -COR12; or > Ύ -¾ Y /n'Y /n'Y
NRiR2 represents N=CR2iNR22R23, N=CR24OR25; or NV-J, N\Y La , or that is unsubstituted or substituted by 1-2 groups independently selected from the group consisting of halogen, C1-C8 alkyl, C1-C8 alkoxy, halo C1-C8 alkoxy, C1-C8 alkylthio, halo C1-C8 alkylthio, amino, C1-C8 alkylamino, di-Cl-C8 alkylamino, C1-C8 alkoxycarbonyl;
wherein Ru independently represents halogen, hydroxy, C1-C8 alkoxy, halo C1-C8 alkoxy, C1-C8 alkylthio, halo C1-C8 alkylthio, amino, C1-C8 alkylamino, di-Cl-C8 alkylamino, C1-C8 alkoxycarbonyl; or phenyl, naphthyl,
that is unsubstituted or substituted by 1-3 groups selected from the group consisting of halogen, C1-C8 alkyl, halo C1-C8 alkyl, C1-C8 alkoxy, nitro;
R12 represents H, C1-C18 alkyl, halo C1-C8 alkyl, C1-C8 alkoxy, phenyl, phenoxy or benzyloxy;
R13 represents H, C1-C8 alkyl, halo C1-C8 alkyl, phenyl, benzyl or CHR3iC(O)OR32; R31 represents H, C1-C8 alkyl or C1-C8 alkoxy; R32 represents H, C1-C8 alkyl or benzyl;
Ru represents C1-C8 alkyl or halo C1-C8 alkyl;
R15 represents H, C1-C8 alkyl, formyl, C1-C8 alkylacyl, halo C1-C8 alkylacyl, C1-C8 alkoxycarbonyl, phenylcarbonyl, phenoxycarbonyl or benzyloxycarbonyl; R16 represents H or C1-C8 alkyl;
Rn represents H, C1-C8 alkyl; or phenyl that is unsubstituted or substituted by 1-3 groups selected from the group consisting of halogen, C1-C8 alkyl, C1-C8 alkoxy; R18 represents H or
Cl-C8 alkyl; or N=CRi7Rts represents or
R21, R24 each independently represent H or C1-C8 alkyl;
R22, R23 each independently represent H or C1-C8 alkyl; or NR22R23 represents NO,
R25 represents C1-C8 alkyl;
the sait is métal sait, ammonium sait NH4 +, primary amine RNH2 sait, secondary amine (R)2NH sait, tertiary amine (R)3N sait, quatemary amine sait (R)4N+, morpholine sait, piperidine sait, pyridine sait, aminopropyl morpholine sait, Jeff amine D-230 sait, the sait of 2,4,6-tri(dimethylaminomethyl) phénol and sodium hydroxide, alkylsulfonium sait, alkylsulfoxonium sait, alkylphosphonium sait or alkanolphosphonium sait;
wherein, R each independently represents unsubstituted alkyl, alkenyl, alkynyl, cycloalkyl or phenyl, and the foregoing groups are optionally substituted by one or more of the following groups: halogen, hydroxy, alkoxy, alkylthio, hydroxyalkoxy, amino, alkylamino, amino alkylamino, phenyl;
in formula 1-1, X represents O or S;
M represents Cl-Cl 8 alkyl, C2-C8 alkenyl, C2-C8 alkynyl, C3-C8 cycloalkyl, C3-C8
O ο Λ JL R Ύ”4 .\nYr-> cycloalkyl C1-C8 alkyl, -(C1-C8 alkyl)-Z, V Ύ * 6 A ΑΌ , R5 , r5 ; ·,Α
O with or without halogen, or unsubstituted or substituted heterocyclyl, aryl, heteroaryl;
t0 A r *>'V4 A'”4 ‘V1’4
Z represents 1 R3, Λ O ; o , Rs , R5 , Rs , cyano, nitro, or unsubstituted or substituted heterocyclyl, aryl, heteroaryl;
R3 each independently represents C1-C8 alkyl, C2-C8 alkenyl, C2-C8 alkynyl, C3-C8 cycloalkyl, C3-C8 cycloalkyl C1-C8 alkyl or unsubstituted or substituted heterocyclyl, aryl, heteroaryl, heterocyclyl C1-C8 alkyl, aryl C1-C8 alkyl, heteroaryl C1-C8 alkyl;
R4, R5, Rô each independently represent hydrogen, C1-C8 alkyl, C2-C8 alkenyl, C2-C8 alkynyl, C3-C8 cycloalkyl, C3-C8 cycloalkyl C1-C8 alkyl, C1-C8 alkoxycarbonyl or unsubstituted or substituted heterocyclyl C1-C8 alkyl, aryl C1-C8 alkyl, heteroaryl C1-C8 alkyl;
R' i rA t <ov s . M aî
Ύύ0 M? ' r / -l— 5 hN 7 4— h |—N the term “heterocyclyl” refers to v h—I ; « </ I I
or with 0, 1 or 2 oxo groups; the term “aryl” refers to phenyl or naphthyl; the term “heteroaryl” refers to an aromatic ring group containing 3 to 6 ring atoms and is optionally fused via benzo ring, 1 to 4 heteroatoms in the ring atoms being
selected from oxygen, nitrogen and sulfur, for example,
group selected from the group consisting of halogen, nitro, cyano, thiocyano, hydroxy, carboxy, mercapto, formyl; phenyl, benzyl, benzyloxy, phenoxy that is unsubstituted or substituted by at least one group from the group consisting of halogen, alkyl, alkoxy; alkyl, alkenyl, alkynyl, cycloalkyl, cycloalkylalkyl, OR”, SR”, -alkyl-OR”, -alkyl-SR”, COR”, COOR”, COSR”, SOR”, SO2R”, OCOR”, SCOR” with or without halogen; and amino or aminocarbonyl substituted by one or two groups selected from the group consisting of hydrogen, alkyl, alkenyl, alkynyl, cycloalkyl, cycloalkylalkyl, phenyl, benzyl, benzyloxy, phenoxy, COR”, COOR”, SO2R”, OR”;
R’ each independently represents hydrogen, nitro, hydroxy, amino; or alkyl, alkenyl, alkynyl, cycloalkyl, cycloalkenyl, cycloalkylalkyl, alkoxy, alkenyloxy, alkynyloxy, cycloalkyloxy, alkoxyalkyl, alkoxycarbonyl, alkylthiocarbonyl, alkylsulfonyl, alkylsulfonylalkyl, alkylcarbonyl, alkylcarbonylalkyl, alkylacyloxy, alkylamino, alkylaminocarbonyl, alkoxyaminocarbonyl, alkoxycarbonylalkyl, alkylaminocarbonylalkyl, trialkylsilyl, dialkylphosphono with or without halogen;
R” each independently represents hydrogen, alkyl, alkenyl, alkynyl, cycloalkyl or cycloalkylalkyl.
More preferably, A, B each independently represent halogen; or C1-C6 alkyl or C3-C6 cycloalkyl with or without halogen;
C represents hydrogen, halogen, C1-C6 alkyl or halo C1-C6 alkyl;
Q represents halogen, cyano, cyano C1-C6 alkyl, hydroxy CT-C6 alkyl, amino, nitro, formyl; C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C1-C6 alkoxy, C1-C6 alkylthio, C1-C6 alkylcarbonyl, C1-C6 alkoxycarbonyl, C1-C6 alkylamino C1-C6 alkyl or C1-C6 alkoxy C1-C6 alkyl with or without halogen; or unsubstituted or substituted aryl, heteroaryl, aryl C1-C6 alkyl, heteroaryl C1-C6 alkyl;
Y represents nitro or NRiR2, wherein Ri represents H; C1-C6 alkyl, C2-C6 alkenyl or C2-C6 alkynyl optionally substituted by 1-2 RH; -CORi2, nitro, OR]3, SO2R14, NRi5R16, N=CR17Ri8, C1-C6 alkylcarbamoyl, di-Cl-C6 alkylcarbamoyl, tri-Cl-C6 alkylsilyl or di-Cl-C6 alkylphosphono; R2 represents H; C1-C6 alkyl optionally substituted by 1-2 Ru; or -COR12; or
NR]R2 represents N=CR2iNR22R23, N=CR24OR25; or \-k, k/, kk or k^O that is unsubstituted or substituted by 1-2 groups independently selected from the group consisting of halogen, C1-C6 alkyl, C1-C6 alkoxy, halo C1-C6 alkoxy, C1-C6 alkylthio, halo C1-C6 alkylthio, amino, C1-C6 alkylamino, di-Cl-C6 alkylamino, C1-C6 alkoxycarbonyl;
wherein Ru independently represents halogen, hydroxy, C1-C6 alkoxy, halo C1-C6 alkoxy, C1-C6 alkylthio, halo C1-C6 alkylthio, amino, C1-C6 alkylamino, di-Cl-C6 alkylamino, C1-C6 alkoxycarbonyl; or phenyl, naphthyl
that is unsubstituted or substituted by 1-3 groups selected from the group consisting of halogen, C1-C6 alkyl, halo C1-C6 alkyl, C1-C6 alkoxy, nitro;
R12 représente H, Cl-Cl 4 alkyl, halo C1-C6 alkyl, C1-C6 alkoxy, phenyl, phenoxy or benzyloxy;
Ri3 represents H, C1-C6 alkyl, halo C1-C6 alkyl, phenyl, benzyl or CHR3iC(O)OR32; R3i represents H, C1-C6 alkyl or C1-C6 alkoxy; R32 represents H, C1-C6 alkyl or benzyl;
Ru represents C1-C6 alkyl or halo C1-C6 alkyl;
Ris represents H, C1-C6 alkyl, formyl, C1-C6 alkylacyl, halo C1-C6 alkylacyl, C1-C6 alkoxycarbonyl, phenylcarbonyl, phenoxycarbonyl or benzyloxycarbonyl; R16 represents H or C1-C6 alkyl;
Ri7 represents H, C1-C6 alkyl; or phenyl that is unsubstituted or substituted by 1-3 groups selected from the group consisting of halogen, C1-C6 alkyl, C1-C6 alkoxy; RIg represents H or C1-C6 alkyl; or N=CRi7Ris represents or CZ/*;
R21, R24 each independently represent H or C1-C6 alkyl;
R22, R23 each independently represent H or C1-C6 alkyl; or NR22R23 represents NO,
XJ Q L J L o v—J, ta , x/ or ---%
R25 represents C1-C6 alkyl;
the sait is métal sait, ammonium sait NH/, primary amine RNH2 sait, secondary amine (R)2NH sait, tertiary amine (R)3N sait, quatemary amine sait (R)4N+, morpholine sait, piperidine sait, pyridine sait, aminopropyl morpholine sait, Jeff amine D-230 sait, the sait of 2,4,6-tri(dimethylaminomethyl) phénol and sodium hydroxide, Cl-Cl 8 alkylsulfonium sait, Cl-Cl 8 alkylsulfoxonium sait, Cl-Cl 8 alkylphosphonium sait or Cl-Cl 8 alkanolphosphonium sait;
wherein, R each independently represents unsubstituted Cl-Cl 8 alkyl, C2-C18 alkenyl, C2-C18 alkynyl, C3-C18 cycloalkyl or phenyl, and the foregoing groups are optionally substituted by one or more of the following groups: halogen, hydroxy, C1-C8 alkoxy, C1-C8 alkylthio, hydroxy C1-C8 alkoxy, amino, C1-C8 alkylamino, amino C1-C8 alkylamino, phenyl;
in formula 1-1, X represents O or S;
M represents Cl-Cl 8 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C3-C6
O ,0 X A r X·4 Va4 cycloalkyl C1-C6 alkyl, -(C1-C6 alkyl)-Z, V A * 6 3, VO' \ R5 ; R5 ,
R4-n.R5 ./γοκ6
O with or without halogen, or unsubstituted or substituted heterocyclyl, aryl, heteroaryl;
O 7 vo.R jn.R, m ^v*4 A-*4 Δ4
Z represents 1 K3, A O ; o , Rs , R5 , Rs , cyano, nitro, or unsubstituted or substituted heterocyclyl, aryl, heteroaryl;
R3 each independently represents C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C3-C6 cycloalkyl C1-C6 alkyl or unsubstituted or substituted heterocyclyl, aryl, heteroaryl, heterocyclyl C1-C6 alkyl, aryl C1-C6 alkyl, heteroaryl C1-C6 alkyl;
R4, R5, Rê each independently represent hydrogen, C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C3-C6 cycloalkyl C1-C6 alkyl, C1-C6 alkoxycarbonyl or unsubstituted or substituted heterocyclyl C1-C6 alkyl, aryl C1-C6 alkyl, heteroaryl C1-C6 alkyl;
R' i o rA . t ,, T / 4— > an 1 4τ- b 1— n the term heterocyclyl” refers to V 11—I A/ \ ' 5 AA ।
R'
1Ej , LA, A^O or A-0 with 0, 1 or 2 oxo groups; the term “aryl”
refers to phenyl or naphthyl; the term “heteroaryl” refers to
selected from the group consisting of halogen, nitro, cyano, thiocyano, hydroxy, carboxy, mercapto, formyl; phenyl, benzyl, benzyloxy, phenoxy that is unsubstituted or substituted by at least one group from the group consisting of halogen, C1-C6 alkyl, C1-C6 alkoxy; C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C3-C6 cycloalkyl C1-C6 alkyl, OR”, SR”, -(Cl-C6)alkyl-OR”, -(Cl-C6)alkyl-SR”, COR”, COOR”, COSR”, SOR”, SO2R”, OCOR”,
SCOR” with or without halogen; and amino or aminocarbonyl substituted by one or two groups selected from the group consisting of hydrogen, C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C3-C6 cycloalkyl C1-C6 alkyl, phenyl, benzyl, benzyloxy, phenoxy, COR”, COOR”, SO2R”, OR”;
R’ each independently represents hydrogen, nitro, hydroxy, amino; or C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C3-C6 cyclo alkenyl, C3-C6 cycloalkyl C1-C6 alkyl, C1-C6 alkoxy, C2-C6 alkenyloxy, C2-C6 alkynyloxy, C3-C6 cycloalkyloxy, C1-C6 alkoxy C1-C6 alkyl, C1-C6 alkoxycarbonyl, C1-C6 alkylthiocarbonyl, C1-C6 alkylsulfonyl, C1-C6 alkylsulfonyl C1-C6 alkyl, C1-C6 alkylcarbonyl, C1-C6 alkylcarbonyl CbC6 alkyl, C1-C6 alkylacyloxy, C1-C6 alkylamino, C1-C6 alkylaminocarbonyl, C1-C6 alkoxyaminocarbonyl, C1-C6 alkoxycarbonyl C1-C6 alkyl, C1-C6 alkylaminocarbonyl C1-C6 alkÿl, tri-Cl-C6 alkylsilyl, di-C 1-C6 alkylphosphono with or without fluoro, chloro or bromo;
R” each independently represents hydrogen, C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl or C3-C6 cycloalkyl C1-C6 alkyl.
Further preferably, A, B each independently represent halogen, C1-C6 alkyl, halo C1-C6 alkyl or C3-C6 cycloalkyl;
C represents hydrogen, halogen, C1-C6 alkyl or halo C1-C6 alkyl;
Q represents C1-C6 alkyl, halo C1-C6 alkyl, C3-C6 cycloalkyl, C2-C6 alkenyl, C2-C6 alkynyl, halogen, cyano, amino, nitro, formyl, C1-C6 alkoxy, C1-C6 alkylthio, C1-C6 alkoxycarbonyl, hydroxy C1-C6 alkyl, C1-C6 alkoxy C1-C2 alkyl, cyano C1-C2 alkyl, C1-C6 . t) alkylamino C1-C2 alkyl, benzyl, naphthyl, furyl, thienyl, thiazolyl, pyridyl, pyrimidinyl; R1' that is unsubstituted or substituted by C1-C6 alkyl; or phenyl that is unsubstituted or substituted by at least one group selected from the group consisting of C1-C6 alkyl, halo C1-C6 alkyl, halogen and C1-C6 alkoxy;
Y represents amino, C1-C6 alkylamino, C1-C6 alkylcarbonylamino, phenylcarbonylamino, benzylamino; or furylmethyleneamino that is unsubstituted or substituted by halo C1-C6 alkyl;
the sait is métal sait, ammonium sait NH4 +, primary amine RNH2 sait, secondary amine (R)2NH sait, tertiary amine (R)3N sait, quatemary amine sait (R)4N+, morpholine sait, piperidine sait, pyridine sait, aminopropyl morpholine sait, Jeff amine D-230 sait, the sait of 2,4,6-tri(dimethylaminomethyl) phénol and sodium hydroxide, Cl-Cl 4 alkylsulfonium sait, C1-C14 alkylsulfoxonium sait, C1-C14 alkylphosphonium sait or C1-C14 alkanolphosphonium sait;
wherein, R each independently represents unsubstituted C1-C14 alkyl, C2-C12 alkenyl, C2-C12 alkynyl, C3-C12 cycloalkyl or phenyl; or C1-C14 alkyl optionally substituted by one or more of the following groups: halogen, hydroxy, C1-C6 alkoxy, C1-C6 alkylthio, hydroxy C1-C6 alkoxy, amino, C1-C6 alkylamino, amino C1-C6 alkylamino, phenyl;
in formula 1-1, X represents O or S;
M represents C1-C18 alkyl (preferably C1-C12 alkyl, more preferably C1-C8 alkyl, further preferably C1-C6 alkyl), halo C1-C8 alkyl, C3-C6 cycloalkyl, C2-C6 alkenyl, halo C2-C6 alkenyl, C2-C6 alkynyl, C1-C6 alkoxy, C1-C6 alkoxycarbonyl, C1-C6 alkylsulfonyl, cyano C1-C6 alkyl (preferably cycno C1-C2 alkyl), nitro C1-C6 alkyl (preferably nitro C1-C2 alkyl), C1-C6 alkoxy C1-C6 alkyl (preferably C1-C6 alkoxy C1-C2 alkyl), C1-C6 alkoxycarbonyl C1-C6 alkyl (preferably C1-C6 alkoxycarbonyl C1-C2 alkyl), C2-C6 alkenyloxycarbonyl C1-C6 alkyl (preferably C2-C6 alkenyloxycarbonyl C1-C2 alkyl), -(C1-C6 alkyl)-Z (preferably -(Cl-C2 o R<NRs .
X n'”4 ^γ”4 Αγθ^ alkyl)-Z), Rs , Rs , O , tetrahydrofuryl, pyridyl, naphthyl, furyl, thienyl,
Y \ Il Y N-N _
Y that is unsubstituted or substituted by C1-C6 alkyl; or phenyl that is unsubstituted or substituted by C1-C6 alkyl, halo C1-C6 alkyl, C1-C6 alkylamino, halogen or C1-C6 alkoxy;
o •<0 Y%3 ΑΛγ4 A'’4 /'N'*4 Tl 41 II 3 I l i N—N
Z represents O , R 5 , Rs , Rs , tetrahydrofuryl, pyridyl, r·' , thienyl, furyl, naphthyl; or phenyl that is unsubstituted or substituted by at least one group selected from the group consisting of C1-C6 alkyl, C1-C6 alkoxy, halo C1-C6 alkyl, cyano and halogen;
R3 each independently represents C1-C6 alkyl;
R4, R5, Rô each independently represent hydrogen, C1-C6 alkyl or C1-C6 alkoxycarbonyl;
R’ represents hydrogen, C1-C6 alkyl or halo C1-C6 alkyl.
More further preferably, A, B each independently represent fluoro, chloro, bromo, iodo, methyl, ethyl, propyl, isopropyl, trifluoromethyl or cyclopropyl;
C represents hydrogen, fluoro, chloro, bromo, iodo, methyl or trifluoromethyl;
Q represents methyl, ethyl, propyl, isopropyl, cyclopropyl, vinyl, ethynyl, fluoro, chloro, bromo, cyano, amino, nitro, formyl, methoxy, methylthio, methoxycarbonyl, monochloromethyl, monofluoromethyl, difluoromethyl, trifluoromethyl, 2-chloro ethyl, 2,2,2-trifluoroethyl, hydroxymethyl, \ \ Υή | , NC Y Y A benzyl, naphthyl, furyl, thiazolyl, pyridyl, pyrimidinyl; thiazolyl that is unsubstituted or substituted by chloro; thienyl that is
X
N-N unsubstituted or substituted by fluoro; R,z that is unsubstituted or substituted by methyl or fluoro; or phenyl that is unsubstituted or substituted by at least one group selected from the group consisting of methyl, trifluoromethyl, chloro and methoxy;
O
H H H ÇA 5 M 5 N X HN q Μ Λν /
Y represents NH2, Y ''Ύ τ , A ; H
PF3 h '' V o or the sait is métal sait, ammonium sait NH4 +, primary amine RNH2 sait, secondary amine (R)2NH sait, tertiary amine (R)3N sait, quatemary amine sait (R)4N+, morpholine sait, piperidine sait, pyridine sait, aminopropyl morpholine sait, Jeff amine D-230 sait, the sait of
2,4,6-tri(dimethylaminomethyl) phénol and sodium hydroxide, C1-C6 alkylsulfonium sait, C1-C6 alkylsulfoxonium sait, C1-C6 alkylphosphonium sait, or C1-C6 alkanolphosphonium sait;
wherein, R each independently represents unsubstituted Cl-Cl 4 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C12 cycloalkyl, phenyl or benzyl; or C1-C14 alkyl optionally substituted by one or more of the following groups: hydroxy, C1-C4 alkoxy, C1-C4 alkylthio, hydroxy C1-C4 alkoxy, amino, C1-C4 alkylamino, amino C1-C4 alkylamino;
the sait is preferably alkali métal (such as sodium, lithium, potassium, césium or rubidium) sait, alkaline earth métal (such as calcium, magnésium, barium or strontium) sait, heavy métal (such as antimony, zinc, bismuth, cadmium, cérium, chromium, cobalt, copper, iron or other metals with a density greater than 4) sait, aluminum sait, amine sait such as ammonium sait, tétraméthylammonium sait, tetraethylammonium sait, tetrapropyl ammonium sait, tetraisopropylammonium sait, tetrabutylammonium sait, benzyltrimethylammonium sait, benzyltriéthylammonium sait, choline amine sait, monomethylamine sait, dimethylamine sait, trimethylamine sait, monoethylamine sait, diethylamine sait, triethylamine sait, monoisopropylamine sait, diisopropylamine sait, triisopropylamine sait, monoisobutylamine sait, pentylamine sait, hexylamine sait, heptylamine sait, dodecylamine sait, tetradecyl amine sait, diallylamine sait, cyclododecylamine sait, benzylamine sait, monoethanolamine sait, diethanolamine sait, triethanolamine sait, tripropanolamine sait, triisopropanolamine sait, tri(2-hydroxypropyl)amine sait, methylmonoethanolamine sait, dimethylmonoethanolamine sait, methyldiethanolamine sait, diethylethanolamine sait, diglycolamine sait, sait of polyamine (for example, diethylenetriamine sait, dimethylaminopropylamine sait, 1,2-propyldiamine sait, triethylenetetramine sait, N,N-bis[aminopropyl]methylamine sait), 2-methylthiopropylamine sait,
HO. ! HO OH _ H2N
2-butoxyethylamine sait, AEPD ( oh) sait, tri(methylol) aminomethane ( oh) sait,
O /N—\ morpholine sait, piperidine sait, pyridine sait, aminopropyl morpholine ( nh2) sait,
T rc H2b‘'''-X .
Jeff amine D-230 ( n , n is 2 or 3) sait, the sait of 2,4,6-tri(dimethylaminomethyl) phénol and sodium hydroxide, sulfonium sait such as alkylsulfonium sait (such as trimethylsulfonium sait, triethylsulfonium sait), alkylsulfoxonium sait, phosphonium sait such as alkylphosphonium sait or alkanolphosphonium sait;
in formula 1-1, X represents O or S;
M represents methyl, ethyl, propyl, isopropyl, n-butyl, sec-butyl, isobutyl, tert-butyl, pentyl, hexyl, heptyl, octyl, nonyl, decyl, undecyl, dodecyl, octadecyl, trifluoromethyl, pentafluoroethyl, 3-chlorobutyl, 2-fluoroethyI, 2-chloroethyl, 2-bromoethyl, 2,2-difluoroethyl, 2,2,2-trifluoroethyl, 4,4,4-trifluorobutyl, 2,2,3,3,3-pentafluoropropyl, cyclopropyl, cyclobutyl, cyclopentyl, cyclohexyl, allyl, 2-propynyl, methoxy, ethoxycarbonyl, methylsulfonyl, >%CN 5
/ or / )that is unsubstituted or substituted by methyl; phenyl that is unsubstituted or substituted by methyl, dimethylamino, chloro, methoxy, trifluoromethyl or isopropyl; or benzyl that is unsubstituted or substituted by trifluoromethyl, bromo, chloro, fluoro, methoxy, cyano or methyl;
R’ represents hydrogen, methyl, ethyl or difluoromethyl.
In the définition of the compound represented by the above general formula I and in ail the structural formula below, the term, whether used alone or in a compound name, refers to the following substituent: an alkyl group having more than two carbon atoms may be straight or branched. For example, in the compound name “-alkyl-OR””, alkyl may be -CH2-, -CH2CH2-, -CH(CH3)-, -C(CH3)2- and the like. The alkyl group is, for example, Cl alkyl-methyl; C2 alkyl-ethyl; C3 alkyl-propyl such as n-propyl or isopropyl; C4 alkyl-butyl such as n-butyl, isobutyl, tert-butyl or 2-butyl; C5 alkyl-pentyl such as n-pentyl; C6-alkyl-hexyl such as n-hexyl, isohexyl or 1,3-dimethylbutyl. Similarly, alkenyl includes, for example, allyl, l-methylprop-2-en-l-yl, 2-methylprop-2-en-l-yl, but-2-en-l-yl, but-3-en-l-yl, l-methylbut-3-en-l-yl and l-methylbut-2-en-l-yl. Alkynyl includes, for example, propargyl, but-2-yn-l-yl, but-3-yn-l-yl, l-methylbut-3-yn-l-yl. Multiple bond can be at any position of each unsaturated group. Cycloalkyl is a carbocyclic saturated ring System having, for example, three to six carbon atoms, such as cyclopropyl, cyclobutyl, cyclopentyl or cyclohexyl. Similarly, cycloalkenyl is a monocyclic alkenyl having, for example, three to six carbocyclic members, such as cyclopropenyl, cyclobutenyl, cyclopentenyl, and cyclohexenyl, wherein double bond can be at any position. Halogen is fluorine, chlorine, bromine or iodine.
If a group is substituted by a group, it is understood to mean that the group is substituted by one or more identical or different groups selected from those mentioned above. Further, the same or different substitution characters contained in the same or different substituents are independently selected, and may be the same or different.
In addition, unless specifically indicated, the term occurring before or after multiple juxtaposed substituents (separated by or “or”) in the présent invention has a limiting effect on each of the subséquent substituents, for example, the term “unsubstituted or substituted” in the expression “unsubstituted or substituted aryl, heteroaryl, arylalkyl, heteroarylalkyl” has a limiting effect on each of the subséquent groups “aryl”, “heteroaryl”, “arylalkyl” and “heteroarylalkyl”.
The préparation method of the R-pyridyloxycarboxylic acid and sait, ester dérivative thereof comprises the following steps.
A compound of formula III is reacted with a compound of formula II to obtain a compound of formula I-1 -1 ; the reaction scheme is as follows:
wherein, W represents an alkali métal, preferably K, Na; Hal represents halogen, preferably Br, Cl; the reaction is carried out in the presence of a catalyst and a solvent. Preferably, the catalyst is TBAB, and the solvent is one or more selected from the group consisting of DCM, DCE, ACN, THF, DMF.
The compound of formula 1-1-1 is reacted in the presence of a lithium hydroxide aqueous solution and a solvent to obtain a compound of formula I; the reaction scheme is as follows:
□ -1-1 preferably, the solvent is one or more selected from the group consisting of methanol, éthanol, and isopropanol.
The compound of formula I is reacted with M-SH to obtain a compound of formula 1-1-2; the reaction scheme is as follows:
wherein, the reaction is carried out in the presence of a dehydrant and a solvent, preferably the dehydrant is DCC, and the solvent is one or more selected from the group consisting of dichloromethane, dichloroethane, acetonitrile, Ν,Ν-dimethylformamide, N,N-dimethylacetamide, dimethyl sulfoxide, tetrahydrofuran, toluene, xylene;
or, when Y represents NRiR2 (Ri, R2 are not hydrogen at the same time), it is obtained by nh2
C^rAo^°H O reacting a compound of formula 1-2 Q-2 or a compound of formula 1-1-3 nh2
[ ( Q*
C NX O'^X'M
O α -1-3 with a corresponding halide;
wherein, the halide is preferably chloride or bromide; the reaction is carried out in the presence of a base and a solvent, wherein the base is one or more selected from the group consisting of sodium hydroxide, potassium hydroxide, sodium carbonate, potassium carbonate, sodium bicarbonate and césium carbonate; the solvent is one or more selected from the group consisting of THF, 1,4-dioxane, toluene, 1,2-dichloroethane, ethyl acetate, acetonitrile, DMF, acetone, dichloromethane and chloroform; a catalyst, preferably DMAP, is optionally added during the reaction.
The sait is an agrochemically acceptable sait, which is preferably prepared by reacting the R-pyridyloxycarboxylic acid compound of the présent invention with a chemically acceptable basic compound.
For example, in the présent application, the diethylamine sait is prepared by reacting the R-pyridyloxycarboxylic acid compound of the présent invention with diethylamine.
For another example, the sait of 2,4,6-tri(dimethylaminomethyl) phénol and sodium hydroxide refers to the sait obtained by reacting the R-pyridyloxycarboxylic acid compound of the présent invention with 2,4,6-tri(dimethylaminomethyl) phénol and sodium hydroxide
OH (CH, Xh-CH,-<q^- CH2-H(CH, )a
7^ 4-HaOH
CH2-H(CH3 X _
The aforesaid agrochemically acceptable sait can be easily separated and can be purified by conventional séparation methods such as solvent extraction, dilution, recrystallization, column chromatography, and préparative thin layer chromatography.
The présent invention provides a herbicidal composition comprising (i) at least one of an R-type pyridyloxycarboxylic acid of the formula I and sait, ester dérivative thereof; preferably, further comprising (ii) one or more further herbicides and/or safeners; more preferably, further comprising (iii) agrochemically acceptable formulation auxiliaries.
The présent invention provides a method for controlling a weed comprising applying a herbicidally effective amount of at least one of the R-type pyridyloxycarboxylic acid and sait, ester dérivative thereof or the herbicidal composition on a plant or in a weed area. Preferably, the plant is rice, or the weed is a gramineous weed (such as Echinochloa crusgalli, Digitaria sanguinalis, Semen Euphorbiae Lathyridis) or a broad-leaved weed (such as Monochorîa Vaginalis, Abutilon theophrasti Medic., Galium aparine).
Use of at least one of the R-pyridyloxycarboxylic acid and sait, ester dérivative thereof or the herbicidal composition for controlling a weed, preferably, the R-pyridyloxycarboxylic acid and sait, ester dérivative thereof being used to control a weed in a useful crop, wherein the useful crop is a genetically modified crop or a crop treated by gene editing technology. Preferably, the crop is rice, or the weed is a gramineous weed (such as Echinochloa crusgalli, Digitaria sanguinalis, Semen Euphorbiae Lathyridis) or a broad-leaved weed (such as Monochorîa Vaginalis, Abutilon theophrasti Medic., Galium aparine).
The compounds of the formula I according to the invention hâve an outstanding herbicidal activity against a broad spectrum of economically important monocotyledonous and dicotyledonous harmful plants. The active compounds also act efficiently on perennial weeds which produce shoots from rhizomes, root stocks or other perennial organs and which are difficult to control. In this context, it is generally immaterial whether the substances are applied pre-sowing, pre-emergence or post-emergence. Specifically, examples may be mentioned of some représentatives of the monocotyledonous and dicotyledonous weed flora which can be controlled by the compounds according to the invention, without these being a restriction to certain species. Examples of weed species on which the active compounds act efficiently are, from amongst the monocotyledons, Avena, Lolium, Alopecurus, Phalaris, Echinochloa, Digitaria, Setaria and also Cyperus species from the annual sector and from amongst the perennial species Agropyron, Cynodon, Imperata and Sorghum, and also perennial Cyperus species.
In the case of the dicotyledonous weed species, the spectrum of action extends to species such as, for example, Gcdium, Viola, Veronica, Lamium, Stellaria, Amaranthus, Sinapis, Ipomoea, Sida, Matricaria and Abutilon from amongst the armuals, and Convolvulus, Cirsium, Rumex and Artemisia in the case of the perennial weeds. The active compounds according to the invention also effect outstanding control of harmful plants which occur under the spécifie conditions of rice growing such as, for example, Echinochloa, Sagittaria, Alisma, Eleocharis, Scirpus and Cyperus. If the compounds according to the invention are applied to the soil surface prior to germination, then the weed seedlings are either prevented completely from emerging, or the weeds grow until they hâve reached the cotylédon stage but then their growth stops, and, eventually, after three to four weeks hâve elapsed, they die completely. In particular, the compounds according to the invention exhibit excellent activity against Apera spica vend, Chenopodium album, Lamium purpureum, Polygonum convulvulus, Stellaria media, Veronica hederifolia, Veronica persica, Viola tricoter and against Amaranthus, Galium and Kochia species.
Although the compounds according to the invention hâve an excellent herbicidal activity against monocotyledonous and dicotyledonous weeds, crop plants of economically important crops such as, for example, wheat, barley, rye, rice, com, sugarbeet, cotton and soya, are not damaged at ail, or only to a negligible extent. In particular, they hâve excellent compatibility in cereals, such as wheat, barley and com, in particular wheat. For these reasons, the présent compounds are highly suitable for selectively controlling undesired plant growth in plantings for agricultural use or in plantings of ornamcntals.
Owing to their herbicidal properties, these active compounds can also be employed for controlling harmful plants in crops of known or still to be developed genetically engineered plants. The transgenic plants generally hâve particularly advantageous properties, for example résistance to certain pesticides, in particular certain herbicides, résistance to plant diseases or causative organisms of plant diseases, such as certain insects or microorganisms such as fungi, bacteria or viruses. Other particular properties relate, for example, to the quantity, quality, storage-stability, composition and to spécifie ingrédients of the harvested product. Thus, transgenic plants having an increased starch content or a modified quality of the starch or those having a different fatty acid composition of the harvested produce are known.
The use of the compounds of the formula I according to the invention or their salts in economically important transgenic crops of useful and omamental plants, for example of cereal, such as wheat, barley, rye, oats, millet, rice, maniok and com, or else in crops of sugarbeet, cotton, soya, rapeseed, potato, tomato, pea and other vegetable species is preferred. The compounds of the formula I can preferably be used as herbicides in crops of useful plants which are résistant or which hâve been made résistant by genetic engineering toward the phytotoxic effects of the herbicides.
Conventional ways for preparing novel plants which hâve modified properties compared to known plants comprise, for example, traditional breeding methods and the génération of mutants. Altematively, novel plants having modified properties can be generated with the aid of genetic engineering methods (see, for example, EP-A 0 221 044, EP-A 0 131 624). For example, there hâve been described several cases of genetically engineered changes in crop plants in order to modify the starch synthesized in the plants (for example WO 92/11376, WO 92/14827, WO 91/19806), transgenic crop plants which are résistant to certain herbicides of the glufosinate (Glufosinate ammonium)- (cf., for example, EP-A 0 242 236, EP-A 0 242 246) or 5 glyphosate-type (WO 92/00377), or of the sulfonylurea-type (EP-A 0 257 993, U. S. Pat. No. 5,013,659 A), transgenic crop plants, for example cotton, having the ability to produce Bacillus thuringiensis toxins (Bt toxins) which impart résistance to certain pests to the plants (EP-A 0 142 924, EP-A 0 193 259), transgenic crop plants having a modified fatty acid composition (WO 91/13972).
Numerous molecular biological techniques which allow the préparation of novel transgenic plants having modified properties are known in principle; see, for example, Sambrook et al. , 1989, Molecular Cloning, A Laboratory Manual, 2nd ed. Cold Spring Harbor Laboratory Press, Cold Spring Harbor, N. Y. ; or Winnacker Gene und Klone [Genes and Clones], VCH 15 Weinheim, 2nd édition 1996, or Christou, Trends in Plant Science 1 (1996) 423-431). In order to carry out such genetic engineering manipulations, it is possible to introduce nucleic acid molécules into plasmids which allow a mutagenesis or a change in the sequence to occur by recombination of DNA sequences. Using the abovementioned standard processes it is possible, for example, to exchange bases, to remove partial sequences or to add natural or synthetic 20 sequences. To link the DNA fragments with each other, it is possible to attach adaptors or linkers to the fragments.
Plant cells having a reduced activity of a gene product can be prepared, for example, by expressing at least one appropriate antisense-RNA, a sense-RNA to achieve a cosuppression effect, or by expressing at least one appropriately constructed ribozyme which specifically 25 cleaves transcripts of the abovementioned gene product.
To this end it is possible to employ both DNA molécules which comprise the entire coding sequence of a gene product including any flanking sequences that may be présent, and DNA molécules which comprise only parts of the coding sequence, it being necessary for these parts to be long enough to cause an antisense effect in the cells. It is also possible to use DNA sequences 30 which hâve a high degree of homology to the coding sequences of a gene product but which are not entîrely identical.
When expressing nucleic acid molécules in plants, the synthesized protein can be localized in any desired compartment of the plant cells. However, to achieve localization in a certain compartment, it is, for example, possible to link the coding région with DNA sequences which 35 ensure localization in a certain compartment. Such sequences are known to the person skilled in the art (see, for example, Braun et al., EMBO J. 11 (1992), 3219-3227; Wolter et al. , Proc. Natl. Acad. Sci. USA 85 (1988), 846-850; Sonnewald et al., Plant J. 1 (1991), 95-106).
The transgenic plant cells can be regenerated to whole plants using known techniques. The transgenic plants can in principle be plants of any desired plant species, i, e. both monocotyledonous and dicotyledonous plants. In this manner, it is possible to obtain transgenic plants which hâve modified properties by overexpression, suppression or inhibition of homologous (=natural) genes or gene sequences or by expression of heterologous (=foreign) genes or gene sequences.
When using the active compounds according to the invention in transgenic crops, in addition to the effects against harmful plants which can be observed in other crops, there are frequently effects which are spécifie for the application in the respective transgenic crop, for example a modified or specifically broadened spectrum of weeds which can be controlled, modified application rates which can be used for the application, preferably good combinability with the herbicides to which the transgenic crops are résistant, and an effect on the growth and the yield of the transgenic crop plants. The invention therefore also provides for the use of the compounds according to the invention as herbicides for controlling harmful plants in transgenic crop plants.
In addition, the substances according to the invention hâve outstanding growth-regulating properties in crop plants. They engage in the plant metabolism in a regulating manner and can this be employed for the targeted control of plant constituents and for facilitating harvesting, for example by provoking desiccation and stunted growth. Furthermore, they are also suitable for generally regulating and inhibiting undesirable végétative growth, without destroying the plants in the process. Inhibition of végétative growth plays an important rôle in many monocotyledon and dicotyledon crops because lodging can be reduced hereby, or prevented completely.
The compounds according to the invention can be applied in the customary formulations in the form of wettable powders, emulsifïable concentrâtes, sprayable solutions, dusts or granules. The invention therefore also provides herbicidal compositions comprising compounds of the formula I. The compounds of the formula I can be formulated in varions ways depending on the prevailing biological and/or chemico-physical parameters. Examples of suitable formulation options are: wettable powders (WP), water-soluble powders (SP), water-soluble concentrâtes, emulsifïable concentrâtes (EC), émulsions (EW), such as oil-in-water and water-in-oil émulsions, sprayable solutions, suspension concentrâtes (SC), oil dispersions (OD), oil- or water-based dispersions, oil-miscible solutions, dusts (DP), capsule suspensions (CS), seed-dressing compositions, granules for broadeasting and soil application, granules (GR) in the form of microgranules, spray granules, coating granules and adsorption granules, water-dispersible granules (WG), water-soluble granules (SG), ULV formulations, microcapsules and waxes. These individual formulation types are known in principle and are described, for example, in Winnacker-Küchler, Chemische Technologie [Chemical Technology], Volume 7, C. Hauser Verlag Munich, 4th. Edition 1986; Wade van Valkenburg, Pesticide Formulations, Marcel Dekker, N. Y. , 1973; K. Martens, Spray Drying Handbook, 3rd Ed. 1979, G. Goodwin Ltd. London.
The necessary formulation auxiliaries, such as inert materials, surfactants, solvents and other additives, are likewise known and are described, for example, in Watkîns, Handbook of Insecticide Dust Diluents and Carriers, 2nd Ed., Darland Books, Caldwell N. J., H. v. Olphen, Introduction to Clay Colloid Chemistry; 2nd Ed. , J. Wiley & Sons, N. Y. ; C. Marsden, Solvents Guide; 2nd Ed., Interscience, N. Y. 1963; McCutcheon's Détergents and Emulsifiers Annual, MC Publ. Corp. , Ridgewood N. J. ; Sisley and Wood, Encyclopedia of Surface Active Agents, Chem. Publ. Co. Inc. , N. Y. 1964; Schonfeldt, Grenzflüchenaktive Âthylenoxidaddkte [Surface-active ethylene oxide adducts], Wiss. Verlagagesell. Stuttgart 1976; Winnacker-Küchler, Chemische Technologie [Chemical Technology], Volume 7, C. Hauser Verlag Munich, 4th Edition 1986.
Wettable powders are préparations which are uniformly dispersible in water and which contain, in addition to the active compound and as well as a diluent or inert substance, surfactants of ionic and/or nonionic type (wetting agents, dispersants), for example polyethoxylated alkyl phénols, polyethoxylated fatty alcohols, polyethoxylated fatty amines, fatty alcohol polyglycol ethersulfates, alkanesulfonates, alkylbenzenesulfonates, sodium ligninsulfonate, sodium 2,2'-dinaphthylmethane-6,6'-disulfonate, sodium dibutyinaphthalenesulfona-te or else sodium oleoylmethyltaurinate. To préparé the wettable powders, the herbicidally active compounds are finely ground, for example in customary apparatus such as hammer mills, fan mills and air-jet mills, and are mixed simultaneously or subsequently with the formulation auxiliaries.
Emulsifiable concentrâtes are prepared by dissolving the active compound in an organic solvent, for examplc butanol, cyclohexanone, dimethylformamide, xylene or else relatively high-boiling aromatic compounds or hydrocarbons or mixtures of the solvents, with the addition of one or more surfactants of ionic and/or nonionic type (emulsifiers). Examples of emulsifiers which can be used are calcium alkylarylsulfonates, such as Ca dodecylbenzenesulfonate, or nonionic emulsifiers, such as fatty acid polyglycol esters, alkylaryl polyglycol ethers, fatty alcohol polyglycol ethers, propylene oxide-ethylene oxide condensation products, alkyl polyethers, sorbitan esters, for example sorbitan fatty acid esters or polyoxyethylene sorbitan esters, for example polyoxyethylene sorbitan fatty acid esters.
Dusts are obtained by grinding the active compound with finely divided solid substances, for example talc, natural clays, such as kaolin, bentonite and pyrophyllite, or diatomaceous earth. Suspension concentrâtes can be water- or oil-based. They can be prepared, for example, by wet milling using commercially customary bead mills, with or without the addition of surfactants as already mentioned above, for example, in the case of the other formulation types.
Emulsions, for example oil-in-water émulsions (EW), can be prepared for example by means of stirrers, colloid mills and/or static mixers using aqueous organic solvents and, if desired, surfactants as already mentioned above, for example, in the case of the other formulation types.
Granules can be prepared either by spraying the active compound onto adsorptive, granulated inert material or by applying active-compound concentrâtes to the surface of carriers such as sand, kaolinites or granulated inert material, by means of adhesive binders, for example polyvinyl alcohol, sodium polyacrylate or else minerai oils. Suitable active compounds can also be granulated in the manner which is customary for the préparation of fertilizer granules, if desired as a mixture with fertilizers. Water-dispersible granules are generally prepared by the customary processes, such as spray-drying, fluidized-bed granulation, disk granulation, mixing using high-speed mixers, and extrusion without solid inert material.
For the préparation of disk, fluidized-bed, extruder and spray granules, see for example processes in Spray-Drying Handbook 3rd ed. 1979, G. Goodwin Ltd., London; J. E. Browning, Agglomération, Chemical and Engineering 1967, pages 147 ff. ; Perry’s Chemical Engineer's Handbook, 5th Ed. , McGraw-Hill, New York 1973, pp. 8-57. For further details on the formulation of crop protection products, see for example G. C. Klingman, Weed Control as a Science, John Wiley and Sons Inc., New York, 1961, pages 81-96 and J. D. Freyer, S. A. Evans, Weed Control Handbook, 5th Ed. , Blackwell Scientific Publications, Oxford, 1968, pages 101-103.
The agrochemical formulations generally contain from 0.1 to 99% by weight, in particular from 0.1 to 95% by weight, of active compound of the formula I. In wettable powders the concentration of active compound is, for example, from about 10 to 99% by weight, the remainder to 100% by weight consisting of customary formulation constituents. In emulsifiable concentrâtes the concentration of active compound can be from about 1 to 90%, preferably from 5 to 80%, by weight. Formulations in the form of dusts contain from 1 to 30% by weight of active compound, preferably most commonly from 5 to 20% by weight of active compound, while sprayable solutions contain from about 0. 05 to 80%, preferably from 2 to 50%, by weight of active compound. In the case of water-dispersible granules the content of active compound dépends partly on whether the active compound is in liquid or solid form and on the granulation auxiliaries, fillers, etc. that are used. In water-dispersiblc granules the content of active compound, for example, is between 1 and 95% by weight, preferably between 10 and 80% by weight.
In addition, said formulations of active compound may comprise the tackifiers, wetting agents, dispersants, emulsifiers, pénétrants, preservatives, antifreeze agents, solvents, fillers, carriers, colorants, antifoams, évaporation inhibitors and pH and viscosity regulators which are customary in each case.
Based on these formulations it is also possible to produce combinations with other pesticidally active substances, for example insecticides, acaricides, herbicides and fungicides, and also with safeners, fertilizers and/or growth regulators, for example in the form of a ready-mix or tank mix.
Suitable active compounds which can be combined with the active compounds according to the invention in mixed formulations or in a tank mix are, for example, known active compounds as described in for example World Herbicide New Product Technology Handbook, China Agricultural Science and Farming Techniques Press, 2010. 9 and in the literature cited therein. For example the following active compounds may be mentioned as herbicides which can be combined with the compounds of the formula I (note: the compounds are either named by the common name in accordance with the International Organization for Standardization (ISO) or by the Chemical names, if appropriate together with a customary code number): acetochlor, butachlor, alachlor, propisochlor, metolachlor, s-metolachlor, pretilachlor, propachlor, ethachlor, napropamide, R-left handed napropamide, propanil, mefenacet, diphenamid, diflufenican, ethaprochlor, beflubutamid, bromobutide, dimethenamid, dimethenamid-P, etobenzanid, flufenacet, thenylchlor, metazachlor, isoxaben, flamprop-M-methyl, flamprop-M-propyl, allidochlor, pethoxamid, chloranocryl, cyprazine, mefluidide, monalide, delachlor, prynachlor, terbuchlor, xylachlor, dimethachlor, cisanilide, trimexachlor, clomeprop, propyzamide, pentanochlor, carbetamide, benzoylprop-ethyl, cyprazole, butenachlor, tebutam, benzipram, mogrton, dichlofluanid, naproanilide, diethatyl-ethyl, naptalam, flufenacet, benzadox, chlorthiamid, chlorophthalimide, isocarbamide, picolinafen, atrazine, simazine, prometryn, cyanatryn, simetryn, ametryn, propazine, dipropetryn, SSH-108, terbutryn, terbuthylazine, triaziflam, cyprazine, proglinazine, trietazine, prometon, simetone, aziprotryne, desmetryn, dimethametryn, procyazine, mesoprazine, sebuthylazine, secbumeton, terbumeton, methoprotryne, cyanatryn, ipazine, chlorazine, atraton, pendimethalin, eglinazine, cyanuric acid, indaziflam, chlorsulfuron, metsulfuron-methyl, bensulfuron methyl, chlorimuron-ethyl, tribenuron-methyl, thifensulfuron-methyl, pyrazosulfuron-ethyl, mesosulfuron, iodosulfuron-methyl sodium, foramsulfuron, cinosuhuron, triasulfuron, sulfometuron methyl, nicosulfuron, ethametsulfuron-methyl, amidosulfuron, ethoxysulfuron, cyclosulfamuron, rimsulfuron, azimsulfuron, flazasulfuron, monosulfuron, monosulfuron-ester, flucarbazone-sodium, flupyrsulfuron-methyl, halosulfuron-methyl, oxasulfuron, imazosulfuron, primisulfuron, propoxycarbazone, prosulfuron, sulfosulfuron, trifloxysulfuron, triflusulfuron-methyl, tritosulfuron, sodium metsulfuron methyl, flucetosulfuron, HNPC-C, orthosulfamuron, propyrisulfuron, metazosulfuron, acifluorfen, fomesafen, lactofen, fluoroglycofen, oxyfluorfen, chlomitrofen, aclonifen, ethoxyfen-ethyl, bifenox, nitrofluorfen, chlomethoxyfen, fluorodifen, fluoronitrofen, furyloxyfen, nitrofen, TOPE, DMNP, PPG1013, AKH-7088, halosafen, chlortoluron, isoproturon, linuron, diuron, dymron, fluometuron, benzthiazuron, methabenzthiazuron, cumyluron, ethidimuron, isouron, tebuthiuron, buturon, chlorbromuron, methyldymron, phenobenzuron, SK-85, metobromuron, metoxuron, afesin, monuron, siduron, fenuron, fluothiuron, neburon, chloroxuron, noruron, isonoruron, 3-cyclooctyl-l, thiazfluron, tebuthiuron, difenoxuron, parafluron, methylamine tribunil, karbutilate, trimeturon, dimefuron, monisouron, anisuron, methiuron, chloreturon, tetrafluron, phenmedipham, phenmedipham-ethyl, desmedipham, asulam, terbucarb, barban, propham, chlorpropham, rowmate, swep, chlorbufam, carboxazole, chlorprocarb, fenasulam, BCPC, CPPC, carbasulam, butylate, benthiocarb, vemolate, molinate, triallate, dimepiperate, esprocarb, pyributicarb, cycloate, avadex, EPTC, ethiolate, orbencarb, pebulate, prosulfocarb, tiocarbazil, CDEC, dimexano, isopolinate, methiobencarb, 2,4-D butyl ester, MCPA-Na, 2,4-D isooctyl ester, MCPA isooctyl ester, 2,4-D sodium sait, 2,4-D dimethyla mine sait, MCPA-thioethyl, MCPA, 2,4-D propionic acid, high 2,4-D propionic acid sait, 2,4-D butyric acid, MCPA propionic acid, MCPA propionic acid sait, MCPA butyric acid, 2,4,5-D, 2,4,5-D propionic acid, 2,4,5-D butyric acid, MCPA amine sait, dicamba, erbon, chlorfenac, saison, TBA, chloramben, methoxy-TBA, diclofop-methyl, fluazifop-butyl, fhiazifop-p-butyl, haloxyfop-methyl, haloxyfop-P, quizalofop-ethyl, quizalofop-p-ethyl, fenoxaprop-ethy, fenoxaprop-p-ethyl, propaquizafop, cyhalofop-butyl, metamifop, clodinafop-propargyl, fenthiaprop-ethyl, chloroazifop-propynyl, poppenate-methyl, trifopsime, isoxapyrifop, paraquat, diquat, oryzalin, ethalfluralin, isopropalin, nitralin, profluralin, prodinamine, benfluralin, fluchloraline, dinitramina, dipropalin, chlomidine, methalpropalin, dinoprop, glyphosate, anilofos, glufosinate ammonium, amiprophos-methyl, sulphosate, piperophos, bialaphos-sodium, bensulide, butamîfos, phocarb, 2,4-DEP, H-9201, zytron, imazapyr, imazethapyr, imazaquin, imazamox, imazamox ammonium sait, imazapic, imazamethabenz-methyl, fluroxypyr, fluroxypyr isooctyl ester, clopyralid, picloram, trichlopyr, dithiopyr, haloxydine, 3,5,6-trichloro-2-pyridinol, thiazopyr, fluridone, aminopyralid, diflufenzopyr, triclopyr-butotyl, Cliodinate, sethoxydim, clethodim, cycloxydim, alloxydim, clefoxydim, butroxydim, tralkoxydim, tepraloxydim, buthidazole, metribuzin, hexazinone, metamitron, ethiozin, ametridione, amibuzin, bromoxynil, bromoxynil octanoate, ioxynil octanoate, ioxynil, dichlobenil, diphenatrile, pyraclonil, chloroxynil, iodobonil, flumetsulam, florasulam, penoxsulam, metosulam, cloransulam-methyl, diclosulam, pyroxsulam, benfuresate, bispyribac-sodium, pyribenzoxim, pyriftalid, pyriminobac-methyl, pyrithiobac-sodium, benzobicylon, mesotrione, sulcotrione, tembotrione, tefuryltrione, bicyclopyrone, ketodpiradox, isoxaflutole, clomazone, fenoxasulfone, methiozolin, fluazolate, pyraflufen-ethyl, pyrazolynate, difenzoquat, pyrazoxyfen, benzofenap, nipyraclofen, pyrasulfotole, topramezone, pyroxasulfone, cafenstrole, flupoxam, aminotriazole, amicarbazone, azafenidin, carfentrazone-ethyl, sulfentrazone, bencarbazone, benzfendizone, butafenacil, bromacil, isocil, lenacil, terbacil, flupropacil, cinidon-ethyl, flumiclorac-pentyl, flumioxazin, propyzamide, MK-129, flumezin, pentachlorophenol, dinoseb, dinoterb, dinoterb acetate, dinosam, DNOC, chloronitrophene, medinoterb acetate, dinofenate, oxadiargyl, oxadiazon, pentoxazone, Flufenacet, fluthiacet-methyl, fentrazamide, flufenpyr-ethyl, pyrazon, brompyrazon, metflurazon, kusakira, dimidazon, oxapyrazon, norflurazon, pyridafol, quinclorac, quinmerac, bentazone, pyridate, oxaziclomefone, benazolin, clomazone, cinmethylin, ZJ0702, pyribambenz-propyl, indanofan, sodium chlorate, dalapon, trichloroacetic acid, monochloroacetic acid, hexachloroacetone, flupropanate, cyperquat, bromofenoxim, epronaz, methazole, flurtamone, benfuresate, ethofumesate, tioclorim, chlorthal, fluorochloridone, tavron, acrolein, bentranil, tridiphane, chlorfenpropmethyl, thidiarizonaimin, phenisopham, busoxinone, methoxyphenone, saflufenacil, clacyfos, chloropon, alorac, diethamquat, etnipromid, iprymidam, ipfencarbazone, thiencarbazone-methyl, pyrimisulfan, chlorflurazole, tripropindan, sulglycapin, prosulfalin, cambendichlor, aminocyclopyrachlor, rodethanil, benoxacor, fenclorim, flurazole, fenchlorazole-ethyl, cloquintocet-mexyl, oxabetrinil, MG/91, cyometrinil, DKA-24, mefenpyr-diethyl, furilazole, fluxofenim, isoxadifen-ethyl, dichlormid, halauxifen-methyl, DOW florpyrauxifen, UBH-509, D489, LS 82-556, KPP-300, NC-324, NC-330, KH-218, DPX-N8189, SC-0744, DOWCO535, DK-8910, V-53482, PP-60O, MBH-001, KIH-9201, ET-751, KIH-6127 and KIH-2023.
In the context of the présent spécification, if an abbreviation of a generic name of an active compound is used, it includes in each case ail customary dérivatives, such as esters and salts, as well as isomers, in particular optical isomers, especially one or more commercially available forms. If the generic name dénotés an ester or a sait, it also includes in each case ail other conventional dérivatives, such as other esters and salts, free acids and neutral compounds, as well as isomers, in particular optical isomers, especially one or more commercially available forms. The Chemical name given to a compound means at least one compound encompassed by the generic name, and generally the preferred compound.
For use, the formulations which are présent in commercially available form are, if appropriate, diluted in the customary manner, for example using water in the case of wettable powders, emulsifiable concentrâtes, dispersions and water-dispersible granules. Products in the form of dusts, granules for soil application or broadcasting and sprayable solutions are usually not further diluted with other inert substances prior to use. The application rate of the compounds of the formula I required varies with the extemal conditions, such as température, humidity, the nature of the herbicide used and the like. It can vary within wide limits, for example between 0. 001 and 1. 0 kg a.i./ha or more of active substance, but it is preferably between 0. 005 and 750 g a.i./ha, in particular between 0. 005 and 500 g a.i./ha.
Spécifie Mode for Carrying out the Invention
The following examples are intended to illustrate the présent invention and should not be construed as limiting the présent invention in any way. The scope for which protection is sought in the présent invention is intended to be defined by the daims.
In view of économies and variety of a compound, we preferably synthesized several compounds, part of which are listed in the following Tables 1-2. The structure and information of a certain compound are shown in Tables 1-3. The compounds in Tables 1-2 are listed for fùrther explication of the présent invention, other than any limit therefor. The subject of the présent invention should not be interpreted by those skilled in the art as being limited to the following compounds.
Table 1 : The structure of compounds (7? configuration)
O
No. | A | B | c | Q | Y |
1-1 | F | F | F | p | nh2 |
1-2 | Cl | Cl | Cl | ch3 | nh2 |
1-3 | Cl | Cl | H | nh2 | |
1-4 | Cl | Cl | F | nh2 | |
1-5 | Cl | Cl | ch3 | ch3 | nh2 |
1-6 | Cl | Cl | cf3 | P | nh2 |
1-7 | ch3 | ch3 | F | ch3 | nh2 |
1-8 | Et | Et | cf3 | ch3 | nh2 |
1-9 | CI | H | ch3 | nh2 |
1-10 | -H | Cl | Cl | ch3 | nh2 |
1-11 | F | CF3 | ch3 | nh2 | |
1-12 | Br | Br | F | ch3 | nh7 |
1-13 | I | I | H | ch3 | nh2 |
1-14 | -M | F | Ύ | nh2 | |
1-15 | cf3 | Cl | F | ch3 | nh2 |
1-16 | Cl | cf3 | H | Y | nh2 |
1-17 | Cl | Cl | I | ch3 | nh2 |
1-18 | Cl | Br | 0 | nh2 | |
1-19 | ch3 | ch3 | ch3 | ch3 | nh2 |
1-20 | Cl | ch3 | F | ch3 | nh2 |
1-21 | Cl | ch3 | H | ch3 | nh2 |
1-22 | Cl | 40 | F | ch3 | nh2 |
1-23 | F | F | cf3 | ch3 | nh2 |
1-24 | ch3 | 40 | F | ch3 | nh2 |
1-25 | Cl | ch3 | Br | ch3 | nh2 |
1-26 | Cl | Cl | F | ch3 | nh2 |
1-27 | Cl | Cl | F | Et | nh2 |
1-28 | Cl | Cl | F | nh2 | |
1-29 | Cl | Cl | F | nh2 | |
1-30 | Cl | Cl | F | 40 | nh2 |
1-31 | Cl | Cl | F | -Oc/ | nh2 |
1-32 | Cl | Cl | F | nh2 | |
1-33 | Cl | Cl | F | nh2 | |
1-34 | Cl | Cl | F | nh2 | |
1-35 | Cl | Cl | F | nh2 |
1-36 | Cl | Cl | F | F | nh2 |
1-37 | Cl | Cl | F | Cl | nh2 |
1-38 | Cl | CI | F | Br | nh2 |
1-39 | CI | Cl | F | Υόι | nh2 |
1-40 | Cl | Cl | F | Y F | nh2 |
1-41 | Cl | Cl | F | F A F | nh2 |
1-42 | Cl | Cl | F | νή2 | |
1-43 | Cl | Cl | F | CF3 | nh2 |
1-44 | Cl | Cl | F | Vcf3 | nh2 |
1-45 | Cl | Cl | F | CN | nh2 |
1-46 | Cl | Cl | F | NcY | nh2 |
1-47 | Cl | Cl | F | nh2 | nh2 |
1-48 | Cl | CI | F | nh2 | |
1-49 | Cl | Cl | F | Y'- | nh2 |
1-50 | Cl | Cl | F | VOH | nh2 |
1-51 | Cl | Cl | F | no2 | nh2 |
1-52 | Cl | Cl | F | nh2 | |
1-53 | Cl | Cl | F | 'Yto | nh2 |
1-54 | Cl | Cl | F | 0 Va | nh2 |
1-55 | Cl | Cl | F | X | nh2 |
1-56 | Cl | Cl | F | nh2 | |
1-57 | Cl | Cl | F | nh2 | |
1-58 _ | Cl | Cl | F | nh2 |
1-59 | Cl | Cl | F | 7PP N-N | nh2 |
1-60 | Cl | Cl | F | N-N / | nh2 |
1-61 | Cl | Cl | F | CF N-N F- / F | nh2 |
1-62 | Cl | Cl | F | '-''cf3 | nh2 |
1-63 | Cl | Cl | F | O P | nh2 |
1-64 | Cl | Cl | F | nh2 | |
1-65 | Cl | Cl | F | nh2 | |
1-66 | Cl | Cl | F | P | nh2 |
1-67 | Cl | Cl | F | N | nh2 |
1-6S | Cl | Cl | F | ch3 | H AS |
1-69 | Cl | Cl | F | P | H |
1-70 | Cl | Cl | F | ch3 | 0 A* H |
1-71 | Cl | Cl | F | ch3 | W H |
1-72 | Cl | Cl | F | ch3 | vO HN.rJ __ |
Table 2: The structure of dérivatives (7? configuration)
Y
O □ -1
No. | A | B | c | Q | X | Y | salt/M |
2-1 | CI | Cl | F | 0 | nh2 | sodium sait | |
2-2 | Cl | Cl | F | ch3 | s | nh2 | calcium sait |
2-3 | Cl | Cl | F | ch3 | 0 | nh2 | ammonium sait |
2-4 | Cl | Cl | F | ch3 | s | nh2 | tétraméthylammonium sait |
2-5 | Cl | Cl | F | Et | 0 | nh2 | benzyltrimethylammonium sait |
2-6 | Cl | Cl | F | 0 | nh2 | choline amine sait | |
2-7 | Cl | Cl | F | ch3 | 0 | nh2 | dimethylamine sait |
2-8 | Cl | Cl | F | yx | 0 | nh2 | monoisopropylamine sait |
2-9 | Cl | Cl | F | Et | s | nh2 | benzylamine sait |
2-10 | Cl | Cl | F | Et | 0 | nh2 | monoethanolamine sait |
2-11 | Cl | Cl | F | 0 | nh2 | diglycolamine sait | |
2-12 | Cl | Cl | F | Et | s | nh2 | diallylamine sait |
2-13 | Cl | Cl | F | Ύ | 0 | nh2 | cyclododecylamine sait |
2-14 | Cl | CI | F | ch3 | 0 | nh2 | dimethylmonoethanolamine sait |
2-15 | Cl | Cl | F | 0 | nh2 | diethylenetriamine sait | |
2-16 | Cl | Cl | F | (7 | 0 | nh2 | dimethylaminopropylamine sait |
2-17 | Cl | Cl | F | ch3 | s | nh2 | 1,2-propyldiamine sait |
2-18 | Cl | Cl | F | Et | s | nh2 | triethylenetetramine sait |
2-19 | Cl | Cl | F | 0 | nh2 | N,N-bis[aminopropyl]methyla mine sait___________ | |
2-20 | Cl | Cl | F | s | nh2 | 2-methylthiopropylamine sait | |
2-21 | Cl | Cl | F | —| y] | 0 | nh2 | 2-butoxyethylamine sait |
2-22 | Cl | Cl | F | Γ ch3 | 0 | nh2 | AEPD sait |
2-23 | Cl | Cl | F | O | nh2 | tri(methylol) aminomethane sait | |
2-24 | Cl | Cl | F | ch3 | O | nh2 | morpholine sait |
2-25 | Cl | Cl | F | Et | s | nh2 | aminopropyl morpholine sait |
2-26 | Cl | Cl | F | ch3 | s | nh2 | Jeff amine D-230 sait |
2-27 | Cl | Cl | F | Et | 0 | nh2 | the sait of 2,4,6-tri(dimethylaminomethy 1) phénol and sodium hydroxide |
2-28 | Cl | ch3 | H | ch3 | 0 | nh2 | ch3 |
2-29 | Cl | ch3 | F | ch3 | 0 | nh2 | ch3 |
2-30 | Cl | Cl | H | ch3 | 0 | nh2 | ch3 |
2-31 | Cl | Cl | Cl | ch3 | O | nh2 | ch3 |
2-32 | Cl | Cl | ch3 | ch3 | O | nh2 | ch3 |
2-33 | Cl | Cl | F | Et | s | nh2 | ch3 |
2-34 | Cl | Cl | F | Et | O | nh2 | ch3 |
2-35 | Cl | Cl | F | O | nh2 | ch3 | |
2-36 | Cl | Cl | F | A | s | nh2 | ch3 |
2-37 | Cl | Cl | F | O | nh2 | ch3 | |
2-38 | Cl | Cl | F | O | nh2 | ch3 | |
2-39 | Cl | Cl | F | cf3 | O | nh2 | ch3 |
2-40 | Cl | Cl | F | ^cf3 | O | nh2 | ch3 |
2-41 | Cl | Cl | F | V'CI | O | nh2 | ch3 |
2-42 | Cl | Cl | F | O | nh2 | ch3 | |
2-43 | Cl | Cl | F | yt | O | nh2 | ch3 |
2-44 | Cl | Cl | F | F Xf | O | nh2 | ch3 |
2-45 | Cl | Cl | F | O | nh2 | ch3 | |
246 | Cl | Cl | F | O | nh2 | ch3 | |
2-47 | Cl | Cl | F | 0 Va | O | nh2 | ch3 |
2-48 | Cl | Cl | F | 'Yq | O | nh2 | __________ch3__________ |
2-49 | Cl | Cl | F | Y^OH | O | nh2 | __ch3 |
2-50 | Cl | Cl | F | no2 | O | nh2 | ch3 |
2-51 | Cl | Cl | F | F | 0 | nh2 | ch3 |
2-52 | Cl | Cl | F | Br | 0 | nh2 | ch3 |
2-53 | Cl | Cl | F | Cl | 0 | nh2 | ch3 |
2-54 | Cl | Cl | F | Y'OZ | nh2 | ch3 | |
2-55 | Cl | Cl | F | ;Υ'όζ | nh2 | ch3 | |
2-56 | Cl | Cl | F | nh2 | 0 | nh2 | ch3 |
2-57 | Cl | Cl | F | 0 | nh2 | ch3 | |
2-58 | Cl | Cl | F | γγ | 0 | nh2 | ch3 |
2-59 | Cl | Cl | F | 0 | nh2 | ch3 | |
2-60 | Cl | Cl | F | νοΆ | 0 | nh2 | ch3 |
2-61 | Cl | Cl | F | CN | 0 | nh2 | ch3 |
2-62 | Cl | Cl | F | VG | O | nh2 | ch3 |
2-63 | Cl | Cl | F | 0 | nh2 | ch3 | |
2-64 | Cl | Cl | F | Q | 0 | nh2 | ch3 |
2-65 | Cl | Cl | F | 0 | nh2 | ch3 | |
2-66 | Cl | Cl | F | V | 0 | nh2 | ch3 |
2-67 | Cl | Cl | F | Ύ n-# Cl | 0 | nh2 | ch3 |
2-68 | Cl | Cl | F | . H Υγ-Κ FZ | 0 | nh2 | ch3 |
2-69 | Cl | Cl | F | CH3 | O | nh2 | ch3 |
2-70 | Cl | Cl | F | ch3 | s | nh2 | ch3 |
2-71 | Cl | Cl | F | ch3 | 0 | nh2 | Et |
2-72 | Cl | Cl | F | ch3 | s | nh2 | Et |
2-73 | Cl | Cl | F | ch3 | 0 | _______nh2_______ |
— | |||||||
2-74 | Cl | Cl | F | ch3 | s | nh2 | |
2-75 | Cl | Cl | F | CH3 | 0 | nh2 | |
2-76 | Cl | Cl | F | ch3 | s | nh2 | V |
2-77 | Cl | Cl | F | ch3 | 0 | nh2 | y./v/ |
2-78 | Cl | Cl | F | ch3 | s | nh2 | XxXXX |
2-79 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-80 | Cl | Cl | F | ch3 | s | nh2 | |
2-81 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-82 | Cl | Cl | F | ch3 | s | nh2 | '/γΧ |
2-83 | Cl | Cl | F | ch3 | 0 | nh2 | “T |
2-84 | Cl | Cl | F | ch3 | s | nh2 | V |
2-85 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-86 | Cl | Cl | F | ch3 | s | nh2 | |
2-87 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-88 | Cl | Cl | F | ch3 | s | nh2 | |
2-89 | Cl | Cl | F | ch3 | 0 | nh2 |
2-90 | Cl | Cl | F | CH3 | s | nh2 | |
2-91 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-92 | Cl | Cl | F | ch3 | s | nh2 | Ά |
2-93 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-94 | Cl | CI | F | ch3 | s | nh2 | |
2-95 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-96 | Cl | Cl | F | ch3 | s | nh2 | ηΛ |
2-97 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-98 | Cl | Cl | F | ch3 | s | nh2 | |
2-99 | Cl | Cl | F | ch3 | 0 | nh2 | Τ |
2-100 | Cl | Cl | F | ch3 | s | nh2 | Τ |
2-101 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-102 | Cl | Cl | F | ch3 | s | nh2 | |
2-103 | Cl | Cl | F | ch3 | 0 | nh2 | _ |
2-104 | Cl | Cl | F | ch3 | s | nh2 | — | |
2-105 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-106 | Cl | Cl | F | ch3 | s | nh2 | ||
2-107 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-108 | Cl | Cl | F | ch3 | s | nh2 | ||
2-109 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-110 | Cl | Cl | F | ch3 | s | νή2 | ||
2-111 | Cl | CI | F | ch3 | 0 | nh2 | ||
2-112 | CI | Cl | F | ch3 | s | nh2 | ||
2-113 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-114 | Cl | Cl | F | ch3 | s | nh2 | ||
2-115 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-116 | Cl | Cl | F | ch3 | s | nh2 | ||
2-117 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-118 | Cl | Cl | F | ch3 | s | _______nh2_______ |
2-119 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-120 | Cl | Cl | F | ch3 | s | nh2 | ||
2-121 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-122 | Cl | Cl | F | ch3 | s | nh2 | ||
2-123 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-124 | Cl | Cl | F | ch3 | s | nh2 | ||
2-125 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-126 | Cl | Cl | F | ch3 | s | nh2 | ||
2-127 | Cl | Cl | F | ch3 | O | nh2 | ||
2-128 | Cl | Cl | F | ch3 | s | nh2 | ||
2-129 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-130 | Cl | Cl | F | ch3 | s | nh2 | ||
2-131 | Cl | Cl | F | ch3 | 0 | nh2 . | ||
2-132 | Cl | Cl | F | ch3 | s | nh2 |
2-133 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-134 | Cl | Cl | F | ch3 | s | nh2 | |
2-135 | Cl | Cl | F | ch3 | O | nh3 | |
2-136 | Cl | Cl | F | ch3 | s | nh2 | |
2-137 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-138 | Cl | Cl | F | ch3 | s | nh2 | |
2-139 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-140 | Cl | Cl | F | ch3 | s | nh2 | |
2-141 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-142 | Cl | Cl | F | ch3 | s | nh2 | |
2-143 | Cl | Cl | F | ch3 | O | nh2 | |
2-144 | Cl | Cl | F | ch3 | s | nh2 | |
2-145 | Cl | Cl | F | ch3 | O | nh2 | XX |
2-146 | Cl | Cl | F | ch3 | s | nh2 | _X_ |
2-147 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-148 | Cl | Cl | F | CH3 | s | nh2 | ίγ |
2-149 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-150 | Cl | Cl | F | ch3 | s | nh2 | |
2-151 | Cl | Cl | F | ch3 | 0 | nh2 | AA |
2-152 | Cl | Cl | F | ch3 | s | nh2 | |
2-153 | CI | Cl | F | ch3 | 0 | nh2 | |
2-154 | Cl | Cl | F | ch3 | s | nh2 | |
2-155 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-156 | Cl | Cl | F | ch3 | s | nh2 | |
2-157 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-158 | Cl | Cl | F | ch3 | s | nh2 | |
2-159 | Cl | Cl | F | ch3 | 0 | •Ü nh2 | |
2-160 | Cl | Cl | F | ch3 | s | nh2 | |
2-161 | Cl | Cl | F | ch3 | 0 | nh2 |
2-162 | Cl | Cl | F | ch3 | s | nh2 | |
2-163 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-164 | Cl | Cl | F | ch3 | s | nh2 | |
2-165 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-166 | Cl | Cl | F | ch3 | s | nh2 | |
2-167 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-168 | Cl | Cl | F | ch3 | s | nh2 | |
2-169 | Cl | Cl | F | ch3 | 0 | nh2 | ' La,-·-' |
2-170 | Cl | CI | F | ch3 | s | nh2 | |
2-171 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-172 | Cl | Cl | F | ch3 | s | nh2 | |
2-173 | Cl | Cl | F | ch3 | O | nh2 |
2-174 | Cl | Cl | F | ch3 | s | nh2 | |
2-175 | Cl | Cl | F | ch3 | O | nh2 | |
2-176 | Cl | Cl | F | ch3 | s | nh2 | |
2-177 | Cl | Cl | F | ch3 | O | nh2 | |
2-178 | Cl | Cl | F | ch3 | s | . nh2 | |
2-179 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-180 | Cl | Cl | F | ch3 | s | nh2 | |
2-181 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-182 | Cl | Cl | F | ch3 | s | nh2 | |
2-183 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-184 | Cl | Cl | F | ch3 | s | nh2 | |
2-185 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-186 | Cl | Cl | F | ch3 | s | nh2 | |
2-187 | Cl | Cl | F | ch3 | 0 | ______nh2_______ | ____________________________________________________ | |
2-188 | Cl | Cl | F | ch3 | s | nh2 | |
2-189 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-190 | Cl | Cl | F | ch3 | s | nh2 | |
2-191 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-192 | Cl | Cl | F | ch3 | s | nh2 | |
2-193 | Cl | Cl | F | ch3 | 0 | nh2 | 7™ |
2-194 | Cl | Cl | F | ch3 | s | nh2 | Ύ“ |
2-195 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-196 | Cl | Cl | F | ch3 | s | nh2 | |
2-197 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-198 | Cl | Cl | F | ch3 | s | nh2 | |
2-199 | Cl | Cl | F | ch3 | O | nh2 | |
2-200 | Cl | Cl | F | ch3 | s | nh2 | |
2-201 | Cl I Cl | F | ch3 | o |________nh2________ |
2-202 | Cl | Cl | F | ch3 | s | nh2 | |
2-203 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-204 | Cl | Cl | F | ch3 | s | nh2 | |
2-205 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-206 | Cl | Cl | F | ch3 | s | nh2 | |
2-207 | Cl | Cl | F | ch3 | 0 | nh2 | QCk |
2-208 | Cl | Cl | F | ch3 | s | nh2 | |
2-209 | Cl | Cl | F | ch3 | 0 | nh2 | / [AP |
2-210 | Cl | Cl | F | ch3 | s | nh2 | |
2-211 | Cl | Cl | F | ch3 | 0 | nh2 | PL |
2-212 | Cl | Cl | F | ch3 | s | nh2 | PL |
2-213 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-214 | Cl | Cl | F | ch3 | s | nh2 | T |
2-215 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-216 | Cl | Cl | F | ch3 | s | nh2 | |
2-217 | Cl | Cl | F | ch3 | 0 | nh2 | YyYzYzYzY |
2-218 | Cl | Cl | F | ch3 | s | nh2 | YyYzYzYY |
2-219 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-220 | Cl | Cl | F | ch3 | s | nh2 | |
2-221 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-222 | Cl | Cl | F | ch3 | s | nh2 | |
2-223 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-224 | Cl | Cl | F | ch3 | s | nh2 | |
2-225 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-226 | Cl | Cl | F | ch3 | s | ______nh2_______ |
2-227 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-228 | Cl | Cl | F | ch3 | s | nh2 | Oik | |
2-229 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-230 | Cl | Cl | F | ch3 | s | nh2 | ||
2-231 | Cl | Cl | F | ch3 | 0 | nh2 | / | \ |
2-232 | Cl | Cl | F | ch3 | s | nh2 | P | t< |
2-233 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-234 | Cl | Cl | F | ch3 | s | nh2 | ||
2-235 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-236 | Cl | Cl | F | ch3 | s | nh2 | ||
2-237 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-238 | Cl | Cl | F | ch3 | s | nh2 |
1 | |||||||
2-239 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-240 | Cl | Cl | F | ch3 | s | nh2 | |
2-241 | Cl | Cl | F | CH3 | 0 | nh2 | \ —/ |
2-242 | Cl | Cl | F | ch3 | s | nh2 | Τ’- —/ |
2-243 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-244 | Cl | Cl | F | ch3 | s | nh2 | |
2-245 | Cl | Cl | F | ch3 | O | nh2 | |
2-246 | Cl | Cl | F | ch3 | s | nh2 | |
2-247 | Cl | Cl | F | ch3 | 0 | nh2 | yv |
2-248 | Cl | Cl | F | ch3 | s | nh2 | |
2-249 | Cl | Cl | F | ch3 | 0 | nh2 | / |
2-250 | Cl | Cl | P 1 | ch3 | s | nh2 |
2-251 | Cl | Cl | F | CH3 | 0 | nh2 | \ | |
2-252 | Cl | Cl | F | ch3 | s | nh2 | / | — |
2-253 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-254 | Cl | Cl | F | ch3 | s | nh2 | ||
2-255 | Cl | Cl | F | ch3 | 0 | nh2 | Y(ch2)17ch3 | |
2-256 | Cl | CI | F | ch3 | S | nh2 | γ(ΟΗ2)17ΟΗ3 | |
2-257 | Cl | Cl | F | ch3 | 0 | nh2 | Χ-γ-(ϋΗ2)12ΟΗ(ϋΗ3)2 | |
2-258 | Cl | Cl | F | ch3 | s | nh2 | ||
2-259 | Cl | Cl | F | ch3 | 0 | nh2 | ^^CH2)i3CH3 | |
2-260 | Cl | Cl | F | ch3 | s | nh2 | Î^(ch2)13ch3 | |
2-261 | Cl | Cl | F | ch3 | 0 | nh2 | A 1 (ch2)7ch3 | |
2-262 | Cl | Cl | F | ch3 | s | nh2 | A 1 (CH2)7CH3 | |
2-263 | Cl | Cl | F | ch3 | O | ______nh2_______ | I |
2-264 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-265 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-266 | Cl | Cl | F | ch3 | s | nh2 | |
2-267 | Cl | Cl | F | ch3 | 0 | nh2 | γ,ΟΝ |
2-268 | Cl | Cl | F | ch3 | 0 | nh2 | Y,.no2 |
2-269 | Cl | Cl | F | ch3 | O | nh2 | |
2-270 | Cl | Cl | ch3 | ch3 | 0 | nh2 | |
2-271 | Cl | Cl | F | ch3 | O | nh2 | |
2-272 | Cl | Cl | F | ch3 | s | nh2 | __ΥΧΧ__ |
2-273 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-274 | Cl | Cl | F | ch3 | s | nh2 | |
2-275 | Cl | CI | F | ch3 | 0 | nh2 | kk ___ |
2-276 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-277 | CI | Cl | F | ch3 | 0 | nh2 | __ |
2-278 | Cl | Cl | F | ch3 | 0 | nh2 | ^^'Rr |
2-279 | Cl | Cl | F | ch3 | 0 | nh2 | -A |
2-280 | Cl | Cl | F | ch3 | O | nh2 | |
2-281 | Cl | Cl | F | ch3 | 0 | nh2 | A'· cfq |
2-282 | Cl | Cl | F | ch3 | 0 | nh2 | V Ο -Π Π ω |
2-283 | CI | Cl | F | ch3 | O | nh2 | 1 |
2-284 | Cl | Cl | F | ch3 | 0 | nh2 | _____X^NH?_____ |
2-285 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-286 | Cl | Cl | F | ch3 | 0 | nh2 | Cl χΑγΟΙ Cl |
2-287 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-288 | Cl | Cl | F | ch3 | 0 | nh2 | (/X |
2-289 | Cl | Cl | F | ch3 | 0 | nh2 | o 1 |
2-290 | Cl | CI | F | CH3 | s | nh2 | O |
2-291 | Cl | Cl | F | ch3 | 0 | nh2 | / \__ |
2-292 | Cl | Cl | F | ch3 | 0 | nh2 | ΑΧ |
2-293 | Cl | Cl | F | ch3 | 0 | nh2 | O t II - -s— ' II 0 |
2-294 | Cl | Cl | F | ch3 | 0 | nh2 | 0 |
2-295 | Cl | Cl | F | ch3 | O | nh2 | |
2-296 | Cl | Cl | F | ch3 | 0 | nh2 | JT _ |
2-297 | Cl | Cl | F | ch3 | 0 | nh2 | Xk |
2-298 | Cl | CI | F | ch3 | 0 | nh2 | |
2-299 | Cl | Cl | F | ch3 | 0 | nh2 | T |
2-300 | Cl | Cl | F | ch3 | 0 | nh2 | TJ |
2-301 | Cl | Cl | F | ch3 | s | nh2 | |
2-302 | Cl | Cl | F | ch3 | O | nh2 | |
2-303 | Cl | Cl | F | ch3 | s | nh2 | Tp1 |
2-304 | Cl | Cl | F | ch3 | 0 | nh2 | xXX |
2-305 | Cl | Cl | F | ch3 | s | nh2 | TT |
2-306 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-307 | CI | Cl | F | ch3 | s | nh2 |
2-308 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-309 | Cl | Cl | F | ch3 | s | nh2 | XJ3 F |
2-310 | Cl | Cl | F | ch3 | 0 | nh2 | xx |
2-311 | Cl | Cl | F | ch3 | s | nh2 | . LL M |
2-312 | Cl | Cl | F | ch3 | 0 | nh2 | X |
2-313 | Cl | Cl | F | ch3 | s | nh2 | ^i\.F |
2-314 | Cl | Cl | F | ch3 | o | nh2 | XJ) Cl |
2-315 | Cl | Cl | F | ch3 | s | nh2 | Xj) Cl |
2-316 | Cl | Cl | F | ch3 | 0 | nh2 | xx |
2-317 | Cl | Cl | F | ch3 | s | nh2 | XX |
2-318 | Cl | Cl | F | ch3 | 0 | nh2 | XA |
2-319 | Cl | CI | F | ch3 | s | nh2 | Xj |
2-320 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-321 | Cl | Cl | F | ch3 | s | nh2 | __ Xj) Br |
2-322 | Cl | Cl | F | ch3 | o | nh2 | XX |
2-323 | CI | Cl | F | ch3 | s | nh2 | R □□ |
2-324 | Cl | Cl | F | ch3 | 0 | nh2 | b CD “T |
2-325 | Cl | Cl | F | ch3 | s | nh2 | Br |
2-326 | Cl | Cl | F | Et | 0 | nh2 | /=\ / MW-0 |
2-327 | Cl | Cl | F | ch3 | O | nh2 | cf3 |
2-328 | Cl | Cl | F | ch3 | s | nh2 | yjQ cf3 |
2-329 | Cl | Cl | F | ch3 | O | nh2 | XxCXCF3 |
2-330 | Cl | Cl | F | ch3 | s | nh2 | |
2-331 | Cl | Cl | F | ch3 | 0 | nh2 | b O “Π Cû |
2-332 | Cl | Cl | F | ch3 | s | nh2 | b O J1 |
2-333 | Cl | Cl | F | ch3 | O | nh2 | |
2-334 | Cl | Cl | F | ch3 | s | nh2 | Ύ) CN |
2-335 | Cl | Cl | F | ch3 | 0 | nh2 | Z O X |
2-336 | Cl | Cl | F | ch3 | s | nh2 | yYY |
2-337 | Cl | Cl | F | ch3 | O | nh2 | ,,χχ ,CN |
2-338 | Cl | Cl | F | ch3 | s | nh2 | b O z |
2-339 | Cl | Cl | F | ch3 | s | nh2 | yoo |
2-340 | Cl | Cl | F | ch3 | O | nh2 | ||
2-341 | Cl | Cl | F | ch3 | 0 | nh2 | Y | |
2-342 | Cl | Cl | F | ch3 | O | nh2 | γΥ | X 'n |
2-343 | Cl | Cl | F | ch3 | s | nh2 | Y | N |
2-344 | Cl | Cl | F | ch3 | 0 | nh2 | γχ | Yn L Jj |
2-345 | Cl | Cl | F | ch3 | s | nh2 | X | Yn L j |
2-346 | Cl | Cl | F | ch3 | 0 | nh2 | Y | XX |
2-347 | Cl | Cl | F | ch3 | s | nh2 | b | |
2-348 | Cl | Cl | F | ch3 | 0 | nh2 | χχ | X) |
2-349 | Cl | Cl | F | ch3 | 0 | nh2 | vx | Lo |
2-350 | Cl | Cl | F | ch3 | 0 | nh2 | Y | y |
2-351 | Cl | Cl | F | ch3 | O | nh2 | ύΧ | Y |
2-352 | Cl | Cl | F | ch3 | 0 | nh2 | N- | b -N |
2-353 | Cl | Cl | F | ch3 | 0 | nh2 | -y. | A'N |
2-354 | Cl | Cl | F | ch3 | 0 | nh2 | ||
2-355 | Cl | Cl | F | ch3 | 0 | nh2 | Y | |
2-356 | Cl | Cl | F | ch3 | 0 | nh2 | xp | Y |
2-357 | Cl | Cl | F | ch3 | s | nh2 | V<CI |
2-358 | Cl | Cl | F | ch3 | s | nh2 | -κγν |
2-359 | Cl | Cl | F | ch3 | 0 | nh2 | tl |
2-360 | Cl | Cl | F | ch3 | s | nh2 | A |
2-361 | Cl | Cl | F | ch3 | 0 | nh2 | y€0 |
2-362 | Cl | Cl | F | ch3 | 0 | nh2 | LL |
2-363 | Cl | Cl | F | ch3 | s | nh2 | 1 ô |
2-364 | Cl | Cl | F | ch3 | 0 | nh2 | / Y |
2-365 | Cl | Cl | F | ch3 | s | nh2 | / n-n yQ |
2-366 | Cl | Cl | F | ch3 | 0 | nh2 | Y Y |
2-367 | Cl | Cl | F | ch3 | 0 | nh2 | |
2-368 | Cl | Cl | F | ch3 | s | nh2 | b |
2-369 | Cl | Cl __ | F | ch3 | O | nh2 | -YY |
2-370 | Cl | Cl | F | ch3 | O | nh2 | |
2-371 | Cl | Cl | F | ch3 | 0 | nh2 | O nh2 |
2-372 | Cl | Cl | F | ch3 | 0 | nh2 | 0 γν HN, Boc |
2-373 | Cl | Cl | F | ch3 | s | nh2 | yNH 2 o |
2-374 | Cl | Cl | F | ch3 | O | nh2 | 0 |
2-375 | Cl | Cl | F | ch3 | O | H AS | ch3 |
2-376 | Cl | Cl | F | ch3 | s | H | ch3 |
2-377 | Cl | Cl | F | ch3 | O | 0 Pp H | ch3 |
2-378 | Cl | Cl | F | ch3 | 0 | /SV Vô H | ch3 |
2-379 | Cl | Cl | F | ch3 | O | vO HS | ch3 |
2-380 | Cl | Cl | F | ch3 | 0 | A | ch3 |
2-381 | Cl | Cl | F | ch3 | O | VO hn . | ch3 |
2-382 | Cl | Cl | F | 0 | nh2 | Et | |
2-383 | Cl | Cl | F | -M | 0 | nh2 | Et |
2-384 | Cl | Cl | F | Et | O | nh2 | |
2-385 | Cl | Cl | F | s | nh2 | ch3 | |
2-386 | Cl | Cl | ch3 | ch3 | 0 | nh2 | '^V |
2-387 | Cl | Cl | F | ch3 | O | CF3 | ch3 |
Table 3 1HNMR data of compounds | |||||||
No. | _______________________________’HNMR ________________ |
1-2 | H NMR (500 MHz, DMSO-d6) δ 12.33 (s, 1H), 7.07 (s, 2H), 5.15 (q, J= 7.0 Hz, 1H) 1 50 (d _________ 7.0Hz, 3H). ’ |
1-4 | H NMR (500 MHz, Chloroform-7) δ 7.63 - 7.61 (m, 2H), 7.45-7.38 (m, 3H), 6.13 (s, 1H) 5 18 (s 2H) ’ ‘ ’ |
1-26 | H NMR (500 MHz, DMSO-7J δ 12.96 (s, 1H), 6.99 (s, 2H), 5.06 (q, J=7.0 Hz, 1H) 1 50 (d >7 0 ___________ Hz, 3H) ’ |
1-27 | H NMR (500 MHz, DMSO-70 δ 6.82 (s, 2H), 4.18 (dd, J= 11.0,2.0 Hz, 1H), 2.05 - 2.27 (m 2H) __ 0.93 (t, J= 8.0 Hz, 3H). ’ ’ |
1-71 | H NMR (500 MHz, DMSO-d6) δ 12.42 (s, 1H),8.21 (d, J = 2.5 Hz, 1H), 7.76 (t, J =5.5 Hz, 1H), 7.21 ___ ~ 7.11 (m, 2H), 5.15 (q, J= 7.0 Hz, 1H), 4.98 (d, J = 5.5 Hz, 2H), 1,50 (d, 7= 7 0Hz 3H) ’ |
2-2S | Ή NMR (500 MHz, DMSO-76) δ 7.53 (s, 1H), 6.36 (s, 2H), 4.63 (q, 7.0 Hz, 1H), 3.72 (s, 3H) _________________________________2.08 (s, 3H), 1,50 (d, J= 7.0 Hz, 3H)._______________________ ’ ’ |
2-29 | H NMR (500 MHz, DMSO-76) δ 6.36 (s, 2H), 4.66 (q, J= 7.0 Hz, 1H), 3.72 (s, 3H), 2.08 (s 3H) _____________________________________1.51 (d, 7= 7.0 Hz, 3H).______________________________ ’ ’ |
2-30 | H NMR (500 MHz, DMSO-76) δ 7.61 (s, 1H), 6.80 (s, 2H), 4.63 (q, J= 7.0 Hz, 1H), 3.72 (s 3H) 1.51 (d, 7= 7.0Hz, 3H). ’ ’ ’ |
2-31 | H NMR (500 MHz, DMSO-0) δ 6.81 (s, 2H), 4.66 (q, 7= 7.0 Hz, 1H), 3.72 (s, 3H), 1 52 (d 7= 7 0 Hz, 3H). ’ |
2-32 | H NMR (500 MHz, DMSO-70 δ 6.81 (s, 2H), 4.65 (q, 7= 7.0 Hz, 1H), 3.72 (s, 3H), 2.53 (s 3H) Ί__ 1.51 (d, 7= 7.0 Hz, 3H). ’ ’ |
2-33 | H NMR (500 MHz, DMSÔ-76) δ 6.79 (s, 2H), 4.74 (dd, 7= 10.0, 2.5 Hz, 1H), 2.31 (s, 3H), 1.84 (dtd ___,__7= 8.0, 4.0, 2.0 Hz, 1H), 1.74-1.84 (m, 1H), 0.89 (t, 7= 8.0 Hz, 3H). ’ ’ |
2-34 | H NMR (500 MHz, DMSO-76) δ 7.04 (s, 2H), 5.00-5.03 (m, 1H), 3.66 (s, 3H), 1.84-1 94 (m 2H) __ 0.96-1.0 (m, 3H). ’ ’ |
2-35 | H NMR (500 MHz, Chloroform-7) δ 5.14 (s, 2H), 4.97 (d, 7= 4.5Hz, 1H), 3.75 (s, 3H), 2.31-2.37 (m 1H), 1.09 (dd, 7= 7.0,2.0 Hz, 6H). ’ ’ |
2-36 | H NMR (500 MHz, DMSO-70 δ 6.79 (s, 2H), 4.83 (d, 7= 7.0 Hz, 1H), 2.31 (s, 3H), 2.27 (dt 7= _______________________13.5, 7.0 Hz, 1H), 0,88 (dd, 7= 25.0, 7.0 Hz, 6H).________________ ’ |
2-37 | HNMR(500MHz, DMSO-76) δ 6.80 (s, 2H), 4.32 (dd, 7= 11.0, 1.0Hz, 1H),3.72 (s, 3H), 1.81____________1-92 (m, 1H), 1,54 - 1.69 (m, 2H), 1.35 - 1,49 (m, 1H), 0.77 - 0,85 (m, 3H) ’ |
2-38 | H NMR (500 MHz, DMSO-d6) δ 6.77 (s, 2H), 4.63 (d, 7= 7.0 Hz, 1H), 3.72 (s, 3H), 0.79-0 86 (m ____________________1H), 0,37 - 0.49 (m, 2H), 0.28-0.33 (m, 2H).__________________________’ |
2-39 | H NMR (500 MHz, Chloroform-7) δ 5.05 (q, 7= 7.0 Hz, 1H), 4.44 (s 2H) 3 85 (s 3H) |
2-40 | HNMR (500 MHz, Chloroform-7) δ 4.52 (dd, 7= 11,0, 2.0 Hz, 1H), 4.44 (s, 2H), 3.85 (s 3H) _____________ 2.77-2.87 (m, 1H), 2.65-2.73 (m, 1H). ’ ’ ’ |
2-41 | H NMR (500 MHz, Chlorofom-7) δ 4.74 (t, 7= 7.0 Hz, 1H), 4.44 (s, 2H), 4.35 (dd, 7=12 5 7 0 Hz 1H), 4.00 (dd, 7= 12.5, 7.0 Hz, 1H), 3.85 (s, 3H). ’ ’ |
2-42 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.58-4.61 (m, 1H), 3.78- 3.86 (m, 1H), 3.72 (s, 3H) __________________ 3.63-3.69 (m, 1H), 2.24-2.29 (m, 1H), 2,07-2,13 (m, 1H).__________ ’ ’ |
2-43 | H NMR (500 MHz, DMSO-î/6) δ 6.80 (s, 2H), 5.16- 5.25 (m, 1H), 5.11 (dd, 7= 10.5, 5.0 Hz, 1H) ______________________4.83 - 4.92 (m, 1H), 4.75 - 4.85 (m, 1H), 3.72 (s, 3H).________’ ’ ’ |
2-44 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 6.29 (d, 7= 7.0 Hz, 1H), 5.Ï6-5.25 (m, 1H) 3 72 (s 3H), ’ ’ |
2-45 | H NMR (500 MHz, Chloroform-7) δ 6.12-6.19 (m, 1H), 5.43 - 5.45 (m, 1H), 5.32-5.37 (m, 1H), _______________________ 5.15-5.21 (m, 1H), 4.45 (s, 2H), 3.70 (s, 3H).__________________ ’ ’ |
2-46 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 5.67 (d, 7= 3.0 Hz, 1H), 3.68 (d, 7= 3.0 Hz 1H) 3 65 _______________ (s, 3H). ’ |
2-47 | _________ H NMR (500 MHz, DMSO-76) δ 7.18 (s, 2H), 5.80 (s, 1H), 3.76 (s, 6H). |
2-48 | H NMR (500 MHz, DMSO-7,) δ 9.95 (d, 7= 6.0 Hz, 1H), 6.80 (s, 2H), 5.38 (d, 7= 6 0 Hz 1H) 3 63 _________________:______________________________________________(s, 3H).________________________________________________’ ’ |
2-49 | H NMR (500 MHz, DMSO-76) δ 6.79 (s, 2H), 4.97 (t, 7= 5.5 Hz, 1H), 4.35 (t, 7= 7.0 Hz, 1H) __________________________4.21-4.26 (m, 1H), 3.91-3.96 (m, 1H), 3.72 (s, 3H)._________________’ ? |
2-50 2-51 | _________H NMR (500 MHz, Chloroform-d) δ 7.27 (s, 1H), 4.45 (s, 2H), 3.71 (s, 3H).________ H NMR (500 MHz, Chlorofonn-7) δ 6.96 (s, 1H), 6,86 (d, 7= 47.0 Hz, 1H), 4.45 (s, 2H) 3 74 (s __________________________________________________________ 3H).__3 ’ ’ |
2-52 2-53 | ___________ H NMR (500 MHz, DMSO-76) δ 6.83 (s, 2H), 6,76 (s, 1H), 3.66 (s, 3H)._____________ _____________H NMR (500 MHz, Chlorofotm-7) δ 6.62 (s, 1H), 4.47 (s, 2H), 3,73 (s, 3H).__ |
2-54 | H NMR (500 MHz, DMSO-d6) δ 7.07 (s, 2H), 5.31-5.33 (m, 1H), 3.85-3.89 (m, 1H) 3 72-3 77 __r (m, 1H), 3,66 (s, 3H), 3.34 (s, 3H). ’ ' | |
2-55 | H NMR (500 MHz, DMSOA6j δ 6.80 (s, 2H), 4.43 (t, J= 7.0 Hz, 1H), 4.02 (dd, J= 12 5 7 0 Hz ]_____________1H), 3.87 (dd, J= 12.5, 7.0 Hz, 1H), 3.19 (s, 3H), 2.31 (s, 3H)__________’ ’ | |
2-56 | _______H NMR (500 MHz, Chloroform-J) δ 5.97 (s, 1H), 4.46 (s, 2H), 3.71 (s 3H) 1 97 (s 2H) | |
2-57 | _______H NMR (500 MHz, Chloroform-J) δ 5.80 (s, 1H), 4.44 (s, 2H), 3.71 fs 3H1 2 23 fs 3H1 | |
2-58 | ||
H NMR (500 MHz, Chloroform-J) δ 6.17 (s, 1H), 4.45 (s, 2H), 3.71 (s 3H) 3 42 (s 3H) | ||
2-59 2-60 | H NMR (500 MHz, DMSO-J0 δ 6.81 (s, 2H), 4.49 (t, J= 7.0 Hz, 1H), 3.72 (s, 3H), 3.14 (dd J= ___________________12.5, 7.1 Hz, 1H), 2.62 (dd, 7= 12.5, 7.0 Hz, 1H), 2,25 (s, 6H).___________ ’ H NMR (500 MHz, Chloroform-J) δ 4.91 (t, J= 7.0 Hz, 1H), 4.45 (s, 2H), 3.85 (s, 3H), 3 33-3 37 (m __ 1H), 2.95-3.00 (m, 1H). ’ ' ’ | |
2-61 | ________ H NMR (500 MHz, Chloroformé) δ 5.76 (s, 1H), 4.45 (s, 2H) 3 75 fs 3H) | |
2-62 | ||
H NMR (500 MHz, Chloroform-d) δ 7.61 - 7.63 (m, 2H), 7.38 - 7.45 (m, 3H), 6.13 (s, 1H) 5 18 (s Ί___ 2H), 3.73 (s, 3H). ’ ’ ' ’ | ||
2-63 2-64 | H NMR (500 MHz, DMSO-d6) δ 7.33 - 7.40 (m, 2H), 7.20 - 7.28 (m, 2H), 7.15- 7.23 (m, 1H) 6.76 _________________(s, 2H), 5.22 (t, J= 7.0 Hz, 1H), 3.72 (s, 3H), 3.31-2.98 (m, 2H). ’ ’ ' H NMR (500 MHz, Chloroform-J) δ 7.61 - 7.63 (m, 2H), 7.38 - 7.45 (m, 2H), 6.13 (s 1H) 5 18 (s _______________ 2H), 3.73 (s, 3H). ’ ’ ' ’ | |
2-65 | H NMR (500 MHz, DMSO-Aj δ 7.41 (dd, J = 7.5, 1.5 Hz, 1H), 7.17 (dd, 7.5, 1.5 Hz, 1H), 7.06 (t ________________________J= TA Hz, 1H), 6.82 (s, 2H), 6.22 (s, 1H), 3.66 (s, 3H).__________’ ’ ' ’ | |
2-67 | H NMR (500 MHz, DMSOé6) δ 7.27 (s, 1H), 6.82 (s, 2H), 6.14 (s 1H) 3 66 (s 3H) | |
2-68 | ||
H NMR (500 MHz, DMSO-J6) δ 7.50 (d, J= 8.0 Hz. 1H), 7.23 (s, 2H), 5.81 (s, 1H) 3 67 fs 3H) | ||
2-69 2-70 | ||
H NMR (500 MHz, DMSOéé) δ 7.04 (s, 2H), 5.15 (q, J= 7.0 Hz, 1H), 3.65 (s, 3H) 1 50 (d J= _____________________________________________7.0Hz, 3H)._____________________ ’ | ||
H NMR (500 MHz, HMSOé6) δ 6.80 (s, 2H), 4.99 (q, J= 7.0 Hz, 1H), 2.31 (s, 3H), 1.54 (d J= 7 0 __ Hz, 3H). ’ | ||
2-71 2-72 | HNMR(500 MHz, Chloroform-i/) δ 5.24 (q, J= 7.0Hz, 1H), 5.15 (s, 2H),4.19-4.25 (m, 2H) 1 64 _____________________ (d, J= 7.5 Hz, 3H), 1.27 (t, J= 7.5 Hz, 3H). ’ ’ ' | |
H NMR (500 MHz, Chloroformé) δ 5.52 (q, J= 7.0 Hz, 1H), 5.19 (s, 2H), 2.84-2.92 (m 2H) 1 60 (d, 7.0 Hz, 3H), 1.25 (t, J= 7.5 Hz, 3H). ’ ’ | ||
2-73 | ||
H NMR (500 MHz, Chloroform-J) δ 5.25 (q, 7.0 Hz, 1H), 5.14 (s, 2H), 4.09-4.15 (m, 2H) 1.55-1.68 (m, 5H), 0.92 (t,J= 7.5 Hz, 3H). ’ ’ | ||
2-74 | ||
H NMR (500 MHz, DMSOé6) δ 6.80 (s, 2H), 4.97 (q, J= 7.0 Hz, 1H), 3.42 (td, J= 12.5, 3.0 Hz 1H), 2.90 (td, J= 12.5,2.5 Hz, 1H), 1.71-1,86 (m, 1H), 1.54 (d, J= 7.0 Hz, 3H), 1.34-1.44’(m 1H) ,__ 0.98 (t, J= 8.0 Hz, 3H). ’ ’ | ||
2-75 | H NMR (500 MHz, DMSÔé6) δ 7.03 (s, 2H), 5.03 (q, J= 7.0 Hz, 1H), 4.89-4.94 (m, 1H), 1.49 (d J = 7.0 Hz, 3H), 1.19 (d, J= 6.5 Hz, 3H), 1.14 (d .7=6 5 Hz 3H) ’ ’ | |
2-76 | ||
H NMR (500 MHz, DMSOé6) δ 6.80 (s, 2H), 5.00 (q, J= 7.0 Hz, 1H), 3.36 (dq, J= 13.5, 7.0 Hz ______________________ 1H), 1.54 (d, J= 7.0Hz, 3H), 1,30 (s, 6H). ’ ’ | ||
2-77 | ||
HNMR (500 MHz, Chloroform-i/) δ 5.24 (q, J= 7.0 Hz, 1H), 5.15 (s, 2H), 4.12-4.20 (m, 2H), 1.59 - 1.64 (m,5H), 1.31-1.38 (m,2H), 0.89 - 0.93 (m,3H). ’ ’ | ||
2-78 | ||
HNMR (500 MHz, DMSOé6) δ 6.80 (s, 2H), 4.99 (q, J= 7.0 Hz, 1H), 3.29 (td, J= 12.5, 3.5 Hz 1H), 3.04 (td, J= 12.5,2.5 Hz, 1H), 1.62-1.75 (m, 1H), 1.44- 1.57 (m, 4H), 1.33-1.41 (m, 1H), 1.14 ___ - 1.27 (m, 1H), 0.92 (t, J= 8.0 Hz, 3H). ’ | ||
2-79 | H NMR (500 MHz, DMSOé6) δ 6.80 (s, 2H), 4.67 (q, 7.0 Hz, 1H), 4.23 (dd, J= 12 5 7 0 Hz 1H), 3.12 (dd, J= 12.5, 7.0 Hz, 1H), 1.93-2.01 (m, 1H), 1.51 (d, J= 7.0 Hz, 3H), 0.88 (d, J=7 0 Hz _____________ 6H). ’ | |
2-80 | HNMR (500 MHz, DMSO-A) δ 6.80 (s, 2H), 5.01 (q, J= 7.0 Hz, 1H), 3.56 (dd, J= 12.5, 7 0 Hz 1H), 2.89 (dd, J= 12.5, 7.0 Hz, 1H), 1.73 (dp, J= 13.5, 7.0 Hz, 1H), 1.54 (d, J= 7.0 Hz, 3H) 0 92 (dd _____________ J = 25,7.0 Hz, 6H). ’ | |
2-81 | H NMR (500 MHz, Chloroform-J) δ 5.17-5.20 (m, 1H), 5.14 (s, 2H), 4.86-4.94 (m, 1H) 1 51-1 66(m ________________________ 5H), 1.18-1,28 (m, 3H), 0,83-0,95 (m, 3H)________________’ ' ’ | |
2-82 | ‘H NMR (500 MHz, DMSOé6) δ 6.79 (s, 2H), 5.00 (q, J= 7.0 Hz, 1H), 2.88-2.95 (m, 1H), 2.21-2 27 __________(m, 1H), 1.51 - 1.62 (m, 4H), 1.32 (d,J= 7.0 Hz, 3H), 0.88 (t, 8.0 Hz 3H) ’ | |
2-83 2-84 1 | ||
H NMR (500 MHz, Chloroformé) δ 5.14 (s, 2H), 5.09 (q, J= 7.0 Hz, 1H), 1,60 (d, J= 7 0 Hz 3H) __________________________________________________1.46 (s, 9H), ’ ’ | ||
H NMR (500 MHz, DMSOéfi) δ 6.80 (s, 2H), 5,01 (q, J=7.0Hz, 1H), 1.53 (d, J= 7 0 Hz 3H) 1 32 | ||
___ (s, 9H). ' | |
2-85 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.67 (q, J= 7.0 Hz, 1H), 4.07 - 3.97 (m, 1H), 3.90 (td 7=12,5, 3.0 Hz, 1H), 1.52 (d, 7= 7.0 Hz, 3H), 1.32 - 1.13 (m, 6H), 0.90 (t, J= 7.0 Hz, 3H) ’ |
2-86 | H NMR (500 MHz, DMSO-7â) δ 6.80 (s, 2H), 4.97 (q, J= 7.0 Hz, 1H), 3.41 (td, 12.5, 3.5 Hz 1H), 2.89 (td, J= 12.5,2.5 Hz, 1H), 1.69-1.75 (m, 1H), 1.54 (d, 7=6.5 Hz, 3H), 1.10- 1,38 (m, 4H) _______________ 0.84 - 0.92 (m,2H), 0.88 (s, 2H). ’ ’ |
2-87 | H NMR (500 MHz, DMSO-7fi) δ 6.80 (s, 2H), 4.67 (q, J= 7.0 Hz, 1H), 4.15 (dd, J= 12 5 7 0 Hz 1H),3.67 (dd,7= 12.5, 7.0Hz, 1H), 1.72- 1.85 (m,7= 7.0 Hz, 1H), 1.51 (d,7= 7.0Hz, 3H), 1,23- ______________ l-35(m, 1H), 1.07- 1.20 (m,lH), 0.83-0.92 (m,6H). ’ |
2-88 | Ή NMR (500 MHz, DMSO-7fi) δ 6.80 (s, 2H), 5.00 (q, 7= 7. Hz, 1H), 3.28 (dd, 7= 12.5, 7.0 Hz 1H) 2.74 (dd,7= 12.5, 7.0 Hz, 1H), 1.61 -1.74 (m, 1H), 1.54 (d, 7= 7.0 Hz, 3H), 1.28-1.41 (m, 1H), ________________1.08-1.14 (m, 1H), 0.91 (d, 7= 7.0 Hz, 3H), 0.84 (t, 7= 8.0 Hz, 3H). ’ ’ |
2-89 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.67 (q, 7=7.0 Hz, 1H), 4.43-4.47 (m, 1H), 3.44-3.50 (m, 1H), 1.77-1.85 (m, 1H), 1.51 (d, 7=7.0 Hz, 3H), 1.42-1.47 (m, 1H), 1.24-1.31 (3 1H) 0 97 _______________ (d,J=7.0 Hz, 6H). ’ |
2-90 | H NMR (500 MHz, DMSO-46) δ 6.80 (s, 2H), 4.99 (q, 7= 6.9 Hz, 1H), 3.51 (td,7= 12.2, 4.2 Hz 1H),2.89 (td, 7= 12.3,3.1 Hz, 1H), 1.68- 1.58 (m, 1H), 1.62- 1.44 (m, 5H), 0.85 (dd,7=25 0 6 7 ____________ Hz, 6H). ’ |
2-91 | H NMR (500 MHz, DMSO-76) δ 6.81 (s, 2H), 4.68 (q, 7= 7.0 Hz, 1H), 3.50-3.61 (m, 2H) 1 53 (d __ 7= 7.0 Hz, 3H), 1.05 (s, 9H). ’ ’ |
2-92 | Ή NMR (500 MHz, DMSO-7é) δ 6.80 (s, 2H), 4.99-5.03 (m, 1H), 3.70 (d, 7= 12.5 Hz, 1H), 2.84 (d J __= 12.5 Hz, 1H), 1.54 (d,7= 7.0 Hz, 3H), 0.86 (s, 9H). ’ ’ |
2-93 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.68 (q, 7= 7.0 Hz, 2H), 1.52 (d, 7= 7.0 Hz, 3H), 1.34 __________~ t·48 (m, 1H), 1.13- 1.25 (m, 5H), 1.03 - 1.16 (m, 1H), 0.81 (t,7= 8.0 Hz, 3H).’ ’ |
2-94 | H NMR (500 MHz, DMSO-76) δ 6.79 (s, 2H), 5.02 (q,7= 7.0 Hz, 1H), 3.27-3.34 (m, 1H), 2.15-2.22 _(m, 1H), 1.45- 1.57 (m, 4H), 1.29 (d, 7= 7.0 Hz, 3H), 1.02 - 1.23 (m, 2H), 0.79 (t, 7= 8.0 Hz 3H1 |
2-95 | H NMR (500 MHz, DMSOVj δ 6.80 (s, 2H), 4.66-4.75 (m, 2H), 1.92- 2.05 (m, 7= 7 0 Hz 1H) __1-52 (d,7= 7.0 Hz, 3H), 1.17 (d,7= 7.0 Hz, 3H), 0.79 (d, J=7.0Hz,6H). ’ ’ |
2-96 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 5.00 (q, 7= 7.0 Hz, 1H), 3.08-3.13 (m, 1H), 1.73-1.80 _________ (m, 1H), 1.54 (d, 7= 7.0 Hz, 3H), 1.34 (d, 7= 7.0Hz, 3H), 0.84-0.90 (m, 6H). ’ |
2-97 | H NMR (500 MHz, DMSO-76) δ 6.8Ô (s, 2H), 4.64- 4.72 (m, 1H), 3.07-3.12 (m, 1H), 1.52 (d, 7= 7 0 __________ Hz, 3H), 1.25-1.32 (m,4H), 0.83 (t, 7= 8.0 Hz, 6H). ’ ’ |
2-98 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.99-5.03 (m, 1H), 2.89-2.94 (m, 1H), 1.94 -2 08 (m _____________2H), 1.54 (d,7= 7.0 Hz, 3H), 1.37- 1.45 (m, 2H), 0.82 (t,7= 8.0 Hz, 6H). ’ |
2-99 | H NMR (500 MHz, DMSO-A) δ 6.80 (s, 2H), 4.68 (q, 7= 7.0Hz, 1H), 1.56-1.63 (m,ÎH), 1.52 (d,7= _________________ 7.0 Hz, 3H), 1.34 -1.45 (m, 7H), 0.84 (t, 7= 8.0 Hz, 3H). ’ ’ |
2-100 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.99-5.03 (m, 1H), 2.20-2.27 (m, 1H), 1 44 - 1 56 (m _______________ 4H), 1.35 (s, 3H), 1.30 (s, 3H), 0.82 (t, 7= 8.0 Hz, 3H). ’ |
2-101 | H NMR (500 MHz, DMSO-A) δ 6.81 (s, 2H), 4.67 (q, 7= 7.0 Hz, 1H), 3.89- 4.02 (m, 2H), 1.52 (d J ___________ = 6.5 Hz, 3H), 1.11-1.31 (m, 8H), 0.85-0.89 (m, 3H). ’ ’ |
2-102 | H NMR(500 MHz, DMSO-76) δ 6.80 (s, 2H), 5.00 (q, 7= 7.0 Hz, 1H), 3.41-3.47( m, 1H), 2.86-2.92 (m, 1H), 1.54- 1.65 (m, 1H), 1.54 (d,7= 7.0Hz, 3H), 1.09- 1.41 (m, 6H), 1.00-1.12 (m 1H) 0 87 _______ (t, 7= 8.0 Hz, 3H). ’ |
2-103 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.67 (q, 7= 7.0 Hz, 1H), 4.23 (dd, 7= 12.5, 7.0Hz, 1H), 3.57 (dd,7= 12.5, 7.0 Hz, 1H), 1.67- 1.81 (m, 1H), 1.40- 1.54 (m, 4H), 1.25-1.30 (m, 1H)’ ________________ 1.14-1.22 (m, 1H), 1.00-1.10 (m, 1H), 0.79-0.89 (m, 6H). ’ |
2-104 | H NMR (500 MHz, DMSO^6) δ 6.80 (s, 2H), 4.99 (q, 7= 7.0 Hz, 1H), 3.15-3.19 (m, 1H), 2.82 2.90 (m, 1H), 1.63-1.70(m, 1H), 1.49- 1.60 (m,4H), 1.35-1.40 (m, 1H), 1.12-1.26 (m, 2H),0.79 __ 0.91 (m, 6H). |
2-105 | H NMR (500 MHz, DMSO-76) δ 6.81 (s, 2H), 4.67 (q, 7= 7.0 Hz, 1H), 4.10 - 4.20 (m 1H) 3 84 3.93 (m, 1H), 1.52 (d, 7= 7.0 Hz, 3H), 1.23 - 1.39 (m, 4H), 1.09 - 1.20 (m, 1H), 0.83 - 0.92 (m 6H) |
2-106 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.99 (q, 7= 7.0 Hz, 1H), 3.50-3.56 (m, 1H) 2 86-2 92 (m, 1H), 1.85-1.92 (m, 1H), 1.54 (d, 7= 7.0 Hz, 3H), 1.19-1.46 (m, 3H), 1.08- 1.20 (m, 1H) 0 81__ 0.88(m, 6H). ’ |
2-107 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.68 (q, 7= 7.0 Hz, 1H), 4,42-4.48 (m, 1H) 3 49-3 45 (m, 1H), 1.53 (dd,7= 16.5, 7.0 Hz, 4H), 1.39-1.51 (m, 1H), 1.26-1.33 (m, 1H), 1.16-1.23 (m, 1H), |
2-108 | _______________1.03 - 1,16 (m, 1H), 0.92 (d, 7=7.0 Hz, 3H), 0,90 (d, 7=7.0 Hz, 3H)._________ H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.99 (q, 7= 7.0 Hz, 1H), 3.25-3.31 (m, 1H), 2.99-3.04 |
(m, 1H), 1.72 1.85 (m, 1H),1.48- 1.56 (m, 4H), 1.37-1.46 (m, 1H), 1.14- 1.31 (m, 2H) 0 88- 0 9 4 _______________________ (m, 6H). ’ ’ | |
2-113 | H NMR (500 MHz, DMSO-^) δ 6.81 (s, 2H), 4.64 - 4.78 (m, 1H), 1.52 (d, J= 7.0 Hz, 3H), 1.33_________________ 1.47 (m,4H), 1.05-1.26 (m, 6H), 0.88 (t, 7= 8.0 Hz, 3H). ’ |
2-114 | H NMR (500 MHz, DMSO-d6) δ 6.79 (s, 2H), 4.99-5.03 (m, 1H), 3.00-3.10 (m, 1H), 2.13 - 2.22(m __1H), 1.42-1,57 (m, 6H), 1.31 (d, 7=7.0 Hz, 3H), 1,11 - 1.30 (m, 2H), 0.88 (t, 7= 7.5 Hz. 3ED ’ |
H NMR (500 MHz, DMSO-d6) δ 6.81 (s, 2H), 4.67 (q, 7= 7.0 Hz, 1H), 3.98-4.03 (m, 1H) 3 95 - | |
2-121 | 3.85 (m, 1H), 1.52 (d, 7= 7.0 Hz, 3H), 1.13-1.32 (m, 8H), 0.83-0.91 (m, 2H), 0.87(t 7= 7 5 Hz ______________ 3H). ’ |
2-122 | HNMR (500 MHz, DMSO-d6) δ 6.80 (s, 2H), 4.99 (q, 7=7.0 Hz, 1H), 3.23 - 3.33 (m, 1H), ___________2.96-3.06 (m, 1H), 1.48 - 1,63 (m, 6H), 1.09 - 1.30 (m, 7H), 0.85-.88 (m, 3H). ’ ’ |
2-155 | H NMR (500 MHz, DMSO-76) δ 6.81 (s, 2H),4.67 (q, 7= 7.0 Hz, 1H), 3.90-4.02 (m, 2H), 1.52 (d J ___ =7.0Hz,3H), 1.31-1.43 (m, 1H), 1.16-1.31 (m, 10H), 1.17 (s, 1H), 0.87 (t, 7= 7.5 Hz. 3H) ’ |
2-156 | H NMR (500 MHz, DMSO-7,) δ 6.80 (s, 2H), 5.00 (q, 7=7.0 Hz, 1H), 3.26 (dd, 7= 12.5, 7.0 Hz 1H), 2.78 (dd, 7= 12.5,7.0 Hz, 1H), 1.36-1.71 (m, 8H), 1.09-1.25 (m, 2H), 0.99-1.12 (m 2H) ’ ____________ 0.82-0.90 (m, 6H). ’ ’ |
2-157 | H NMR (500 MHz, DMSO-d6) δ 6.80 (s, 2H), 4.68 (q, 7=7.0 Hz, 1H), 4.14 (dd, 7= 12.5, 7.0 Hz 1H), 3.82 (dd,7= 12.5, 7.0 Hz, 1H), 1.66-1.68 (m, 1H), 1.49 - 1.62 (m, 4H), 1.36 - 1.52 (m’2H), 1.03 _____- l-29(m, 4H), 0.94-0.99 (m, 4H), 0.88 (t, 7= 8.0 Hz, 3H). ’ |
2-158 | H NMR (500 MHz, DMSO-d6) δ 6.80 (s, 2H), 5.00 (q, J- 7.0 Hz, 1H), 3.26 (dd, 7= 12.5, 7.0 Hz 1H), 2.78 (dd,7= 12.5, 7.0 Hz, 1H), 1.71-1.36(m, 8H), 1.25 - 1.09 (m, 2H), 1.12-0.99 (m 2H) ’ _______________ 0.90-0.80 (m, 6H). ’ ’ |
2-159 | H NMR (500 MHz, DMSO-d6) δ 6.81 (s, 2H), 4.67 (q, 7= 7.0 Hz, 1H), 3.89 - 4.02 (m, 2H) 1 52 (dd 7= 7.0, 3.0 Hz, 4H), 1.35 - 1.49 (m, 1H), 1.00- 1.34 (m, 7H), 0.93 (d,7= 7.0 Hz, 3H), 0.89 (d 7= ’ t_________________ 7.0 Hz, 3H). ’ |
2-160 | H NMR (500 MHz, DMSO-J6) δ 6.80 (s, 2H), 4.99 (q,7= 7.0 Hz, 1H), 3.23 -3.45 (m, 1H), 2.95 3.06 (m, 1H), 1.47- 1.63 (m, 7H), 1.34- 1.50 (m, 1H), 1.19-1.31 (m, 1H), 1.15-1.18 (m, 2H), 1.00__1-15 (m, 1H), 0.91 (dd, 7= 25.0, 7.0 Hz, 6H). |
2-163 | H NMR (500 MHz, DMSO-76) δ 6.81 (s, 2H), 4.68 (qd, 7= 7.0, 2,0 Hz, 2H), 1.52 (d,7= 7.0 Hz 3H) 1.46- 1.35 (m, 1H), 1.28 (s, 1H), 1.20-1.29 (m, 1H), 1.12 - 1.24 (m, 9H), 1.00-1.10 (m, 1H) ’ ______________ 0.86-0.88(m, 3H). ’ |
2-164 | H NMR (500 MHz, DMSO-d6) δ 6.80 (s, 2H), 5.00 (q, 7= 7.0 Hz, 1H), 3.09 - 3.20 (m 1H) 1 68 1.79 (m, 1H), 1.54 (d,7= 6.5 Hz, 3H), 1.32 - 1.45 (m, 2H), 1.29 (d, 7= 7.0 Hz, 3H), M6-l’19(m ________________ 6H), 1.13 (s, 1H), 0.86-0.88 (m, 3H). ’ |
2-175 | H NMR (500 MHz, DMSO-d6) δ 6.81 (s, 2H), 4.67 (q, 7= 7.0 Hz, 1H), 3.86 -4.04 (m, 2H), 1.52 (d J ____________ -7.0 Hz, 3H), 1,12-1.31 (m, 14H), 0.86-0.89(m, 3H). ’ ’ |
2-176 | H NMR (500 MHz, DMSO-76) δ 6.79 (s, 2H), 4.99 (q, 7= 7.0 Hz, 1H), 3.24 - 3.33 (m, 1H), 2,963.06 (m, 1H), 1.47-1.62 (m, 5H), 1.14- 1.31 (m, HH), 1.07- 1.17 (m, 1H), 0.85-0.89 (m’sH) |
2-195 | H NMR (500 MHz, DMSO-d6) δ 6.80 (s, 2H), 4.67 (q,7= 7.0Hz, 1H), 3.89 - 4.01 (m, 2H), 1 52 (d J _______________ = 7.0Hz, 3H), 1.08- 1.33 (m, 16H), 0.84-0.90 (m,3H). ’ ’ |
2-196 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.99 (q, 7= 7.0 Hz, 1H), 3.23 - 3.33 (m, 1H), 2.96- |
___________3-06 (m, 1H), 1.49 - 1.62 (m, 5H), 1.11 - 1.26 (m, 14H), 0.82 - 0.93 (m, 3H). | |
2-215 | H NMR (500 MHz, DMSO-d6) δ 6.81 (s, 2H), 4.67 (q, 7= 7.0 Hz, 1H), 3.91-4.01 (m, 2H), 1 52 (d 7 ____________=_7.0Hz,3H), 1.21 - 1.31 (m, 2H), 1.12- 1.24 (m, 16H), 0.83 -0.91 (m, 3H) ’ ’ |
2-216 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.99 (q, 7= 7.0 Hz, 1H), 3.23 - 3.33 (m, 1H), __________2-96-3,06 (m, 1H), 1.48 - 1.62 (m, 5H), 1.11 - 1.27 (m, 16H), 0.82-0.92 (m, 3H) ’ ’ |
2-235 | H NMR (500 MHz, DMSO-76) δ 6.81 (s, 2H), 4.67 (q, 7= 7.0 Hz, 1H), 4.00-4.05 (m, 1H), 3.83 ___ 3-92 (m, 1H), 1.52 (d, 7= 7.0 Hz, 3H), 109 - 1.32 (m, 20H), 0.82 - 0.92 (m, 3H). ’ |
2-236 | H NMR (500 MHz, DMSO-d6) δ 6.80 (s, 2H), 4.99 (q, 7= 7.0 Hz, 1H), 3.23 - 3.33 (m, 1H), 2.96 _____________________=3.06 (m, 1H), 1.48 -1.26 (m, 15H), 0.81 - 0.91 (m, 11H). ’ ’ |
2-263 | H NMR (500 MHz, DMSO-d6) δ 6.77 (s, 2H), 4.62 (q, 7= 7.0 Hz, 1H), 3.32 (p, 7= 7.0 Hz, 1H), 1,50 __(d, 7= 7.0 Hz, 3H), 0.44-0.48 (m, 2H), 0.23 -0.35 (m, 2H), ’ ’ |
2-264 | H NMR (500 MHz, DMSO-d6) δ 6.80 (s, 2H), 4.68 (q, 7= 7.0 Hz, 1H), 4.49 (p, 7= 7.0 Hz 1H) 2.09 ___ ~ 2.20 (m, 2H), 1.78 - 1.92 (m, 3H), 1.63 - 1.76 (m, 1H), 1.52 (d, 7= 7.0 Hz, 3H). ’ |
2-265 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.87 (p, 7= 7.0 Hz, 1H), 4.68 (q, 7= 7.0 Hz, 1H) ___________1-73-1.80 (m, 2H), 1.58-1.67 (m, 2H), 1.42-1.56 (m, 6H), 1.40-1.45 (m, 1H). ’ ’ |
2-266 | H NMR (500 MHz, DMSO-76) δ 6.76 (s, 2H), 4.96 (s, 1H), 2.95 (s, 1H), 1.49 - 1.70 (m, 4H) 1 52 (s _________________________ 4H), 1.32-1,38 (m, 3H), 1,04-1.09 (m, 2H).______________ ’ ’ |
2-267 | H NMR (500 MHz, DMSO-^) δ 6.80 (s, 2H), 5.40 (d, J= 12.5 Hz, 1H), 4.89 (d, J= 12.5 Hz 1H) “ __________ 4.67 (q, 7= 7.0 Hz, 1H), 1.53 (d, 7=7.0 Hz, 3H). ’ ’ |
2-268 | H NMR (500 MHz, DMSO-76) δ 7.32 (d, 0= 12.5 Hz, 1H), 6.80 (s, 2H), 6.29 (d, J= 12.5 Hz, 1H) ’ .____________________4.66 (g, 0= 7.0 Hz, 1H), 1.56 (d, J= 7.0 Hz, 3H)._______________ ’ ’ |
2-270 | H NMR (500 MHz, Chloroform-7) δ 4.49-4.58 (m, 2H), 4.45 (s, 2H), 3.72 - 3.62 (m, 1H) 3 60 - 3 50 ___________________ (m. 2H), 3.37 (s, 3H), 2.51 (s, 3H), 1,68 (d, 7=7.0 Hz, 3H) ’ ’ ' ’ |
2-271 | H NMR (500 MHz, Chloroform-7) δ 4.67 (q, J= 6.5 Hz, 1H), 4.45 (s, 2H), 4.20 - 4.09 (m 2H) 3.38 3.12 (m, 3H), 3.04-2.95 (m, 1H), 1.61 (d, 0= 6.5 Hz, 3H), 1.59-1.15 (m, 4H), 1.03 (t 0=7 5 Hz __________ 3H). ’ |
2-272 | H NMR (500 MHz, DMSO-76) δ 6.79 (s, 2H), 4.99 (q, 0= 7.0 Hz, 1H), 3.37 (td, 0= 12 5 3 0 Hz 1H), 3.30 (td,7= 12.0, 1.5Hz, 1H),3.21 (dt,0= 12.5, 3.0Hz, 1H),3.18 (s, 3H),2.98 (td,0= 125 3 5 Hz, ÎH), 1,64- 1.74 (m, 1H), 1.60 (tt, 7= 12.0, 3.5 Hz, 1H), 1.54 (d, 0=7 0 Hz 3H) ’ |
2-273 | H NMR (500 MHz, DMSO-d6) δ 6.81 (s, 2H), 5.94-6.02 (m, 1H), 5.28 - 5.37 (m, 1H), 5.20 - 5.31 ___ ____________________(m, 1H), 4.55 4.70 (m, 3H), 1,53 (d, 7= 7.0 Hz, 3H)·_________’ |
2-274 | H NMR (500 MHz, DMSO-0j δ 6.80 (s, 2H), 4.96 (q, 7= 7.0 Hz, IH), 4.14 (dd, 7= 12,5 3.0 Hz 1H), 3,53 (dd, 7= 12,5, 3.0 Hz, 1H), 3,09 (t, 7= 3.0 Hz, 1H), 1 61 (d 7= 7 0 Hz 3H1 ’ |
2-275 | H NMR (500 MHz, DMSO-00 δ 6.80 (s, 2H), 4.71 (dd, 7= 12,5, 3.0 Hz, 1H), 4.59- 4.70 (m 2H) ________________________3.55 (t, 7= 3.0 Hz, 1H), 1,52 (d, 7=7.0 Hz, 3H).___________ ’ ’ |
2-276 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 4.50 - 4.83m, 3H), 4.25 - 4.48 (m, 2H) 1 50 (d 7= _____ 7.0 Hz, 3H). ’ ’ |
2-277 | HNMR(500 MHz, DMSO-0Û δ 6.80 (s, 2H), 4.83 (dt, 7= 12.5, 1.5 Hz, 1H), 4.70 (q, 7= 7.0 Hz ________________1H), 3.78 - 3.89 (m, 2H), 3.46-3.51(m, 1H), 1,52 (d, 7= 7.0 Hz, 3H) ’ ’ |
2-278 | H NMR (500 MHz, DMSO-0) δ 6.80 (s, 2H), 4.68 (q, 7= 7.0 Hz, 1H), 4.54 (dt, 7= 12.5 2.0 Hz 1H), 4.39-4.44 (m, 1H), 3.61 (dt,7= 12.5, 2.0 Hz, 1H), 3.29-3.34 (m, 1H), 1,48 (d,7= 7 0 Hz 3H) |
2-279 | H NMR (500 MHz, DMSO-76) δ 6.80 (s, 2H), 5.86 (t, 7= 7.0 Hz, 1H), 4.68 - 4.78 (m, 1H) 4.62 _____________________ 4.72 (m, 1H), 3.74-3.87(m, 1H), 1.52 (d, 7= 7.0 Hz, 3H). ’ ’ ’ |
2-280 | H NMR (500 MHz, DMSO-76) δ 7.06 (s, 2H), 5.13-5.14 (m, 1H), 4.15-4.17 (m, 2H), 2 12-2 26 (m __2H), 1,74-1.77 (m, 2H), 1.43-1,52 (m, 3H).______________ ’ |
2-281 | H NMR (500 MHz, DMSO-00 δ 6.80 (s, 2H), 5.17-5.25 (m, 1H), 4.66 (q, 7= 7.0 Hz, 1H), 4 03-4 09 ___ (m, 1H), 1.53 (d, 7= 7.0 Hz, 3H). ’ |
2-282 | H NMR (500 MHz, ChIoroform-7) δ 4.77-5.00 (m, 2H), 4.59 (q, 7= 7.0 Hz, 1H), 4.45 (s 2H) 1 69 _________________ (d, 7= 7.0Hz, 3H). ’ ’ ’ ‘ |
2-283 | H NMR (500 MHz, DMSO-0.) δ 6.81 (s, 2H), 4.67 (q, 7= 7.0 Hz, 1H), 4.37-4.42 (m 1H) 4 02-4 08 ______(m, 1H)> 2-75 (s, 6H), 2.59-2.62 (m. 1H), 1.79- 1.89 (m, 1H), 1.52 (d,7= 7.0 Hz 3H1 ’ |
2-284 | H NMR (500 MHz, DMSO-0,) δ 6.80 (s, 2H), 4.66 (q, 7= 7.0Hz, 1H), 4.45-4.50 (m, 1H) 3 46-3 51 Ί________________(m, 1H), 2.80 (s, 2H), 2.60-2.74 (m, 2H), 1.52 (d, 7= 7.0Hz, 3H) ’ |
2-285 | H NMR(500 MHz, DMSO-76) δ 6.81 (s, 2H), 6.24-6.28 (m, 1 H), 6.01-6.07 (m, 1H),4.61 -472 (m _______________ 3H), 1.53 (d, 7= 7.0 Hz, 3H). ’ ' ’ |
2-286 | H NMR (500 MHz, Chloroform-7) δ 6.07 (d, 7= 12.5 Hz, 1H), 4.57 (q, 7= 7.0 Hz, 1H), 4.43 (s 2H) ____________ 4.25 (d, 7= 12.5 Hz, 1H), 1.67 (d, 7= 7.0 Hz, 3H). ’ ’ ’ ’ ’ |
2-287 | H NMR (500 MHz, DMSO-d6) δ 7.00 (s, 2H), 5.11 (q, J = 7.0 Hz, 1H), 4.31-4.27 (m 1H) 4 20-4 15 (m, 1H), 4.08-4.00 (m, 2H), 1.75 (s, 3H), 1.66 (s, 3H), 1.48 (d, J = 7 0 Hz 3H)__________ ’ ' |
2-288 | H NMR (500 MHz, Chloroform-7) δ 5.90-5.98 (m, 1H), 5.13-5.26 (m, 1H), 5.22 - 5.11 (m 1H) 4 94 - 4.86 (m, 1H), 4.68 - 4.59 (m, 2H), 4.45 (s, 2H), 1.69 (d,7= 7.0 Hz, 3H), 1 62 (s 3H) 1 57 (s 3H1 |
2-289 | H NMR (500 MHz, Chloroform-7) δ 5.32 (d, 7= 12.5 Hz, 1H), 5.03 (d, J= 12.5 Hz, 1H), 4.70 (q 7= —__________6·5 Hz, ÎH), 4.47 (s, 2H), 2.95 (s, 3H), 2.84 (s, 3H), 1.61 (d, 7= 6.5 Hz,3H) ’ ’ |
2-290 | H NMR (500 MHz, DMSO-76) δ 6.82 (s, 2H), 5.13 (q, 7= 7.0 Hz, 1H), 4.26 (d, 7= 12.5 Hz 1H) __________________3-73 (d, 7= 12.5 Hz, 1H), 3.67 (s, 3H), 1.50 (d, 7= 7.0 Hz, 3H). ’ ’ |
2-291 | H NMR (500 MHz, Chloroform-7) δ 6.00 (dd, 7= 10.0, 1.5 Hz, 1H), 4.59 (q, 7= 6.5 Hz, 1H) 4.45 (s _____________ 2H),3.27(s,3H), 1.77- 1.68 (m,4H), 1.23-0.87 (m,4H). ’ ’ ’ |
2-292 | H NMR (500 MHz, DMSO-0) δ 6.79 (s, 2H), 4.73 (q, 7= 7.0 Hz, 1H), 2.47 (s, 3H) 2 41 (s 3H) _______________ 1.50 (d, 7= 7.0 Hz, 3H). ’ ’ |
2-294 | H NMR (500 MHz, Chloroform-7) δ 5.04 (d, 7= 12.5 Hz, 1H), 4.89 (d, 7= 12.5 Hz, 1H), 4.60 (q 7= __LP Hz. 1H), 4.45 (s, 2H), 4.23-4.30 (m, 2H), 1,69 (d, 7= 7.0Hz, 3H), L22 (t, 7= 8 0 Hz 3H) ’ |
2-295 | H NMR (500 MHz, Chloroform-d) δ 5.32 (q, 7= 7.0 Hz, 1H), 4.62 (q, 7= 7.0 Hz, 1H), 4.45 (s 2H) __3.85 (s, 3H), L73 (d,7= 7.0 Hz, 3H), 1,59 (d 7=7 0 Hz 3H) ’ ’ ’ |
2-296 | H NMR (500 MHz, Chloroform-7) δ 7.82 (q, 7= 6.5 Hz, 1H), 4.57 (q, 7= 6.5 Hz, 1H), 4 45 (s 2H) __4.01 (s, 3H), 1.69-1.52 (m, 6H).________________ ’ ’ ’ |
2-297 | H NMR (500 MHz, Chloroform-7) δ 6.29 (t, 7= 7.0 Hz, 1H), 4.57 (q, J= 7.0 Hz, 1H), 4.45 (s, 2H) 3.93-3.97 (m, 1H), 3.81-3.85 (m, 1H), 2.09-1.89 (m, 2H), 1.65-1,72 (m, 4H) 1 53-1’59 (m IH) ’ |
2-298 | HNMR (500 MHz, Chloroform-d) δ 5.28 (q, J= 7.0 Hz, 1H), 5.15 (s, 2H), 4.27-4.07 (m 3H) 3,91 - 3.73 (m, 2H), 2.04 -1.82 (m, 3H), 1.66 (d,7= 7.0 Hz, 3H), 1.59-1.54 (m, 1H). ’ ’ |
2-299 | H NMR (500 MHz, Chlore form-7) δ 7.47 - 7.39 (m, 1H), 7.41 - 7.33 (m, 2H), 7.04 - 6.98 (m, 2H) 4.60 (q, 7= 7.0 Hz, 1H), 4.42 (s, 2H), 1.76 (d, 7= 7.0 Hz, 3H). ’ ’ |
2-300 | H NMR (500 MHz, DMSO-76) δ 7.34-7.27 (m, 5H), 7.05 (s, 2H), 5.20-5.17 (m, 3H), 1.53 (d, J= 7.0 Hz, 3H).______ ’ |
2-301 | H NMR (500 MHz, Chloroform-7) δ 7.25 - 7.34 (m, 5H), 5.59 (q, J= 7.0 Hz, 1H), 5.21 (s 2H) 4 15 (s, 2H), 1.65 (d, 7= 7.0 Hz, 3H). ’ ’ ' |
2-302 | H NMR (500 MHz, Chloroform-7) δ 7.31 - 7.17 (m, 4H), 5.77-5.79 (m, 1H), 4.68-4,71 (m, 1H), 4.55 __ (q, 7= 7.0 Hz, IH), 4.42 (s, 2H), 2.25 (s, 3H), 1.67 (d, 7= 7.0 Hz, 3H). ’ ’ ' |
2-303 | H NMR (500 MHz, DMSO-76) δ 7.17-7.20 (m, 1H), 7.10-7.19 (m, 2H), 7.02-7.06 (m, 1H), 6.76 (s 2H), 4.92 (q, 7=7.0 Hz, 1H), 4.49 (dt, 7= 12.0, 1.0 Hz, 1H), 4.30-4.40 (m, 1H), 2.23 (d, 7= 1.5 Hz’ !__ 3H), 1.31 (d, 7= 7.0Hz, 3H). ’ ' ’ |
2-304 | H NMR (500 MHz, DMSO-76) δ 7.38 (t, 7= 7,5 Hz, 1H), 7,31-7.33 (m, 2H), 7.02-7.04 (m, 1H), 6.78 (s, 2H), 5.04-5.16 (m, 2H), 4.65 (q, 7= 7.0 Hz, 1H), 2.22 (d, 7= 2.0 Hz, 1H), 2,22 (s, 2H) 1 51 (d 7= ____ 7.0 Hz, 3H). ’ |
2-305 | H NMR (500 MHz, DMSO-76) δ 7.25 - 7.34 (m, 2H), 7.22 - 7.29 (m, 1H), 6.93 - 6.99 (m, 1H), 6.77 (s, 2H), 4.99 (q, 7= 7.0 Hz, 1H), 4.41-4.51 (m, IH), 4.10 - 4.17 (m, 1H), 2.22 (d, 7= 2.0 Hz 1H) 2.22 (s, 2H), 1.53 (d, 7= 7.0 Hz, 3H). ’ ’ |
2-306 | Ή NMR (500 MHz, DMSO-d6) δ 7.39-7.46 (m, 2H), 7.17 - 7.23(m, 2H), 6.78 (s, 2H), 5.10 (dt 7= 12.5, 1.0 Hz, 1H), 5.04 (d,7= 12.5 Hz, 1H), 4.65 (q, 7=7.0 Hz, 1H), 2.21 (d,7= 2.0 Hz, IH), 2 21 (s ___________ 2H), 1.51 (d, 7= 7.0 Hz, 3H). ’ |
2-307 | HNMR (500 MHz, DMSO-76) δ 7.31 (dt,7=7.5,1.0 Hz, 2H), 7.09 (dd, 7= 7.5, 1.5Hz,2H) 6 77 (s 2H), 4.99 (q, 7= 7.0 Hz, 1H), 4.47 (dt,7= 12.5, 1.0 Hz, 1H), 4.10 (dt,7= 12.5, 1.0 Hz, 1H), 2.21 (d,7 _ = 2.0 Hz, 1H), 2.21 (s, 2H), 1.54 (d, 7= 7.0 Hz, 3H). ’ |
2-308 | H NMR (500 MHz, DMSO-76) δ 7.39 - 7.46 (m, 1H), 7.28 - 7.40 (m, 2H), 7.14-7.48 (m, 1H) 6 78 (s, 2H), 5.43 (dd, 7= 12.5, 1.0 Hz, 1H), 5.07 (d, 7= 12.5 Hz, 1H), 4.66 (q, 7= 7.0 Hz, 1H) 1 52’(d 7= __ 7.0 Hz, 3H). ’ |
2-309 | H NMR (500 MHz, DMSO-76) δ 7.23-7.31 (m, 3H), 7.07 (td, 7= 7.5,2.0 Hz, 1H), 6.77 (s, 2H), 4.99 (g, 7= 7.0 Hz, 1H),4.52 (d, 7= 12.5 Hz, 1H), 4.35 (dd, 7= 12.5,1.0 Hz, 1H), 1.54 (d, 7= 7Ό Hz. 3H) |
2-310 | HNMR (500 MHz, DMSO-76) δ 7.37-7.41 (m, 1H), 7.28-7.30 (m, 1H), 7.22-7.24 (m, 1H) 7 00-7 04 (m, 1H), 6.77 (s, 2H), 5.40 (dt,7= 12.5, 1.0 Hz, 1H), 4.87 (d,7= 12.5 Hz, 1H), 4.64 (q, 7= 7 0Hz ___ 1H), 1.50 (d, 7= 7.0 Hz, 3H). ’ |
2-311 | H NMR (500 MHz, DMSO-d6) δ 7.33 (td, 7= 7.5, 5.5 Hz, 1H),7.21 (dq, 7= 7.5, 2.0 Hz, 1H),7.1O (dq,7= 9.0,2.0 Hz, 1H), 6.93-6.97 (m, 1H), 6.76 (s, 2H), 4.74 (dt, 7= 12,5, 1.0 Hz, 1H), 4.52 (q,7= _________ 6.5 Hz, 1H), 4.19 (d, 7= 12.5 Hz, 1H), 1.51 (d, 7= 7.0Hz, 3H). ’ |
2-312 — | Ή NMR (500 MHz, DMSO-76) δ 7.37-7.41 (m, 2H), 7.17 - 7.25 (m, 2H), 6.75 (s, 2H), 5.58 - 5.65 (m, 1H), 4.58 - 4.69 (m, 2H), 1.49 (d, 7= 7.0 Hz, 3H). |
2-313 | Ή NMR (500 MHz, DMSO-76) δ 7.41-7.45 (m, 2H), 7.08- 7.16 (m, 2H), 6.76 (s, 2H), 4.64 (dt, 7= 12.0, 1.0 Hz, 1H), 4.58 (q, 7= 7.0 Hz, 1H), 4.11 (d,7= 12.5 Hz, 1H), 1.51 (d, 7= 7.0 Hz 3H) |
2-314 | H NMR (500 MHz, DMSO-76) δ 7.39 - 7.49 (m, 2H), 7.24 (td, 7= 7.5, 2.0 Hz, 1H), 7.10 (td, 7= 7.5, 2.0 Hz, 1H), 6.77 (s, 2H), 5.56 (d, 7= 12.5 Hz, 1H), 4.85 (dd, 7= 12.5, 1.0 Hz, 1H), 4.64 (q, 7= 7.0 ’ . 1___________________ Hz, 1H), 1.52 (d, 7= 7.0 Hz, 3H). |
2-315 | H NMR (500 MHz, OMSO-t/j δ 7.39 (dd, 7=7.5, 2.0 Hz, 1H), 7.24-7.28 (m, 1H), 7.18 (td 7= 7 5 2.0 Hz, 1H), 7.03 (td, 7= 7.5, 2.0 Hz, 1H), 6.77 (s, 2H), 5.00 (q, 7= 7.0 Hz, 1H), 4.64 (dd, 7= ’ _____ 12.5,1.0Hz, 1H), 4.37 (dd, 7= 12.5, 1.0 Hz, 1H), 1.54 (d, 7= 7.0 Hz, 3H). ’ |
2-316 | H NMR (500 MHz, DMSO-76) δ 7.51 (q, 7= 1.5 Hz, 1H), 7.27- 7.34(m, 3H), 6.80 (s, 2H), 5.82 (d, 7 = 12.5 Hz, 1H), 4.64 (q, 7= 7.0 Hz, 1H), 4.52 (d, 7= 12.5 Hz, 1H), 1.47 (d, 7= 6.5 Hz 3H) ’ |
2-317 | H NMR (500 MHz, DMSO-76) δ 7.54 (q, 7= 1.5 Hz, 1H), 7.25- 7.37(m, 3H), 6.79 (s, 2H), 4.72 (dt, 7 = 12-5, 1.0 Hz, 1H), 4.49 (q, 7= 7.0Hz, 1H), 4.19 (d, 7= 12.5 Hz, 1H), 1.51 (d, 7=7.0 Hz 3H) ’ |
2-318 | H NMR (500 MHz, DMSO-76) δ 7.40 - 7.47 (m, 2H), 7.31 - 7.37 (m, 2H), 6.75 (s, 2H), 5.73 (dt, 7= 12.5, 1.0 Hz, 1H), 4.65 (q, 7= 6.5 Hz, 1H), 4.56 (d, 7= 12.5 Hz, 1H), 1.48 (d, 7= 7.0 Hz 3H1’ |
2-319 | H NMR (500 MHz, DMSO-76) δ 7.37 - 7.44 (m, 2H), 7.31 - 7.37 (m, 2H), 6.75 (s, 2H), 5.03 (q 7= 7-0 Hz, 1H), 4.68 (d,7=12.5Hz, 1H), 4.15 (dt, 7= 12,5, 1.2 Hz, 1H), 1.50 (d, 7= 7.0 Hz, 3H) |
2-320 | H NMR (500 MHz, DMSO-76) δ 7.65 (dd, 7= 7.5, 2.0 Hz, 1H), 7.40-7.42 (m, 1H), 7.32 (td, 7= 7.5 ^2.0 Hz, 1H), 7,25 (td, J= 7.5, 2,0 Hz, 1H), 6.77 (s, 2H), 5.58 (d, 7= 12,5 Hz, IH), 4.88 (dd,7= 12^5,’ |
_ | __________________1-0 Hz, IH), 4,66 (g, J= 7.0Hz, 1H), 1.54 (d, J~- 7.0 Hz, 3H). |
2-321 | H NMR (500 MHz, DMSO-2fi) δ 7.50 (dd, J= 7.5, 1.5 Hz, 1H), 7.26 - 7.35 (m, 2H), 7 13 - 7 22 (m 1 H), 6.77 (s, 2H), 5.22 (d, J= 12.5 Hz, IH), 5.04 (q, 2= 7.0 Hz, 1H), 4.05 - 4.12(m, 1H) 1 50 (d J= ______________ 7.0 Hz, 3H). ’ ’ |
2-322 | H NMR (500 MHz, DMSO-26) δ 7.61 (q, J= 2.0 Hz, 1H), 7.51 (dt, 7.5, 2.0 Hz, 1H), 7.45 (dq J= 7.5,2.0Hz, 1H), 7.28 (t, 2= 7.5 Hz, 1H), 6.83 (s,2H), 5.81 (dt, J= 12.5, 1.0Hz, 1H), 4.64 (q, J=7 0 ____Hz, IH), 4.49 (d, J= 12.5 Hz, 1H), 1.47 (d, J= 7.0 Hz, 3H). ’ |
2-323 | H NMR (500 MHz, DMSO-d6) δ 7.39-7.49 (m, 3H), 7.22 (t, J= 7.5 Hz, 1H), 6.83 (s, 2H), 4.71 (dt . A 12-5, 1.0 Hz, 1H), 4.48 (q, 2=7.0 Hz, 1H),4.16 (d, J= 12.5 Hz, 1H), 1.51 (d, J= 7 0 Hz 3141 |
2-324 | H NMR (500 MHz, DMSO-2,) δ 7.59 - 7.66 (m, 2H), 7.26 - 7.33 (m, 2H), 6.77 (s, 2H), 5.77 (dt J= 12,5, 1.0Hz, IH),4.65 (g, J= 7.0Hz, 1H),4.54 (d. J= 12.5 Hz, 1H), 1.48 (d 7=7 0Hz 3H1’ |
2-325 | ‘H NMR (500 MHz, DMSO-26) δ 7.52 - 7.59 (m, 2H), 7.22 (dt, J= 7.5, 1.0 Hz’, 2H) 6 77 (s 2H) 4.99 (q, J= 7.0 Hz, 1H), 4.48 (dt, J= 12.5, 1.0 Hz, 1H), 4.13 (dt, J= 12.5, 1.0 Hz, 1H) 1 53 (d J= ________________ 7.0 Hz, 3H). ’ ’ |
2-327 | H NMR (500 MHz, DMSO-26) δ 7.56 - 7.62 (m, 1H), 7.49 (td, 7.5,2.0 Hz, 1H), 7.37 - 7.46 (m 2H), 6.77 (s, 2H), 5.55 (dd, J= 12.5, 1.0 Hz, 1H), 5.14 (dd, J = 12.5, 1.0 Hz, 1H), 4.63 (q J= 7 0 Hz ________________ 1H), 1.55 (d, J= 7.0 Hz, 3H). ’ |
2-328 | H NMR (500 MHz, ΌΜ8Ο-2ή) δ 7.52 (dd, J= 7.0,2.0Hz, 1H), 7.40 (td, J= 7.5, 2.0 Hz, 1H) 7.29 (t /= 7.2 Hz, 2H), 6.77 (s, 2H), 5.01 (q, 7.0 Hz, 1H), 4.66 (d, J= 12.5 Hz, 1H), 4.55 (dd, J= 12 5 ’ __________________ 1.0 Hz, 1H), 1.54 (d, J= 7.0 Hz, 3H). ’ |
2-329 | H NMR (500 MHz, DMSO-26) δ 7.65 (dd, J= 2.5, 1.5 Hz, 1H), 7.58 (dq, J= 5.5, 3.0 Hz, 1H) 7.50 (s, IH), 7.49 (d, 2= 3.0 Hz, 1H), 6.77 (s, 2H), 5.09 - 5.18 (m, 2H), 4.64 (q, 2= 7.0 Hz, 1H), 1.51 (d J ___________ — 6.5 Hz, 3H). |
2-330 | H NMR (500 MHz, DMSO-2â) δ 7.60 (d, J= 2.0 Hz, 1H), 7.50 - 7.57 (m, 1H), 7.38 - 7.46 (m 2H) 6.77 (s, 2H), 4.90 (g, 7.0 Hz, 1H), 4.59 (dt, 2= 12.5, 1.0 Hz, IH), 4.18 (dd, 2= 12.5 1 5Hz’ 1H)’ ____________ 1-55 (d, 2= 7.0 Hz, 3H). ’ ’ ’ |
2-331 | H NMR (500 MHz, DMSO-26) δ 7.69 (d, 2= 7.0 Hz, 2H), 7.52 - 7.58 (m, 2H), 6.78 (s, 2H) 5.18 (dt 2- 12.5, 1,0 Hz, 1H), 5,10 (d,2= 12,5 Hz, 1H), 4.65 (q, 2= 7 0 Hz 1H) 151 td Ί OHz 3H1 ’ |
2-332 | H NMR (500 MHz, DMSO-26) δ 7.59 - 7.65 (m, 2H), 7.40 - 7.46 (m, 2H), 6.78 (s, 2H), 5.02 (q 2= 7.0 Hz, 1H), 4.73 (d,2= 12.5 Hz, 1H), 4.19 (dt, 2= 12.5, 1.0 Hz, 1H), 1.50 (d,2= 7.0 Hz 3H1 |
2-333 | H NMR (500 MHz, DMSO-Y δ 7.71 - 7.78 (m, 1H), 7.60-7.66 (m, 3H), 6.77 (s, 2H), 5,59 (d 2= _,_____12.5 Hz, 1H), 5.10 (d, 2= 12.5 Hz, 1H), 4.63 (q, 2= 7.0 Hz, 1H), 1.55 (d, 2= 7.0 Hz 3H) ’ |
2-334 | H NMR (500 MHz, DMSO-4) δ 7.64 (dd, 2= 7.0,2.0 Hz, 1H), 7.46 - 7.58 (m, 2H), 7,42 - 7 48 (m 1H), 6.76 (s, 2H), 5.05 (q, 2=7.0 Hz, 1H), 4.76 (dd,2= 12.5, 1.0 Hz, 1H), 4.50 (dd,2= 12 5 1 0 Hz’ _,___________ 1H), 1.52 (d, 2= 7.0 Hz, 3H). ’ ’ |
2-335 | H NMR (500 MHz, DMSO-26) δ 7.96 (q, 2= 1.5 Hz, 1H), 7.86 (dt, 2= 7.5, 2.0 Hz, 1H), 7.64-7.67 (m, 1H), 7.49 (t, 2= 7.5 Hz, 1H), 6.77 (s, 2H), 5.69 (d, 2= 12.5 Hz, 1H), 4.60 - 4.69 (m 2H) 1 48 (d ___________ 2= 7.0 Hz, 3H). ’ ’ |
2-336 | H NMR (500 MHz, DMSO-26) δ 7.76 - 7.84 (m, 2H), 7.62 - 7.69 (m, 1H), 7.45 (t, 2= 7 5 Hz 1H) 6.81 (s, 2H), 5.00 (q, 2= 7.0 Hz, 1H),4.75 (d,2= 12.5 Hz, 1H),4.23 (dt,2= 12.5, 1.0 Hz, 1H) 1 52 τ_________________ (d, 2 = 7.0 Hz, 3H). ’ |
2-337 | H NMR (500 MHz, DMSO-26) δ 7.84 - 7.90 (m, 2H), 7.66 - 7.73 (m, 2H), 6.76 (s, 2H), 5.79 (dt 2= ___12.5, 1,0 Hz, IH), 4.62 - 4.70 (m,2H), 1.49 (d, 2= 7.0 Hz, 3H). ’ ’ |
2-338 | H NMR (500 MHz, DMSO-26) δ 7.61 - 7.68 (m, 2H), 7.46 - 7.52 (m, 2H), 6.77 (s, 2H) 4.99 (q 2= 7.0 Hz, 1H), 4.75 (d, 2= 12.5 Hz, 1H), 4.23 (dt, 2= 12.5, 1.0 Hz, 1H), 1.52 (d, 2= 7.0 Hz 3ΗΊ |
2-339 | H NMR (500 MHz, DMSO-26) Ô7.95- 8.02 (m, 2H), 7.82 - 7.90 (m, 2H), 7.81 (dd, 2= 7.5 1.5 Hz ______IH), 7·47 - 7·56 (m, 2H), 6.11 (s, 2H), 5.07 (q, 2= 7.0 Hz, 1H), 1.46 (d, 2= 7.0 Hz. 3H) ’ |
2-340 | H NMR (500 MHz, DMSO-26) δ 8.01-8.04 (m, 1H), 7.90-7.99 (m, 3H), 7.66 (6ζ2= 7.5, 1.0 Hz 1H), 7.57 (dd, 2= 5.5, 3.5 Hz, 2H), 5.92 (s, 2H), 5.53 (dt, 2= 12.5, 1.0 Hz, IH), 5.00 (d, J= 12.5 Hz _,_______________ 1H), 4.69 (q, 2= 7.0 Hz, 1H), 1.50 (d, 2= 6.5 Hz, 3H). ’ |
2-341 | H NMR (500 MHz, DMSO-26) δ 8.02 (dt, 2= 7.5, 1.5 Hz, IH), 7.95 (dq,2= 7.0, 1.5 Hz 2H) 7 66 (dt,2= 7.5, 1.5 Hz, IH), 7.55 - 7.66 (m, 2H), 7.38 (td, 2= 7.5, 1.5 Hz, 1H), 5.92 (s, 2H), 5.62 (d 2= 12.5 Hz, 1H), 5.14 (dd, 2= 12.5, 1.0 Hz, IH), 4.69 (q, 2= 7.0 Hz, IH), 1.55 (d, 2= 7.0 Hz 3H1 |
2-342 | HNMR(500 MHz, DMSO-2g) δ 8.53 (dd, 2= 5.0,1.5 Hz, IH), 7.75 (td, 2= 8.0, 1.5 Hz, IH) 7.51 (dt, 2=8.0, 1.5 Hz, IH), 7.28-7.30 (m, IH), 6.78 (s, 2H), 5.44 (dd, 2= 12.5, 1.5 Hz, IH), 5.18 (d 2= ____12-5 Hz, IH), 4.65 (q, 2= 7.0 Hz, IH), 1.51 (d, 2= 7.0 Hz, 3H). ’ |
2-343 | H NMR (500 MHz, DMSO-26) δ 8.40 (dd, 2=5.0, 1.0 Hz, 1 H), 7.67 (td, 2= 8.0, 1.5 Hz, IH) 7.49 (dt,2= 8.0, 1.5 Hz, IH), 7.28-7.31 (m, IH), 6,76 (s, 2H), 5.05 (d,2= 12.5 Hz, IH), 5.00 (q, 2= 7.0 |
t_______________ Hz, 1H), 4.13 (dd, 7= 12.5,1.5 Hz, 1H), 1.51 (d,7= 7.0 Hz, 3H). ' | |
2-344 | H NMR (500 MHz, DMSO-d6) δ 8.58 (d, J= 5.0 Hz, 2H), 7.51 -7.56 (m, 2H), 6.77 (s, 2H) 5 07 (dt 7=12,5, 1.0 Hz, 1H), 4.94 (d, 12.5 Hz, 1 H), 4.65 (q, J= 7.0 Hz, 1H), 1.51 (d, 7= 7.0 Hz 3H) ’ |
2-345 | lH NMR (500 MHz, DMSO-%) δ 8.40 (d, J= 5.0 Hz, 2H), 7.38 (d, J= 5.0 Hz, 2H), 6.77 (s, 2H), 4.95 (g, 7= 7.0 Hz, 1H), 4.48 (d, J= 12.5 Hz, 1H), 4.11 (d, 7= 12.5 Hz, 1H), 1.54 (d,7= 7.0 Hz, 3H). |
2-346 | H NMR (500 MHz, DMSO-76) δ 8.59 (dd, 7= 5.0, 1.5 Hz, 1H),8.43 (d,7= 1.0 Hz, 1H), 8.01 (dd,7= 8.0, 5.0 Hz, 1H), 7.53 (dt, 7= 8.0, 1.5 Hz, 1H), 6.77 (s, 2H), 4.99 (d, 7= 12.5 Hz, 1H), 4.93 (d, 7= |
__ | ___________ 12.5 Hz, 1H), 4.64 (q, 7= 7.0 Hz, 1H), 1.51 (d, 7= 7.0 Hz, 3H). |
2-347 | Ή NMR (500 MHz, DMSO-7,) δ 8.39 - 8.49 (m, 2H), 7.59 (dt, 7= 8.0, 1.5 Hz, 1H), 7.36 (dd, 7= 8 0 5.0 Hz, 1H), 6.77 (s, 2H), 4.96 (q, 7= 7.0Hz, 1H), 4.46 (d, 7= 12.5 Hz, 1H), 4.10 (d, 7= 12.5 Hz 1H)’ __ 1.54 (d, 7= 7.0 Hz, 3H). ’ ’ |
2-348 | H NMR (500 MHz, Chloroform-7) δ 7.41 (d, 7= 2.0 Hz, 1H), 6.41 (d, 7=3.5 Hz, 1H), 6.36 (dd, 7= 3.5,2.0 Hz, 1H), 5.25 (q, 7= 7.0 Hz, 1H), 5.20 - 5.08 (m, 4H), 1.63 (d, J= 7.0 Hz, 3H). ’ |
2-349 | Ή NMR (500 MHz, DMSO-76) δ 7.46 (d, 7= 7.5 Hz, 1H), 7.25 (d, 7= 1.5 Hz, 1H), 6.81 (s, 2H), 6.37 (dd, 7=7.5,1.5 Hz, 1H),5.47 (d,7= 12.5 Hz, 1H), 4.99 (d, 7= 12.5 Hz, 1H), 4.69 (g, 7=7.0 Hz, 1H) __________ 1.53 (d, 7= 7.0 Hz, 3H). ’ |
2-350 | lH NMR (500 MHz, DMSO-%) δ 7.35 (dd, 7=6.5, 2.0 Hz, 1H), 7.00 - 7.09 (m, 2H), 6.81 (s, 2H), 5.71 (d,7= 12,5 Hz, 1H), 5.20 (d, 7=12,5 Hz, 1H), 4.69 (q, 7= 7.0 Hz, 1H), 1.54 (d, 7= 7.0 Hz, 3H). |
2-351 | H NMR (500 MHz, DMSO-76) δ 7.33 (d,7= 7.5 Hz, 1H), 7.05-7.12 (m, 2H), 6.81 (s, 2H), 5.51 (d, . J~ 12-5 Hz, 1H), 4.87 (d, 7= 12.5 Hz, 1H), 4.71 (q, 7= 7.0 Hz, 1H), 1.52 (d, 7= 7.0 Hz, 3H) ’ |
2-352 | ΉNMR(500 MHz, DMSO-76) δ 6.82 (s, 2H), 5.84 (s, 1H), 4.69 (q, J= 7.0 Hz, 1H), 3.72 (s, 3H) __ 2.32 (s, 3H), 1.44 (d, 7= 7.0 Hz, 3H). ’ ’ |
2-353 | Ή NMR (500 MHz, DMSO-76) δ 7.53 (d, 7= 7.5 Hz, 1H), 6.81 (s, 2H), 6.37 (dd, 7= 7.5, 1.0 Hz, 1H), 5.40 - 5.47 (m, 1H), 5.03 (d, 7= 12.5 Hz, 1H), 4.70 (q, 7=7.0 Hz, 1H), 3.75 (s, 3H), 1.55 (d, 7= ’ ____________ 7.0Hz, 3H). |
2-354 | H NMR (500 MHz, DMSO-7Ê) δ 7.70 (t,7= 1.5 Hz, 1H), 7.01 (t, 7= 1.0 Hz, 1H), 6.81 (s, 2H), 5.00____________5-07 (m, 2H), 4,69 (q, 7=7.0 Hz, 1H), 3.89 (s, 3H), 1,54 (d, 7= 7.0 Hz, 3H). ’ ’ |
2-355 | 'HNMR(500MHz, DMSO-76) δ 7.19 - 7.28 (m, 2H), 7.15 - 7.21 (m, 1H), 7.09-7.29 (m, 1H), 6.77 _________(s, 2H), 4.71 (q, 7= 7.0 Hz, 1H), 2,10 (d, 7= l.OHz,3H), 1.61 (d, 7= 7.0 Hz, 3H). ’ |
2-357 | H NMR (500 MHz, DMSO-76) δ 7.71 (t, 7= 2.0 Hz, 1H), 7.52 (dt, 7= 7.5, 2.0 Hz, 1H), 7.36 (dt, 7= 7.5, 2.0 Hz, 1H), 7.25 (t, 7= 7.5 Hz, 1H), 6.74 (s, 2H), 5.04 (q, 7= 7.0 Hz, 1H), 1.52 (d, 7= 7.0 Hz ____ 3H). ’ |
2-358 | H NMR (500 MHz, DMSO-76) δ 7.61 - 7.67 (m, 2H), 6.93-7.00 (m, 2H), 6.73 (s, 2H), 5.06 (q, 7=7.0 ___ Hz, 1H), 3.79 (s, 3H), 1.51 (d, 7= 7.0 Hz, 3H). ’ |
2-360 | H NMR (500 MHz, DMSO-<4) δ 7.46 - 7.53 (m, 2H), 7.28 (t, 7= 7.5 Hz, 1H), 7.15-7.18 (Μ, 1H), 6.77 (s, 2H), 4.98 (q,7= 7.0 Hz, 1H), 2.89 (tt, 7= 8,0, 6.0 Hz, 1H), 1,45 (d, 7= 7.0Hz, 3H), 1.17-1.23 __ (m, 6H). |
2-363 | H NMR (500 MHz, DMSO-Tj δ 8.50 (d, 7= 5.0 Hz, 2H), 7.76 (d,7= 5.0 Hz, 2H), 6.74 (s, 2H), 5.03 , _ (q, 7= 7.0Hz, 1H), 1.51 (d, 7= 7.0 Hz, 3H). ’ ’ |
2-365 | H NMR (500 MHz, DMSO-76) δ 6.97 (s, 1H), 6.82 (s, 2H), 5.06 (q, J- 7,0 Hz, 1H), 3.90 (s, 3H) ______ 2.14 (s, 3H), 1.53 (d, 7= 7.0 Hz, 3H). ’ ’ |
2-368 | Ή NMR (500 MHz, DMSO-%) δ 6.80 (s, 2H), 6.66 (dd,7= 7.5, 1.5 Hz, 1H), 6.29 (dd, 7= 7.5, 1.5 Hz, 1H), 6.12 (t, 7= 7.5 Hz, 1H), 5.07 (q, 7= 7.0 Hz, 1H), 3.62 (s, 3H), 1,56 (d, 7= 7.0 Hz, 3H). |
2-370 | H NMR (500 MHz, DMS0-76) δ 6.80 (s, 2H), 4.98 (d, 7= 12.5 Hz, 1H), 4.93 (d, 7= 12.5 Hz, 1H), 4.66 (q, 7= 6.5 Hz, 1H), 3.44-3.51 (m, 1H), 3.16-3.24 (m, 1H), 1.51 (d,7= 7.0 Hz, 3H), 1.05 (t 7= __ 8.0 Hz, 3H). ’ |
2-371 | H NMR (500 MHz, Chloroform-7) δ 6.76 (s, 1H), 4.61 (q, 7 = 6.5 Hz, 1H), 4.44 (s, 2H), 1 73 (d 7= 6.5 Hz, 3H), 1.66 (s, 2H). ’ ’ |
2-372 | H NMR (500 MHz, Chloroform-7) δ 8.09 (s, 1H), 4.93 (s, 1H), 4.71 (q, 7= 6.5 Hz, 1H), 4.47 (s, 2H), _______ 3.63 (s, 3H), 1.71 (d, 7= 6.5 Hz, 3H), 1.44 (s, 9H). ’ ’ ’ |
2-373 | H NMR (500 MHz, DMSO-76) δ 7.46 (s, 2H), 6.79 (s, 2H), 5.02 (q, 7= 7.0 Hz, 1H), 1.59 (d, 7=7 0 ।______ Hz, 3H). |
2-376 | H NMR (500 MHz, DMSO-76) δ 6.12 (s, 1H), 4.99 (q, 7=7.0 Hz, 1H), 3.66 (dq, 7= 12.5, 8.0 Hz, !H), 3.28 (dq,7= 12.5, 8.0 Hz, 1H),2.31 (s, 3H), 1.54 (d, 7= 7.0 Hz, 3H), 1.26 (t, 7= 8.0 Hz, 3H). |
2-377 | H NMR (500 MHz, Chloroform-7) δ 9.90 (s, 1 H), 4.64 (q, 7= 7.0 Hz, 1H), 3.85 (s, 3H), 2.20 (s 3H) ,__ 1.70 (d, 7= 7.0 Hz, 3H). ’ ’ |
2-378 | H NMR (500 MHz, DMSO-%) δ 7.55 (dd, 7= 7.0, 2.0 Hz, 1H), 6.34 - 6.43 (m, 2H), 6.22 (s, 1H), 5,14 (d, 7= 12.5 Hz, 1H), 4.67 (q, 7= 7.0 Hz, 1H), 4.43 (d, 7=12.5 Hz, 1H), 3.72 (s, 3H), 1.53 (d, 7= |
, _ 7.0 Hz, 3H). | |
2-379 | H NMR (500 MHz, Chloroform-d) δ 7.95 - 7.98 (m, 3H), 7.52 - 7.56 (m, 2H), 7.29-7.33 (m, 1H), _________ 4.56 (q, J= 7.0 Hz, 1H), 3.85 (s, 3H), 1.69 (d,J= 7.0Hz, 3H). ’ ’ |
2-381 | Ή NMR (500 MHz, DMSO-d6) 57.93- 8.00 (m, 2H), 7.55 7.63 (m, 1H), 7.50 - 7.58 (mr 2H), 4.63 (q, .7=7.0 Hz, 1H), 3.72(s, 3H), 1.53 (d,J= 7.0 Hz, 3H). ’ |
2-383 | H NMR (500 MHz, DMSO-î/6) δ 7.04 (s, 2H), 4.41 (d, J=8.5Hz, 1H), 4.11-4.18 (m, 2H), 1.14-1 31 (m, 5H), 0.48-0.66 (m, 3H) |
2-385 | H NMR (500 MHz, DMSO-J,) δ 7.59-7.62 (m, 2H), 7.32-7.34 (m, 3H), 6.77 (s, 2H), 6.27 (d, J= 1 0 Hz, 1H), 2.31 (s, 3H). ’ |
2-386 | H NMR (500 MHz, DMSO-d6) δ 6.96 (s, 2H), 5.10 (q, J=7.0 Hz, 1H), 4.30-4.26 (m, 1H) 4 19-4 14 (m, 1H), 4.07-4.00 (m, 2H), 2.23 (s, 3H), 1.75 (s, 3H), 1.66 (s, 3H), 1.48 (d, J = 7.0 Hz. 3H1 |
2-387 | ‘H NMR (500 MHz, DMSO-d6) δ 6.43 - 6.34 (m, 2H), 6.22 (s, 1H), 4.84 (d, J = 7.0 Hz, 1H) 4 70 ___________________________4-62 (m, 2H), 3.26 (s, 3H), 1.51 (d, J = 7.0 Hz, 3H). ’ |
Several methods for preparing the compounds of the présent invention are detailedly illustrated in the following schemes and examples. The starting materials can be purchased commercially or can be prepared by methods known in the literature or according to the detailed illustrations. Those skilled in the art will appreciate that other synthetic routes can also be utilized to synthesize the compounds of the présent invention. Although spécifie starting materials and conditions in the synthetic route hâve been described below, they can be easily replaced with other similar starting materials and conditions, and various isomers of compounds and the like produced by variations or variants of the préparation methods of the présent invention are included in the scope of the présent invention. Additionally, the préparation methods described below can be further modified in accordance with the présent disclosure, using conventional Chemical methods well known to those skilled in the art. For example, appropriate groups are protected during the reaction, and the like.
The method examples are provided below to facilitate a further understanding of the préparation method of the présent invention, and the spécifie materials, types and conditions used are determined to be further description of the présent invention and are not intended to limit its rational scope. The reagents used for synthesizing the following compounds indicated in the table below are either commercially available or can be readily prepared by those skilled in the art.
The examples of représentative compounds are as follows, the synthetic methods of other compounds are similar, and will not be described in detail here.
1. Synthesis of compounds 2-31 and 1-2 (1) Compound 2-31-1 (300mg, 1.27mmol), compound b (255mg, 1.53mmol), a catalytic amount of TBAB (lOmg), and DMF (20mL) were added to a 50 mL round-bottom flask, heated to 85 C and reacted for 12 hr. After completed reaction of the starting materials according to LC-MS détection, the reaction solution was cooled to room température, concentrated, and separated by column chromatography to obtain compound 2-31 (180mg, yield 47%).
2-31-1
2-31 (2) Compound 2-31 (0.5g, 1.77mmol), methanol (20mL) were added to a 100 mL single-port flask, lithium hydroxide (74mg, 1.77mmol) was dissolved in 2 mL of water, and slowly added dropwise to the single-port flask at room température, followed by stirring at room température for 12 hr. After completed reaction of the starting materials according to LC-MS détection, the reaction solution was adjusted with 0.5M dilute HCl to pH = 5-6, concentrated, and then extracted with water and ethyl acetate. The organic phase was dried, and concentrated to obtain compound 1-2 (400mg) as a white solid.
2. Synthesis of compound 2-45 (1) Compound 2-45-1 (1g, 8.61mmol), phosphorus oxybromide (3.7g, 12.9mmol) were added to a 50 mL round-bottom flask, heated to 60°C and reacted for 5 hr. After completed reaction of the starting materials according to HPLC détection, the reaction solution was cooled to room température, and slowly poured into an ice-water bath, with the température being controlled at 0-10°C during quenching. The aqueous phase was extracted with ethyl acetate (lOOmL x 2). The organic phase was dried and concentrated to obtain compound 2-45-2 (1.5g, crude product). Without further purification, the compound was directly used in the next step.
o o
2-45-1 2-45-2 (2) Compound a (400mg, 2.13mmol), compound 2-45-2 (700mg), a catalytic amount of TBAB (lOmg), and DMF (lOmL) were added to a 50 mL round-bottom flask, heated to 85°C and reacted for 12 hr. After completed reaction of the starting materials according to LC-MS détection, the reaction solution was cooled to room température, and extracted with water (lOOmL) and methyl tert-butyl ether (50mLx 2). The organic phase was dried, concentrated, and separated by column chromatography to obtain compound 2-45 (200mg, yield 35%), as a white solid.
a
Ο 2-45-2
NH2
CI^A^CI TBAB > J T DMF Ρ^Ν^Ο^γ0'
O 2-45
3. Synthesis of compound 2-69
Compound a (0.5g, 2.13mmol), compound b (313mg, 2.55mmol), a catalytic amount of TBAB (lOmg), and DMF (lOmL) were added to a round-bottom flask, and stirred at room température 15 °C for 24 hr. When there was a small amount of starting materials remained according to LC-MS détection, a further treatment was made. The reaction solution was poured into 50mL of water, and extracted with methyl tert-butyl ether twice (50mL x 2). The organic phase was dried, concentrated, and separated by column chromatography, to obtain compound 2-69 (300mg, yield 50%), as a white solid.
o a b 2-69
4. Synthesis of compound 2-319
With a reference to the synthesis method of compound 1-2, compound 1-26 was prepared, then compound 1-26 (400mg, 1.49mmol), compound 2-319-1 (219mg, 1.49mmol), DCC (459mg, 2.24mmol), and anhydrous DCM (20mL) were added to a 100 mL round-bottom flask, and reacted at room température for 12 hr. After completed reaction of the starting materials according to LC-MS détection, the reaction solution was concentrated, and separated by column chromatography to obtain compound 2-319 (250mg, yield 41%), as a white solid.
5. Synthesis of compounds 2-378 and 1-71 (1) Compound 2-69 (200mg, 0.71mmol), compound c (145mg, 0.85mmol), potassium carbonate (leq), a catalytic amount of DMAP (lOmg), and acetonitrile (20mL) were added to a 50 mL round-bottom flask, heated to 80°C and reacted for 12 hr. After completed reaction of the starting materials according to LC-MS détection, the reaction solution was cooled to room température, concentrated, and separated b y column chromatography to obtain compound 2-378 (150mg, yield 50%), as a colorless oil.
Ο
2-69
B
K2CO3 DMAP^
MeCN
(2) Compound 2-378 (0,15g, 0.43mmol), methanol (20mL) were added to a 100 mL single-port flask, lithium hydroxide (48mg, 2mmol) was dissolved in 2 mL water, and slowly added dropwise to the single-port flask at room température, foliowed by stirring at room température for 12 hr. After completed reaction of the starting materials according to LC-MS détection, the reaction solution was adjusted with 0.5M dilute HCl to pH = 5-6, concentrated, and then extracted with water and ethyl acetate. The organic phase was dried and concentrated to obtain compound 1-71 (lOOmg), as a white solid.
Biological activity évaluation:
The activity level standard of plants destruction (i. e. growth inhibition rate) is as follows:
Level 5: the growth inhibition rate is greater than 85%;
Level 4: the growth inhibition rate is equal to or greater than 60% and less than 85%;
Level 3: the growth inhibition rate is equal to or greater than 40% and less than 60%;
Level 2: the growth inhibition rate is equal to or greater than 20% and less than 40%;
Level 1 : the growth inhibition rate is equal to or greater than 5% and less than 20%;
Level 0: the growth inhibition rate is less than 5%;
The above described growth inhibition rate is fresh weight inhibition rate.
Post-emergence test experiment: Monocotyledonous and dicotyledonous weed seeds and main crop seeds (i. e. wheat, com, rice, soybean, cotton, oilseed, millet and sorghum. ) were put into a plastic pot loaded with soil. Then covered with 0.5-2 cm soil, the seeds were allowed to grow in good greenhouse environment. The test plants were treated at 2-3 leaf stage 2 weeks after sowing. The test compounds of the invention were dissolved with acetone respectively, then added with tween-80, and using 1.5 liters per hectare of an emulsible concentrate of methyl oleate as a synergist, and diluted by certain amount of water to certain concentration. The solution was sprayed to the plants with a sprayer. Then the plants were cultured for 3 weeks in the greenhouse, and the experiment resuit of weed controlling effect was listed in tables 4-5.
Table 4 Activity test results of compounds (1000 g a.i./ha)
No. | Echinochloa crusgalli | Digitaria sanguinalis | Monochorîa Vaginalis | Abutilon theophrasti Medic. | Galium aparine |
___ 1-2 | 5 | 5 | 5 | 5 | 5 |
1-4 | 5 | 5 | 5 | ||
1-26 | 5 | 5 | 5 | 5 | 5 |
1-27 | 5 | 5 | 5 | ||
1-71 | 5 | 5 | 5 | 5 | 5 |
2-1 | 5 | 5 | 5 | ||
2-2 | 5 | 5 | 5 | 5 | 5 |
2-3 | 5 | 5 | 5 | 5 | 5 |
2-4 | 5 | 5 | 5 | 5 | 5 |
2-5 | 5 | 5 | 5 | ||
2-6 | 5 | 5 | 5 | ||
2-7 | 5 | 5 | 5 | 5 | 5 |
_ 2-8 | 5 | 5 | 5 | ||
2-9 | 5 | 5 | 5 | ||
2-10 | 5 | 5 | 5 | ||
2-11 | 5 | 5 | 5 | ||
_ 2-12 | 5 | 5 | 5 | ||
2-13 | 5 | 5 | 5 | ||
2-14 | 5 | 5 | 5 | 5 | 5 |
2-15 | 5 | 5 | 5 | ||
2-16 | 5 | 5 | 5 | ||
2-17 | 5 | 5 | 5 | 5 | 5 |
2-18 | 5 | 5 | 5 | ||
2-19 | 5 | 5 | 5 | ||
2-20 | 5 | 5 | 5 | ||
2-21 | 5 | 5 | 5 | ||
2-22 | 5 | 5 | 5 | 5 | 5 |
2-23 | 5 | 5 | 5 | ||
2-24 | 5 | 5 | 5 | 5 | 5 |
2-25 | 5 | 5 | 5 | ||
2-26 | 5 | 5 | 5 | 5 | 5 |
2-27 | 5 | 5 | 5 | ||
2-28 | 5 | 5 | 5 | 5 | 5 |
2-29 | 5 | 5 | 5 | 5 | 5 |
2-30 | 5 | 5 | 5 | 5 | 5 |
2-31 | 5 | 5 | 5 | 5 | 5 |
2-32 | 5 | 5 | 5 | 5 | 5 |
2-33 | 5 | 5 | 5 | ||
2-34 | 5 | 5 | 5 | ||
2-35 | 5 | 5 | 5 | ||
_ 2-36 | 5 | 5 | 5 | ||
2-37 | 5 | 5 | 5 | ||
2-38 | 5 | 5 | 5 | ||
2-39 | 5 | 5 | 5 | ||
_ 2-40 | 5 | 5 | 5 | ||
2-41 | 5 | 5 | 5 | ||
2-42 | 5 | 5 | 5 | ||
2-43 | 5 | 5 | 5 | ||
2-44 | 5 | 5 | 5 | ||
2-45 | 5 | ____ 5 | 5 |
2-46 | 5 | 5 | 5 | ||
2-47 | 5 | 5 | 5 | ||
2-48 | 5 | 5 | 5 | ||
2-49 | 5 | 5 | 5 | ||
2-50 | 5 | 5 | 5 | ||
2-51 | 5 | 5 | 5 | ||
2-52 | 5 | 5 | 5 | ||
2-53 | 5 | 5 | 5 | ||
2-54 | 5 | 5 | 5 | ||
______2-55 | 5 | 5 | 5 | ||
2-56 | 5 | 5 | 5 | ||
_____2-57 | 5 | 5 | 5 | ||
2-58 | 5 | 5 | 5 | ||
2-59 | 5 | 5 | 5 | ||
2-60 | 5 | 5 | 5 | ||
2-61 | 5 | 5 | 5 | ||
2-62 | 5 | 5 | 5 | ||
2-63 | 5 | 5 | 5 | ||
2-64 | 5 | 5 | 5 | ||
2-65 | 5 | 5 | 5 | ||
2-67 | 5 | 5 | 5 | ||
2-68 | 5 | 5 | 5 | ||
2-69 | 5 | 5 | 5 | 5 | 5 |
2-70 | . 5 | 5 | 5 | 5 | 5 |
2-71 | 5 | 5 | 5 | 5 | 5 |
2-72 | 5 | 5 | 5 | 5 | 5 |
2-73 | 5 | 5 | 5 | 5 | 5 |
2-74 | 5 | 5 | 5 | 5 | 5 |
2-75 | 5 | 5 | 5 | 5 | 5 |
2-76 | 5 | 5 | 5 | 5 | 5 |
2-77 | 5 | 5 | 5 | 5 | 5 |
2-78 | 5 | 5 | 5 | 5 | 5 |
__2-79 | 5 | 5 | 5 | 5 | 5 |
2-80 | 5 | 5 | 5 | 5 | 5 |
2-81 | 5 | 5 | 5 | 5 | 5 |
2-82 | 5 | 5 | 5 | 5 | 5 |
_____2-83 | 5 | 5 | 5 | 5 | 5 |
2-84 | 5 | 5 | 5 | 5 | 5 |
2-85 | 5 | 5 | 5 | 5 | 5 |
2-86 | 5 | 5 | 5 | 5 | 5 |
_____2-87 | 5 | 5 | 5 | 5 | 5 |
2-88 | 5 | 5 | 5 | 5 | 5 |
2-89 | 5 | 5 | 5 | 5 | 5 |
2-90 | 5 | 5 | 5 | 5 | 5 |
______2-91 | 5 | 5 | 5 | 5 | 5 |
2-92 | 5 | 5 | 5 | 5 | 5 |
2-93 | 5 | 5 | 5 | 5 | 5 |
2-94 | 5 | 5 | 5 | 5 | 5 . |
2-95 | 5 | 5 | 5 | 5 | 5 |
2-96 | 5 | 5 | 5 | 5 | 5 |
2-97 | 5 | 5 | 5 | 5 | 5 |
2-98 | 5 | 5 | 5 | 5 | 5 |
2-99 | 5 | 5 | 5 | 5 | 5 |
2-100 | 5 | 5 | 5 | 5 | 5 |
2-101 | 5 | 5 | 5 | 5 | 5 |
2-102 | 5 | 5 | 5________ | 5 | 5 |
2-103 | 5 | 5 | 5 | 5 | 5 |
2-104 | 5 | 5 | 5 | 5 | 5 |
2-105 | 5 | 5 | 5 | 5 | 5 |
2-106 | 5 | 5 | 5 | 5 | 5 |
2-107 | 5 | 5 | 5 | 5 | 5 |
2-108 | 5 | 5 | 5 | 5 | 5 |
2-113 | 5 | 5 | 5 | 5 | 5 |
2-114 | 5 | 5 | 5 | 5 | 5 |
2-121 | 5 | 5 | 5 | 5 | 5 |
2-122 | 5 | 5 | 5 | 5 | 5 |
2-155 | 5 | 5 | 5 | 5 | 5 |
2-156 | 5 | 5 | 5 | 5 | 5 |
2-157 | ___ 5 | 5 | 5 | 5 | 5 |
2-158 | 5 | 5 | 5 | 5 | 5 |
2-159 | 5 | 5 | 5 | 5 | 5 |
2-160 | 5 | 5 | 5 | 5 | 5 |
2-163 | 5 | 5 | 5 | 5 | 5 |
2-164 | 5 | 5 | 5 | 5 | 5 |
2-175 | 5 | 5 | 5 | 5 | 5 |
2-176 | 5 | 5 | 5 | 5 | 5 |
2-195 | 5 | 5 | 5 | 5 | 5 |
2-196 | 5 | 5 | 5 | 5 | 5 |
2-215 | 5 | 5 | 5 | 5 | 5 |
2-216 | 5 | 5 | 5 | 5 | 5 |
2-235 | 5 | 5 | 5 | 5 | 5 |
2-236 | 5 | 5 | 5 | 5 | 5 |
2-263 | 5 | 5 | 5 | 5 | 5 |
2-264 | 5 | 5 | 5 | 5 | 5 |
2-265 | 5 | 5 | 5 | 5 | 5 |
2-266 | 5 | 5 | 5 | 5 | 5 |
2-267 | 5 | 5 | 5 | 5 | 5 |
2-268 | 5 | 5 | 5 | 5 | 5 |
2-270 | ____ 5 | 5 | 5 | 5 | 5 |
2-271 | 5 | 5 | 5 | 5 | 5 |
2-272 | 5 | 5 | 5 | 5 | 5 |
2-273 | ______ 5 | 5 | 5 | 5 | 5 |
2-274 | 5 | 5 | 5 | 5 | 5 |
2-275 | 5 | 5 | 5 | 5 | 5 |
2-276 | 5 | 5 | 5 | 5 | 5 |
2-277 | 5 | 5 | 5 | 5 | 5 |
2-278 | 5 | 5 | 5 | 5 | 5 |
2-279 | 5 | 5 | 5 | 5 | 5 |
2-280 | 5 | 5 | 5 | 5 | 5 |
2-281 | 5 | 5 | 5 | 5 | 5 |
2-282 | 5 | 5 | 5 | 5 | 5 |
2-283 | 5 | 5 | 5 | 5 | 5 |
2-284 | 5 | 5 | 5 | 5 | 5 |
2-285 | 5 | 5 | 5 | 5 | 5 |
2-286 | 5 | 5 | 5 | 5 | 5 |
2-287 | 5 | 5 | 5 | 5 | 5 |
2-288 | ______ 5 | 5 | 5 | 5 | 5 |
2-289 | 5 | 5 | 5 | 5 | 5 |
2-290 | 5 | 5 | 5 | 5 | 5 |
2-291 | 5 | 5 | 5 | 5 | 5 |
2-292 | _ 5 | 5 | 5 | 5 | 5 |
2-294 | ,5 ' | 5 | 5 | 5 | 5 |
2-295 | 5 | 5 | 5 | 5 | 5 |
2-296 | _ 5 | 5 | 5 | 5 | 5 |
2-297 | 5 | 5 | 5 | 5 | 5 |
2-298 | 5 | 5 | 5 | 5 | 5 |
2-299 | 5 | 5 | 5 | 5 | 5 |
2-300 | 5 | 5 | 5 | 5 | 5 |
. 2-301 | 5 | 5 | 5 | 5 | 5 |
2-302 | 5 | 5 | 5 | 5 | 5 |
2-303 | 5 | 5 | 5 | 5 | 5 |
2-304 | 5 | 5 | 5 | 5 | 5 |
2-305 | 5 | 5 | 5 | 5 | 5 |
2-306 | 5 | 5 | 5 | 5 | 5 |
2-307 | 5 | 5 | 5 | 5 | 5 |
2-308 | 5 | 5 | 5 | 5 | 5 |
_ 2-309 | 5 | 5 | 5 | 5 | 5 |
2-310 | 5 | 5 | 5 | 5 | 5 |
2-311 | 5 | 5 | 5 | 5 | 5 |
2-312 | 5 | 5 | 5 | 5 | 5 |
2-313 | 5 | 5 | 5 | 5 | 5 |
2-314 | 5 | 5 | 5 | 5 | 5 |
2-315 | 5 | 5 | 5 | 5 | 5 |
2-316 | 5 | 5 | 5 | 5 | 5 |
2-317 | 5 | 5 | 5 | 5 | 5 |
2-318 | 5 | 5 | 5 | 5 | 5 |
2-319 | 5 | 5 | 5 | 5 | 5 |
2-320 | 5 | 5 | 5 | 5 | 5 |
2-321 | 5 | 5 | 5 | 5 | 5 |
2-322 | 5 | 5 | 5 | 5 | 5 |
2-323 | 5 | 5 | 5 | Γ 5 | 5 |
2-324 | 5 | 5 | 5 | 5 | 5 |
2-325 | 5 | 5 | 5 | 5 | 5 |
2-327 | 5 | 5 | 5 | 5 | 5 |
2-328 | 5 | 5 | 5 | 5 | 5 |
2-329 | 5 | 5 | 5 | 5 | 5 |
2-330 | 5 | 5 | 5 | 5 | 5 |
2-331 | 5 | 5 | 5 | 5 | 5 |
2-332 | 5 | 5 | 5 | 5 | 5 |
2-333 | 5 | 5 | 5 | 5 | 5 |
2-334 | 5 | 5 | 5 | 5 | 5 |
2-335 | 5 | 5 | 5 | 5 | 5 |
2-336 | 5 | 5 | 5 | 5 | 5 |
2-337 | 5 | 5 | 5 | 5 | 5 |
2-338 | 5 | 5 | 5 | 5 | 5 |
2-339 | 5 | 5 | 5 | 5 | 5 |
2-340 | 5 | 5 | 5 | 5 | 5 |
2-341 | 5 | 5 | 5 | 5 | 5 |
2-342 | 5 | 5 | 5 | 5 | 5 |
2-343 | 5 | 5 | 5 | 5 | 5 |
2-344 | 5 | 5 | 5 | 5 | 5 |
2-345 | 5 | 5 | 5 | 5 | 5 |
2-346 | 5 | 5 | 5 | 5 | 5 |
2-347 | 5 | 5 | 5 | 5 | 5 |
2-348 | 5 | 5 | 5 | 5 | 5 |
2-349 | 5 | 5 | 5 | 5 | 5 |
2-350 | 5 | 5 | 5 | 5 | 5 |
2-351 | 5_________ | 5 | 5________ | 5 | 5 |
2-352 | 5 | 5 | 5 | 5 | 5 |
2-353 | 5 | 5 | 5 | 5 | 5 |
2-354 | 5 | 5 | 5 | 5 | 5 |
2-355 | 5 | 5 | 5 | 5 | 5 |
2-357 | 5 | 5 | 5 | 5 | 5 |
2-358 | 5 | 5 | 5 | 5 | 5 |
2-360 | 5 | 5 | 5 | 5 | 5 |
2-363 | 5 | 5 | 5 | 5 | 5 |
2-365 | 5 | 5 | 5 | 5 | 5 |
2-368 | ____ 5 | 5 | 5 | 5 | 5 |
2-370 | 5 | 5 | 5 | 5 | 5 |
2-371 | 5 | 5 | 5 | 5 | 5 |
2-372 | 5 | 5 | 5 | 5 | 5 |
2-373 | 5 | 5 | 5 | 5 | 5 |
2-376 | 5 | 5 | 5 | 5 | 5 |
2-377 | 5 | 5 | 5 | 5 | 5 ' |
2-378 | 5 | 5 | 5 | 5 | 5 |
2-379 | 5 | 5 | 5 | 5 | 5 |
2-381 | 5 | 5 | 5 | 5 | 5 |
2-383 | 5 | 5 | 5 | ||
2-385 | 5 | 5 | 5 | ||
2-386 | 5 | 5 | 5 | 5 | 5 |
2-387 | 5 | 5 | 5 | 5_________ | 5 |
Table 5 Post-emergence comparative activity test
No. | Echinochloa crusgalli | Digitaria sanguinalis | Semen Euphorbiae Lathyridis | rice |
_____________________1-2___________________________ | 5 | 5 | 5 | N |
nh2 ciX^ci _ _ ·. 0 | 2 | 3 | 3 | N |
nh2 Clx^-Yci cXnX>Jy0'h _____________________0 CS configuration) | 1 | 1 | 1 | N |
_________________________1-26 | 5 | 5 | 5 | 0 |
_________________1-26 (400 g a.i./ha) | 5 | 5 | 5 | 3 |
Y ! ---------------=---------Cl_______Q______________________ | 2 | 3 | 3 | 2 |
h2n VoV ______________Cl_______O (N configuration) | 1 | 1 | 1 | N |
___________________________1-71___________________________ | 5 | 5 | 5 | 0 |
_____________________ 2-30 | 4 | 5 | 4 | N |
nh2 OyCci Η^γΧγ0'''' --Q_________________ | 2 | 3 | 2 | N |
NH2 CI^J^CI H O (S configuration ) | 0 | 0 | 0 | N |
2-69 | 5 | 5 | 5 | 0 |
2-70 | 5 | 5 | 5 | 0 |
2-71 | 5 | 5 | 5 | 0 |
2-71 (400 g a.i./ha) | 5 | 5 | 5 | 2 |
Cl O | 2 | 2 | 3 | 1 |
X,- Cl O (S configuration) | 1 | 1 | 1 | N |
2-72 | 5 | 5 | 5 | 0 |
2-86 | 5 | 5 | 5 | 0 |
2-103 | 5 | 5 | 5 | 0 |
2-113 | 5 | 5 | 5 | 0 |
2-121 | 5 | 5 | 5 | 0 |
2-195 | 4 | 5 | 5 | 0 |
2-215 | 4 | 5 | 5 | 0 |
2-235 | 5 | 5 | 5 | 0 |
2-271 | 5 | 5 | 5 | 0 |
2-280 | 5 | 5 | 5 | 0 |
2-283 | 5 | 5 | 5 | 0 |
2-287 | 5 | 5 | 5 | 0 |
2-292 | 5 | 5 | 5 | N |
2-294 | 5 | 5 | 5 | 0 |
2-298 | 5 | 5 | 5 | 0 |
2-298 (400 g a.i./ha) | 5 | 5 | 5 | 1 |
2-298 ( 100 g a.i./ha) | 4 | 5 | 5 | 0 |
0 0 0 b | 3 | N | N | 0 |
nh2 en .X γι O (S configuration) | 1 | N | N | N |
2-300 | 5 | 5 | 5 | 0 |
2-319 | 5 | 5 | 5 | 0 |
2-343 | 5 | 5 | 5 | 0 |
2-348 | 5 | 5 | 5 | 0 |
bispyribac-sodium ( 100 g a.i./ha) | 1 | 1 | 0 | N |
cyhalofop-butyl (300 g a.i./ha) | 1 | 1 | 1 | 0 |
Notes: An average value was obtained through three répétitive experiments, N represented missing of some data; if not clearly indicated, the application dose was active ingrédient 200 g/ha, plus water 450 kg/ha. Echinochloa crusgalli collected from Jiangsu, China, was résistant to ALS inhibitor herbicides and ACCe herbicides, and Digitaria sanguinalis and Semen
Euphorbiae Lathyridis also collected from Jiangsu were résistant to the ACCe herbicide cyhalofop-butyl.
Unexpectedly, although the compounds of the présent invention were similar in structure to the control compounds, they had good effects and better selectivity for major gramineous weeds, broad-leaved weeds, and Cyperus rotundus in rice fields, and had excellent commercial value. In particular, they were still outstanding to control key weeds that were résistant to the ALS inhibitor bispyribac-sodium and the ACCe inhibitor cyhalofop-butyl. In addition, compared with the racemate and the S-isomer, the R-isomer of the présent invention had significantly improved activity against gramineous weeds such as Echinochloa crusgalli, Digitaria sanguinalis and Semen Euphorbiae Lathyridis, and had good selectivity for rice.
Experiment on weed effcct in pre-emergence stage
Seeds of monocotyledonous and dicotyledonous weeds and main crops (e. g. wheat, corn, rice, soybean, cotton, oilseed, millet and sorghum) were put into a plastic pot loaded with soil and covered with 0. 5-2cm soil. The test compounds of the présent invention was dissolved with acetone, then added with tween-80, diluted by a certain amount of water to reach a certain concentration, and sprayed immediately after sowîng. The obtained seeds were incubated for 4 weeks in the greenhouse after spraying and the test results were observed. It was observed that the herbicide mostly had excellent effect at the application rate of 250 g a.i./ha, especially to weeds such as Echinochloa crusgalli, Digitaria sanguinalis and Abutilon theophrasti, etc. Many compounds had good selectivity for corn, wheat, rice, soybean, oilseed râpe, etc.
Through experiments, we found that the compounds of the présent invention generally had better weed control effects, especially for major gramineous weeds such as Echinochloa crusgalli, Digitaria sanguinalis, and Setaria viridis, which are widely occurring in corn fields, rice fields and wheat fields, and major broad-leaved weeds such as Abutilon theophrasti, Rorippa indica and Bidens pilosa, and had excellent commercial value. In particular, we noticed that they had extremely high activity against broad-leaved weeds, such as Rorippa indica, Descurainia sophia, Capsella bursa-pastoris, Lithospermum arvense, Galium aparine and Stellaria media, which were résistant to ALS inhibitors.
Transplanted rice safety évaluation and weed control effect évaluation in rice field:
Rice field soil was loaded into a 1/1,000,000 ha pot. The seeds of Monochoria vaginalis were sowed and gently covered with soil, then left to stand still in greenhouse in the State of 0.5-lcm of water storage. It was kept at 3-4cm of water storage thereafter. The weeds were treated by dripping the WP or SC water diluents prepared according to the common préparation method of the compounds of the présent invention with pipette homogeneously to achieve specified effective amount when Monochoria vaginalis reached 0. 5 leaf stage.
In addition, the rice field soil that loaded into the 1/1,000,000 ha pot was leveled to keep water storage at 3-4cm depth. The 3-leaf stage rice (japonica rice) was transplanted at 3 cm of transplanting depth the next day. The compound of the présent invention was treated by the same way after 5 days of transplantation.
The fertility condition of Monochoria vaginalis 14 days and rice 21 days after the treatment of the compound of the invention with the naked eye. Evaluate the weed control effect with the aforementioned activity standard level of 0-5, many compounds exhibited excellent activity and selectivity.
Table 6 Test results of activity and safety (1000 g a.i./ha)
No. | rice | Monochoria Vaginalis |
1-2 | 0 | 5 |
1-26 | 0 | 5 |
1-71 | 0 | 5 |
2-69 | 0 | 5 |
2-70 | 0 | 5 |
2-71 | 0 | 5 |
2-294 | 0 | 5 |
2-300 | 0 | 5 |
2-319 | 0 | 5 |
2-343 | 0 | 5 |
2-348 | 0 | 5 |
penoxsulam (50 g a.i./ha) | 1 | 1 |
Note: The seeds of Monochoria vaginalis were collected from Heilongjing Province of China. Tests indicated that the weeds were résistant to common rate of pyrazosulfuron-ethyl and penoxsulam.
It can be seen from the experiments that the compounds of the présent invention had excellent activity against weeds having an anti-ALS inhibiting activity which cause a serions challenge in production, and can solve the increasingly serions problem of résistance.
At the same time, it is found after several tests that the compound and the composition of the présent invention hâve good selectivity to many gramineae weeds such as Zoysia japonica, Cynodon dactylon, Festuca data, Poa annua, Lolium perenne and Paspalum vaginatum etc, and is able to control many important gramineous weeds and broad-leaved weeds. The compound also shows excellent selectivity and commercial value in the tests on wheat, corn, rice, sugarcane, soybean, cotton, oil sunflower, potato, orchards and vegetables in different herbicide application methods.
Claims (10)
1. An R-pyridyloxycarboxylic acid represented by formula I and sait, ester dérivative thereof,
V
wherein, A, B each independently represent halogen; or alkyl or cycloalkyl with or without halogen;
C represents hydrogen, halogen, alkyl or haloalkyl;
Q represents halogen, cyano, cyanoalkyl, hydroxyalkyl, amino, nitro, formyl; alkyl, alkenyl, alkynyl, cycloalkyl, alkoxy, alkylthio, alkylcarbonyl, alkoxycarbonyl, alkylaminoalkyl or alkoxyalkyl with or without halogen; or unsubstituted or substituted aryl, heteroaryl, arylalkyl, heteroarylalkyl;
Y represents nitro or NRjR2, wherein Ri represents H; alkyl, alkenyl or alkynyl optionally substituted by 1-2 Ru; -COR12, nitro, OR13, SO2R14, NR15R16, N=CRi7Ri8, alkylcarbamoyl, dialkylcarbamoyl, trialkylsilyl or dialkylphosphono; R2 represents H; alkyl optionally substituted by 1-2 Ru; or -COR12; or NR1R2 represents N=CR2iNR22R23; N=CR24OR25; or a 5- or 6-membered saturated or unsaturated ring with or without oxygen atom, sulfur atom, or other nitrogen atom, which is unsubstituted or substituted by 1-2 groups independently selected from the group consisting of halogen^ alkyl, alkoxy, haloalkoxy, alkylthio, haloalkylthio, amino, alkylamino, dialkylamino, alkoxycarbonyl;
wherein Ru independently represents halogen, hydroxy, alkoxy, haloalkoxy, alkylthio, haloalkylthio, amino, alkylamino, dialkylamino, alkoxycarbonyl; or unsubstituted or substituted aryl, heteroaryl;
Ri2 represents H, alkyl, haloalkyl, alkoxy, phenyl, phenoxy or benzyloxy;
R13 represents H, alkyl, haloalkyl, phenyl, benzyl or CHR3iC(O)OR32; R31 represents H, alkyl or alkoxy; R32 represents H, alkyl or benzyl;
R|4 represents alkyl or haloalkyl;
Ris represents H, alkyl, formyl, alkylacyl, haloalkylacyl, alkoxycarbonyl, phenylcarbonyl, phenoxy carbonyl or benzyloxycarbonyl; R]6 represents H or alkyl;
R17 represents H, alkyl; or phenyl that is unsubstituted or substituted by 1-3 groups selected from the group consisting of halogen, alkyl, alkoxy; R^ represents H or alkyl; or N=CRi7Ri8 N=\ J n=/M represents or Ά X__/ ;
R21, R24 each independently represent H or alkyl;
R22, R23 each independently represent H or alkyl; or NR22R23 represents a 5- or 6-membered saturated or unsaturated ring with or without oxygen atom, sulfur atom, or other nitrogen atom;
R25 represents alkyl;
the sait is métal sait, amine sait, sulfonium sait or phosphonium sait;
Q
Jl J h v
O the ester is 1 , wherein, X represents O or S;
O
5,0, Ah'R
M represents alkyl, alkenyl, alkynyl, cycloalkyl, cycloalkylalkyl, -alkyl-Z, 1 R3, < ό 3,
O R4N'R5
O -A'R4 -VN—'R4 àAor6 । I e 11
A 0 , R5 , R5 , 0 with or without halogen; or unsubstituted or substituted heterocyclyl, aryl, heteroaryl;
O
J .R, x°Y% Y Y /-Y
Z represents * R3, T O ; ό , Rs , R5 , Rs , cyano, nitro, or unsubstituted or substituted heterocyclyl, aryl, heteroaryl;
R3 each independently represents alkyl, alkenyl, alkynyl, cycloalkyl, cycloalkylalkyl or unsubstituted or substituted heterocyclyl, aryl, heteroaryl, heterocyclylalkyl, arylalkyl, heteroarylalkyl;
R4, R5, Rô each independently represent hydrogen, alkyl, alkenyl, alkynyl, cycloalkyl, cycloalkylalkyl, alkoxycarbonyl or unsubstituted or substituted heterocyclyl, aryl, heteroaryl, heterocyclylalkyl, arylalkyl, heteroarylalkyl.
2. The R-pyridyloxycarboxylic acid and sait, ester dérivative thereof according to claim 1, wherein A, B each independently represent halogen; or C1-C8 alkyl or C3-C8 cycloalkyl with or without halogen;
C represents hydrogen, halogen, C1-C8 alkyl or halo C1-C8 alkyl;
Q represents halogen, cyano, cyano C1-C8 alkyl, hydroxy C1-C8 alkyl, amino, nitro, formyl; C1-C8 alkyl, C2-C8 alkenyl, C2-C8 alkynyl, C3-C8 cycloalkyl, C1-C8 alkoxy, C1-C8 alkylthio, C1-C8 alkylcarbonyl, C1-C8 alkoxycarbonyl, C1-C8 alkylamino C1-C8 alkyl or C1-C8 alkoxy C1-C8 alkyl with or without halogen; or unsubstituted or substituted aryl, heteroaryl, aryl C1-C8 alkyl, heteroaryl C1-C8 alkyl;
Y represents nitro or NRjR2, wherein Ri represents H; C1-C8 alkyl, C2-C8 alkenyl or C2-C8 alkynyl optionally substituted by 1-2 Ru; -CORi2, nitro, ORi3, SO2Ri4, NRi5Ri6, N=CR[7R1S, C1-C8 alkylcarbamoyl, di-Cl-C8 alkylcarbamoyl, tri-Cl-C8 alkylsilyl or di-Cl-C8 alkylphosphono; R2 represents H; C1-C8 alkyl optionally substituted by 1-2 Ru; or -COR]2; or NRiR2 represents
Y -7 χΧ Y xX_
J s Z-x V Y ί N Y
Yn i Yn h I Y i i 1
N=CR2iNR22R23, N=CR24OR25; or \V, \—, -Y, YY or Y0 that is unsubstituted or substituted by 1-2 groups independently selected from the group consisting of halogen, C1-C8 alkyl, C1-C8 alkoxy, halo C1-C8 alkoxy, C1-C8 alkylthio, halo C1-C8 alkylthio, amino, C1-C8 alkylamino, di-Cl-C8 alkylamino, C1-C8 alkoxycarbonyl;
wherein Ru independently represents halogen, hydroxy, C1-C8 alkoxy, halo C1-C8 alkoxy, C1-C8 alkylthio, halo C1-C8 alkylthio, amino, C1-C8 alkylamino, di-Cl-C8 alkylamino, C1-C8 alkoxycarbonyl; or phenyl, naphthyl,
is unsubstituted or substituted by 1-3 groups selected from the group consisting of halogen, C1-C8 alkyl, halo C1-C8 alkyl, C1-C8 alkoxy, nitro;
Ri2 represents H, Cl-Cl 8 alkyl, halo C1-C8 alkyl, C1-C8 alkoxy, phenyl, phenoxy or benzyloxy;
Ri3 represents H, C1-C8 alkyl, halo C1-C8 alkyl, phenyl, benzyl or CHR3iC(O)OR32; R3i represents H, C1-C8 alkyl or C1-C8 alkoxy; R32 represents H, C1-C8 alkyl or benzyl;
Ri4 represents C1-C8 alkyl or halo C1-C8 alkyl;
Ris represents H, C1-C8 alkyl, formyl, C1-C8 alkylacyl, halo C1-C8 alkylacyl, C1-C8 alkoxycarbonyl, phenylcarbonyl, phenoxycarbonyl or benzyloxycarbonyl; Rie represents H or C1-C8 alkyl;
Ri7 represents H, C1-C8 alkyl; or phenyl that is unsubstituted or substituted by 1-3 groups selected from the group consisting of halogen, C1-C8 alkyl, C1-C8 alkoxy; R18 represents H or
N=b3 n=/ ?
C1-C8 alkyl; or N=CRi7Ri8 represents V or za \__/;
R2i, R24 each independently represent H or C1-C8 alkyl;
β-Ν'Υ
R22, R23 each independently represent H or C1-C8 alkyl; or NR22R23 represents \-Y,
R25 represents C1-C8 alkyl;
the sait is métal sait, ammonium sait NHY primary amine RNH2 sait, secondary amine (R)2NH sait, tertiary amine (R)3N sait, quatemary amine sait (R)4N+, morpholine sait, piperidine sait, pyridine sait, aminopropyl morpholine sait, Jeff amine D-230 sait, the sait of 2,4,6-tri(dimethylammomethyl) phénol and sodium hydroxide, alkyl sulfonium sait, alkylsulfoxonium sait, alkylphosphonium sait or alkanolphosphonium sait;
wherein, R each independently represents unsubstituted alkyl, alkenyl, alkynyl, cycloalkyl or phenyl, and the foregoing groups are optionally substituted by one or more of the following groups: halogen, hydroxy, alkoxy, alkylthio, hydroxyalkoxy, amino, alkylamino, aminoalkylamino, phenyl;
in formula 1-1, X represents O or S;
M represents C1-C18 alkyl, C2-C8 alkenyl, C2-C8 alkynyl, C3-C8 cycloalkyl, C3-C8
O
II
O cycloalkyl C1-C8 alkyl, -(C1-C8 alkyl)-Z, t ^3, M R3
O
R4N'R5
O with or without halogen, or unsubstituted or substituted heterocyclyl, aryl, heteroaryl;
O n î » χογ%3 ArNYR< Α·νλ
-R3 k II 3 I I I
Z represents V R3, X O , o , R5 , Rs , Rs , cyano, nitro, or unsubstituted or substituted heterocyclyl, aryl, heteroaryl;
R3 each independently represents C1-C8 alkyl, C2-C8 alkenyl, C2-C8 alkynyl, C3-C8 cycloalkyl, C3-C8 cycloalkyl C1-C8 alkyl or unsubstituted or substituted heterocyclyl, aryl, heteroaryl, heterocyclyl C1-C8 alkyl, aryl C1-C8 alkyl, heteroaryl C1-C8 alkyl;
R4, Rs, Ré each independently represent hydrogen, C1-C8 alkyl, C2-C8 alkenyl, C2-C8 alkynyl, C3-C8 cycloalkyl, C3-C8 cycloalkyl C1-C8 alkyl, C1-C8 alkoxycarbonyl or unsubstituted or substituted heterocyclyl C1-C8 alkyl, aryl C1-C8 alkyl, heteroaryl C1-C8 alkyl;
R' ,γΛ ύ ,R' ) An ] It- b I—N ; _ N the term “heterocyclyl” refers to v , si—I, \ I ! , I
'ύ-'0 or with 0, 1 or 2 oxo groups; the term “aryl” refers to phenyl
or A N , which is optionally substituted by at least one group selected from the group consisting of halogen, nitro, cyano, thiocyano, hydroxy, carboxy, mercapto, formyl; phenyl, benzyl, benzyloxy, phenoxy that is unsubstituted or substituted by at least one group from the group consisting of halogen, alkyl, alkoxy; alkyl, alkenyl, alkynyl, cycloalkyl, cycloalkylalkyl, OR”, SR”, -alkyl-OR”, -alkyl-SR”, COR”, COOR”, COSR”, SOR”, SO2R”, OCOR”, SCOR” with or without halogen; and amino or aminocarbonyl substituted by one or two groups selected from the group consisting of hydrogen, alkyl, alkenyl, alkynyl, cycloalkyl, cycloalkylalkyl, phenyl, benzyl, benzyloxy, phenoxy, COR”, COOR”, SO2R”, OR”;
R’ each independently represents hydrogen, nitro, hydroxy, amino; or alkyl, alkenyl, alkynyl, cycloalkyl, cycloalkenyl, cycloalkylalkyl, alkoxy, alkenyloxy, alkynyloxy, cycloalkyloxy, alkoxyalkyl, alkoxycarbonyl, alkylthiocarbonyl, alkylsulfonyl, alkylsulfonylalkyl, alkylcarbonyl, alkylcarbonylalkyl, alkylacyloxy, alkylamino, alkylaminocarbonyl, alkoxyaminocarbonyl, alkoxycarbonylalkyl, alkylaminocarbonylalkyl, trialkylsilyl, dialkylphosphono with or without halogen;
R” each independently represents hydrogen, alkyl, alkenyl, alkynyl, cycloalkyl or cycloalkylalkyl.
3. The R-pyridyloxycarboxylic acid and sait, ester dérivative thereof according to claim 2, wherein A, B each independently represent halogen; or C1-C6 alkyl or C3-C6 cycloalkyl with or without halogen;
C represents hydrogen, halogen, C1-C6 alkyl or halo C1-C6 alkyl;
Q represents halogen, cyano, cyano C1-C6 alkyl, hydroxy C1-C6 alkyl, amino, nitro, formyl; C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C1-C6 alkoxy, C1-C6 alkylthio, C1-C6 alkylcarbonyl, C1-C6 alkoxycarbonyl, C1-C6 alkylamino C1-C6 alkyl or C1-C6 alkoxy C1-C6 alkyl with or without halogen; or unsubstituted or substituted aryl, heteroaryl, aryl C1-C6 alkyl, heteroaryl C1-C6 alkyl;
Y represents nitro or NRjR2, wherein Ri represents H; C1-C6 alkyl, C2-C6 alkenyl or C2-C6 alkynyl optionally substituted by 1-2 Ru; -CORj2, nitro, ORb, SO2Ri4, NRi5Ri6, N=CRi7Ris, C1-C6 alkylcarbamoyl, di-Cl-C6 alkylcarbamoyl, tri-Cl-C6 alkylsilyl or di-Cl-C6 alkylphosphono; R2 represents H; C1-C6 alkyl optionally substituted by 1-2 Ru; or -CORi2; or NRjR2 represents
N=CR2iNR22R23, N=CR24OR25; or
or 0 that is unsubstituted or substituted by 1-2 groups independently selected from the group consisting of halogen, C1-C6 alkyl, C1-C6 alkoxy, halo C1-C6 alkoxy, C1-C6 alkylthio, halo C1-C6 alkylthio, amino, C1-C6 alkylamino, di-Cl-C6 alkylamino, C1-C6 alkoxycarbonyl;
wherein Ru independently represents halogen, hydroxy, C1-C6 alkoxy, halo C1-C6 alkoxy, C1-C6 alkylthio, halo C1-C6 alkylthio, amino, C1-C6 alkylamino, di-Cl-C6 alkylamino, C1-C6 alkoxycarbonyl; or phenyl, naphthyl,
is unsubstituted or substituted by 1-3 groups selected from the group consisting of halogen, C1-C6 alkyl, halo C1-C6 alkyl, C1-C6 alkoxy, nitro;
R12 represents H, Cl-Cl4 alkyl, halo C1-C6 alkyl, C1-C6 alkoxy, phenyl, phenoxy or benzyloxy;
Ri3 represents H, C1-C6 alkyl, halo C1-C6 alkyl, phenyl, benzyl or CHR3iC(O)OR32; R3i represents H, C1-C6 alkyl or C1-C6 alkoxy; R3? represents H, C1-C6 alkyl or benzyl;
Ri4 represents C1-C6 alkyl or halo C1-C6 alkyl;
Ris represents H, C1-C6 alkyl, formyl, C1-C6 alkylacyl, halo C1-C6 alkylacyl, C1-C6 alkoxycarbonyl, phenylcarbonyl, phenoxycarbonyl or benzyloxycarbonyl; Ri6 represents H or C1-C6 alkyl;
Ri7 represents H, C1-C6 alkyl; or phenyl that is unsubstituted or substituted by 1-3 groups selected from the group consisting of halogen, C1-C6 alkyl, C1-C6 alkoxy; Rlg represents H or N=\ J N=Z )
Cl-C6 alkyl; or N=CRi7Rjg represents or H
R21, R24 each independently represent H or C1-C6 alkyl;
R22, R23 each independently represent H or C1-C6 alkyl; or NR22R23 represents NCb,
W, Oor U;
R25 represents C1-C6 alkyl;
the sait is métal sait, ammonium sait NH4 +, primary amine RNH2 sait, secondary amine (R)2NH sait, tertiary amine (R)3N sait, quatemary amine sait (R)4N+, morpholine sait, piperidine sait, pyridine sait, aminopropyl morpholine sait, Jeff amine D-230 sait, the sait of 2,4,6-tri(dimethylaminomethyl) phénol and sodium hydroxide, C1-C18 alkylsulfonium sait, Cl-Cl 8 alkylsulfoxonium sait, Cl-Cl 8 alkylphosphonium sait or Cl-Cl 8 alkanolphosphonium sait;
wherein, R each independently represents unsubstituted Cl-Cl 8 alkyl, C2-C18 alkenyl, C2-C18 alkynyl, C3-C18 cycloalkyl or phenyl, and the foregoing groups are optionally substituted by one or more of the following groups: halogen, hydroxy, C1-C8 alkoxy, C1-C8 alkylthio, hydroxy
C1-C8 alkoxy, amino, C1-C8 alkylamino, amino C1-C8 alkylamino, phenyl;
in formula 1-1, X represents O or S;
M represents C1-C18 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C3-C6 O
9 O '-o Y r3 n a η cycloalkyl C1-C6 alkyl, -(C1-C6 alkyl)-Z, R3 J Ô 3, b θ' , Rs , Rs ,
O with or without halogen, or unsubstituted or substituted heterocyclyl, aryl, heteroaryl; o ο λ R \°y°'r3 NR<
Z represents V°R3, Vo^3, O , Rs , Rs , Rs , cyano, nitro, or unsubstituted or substituted heterocyclyl, aryl, heteroaryl;
R3 each independently represents C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C3-C6 cycloalkyl C1-C6 alkyl or unsubstituted or substituted heterocyclyl, aryl, heteroaryl, heterocyclyl C1-C6 alkyl, aryl C1-C6 alkyl, heteroaryl C1-C6 alkyl;
R4, R5, Ré each independently represent hydrogen, C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C3-C6 cycloalkyl C1-C6 alkyl, C1-C6 alkoxycarbonyl or unsubstituted or substituted heterocyclyl C1-C6 alkyl, aryl C1-C6 alkyl, heteroaryl C1-C6 alkyl;
R' ·' O “K -R' _^O < ) U X f/η ·γ X ΓΝ -N the term “heterocyclyl” refers to v , b—b o, ' , Χ-Ά 1—1 , Sl—1 ,
Y'nR' N Y ^Ν-γ M'Y or with 0, 1 or 2 oxo groups; the term “aryl” refers to phenyl
consisting of halogen, nitro, cyano, thiocyano, hydroxy, carboxy, mercapto, formyl; phenyl, benzyl, benzyloxy, phenoxy that is unsubstituted or substituted by at least one group from the group consisting of halogen, C1-C6 alkyl, C1-C6 alkoxy; C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C3-C6 cycloalkyl C1-C6 alkyl, OR”, SR”, -(Cl-C6)alkyl-OR”, -(Cl-C6)alkyl-SR”, COR”, COOR”, COSR”, SOR”, SO2R”, OCOR”, SCOR” with or without 5 halogen; and amino or aminocarbonyl substituted by one or two groups selected from the group consisting of hydrogen, C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C3-C6 cycloalkyl C1-C6 alkyl, phenyl, benzyl, benzyloxy, phenoxy, COR”, COOR”, SO2R”, OR”;
R each independently represents hydrogen, nitro, hydroxy, amino; or C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl, C3-C6 cycloalkenyl, C3-C6 cycloalkyl C1-C6 alkyl, 10 C1-C6 alkoxy, C2-C6 alkenyloxy, C2-C6 alkynyloxy, C3-C6 cycloalkyloxy, C1-C6 alkoxy C1-C6 alkyl, C1-C6 alkoxycarbonyl, C1-C6 alkylthiocarbonyl, C1-C6 alkylsulfonyl, C1-C6 alkylsulfonyl C1-C6 alkyl, C1-C6 alkylcarbonyl, C1-C6 alkylcarbonyl C1-C6 alkyl, C1-C6 alkylacyloxy, C1-C6 alkylamino, C1-C6 alkylaminocarbonyl, C1-C6 alkoxyaminocarbonyl, C1-C6 alkoxycarbonyl C1-C6 alkyl, C1-C6 alkylaminocarbonyl C1-C6 alkyl, tri-Cl-C6 alkylsilyl, di-Cl-C6 15 alkylphosphono with or without fhioro, chloro orbromo;
R” each independently represents hydrogen, C1-C6 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C6 cycloalkyl or C3-C6 cycloalkyl C1-C6 alkyl.
4. The R-pyridyloxycarboxylic acid and sait, ester dérivative thereof according to claim 3, wherein A, B each independently represent halogen, C1-C6 alkyl, halo C1-C6 alkyl or C3-C6 20 cycloalkyl;
C represents hydrogen, halogen, C1-C6 alkyl or halo C1-C6 alkyl;
Q represents C1-C6 alkyl, halo C1-C6 alkyl, C3-C6 cycloalkyl, C2-C6 alkenyl, C2-C6 alkynyl, halogen, cyano, amino, nitro, formyl, C1-C6 alkoxy, C1-C6 alkylthio, C1-C6 alkoxycarbonyl, hydroxy C1-C6 alkyl, C1-C6 alkoxy C1-C2 alkyl, cyano C1-C2 alkyl, C1-C6 alkylamino C1-C2
V
25 alkyl, benzyl, naphthyl, furyl, thienyl, thiazolyl, pyridyl, pyrimidinyl; R,/ that is unsubstituted or substituted by C1-C6 alkyl; or phenyl that is unsubstituted or substituted by at least one group selected from the group consisting of C1-C6 alkyl, halo C1-C6 alkyl, halogen and C1-C6 alkoxy;
Y represents amino, C1-C6 alkylamino, C1-C6 alkylcarbonylamino, phenylcarbonylamino, benzylamino; or furylmethyleneamino that is unsubstituted or substituted by halo C1-C6 alkyl;
30 the sait is métal sait, ammonium sait NH4 +, primaiy amine RNH2 sait, secondary amine (R)2NH sait, tertiary amine (R)3N sait, quatemary amine sait (R)4N+, morpholine sait, piperidine sait, pyridine sait, aminopropyl morpholine sait, Jeff amine D-230 sait, the sait of 2,4,6-tn(dimethylaminomethyl) phénol and sodium hydroxide, C1-C14 alkylsulfonium sait, C1-C14 alkylsulfoxonium sait, C1-C14 alkylphosphonium sait or C1-C14 alkanolphosphonium sait;
wherein, R each independently represents unsubstituted Cl-Cl4 alkyl, C2-C12 alkenyl, C2-C12 alkynyl, C3-C12 cycloalkyl or phenyl; or C1-C14 alkyl optionally substituted by one or more of the following groups: halogen, hydroxy, C1-C6 alkoxy, C1-C6 alkylthio, hydroxy C1-C6 alkoxy, amino, C1-C6 alkylamino, amino C1-C6 alkylamino, phenyl;
in formula 1-1, X represents O or S;
M represents Cl-Cl 8 alkyl, halo C1-C8 alkyl, C3-C6 cycloalkyl, C2-C6 alkenyl, halo C2-C6 alkenyl, C2-C6 alkynyl, C1-C6 alkoxy, C1-C6 alkoxycarbonyl, C1-C6 alkylsulfonyl, cyano C1-C2 alkyl, nitro C1-C2 alkyl, C1-C6 alkoxy C1-C2 alkyl, C1-C6 alkoxycarbonyl C1-C2 alkyl, C2-C6
O R4-N'R5
Ύ*4 vnyr4 alkenyloxycarbonyl C1-Ç2 alkyl, -(C1-C2 alkyl)-Z, Rs , Rs , o , R' R' Υγ > AY tetrahydrofuryl, pyridyl, naphthyl, furyl, thienyl, * YA, N Y; r'z that is unsubstituted or substituted by C1-C6 alkyl; or phenyl that is unsubstituted or substituted by C1-C6 alkyl, halo C1-C6 alkyl, C1-C6 alkylamino, halogen or C1-C6 alkoxy;
o 0 ArV4 AV -A'A
Z represents O , Rs , Rs , Rs , tetrahydrofuryl, pyridyl, R,z , thienyl, furyl, naphthyl; or phenyl that is unsubstituted or substituted by at least one group selected from the group consisting of C1-C6 alkyl, C1-C6 alkoxy, halo C1-C6 alkyl, cyano and halogen;
R3 each independently represents C1-C6 alkyl;
R4, R5, Rs each independently represent hydrogen, C1-C6 alkyl or C1-C6 alkoxycarbonyl;
R’ represents hydrogen, C1-C6 alkyl or halo C1-C6 alkyl.
5. The R-pyridyloxycarboxylic acid and sait, ester dérivative thereof according to claim 4, wherein A, B each independently represent fluoro, chloro, bromo, iodo, methyl, ethyl, propyl, isopropyl, trifluoromethyl or cyclopropyl;
C represents hydrogen, fluoro, chloro, bromo, iodo, methyl or trifluoromethyl;
Q represents methyl, ethyl, propyl, isopropyl, cyclopropyl, vinyl, ethynyl, fluoro, chloro, bromo, cyano, amino, nitro, formyl, methoxy, methylthio, methoxycarbonyl, monochloromethyl, monofluoromethyl, difluoromethyl, trifluoromethyl, 2-chloroethyl, 2,2,2-trifluoroethyl,
I hydroxymethyl, Ύ-'0', Voz, T , νοΎ Yn\, benzyl, naphthyl, furyl, thiazolyl, pyridyl, pyrimidinyl; thiazolyl that is unsubstituted or substituted by chloro; thienyl that is
-h . . N N unsubstituted or substituted by fluoro; R’ that is unsubstituted or substituted by methyl or fluoro; or phenyl that is unsubstituted or substituted by at least one group selected from the group consisting of methyl, trifluoromethyl, chloro and methoxy;
the sait is métal sait, ammonium sait NH4 +, primary amine RNH2 sait, secondary amine (R)2NH sait, tertiary amine (R)jN sait, quaternary amine sait (R)4N+, morpholine sait, piperidine sait, pyridine sait, aminopropyl morpholine sait, Jeff amine D-230 sait, the sait of 2,4,6-tri(dimethylaminomethyl) phénol and sodium hydroxide, C1-C6 alkylsulfonium sait, C1-C6 alkylsulfoxonium sait, C1-C6 alkylphosphonium sait or C1-C6 alkanolphosphonium sait;
wherein, R each independently represents unsubstituted C1-C14 alkyl, C2-C6 alkenyl, C2-C6 alkynyl, C3-C12 cycloalkyl, phenyl or benzyl; or C1-C14 alkyl optionally substituted by one or more of the following groups: hydroxy, C1-C4 alkoxy, C1-C4 alkylthio, hydroxy C1-C4 alkoxy, amino, C1-C4 alkylamino, amino C1-C4 alkylamino;
or the sait is alkali métal sait, alkaline earth métal sait, heavy métal sait, aluminum sait, ammonium sait, tétraméthylammonium sait, tetraethylammonium sait, tetrapropylammonium sait, tetraisopropylammonium sait, tetrabutylammonium sait, benzyltrimethylammonium sait, benzyltriéthylammonium sait, choline amine sait, monomethylamine sait, dimethylamine sait, trimethylamine sait, monoethylamine sait, diethylamine sait, triethylamine sait, monoisopropylamine sait, diisopropylamine sait, triisopropylamine sait, monoisobutylamine sait, pentylamine sait, hexylamine sait, heptylamine sait, dodecylamine sait, tetradecylamine sait, diallylamine sait, cyclo dodecylamine sait, benzylamine sait, monoethanolamine sait, diethanolamine sait, triethanolamine sait, tripropanolamine sait, triisopropanolamine sait, tri(2-hydroxypropyl)amine sait, methylmonoethanolamine sait, dimethylmonoethano lamine sait, methyldiethanolamine sait, diethylethanolamine sait, diglycolamine sait, diethylenetriamine sait, dimethylaminopropylamine sait, 1,2-propyldiamine sait, triethylenetetramine sait, N,N-bis[aminopropyl]methylamine sait, 2-methylthiopropylamine sait, 2-butoxyethylamine sait, AEPD sait, tri(methylol) aminomethane sait, morpholine sait, aminopropyl morpholine sait, Jeff amine D-230 sait, the sait of 2,4,6-tri(dimethylaminomethyl) phénol and sodium hydroxide;
in formula I-1, X represents O or S;
M represents methyl, ethyl, propyl, isopropyl, n-butyl, sec-butyl, isobutyl, tert-butyl, pentyl, hexyl, heptyl, octyl, nonyl, decyl, undecyl, dodecyl, octadecyl, trifluoromethyl, pentafluoroethyl, 3-chlorobutyl, 2-fluoroethyl, 2-chloroethyl, 2-bromoethyl, 2,2-difluoroethyl, 2,2,2-trifluoroethyl, 4,4,4-trifluorobutyl, 2,2,3,3,3-pentafluoropropyl, cyclopropyl, cyclobutyl, cyclopentyl, cyclohexyl, allyl, 2-propynyl, methoxy, ethoxycarbonyl, methylsulfonyl, yVN°25 /° \__,
γΛ'/^νη2 , tetrahydrofuryl, tetrahydrofurylmethylene, pyridyl, pyridylmethylene,
5 naphthyl, naphthylmethylene, furyl, furylmethylene, thienyl, thienylmethylene,
N-N N-n
R' ; / that is unsubstituted or substituted by methyl; phenyl that is unsubstituted or substituted by methyl, dimethylamino, chloro, methoxy, trifluoromethyl or isopropyl; or benzyl that is unsubstituted or substituted by trifluoromethyl, bromo, chloro, fluoro, methoxy, cyano or methyl;
R’ represents hydrogen, methyl, ethyl or difluoromethyl.
10
6. The R-pyridyloxycarboxylic acid and sait, ester dérivative thereof according to claim 5, which is selected from: nh2
1-26 0
2-30
O
2-34
2-62
Ο
2-271
2-294
2-283
ο 2-300
7. A préparation method of the R-pyridyloxycarboxylic acid and sait, ester dérivative thereof according to any one of claims 1-6, which comprises the following steps:
5 a compound of formula III is reacted with a compound of formula II to obtain a compound of formula 1-1-1; the reaction scheme is as foliows:
wherein, W represents an alkali métal; Hal represents halogen; the reaction is carried out in the presence of a catalyst and a solvent, the catalyst is TBAB, and the solvent is one or more selected 10 from the group consisting of DCM, DCE, ACN, THF, DMF;
the compound of formula 1-1-1 is reacted in the presence of a lithium hydroxide aqueous solution and a solvent to obtain a compound of formula I; the reaction scheme is as foliows:
Y ¥
l -14 I the solvent is one or more selected from the group consisting of methanol, éthanol, and 15 isopropanol;
the compound of formula I is reacted with M-SH to obtain a compound of formula 1-1-2; the reaction scheme is as follows:
.1 Ί-2 wherein, the reaction is carried out in the presence of a dehydrant and a solvent, the dehydrant is DCC, and the solvent is one or more selected from the group consisting of dichloromethane, dichloroethane, acetonitrile, N,N-dimethylformamide, Ν,Ν-dimethylacetamide, dimethyl sulfoxide, tetrahydrofuran, toluene, xylene;
or, when Y represents NR|R2 (Ru R2 are not hydrogen at the same time), it is obtained by
reacting a compound of formula 1-2 or a compound of formula 1-1-3
ï L3 with a corresponding halide;
wherein, the reaction is carried out in the presence of a base and a solvent, wherein the base is one or more selected from the group consisting of sodium hydroxide, potassium hydroxide, sodium carbonate, potassium carbonate, sodium bicarbonate and césium carbonate; the solvent is one or more selected from the group consisting of THF, 1,4-dioxane, toluene, 1,2-dichloroethane, ethyl acetate, acetonitrile, DMF, acetone, dichloromethane and chloroform; a catalyst is optionally added during the reaction.
8. A herbicidal composition comprising (i) at least one of an R-type pyridyloxycarboxylic acid and sait, ester dérivative thereof according to any one of claims 1-6; optionally, comprising (ii) one or more further herbicides and/or safeners or (iii) agrochemically acceptable formulation auxiliaries.
9. A method for controlling a weed comprising applying a herbicidally effective amount of at least one of the R-type pyridyloxycarboxylic acid and sait, ester dérivative thereof according to any one of claims 1-6 or the herbicidal composition according to claim 8 on a plant or in a weed area.
10. Use of at least one of the R-type pyridyloxycarboxylic acid and sait, ester dérivative thereof according to any one of claims 1-6 or the herbicidal composition according to claim 8 for controlling a weed.
Abstract
The invention relates to the field of pesticide technology, and in particular to a type of R-pyridyloxycarboxylic acid and sait, ester dérivative, préparation method, herbicidal composition and application thereof. The R-pyridyloxycarboxylic acid is represented by formula
A
C
5 I,
H
O ü , wherein, A, B each independently represent halogen, alkyl or cycloalkyl with or without halogen; C represents hydrogen, halogen, alkyl, haloalkyl; Q represents halogen, cyano, cyanoalkyl and the like; Y represents nitro or NRiR2; the sait is métal sait, amine sait, sulfonium sait, phosphonium sait; the ester is
A
B Q
O 0-1 , wherein, X represents O or
S; M represents alkyl, alkenyl, alkynyl and the like with or without halogen. The compound has 10 excellent herbicidal activity and hîgher crop safety, especially good selectivity for key crops such as rice.
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CN201811613197.0 | 2018-12-27 |
Publications (1)
Publication Number | Publication Date |
---|---|
OA20640A true OA20640A (en) | 2022-12-28 |
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
EP3372595B1 (en) | Oxime group-containing condensed heterocyclic compound or salts thereof and agricultural and horticultural insecticide containing said compound, and method for using same | |
JP2019509251A (en) | Pyrazole compounds or salts thereof, methods for producing them, herbicidal compositions and uses thereof | |
AU2018430945B2 (en) | Substituted pyrimidinyl formyl oxime derivative, preparation method therefor, herbicidal composition and use thereof | |
CA3160070A1 (en) | Substituted-isoxazoline-containing aromatic compound, preparation method therefor, herbicidal composition and use thereof | |
MXPA05012987A (en) | Use of isoindolinone derivatives as insecticides. | |
WO2020204112A1 (en) | Pyridazinone compound and herbicide | |
JP2022553987A (en) | Arylformamide compound containing chiral sulfur oxide or its salt, preparation method, herbicidal composition and use thereof | |
EP3904341A1 (en) | R-type pyridyloxycarboxylic acid, salt and ester derivative thereof, and preparation method therefor, and herbicidal composition and application thereof | |
EP3508485B1 (en) | Hydrazonyl group containing-condensed heterocyclic compound or salt thereof, agricultural and horticultural insecticide comprising the compound, and method for using the insecticide | |
OA20640A (en) | R-type Pyridyloxycarboxylic acid, salt and ester derivative thereof, and preparation method therefor, and herbicidal composition and application thereof. | |
RU2791978C2 (en) | R-pyridyloxycarboxylic acid and salt, composite ester derivative, production method, herbicidal composition and their use | |
EP3892618B1 (en) | 4-pyridinyl formamide compound or derivative thereof, preparation method therefor, herbicidal composition and use thereof | |
BR112021012563A2 (en) | PYRIDYLOXY CARBOXYLIC ACID OXIMA DERIVATIVE, PREPARATION METHOD, HERBICIDAL COMPOSITION AND APPLICATION THEREOF | |
BR112021012415B1 (en) | PYRIDYLOXYCARBOXYLATE DERIVATIVE, HERBICIDAL COMPOSITION COMPRISING THE SAME, METHOD FOR PREPARING THE SAME, AS WELL AS METHOD AND USE OF SAID DERIVATIVE TO CONTROL WEED | |
TWI793831B (en) | Nitrogen-containing condensed heterocyclic compounds having an oxime group, agricultural and horticultural herbicides containing the same, and methods of using them | |
EP4132917B1 (en) | Substituted isophtalic acid diamides | |
BR112021012577B1 (en) | PYRIDYLOXY THIOESTER DERIVATIVES, METHOD OF PREPARATION OF THE PYRIDYLOXY THIOESTER DERIVATIVE, HERBICIDAL COMPOSITION, METHOD FOR CONTROLING A WEED AND USE OF AT LEAST ONE OF THE PYRIDYLOXY THIOESTER DERIVATIVES | |
BR112021012431A2 (en) | PYRIDYLOXYCARBOXYLATE DERIVATIVE, PREPARATION METHOD, HERBICIDAL COMPOSITION AND APPLICATION THEREOF | |
OA17475A (en) | 4-Amino-6-(4-substituted-phenyl)-picolinates and 6-amino-2-(4-substituted-phenyl)-pyrimidine4-carboxylates and their use as herbicides. |