OA17485A - 4-Amino-6-(heterocycIic) picolinates and 6amino-2 (heterocyclic) pyrimidine-4-carboxylates and their use as herbicides. - Google Patents
4-Amino-6-(heterocycIic) picolinates and 6amino-2 (heterocyclic) pyrimidine-4-carboxylates and their use as herbicides. Download PDFInfo
- Publication number
- OA17485A OA17485A OA1201500371 OA17485A OA 17485 A OA17485 A OA 17485A OA 1201500371 OA1201500371 OA 1201500371 OA 17485 A OA17485 A OA 17485A
- Authority
- OA
- OAPI
- Prior art keywords
- alkyl
- hydrogen
- alkenyl
- haloalkyl
- alkynyl
- Prior art date
Links
- 230000002363 herbicidal Effects 0.000 title claims abstract description 43
- SIOXPEMLGUPBBT-UHFFFAOYSA-M picolinate Chemical class [O-]C(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-M 0.000 title claims description 10
- 239000004009 herbicide Substances 0.000 title abstract description 25
- BRBUBVKGJRPRRD-UHFFFAOYSA-N 4,6-dimethylpyridin-2-amine Chemical compound CC1=CC(C)=NC(N)=C1 BRBUBVKGJRPRRD-UHFFFAOYSA-N 0.000 title description 2
- 125000000623 heterocyclic group Chemical group 0.000 title 1
- YPOXGDJGKBXRFP-UHFFFAOYSA-M pyrimidine-4-carboxylate Chemical class [O-]C(=O)C1=CC=NC=N1 YPOXGDJGKBXRFP-UHFFFAOYSA-M 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 237
- 239000000203 mixture Substances 0.000 claims abstract description 97
- 229910052739 hydrogen Inorganic materials 0.000 claims description 368
- 239000001257 hydrogen Substances 0.000 claims description 368
- 239000000460 chlorine Substances 0.000 claims description 220
- 125000004435 hydrogen atoms Chemical group [H]* 0.000 claims description 206
- 125000000262 haloalkenyl group Chemical group 0.000 claims description 177
- -1 halocyclopropyl Chemical group 0.000 claims description 169
- 125000000217 alkyl group Chemical group 0.000 claims description 162
- 229910052736 halogen Inorganic materials 0.000 claims description 158
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims description 139
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 138
- 125000003282 alkyl amino group Chemical group 0.000 claims description 136
- 150000002367 halogens Chemical group 0.000 claims description 135
- 125000004995 haloalkylthio group Chemical group 0.000 claims description 130
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims description 128
- 125000003342 alkenyl group Chemical group 0.000 claims description 119
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 117
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 113
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 claims description 113
- 125000000304 alkynyl group Chemical group 0.000 claims description 111
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 109
- 125000006677 (C1-C3) haloalkoxy group Chemical group 0.000 claims description 107
- 125000004992 haloalkylamino group Chemical group 0.000 claims description 104
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 90
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 88
- 125000001188 haloalkyl group Chemical group 0.000 claims description 88
- 125000004692 haloalkylcarbonyl group Chemical group 0.000 claims description 86
- 125000004455 (C1-C3) alkylthio group Chemical group 0.000 claims description 85
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 85
- 125000004414 alkyl thio group Chemical group 0.000 claims description 56
- 229910052731 fluorine Inorganic materials 0.000 claims description 56
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 55
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 53
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 53
- 125000004665 trialkylsilyl group Chemical group 0.000 claims description 52
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 50
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 50
- 125000003545 alkoxy group Chemical group 0.000 claims description 48
- 229910052801 chlorine Inorganic materials 0.000 claims description 42
- UFHFLCQGNIYNRP-UHFFFAOYSA-N hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 42
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 39
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 30
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 27
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 claims description 26
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 25
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 24
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims description 22
- 150000001204 N-oxides Chemical class 0.000 claims description 21
- 125000000027 (C1-C10) alkoxy group Chemical group 0.000 claims description 18
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 17
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 16
- 125000006017 1-propenyl group Chemical group 0.000 claims description 14
- 239000000969 carrier Substances 0.000 claims description 12
- 229910019567 Re Re Inorganic materials 0.000 claims description 8
- 239000002671 adjuvant Substances 0.000 claims description 8
- 230000000240 adjuvant Effects 0.000 claims description 8
- 239000002689 soil Substances 0.000 claims description 8
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims description 7
- 125000006559 (C1-C3) alkylamino group Chemical group 0.000 claims description 7
- 230000001276 controlling effect Effects 0.000 claims description 7
- SIOXPEMLGUPBBT-UHFFFAOYSA-N Picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 claims description 5
- 229940081066 picolinic acid Drugs 0.000 claims description 5
- 125000006416 CBr Chemical group BrC* 0.000 claims description 4
- 125000006317 cyclopropyl amino group Chemical group 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 121
- 239000000575 pesticide Substances 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Natural products CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 184
- 239000007787 solid Substances 0.000 description 141
- 230000001808 coupling Effects 0.000 description 89
- 238000010168 coupling process Methods 0.000 description 89
- 238000005859 coupling reaction Methods 0.000 description 89
- 235000019439 ethyl acetate Nutrition 0.000 description 64
- 238000006243 chemical reaction Methods 0.000 description 48
- 238000006460 hydrolysis reaction Methods 0.000 description 44
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 44
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 40
- 241000196324 Embryophyta Species 0.000 description 36
- OZAIFHULBGXAKX-UHFFFAOYSA-N precursor Substances N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 32
- 239000000243 solution Substances 0.000 description 32
- YNHIGQDRGKUECZ-UHFFFAOYSA-L Bis(triphenylphosphine)palladium(II) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 30
- 239000008079 hexane Substances 0.000 description 30
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 30
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 29
- 239000011541 reaction mixture Substances 0.000 description 28
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 27
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- 125000005843 halogen group Chemical group 0.000 description 27
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 27
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical class CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 24
- 239000003112 inhibitor Substances 0.000 description 23
- 230000002401 inhibitory effect Effects 0.000 description 23
- 238000000746 purification Methods 0.000 description 22
- 238000003818 flash chromatography Methods 0.000 description 21
- 238000004293 19F NMR spectroscopy Methods 0.000 description 20
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 20
- 239000003921 oil Substances 0.000 description 19
- 235000019198 oils Nutrition 0.000 description 19
- 239000012074 organic phase Substances 0.000 description 18
- 239000002904 solvent Substances 0.000 description 17
- NROKBHXJSPEDAR-UHFFFAOYSA-M Potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 16
- 150000002148 esters Chemical class 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N methylene dichloride Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 16
- 239000000843 powder Substances 0.000 description 16
- 125000005605 benzo group Chemical group 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 15
- SIKJAQJRHWYJAI-UHFFFAOYSA-N indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 15
- 229910052681 coesite Inorganic materials 0.000 description 14
- 229910052906 cristobalite Inorganic materials 0.000 description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 229910052904 quartz Inorganic materials 0.000 description 14
- 229910052682 stishovite Inorganic materials 0.000 description 14
- 229910052905 tridymite Inorganic materials 0.000 description 14
- LZPWAYBEOJRFAX-UHFFFAOYSA-N 4,4,5,5-tetramethyl-1,3,2$l^{2}-dioxaborolane Chemical group CC1(C)O[B]OC1(C)C LZPWAYBEOJRFAX-UHFFFAOYSA-N 0.000 description 13
- 239000002253 acid Substances 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 230000000007 visual effect Effects 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 11
- KFZMGEQAYNKOFK-UHFFFAOYSA-N iso-propanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 11
- 239000003586 protic polar solvent Substances 0.000 description 11
- 239000000377 silicon dioxide Substances 0.000 description 11
- 239000011780 sodium chloride Substances 0.000 description 11
- 229910052938 sodium sulfate Inorganic materials 0.000 description 11
- YTPLMLYBLZKORZ-UHFFFAOYSA-N thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 11
- 239000011698 potassium fluoride Substances 0.000 description 10
- SCVFZCLFOSHCOH-UHFFFAOYSA-M Potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 9
- 210000000538 Tail Anatomy 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 239000004094 surface-active agent Substances 0.000 description 9
- NCWDBNBNYVVARF-UHFFFAOYSA-N 1,3,2-dioxaborolane Chemical compound B1OCCO1 NCWDBNBNYVVARF-UHFFFAOYSA-N 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- 235000007320 Avena fatua Nutrition 0.000 description 8
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 8
- KRHYYFGTRYWZRS-UHFFFAOYSA-M fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 239000012044 organic layer Substances 0.000 description 8
- 235000003270 potassium fluoride Nutrition 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 235000015112 vegetable and seed oil Nutrition 0.000 description 8
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 7
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- 235000020127 ayran Nutrition 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 238000002451 electron ionisation mass spectrometry Methods 0.000 description 7
- 239000003480 eluent Substances 0.000 description 7
- 125000004438 haloalkoxy group Chemical group 0.000 description 7
- 239000011630 iodine Substances 0.000 description 7
- 229910052740 iodine Inorganic materials 0.000 description 7
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- UBOUJNVKCFPWEB-UHFFFAOYSA-N 2,4-dichloro-6-ethenyl-5-methoxypyrimidine Chemical compound COC1=C(Cl)N=C(Cl)N=C1C=C UBOUJNVKCFPWEB-UHFFFAOYSA-N 0.000 description 6
- 241000209764 Avena fatua Species 0.000 description 6
- 235000005918 Cirsium arvense Nutrition 0.000 description 6
- 240000001579 Cirsium arvense Species 0.000 description 6
- 240000006669 Helianthus annuus Species 0.000 description 6
- 235000003222 Helianthus annuus Nutrition 0.000 description 6
- 239000007832 Na2SO4 Substances 0.000 description 6
- ZADPBFCGQRWHPN-UHFFFAOYSA-N OBO Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 6
- 238000007792 addition Methods 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 125000004432 carbon atoms Chemical group C* 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 239000003999 initiator Substances 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- SHXCUQHMQIBOAR-UHFFFAOYSA-N 1,2,3$l^{2}-dioxaborolane Chemical compound [B]1CCOO1 SHXCUQHMQIBOAR-UHFFFAOYSA-N 0.000 description 5
- OFOSNAUBFUBOPC-UHFFFAOYSA-N 2,6-dichloro-5-methoxypyrimidine-4-carbaldehyde Chemical compound COC1=C(Cl)N=C(Cl)N=C1C=O OFOSNAUBFUBOPC-UHFFFAOYSA-N 0.000 description 5
- 102000000452 Acetyl-CoA Carboxylase Human genes 0.000 description 5
- 108010016219 Acetyl-CoA Carboxylase Proteins 0.000 description 5
- IPWKHHSGDUIRAH-UHFFFAOYSA-N Bis(pinacolato)diboron Chemical compound O1C(C)(C)C(C)(C)OB1B1OC(C)(C)C(C)(C)O1 IPWKHHSGDUIRAH-UHFFFAOYSA-N 0.000 description 5
- 108010068327 EC 1.13.11.27 Proteins 0.000 description 5
- 102000005135 EC 1.3.3.4 Human genes 0.000 description 5
- 108020001991 EC 1.3.3.4 Proteins 0.000 description 5
- 108010000700 EC 2.2.1.6 Proteins 0.000 description 5
- 102100017125 HPD Human genes 0.000 description 5
- 235000015225 Panicum colonum Nutrition 0.000 description 5
- 238000006619 Stille reaction Methods 0.000 description 5
- 238000006069 Suzuki reaction reaction Methods 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- WPKWCOJJOVQDPB-UHFFFAOYSA-N methyl 2,6-dichloro-5-methoxypyrimidine-4-carboxylate Chemical compound COC(=O)C1=NC(Cl)=NC(Cl)=C1OC WPKWCOJJOVQDPB-UHFFFAOYSA-N 0.000 description 5
- KIKNEFFJHGIUKZ-UHFFFAOYSA-N methyl 4-amino-3,6-dichloro-5-fluoropyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(F)C(N)=C1Cl KIKNEFFJHGIUKZ-UHFFFAOYSA-N 0.000 description 5
- 150000004702 methyl esters Chemical class 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L na2so4 Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 5
- 241000894007 species Species 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 4
- SSYOZIMXPFXBKE-UHFFFAOYSA-N 5-bromo-4-fluoro-1-benzofuran Chemical compound FC1=C(Br)C=CC2=C1C=CO2 SSYOZIMXPFXBKE-UHFFFAOYSA-N 0.000 description 4
- BHLGVJAMAUEQIY-UHFFFAOYSA-N 5-bromo-6-fluoro-1-benzofuran Chemical compound C1=C(Br)C(F)=CC2=C1C=CO2 BHLGVJAMAUEQIY-UHFFFAOYSA-N 0.000 description 4
- 240000006995 Abutilon theophrasti Species 0.000 description 4
- 241001621841 Alopecurus myosuroides Species 0.000 description 4
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 4
- 240000006249 Ambrosia artemisiifolia Species 0.000 description 4
- 244000024671 Brassica kaber Species 0.000 description 4
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 4
- 101700067048 CDC13 Proteins 0.000 description 4
- 240000006122 Chenopodium album Species 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N Chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- LSXDOTMGLUJQCM-UHFFFAOYSA-M Copper(I) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 4
- 240000003688 Cyperus esculentus Species 0.000 description 4
- 240000000628 Cyperus rotundus Species 0.000 description 4
- 240000003424 Digitaria sanguinalis Species 0.000 description 4
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 4
- 240000002436 Echinochloa crus-galli Species 0.000 description 4
- 235000003127 Lactuca serriola Nutrition 0.000 description 4
- 240000006137 Lactuca serriola Species 0.000 description 4
- RYOVMJCNDAAHAM-UHFFFAOYSA-M NC1=CC(C([O-])=O)=NC(Cl)=C1F Chemical compound NC1=CC(C([O-])=O)=NC(Cl)=C1F RYOVMJCNDAAHAM-UHFFFAOYSA-M 0.000 description 4
- 241000209094 Oryza Species 0.000 description 4
- 235000007164 Oryza sativa Nutrition 0.000 description 4
- 244000236458 Panicum colonum Species 0.000 description 4
- 241001148659 Panicum dichotomiflorum Species 0.000 description 4
- 241001355178 Setaria faberi Species 0.000 description 4
- 235000017016 Setaria faberi Nutrition 0.000 description 4
- 240000003461 Setaria viridis Species 0.000 description 4
- 235000005773 Setaria viridis Nutrition 0.000 description 4
- 240000006410 Sida spinosa Species 0.000 description 4
- FPKOPBFLPLFWAD-UHFFFAOYSA-N Trinitrotoluene Chemical compound CC1=CC=C([N+]([O-])=O)C([N+]([O-])=O)=C1[N+]([O-])=O FPKOPBFLPLFWAD-UHFFFAOYSA-N 0.000 description 4
- 241001141210 Urochloa platyphylla Species 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M buffer Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- 229910052570 clay Inorganic materials 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 230000000875 corresponding Effects 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000003337 fertilizer Substances 0.000 description 4
- 235000013312 flour Nutrition 0.000 description 4
- 150000002430 hydrocarbons Chemical group 0.000 description 4
- 230000002083 iodinating Effects 0.000 description 4
- 230000002829 reduced Effects 0.000 description 4
- 235000009566 rice Nutrition 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- KXCAEQNNTZANTK-UHFFFAOYSA-N stannane Chemical compound [SnH4] KXCAEQNNTZANTK-UHFFFAOYSA-N 0.000 description 4
- 229910000080 stannane Inorganic materials 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 230000002194 synthesizing Effects 0.000 description 4
- UHJBPAQSOYXUMZ-UHFFFAOYSA-N 1-bromo-4-(2,2-diethoxyethylsulfanyl)-2-fluorobenzene Chemical compound CCOC(OCC)CSC1=CC=C(Br)C(F)=C1 UHJBPAQSOYXUMZ-UHFFFAOYSA-N 0.000 description 3
- ZTHHRSBDBPCCMZ-UHFFFAOYSA-N 2,4-dichloro-5-methoxypyrimidine Chemical compound COC1=CN=C(Cl)N=C1Cl ZTHHRSBDBPCCMZ-UHFFFAOYSA-N 0.000 description 3
- YFKGZOJEQUDHAD-UHFFFAOYSA-N 4-bromo-1-benzofuran Chemical compound BrC1=CC=CC2=C1C=CO2 YFKGZOJEQUDHAD-UHFFFAOYSA-N 0.000 description 3
- QNZKCAHQZRFCHA-UHFFFAOYSA-N 4-bromo-7-chloro-1-benzofuran Chemical compound ClC1=CC=C(Br)C2=C1OC=C2 QNZKCAHQZRFCHA-UHFFFAOYSA-N 0.000 description 3
- BBXQYOQXGGJUFK-UHFFFAOYSA-N 6-bromo-1-benzofuran Chemical compound BrC1=CC=C2C=COC2=C1 BBXQYOQXGGJUFK-UHFFFAOYSA-N 0.000 description 3
- CYQRQBZIFMXUGJ-UHFFFAOYSA-N 6-bromo-5-fluoro-1-benzofuran Chemical compound C1=C(Br)C(F)=CC2=C1OC=C2 CYQRQBZIFMXUGJ-UHFFFAOYSA-N 0.000 description 3
- FRFKOGIDFNTSBY-UHFFFAOYSA-N 7-bromo-4-chloro-1-benzofuran Chemical compound ClC1=CC=C(Br)C2=C1C=CO2 FRFKOGIDFNTSBY-UHFFFAOYSA-N 0.000 description 3
- 244000075850 Avena orientalis Species 0.000 description 3
- 235000007319 Avena orientalis Nutrition 0.000 description 3
- QHTQREMOGMZHJV-UHFFFAOYSA-N Benthiocarb Chemical compound CCN(CC)C(=O)SCC1=CC=C(Cl)C=C1 QHTQREMOGMZHJV-UHFFFAOYSA-N 0.000 description 3
- 235000009344 Chenopodium album Nutrition 0.000 description 3
- 239000005562 Glyphosate Substances 0.000 description 3
- 240000006022 Lolium multiflorum Species 0.000 description 3
- CWFUTCVVDBOKPS-UHFFFAOYSA-M NC1=C(F)C(Cl)=NC(C([O-])=O)=C1I Chemical compound NC1=C(F)C(Cl)=NC(C([O-])=O)=C1I CWFUTCVVDBOKPS-UHFFFAOYSA-M 0.000 description 3
- 240000006394 Sorghum bicolor Species 0.000 description 3
- VXKWYPOMXBVZSJ-UHFFFAOYSA-N Tetramethyltin Chemical compound C[Sn](C)(C)C VXKWYPOMXBVZSJ-UHFFFAOYSA-N 0.000 description 3
- 241001148683 Zostera marina Species 0.000 description 3
- 239000000010 aprotic solvent Substances 0.000 description 3
- 239000002363 auxin Substances 0.000 description 3
- 150000001642 boronic acid derivatives Chemical class 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 239000001752 chlorophylls and chlorophyllins Substances 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 235000012343 cottonseed oil Nutrition 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- CVYZJUXLXNJDEU-UHFFFAOYSA-N methyl 4-amino-6-bromo-3-chloro-5-fluoropyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Br)=C(F)C(N)=C1Cl CVYZJUXLXNJDEU-UHFFFAOYSA-N 0.000 description 3
- VHXVXHHVPQJMFM-UHFFFAOYSA-N methyl 6-amino-2-chloro-5-methoxypyrimidine-4-carboxylate Chemical compound COC(=O)C1=NC(Cl)=NC(N)=C1OC VHXVXHHVPQJMFM-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 229920000137 polyphosphoric acid Polymers 0.000 description 3
- 235000011056 potassium acetate Nutrition 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- QIWRFOJWQSSRJZ-UHFFFAOYSA-N tributyl(ethenyl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C=C QIWRFOJWQSSRJZ-UHFFFAOYSA-N 0.000 description 3
- 125000000025 triisopropylsilyl group Chemical group C(C)(C)[Si](C(C)C)(C(C)C)* 0.000 description 3
- 239000008158 vegetable oil Substances 0.000 description 3
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 2
- 239000005631 2,4-D Substances 0.000 description 2
- KUXGUCNZFCVULO-UHFFFAOYSA-N 2-(4-nonylphenoxy)ethanol Chemical compound CCCCCCCCCC1=CC=C(OCCO)C=C1 KUXGUCNZFCVULO-UHFFFAOYSA-N 0.000 description 2
- LIXKPOLDKKJLFD-UHFFFAOYSA-N 2-bromo-4-(2,2-diethoxyethoxy)-1-fluorobenzene Chemical compound CCOC(OCC)COC1=CC=C(F)C(Br)=C1 LIXKPOLDKKJLFD-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- KGGKVJFSHSMYRB-UHFFFAOYSA-N 2-ethynyl-4,6-difluoroaniline Chemical compound NC1=C(F)C=C(F)C=C1C#C KGGKVJFSHSMYRB-UHFFFAOYSA-N 0.000 description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- QUTYKIXIUDQOLK-PRJMDXOYSA-J 5-O-(1-carboxylatovinyl)-3-phosphonatoshikimate Chemical compound O[C@H]1[C@H](OC(=C)C([O-])=O)CC(C([O-])=O)=C[C@H]1OP([O-])([O-])=O QUTYKIXIUDQOLK-PRJMDXOYSA-J 0.000 description 2
- DDNFNBKKCMLAML-UHFFFAOYSA-N 6-bromo-7-fluoro-1-benzofuran Chemical compound FC1=C(Br)C=CC2=C1OC=C2 DDNFNBKKCMLAML-UHFFFAOYSA-N 0.000 description 2
- GXEKYRXVRROBEV-UHFFFAOYSA-N 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid Chemical compound C1CC2C(C(O)=O)C(C(=O)O)C1O2 GXEKYRXVRROBEV-UHFFFAOYSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N Acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 240000004615 Alisma plantago-aquatica Species 0.000 description 2
- 240000002216 Alternanthera philoxeroides Species 0.000 description 2
- 241000219318 Amaranthus Species 0.000 description 2
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 2
- 240000001592 Amaranthus caudatus Species 0.000 description 2
- 240000008812 Amaranthus retroflexus Species 0.000 description 2
- 235000004135 Amaranthus viridis Nutrition 0.000 description 2
- 235000003133 Ambrosia artemisiifolia Nutrition 0.000 description 2
- 235000003129 Ambrosia artemisiifolia var elatior Nutrition 0.000 description 2
- 241001149224 Ambrosia psilostachya Species 0.000 description 2
- 241000208841 Ambrosia trifida Species 0.000 description 2
- 241000309554 Ammannia coccinea Species 0.000 description 2
- 241001666376 Apera spica-venti Species 0.000 description 2
- 235000002470 Asclepias syriaca Nutrition 0.000 description 2
- 240000002595 Asclepias syriaca Species 0.000 description 2
- 235000004535 Avena sterilis Nutrition 0.000 description 2
- 241001645380 Bassia scoparia Species 0.000 description 2
- 240000007202 Bolboschoenus maritimus Species 0.000 description 2
- 235000014750 Brassica kaber Nutrition 0.000 description 2
- 235000006008 Brassica napus var napus Nutrition 0.000 description 2
- 235000011292 Brassica rapa Nutrition 0.000 description 2
- 235000006618 Brassica rapa subsp oleifera Nutrition 0.000 description 2
- 244000188595 Brassica sinapistrum Species 0.000 description 2
- 235000011304 Brassica sp Nutrition 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N Bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 239000005489 Bromoxynil Substances 0.000 description 2
- UPMXNNIRAGDFEH-UHFFFAOYSA-N Bromoxynil Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 2
- 241001148727 Bromus tectorum Species 0.000 description 2
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 2
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate dianion Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- 244000277285 Cassia obtusifolia Species 0.000 description 2
- 235000006719 Cassia obtusifolia Nutrition 0.000 description 2
- 241001247876 Centaurea stoebe Species 0.000 description 2
- 235000011498 Chenopodium album var missouriense Nutrition 0.000 description 2
- 235000005484 Chenopodium berlandieri Nutrition 0.000 description 2
- 235000009332 Chenopodium rubrum Nutrition 0.000 description 2
- 241001478752 Commelina benghalensis Species 0.000 description 2
- 240000006782 Conyza bonariensis Species 0.000 description 2
- 235000004385 Conyza canadensis Nutrition 0.000 description 2
- 244000074881 Conyza canadensis Species 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- 240000001021 Cyperus difformis Species 0.000 description 2
- 235000005853 Cyperus esculentus Nutrition 0.000 description 2
- 240000007079 Cyperus iria Species 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N DMSO-d6 Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- NNYRZQHKCHEXSD-UHFFFAOYSA-N Daimuron Chemical compound C1=CC(C)=CC=C1NC(=O)NC(C)(C)C1=CC=CC=C1 NNYRZQHKCHEXSD-UHFFFAOYSA-N 0.000 description 2
- 240000008853 Datura stramonium Species 0.000 description 2
- 240000002860 Daucus carota Species 0.000 description 2
- 239000005504 Dicamba Substances 0.000 description 2
- IWEDIXLBFLAXBO-UHFFFAOYSA-N Dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 2
- LBGPXIPGGRQBJW-UHFFFAOYSA-N Difenzoquat Chemical compound C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 LBGPXIPGGRQBJW-UHFFFAOYSA-N 0.000 description 2
- 229920005682 EO-PO block copolymer Polymers 0.000 description 2
- 240000002358 Echinochloa oryzoides Species 0.000 description 2
- 240000003594 Eclipta prostrata Species 0.000 description 2
- 241000221085 Euphorbia esula Species 0.000 description 2
- 240000003276 Euphorbia heterophylla Species 0.000 description 2
- 241001289540 Fallopia convolvulus Species 0.000 description 2
- KTWOOEGAPBSYNW-UHFFFAOYSA-N Ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 description 2
- 235000014820 Galium aparine Nutrition 0.000 description 2
- 240000005702 Galium aparine Species 0.000 description 2
- 239000005561 Glufosinate Substances 0.000 description 2
- IAJOBQBIJHVGMQ-UHFFFAOYSA-N Glufosinate Chemical compound CP(O)(=O)CCC(N)C(O)=O IAJOBQBIJHVGMQ-UHFFFAOYSA-N 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 240000007842 Glycine max Species 0.000 description 2
- XDDAORKBJWWYJS-UHFFFAOYSA-O Glyphosate Chemical compound OC(=O)C[NH2+]CP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-O 0.000 description 2
- 240000006962 Gossypium hirsutum Species 0.000 description 2
- 241000169130 Heteranthera limosa Species 0.000 description 2
- RAXXELZNTBOGNW-UHFFFAOYSA-N Imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 2
- 241000207783 Ipomoea Species 0.000 description 2
- 240000007218 Ipomoea hederacea Species 0.000 description 2
- 240000006695 Ischaemum rugosum Species 0.000 description 2
- SKRDXYBATCVEMS-UHFFFAOYSA-N Isopropyl nitrite Chemical compound CC(C)ON=O SKRDXYBATCVEMS-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 240000006503 Lamium purpureum Species 0.000 description 2
- 244000143149 Leptochloa chinensis Species 0.000 description 2
- 235000003403 Limnocharis flava Nutrition 0.000 description 2
- 240000006940 Matricaria matricarioides Species 0.000 description 2
- 235000004589 Matricaria matricarioides Nutrition 0.000 description 2
- 240000005824 Monochoria hastata Species 0.000 description 2
- 235000003990 Monochoria hastata Nutrition 0.000 description 2
- 240000007383 Murdannia nudiflora Species 0.000 description 2
- QRQIQKCMPCEYLV-UHFFFAOYSA-M NC1=CC(C([O-])=O)=NC(Cl)=C1I Chemical class NC1=CC(C([O-])=O)=NC(Cl)=C1I QRQIQKCMPCEYLV-UHFFFAOYSA-M 0.000 description 2
- NDIKZEVBVMRKMC-UHFFFAOYSA-M NC1=CC(C([O-])=O)=NC(F)=C1F Chemical compound NC1=CC(C([O-])=O)=NC(F)=C1F NDIKZEVBVMRKMC-UHFFFAOYSA-M 0.000 description 2
- SSSUQLVGYOIGIX-UHFFFAOYSA-M NC1=CC(Cl)=NC(C([O-])=O)=C1 Chemical class NC1=CC(Cl)=NC(C([O-])=O)=C1 SSSUQLVGYOIGIX-UHFFFAOYSA-M 0.000 description 2
- GRSMWKLPSNHDHA-UHFFFAOYSA-N Naphthalic anhydride Chemical compound C1=CC(C(=O)OC2=O)=C3C2=CC=CC3=C1 GRSMWKLPSNHDHA-UHFFFAOYSA-N 0.000 description 2
- FBUKVWPVBMHYJY-UHFFFAOYSA-N Nonanoic acid Chemical compound CCCCCCCCC(O)=O FBUKVWPVBMHYJY-UHFFFAOYSA-N 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L Palladium(II) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- 235000019482 Palm oil Nutrition 0.000 description 2
- 240000008114 Panicum miliaceum Species 0.000 description 2
- 235000007846 Papaver rhoeas Nutrition 0.000 description 2
- 240000004674 Papaver rhoeas Species 0.000 description 2
- 241001268782 Paspalum dilatatum Species 0.000 description 2
- 235000019483 Peanut oil Nutrition 0.000 description 2
- 241000270713 Persicaria hydropiperoides Species 0.000 description 2
- 241000978467 Persicaria pensylvanica Species 0.000 description 2
- 241000257649 Phalaris minor Species 0.000 description 2
- 240000003443 Poa annua Species 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 235000004442 Polygonum persicaria Nutrition 0.000 description 2
- 235000001855 Portulaca oleracea Nutrition 0.000 description 2
- 240000001474 Portulaca oleracea Species 0.000 description 2
- 102000014961 Protein Precursors Human genes 0.000 description 2
- 108010078762 Protein Precursors Proteins 0.000 description 2
- FFSSWMQPCJRCRV-UHFFFAOYSA-N Quinclorac Chemical compound ClC1=CN=C2C(C(=O)O)=C(Cl)C=CC2=C1 FFSSWMQPCJRCRV-UHFFFAOYSA-N 0.000 description 2
- 235000019484 Rapeseed oil Nutrition 0.000 description 2
- 240000003986 Rotala indica Species 0.000 description 2
- 235000009422 Rumex obtusifolius Nutrition 0.000 description 2
- 240000007113 Rumex obtusifolius Species 0.000 description 2
- 235000019485 Safflower oil Nutrition 0.000 description 2
- 240000001744 Salsola kali Species 0.000 description 2
- 235000007658 Salsola kali Nutrition 0.000 description 2
- 244000138462 Schoenoplectus mucronatus Species 0.000 description 2
- 241000644362 Sesbania herbacea Species 0.000 description 2
- 235000005775 Setaria Nutrition 0.000 description 2
- 241000232088 Setaria <nematode> Species 0.000 description 2
- 240000008653 Setaria pumila Species 0.000 description 2
- 235000002974 Sisymbrium officinale Nutrition 0.000 description 2
- 240000002307 Solanum ptychanthum Species 0.000 description 2
- 235000000341 Solanum ptychanthum Nutrition 0.000 description 2
- 240000008217 Sonchus arvensis Species 0.000 description 2
- 240000002439 Sorghum halepense Species 0.000 description 2
- 235000017967 Sphenoclea zeylanica Nutrition 0.000 description 2
- 240000002444 Sphenoclea zeylanica Species 0.000 description 2
- 240000006694 Stellaria media Species 0.000 description 2
- 235000014050 Stevens lambsquarters Nutrition 0.000 description 2
- 240000001949 Taraxacum officinale Species 0.000 description 2
- 240000008214 Trifolium repens Species 0.000 description 2
- CWMFRHBXRUITQE-UHFFFAOYSA-N Trimethylsilylacetylene Chemical compound C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 2
- 240000008529 Triticum aestivum Species 0.000 description 2
- 235000009108 Urtica dioica Nutrition 0.000 description 2
- 240000004767 Urtica dioica Species 0.000 description 2
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 2
- 241000990144 Veronica persica Species 0.000 description 2
- 241000394440 Viola arvensis Species 0.000 description 2
- 240000002608 Viola tricolor Species 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 2
- 235000012735 amaranth Nutrition 0.000 description 2
- 235000003484 annual ragweed Nutrition 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 240000000314 bearded sprangletop Species 0.000 description 2
- 230000037348 biosynthesis Effects 0.000 description 2
- 235000008984 brauner Senf Nutrition 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000004359 castor oil Substances 0.000 description 2
- 235000019438 castor oil Nutrition 0.000 description 2
- 230000003197 catalytic Effects 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- KQIADDMXRMTWHZ-UHFFFAOYSA-N chloro-tri(propan-2-yl)silane Chemical compound CC(C)[Si](Cl)(C(C)C)C(C)C KQIADDMXRMTWHZ-UHFFFAOYSA-N 0.000 description 2
- 235000011107 chufa flatsedge Nutrition 0.000 description 2
- 235000011110 chufa flatsedge Nutrition 0.000 description 2
- 235000011120 chufa flatsedge Nutrition 0.000 description 2
- 239000003240 coconut oil Substances 0.000 description 2
- 235000019864 coconut oil Nutrition 0.000 description 2
- 235000003488 common ragweed Nutrition 0.000 description 2
- 235000005687 corn oil Nutrition 0.000 description 2
- 239000002285 corn oil Substances 0.000 description 2
- 239000002385 cottonseed oil Substances 0.000 description 2
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 2
- 235000009242 dandelion Nutrition 0.000 description 2
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- BWUPSGJXXPATLU-UHFFFAOYSA-N dimepiperate Chemical compound C=1C=CC=CC=1C(C)(C)SC(=O)N1CCCCC1 BWUPSGJXXPATLU-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- PQKBPHSEKWERTG-LLVKDONJSA-N ethyl (2R)-2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]propanoate Chemical group C1=CC(O[C@H](C)C(=O)OCC)=CC=C1OC1=NC2=CC=C(Cl)C=C2O1 PQKBPHSEKWERTG-LLVKDONJSA-N 0.000 description 2
- MWKVXOJATACCCH-UHFFFAOYSA-N ethyl 5,5-diphenyl-4H-1,2-oxazole-3-carboxylate Chemical group C1C(C(=O)OCC)=NOC1(C=1C=CC=CC=1)C1=CC=CC=C1 MWKVXOJATACCCH-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000011491 glass wool Substances 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 229940097068 glyphosate Drugs 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 235000002248 green bristle grass Nutrition 0.000 description 2
- 235000010086 green foxtail Nutrition 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxyl anion Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000003973 irrigation Methods 0.000 description 2
- 230000002262 irrigation Effects 0.000 description 2
- 235000013012 lambsquarters Nutrition 0.000 description 2
- 235000013328 lambsquarters Nutrition 0.000 description 2
- 239000000944 linseed oil Substances 0.000 description 2
- 235000021388 linseed oil Nutrition 0.000 description 2
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 2
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium;hydroxide;hydrate Chemical compound [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 2
- CSKIJJZFXAACON-UHFFFAOYSA-N methyl 4-acetamido-3,6-dichloropyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=CC(NC(C)=O)=C1Cl CSKIJJZFXAACON-UHFFFAOYSA-N 0.000 description 2
- RJQUHEYNLDNJLN-UHFFFAOYSA-N methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(Cl)C(N)=C1Cl RJQUHEYNLDNJLN-UHFFFAOYSA-N 0.000 description 2
- HNVKGYSSRCIGCA-UHFFFAOYSA-N methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(I)C(N)=C1Cl HNVKGYSSRCIGCA-UHFFFAOYSA-N 0.000 description 2
- FRMBCYILCYTPHY-UHFFFAOYSA-N methyl 4-amino-3,6-dichloropyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=CC(N)=C1Cl FRMBCYILCYTPHY-UHFFFAOYSA-N 0.000 description 2
- KQCXXSKPUFSCJR-UHFFFAOYSA-N methyl 4-amino-6-chloro-3-ethenyl-5-fluoropyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(F)C(N)=C1C=C KQCXXSKPUFSCJR-UHFFFAOYSA-N 0.000 description 2
- QMMFVYPAHWMCMS-UHFFFAOYSA-N methyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 229920000847 nonoxynol Polymers 0.000 description 2
- 235000015097 nutrients Nutrition 0.000 description 2
- 239000004006 olive oil Substances 0.000 description 2
- 235000008390 olive oil Nutrition 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- CBENFWSGALASAD-UHFFFAOYSA-N ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 2
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 2
- 239000002540 palm oil Substances 0.000 description 2
- 239000000312 peanut oil Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 108010001545 phytoene dehydrogenase Proteins 0.000 description 2
- 230000000885 phytotoxic Effects 0.000 description 2
- 231100000208 phytotoxic Toxicity 0.000 description 2
- 230000005080 plant death Effects 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- YRGNDQQIUXCCAI-UHFFFAOYSA-N propan-2-yl 4,5,6-trifluoropyridine-2-carboxylate Chemical compound CC(C)OC(=O)C1=CC(F)=C(F)C(F)=N1 YRGNDQQIUXCCAI-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 2
- 125000005554 pyridyloxy group Chemical group 0.000 description 2
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 2
- 235000005713 safflower oil Nutrition 0.000 description 2
- 239000003813 safflower oil Substances 0.000 description 2
- 239000008159 sesame oil Substances 0.000 description 2
- 235000011803 sesame oil Nutrition 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- 229940001607 sodium bisulfite Drugs 0.000 description 2
- 239000001187 sodium carbonate Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 235000012424 soybean oil Nutrition 0.000 description 2
- 239000003549 soybean oil Substances 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- 235000020238 sunflower seed Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- UQCWXKSHRQJGPH-UHFFFAOYSA-M tetrabutylazanium;fluoride;hydrate Chemical compound O.[F-].CCCC[N+](CCCC)(CCCC)CCCC UQCWXKSHRQJGPH-UHFFFAOYSA-M 0.000 description 2
- 239000002383 tung oil Substances 0.000 description 2
- 150000004669 very long chain fatty acids Chemical class 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- 235000021307 wheat Nutrition 0.000 description 2
- 235000014052 white goosefoot Nutrition 0.000 description 2
- 235000011295 yellow nutgrass Nutrition 0.000 description 2
- AIAYSXFWIUNXRC-PHIMTYICSA-N (1R,5S)-3-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)pyridin-3-yl]methylidene]bicyclo[3.2.1]octane-2,4-dione Chemical compound COCCOCC1=NC(C(F)(F)F)=CC=C1C(O)=C1C(=O)[C@@H](C2)CC[C@@H]2C1=O AIAYSXFWIUNXRC-PHIMTYICSA-N 0.000 description 1
- ZBCPHFKSIUPISV-UHFFFAOYSA-N (2,6-dibromo-4-cyanophenyl) oxolan-2-ylmethyl carbonate Chemical compound BrC1=CC(C#N)=CC(Br)=C1OC(=O)OCC1OCCC1 ZBCPHFKSIUPISV-UHFFFAOYSA-N 0.000 description 1
- HEJVROKEIMJTIN-UHFFFAOYSA-N (2-butan-2-yl-4,6-dinitrophenyl) (2,4-dinitrophenyl) carbonate Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O HEJVROKEIMJTIN-UHFFFAOYSA-N 0.000 description 1
- QWZIGUJYMLBQCY-UHFFFAOYSA-N (2-chloro-3,5-diiodopyridin-4-yl) acetate Chemical compound CC(=O)OC1=C(I)C=NC(Cl)=C1I QWZIGUJYMLBQCY-UHFFFAOYSA-N 0.000 description 1
- JEDYYFXHPAIBGR-UHFFFAOYSA-N (2-methyl-1-oxo-1-prop-2-enoxypropan-2-yl) 2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate Chemical compound O=C1N(C)C(C(F)(F)F)=CC(=O)N1C1=CC=C(Cl)C(C(=O)OC(C)(C)C(=O)OCC=C)=C1 JEDYYFXHPAIBGR-UHFFFAOYSA-N 0.000 description 1
- ADDQHLREJDZPMT-CQSZACIVSA-N (2R)-2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]-N-(2-fluorophenyl)-N-methylpropanamide Chemical compound O=C([C@H](OC=1C=CC(OC=2OC3=CC(Cl)=CC=C3N=2)=CC=1)C)N(C)C1=CC=CC=C1F ADDQHLREJDZPMT-CQSZACIVSA-N 0.000 description 1
- FIWSRSRCWYARAJ-SQOFCNSWSA-N (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;(Z)-octadec-9-enoic acid Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CCCCCCCC\C=C/CCCCCCCC(O)=O FIWSRSRCWYARAJ-SQOFCNSWSA-N 0.000 description 1
- NYHLMHAKWBUZDY-QMMMGPOBSA-N (2S)-2-[2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoyl]oxypropanoic acid Chemical compound C1=C(Cl)C(C(=O)O[C@@H](C)C(O)=O)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 NYHLMHAKWBUZDY-QMMMGPOBSA-N 0.000 description 1
- LNGRZPZKVUBWQV-UHFFFAOYSA-N (4-chloro-2-methylsulfonylphenyl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CS(=O)(=O)C1=CC(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 LNGRZPZKVUBWQV-UHFFFAOYSA-N 0.000 description 1
- GGQDJKYTNRIKQS-UHFFFAOYSA-N (4-cyano-2,6-diiodophenyl) prop-2-enyl carbonate Chemical compound IC1=CC(C#N)=CC(I)=C1OC(=O)OCC=C GGQDJKYTNRIKQS-UHFFFAOYSA-N 0.000 description 1
- RXGWQJFJQKQKPH-UHFFFAOYSA-M (5',8'-dimethyl-1',1'-dioxospiro[1,3-dioxolane-2,4'-2,3-dihydrothiochromene]-6'-yl)-(2,6-dioxocyclohexylidene)methanolate Chemical compound CC=1C(C2(OCCO2)CCS2(=O)=O)=C2C(C)=CC=1C([O-])=C1C(=O)CCCC1=O RXGWQJFJQKQKPH-UHFFFAOYSA-M 0.000 description 1
- OYIKARCXOQLFHF-UHFFFAOYSA-N (5-cyclopropyl-1,2-oxazol-4-yl)-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]methanone Chemical compound CS(=O)(=O)C1=CC(C(F)(F)F)=CC=C1C(=O)C1=C(C2CC2)ON=C1 OYIKARCXOQLFHF-UHFFFAOYSA-N 0.000 description 1
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 description 1
- 125000006313 (C5-C8) alkyl group Chemical group 0.000 description 1
- UKSLKNUCVPZQCQ-GZTJUZNOSA-N (E)-1-(4-chlorophenyl)-N-(1,3-dioxolan-2-ylmethoxy)-2,2,2-trifluoroethanimine Chemical compound C=1C=C(Cl)C=CC=1/C(C(F)(F)F)=N\OCC1OCCO1 UKSLKNUCVPZQCQ-GZTJUZNOSA-N 0.000 description 1
- ZJXKMHFMOPXCOJ-BIIKFXOESA-N (E)-4-[4-[4-(trifluoromethyl)phenoxy]phenoxy]pent-2-enoic acid Chemical compound C1=CC(OC(C)\C=C\C(O)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 ZJXKMHFMOPXCOJ-BIIKFXOESA-N 0.000 description 1
- NPUZFKMKEFBWLV-SNAWJCMRSA-N (E)-pent-2-ene Chemical group [CH2]C\C=C\C NPUZFKMKEFBWLV-SNAWJCMRSA-N 0.000 description 1
- MZHCENGPTKEIGP-RXMQYKEDSA-N (R)-dichlorprop Chemical compound OC(=O)[C@@H](C)OC1=CC=C(Cl)C=C1Cl MZHCENGPTKEIGP-RXMQYKEDSA-N 0.000 description 1
- WNTGYJSOUMFZEP-SSDOTTSWSA-N (R)-mecoprop Chemical compound OC(=O)[C@@H](C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-SSDOTTSWSA-N 0.000 description 1
- WXZVAROIGSFCFJ-CYBMUJFWSA-N (R)-napropamide Chemical compound C1=CC=C2C(O[C@H](C)C(=O)N(CC)CC)=CC=CC2=C1 WXZVAROIGSFCFJ-CYBMUJFWSA-N 0.000 description 1
- JLYFCTQDENRSOL-VIFPVBQESA-N (S)-dimethenamid Chemical compound COC[C@H](C)N(C(=O)CCl)C=1C(C)=CSC=1C JLYFCTQDENRSOL-VIFPVBQESA-N 0.000 description 1
- WVQBLGZPHOPPFO-LBPRGKRZSA-N (S)-metolachlor Chemical compound CCC1=CC=CC(C)=C1N([C@@H](C)COC)C(=O)CCl WVQBLGZPHOPPFO-LBPRGKRZSA-N 0.000 description 1
- RRLHZVASKJLNFJ-UPHRSURJSA-N (Z)-2,3,5,5,5-pentachloro-4-oxopent-2-enoic acid Chemical compound OC(=O)C(\Cl)=C(\Cl)C(=O)C(Cl)(Cl)Cl RRLHZVASKJLNFJ-UPHRSURJSA-N 0.000 description 1
- PYKLUAIDKVVEOS-JLHYYAGUSA-N (Z)-N-(cyanomethoxy)benzenecarboximidoyl cyanide Chemical compound N#CCO\N=C(/C#N)C1=CC=CC=C1 PYKLUAIDKVVEOS-JLHYYAGUSA-N 0.000 description 1
- CRPTXKKKIGGDBX-UHFFFAOYSA-N (Z)-but-2-ene Chemical group [CH2]C=CC CRPTXKKKIGGDBX-UHFFFAOYSA-N 0.000 description 1
- OVXMBIVWNJDDSM-UHFFFAOYSA-N (benzhydrylideneamino) 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoate Chemical compound COC1=CC(OC)=NC(OC=2C(=C(OC=3N=C(OC)C=C(OC)N=3)C=CC=2)C(=O)ON=C(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 OVXMBIVWNJDDSM-UHFFFAOYSA-N 0.000 description 1
- IBHCSFXTRODDNR-ZDUSSCGKSA-N (propan-2-ylideneamino) (2S)-2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate Chemical compound C1=CC(O[C@@H](C)C(=O)ON=C(C)C)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 IBHCSFXTRODDNR-ZDUSSCGKSA-N 0.000 description 1
- MCNOFYBITGAAGM-UHFFFAOYSA-N (±)-Furilazole Chemical compound C1N(C(=O)C(Cl)Cl)C(C)(C)OC1C1=CC=CO1 MCNOFYBITGAAGM-UHFFFAOYSA-N 0.000 description 1
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-Bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 1
- FCAKZZMVXCLLHM-UHFFFAOYSA-N 1,1-dimethyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]urea Chemical compound CN(C)C(=O)NC1=CC=CC(OC(F)(F)C(F)F)=C1 FCAKZZMVXCLLHM-UHFFFAOYSA-N 0.000 description 1
- 125000005919 1,2,2-trimethylpropyl group Chemical group 0.000 description 1
- 125000006034 1,2-dimethyl-1-propenyl group Chemical group 0.000 description 1
- 125000006062 1,2-dimethyl-2-butenyl group Chemical group 0.000 description 1
- 125000005918 1,2-dimethylbutyl group Chemical group 0.000 description 1
- RHFWLPWDOYJEAL-UHFFFAOYSA-N 1,2-oxazol-3-amine Chemical compound NC=1C=CON=1 RHFWLPWDOYJEAL-UHFFFAOYSA-N 0.000 description 1
- OPMGYPOENUJLEM-UHFFFAOYSA-N 1,3-thiazol-5-ylboronic acid Chemical compound OB(O)C1=CN=CS1 OPMGYPOENUJLEM-UHFFFAOYSA-N 0.000 description 1
- MVHWKYHDYCGNQN-UHFFFAOYSA-N 1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)benzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=C(F)C=C(Cl)C=C1Cl MVHWKYHDYCGNQN-UHFFFAOYSA-N 0.000 description 1
- CAAMSDWKXXPUJR-UHFFFAOYSA-N 1,5-dihydro-4H-imidazol-4-one Chemical class O=C1CNC=N1 CAAMSDWKXXPUJR-UHFFFAOYSA-N 0.000 description 1
- IHSBKMBNDURWAT-UHFFFAOYSA-N 1-(1,1,4-trimethyl-6-propan-2-yl-2,3-dihydroinden-5-yl)propan-1-one Chemical compound C1=C(C(C)C)C(C(=O)CC)=C(C)C2=C1C(C)(C)CC2 IHSBKMBNDURWAT-UHFFFAOYSA-N 0.000 description 1
- MHULQDZDXMHODA-UHFFFAOYSA-N 1-(2,2-dichloroacetyl)-3,3,8a-trimethyl-2,4,7,8-tetrahydropyrrolo[1,2-a]pyrimidin-6-one Chemical compound C1C(C)(C)CN(C(=O)C(Cl)Cl)C2(C)N1C(=O)CC2 MHULQDZDXMHODA-UHFFFAOYSA-N 0.000 description 1
- DHYXNIKICPUXJI-UHFFFAOYSA-N 1-(2,4-dichlorophenyl)-N-(2,4-difluorophenyl)-5-oxo-N-propan-2-yl-1,2,4-triazole-4-carboxamide Chemical compound C=1C=C(F)C=C(F)C=1N(C(C)C)C(=O)N(C1=O)C=NN1C1=CC=C(Cl)C=C1Cl DHYXNIKICPUXJI-UHFFFAOYSA-N 0.000 description 1
- PYCINWWWERDNKE-UHFFFAOYSA-N 1-(2-chloro-6-propylimidazo[1,2-b]pyridazin-3-yl)sulfonyl-3-(4,6-dimethoxypyrimidin-2-yl)urea Chemical compound N12N=C(CCC)C=CC2=NC(Cl)=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 PYCINWWWERDNKE-UHFFFAOYSA-N 0.000 description 1
- VJYIFXVZLXQVHO-UHFFFAOYSA-N 1-(2-chlorophenyl)sulfonyl-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)Cl)=N1 VJYIFXVZLXQVHO-UHFFFAOYSA-N 0.000 description 1
- VQHHIQJPQOLZGF-UHFFFAOYSA-N 1-(2-iodophenyl)sulfonyl-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)I)=N1 VQHHIQJPQOLZGF-UHFFFAOYSA-N 0.000 description 1
- JIGPTDXPKKMNCN-UHFFFAOYSA-N 1-(5-butylsulfonyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea Chemical compound CCCCS(=O)(=O)C1=NN=C(N(C)C(=O)NC)S1 JIGPTDXPKKMNCN-UHFFFAOYSA-N 0.000 description 1
- GUGLRTKPJBGNAF-UHFFFAOYSA-N 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-methylurea Chemical compound CNC(=O)NC=1C=C(C(C)(C)C)ON=1 GUGLRTKPJBGNAF-UHFFFAOYSA-N 0.000 description 1
- XFRVVPUIAFSTFO-UHFFFAOYSA-N 1-Tridecanol Chemical compound CCCCCCCCCCCCCO XFRVVPUIAFSTFO-UHFFFAOYSA-N 0.000 description 1
- KOKBUARVIJVMMM-UHFFFAOYSA-N 1-amino-3-(2,2-dimethylpropyl)-6-ethylsulfanyl-1,3,5-triazine-2,4-dione Chemical compound CCSC1=NC(=O)N(CC(C)(C)C)C(=O)N1N KOKBUARVIJVMMM-UHFFFAOYSA-N 0.000 description 1
- 125000006083 1-bromoethyl group Chemical group 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 1
- WLKSPGHQGFFKGE-UHFFFAOYSA-N 1-chloropropan-2-yl N-(3-chlorophenyl)carbamate Chemical compound ClCC(C)OC(=O)NC1=CC=CC(Cl)=C1 WLKSPGHQGFFKGE-UHFFFAOYSA-N 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004717 1-ethylpropylthio group Chemical group C(C)C(CC)S* 0.000 description 1
- 125000004776 1-fluoroethyl group Chemical group [H]C([H])([H])C([H])(F)* 0.000 description 1
- 125000006039 1-hexenyl group Chemical group 0.000 description 1
- BXKKQFGRMSOANI-UHFFFAOYSA-N 1-methoxy-3-[4-[(2-methoxy-2,4,4-trimethyl-3H-chromen-7-yl)oxy]phenyl]-1-methylurea Chemical compound C1=CC(NC(=O)N(C)OC)=CC=C1OC1=CC=C2C(C)(C)CC(C)(OC)OC2=C1 BXKKQFGRMSOANI-UHFFFAOYSA-N 0.000 description 1
- ARXJGSRGQADJSQ-UHFFFAOYSA-N 1-methoxypropan-2-ol Chemical compound COCC(C)O ARXJGSRGQADJSQ-UHFFFAOYSA-N 0.000 description 1
- 125000006025 1-methyl-1-butenyl group Chemical group 0.000 description 1
- 125000006019 1-methyl-1-propenyl group Chemical group 0.000 description 1
- 125000006018 1-methyl-ethenyl group Chemical group 0.000 description 1
- QDXQAOGNBCOEQX-UHFFFAOYSA-N 1-methylcyclohexa-1,4-diene Chemical compound CC1=CCC=CC1 QDXQAOGNBCOEQX-UHFFFAOYSA-N 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- ZVMHOIWRCCZGPZ-UHFFFAOYSA-N 1H-indol-6-ylboronic acid Chemical compound OB(O)C1=CC=C2C=CNC2=C1 ZVMHOIWRCCZGPZ-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- QZEKHJXYZSJVCL-UHFFFAOYSA-N 2,2,3-trichloropropanoic acid Chemical compound OC(=O)C(Cl)(Cl)CCl QZEKHJXYZSJVCL-UHFFFAOYSA-N 0.000 description 1
- QWWHRELOCZEQNZ-UHFFFAOYSA-N 2,2-dichloro-1-(1-oxa-4-azaspiro[4.5]decan-4-yl)ethanone Chemical compound ClC(Cl)C(=O)N1CCOC11CCCCC1 QWWHRELOCZEQNZ-UHFFFAOYSA-N 0.000 description 1
- 125000004781 2,2-dichloro-2-fluoroethyl group Chemical group [H]C([H])(*)C(F)(Cl)Cl 0.000 description 1
- 125000004778 2,2-difluoroethyl group Chemical group [H]C([H])(*)C([H])(F)F 0.000 description 1
- 125000006067 2,2-dimethyl-3-butenyl group Chemical group 0.000 description 1
- XTVIFVALDYTCLL-UHFFFAOYSA-N 2,3,5-trichloro-1H-pyridin-4-one Chemical compound ClC1=CNC(Cl)=C(Cl)C1=O XTVIFVALDYTCLL-UHFFFAOYSA-N 0.000 description 1
- XZIDTOHMJBOSOX-UHFFFAOYSA-N 2,3,6-TBA Chemical compound OC(=O)C1=C(Cl)C=CC(Cl)=C1Cl XZIDTOHMJBOSOX-UHFFFAOYSA-N 0.000 description 1
- ROOPEIGRBDVOKP-UHFFFAOYSA-N 2,3-di(butan-2-yl)phenol Chemical compound CCC(C)C1=CC=CC(O)=C1C(C)CC ROOPEIGRBDVOKP-UHFFFAOYSA-N 0.000 description 1
- 125000006069 2,3-dimethyl-2-butenyl group Chemical group 0.000 description 1
- 125000006070 2,3-dimethyl-3-butenyl group Chemical group 0.000 description 1
- SMYMJHWAQXWPDB-UHFFFAOYSA-N 2,4,5-Trichlorophenoxyacetic acid Chemical compound OC(=O)COC1=CC(Cl)=C(Cl)C=C1Cl SMYMJHWAQXWPDB-UHFFFAOYSA-N 0.000 description 1
- 239000002794 2,4-DB Substances 0.000 description 1
- YIVXMZJTEQBPQO-UHFFFAOYSA-N 2,4-DB Chemical compound OC(=O)CCCOC1=CC=C(Cl)C=C1Cl YIVXMZJTEQBPQO-UHFFFAOYSA-N 0.000 description 1
- PSOZMUMWCXLRKX-UHFFFAOYSA-N 2,4-dinitro-6-pentan-2-ylphenol Chemical compound CCCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O PSOZMUMWCXLRKX-UHFFFAOYSA-N 0.000 description 1
- CZRVDACSCJKRFL-UHFFFAOYSA-N 2,5-dimethyl-4-[2-methylsulfonyl-4-(trifluoromethyl)benzoyl]-1H-pyrazol-3-one Chemical compound N1N(C)C(=O)C(C(=O)C=2C(=CC(=CC=2)C(F)(F)F)S(C)(=O)=O)=C1C CZRVDACSCJKRFL-UHFFFAOYSA-N 0.000 description 1
- XJPOOEMIUDHWSO-UHFFFAOYSA-N 2,5-dimethyl-N-phenylpyrrolidine-1-carboxamide Chemical compound CC1CCC(C)N1C(=O)NC1=CC=CC=C1 XJPOOEMIUDHWSO-UHFFFAOYSA-N 0.000 description 1
- YOYAIZYFCNQIRF-UHFFFAOYSA-N 2,6-Dichlorobenzonitrile Chemical compound ClC1=CC=CC(Cl)=C1C#N YOYAIZYFCNQIRF-UHFFFAOYSA-N 0.000 description 1
- QHBWRIRRPKKWSW-UHFFFAOYSA-N 2-(1-benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=CC2=C1C=CO2 QHBWRIRRPKKWSW-UHFFFAOYSA-N 0.000 description 1
- ATKFMEGWDYLXBP-UHFFFAOYSA-N 2-(2,4,5-trichlorophenoxy)ethanol Chemical compound OCCOC1=CC(Cl)=C(Cl)C=C1Cl ATKFMEGWDYLXBP-UHFFFAOYSA-N 0.000 description 1
- OXJISOJFVQITNG-UHFFFAOYSA-M 2-(2,4-dichlorophenoxy)acetate;2-hydroxyethyl(trimethyl)azanium Chemical compound C[N+](C)(C)CCO.[O-]C(=O)COC1=CC=C(Cl)C=C1Cl OXJISOJFVQITNG-UHFFFAOYSA-M 0.000 description 1
- LGURYBCSJPXHTF-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)ethyl benzoate Chemical compound ClC1=CC(Cl)=CC=C1OCCOC(=O)C1=CC=CC=C1 LGURYBCSJPXHTF-UHFFFAOYSA-N 0.000 description 1
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-Methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 1
- BIPAGODSEBNAJR-UHFFFAOYSA-N 2-(3,4-dichlorophenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C(Cl)=C1 BIPAGODSEBNAJR-UHFFFAOYSA-N 0.000 description 1
- YNTJKQDWYXUTLZ-UHFFFAOYSA-N 2-(3-chlorophenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=CC(Cl)=C1 YNTJKQDWYXUTLZ-UHFFFAOYSA-N 0.000 description 1
- JJMCZIFFTICTDD-UHFFFAOYSA-N 2-(4-chloro-1-benzofuran-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=C(Cl)C2=C1OC=C2 JJMCZIFFTICTDD-UHFFFAOYSA-N 0.000 description 1
- DKHJWWRYTONYHB-UHFFFAOYSA-N 2-(4-chlorophenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1 DKHJWWRYTONYHB-UHFFFAOYSA-N 0.000 description 1
- YUVKUEAFAVKILW-UHFFFAOYSA-N 2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 YUVKUEAFAVKILW-UHFFFAOYSA-N 0.000 description 1
- MRRVBEDKTDLWSE-UHFFFAOYSA-N 2-(5-bromo-2-chlorophenoxy)acetaldehyde Chemical compound ClC1=CC=C(Br)C=C1OCC=O MRRVBEDKTDLWSE-UHFFFAOYSA-N 0.000 description 1
- ICJSJAJWTWPSBD-UHFFFAOYSA-N 2-(5-chloroquinolin-8-yl)oxyacetic acid Chemical compound C1=CN=C2C(OCC(=O)O)=CC=C(Cl)C2=C1 ICJSJAJWTWPSBD-UHFFFAOYSA-N 0.000 description 1
- VJOZZZPANABKOS-UHFFFAOYSA-N 2-(6-fluoro-1-benzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C(C(=C1)F)=CC2=C1OC=C2 VJOZZZPANABKOS-UHFFFAOYSA-N 0.000 description 1
- ISERORSDFSDMDV-UHFFFAOYSA-N 2-(N-(2-chloroacetyl)-2,6-diethylanilino)acetic acid Chemical compound CCC1=CC=CC(CC)=C1N(CC(O)=O)C(=O)CCl ISERORSDFSDMDV-UHFFFAOYSA-N 0.000 description 1
- WZZRJCUYSKKFHO-UHFFFAOYSA-N 2-(N-benzoyl-3,4-dichloroanilino)propanoic acid Chemical compound C=1C=C(Cl)C(Cl)=CC=1N(C(C)C(O)=O)C(=O)C1=CC=CC=C1 WZZRJCUYSKKFHO-UHFFFAOYSA-N 0.000 description 1
- DSABESMCWFGGNQ-UHFFFAOYSA-N 2-(ethoxymethyl)-4,6-dinitrophenol Chemical compound CCOCC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O DSABESMCWFGGNQ-UHFFFAOYSA-N 0.000 description 1
- LVKBXDHACCFCTA-UHFFFAOYSA-N 2-(ethylsulfonylamino)-5-fluoro-4-[4-methyl-5-oxo-3-(trifluoromethyl)-1,2,4-triazol-1-yl]benzenecarbothioamide Chemical compound C1=C(C(N)=S)C(NS(=O)(=O)CC)=CC(N2C(N(C)C(=N2)C(F)(F)F)=O)=C1F LVKBXDHACCFCTA-UHFFFAOYSA-N 0.000 description 1
- VTNQPKFIQCLBDU-UHFFFAOYSA-N 2-Chloro-N-(ethoxymethyl)-6'-ethyl-o-acetotoluidide Chemical compound CCOCN(C(=O)CCl)C1=C(C)C=CC=C1CC VTNQPKFIQCLBDU-UHFFFAOYSA-N 0.000 description 1
- YFONKFDEZLYQDH-BOURZNODSA-N 2-N-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-6-(1-fluoroethyl)-1,3,5-triazine-2,4-diamine Chemical compound CC(F)C1=NC(N)=NC(N[C@H]2C3=CC(C)=CC=C3C[C@@H]2C)=N1 YFONKFDEZLYQDH-BOURZNODSA-N 0.000 description 1
- IUFUITYPUYMIHI-UHFFFAOYSA-N 2-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-6-(2-fluoropropan-2-yl)-1,3,5-triazine-2,4-diamine Chemical compound N=1C(N)=NC(C(C)(C)F)=NC=1NC(C)COC1=CC(C)=CC(C)=C1 IUFUITYPUYMIHI-UHFFFAOYSA-N 0.000 description 1
- MAYMYMXYWIVVOK-UHFFFAOYSA-N 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoic acid Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=C(CNS(C)(=O)=O)C=2)C(O)=O)=N1 MAYMYMXYWIVVOK-UHFFFAOYSA-N 0.000 description 1
- HCNBYBFTNHEQQJ-UHFFFAOYSA-N 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-6-(trifluoromethyl)pyridine-3-carboxylic acid Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=C(N=2)C(F)(F)F)C(O)=O)=N1 HCNBYBFTNHEQQJ-UHFFFAOYSA-N 0.000 description 1
- UCDPMNSCCRBWIC-UHFFFAOYSA-N 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoylamino]-N,N-dimethylbenzamide Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)NC=2C(=CC=CC=2)C(=O)N(C)C)=N1 UCDPMNSCCRBWIC-UHFFFAOYSA-N 0.000 description 1
- IRJQWZWMQCVOLA-DNTJNYDQSA-N 2-[(E)-N-[(3,5-difluorophenyl)carbamoylamino]-C-methylcarbonimidoyl]pyridine-3-carboxylic acid Chemical compound N=1C=CC=C(C(O)=O)C=1C(/C)=N/NC(=O)NC1=CC(F)=CC(F)=C1 IRJQWZWMQCVOLA-DNTJNYDQSA-N 0.000 description 1
- UMHYVXGZRGOICM-AUYXYSRISA-N 2-[(Z)-octadec-9-enoyl]oxypropyl (Z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC(C)OC(=O)CCCCCCC\C=C/CCCCCCCC UMHYVXGZRGOICM-AUYXYSRISA-N 0.000 description 1
- NZYQPWCHQXECMD-UHFFFAOYSA-N 2-[1-[2-(4-chlorophenoxy)propoxyamino]butylidene]-5-(thian-3-yl)cyclohexane-1,3-dione Chemical compound O=C1CC(C2CSCCC2)CC(=O)C1=C(CCC)NOCC(C)OC1=CC=C(Cl)C=C1 NZYQPWCHQXECMD-UHFFFAOYSA-N 0.000 description 1
- ZLHCMAGENYBXFU-XVSUINCXSA-N 2-[1-[[(E)-3-chloroprop-2-enoxy]amino]butylidene]-5-(2-ethylsulfanylpropyl)cyclohexane-1,3-dione Chemical compound Cl/C=C/CONC(CCC)=C1C(=O)CC(CC(C)SCC)CC1=O ZLHCMAGENYBXFU-XVSUINCXSA-N 0.000 description 1
- PHXHZCIAPNNPTQ-JUFJSZMKSA-N 2-[1-[[(E)-3-chloroprop-2-enoxy]amino]propylidene]-5-(oxan-4-yl)cyclohexane-1,3-dione Chemical compound C1C(=O)C(=C(NOC\C=C\Cl)CC)C(=O)CC1C1CCOCC1 PHXHZCIAPNNPTQ-JUFJSZMKSA-N 0.000 description 1
- OVQJTYOXWVHPTA-UHFFFAOYSA-N 2-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-3-amine Chemical compound NC1=C([N+]([O-])=O)C=NN1C1=C(Cl)C=C(C(F)(F)F)C=C1Cl OVQJTYOXWVHPTA-UHFFFAOYSA-N 0.000 description 1
- IUQAXCIUEPFPSF-UHFFFAOYSA-N 2-[2-chloro-4-methylsulfonyl-3-(2,2,2-trifluoroethoxymethyl)benzoyl]cyclohexane-1,3-dione Chemical compound ClC1=C(COCC(F)(F)F)C(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O IUQAXCIUEPFPSF-UHFFFAOYSA-N 0.000 description 1
- UFAPVJDEYHLLBG-UHFFFAOYSA-N 2-[2-chloro-4-methylsulfonyl-3-(oxolan-2-ylmethoxymethyl)benzoyl]cyclohexane-1,3-dione Chemical compound ClC1=C(COCC2OCCC2)C(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O UFAPVJDEYHLLBG-UHFFFAOYSA-N 0.000 description 1
- YXIIPOGUBVYZIW-UHFFFAOYSA-N 2-[2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-4-fluorophenoxy]acetic acid Chemical compound ClC1=C(OC(F)F)N(C)N=C1C1=CC(OCC(O)=O)=C(Cl)C=C1F YXIIPOGUBVYZIW-UHFFFAOYSA-N 0.000 description 1
- SVGBNTOHFITEDI-UHFFFAOYSA-N 2-[4-(3,5-dichloropyridin-2-yl)oxyphenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC=C(Cl)C=C1Cl SVGBNTOHFITEDI-UHFFFAOYSA-N 0.000 description 1
- BSFAVVHPEZCASB-UHFFFAOYSA-N 2-[4-(4-chlorophenoxy)phenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CC=C(Cl)C=C1 BSFAVVHPEZCASB-UHFFFAOYSA-N 0.000 description 1
- MPPOHAUSNPTFAJ-UHFFFAOYSA-N 2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC2=CC=C(Cl)C=C2O1 MPPOHAUSNPTFAJ-UHFFFAOYSA-N 0.000 description 1
- VAZKTDRSMMSAQB-UHFFFAOYSA-N 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 VAZKTDRSMMSAQB-UHFFFAOYSA-N 0.000 description 1
- RCOHXZITQFQFRZ-UHFFFAOYSA-N 2-[N-[2-(3,5-dichloro-2-methoxybenzoyl)oxyethyl]anilino]ethyl 3,6-dichloro-2-methoxybenzoate Chemical compound COC1=C(Cl)C=C(Cl)C=C1C(=O)OCCN(C=1C=CC=CC=1)CCOC(=O)C1=C(Cl)C=CC(Cl)=C1OC RCOHXZITQFQFRZ-UHFFFAOYSA-N 0.000 description 1
- AKTQJCBOGPBERP-UHFFFAOYSA-N 2-[[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]carbamoylsulfamoyl]-3-methylbenzoic acid Chemical compound FC(F)(F)COC1=NC(N(C)C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2C)C(O)=O)=N1 AKTQJCBOGPBERP-UHFFFAOYSA-N 0.000 description 1
- WUZNHSBFPPFULJ-UHFFFAOYSA-N 2-[[4-chloro-6-(cyclopropylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile Chemical compound N#CC(C)(C)NC1=NC(Cl)=NC(NC2CC2)=N1 WUZNHSBFPPFULJ-UHFFFAOYSA-N 0.000 description 1
- IRLGCAJYYKDTCG-UHFFFAOYSA-N 2-[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]carbamoylsulfamoyl]benzoic acid Chemical compound CCOC1=NC(NC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(O)=O)=N1 IRLGCAJYYKDTCG-UHFFFAOYSA-N 0.000 description 1
- ZBMRKNMTMPPMMK-UHFFFAOYSA-N 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;azane Chemical compound [NH4+].CP(O)(=O)CCC(N)C([O-])=O ZBMRKNMTMPPMMK-UHFFFAOYSA-N 0.000 description 1
- WDRGQGLIUAMOOC-UHFFFAOYSA-N 2-benzamidooxyacetic acid Chemical compound OC(=O)CONC(=O)C1=CC=CC=C1 WDRGQGLIUAMOOC-UHFFFAOYSA-N 0.000 description 1
- YQEPTNWSGJQCOK-UHFFFAOYSA-K 2-bis(2-sulfonatophenyl)phosphanylbenzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1P(C=1C(=CC=CC=1)S([O-])(=O)=O)C1=CC=CC=C1S([O-])(=O)=O YQEPTNWSGJQCOK-UHFFFAOYSA-K 0.000 description 1
- WUJKFVGKLTWVSQ-UHFFFAOYSA-N 2-bromo-4,6-difluoroaniline Chemical compound NC1=C(F)C=C(F)C=C1Br WUJKFVGKLTWVSQ-UHFFFAOYSA-N 0.000 description 1
- XXXMURLCTMDGRI-UHFFFAOYSA-N 2-bromo-4-(2,2-diethoxyethylsulfanyl)-1-fluorobenzene Chemical compound CCOC(OCC)CSC1=CC=C(F)C(Br)=C1 XXXMURLCTMDGRI-UHFFFAOYSA-N 0.000 description 1
- FMRKYXVZQWHGDA-UHFFFAOYSA-N 2-bromo-5-chlorophenol Chemical compound OC1=CC(Cl)=CC=C1Br FMRKYXVZQWHGDA-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- BFBKUYFMLNOLOQ-UHFFFAOYSA-N 2-butoxyethanamine Chemical compound CCCCOCCN BFBKUYFMLNOLOQ-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- ZGGSVBWJVIXBHV-UHFFFAOYSA-N 2-chloro-1-(4-nitrophenoxy)-4-(trifluoromethyl)benzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(C(F)(F)F)C=C1Cl ZGGSVBWJVIXBHV-UHFFFAOYSA-N 0.000 description 1
- 125000004779 2-chloro-2-fluoroethyl group Chemical group [H]C([H])(*)C([H])(F)Cl 0.000 description 1
- QCTALYCTVMUWPT-UHFFFAOYSA-N 2-chloro-3-(4-chlorophenyl)propanoic acid Chemical compound OC(=O)C(Cl)CC1=CC=C(Cl)C=C1 QCTALYCTVMUWPT-UHFFFAOYSA-N 0.000 description 1
- GNHDVXLWBQYPJE-UHFFFAOYSA-N 2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]-N-[methyl(propan-2-yl)sulfamoyl]benzamide Chemical compound C1=C(Cl)C(C(=O)NS(=O)(=O)N(C)C(C)C)=CC(N2C(N(C)C(=CC2=O)C(F)(F)F)=O)=C1F GNHDVXLWBQYPJE-UHFFFAOYSA-N 0.000 description 1
- DDBMQDADIHOWIC-UHFFFAOYSA-N 2-chloro-6-nitro-3-phenoxyaniline Chemical compound C1=C([N+]([O-])=O)C(N)=C(Cl)C(OC=2C=CC=CC=2)=C1 DDBMQDADIHOWIC-UHFFFAOYSA-N 0.000 description 1
- SVOAUHHKPGKPQK-UHFFFAOYSA-N 2-chloro-9-hydroxyfluorene-9-carboxylic acid Chemical compound C1=C(Cl)C=C2C(C(=O)O)(O)C3=CC=CC=C3C2=C1 SVOAUHHKPGKPQK-UHFFFAOYSA-N 0.000 description 1
- CQQUWTMMFMJEFE-UHFFFAOYSA-N 2-chloro-N,N-diethylacetamide Chemical compound CCN(CC)C(=O)CCl CQQUWTMMFMJEFE-UHFFFAOYSA-N 0.000 description 1
- UDRNNGBAXFCBLJ-UHFFFAOYSA-N 2-chloro-N-(2,3-dimethylphenyl)-N-propan-2-ylacetamide Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC(C)=C1C UDRNNGBAXFCBLJ-UHFFFAOYSA-N 0.000 description 1
- KZNDFYDURHAESM-UHFFFAOYSA-N 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(propan-2-yloxymethyl)acetamide Chemical compound CCC1=CC=CC(C)=C1N(COC(C)C)C(=O)CCl KZNDFYDURHAESM-UHFFFAOYSA-N 0.000 description 1
- GYJQWEIGUGMFMU-UHFFFAOYSA-N 2-chloroethyl N-(3-chlorophenyl)carbamate Chemical compound ClCCOC(=O)NC1=CC=CC(Cl)=C1 GYJQWEIGUGMFMU-UHFFFAOYSA-N 0.000 description 1
- UHZZMRAGKVHANO-UHFFFAOYSA-M 2-chloroethyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CCCl UHZZMRAGKVHANO-UHFFFAOYSA-M 0.000 description 1
- IRCMYGHHKLLGHV-UHFFFAOYSA-N 2-ethoxy-3,3-dimethyl-2,3-dihydro-1-benzofuran-5-yl methanesulfonate Chemical compound C1=C(OS(C)(=O)=O)C=C2C(C)(C)C(OCC)OC2=C1 IRCMYGHHKLLGHV-UHFFFAOYSA-N 0.000 description 1
- 125000006077 2-ethyl-2-butenyl group Chemical group 0.000 description 1
- 125000006078 2-ethyl-3-butenyl group Chemical group 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- 125000006026 2-methyl-1-butenyl group Chemical group 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- 125000006029 2-methyl-2-butenyl group Chemical group 0.000 description 1
- 125000006049 2-methyl-2-pentenyl group Chemical group 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- 125000006031 2-methyl-3-butenyl group Chemical group 0.000 description 1
- 125000006053 2-methyl-3-pentenyl group Chemical group 0.000 description 1
- FYEWDLAVQKIKQE-UHFFFAOYSA-N 2-methyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazinane-3,5-dione Chemical compound O=C1N(C)OCC(=O)N1C1=CC=CC(C(F)(F)F)=C1 FYEWDLAVQKIKQE-UHFFFAOYSA-N 0.000 description 1
- 125000006056 2-methyl-4-pentenyl group Chemical group 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- PJHRMQPEENZCPK-UHFFFAOYSA-N 2-methylsulfanylpropan-1-amine Chemical compound CSC(C)CN PJHRMQPEENZCPK-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-L 2-sulfobutanedioate Chemical class OS(=O)(=O)C(C([O-])=O)CC([O-])=O ULUAUXLGCMPNKK-UHFFFAOYSA-L 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N 289-95-2 Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 125000006072 3,3-dimethyl-2-butenyl group Chemical group 0.000 description 1
- YRSSHOVRSMQULE-UHFFFAOYSA-N 3,5-dichloro-4-hydroxybenzonitrile Chemical compound OC1=C(Cl)C=C(C#N)C=C1Cl YRSSHOVRSMQULE-UHFFFAOYSA-N 0.000 description 1
- YKYGJHGXTSEGDB-UHFFFAOYSA-N 3-(3-chloro-4-ethoxyphenyl)-1,1-dimethylurea Chemical compound CCOC1=CC=C(NC(=O)N(C)C)C=C1Cl YKYGJHGXTSEGDB-UHFFFAOYSA-N 0.000 description 1
- LOQQVLXUKHKNIA-UHFFFAOYSA-N 3-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]thiophene-2-carboxylic acid Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C2=C(SC=C2)C(O)=O)=N1 LOQQVLXUKHKNIA-UHFFFAOYSA-N 0.000 description 1
- YFEUKKUPOVGUIW-UHFFFAOYSA-N 3-[3-chloro-4-[chloro(difluoro)methyl]sulfanylphenyl]-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=C(SC(F)(F)Cl)C(Cl)=C1 YFEUKKUPOVGUIW-UHFFFAOYSA-N 0.000 description 1
- WYJOEQHHWHAJRB-UHFFFAOYSA-N 3-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]oxolane Chemical compound C1=C(OC2COCC2)C([N+](=O)[O-])=CC=C1OC1=CC=C(C(F)(F)F)C=C1Cl WYJOEQHHWHAJRB-UHFFFAOYSA-N 0.000 description 1
- CASLETQIYIQFTQ-UHFFFAOYSA-N 3-[[5-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylsulfonyl]-5,5-dimethyl-4H-1,2-oxazole Chemical compound CN1N=C(C(F)(F)F)C(CS(=O)(=O)C=2CC(C)(C)ON=2)=C1OC(F)F CASLETQIYIQFTQ-UHFFFAOYSA-N 0.000 description 1
- MEZFCUMYQXLFOV-UHFFFAOYSA-N 3-bromo-2-fluorophenol Chemical compound OC1=CC=CC(Br)=C1F MEZFCUMYQXLFOV-UHFFFAOYSA-N 0.000 description 1
- QWTULQLVGNZMLF-UHFFFAOYSA-N 3-bromo-4-fluorophenol Chemical compound OC1=CC=C(F)C(Br)=C1 QWTULQLVGNZMLF-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- GINFBXXYGUODAT-UHFFFAOYSA-N 3-methoxy-4-methyl-5-oxo-N-[2-(trifluoromethoxy)phenyl]sulfonyl-1,2,4-triazole-1-carboxamide Chemical compound O=C1N(C)C(OC)=NN1C(=O)NS(=O)(=O)C1=CC=CC=C1OC(F)(F)F GINFBXXYGUODAT-UHFFFAOYSA-N 0.000 description 1
- 125000006027 3-methyl-1-butenyl group Chemical group 0.000 description 1
- 125000006050 3-methyl-2-pentenyl group Chemical group 0.000 description 1
- 125000006032 3-methyl-3-butenyl group Chemical group 0.000 description 1
- 125000006054 3-methyl-3-pentenyl group Chemical group 0.000 description 1
- SOPHXJOERHTMIL-UHFFFAOYSA-N 3-methyl-4,6-dinitro-2-propan-2-ylphenol Chemical compound CC(C)C1=C(C)C([N+]([O-])=O)=CC([N+]([O-])=O)=C1O SOPHXJOERHTMIL-UHFFFAOYSA-N 0.000 description 1
- 125000006057 3-methyl-4-pentenyl group Chemical group 0.000 description 1
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- XKTYXVDYIKIYJP-UHFFFAOYSA-N 3H-dioxole Chemical compound C1OOC=C1 XKTYXVDYIKIYJP-UHFFFAOYSA-N 0.000 description 1
- LHGHJAGVMNLDGA-UHFFFAOYSA-M 4,5,6-trichloropyridine-2-carboxylate Chemical compound [O-]C(=O)C1=CC(Cl)=C(Cl)C(Cl)=N1 LHGHJAGVMNLDGA-UHFFFAOYSA-M 0.000 description 1
- NEFZKJCNHBXWLP-UHFFFAOYSA-N 4,5-dimethoxy-2-phenylpyridazin-3-one Chemical compound O=C1C(OC)=C(OC)C=NN1C1=CC=CC=C1 NEFZKJCNHBXWLP-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- RTWCZQFXFMXXKP-UHFFFAOYSA-N 4-(2,4,5-trichlorophenoxy)butanoic acid Chemical compound OC(=O)CCCOC1=CC(Cl)=C(Cl)C=C1Cl RTWCZQFXFMXXKP-UHFFFAOYSA-N 0.000 description 1
- SIYAHZSHQIPQLY-UHFFFAOYSA-N 4-(4-chlorophenoxy)butanoic acid Chemical compound OC(=O)CCCOC1=CC=C(Cl)C=C1 SIYAHZSHQIPQLY-UHFFFAOYSA-N 0.000 description 1
- SODPIMGUZLOIPE-UHFFFAOYSA-N 4-Chlorophenoxyacetic acid Chemical compound OC(=O)COC1=CC=C(Cl)C=C1 SODPIMGUZLOIPE-UHFFFAOYSA-N 0.000 description 1
- BPPVUXSMLBXYGG-UHFFFAOYSA-N 4-[3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoyl]-2-methyl-1H-pyrazol-3-one Chemical compound CC1=C(C(=O)C=2C(N(C)NC=2)=O)C=CC(S(C)(=O)=O)=C1C1=NOCC1 BPPVUXSMLBXYGG-UHFFFAOYSA-N 0.000 description 1
- ORFPWVRKFLOQHK-UHFFFAOYSA-N 4-amino-N-tert-butyl-5-oxo-3-propan-2-yl-1,2,4-triazole-1-carboxamide Chemical compound CC(C)C1=NN(C(=O)NC(C)(C)C)C(=O)N1N ORFPWVRKFLOQHK-UHFFFAOYSA-N 0.000 description 1
- DJRYWPGOQTUJMQ-UHFFFAOYSA-N 4-bromo-1-chloro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Br)=CC=C1Cl DJRYWPGOQTUJMQ-UHFFFAOYSA-N 0.000 description 1
- QWSUMJXRROQYPN-UHFFFAOYSA-N 4-bromo-3-fluorobenzenethiol Chemical compound FC1=CC(S)=CC=C1Br QWSUMJXRROQYPN-UHFFFAOYSA-N 0.000 description 1
- MRQYTJXVULSNIS-UHFFFAOYSA-N 4-bromo-3-fluorophenol Chemical compound OC1=CC=C(Br)C(F)=C1 MRQYTJXVULSNIS-UHFFFAOYSA-N 0.000 description 1
- ABBUZRXDYLQKRH-UHFFFAOYSA-N 4-bromo-7-chloro-1H-indole Chemical compound ClC1=CC=C(Br)C2=C1NC=C2 ABBUZRXDYLQKRH-UHFFFAOYSA-N 0.000 description 1
- CYQMVKQKBFFDOO-UHFFFAOYSA-N 4-chloro-5-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one Chemical compound O=C1C(Cl)=C(N(C)C)C=NN1C1=CC=CC(C(F)(F)F)=C1 CYQMVKQKBFFDOO-UHFFFAOYSA-N 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- MBFHUWCOCCICOK-UHFFFAOYSA-N 4-iodo-2-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoic acid Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=C(I)C=2)C(O)=O)=N1 MBFHUWCOCCICOK-UHFFFAOYSA-N 0.000 description 1
- 125000006051 4-methyl-2-pentenyl group Chemical group 0.000 description 1
- 125000003119 4-methyl-3-pentenyl group Chemical group [H]\C(=C(/C([H])([H])[H])C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000006058 4-methyl-4-pentenyl group Chemical group 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N 4H-1,2,4-triazol-3-amine Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- CHLWHHUKKHNQTH-UHFFFAOYSA-N 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=C(OC=N2)C2=C1 CHLWHHUKKHNQTH-UHFFFAOYSA-N 0.000 description 1
- NUPJIGQFXCQJBK-UHFFFAOYSA-N 5-(methoxymethyl)-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC(COC)=CN=C1C1=NC(C)(C(C)C)C(=O)N1 NUPJIGQFXCQJBK-UHFFFAOYSA-N 0.000 description 1
- NYRMIJKDBAQCHC-UHFFFAOYSA-N 5-(methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3-one Chemical compound O1C(NC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 NYRMIJKDBAQCHC-UHFFFAOYSA-N 0.000 description 1
- OPEJGICLTMWFNQ-UHFFFAOYSA-N 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-(3-methylthiophen-2-yl)-4H-1,2-oxazole Chemical compound C1=CSC(C=2CC(C)(COCC=3C(=CC=CC=3F)F)ON=2)=C1C OPEJGICLTMWFNQ-UHFFFAOYSA-N 0.000 description 1
- QQOGZMUZAZWLJH-UHFFFAOYSA-N 5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-N-ethylsulfonyl-2-nitrobenzamide Chemical compound C1=C([N+]([O-])=O)C(C(=O)NS(=O)(=O)CC)=CC(OC=2C(=CC(=CC=2F)C(F)(F)F)Cl)=C1 QQOGZMUZAZWLJH-UHFFFAOYSA-N 0.000 description 1
- ODNZLRLWXRXPOH-UHFFFAOYSA-N 5-amino-4-bromo-2-phenylpyridazin-3-one Chemical compound O=C1C(Br)=C(N)C=NN1C1=CC=CC=C1 ODNZLRLWXRXPOH-UHFFFAOYSA-N 0.000 description 1
- AASRSBQIWRXUBV-UHFFFAOYSA-N 5-bromo-6-fluoro-1-benzothiophene Chemical compound C1=C(Br)C(F)=CC2=C1C=CS2 AASRSBQIWRXUBV-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- DVOODWOZJVJKQR-UHFFFAOYSA-N 5-tert-butyl-3-(2,4-dichloro-5-prop-2-ynoxyphenyl)-1,3,4-oxadiazol-2-one Chemical group O=C1OC(C(C)(C)C)=NN1C1=CC(OCC#C)=C(Cl)C=C1Cl DVOODWOZJVJKQR-UHFFFAOYSA-N 0.000 description 1
- HZKBYBNLTLVSPX-UHFFFAOYSA-N 6-[(6,6-dimethyl-5,7-dihydropyrrolo[2,1-c][1,2,4]thiadiazol-3-ylidene)amino]-7-fluoro-4-prop-2-ynyl-1,4-benzoxazin-3-one Chemical compound C#CCN1C(=O)COC(C=C2F)=C1C=C2N=C1SN=C2CC(C)(C)CN21 HZKBYBNLTLVSPX-UHFFFAOYSA-N 0.000 description 1
- OBLXHKVOGHXFIW-UHFFFAOYSA-N 6-bromo-5-fluoro-1-benzothiophene Chemical compound C1=C(Br)C(F)=CC2=C1SC=C2 OBLXHKVOGHXFIW-UHFFFAOYSA-N 0.000 description 1
- QHXDTLYEHWXDSO-UHFFFAOYSA-N 6-chloro-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine Chemical compound CCN(CC)C1=NC(Cl)=NC(N(CC)CC)=N1 QHXDTLYEHWXDSO-UHFFFAOYSA-N 0.000 description 1
- ZUSHSDOEVHPTCU-UHFFFAOYSA-N 6-chloro-3-phenyl-1H-pyridazin-4-one Chemical compound N1C(Cl)=CC(=O)C(C=2C=CC=CC=2)=N1 ZUSHSDOEVHPTCU-UHFFFAOYSA-N 0.000 description 1
- PMYBBBROJPQQQV-UHFFFAOYSA-N 6-chloro-4-N-(3-methoxypropyl)-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine Chemical compound COCCCNC1=NC(Cl)=NC(NC(C)C)=N1 PMYBBBROJPQQQV-UHFFFAOYSA-N 0.000 description 1
- OOHIAOSLOGDBCE-UHFFFAOYSA-N 6-chloro-4-N-cyclopropyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine Chemical compound CC(C)NC1=NC(Cl)=NC(NC2CC2)=N1 OOHIAOSLOGDBCE-UHFFFAOYSA-N 0.000 description 1
- UCOIYRGMDBGBOU-UHFFFAOYSA-N 6-chloro-4-N-propan-2-ylpyrimidine-2,4-diamine Chemical compound CC(C)NC1=CC(Cl)=NC(N)=N1 UCOIYRGMDBGBOU-UHFFFAOYSA-N 0.000 description 1
- QQRJUWIHLNBDQF-UHFFFAOYSA-N 6-chloro-5-methylsulfanylpyrimidine-2,4-diamine Chemical compound CSC1=C(N)N=C(N)N=C1Cl QQRJUWIHLNBDQF-UHFFFAOYSA-N 0.000 description 1
- HVHHQHTXTGUMSR-UHFFFAOYSA-N 6-tert-butyl-3-(dimethylamino)-4-methyl-1,2,4-triazin-5-one Chemical compound CN(C)C1=NN=C(C(C)(C)C)C(=O)N1C HVHHQHTXTGUMSR-UHFFFAOYSA-N 0.000 description 1
- LJGZUMNXGLDTFF-UHFFFAOYSA-N 6-tert-butyl-3-methyl-2,4-dinitrophenol Chemical compound CC1=C([N+]([O-])=O)C=C(C(C)(C)C)C(O)=C1[N+]([O-])=O LJGZUMNXGLDTFF-UHFFFAOYSA-N 0.000 description 1
- ODFJOVXVLFUVNQ-UHFFFAOYSA-N Acetarsol Chemical group CC(=O)NC1=CC([As](O)(O)=O)=CC=C1O ODFJOVXVLFUVNQ-UHFFFAOYSA-N 0.000 description 1
- NUFNQYOELLVIPL-UHFFFAOYSA-N Acifluorfen Chemical compound C1=C([N+]([O-])=O)C(C(=O)O)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 NUFNQYOELLVIPL-UHFFFAOYSA-N 0.000 description 1
- 239000002890 Aclonifen Substances 0.000 description 1
- 241000212906 Aeschynomene Species 0.000 description 1
- 235000004051 Aeschynomene indica Nutrition 0.000 description 1
- 240000005883 Aeschynomene indica Species 0.000 description 1
- XCSGPAVHZFQHGE-UHFFFAOYSA-N Alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 description 1
- 235000013291 Alisma plantago aquatica Nutrition 0.000 description 1
- MDBGGTQNNUOQRC-UHFFFAOYSA-N Allidochlor Chemical compound ClCC(=O)N(CC=C)CC=C MDBGGTQNNUOQRC-UHFFFAOYSA-N 0.000 description 1
- XXROGKLTLUQVRX-UHFFFAOYSA-N Allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- PZZYQPZGQPZBDN-UHFFFAOYSA-N Aluminium silicate Chemical compound O=[Al]O[Si](=O)O[Al]=O PZZYQPZGQPZBDN-UHFFFAOYSA-N 0.000 description 1
- 239000003666 Amidosulfuron Substances 0.000 description 1
- CTTHWASMBLQOFR-UHFFFAOYSA-N Amidosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)=N1 CTTHWASMBLQOFR-UHFFFAOYSA-N 0.000 description 1
- NIXXQNOQHKNPEJ-UHFFFAOYSA-N Aminopyralid Chemical compound NC1=CC(Cl)=NC(C(O)=O)=C1Cl NIXXQNOQHKNPEJ-UHFFFAOYSA-N 0.000 description 1
- 239000005468 Aminopyralid Substances 0.000 description 1
- DVARTQFDIMZBAA-UHFFFAOYSA-O Ammonium nitrate Chemical compound [NH4+].[O-][N+]([O-])=O DVARTQFDIMZBAA-UHFFFAOYSA-O 0.000 description 1
- GEHMBYLTCISYNY-UHFFFAOYSA-N Ammonium sulfamate Chemical compound [NH4+].NS([O-])(=O)=O GEHMBYLTCISYNY-UHFFFAOYSA-N 0.000 description 1
- 244000144725 Amygdalus communis Species 0.000 description 1
- PGMYKACGEOXYJE-UHFFFAOYSA-N Amyl acetate Chemical compound CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 1
- NXQDBZGWYSEGFL-UHFFFAOYSA-N Anilofos Chemical compound COP(=S)(OC)SCC(=O)N(C(C)C)C1=CC=C(Cl)C=C1 NXQDBZGWYSEGFL-UHFFFAOYSA-N 0.000 description 1
- VGPYEHKOIGNJKV-UHFFFAOYSA-N Asulam Chemical compound COC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 VGPYEHKOIGNJKV-UHFFFAOYSA-N 0.000 description 1
- MXWJVTOOROXGIU-UHFFFAOYSA-N Atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 1
- XOEMATDHVZOBSG-UHFFFAOYSA-N Azafenidin Chemical compound C1=C(OCC#C)C(Cl)=CC(Cl)=C1N1C(=O)N2CCCCC2=N1 XOEMATDHVZOBSG-UHFFFAOYSA-N 0.000 description 1
- 239000005469 Azimsulfuron Substances 0.000 description 1
- MAHPNPYYQAIOJN-UHFFFAOYSA-N Azimsulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2N(N=CC=2C2=NN(C)N=N2)C)=N1 MAHPNPYYQAIOJN-UHFFFAOYSA-N 0.000 description 1
- AFIIBUOYKYSPKB-UHFFFAOYSA-N Aziprotryne Chemical compound CSC1=NC(NC(C)C)=NC(N=[N+]=[N-])=N1 AFIIBUOYKYSPKB-UHFFFAOYSA-N 0.000 description 1
- 239000005470 Beflubutamid Substances 0.000 description 1
- HYJSGOXICXYZGS-UHFFFAOYSA-N Benazolin Chemical compound C1=CC=C2SC(=O)N(CC(=O)O)C2=C1Cl HYJSGOXICXYZGS-UHFFFAOYSA-N 0.000 description 1
- 239000005471 Benfluralin Substances 0.000 description 1
- SMDHCQAYESWHAE-UHFFFAOYSA-N Benfluralin Chemical compound CCCCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O SMDHCQAYESWHAE-UHFFFAOYSA-N 0.000 description 1
- QGQSRQPXXMTJCM-UHFFFAOYSA-N Benfuresate Chemical compound CCS(=O)(=O)OC1=CC=C2OCC(C)(C)C2=C1 QGQSRQPXXMTJCM-UHFFFAOYSA-N 0.000 description 1
- PFJJMJDEVDLPNE-UHFFFAOYSA-N Benoxacor Chemical compound C1=CC=C2N(C(=O)C(Cl)Cl)C(C)COC2=C1 PFJJMJDEVDLPNE-UHFFFAOYSA-N 0.000 description 1
- 239000005472 Bensulfuron methyl Substances 0.000 description 1
- XMQFTWRPUQYINF-UHFFFAOYSA-N Bensulfuron methyl Chemical group COC(=O)C1=CC=CC=C1CS(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 XMQFTWRPUQYINF-UHFFFAOYSA-N 0.000 description 1
- RRNIZKPFKNDSRS-UHFFFAOYSA-N Bensulide Chemical compound CC(C)OP(=S)(OC(C)C)SCCNS(=O)(=O)C1=CC=CC=C1 RRNIZKPFKNDSRS-UHFFFAOYSA-N 0.000 description 1
- VIXCLRUCUMWJFF-UHFFFAOYSA-N Benzobicyclon Chemical compound ClC1=CC(S(=O)(=O)C)=CC=C1C(=O)C(C(C1CCC2C1)=O)=C2SC1=CC=CC=C1 VIXCLRUCUMWJFF-UHFFFAOYSA-N 0.000 description 1
- JDWQITFHZOBBFE-UHFFFAOYSA-N Benzofenap Chemical compound C=1C=C(Cl)C(C)=C(Cl)C=1C(=O)C=1C(C)=NN(C)C=1OCC(=O)C1=CC=C(C)C=C1 JDWQITFHZOBBFE-UHFFFAOYSA-N 0.000 description 1
- DTCJYIIKPVRVDD-UHFFFAOYSA-N Benzthiazuron Chemical compound C1=CC=C2SC(NC(=O)NC)=NC2=C1 DTCJYIIKPVRVDD-UHFFFAOYSA-N 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N Benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- 239000005484 Bifenox Substances 0.000 description 1
- SUSRORUBZHMPCO-UHFFFAOYSA-N Bifenox Chemical compound C1=C([N+]([O-])=O)C(C(=O)OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 SUSRORUBZHMPCO-UHFFFAOYSA-N 0.000 description 1
- MPOOECNQTZRJKI-UHFFFAOYSA-N Bispyribac-sodium Chemical compound [NaH].COC1=CC(OC)=NC(OC=2C(=C(OC=3N=C(OC)C=C(OC)N=3)C=CC=2)C(O)=O)=N1 MPOOECNQTZRJKI-UHFFFAOYSA-N 0.000 description 1
- 235000011297 Brassica napobrassica Nutrition 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- IXVMHGVQKLDRKH-KNBKMWSGSA-N Brassinolide Chemical compound C1OC(=O)[C@H]2C[C@H](O)[C@H](O)C[C@]2(C)[C@H]2CC[C@]3(C)[C@@H]([C@H](C)[C@@H](O)[C@H](O)[C@@H](C)C(C)C)CC[C@H]3[C@@H]21 IXVMHGVQKLDRKH-KNBKMWSGSA-N 0.000 description 1
- IXVMHGVQKLDRKH-VRESXRICSA-N Brassinolide Natural products O=C1OC[C@@H]2[C@@H]3[C@@](C)([C@H]([C@@H]([C@@H](O)[C@H](O)[C@H](C(C)C)C)C)CC3)CC[C@@H]2[C@]2(C)[C@@H]1C[C@H](O)[C@H](O)C2 IXVMHGVQKLDRKH-VRESXRICSA-N 0.000 description 1
- CTSLUCNDVMMDHG-UHFFFAOYSA-N Bromacil Chemical compound CCC(C)N1C(=O)NC(C)=C(Br)C1=O CTSLUCNDVMMDHG-UHFFFAOYSA-N 0.000 description 1
- XTFNPKDYCLFGPV-OMCISZLKSA-N Bromofenoxim Chemical compound C1=C(Br)C(O)=C(Br)C=C1\C=N\OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O XTFNPKDYCLFGPV-OMCISZLKSA-N 0.000 description 1
- 229940045348 Brown mixture Drugs 0.000 description 1
- HKPHPIREJKHECO-UHFFFAOYSA-N Butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 description 1
- OEYOMNZEMCPTKN-UHFFFAOYSA-N Butamifos Chemical compound CCC(C)NP(=S)(OCC)OC1=CC(C)=CC=C1[N+]([O-])=O OEYOMNZEMCPTKN-UHFFFAOYSA-N 0.000 description 1
- SWMGXKSQWDSBKV-UHFFFAOYSA-N Buthidazole Chemical compound O=C1N(C)CC(O)N1C1=NN=C(C(C)(C)C)S1 SWMGXKSQWDSBKV-UHFFFAOYSA-N 0.000 description 1
- SPNQRCTZKIBOAX-UHFFFAOYSA-N Butralin Chemical compound CCC(C)NC1=C([N+]([O-])=O)C=C(C(C)(C)C)C=C1[N+]([O-])=O SPNQRCTZKIBOAX-UHFFFAOYSA-N 0.000 description 1
- ZOGDSYNXUXQGHF-XIEYBQDHSA-N Butroxydim Chemical compound CCCC(=O)C1=C(C)C=C(C)C(C2CC(=O)C(\C(CC)=N\OCC)=C(O)C2)=C1C ZOGDSYNXUXQGHF-XIEYBQDHSA-N 0.000 description 1
- BYYMILHAKOURNM-UHFFFAOYSA-N Buturon Chemical compound C#CC(C)N(C)C(=O)NC1=CC=C(Cl)C=C1 BYYMILHAKOURNM-UHFFFAOYSA-N 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 description 1
- 125000004649 C2-C8 alkynyl group Chemical group 0.000 description 1
- FKKSOCHESHXWTD-UHFFFAOYSA-M CC(=O)NC1=CC(C([O-])=O)=NC([Sn](C)(C)C)=C1 Chemical class CC(=O)NC1=CC(C([O-])=O)=NC([Sn](C)(C)C)=C1 FKKSOCHESHXWTD-UHFFFAOYSA-M 0.000 description 1
- UYISBQRLYUMVPG-UHFFFAOYSA-N CCCONNC(=O)N=N Chemical compound CCCONNC(=O)N=N UYISBQRLYUMVPG-UHFFFAOYSA-N 0.000 description 1
- OGGXGZAMXPVRFZ-UHFFFAOYSA-N Cacodylic acid Chemical compound C[As](C)(O)=O OGGXGZAMXPVRFZ-UHFFFAOYSA-N 0.000 description 1
- HFEJHAAIJZXXRE-UHFFFAOYSA-N Cafenstrole Chemical compound CCN(CC)C(=O)N1C=NC(S(=O)(=O)C=2C(=CC(C)=CC=2C)C)=N1 HFEJHAAIJZXXRE-UHFFFAOYSA-N 0.000 description 1
- 229960003563 Calcium Carbonate Drugs 0.000 description 1
- YALMXYPQBUJUME-UHFFFAOYSA-L Calcium chlorate Chemical compound [Ca+2].[O-]Cl(=O)=O.[O-]Cl(=O)=O YALMXYPQBUJUME-UHFFFAOYSA-L 0.000 description 1
- 239000005490 Carbetamide Substances 0.000 description 1
- 241000722731 Carex Species 0.000 description 1
- 239000005492 Carfentrazone-ethyl Substances 0.000 description 1
- MLKCGVHIFJBRCD-UHFFFAOYSA-N Carfentrazone-ethyl Chemical group C1=C(Cl)C(CC(Cl)C(=O)OCC)=CC(N2C(N(C(F)F)C(C)=N2)=O)=C1F MLKCGVHIFJBRCD-UHFFFAOYSA-N 0.000 description 1
- 235000014552 Cassia tora Nutrition 0.000 description 1
- 235000005821 Chenopodium album ssp amaranticolor Nutrition 0.000 description 1
- 235000013414 Chenopodium album var centrorubrum Nutrition 0.000 description 1
- DXXVCXKMSWHGTF-UHFFFAOYSA-N Chlomethoxyfen Chemical compound C1=C([N+]([O-])=O)C(OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 DXXVCXKMSWHGTF-UHFFFAOYSA-N 0.000 description 1
- HSSBORCLYSCBJR-UHFFFAOYSA-N Chloramben Chemical compound NC1=CC(Cl)=CC(C(O)=O)=C1Cl HSSBORCLYSCBJR-UHFFFAOYSA-N 0.000 description 1
- VCBRBUKGTWLJOB-UHFFFAOYSA-N Chloranocryl Chemical compound CC(=C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 VCBRBUKGTWLJOB-UHFFFAOYSA-N 0.000 description 1
- NLYNUTMZTCLNOO-UHFFFAOYSA-N Chlorbromuron Chemical compound CON(C)C(=O)NC1=CC=C(Br)C(Cl)=C1 NLYNUTMZTCLNOO-UHFFFAOYSA-N 0.000 description 1
- ULBXWWGWDPVHAO-UHFFFAOYSA-N Chlorbufam Chemical compound C#CC(C)OC(=O)NC1=CC=CC(Cl)=C1 ULBXWWGWDPVHAO-UHFFFAOYSA-N 0.000 description 1
- QZXCCPZJCKEPSA-UHFFFAOYSA-N Chlorfenac Chemical compound OC(=O)CC1=C(Cl)C=CC(Cl)=C1Cl QZXCCPZJCKEPSA-UHFFFAOYSA-N 0.000 description 1
- 239000005493 Chloridazon (aka pyrazone) Substances 0.000 description 1
- RIUXZHMCCFLRBI-UHFFFAOYSA-N Chlorimuron Chemical compound COC1=CC(Cl)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(O)=O)=N1 RIUXZHMCCFLRBI-UHFFFAOYSA-N 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N Chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 239000005494 Chlorotoluron Substances 0.000 description 1
- IUNBHEGRIBDSIH-UHFFFAOYSA-N Chloroxuron Chemical compound CN(C)C(=O)NC1=CC=CC(OC=2C=CC(Cl)=CC=2)=C1 IUNBHEGRIBDSIH-UHFFFAOYSA-N 0.000 description 1
- 239000005647 Chlorpropham Substances 0.000 description 1
- CWJSHJJYOPWUGX-UHFFFAOYSA-N Chlorpropham Chemical compound CC(C)OC(=O)NC1=CC=CC(Cl)=C1 CWJSHJJYOPWUGX-UHFFFAOYSA-N 0.000 description 1
- 239000005496 Chlorsulfuron Substances 0.000 description 1
- KZCBXHSWMMIEQU-UHFFFAOYSA-N Chlorthal Chemical compound OC(=O)C1=C(Cl)C(Cl)=C(C(O)=O)C(Cl)=C1Cl KZCBXHSWMMIEQU-UHFFFAOYSA-N 0.000 description 1
- KGKGSIUWJCAFPX-UHFFFAOYSA-N Chlorthiamide Chemical compound NC(=S)C1=C(Cl)C=CC=C1Cl KGKGSIUWJCAFPX-UHFFFAOYSA-N 0.000 description 1
- JXCGFZXSOMJFOA-UHFFFAOYSA-N Chlortoluron Chemical compound CN(C)C(=O)NC1=CC=C(C)C(Cl)=C1 JXCGFZXSOMJFOA-UHFFFAOYSA-N 0.000 description 1
- 229940075419 Choline Hydroxide Drugs 0.000 description 1
- QMTNOLKHSWIQBE-FGTMMUONSA-N Cinmethylin Chemical compound O([C@H]1[C@]2(C)CC[C@@](O2)(C1)C(C)C)CC1=CC=CC=C1C QMTNOLKHSWIQBE-FGTMMUONSA-N 0.000 description 1
- WMLPCIHUFDKWJU-UHFFFAOYSA-N Cinosulfuron Chemical compound COCCOC1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(OC)=NC(OC)=N1 WMLPCIHUFDKWJU-UHFFFAOYSA-N 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- BOHUJVIRMMTWGG-UHFFFAOYSA-M ClC1=NC=C(C(=N1)C(=O)[O-])OC Chemical compound ClC1=NC=C(C(=N1)C(=O)[O-])OC BOHUJVIRMMTWGG-UHFFFAOYSA-M 0.000 description 1
- 239000005497 Clethodim Substances 0.000 description 1
- 239000005499 Clomazone Substances 0.000 description 1
- KIEDNEWSYUYDSN-UHFFFAOYSA-N Clomazone Chemical compound O=C1C(C)(C)CON1CC1=CC=CC=C1Cl KIEDNEWSYUYDSN-UHFFFAOYSA-N 0.000 description 1
- RKEPXZFDMPAEAN-UHFFFAOYSA-N Clomeprop Chemical compound C=1C=CC=CC=1NC(=O)C(C)OC1=CC(Cl)=C(C)C(Cl)=C1 RKEPXZFDMPAEAN-UHFFFAOYSA-N 0.000 description 1
- 239000005500 Clopyralid Substances 0.000 description 1
- HUBANNPOLNYSAD-UHFFFAOYSA-N Clopyralid Chemical compound OC(=O)C1=NC(Cl)=CC=C1Cl HUBANNPOLNYSAD-UHFFFAOYSA-N 0.000 description 1
- BIKACRYIQSLICJ-UHFFFAOYSA-N Cloransulam-methyl Chemical group N=1N2C(OCC)=NC(F)=CC2=NC=1S(=O)(=O)NC1=C(Cl)C=CC=C1C(=O)OC BIKACRYIQSLICJ-UHFFFAOYSA-N 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- 241000207894 Convolvulus arvensis Species 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L Copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- DNPSYFHJYIRREW-UHFFFAOYSA-N Credazine Chemical compound CC1=CC=CC=C1OC1=CC=CN=N1 DNPSYFHJYIRREW-UHFFFAOYSA-N 0.000 description 1
- VYNOULHXXDFBLU-UHFFFAOYSA-N Cumyluron Chemical compound C=1C=CC=CC=1C(C)(C)NC(=O)NCC1=CC=CC=C1Cl VYNOULHXXDFBLU-UHFFFAOYSA-N 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N Cyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- DFCAFRGABIXSDS-UHFFFAOYSA-N Cycloate Chemical compound CCSC(=O)N(CC)C1CCCCC1 DFCAFRGABIXSDS-UHFFFAOYSA-N 0.000 description 1
- JHIVVAPYMSGYDF-UHFFFAOYSA-N Cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 1
- OFSLKOLYLQSJPB-UHFFFAOYSA-N Cyclosulfamuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)NC=2C(=CC=CC=2)C(=O)C2CC2)=N1 OFSLKOLYLQSJPB-UHFFFAOYSA-N 0.000 description 1
- 239000005501 Cycloxydim Substances 0.000 description 1
- DQZCVNGCTZLGAQ-UHFFFAOYSA-N Cycluron Chemical compound CN(C)C(=O)NC1CCCCCCC1 DQZCVNGCTZLGAQ-UHFFFAOYSA-N 0.000 description 1
- 239000005502 Cyhalofop-butyl Substances 0.000 description 1
- TYIYMOAHACZAMQ-CQSZACIVSA-N Cyhalofop-butyl Chemical group C1=CC(O[C@H](C)C(=O)OCCCC)=CC=C1OC1=CC=C(C#N)C=C1F TYIYMOAHACZAMQ-CQSZACIVSA-N 0.000 description 1
- FMGYKKMPNATWHP-UHFFFAOYSA-N Cyperquat Chemical compound C1=C[N+](C)=CC=C1C1=CC=CC=C1 FMGYKKMPNATWHP-UHFFFAOYSA-N 0.000 description 1
- PLQDLOBGKJCDSZ-UHFFFAOYSA-N Cypromid Chemical compound C1=C(Cl)C(Cl)=CC=C1NC(=O)C1CC1 PLQDLOBGKJCDSZ-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical class OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-N Dalapon Chemical compound CC(Cl)(Cl)C(O)=O NDUPDOJHUQKPAG-UHFFFAOYSA-N 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 235000002206 Daucus carota subsp carota Nutrition 0.000 description 1
- 239000005644 Dazomet Substances 0.000 description 1
- QAYICIQNSGETAS-UHFFFAOYSA-N Dazomet Chemical compound CN1CSC(=S)N(C)C1 QAYICIQNSGETAS-UHFFFAOYSA-N 0.000 description 1
- BIQOEDQVNIYWPQ-UHFFFAOYSA-N Delachlor Chemical compound CC(C)COCN(C(=O)CCl)C1=C(C)C=CC=C1C BIQOEDQVNIYWPQ-UHFFFAOYSA-N 0.000 description 1
- 239000005503 Desmedipham Substances 0.000 description 1
- HCRWJJJUKUVORR-UHFFFAOYSA-N Desmetryn Chemical compound CNC1=NC(NC(C)C)=NC(SC)=N1 HCRWJJJUKUVORR-UHFFFAOYSA-N 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Chemical compound CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- SPANOECCGNXGNR-UITAMQMPSA-N Diallat Chemical compound CC(C)N(C(C)C)C(=O)SC\C(Cl)=C\Cl SPANOECCGNXGNR-UITAMQMPSA-N 0.000 description 1
- XTJFFFGAUHQWII-UHFFFAOYSA-N Dibutyl adipate Chemical compound CCCCOC(=O)CCCCC(=O)OCCCC XTJFFFGAUHQWII-UHFFFAOYSA-N 0.000 description 1
- YRMLFORXOOIJDR-UHFFFAOYSA-N Dichlormid Chemical compound ClC(Cl)C(=O)N(CC=C)CC=C YRMLFORXOOIJDR-UHFFFAOYSA-N 0.000 description 1
- MZHCENGPTKEIGP-UHFFFAOYSA-N Dichlorprop Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1Cl MZHCENGPTKEIGP-UHFFFAOYSA-N 0.000 description 1
- 239000005505 Dichlorprop-P Substances 0.000 description 1
- 239000005506 Diclofop Substances 0.000 description 1
- OOLBCHYXZDXLDS-UHFFFAOYSA-N Diclofop Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CC=C(Cl)C=C1Cl OOLBCHYXZDXLDS-UHFFFAOYSA-N 0.000 description 1
- PPJXIHLNYDVTDI-UHFFFAOYSA-N Dicloralurea Chemical compound ClC(Cl)(Cl)C(O)NC(=O)NC(O)C(Cl)(Cl)Cl PPJXIHLNYDVTDI-UHFFFAOYSA-N 0.000 description 1
- QNXAVFXEJCPCJO-UHFFFAOYSA-N Diclosulam Chemical compound N=1N2C(OCC)=NC(F)=CC2=NC=1S(=O)(=O)NC1=C(Cl)C=CC=C1Cl QNXAVFXEJCPCJO-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N Diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- YJVUGZMEFMKALF-UHFFFAOYSA-N Difenoxuron Chemical compound C1=CC(OC)=CC=C1OC1=CC=CC(NC(=O)N(C)C)=C1 YJVUGZMEFMKALF-UHFFFAOYSA-N 0.000 description 1
- 239000005507 Diflufenican Substances 0.000 description 1
- DHWRNDJOGMTCPB-UHFFFAOYSA-N Dimefuron Chemical compound ClC1=CC(NC(=O)N(C)C)=CC=C1N1C(=O)OC(C(C)(C)C)=N1 DHWRNDJOGMTCPB-UHFFFAOYSA-N 0.000 description 1
- 239000005508 Dimethachlor Substances 0.000 description 1
- IKYICRRUVNIHPP-UHFFFAOYSA-N Dimethametryn Chemical compound CCNC1=NC(NC(C)C(C)C)=NC(SC)=N1 IKYICRRUVNIHPP-UHFFFAOYSA-N 0.000 description 1
- JLYFCTQDENRSOL-UHFFFAOYSA-N Dimethenamid Chemical compound COCC(C)N(C(=O)CCl)C=1C(C)=CSC=1C JLYFCTQDENRSOL-UHFFFAOYSA-N 0.000 description 1
- 239000005509 Dimethenamid-P Substances 0.000 description 1
- FVCPXLWAKNJIKK-UHFFFAOYSA-N Dimexano Chemical group COC(=S)SSC(=S)OC FVCPXLWAKNJIKK-UHFFFAOYSA-N 0.000 description 1
- 241000771421 Dinebra panicoides Species 0.000 description 1
- OFDYMSKSGFSLLM-UHFFFAOYSA-N Dinitramine Chemical compound CCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C(N)=C1[N+]([O-])=O OFDYMSKSGFSLLM-UHFFFAOYSA-N 0.000 description 1
- OWZPCEFYPSAJFR-UHFFFAOYSA-N Dinoseb Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O OWZPCEFYPSAJFR-UHFFFAOYSA-N 0.000 description 1
- IIPZYDQGBIWLBU-UHFFFAOYSA-N Dinoterb Chemical compound CC(C)(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O IIPZYDQGBIWLBU-UHFFFAOYSA-N 0.000 description 1
- APSBXTVYXVQYAB-UHFFFAOYSA-M Dioctyl sodium sulfosuccinate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 1
- QAHFOPIILNICLA-UHFFFAOYSA-N Diphenamid Chemical compound C=1C=CC=CC=1C(C(=O)N(C)C)C1=CC=CC=C1 QAHFOPIILNICLA-UHFFFAOYSA-N 0.000 description 1
- NPWMZOGDXOFZIN-UHFFFAOYSA-N Dipropetryn Chemical compound CCSC1=NC(NC(C)C)=NC(NC(C)C)=N1 NPWMZOGDXOFZIN-UHFFFAOYSA-N 0.000 description 1
- 239000005630 Diquat Substances 0.000 description 1
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N Dirurol Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L Disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- HJEINPVZRDJRBY-UHFFFAOYSA-N Disul Chemical compound OS(=O)(=O)OCCOC1=CC=C(Cl)C=C1Cl HJEINPVZRDJRBY-UHFFFAOYSA-N 0.000 description 1
- DOFZAZXDOSGAJZ-UHFFFAOYSA-N Disulfoton Chemical compound CCOP(=S)(OCC)SCCSCC DOFZAZXDOSGAJZ-UHFFFAOYSA-N 0.000 description 1
- YUBJPYNSGLJZPQ-UHFFFAOYSA-N Dithiopyr Chemical compound CSC(=O)C1=C(C(F)F)N=C(C(F)(F)F)C(C(=O)SC)=C1CC(C)C YUBJPYNSGLJZPQ-UHFFFAOYSA-N 0.000 description 1
- 239000005510 Diuron Substances 0.000 description 1
- 108030002048 EC 1.10.3.9 Proteins 0.000 description 1
- 108030005866 EC 1.97.1.12 Proteins 0.000 description 1
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 241000400644 Echinochloa oryzicola Species 0.000 description 1
- IAUFMJOLSFEAIJ-UHFFFAOYSA-N Eglinazine Chemical compound CCNC1=NC(Cl)=NC(NCC(O)=O)=N1 IAUFMJOLSFEAIJ-UHFFFAOYSA-N 0.000 description 1
- 241000202829 Eleocharis Species 0.000 description 1
- KMHZPJNVPCAUMN-UHFFFAOYSA-N Erbon Chemical compound CC(Cl)(Cl)C(=O)OCCOC1=CC(Cl)=C(Cl)C=C1Cl KMHZPJNVPCAUMN-UHFFFAOYSA-N 0.000 description 1
- 244000039154 Erica Species 0.000 description 1
- 235000009967 Erodium cicutarium Nutrition 0.000 description 1
- BXEHUCNTIZGSOJ-UHFFFAOYSA-N Esprocarb Chemical compound CC(C)C(C)N(CC)C(=O)SCC1=CC=CC=C1 BXEHUCNTIZGSOJ-UHFFFAOYSA-N 0.000 description 1
- PTFJIKYUEPWBMS-UHFFFAOYSA-N Ethalfluralin Chemical compound CC(=C)CN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O PTFJIKYUEPWBMS-UHFFFAOYSA-N 0.000 description 1
- SBNKFTQSBPKMBZ-UHFFFAOYSA-N Ethenzamide Chemical compound CCOC1=CC=CC=C1C(N)=O SBNKFTQSBPKMBZ-UHFFFAOYSA-N 0.000 description 1
- KCOCSOWTADCKOL-UHFFFAOYSA-N Ethidimuron Chemical compound CCS(=O)(=O)C1=NN=C(N(C)C(=O)NC)S1 KCOCSOWTADCKOL-UHFFFAOYSA-N 0.000 description 1
- WARIWGPBHKPYON-UHFFFAOYSA-N Ethiolate Chemical compound CCSC(=O)N(CC)CC WARIWGPBHKPYON-UHFFFAOYSA-N 0.000 description 1
- 239000005512 Ethofumesate Substances 0.000 description 1
- UWVKRNOCDUPIDM-UHFFFAOYSA-N Ethoxysulfuron Chemical compound CCOC1=CC=CC=C1OS(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 UWVKRNOCDUPIDM-UHFFFAOYSA-N 0.000 description 1
- ICWUMLXQKFTJMH-UHFFFAOYSA-N Etobenzanid Chemical compound C1=CC(OCOCC)=CC=C1C(=O)NC1=CC=CC(Cl)=C1Cl ICWUMLXQKFTJMH-UHFFFAOYSA-N 0.000 description 1
- 229910017056 FCl Inorganic materials 0.000 description 1
- GMBRUAIJEFRHFQ-UHFFFAOYSA-N Fenchlorazole-ethyl Chemical group N1=C(C(=O)OCC)N=C(C(Cl)(Cl)Cl)N1C1=CC=C(Cl)C=C1Cl GMBRUAIJEFRHFQ-UHFFFAOYSA-N 0.000 description 1
- NRFQZTCQAYEXEE-UHFFFAOYSA-N Fenclorim Chemical compound ClC1=CC(Cl)=NC(C=2C=CC=CC=2)=N1 NRFQZTCQAYEXEE-UHFFFAOYSA-N 0.000 description 1
- ZLSWBLPERHFHIS-UHFFFAOYSA-N Fenoprop Chemical compound OC(=O)C(C)OC1=CC(Cl)=C(Cl)C=C1Cl ZLSWBLPERHFHIS-UHFFFAOYSA-N 0.000 description 1
- WHWHBAUZDPEHEM-UHFFFAOYSA-N Fenthiaprop Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC2=CC=C(Cl)C=C2S1 WHWHBAUZDPEHEM-UHFFFAOYSA-N 0.000 description 1
- LLQPHQFNMLZJMP-UHFFFAOYSA-N Fentrazamide Chemical compound N1=NN(C=2C(=CC=CC=2)Cl)C(=O)N1C(=O)N(CC)C1CCCCC1 LLQPHQFNMLZJMP-UHFFFAOYSA-N 0.000 description 1
- XXOYNJXVWVNOOJ-UHFFFAOYSA-N Fenuron Chemical compound CN(C)C(=O)NC1=CC=CC=C1 XXOYNJXVWVNOOJ-UHFFFAOYSA-N 0.000 description 1
- 244000295633 Fimbristylis miliacea Species 0.000 description 1
- YQVMVCCFZCMYQB-UHFFFAOYSA-N Flamprop Chemical compound C=1C=C(F)C(Cl)=CC=1N(C(C)C(O)=O)C(=O)C1=CC=CC=C1 YQVMVCCFZCMYQB-UHFFFAOYSA-N 0.000 description 1
- YQVMVCCFZCMYQB-SNVBAGLBSA-N Flamprop-M Chemical compound C=1C=C(F)C(Cl)=CC=1N([C@H](C)C(O)=O)C(=O)C1=CC=CC=C1 YQVMVCCFZCMYQB-SNVBAGLBSA-N 0.000 description 1
- 239000005514 Flazasulfuron Substances 0.000 description 1
- HWATZEJQIXKWQS-UHFFFAOYSA-N Flazasulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CN=2)C(F)(F)F)=N1 HWATZEJQIXKWQS-UHFFFAOYSA-N 0.000 description 1
- 239000005529 Florasulam Substances 0.000 description 1
- QZXATCCPQKOEIH-UHFFFAOYSA-N Florasulam Chemical compound N=1N2C(OC)=NC=C(F)C2=NC=1S(=O)(=O)NC1=C(F)C=CC=C1F QZXATCCPQKOEIH-UHFFFAOYSA-N 0.000 description 1
- FICWGWVVIRLNRB-UHFFFAOYSA-N Flucetosulfuron Chemical compound COCC(=O)OC(C(C)F)C1=NC=CC=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 FICWGWVVIRLNRB-UHFFFAOYSA-N 0.000 description 1
- MNFMIVVPXOGUMX-UHFFFAOYSA-N Fluchloralin Chemical compound CCCN(CCCl)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O MNFMIVVPXOGUMX-UHFFFAOYSA-N 0.000 description 1
- 239000005531 Flufenacet Substances 0.000 description 1
- RXCPQSJAVKGONC-UHFFFAOYSA-N Flumetsulam Chemical compound N1=C2N=C(C)C=CN2N=C1S(=O)(=O)NC1=C(F)C=CC=C1F RXCPQSJAVKGONC-UHFFFAOYSA-N 0.000 description 1
- IRECWLYBCAZIJM-UHFFFAOYSA-N Flumiclorac pentyl Chemical group C1=C(Cl)C(OCC(=O)OCCCCC)=CC(N2C(C3=C(CCCC3)C2=O)=O)=C1F IRECWLYBCAZIJM-UHFFFAOYSA-N 0.000 description 1
- FOUWCSDKDDHKQP-UHFFFAOYSA-N Flumioxazin Chemical compound FC1=CC=2OCC(=O)N(CC#C)C=2C=C1N(C1=O)C(=O)C2=C1CCCC2 FOUWCSDKDDHKQP-UHFFFAOYSA-N 0.000 description 1
- ONNQFZOZHDEENE-UHFFFAOYSA-N Flumipropyn Chemical compound C1=C(Cl)C(OC(C)C#C)=CC(N2C(C3=C(CCCC3)C2=O)=O)=C1F ONNQFZOZHDEENE-UHFFFAOYSA-N 0.000 description 1
- 239000005533 Fluometuron Substances 0.000 description 1
- RZILCCPWPBTYDO-UHFFFAOYSA-N Fluometuron Chemical compound CN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 RZILCCPWPBTYDO-UHFFFAOYSA-N 0.000 description 1
- HHMCAJWVGYGUEF-UHFFFAOYSA-N Fluorodifen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O HHMCAJWVGYGUEF-UHFFFAOYSA-N 0.000 description 1
- DHAHEVIQIYRFRG-UHFFFAOYSA-N Fluoroglycofen Chemical compound C1=C([N+]([O-])=O)C(C(=O)OCC(=O)O)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 DHAHEVIQIYRFRG-UHFFFAOYSA-N 0.000 description 1
- QJYOCYOOZHULNN-UHFFFAOYSA-N Fluoromidine Chemical compound C1=C(Cl)C=C2NC(C(F)(F)F)=NC2=N1 QJYOCYOOZHULNN-UHFFFAOYSA-N 0.000 description 1
- AOQMRUTZEYVDIL-UHFFFAOYSA-N Flupoxam Chemical compound C=1C=C(Cl)C(COCC(F)(F)C(F)(F)F)=CC=1N1N=C(C(=O)N)N=C1C1=CC=CC=C1 AOQMRUTZEYVDIL-UHFFFAOYSA-N 0.000 description 1
- PXRROZVNOOEPPZ-UHFFFAOYSA-N Flupropanate Chemical compound OC(=O)C(F)(F)C(F)F PXRROZVNOOEPPZ-UHFFFAOYSA-N 0.000 description 1
- YWBVHLJPRPCRSD-UHFFFAOYSA-N Fluridone Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC=C1 YWBVHLJPRPCRSD-UHFFFAOYSA-N 0.000 description 1
- 239000005535 Flurochloridone Substances 0.000 description 1
- OQZCSNDVOWYALR-UHFFFAOYSA-N Flurochloridone Chemical compound FC(F)(F)C1=CC=CC(N2C(C(Cl)C(CCl)C2)=O)=C1 OQZCSNDVOWYALR-UHFFFAOYSA-N 0.000 description 1
- 239000005558 Fluroxypyr Substances 0.000 description 1
- MEFQWPUMEMWTJP-UHFFFAOYSA-N Fluroxypyr Chemical compound NC1=C(Cl)C(F)=NC(OCC(O)=O)=C1Cl MEFQWPUMEMWTJP-UHFFFAOYSA-N 0.000 description 1
- 239000005559 Flurtamone Substances 0.000 description 1
- XWROTTLWMHCFEC-LGMDPLHJSA-N Fluthiacet Chemical compound C1=C(Cl)C(SCC(=O)O)=CC(\N=C/2N3CCCCN3C(=O)S\2)=C1F XWROTTLWMHCFEC-LGMDPLHJSA-N 0.000 description 1
- BGZZWXTVIYUUEY-UHFFFAOYSA-N Fomesafen Chemical compound C1=C([N+]([O-])=O)C(C(=O)NS(=O)(=O)C)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 BGZZWXTVIYUUEY-UHFFFAOYSA-N 0.000 description 1
- 239000005560 Foramsulfuron Substances 0.000 description 1
- UCHDFLNGIZUADY-UHFFFAOYSA-N Fosamine Chemical compound CCOP(O)(=O)C(N)=O UCHDFLNGIZUADY-UHFFFAOYSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 239000005563 Halauxifen-methyl Substances 0.000 description 1
- 239000005564 Halosulfuron methyl Substances 0.000 description 1
- FMGZEUWROYGLAY-UHFFFAOYSA-N Halosulfuron-methyl Chemical group ClC1=NN(C)C(S(=O)(=O)NC(=O)NC=2N=C(OC)C=C(OC)N=2)=C1C(=O)OC FMGZEUWROYGLAY-UHFFFAOYSA-N 0.000 description 1
- MJAWMRVEIWPJRW-UHFFFAOYSA-N Haloxydine Chemical compound FC=1NC(F)=C(Cl)C(=O)C=1Cl MJAWMRVEIWPJRW-UHFFFAOYSA-N 0.000 description 1
- MFSWTRQUCLNFOM-UHFFFAOYSA-N Haloxyfop methyl Chemical group C1=CC(OC(C)C(=O)OC)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl MFSWTRQUCLNFOM-UHFFFAOYSA-N 0.000 description 1
- 240000003812 Heteranthera reniformis Species 0.000 description 1
- 241000169134 Heteranthera rotundifolia Species 0.000 description 1
- DOJXGHGHTWFZHK-UHFFFAOYSA-N Hexachloroacetone Chemical compound ClC(Cl)(Cl)C(=O)C(Cl)(Cl)Cl DOJXGHGHTWFZHK-UHFFFAOYSA-N 0.000 description 1
- DITNVAZRXJOPSJ-UHFFFAOYSA-N Hexaflurate Chemical compound [K+].F[As-](F)(F)(F)(F)F DITNVAZRXJOPSJ-UHFFFAOYSA-N 0.000 description 1
- CAWXEEYDBZRFPE-UHFFFAOYSA-N Hexazinone Chemical compound O=C1N(C)C(N(C)C)=NC(=O)N1C1CCCCC1 CAWXEEYDBZRFPE-UHFFFAOYSA-N 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- KFEFNHNXZQYTEW-UHFFFAOYSA-N Imazamethabenz Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=CC(C)=CC=C1C(O)=O KFEFNHNXZQYTEW-UHFFFAOYSA-N 0.000 description 1
- 239000005566 Imazamox Substances 0.000 description 1
- PVSGXWMWNRGTKE-UHFFFAOYSA-N Imazapic Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC=C(C)C=C1C(O)=O PVSGXWMWNRGTKE-UHFFFAOYSA-N 0.000 description 1
- CLQMBPJKHLGMQK-UHFFFAOYSA-N Imazapyr Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC=CC=C1C(O)=O CLQMBPJKHLGMQK-UHFFFAOYSA-N 0.000 description 1
- 239000005981 Imazaquin Substances 0.000 description 1
- CABMTIJINOIHOD-UHFFFAOYSA-N Imazaquin Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC2=CC=CC=C2C=C1C(O)=O CABMTIJINOIHOD-UHFFFAOYSA-N 0.000 description 1
- XVOKUMIPKHGGTN-UHFFFAOYSA-N Imazethapyr Chemical compound OC(=O)C1=CC(CC)=CN=C1C1=NC(C)(C(C)C)C(=O)N1 XVOKUMIPKHGGTN-UHFFFAOYSA-N 0.000 description 1
- 239000005567 Imazosulfuron Substances 0.000 description 1
- NAGRVUXEKKZNHT-UHFFFAOYSA-N Imazosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2N3C=CC=CC3=NC=2Cl)=N1 NAGRVUXEKKZNHT-UHFFFAOYSA-N 0.000 description 1
- PMAAYIYCDXGUAP-UHFFFAOYSA-N Indanofan Chemical compound O=C1C2=CC=CC=C2C(=O)C1(CC)CC1(C=2C=C(Cl)C=CC=2)CO1 PMAAYIYCDXGUAP-UHFFFAOYSA-N 0.000 description 1
- 206010022114 Injury Diseases 0.000 description 1
- 239000005568 Iodosulfuron Substances 0.000 description 1
- OWYWGLHRNBIFJP-UHFFFAOYSA-N Ipazine Chemical compound CCN(CC)C1=NC(Cl)=NC(NC(C)C)=N1 OWYWGLHRNBIFJP-UHFFFAOYSA-N 0.000 description 1
- 241000032989 Ipomoea lacunosa Species 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L Iron(II) sulfate Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- SBYAVOHNDJTVPA-UHFFFAOYSA-N Isocarbamid Chemical compound CC(C)CNC(=O)N1CCNC1=O SBYAVOHNDJTVPA-UHFFFAOYSA-N 0.000 description 1
- PSYBGEADHLUXCS-UHFFFAOYSA-N Isocil Chemical compound CC(C)N1C(=O)NC(C)=C(Br)C1=O PSYBGEADHLUXCS-UHFFFAOYSA-N 0.000 description 1
- MZTLOILRKLUURT-NTUHNPAUSA-N Isomethiozin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1\N=C\C(C)C MZTLOILRKLUURT-NTUHNPAUSA-N 0.000 description 1
- QOBMKVRRANLSMZ-UHFFFAOYSA-N Isonoruron Chemical compound C1CC2C3C(NC(=O)N(C)C)CCC3C1C2 QOBMKVRRANLSMZ-UHFFFAOYSA-N 0.000 description 1
- NEKOXWSIMFDGMA-UHFFFAOYSA-N Isopropalin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(C)C)C=C1[N+]([O-])=O NEKOXWSIMFDGMA-UHFFFAOYSA-N 0.000 description 1
- AXISYYRBXTVTFY-UHFFFAOYSA-N Isopropyl myristate Chemical compound CCCCCCCCCCCCCC(=O)OC(C)C AXISYYRBXTVTFY-UHFFFAOYSA-N 0.000 description 1
- JLLJHQLUZAKJFH-UHFFFAOYSA-N Isouron Chemical compound CN(C)C(=O)NC=1C=C(C(C)(C)C)ON=1 JLLJHQLUZAKJFH-UHFFFAOYSA-N 0.000 description 1
- 239000005570 Isoxaben Substances 0.000 description 1
- PMHURSZHKKJGBM-UHFFFAOYSA-N Isoxaben Chemical compound O1N=C(C(C)(CC)CC)C=C1NC(=O)C1=C(OC)C=CC=C1OC PMHURSZHKKJGBM-UHFFFAOYSA-N 0.000 description 1
- 239000005571 Isoxaflutole Substances 0.000 description 1
- ANFHKXSOSRDDRQ-UHFFFAOYSA-N Isoxapyrifop Chemical compound C1CCON1C(=O)C(C)OC(C=C1)=CC=C1OC1=NC=C(Cl)C=C1Cl ANFHKXSOSRDDRQ-UHFFFAOYSA-N 0.000 description 1
- 241000171285 Jacquemontia tamnifolia Species 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- UQVYUTAMNICZNI-UHFFFAOYSA-N Karbutilate Chemical compound CN(C)C(=O)NC1=CC=CC(NC(=O)OC(C)(C)C)=C1 UQVYUTAMNICZNI-UHFFFAOYSA-N 0.000 description 1
- CONWAEURSVPLRM-UHFFFAOYSA-N Lactofen Chemical compound C1=C([N+]([O-])=O)C(C(=O)OC(C)C(=O)OCC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 CONWAEURSVPLRM-UHFFFAOYSA-N 0.000 description 1
- 235000009193 Lamium purpureum Nutrition 0.000 description 1
- 239000005572 Lenacil Substances 0.000 description 1
- 244000222035 Leptochloa panicea Species 0.000 description 1
- 240000007038 Lindernia dubia Species 0.000 description 1
- 239000005573 Linuron Substances 0.000 description 1
- AZFKQCNGMSSWDS-UHFFFAOYSA-N MCPA-thioethyl Chemical group CCSC(=O)COC1=CC=C(Cl)C=C1C AZFKQCNGMSSWDS-UHFFFAOYSA-N 0.000 description 1
- 239000005575 MCPB Substances 0.000 description 1
- LLWADFLAOKUBDR-UHFFFAOYSA-N MCPB Chemical compound CC1=CC(Cl)=CC=C1OCCCC(O)=O LLWADFLAOKUBDR-UHFFFAOYSA-N 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- 240000006223 Matricaria chamomilla Species 0.000 description 1
- 235000004429 Matricaria chamomilla var recutita Nutrition 0.000 description 1
- 240000008924 Matricaria chamomilla var. recutita Species 0.000 description 1
- WNTGYJSOUMFZEP-UHFFFAOYSA-N Mecoprop Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-UHFFFAOYSA-N 0.000 description 1
- 239000005576 Mecoprop-P Substances 0.000 description 1
- OKIBNKKYNPBDRS-UHFFFAOYSA-N Mefluidide Chemical compound CC(=O)NC1=CC(NS(=O)(=O)C(F)(F)F)=C(C)C=C1C OKIBNKKYNPBDRS-UHFFFAOYSA-N 0.000 description 1
- 239000005577 Mesosulfuron Substances 0.000 description 1
- 239000005578 Mesotrione Substances 0.000 description 1
- KPUREKXXPHOJQT-UHFFFAOYSA-N Mesotrione Chemical compound [O-][N+](=O)C1=CC(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O KPUREKXXPHOJQT-UHFFFAOYSA-N 0.000 description 1
- 230000035633 Metabolized Effects 0.000 description 1
- 239000002169 Metam Substances 0.000 description 1
- 239000005579 Metamitron Substances 0.000 description 1
- 239000005580 Metazachlor Substances 0.000 description 1
- RRVIAQKBTUQODI-UHFFFAOYSA-N Methabenzthiazuron Chemical compound C1=CC=C2SC(N(C)C(=O)NC)=NC2=C1 RRVIAQKBTUQODI-UHFFFAOYSA-N 0.000 description 1
- LRUUNMYPIBZBQH-UHFFFAOYSA-N Methazole Chemical compound O=C1N(C)C(=O)ON1C1=CC=C(Cl)C(Cl)=C1 LRUUNMYPIBZBQH-UHFFFAOYSA-N 0.000 description 1
- MMCJEAKINANSOL-UHFFFAOYSA-N Methiuron Chemical compound CN(C)C(=S)NC1=CC=CC(C)=C1 MMCJEAKINANSOL-UHFFFAOYSA-N 0.000 description 1
- DDUIUBPJPOKOMV-UHFFFAOYSA-N Methoprotryne Chemical compound COCCCNC1=NC(NC(C)C)=NC(SC)=N1 DDUIUBPJPOKOMV-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N Methyl iodide Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- HYVVJDQGXFXBRZ-UHFFFAOYSA-N Methylcarbamodithioic acid K salt Chemical compound CNC(S)=S HYVVJDQGXFXBRZ-UHFFFAOYSA-N 0.000 description 1
- FMINYZXVCTYSNY-UHFFFAOYSA-N Methyldymron Chemical compound C=1C=CC=CC=1N(C)C(=O)NC(C)(C)C1=CC=CC=C1 FMINYZXVCTYSNY-UHFFFAOYSA-N 0.000 description 1
- 239000005581 Metobromuron Substances 0.000 description 1
- WLFDQEVORAMCIM-UHFFFAOYSA-N Metobromuron Chemical compound CON(C)C(=O)NC1=CC=C(Br)C=C1 WLFDQEVORAMCIM-UHFFFAOYSA-N 0.000 description 1
- WVQBLGZPHOPPFO-UHFFFAOYSA-N Metolachlor Chemical compound CCC1=CC=CC(C)=C1N(C(C)COC)C(=O)CCl WVQBLGZPHOPPFO-UHFFFAOYSA-N 0.000 description 1
- 239000005582 Metosulam Substances 0.000 description 1
- VGHPMIFEKOFHHQ-UHFFFAOYSA-N Metosulam Chemical compound N1=C2N=C(OC)C=C(OC)N2N=C1S(=O)(=O)NC1=C(Cl)C=CC(C)=C1Cl VGHPMIFEKOFHHQ-UHFFFAOYSA-N 0.000 description 1
- DSRNRYQBBJQVCW-UHFFFAOYSA-N Metoxuron Chemical compound COC1=CC=C(NC(=O)N(C)C)C=C1Cl DSRNRYQBBJQVCW-UHFFFAOYSA-N 0.000 description 1
- 239000005583 Metribuzin Substances 0.000 description 1
- FOXFZRUHNHCZPX-UHFFFAOYSA-N Metribuzin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1N FOXFZRUHNHCZPX-UHFFFAOYSA-N 0.000 description 1
- 210000004688 Microtubules Anatomy 0.000 description 1
- 102000028664 Microtubules Human genes 0.000 description 1
- 108091022031 Microtubules Proteins 0.000 description 1
- 241000367571 Mohoua ochrocephala Species 0.000 description 1
- DEDOPGXGGQYYMW-UHFFFAOYSA-N Molinate Chemical compound CCSC(=O)N1CCCCCC1 DEDOPGXGGQYYMW-UHFFFAOYSA-N 0.000 description 1
- KXGYBSNVFXBPNO-UHFFFAOYSA-N Monalide Chemical compound CCCC(C)(C)C(=O)NC1=CC=C(Cl)C=C1 KXGYBSNVFXBPNO-UHFFFAOYSA-N 0.000 description 1
- 241000169076 Monochoria korsakowii Species 0.000 description 1
- 240000000178 Monochoria vaginalis Species 0.000 description 1
- LKJPSUCKSLORMF-UHFFFAOYSA-N Monolinuron Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C=C1 LKJPSUCKSLORMF-UHFFFAOYSA-N 0.000 description 1
- JITOKQVGRJSHHA-UHFFFAOYSA-M Monosodium methyl arsenate Chemical compound [Na+].C[As](O)([O-])=O JITOKQVGRJSHHA-UHFFFAOYSA-M 0.000 description 1
- LVPGGWVHPIAEMC-UHFFFAOYSA-L Morfamquat Chemical compound [Cl-].[Cl-].CC1COCC(C)N1C(=O)C[N+]1=CC=C(C=2C=C[N+](CC(=O)N3C(COCC3C)C)=CC=2)C=C1 LVPGGWVHPIAEMC-UHFFFAOYSA-L 0.000 description 1
- 235000003805 Musa ABB Group Nutrition 0.000 description 1
- WKQYAIDXQNGNIQ-UHFFFAOYSA-N N'-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=C(Cl)C(Cl)=C1 WKQYAIDXQNGNIQ-UHFFFAOYSA-N 0.000 description 1
- WXZVAROIGSFCFJ-UHFFFAOYSA-N N,N-diethyl-2-(naphthalen-1-yloxy)propanamide Chemical compound C1=CC=C2C(OC(C)C(=O)N(CC)CC)=CC=CC2=C1 WXZVAROIGSFCFJ-UHFFFAOYSA-N 0.000 description 1
- DRWWMFAZIDKURY-UHFFFAOYSA-N N-(2-methylprop-2-enyl)-2,6-dinitro-N-propyl-4-(trifluoromethyl)aniline Chemical compound CCCN(CC(C)=C)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O DRWWMFAZIDKURY-UHFFFAOYSA-N 0.000 description 1
- RGKLVVDHWRAWRO-UHFFFAOYSA-N N-(3,4-dichlorophenyl)-N-(dimethylcarbamoyl)-4-methoxybenzamide Chemical compound C1=CC(OC)=CC=C1C(=O)N(C(=O)N(C)C)C1=CC=C(Cl)C(Cl)=C1 RGKLVVDHWRAWRO-UHFFFAOYSA-N 0.000 description 1
- AIMMSOZBPYFASU-UHFFFAOYSA-N N-(4,6-dimethoxypyrimidin-2-yl)-N'-[3-(2,2,2-trifluoroethoxy)pyridin-1-ium-2-yl]sulfonylcarbamimidate Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CN=2)OCC(F)(F)F)=N1 AIMMSOZBPYFASU-UHFFFAOYSA-N 0.000 description 1
- CWKFPEBMTGKLKX-UHFFFAOYSA-N N-(4-fluorophenyl)-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxamide Chemical compound C1=CC(F)=CC=C1NC(=O)C1=CC=CC(OC=2C=C(C=CC=2)C(F)(F)F)=N1 CWKFPEBMTGKLKX-UHFFFAOYSA-N 0.000 description 1
- GLBLPMUBLHYFCW-UHFFFAOYSA-N N-(5,7-dimethoxy-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-methoxy-4-(trifluoromethyl)pyridine-3-sulfonamide Chemical compound N1=C2N=C(OC)C=C(OC)N2N=C1NS(=O)(=O)C1=C(OC)N=CC=C1C(F)(F)F GLBLPMUBLHYFCW-UHFFFAOYSA-N 0.000 description 1
- BZRUVKZGXNSXMB-UHFFFAOYSA-N N-(butan-2-yl)-6-chloro-N'-ethyl-1,3,5-triazine-2,4-diamine Chemical compound CCNC1=NC(Cl)=NC(NC(C)CC)=N1 BZRUVKZGXNSXMB-UHFFFAOYSA-N 0.000 description 1
- ZJMZZNVGNSWOOM-UHFFFAOYSA-N N-(butan-2-yl)-N'-ethyl-6-methoxy-1,3,5-triazine-2,4-diamine Chemical compound CCNC1=NC(NC(C)CC)=NC(OC)=N1 ZJMZZNVGNSWOOM-UHFFFAOYSA-N 0.000 description 1
- KGMBZDZHRAFLBY-UHFFFAOYSA-N N-(butoxymethyl)-N-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide Chemical compound CCCCOCN(C(=O)CCl)C1=C(C)C=CC=C1C(C)(C)C KGMBZDZHRAFLBY-UHFFFAOYSA-N 0.000 description 1
- LKVOXDJKFRBRQV-UHFFFAOYSA-N N-(dimethyl-$l^{4}-sulfanylidene)-4-(dipropylamino)-3,5-dinitrobenzenesulfonamide Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(S(=O)(=O)N=S(C)C)C=C1[N+]([O-])=O LKVOXDJKFRBRQV-UHFFFAOYSA-N 0.000 description 1
- GBHVIWKSEHWFDD-UHFFFAOYSA-N N-[2-(4,6-dimethoxy-1,3,5-triazine-2-carbonyl)-6-fluorophenyl]-1,1-difluoro-N-methylmethanesulfonamide Chemical compound COC1=NC(OC)=NC(C(=O)C=2C(=C(F)C=CC=2)N(C)S(=O)(=O)C(F)F)=N1 GBHVIWKSEHWFDD-UHFFFAOYSA-N 0.000 description 1
- NTBVTCXMRYKRTB-UHFFFAOYSA-N N-[2-[(4,6-dimethoxypyrimidin-2-yl)-hydroxymethyl]-6-(methoxymethyl)phenyl]-1,1-difluoromethanesulfonamide Chemical compound COCC1=CC=CC(C(O)C=2N=C(OC)C=C(OC)N=2)=C1NS(=O)(=O)C(F)F NTBVTCXMRYKRTB-UHFFFAOYSA-N 0.000 description 1
- IDFXUDGCYIGBDC-UHFFFAOYSA-N N-[4-ethylsulfanyl-2-(trifluoromethyl)phenyl]methanesulfonamide Chemical compound CCSC1=CC=C(NS(C)(=O)=O)C(C(F)(F)F)=C1 IDFXUDGCYIGBDC-UHFFFAOYSA-N 0.000 description 1
- KDOKZLSGPVBDLS-UHFFFAOYSA-N N-[5-(1-chloro-2-methylpropan-2-yl)-1,3,4-thiadiazol-2-yl]cyclopropanecarboxamide Chemical compound S1C(C(C)(CCl)C)=NN=C1NC(=O)C1CC1 KDOKZLSGPVBDLS-UHFFFAOYSA-N 0.000 description 1
- CHEDHKBPPDKBQF-UPONEAKYSA-N N-[5-[(6S,7aR)-6-fluoro-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-2-chloro-4-fluorophenyl]-1-chloromethanesulfonamide Chemical compound N1([C@@H](C2=O)C[C@@H](C1)F)C(=O)N2C1=CC(NS(=O)(=O)CCl)=C(Cl)C=C1F CHEDHKBPPDKBQF-UPONEAKYSA-N 0.000 description 1
- HZDIJTXDRLNTIS-DAXSKMNVSA-N N-[[(Z)-but-2-enoxy]methyl]-2-chloro-N-(2,6-diethylphenyl)acetamide Chemical compound CCC1=CC=CC(CC)=C1N(COC\C=C/C)C(=O)CCl HZDIJTXDRLNTIS-DAXSKMNVSA-N 0.000 description 1
- VHEWQRWLIDWRMR-UHFFFAOYSA-N N-[methoxy-(4-methyl-2-nitrophenoxy)phosphinothioyl]propan-2-amine Chemical compound CC(C)NP(=S)(OC)OC1=CC=C(C)C=C1[N+]([O-])=O VHEWQRWLIDWRMR-UHFFFAOYSA-N 0.000 description 1
- FFQPZWRNXKPNPX-UHFFFAOYSA-N N-benzyl-2-[4-fluoro-3-(trifluoromethyl)phenoxy]butanamide Chemical compound C=1C=CC=CC=1CNC(=O)C(CC)OC1=CC=C(F)C(C(F)(F)F)=C1 FFQPZWRNXKPNPX-UHFFFAOYSA-N 0.000 description 1
- FVLVBVSILSHUAF-UHFFFAOYSA-N N-benzyl-3,5-dimethyl-N-propan-2-ylbenzamide Chemical compound C=1C(C)=CC(C)=CC=1C(=O)N(C(C)C)CC1=CC=CC=C1 FVLVBVSILSHUAF-UHFFFAOYSA-N 0.000 description 1
- DGPBHERUGBOSFZ-UHFFFAOYSA-N N-but-3-yn-2-yl-2-chloro-N-phenylacetamide Chemical compound C#CC(C)N(C(=O)CCl)C1=CC=CC=C1 DGPBHERUGBOSFZ-UHFFFAOYSA-N 0.000 description 1
- KCNUWLJAWRWKMO-UHFFFAOYSA-N N-ethyl-N-propyl-3-propylsulfonyl-1,2,4-triazole-1-carboxamide Chemical compound CCCN(CC)C(=O)N1C=NC(S(=O)(=O)CCC)=N1 KCNUWLJAWRWKMO-UHFFFAOYSA-N 0.000 description 1
- VHLJOTFFKVPIAA-UHFFFAOYSA-N N-phenyl-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide Chemical compound FC(F)(F)C1=CC=CC(OC=2C(=CC=CN=2)C(=O)NC=2C=CC=CC=2)=C1 VHLJOTFFKVPIAA-UHFFFAOYSA-N 0.000 description 1
- TYBVCNFSZGXGQJ-UHFFFAOYSA-M NC1=C(C(=NC(=C1F)Cl)C(=O)[O-])Cl Chemical compound NC1=C(C(=NC(=C1F)Cl)C(=O)[O-])Cl TYBVCNFSZGXGQJ-UHFFFAOYSA-M 0.000 description 1
- LVKTWOXHRYGDMM-UHFFFAOYSA-N Naproanilide Chemical compound C=1C=C2C=CC=CC2=CC=1OC(C)C(=O)NC1=CC=CC=C1 LVKTWOXHRYGDMM-UHFFFAOYSA-N 0.000 description 1
- 239000005585 Napropamide Substances 0.000 description 1
- CCGPUGMWYLICGL-UHFFFAOYSA-N Neburon Chemical compound CCCCN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 CCGPUGMWYLICGL-UHFFFAOYSA-N 0.000 description 1
- 239000005586 Nicosulfuron Substances 0.000 description 1
- UMKANAFDOQQUKE-UHFFFAOYSA-N Nitralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(S(C)(=O)=O)C=C1[N+]([O-])=O UMKANAFDOQQUKE-UHFFFAOYSA-N 0.000 description 1
- XITQUSLLOSKDTB-UHFFFAOYSA-N Nitrofen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(Cl)C=C1Cl XITQUSLLOSKDTB-UHFFFAOYSA-N 0.000 description 1
- YGLMVCVJLXREAK-UHFFFAOYSA-N Noruron Chemical compound C12CCCC2C2CC(NC(=O)N(C)C)C1C2 YGLMVCVJLXREAK-UHFFFAOYSA-N 0.000 description 1
- YFVIYGLLZWYWOI-UHFFFAOYSA-K O.O.[Na].Cl[Au](Cl)Cl Chemical compound O.O.[Na].Cl[Au](Cl)Cl YFVIYGLLZWYWOI-UHFFFAOYSA-K 0.000 description 1
- 239000005587 Oryzalin Substances 0.000 description 1
- UNAHYJYOSSSJHH-UHFFFAOYSA-N Oryzalin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(S(N)(=O)=O)C=C1[N+]([O-])=O UNAHYJYOSSSJHH-UHFFFAOYSA-N 0.000 description 1
- WFVUIONFJOAYPK-KAMYIIQDSA-N Oxabetrinil Chemical compound C=1C=CC=CC=1C(/C#N)=N\OCC1OCCO1 WFVUIONFJOAYPK-KAMYIIQDSA-N 0.000 description 1
- 239000005588 Oxadiazon Substances 0.000 description 1
- CHNUNORXWHYHNE-UHFFFAOYSA-N Oxadiazon Chemical compound C1=C(Cl)C(OC(C)C)=CC(N2C(OC(=N2)C(C)(C)C)=O)=C1Cl CHNUNORXWHYHNE-UHFFFAOYSA-N 0.000 description 1
- XRGQIRXQFSJBKJ-UHFFFAOYSA-N Oxapyrazon Chemical compound O=C1C(Br)=C(NC(=O)C(=O)O)C=NN1C1=CC=CC=C1 XRGQIRXQFSJBKJ-UHFFFAOYSA-N 0.000 description 1
- 239000005589 Oxasulfuron Substances 0.000 description 1
- FCOHEOSCARXMMS-UHFFFAOYSA-N Oxaziclomefone Chemical compound C1OC(C)=C(C=2C=CC=CC=2)C(=O)N1C(C)(C)C1=CC(Cl)=CC(Cl)=C1 FCOHEOSCARXMMS-UHFFFAOYSA-N 0.000 description 1
- 239000005590 Oxyfluorfen Substances 0.000 description 1
- OQMBBFQZGJFLBU-UHFFFAOYSA-N Oxyfluorfen Chemical compound C1=C([N+]([O-])=O)C(OCC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 OQMBBFQZGJFLBU-UHFFFAOYSA-N 0.000 description 1
- UKODFQOELJFMII-UHFFFAOYSA-N PMDTA Chemical compound CN(C)CCN(C)CCN(C)C UKODFQOELJFMII-UHFFFAOYSA-N 0.000 description 1
- 229940010310 PROPYLENE GLYCOL DIOLEATE Drugs 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 235000007199 Panicum miliaceum Nutrition 0.000 description 1
- CDHBAZHPEVDWMO-UHFFFAOYSA-N Parafluron Chemical compound CN(C)C(=O)NC1=CC=C(C(F)(F)F)C=C1 CDHBAZHPEVDWMO-UHFFFAOYSA-N 0.000 description 1
- 229910002666 PdCl2 Inorganic materials 0.000 description 1
- SGEJQUSYQTVSIU-UHFFFAOYSA-N Pebulate Chemical compound CCCCN(CC)C(=O)SCCC SGEJQUSYQTVSIU-UHFFFAOYSA-N 0.000 description 1
- 239000005643 Pelargonic acid Substances 0.000 description 1
- 239000005591 Pendimethalin Substances 0.000 description 1
- CHIFOSRWCNZCFN-UHFFFAOYSA-N Pendimethalin Chemical compound CCC(CC)NC1=C([N+]([O-])=O)C=C(C)C(C)=C1[N+]([O-])=O CHIFOSRWCNZCFN-UHFFFAOYSA-N 0.000 description 1
- 239000005592 Penoxsulam Substances 0.000 description 1
- SYJGKVOENHZYMQ-UHFFFAOYSA-N Penoxsulam Chemical compound N1=C2C(OC)=CN=C(OC)N2N=C1NS(=O)(=O)C1=C(OCC(F)F)C=CC=C1C(F)(F)F SYJGKVOENHZYMQ-UHFFFAOYSA-N 0.000 description 1
- IZUPBVBPLAPZRR-UHFFFAOYSA-N Pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 1
- WGVWLKXZBUVUAM-UHFFFAOYSA-N Pentanochlor Chemical compound CCCC(C)C(=O)NC1=CC=C(C)C(Cl)=C1 WGVWLKXZBUVUAM-UHFFFAOYSA-N 0.000 description 1
- JZPKLLLUDLHCEL-UHFFFAOYSA-N Pentoxazone Chemical compound O=C1C(=C(C)C)OC(=O)N1C1=CC(OC2CCCC2)=C(Cl)C=C1F JZPKLLLUDLHCEL-UHFFFAOYSA-N 0.000 description 1
- WHTBVLXUSXVMEV-UHFFFAOYSA-N Perfluidone Chemical compound C1=C(NS(=O)(=O)C(F)(F)F)C(C)=CC(S(=O)(=O)C=2C=CC=CC=2)=C1 WHTBVLXUSXVMEV-UHFFFAOYSA-N 0.000 description 1
- 240000006754 Persicaria maculosa Species 0.000 description 1
- 239000005593 Pethoxamid Substances 0.000 description 1
- PWEOEHNGYFXZLI-UHFFFAOYSA-N Phenisopham Chemical compound C=1C=CC=CC=1N(CC)C(=O)OC1=CC=CC(NC(=O)OC(C)C)=C1 PWEOEHNGYFXZLI-UHFFFAOYSA-N 0.000 description 1
- 239000005594 Phenmedipham Substances 0.000 description 1
- QQXXYTVEGCOZRF-UHFFFAOYSA-N Phenobenzuron Chemical compound C=1C=C(Cl)C(Cl)=CC=1N(C(=O)N(C)C)C(=O)C1=CC=CC=C1 QQXXYTVEGCOZRF-UHFFFAOYSA-N 0.000 description 1
- XEBWQGVWTUSTLN-UHFFFAOYSA-M Phenylmercury acetate Chemical compound CC(=O)O[Hg]C1=CC=CC=C1 XEBWQGVWTUSTLN-UHFFFAOYSA-M 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- NQQVFXUMIDALNH-UHFFFAOYSA-N Picloram Chemical compound NC1=C(Cl)C(Cl)=NC(C(O)=O)=C1Cl NQQVFXUMIDALNH-UHFFFAOYSA-N 0.000 description 1
- 239000005595 Picloram Substances 0.000 description 1
- 239000005596 Picolinafen Substances 0.000 description 1
- 239000005597 Pinoxaden Substances 0.000 description 1
- UNLYSVIDNRIVFJ-UHFFFAOYSA-N Piperophos Chemical compound CCCOP(=S)(OCCC)SCC(=O)N1CCCCC1C UNLYSVIDNRIVFJ-UHFFFAOYSA-N 0.000 description 1
- 235000010503 Plantago lanceolata Nutrition 0.000 description 1
- 240000003964 Plantago lanceolata Species 0.000 description 1
- 240000004331 Plantago major Species 0.000 description 1
- 235000015266 Plantago major Nutrition 0.000 description 1
- 244000110797 Polygonum persicaria Species 0.000 description 1
- 229940097322 Potassium arsenite Drugs 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N Potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M Potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- YLPGTOIOYRQOHV-UHFFFAOYSA-N Pretilachlor Chemical compound CCCOCCN(C(=O)CCl)C1=C(CC)C=CC=C1CC YLPGTOIOYRQOHV-UHFFFAOYSA-N 0.000 description 1
- RSVPPPHXAASNOL-UHFFFAOYSA-N Prodiamine Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C(N)=C1[N+]([O-])=O RSVPPPHXAASNOL-UHFFFAOYSA-N 0.000 description 1
- ITVQAKZNYJEWKS-UHFFFAOYSA-N Profluralin Chemical compound [O-][N+](=O)C=1C=C(C(F)(F)F)C=C([N+]([O-])=O)C=1N(CCC)CC1CC1 ITVQAKZNYJEWKS-UHFFFAOYSA-N 0.000 description 1
- 239000005599 Profoxydim Substances 0.000 description 1
- XCXCBWSRDOSZRU-UHFFFAOYSA-N Proglinazine Chemical compound CC(C)NC1=NC(Cl)=NC(NCC(O)=O)=N1 XCXCBWSRDOSZRU-UHFFFAOYSA-N 0.000 description 1
- ISEUFVQQFVOBCY-UHFFFAOYSA-N Prometon Chemical compound COC1=NC(NC(C)C)=NC(NC(C)C)=N1 ISEUFVQQFVOBCY-UHFFFAOYSA-N 0.000 description 1
- PHNUZKMIPFFYSO-UHFFFAOYSA-N Pronamide Chemical compound C#CC(C)(C)NC(=O)C1=CC(Cl)=CC(Cl)=C1 PHNUZKMIPFFYSO-UHFFFAOYSA-N 0.000 description 1
- MFOUDYKPLGXPGO-UHFFFAOYSA-N Propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 1
- LFULEKSKNZEWOE-UHFFFAOYSA-N Propanil Chemical compound CCC(=O)NC1=CC=C(Cl)C(Cl)=C1 LFULEKSKNZEWOE-UHFFFAOYSA-N 0.000 description 1
- 239000005600 Propaquizafop Substances 0.000 description 1
- VXPLXMJHHKHSOA-UHFFFAOYSA-N Propham Chemical compound CC(C)OC(=O)NC1=CC=CC=C1 VXPLXMJHHKHSOA-UHFFFAOYSA-N 0.000 description 1
- 239000005601 Propoxycarbazone Substances 0.000 description 1
- 239000005602 Propyzamide Substances 0.000 description 1
- 239000005603 Prosulfocarb Substances 0.000 description 1
- 239000005604 Prosulfuron Substances 0.000 description 1
- LTUNNEGNEKBSEH-UHFFFAOYSA-N Prosulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)CCC(F)(F)F)=N1 LTUNNEGNEKBSEH-UHFFFAOYSA-N 0.000 description 1
- UOJYYXATTMQQNA-UHFFFAOYSA-N Proxan Chemical compound CC(C)OC(S)=S UOJYYXATTMQQNA-UHFFFAOYSA-N 0.000 description 1
- BKVRQJSQZDTXCG-UHFFFAOYSA-N Pydanon Chemical compound OC(=O)CC1(O)CC(=O)NNC1=O BKVRQJSQZDTXCG-UHFFFAOYSA-N 0.000 description 1
- IHHMUBRVTJMLQO-UHFFFAOYSA-N Pyraclonil Chemical compound C#CCN(C)C1=C(C#N)C=NN1C1=NN(CCCC2)C2=C1Cl IHHMUBRVTJMLQO-UHFFFAOYSA-N 0.000 description 1
- BGNQYGRXEXDAIQ-UHFFFAOYSA-N Pyrazosulfuron-ethyl Chemical group C1=NN(C)C(S(=O)(=O)NC(=O)NC=2N=C(OC)C=C(OC)N=2)=C1C(=O)OCC BGNQYGRXEXDAIQ-UHFFFAOYSA-N 0.000 description 1
- FKERUJTUOYLBKB-UHFFFAOYSA-N Pyrazoxyfen Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=O)C=1C(C)=NN(C)C=1OCC(=O)C1=CC=CC=C1 FKERUJTUOYLBKB-UHFFFAOYSA-N 0.000 description 1
- 239000005606 Pyridate Substances 0.000 description 1
- JTZCTMAVMHRNTR-UHFFFAOYSA-N Pyridate Chemical compound CCCCCCCCSC(=O)OC1=CC(Cl)=NN=C1C1=CC=CC=C1 JTZCTMAVMHRNTR-UHFFFAOYSA-N 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N Pyridine-N-oxide Chemical class [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- RRKHIAYNPVQKEF-UHFFFAOYSA-N Pyriftalid Chemical compound COC1=CC(OC)=NC(SC=2C=3C(=O)OC(C)C=3C=CC=2)=N1 RRKHIAYNPVQKEF-UHFFFAOYSA-N 0.000 description 1
- DEIKMOQTJBGGAX-DJKKODMXSA-N Pyriminobac Chemical compound CO\N=C(/C)C1=CC=CC(OC=2N=C(OC)C=C(OC)N=2)=C1C(O)=O DEIKMOQTJBGGAX-DJKKODMXSA-N 0.000 description 1
- 239000005607 Pyroxsulam Substances 0.000 description 1
- 239000005608 Quinmerac Substances 0.000 description 1
- OBLNWSCLAYSJJR-UHFFFAOYSA-N Quinoclamin Chemical compound C1=CC=C2C(=O)C(N)=C(Cl)C(=O)C2=C1 OBLNWSCLAYSJJR-UHFFFAOYSA-N 0.000 description 1
- 239000002167 Quinoclamine Substances 0.000 description 1
- ZIEWAMOXCOLNSJ-UHFFFAOYSA-N Quinonamid Chemical compound C1=CC=C2C(=O)C(NC(=O)C(Cl)Cl)=C(Cl)C(=O)C2=C1 ZIEWAMOXCOLNSJ-UHFFFAOYSA-N 0.000 description 1
- ABOOPXYCKNFDNJ-UHFFFAOYSA-N Quizalofop Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CN=C(C=C(Cl)C=C2)C2=N1 ABOOPXYCKNFDNJ-UHFFFAOYSA-N 0.000 description 1
- 239000005614 Quizalofop-P-ethyl Substances 0.000 description 1
- 239000005616 Rimsulfuron Substances 0.000 description 1
- 239000005617 S-Metolachlor Substances 0.000 description 1
- BUHNESFUCHPWED-UHFFFAOYSA-N S-[(4-methoxyphenyl)methyl] N,N-diethylcarbamothioate Chemical compound CCN(CC)C(=O)SCC1=CC=C(OC)C=C1 BUHNESFUCHPWED-UHFFFAOYSA-N 0.000 description 1
- LMHHRCOWPQNFTF-UHFFFAOYSA-N S-propan-2-yl azepane-1-carbothioate Chemical compound CC(C)SC(=O)N1CCCCCC1 LMHHRCOWPQNFTF-UHFFFAOYSA-N 0.000 description 1
- WOZQBERUBLYCEG-UHFFFAOYSA-N SWEP Chemical compound COC(=O)NC1=CC=C(Cl)C(Cl)=C1 WOZQBERUBLYCEG-UHFFFAOYSA-N 0.000 description 1
- 240000009132 Sagittaria sagittifolia Species 0.000 description 1
- 241000759137 Schoenoplectiella juncoides Species 0.000 description 1
- 244000139819 Schoenoplectus juncoides Species 0.000 description 1
- 229940115128 Sebex Drugs 0.000 description 1
- 235000007238 Secale cereale Nutrition 0.000 description 1
- 240000002057 Secale cereale Species 0.000 description 1
- 235000008515 Setaria glauca Nutrition 0.000 description 1
- 235000001155 Setaria leucopila Nutrition 0.000 description 1
- 235000004250 Setaria pumila Nutrition 0.000 description 1
- CSPPKDPQLUUTND-NBVRZTHBSA-N Sethoxydim Chemical compound CCO\N=C(/CCC)C1=C(O)CC(CC(C)SCC)CC1=O CSPPKDPQLUUTND-NBVRZTHBSA-N 0.000 description 1
- JXVIIQLNUPXOII-UHFFFAOYSA-N Siduron Chemical compound CC1CCCCC1NC(=O)NC1=CC=CC=C1 JXVIIQLNUPXOII-UHFFFAOYSA-N 0.000 description 1
- ODCWYMIRDDJXKW-UHFFFAOYSA-N Simazine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1 ODCWYMIRDDJXKW-UHFFFAOYSA-N 0.000 description 1
- PTLRDCMBXHILCL-UHFFFAOYSA-M Sodium arsenite Chemical compound [Na+].[O-][As]=O PTLRDCMBXHILCL-UHFFFAOYSA-M 0.000 description 1
- YZHUMGUJCQRKBT-UHFFFAOYSA-M Sodium chlorate Chemical compound [Na+].[O-]Cl(=O)=O YZHUMGUJCQRKBT-UHFFFAOYSA-M 0.000 description 1
- 235000000255 Solanum americanum Nutrition 0.000 description 1
- 235000002594 Solanum nigrum Nutrition 0.000 description 1
- 241000607059 Solidago Species 0.000 description 1
- 240000006324 Solidago virgaurea Species 0.000 description 1
- 235000000914 Solidago virgaurea Nutrition 0.000 description 1
- 235000006731 Sonchus arvensis Nutrition 0.000 description 1
- 235000006744 Sonchus asper Nutrition 0.000 description 1
- 235000007230 Sorghum bicolor Nutrition 0.000 description 1
- 235000006923 Sorghum bicolor subsp x drummondii Nutrition 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- 235000003349 Sudangras Nutrition 0.000 description 1
- 235000015503 Sudangrass Nutrition 0.000 description 1
- 239000005618 Sulcotrione Substances 0.000 description 1
- XJCLWVXTCRQIDI-UHFFFAOYSA-N Sulfallate Chemical compound CCN(CC)C(=S)SCC(Cl)=C XJCLWVXTCRQIDI-UHFFFAOYSA-N 0.000 description 1
- OORLZFUTLGXMEF-UHFFFAOYSA-N Sulfentrazone Chemical compound O=C1N(C(F)F)C(C)=NN1C1=CC(NS(C)(=O)=O)=C(Cl)C=C1Cl OORLZFUTLGXMEF-UHFFFAOYSA-N 0.000 description 1
- FZMKKCQHDROFNI-UHFFFAOYSA-N Sulfometuron Chemical compound CC1=CC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(O)=O)=N1 FZMKKCQHDROFNI-UHFFFAOYSA-N 0.000 description 1
- 239000005619 Sulfosulfuron Substances 0.000 description 1
- 235000006754 Taraxacum officinale Nutrition 0.000 description 1
- HBPDKDSFLXWOAE-UHFFFAOYSA-N Tebuthiuron Chemical compound CNC(=O)N(C)C1=NN=C(C(C)(C)C)S1 HBPDKDSFLXWOAE-UHFFFAOYSA-N 0.000 description 1
- 239000005620 Tembotrione Substances 0.000 description 1
- NBQCNZYJJMBDKY-UHFFFAOYSA-N Terbacil Chemical compound CC=1NC(=O)N(C(C)(C)C)C(=O)C=1Cl NBQCNZYJJMBDKY-UHFFFAOYSA-N 0.000 description 1
- PNRAZZZISDRWMV-UHFFFAOYSA-N Terbucarb Chemical compound CNC(=O)OC1=C(C(C)(C)C)C=C(C)C=C1C(C)(C)C PNRAZZZISDRWMV-UHFFFAOYSA-N 0.000 description 1
- 239000005621 Terbuthylazine Substances 0.000 description 1
- FZXISNSWEXTPMF-UHFFFAOYSA-N Terbuthylazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C)=N1 FZXISNSWEXTPMF-UHFFFAOYSA-N 0.000 description 1
- KDWQYMVPYJGPHS-UHFFFAOYSA-N Thenylchlor Chemical compound C1=CSC(CN(C(=O)CCl)C=2C(=CC=CC=2C)C)=C1OC KDWQYMVPYJGPHS-UHFFFAOYSA-N 0.000 description 1
- BBJPZPLAZVZTGR-UHFFFAOYSA-N Thiazafluron Chemical compound CNC(=O)N(C)C1=NN=C(C(F)(F)F)S1 BBJPZPLAZVZTGR-UHFFFAOYSA-N 0.000 description 1
- YIJZJEYQBAAWRJ-UHFFFAOYSA-N Thiazopyr Chemical compound N1=C(C(F)F)C(C(=O)OC)=C(CC(C)C)C(C=2SCCN=2)=C1C(F)(F)F YIJZJEYQBAAWRJ-UHFFFAOYSA-N 0.000 description 1
- HFCYZXMHUIHAQI-UHFFFAOYSA-N Thidiazuron Chemical compound C=1C=CC=CC=1NC(=O)NC1=CN=NS1 HFCYZXMHUIHAQI-UHFFFAOYSA-N 0.000 description 1
- 235000015450 Tilia cordata Nutrition 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- PHSUVQBHRAWOQD-UHFFFAOYSA-N Tiocarbazil Chemical compound CCC(C)N(C(C)CC)C(=O)SCC1=CC=CC=C1 PHSUVQBHRAWOQD-UHFFFAOYSA-N 0.000 description 1
- VXUYXOFXAQZZMF-UHFFFAOYSA-N Titanium isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 1
- 239000005624 Tralkoxydim Substances 0.000 description 1
- DQFPEYARZIQXRM-LTGZKZEYSA-N Tralkoxydim Chemical compound C1C(=O)C(C(/CC)=N/OCC)=C(O)CC1C1=C(C)C=C(C)C=C1C DQFPEYARZIQXRM-LTGZKZEYSA-N 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical class CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- 239000005625 Tri-allate Substances 0.000 description 1
- MWBPRDONLNQCFV-UHFFFAOYSA-N Tri-allate Chemical compound CC(C)N(C(C)C)C(=O)SCC(Cl)=C(Cl)Cl MWBPRDONLNQCFV-UHFFFAOYSA-N 0.000 description 1
- XOPFESVZMSQIKC-UHFFFAOYSA-N Triasulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OCCCl)=N1 XOPFESVZMSQIKC-UHFFFAOYSA-N 0.000 description 1
- 239000005626 Tribenuron Substances 0.000 description 1
- WCLDITPGPXSPGV-UHFFFAOYSA-N Tricamba Chemical compound COC1=C(Cl)C=C(Cl)C(Cl)=C1C(O)=O WCLDITPGPXSPGV-UHFFFAOYSA-N 0.000 description 1
- REEQLXCGVXDJSQ-UHFFFAOYSA-N Triclopyr Chemical class OC(=O)COC1=NC(Cl)=C(Cl)C=C1Cl REEQLXCGVXDJSQ-UHFFFAOYSA-N 0.000 description 1
- IBZHOAONZVJLOB-UHFFFAOYSA-N Tridiphane Chemical compound ClC1=CC(Cl)=CC(C2(CC(Cl)(Cl)Cl)OC2)=C1 IBZHOAONZVJLOB-UHFFFAOYSA-N 0.000 description 1
- HFBWPRKWDIRYNX-UHFFFAOYSA-N Trietazine Chemical compound CCNC1=NC(Cl)=NC(N(CC)CC)=N1 HFBWPRKWDIRYNX-UHFFFAOYSA-N 0.000 description 1
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N Trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 description 1
- 239000005628 Triflusulfuron Substances 0.000 description 1
- 235000010729 Trifolium repens Nutrition 0.000 description 1
- 235000013540 Trifolium repens var repens Nutrition 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N Trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 239000005629 Tritosulfuron Substances 0.000 description 1
- HWKQNAWCHQMZHK-UHFFFAOYSA-N Trolnitrate Chemical compound [O-][N+](=O)OCCN(CCO[N+]([O-])=O)CCO[N+]([O-])=O HWKQNAWCHQMZHK-UHFFFAOYSA-N 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- 240000007995 Xanthium strumarium Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- OTSYOPHQYHLKTK-UHFFFAOYSA-N [2-(azepan-1-yl)-2-oxoethyl] N-methylsulfamate Chemical compound CNS(=O)(=O)OCC(=O)N1CCCCCC1 OTSYOPHQYHLKTK-UHFFFAOYSA-N 0.000 description 1
- MVEFZZKZBYQFPP-UHFFFAOYSA-N [3-(ethoxycarbonylamino)phenyl] N-(3-methylphenyl)carbamate Chemical group CCOC(=O)NC1=CC=CC(OC(=O)NC=2C=C(C)C=CC=2)=C1 MVEFZZKZBYQFPP-UHFFFAOYSA-N 0.000 description 1
- CYDCAYZRTPOUJJ-UHFFFAOYSA-N [3-(methoxycarbonylamino)phenyl] N-(1-chlorobutan-2-yl)carbamate Chemical compound CCC(CCl)NC(=O)OC1=CC=CC(NC(=O)OC)=C1 CYDCAYZRTPOUJJ-UHFFFAOYSA-N 0.000 description 1
- DXGTUUQHTDOFFQ-UHFFFAOYSA-N [N].C1=CC=C2NC=CC2=C1 Chemical compound [N].C1=CC=C2NC=CC2=C1 DXGTUUQHTDOFFQ-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- HGINCPLSRVDWNT-UHFFFAOYSA-N acrylaldehyde Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- RQVYBGPQFYCBGX-UHFFFAOYSA-N ametryn Chemical compound CCNC1=NC(NC(C)C)=NC(SC)=N1 RQVYBGPQFYCBGX-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- KWAIHLIXESXTJL-UHFFFAOYSA-N aminocyclopyrachlor Chemical compound OC(=O)C1=C(Cl)C(N)=NC(C2CC2)=N1 KWAIHLIXESXTJL-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 229940072049 amyl acetate Drugs 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- SOEMYGYJIDMXMO-UHFFFAOYSA-N arsorous acid;potassium Chemical compound [K].O[As](O)O SOEMYGYJIDMXMO-UHFFFAOYSA-N 0.000 description 1
- 125000005418 aryl aryl group Chemical group 0.000 description 1
- 150000001499 aryl bromides Chemical class 0.000 description 1
- 150000001503 aryl iodides Chemical class 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000004429 atoms Chemical group 0.000 description 1
- PXWUKZGIHQRDHL-UHFFFAOYSA-N atraton Chemical compound CCNC1=NC(NC(C)C)=NC(OC)=N1 PXWUKZGIHQRDHL-UHFFFAOYSA-N 0.000 description 1
- WZEMSIKSCALWJZ-UHFFFAOYSA-O azanium;ethanol Chemical compound [NH4+].CCO.CCO WZEMSIKSCALWJZ-UHFFFAOYSA-O 0.000 description 1
- PPBAJDRXASKAGH-UHFFFAOYSA-O azanium;urea Chemical compound [NH4+].NC(N)=O PPBAJDRXASKAGH-UHFFFAOYSA-O 0.000 description 1
- CSGLCWIAEFNDIL-UHFFFAOYSA-O azanium;urea;nitrate Chemical compound [NH4+].NC(N)=O.[O-][N+]([O-])=O CSGLCWIAEFNDIL-UHFFFAOYSA-O 0.000 description 1
- MCOQHIWZJUDQIC-UHFFFAOYSA-N barban Chemical compound ClCC#CCOC(=O)NC1=CC=CC(Cl)=C1 MCOQHIWZJUDQIC-UHFFFAOYSA-N 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- MKQSWTQPLLCSOB-UHFFFAOYSA-N benzyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate Chemical compound N1=C(Cl)SC(C(=O)OCC=2C=CC=CC=2)=C1C(F)(F)F MKQSWTQPLLCSOB-UHFFFAOYSA-N 0.000 description 1
- GINJFDRNADDBIN-FXQIFTODSA-N bilanafos Chemical compound OC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](N)CCP(C)(O)=O GINJFDRNADDBIN-FXQIFTODSA-N 0.000 description 1
- 235000005770 birds nest Nutrition 0.000 description 1
- 235000006442 blackseeded proso millet Nutrition 0.000 description 1
- WZDDLAZXUYIVMU-UHFFFAOYSA-N bromobutide Chemical compound CC(C)(C)C(Br)C(=O)NC(C)(C)C1=CC=CC=C1 WZDDLAZXUYIVMU-UHFFFAOYSA-N 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 235000006443 broomcorn panic Nutrition 0.000 description 1
- CURLHBZYTFVCRG-UHFFFAOYSA-N butan-2-yl N-(3-chlorophenyl)carbamate Chemical compound CCC(C)OC(=O)NC1=CC=CC(Cl)=C1 CURLHBZYTFVCRG-UHFFFAOYSA-N 0.000 description 1
- 229940043232 butyl acetate Drugs 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229950004243 cacodylic acid Drugs 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- NLKUPINTOLSSLD-UHFFFAOYSA-L calcium;4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate Chemical compound [Ca+2].CCC([O-])=C1C(=O)CC(C([O-])=O)CC1=O NLKUPINTOLSSLD-UHFFFAOYSA-L 0.000 description 1
- HCWYXKWQOMTBKY-UHFFFAOYSA-N calcium;dodecyl benzenesulfonate Chemical compound [Ca].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 HCWYXKWQOMTBKY-UHFFFAOYSA-N 0.000 description 1
- 239000000828 canola oil Substances 0.000 description 1
- 235000019519 canola oil Nutrition 0.000 description 1
- AMRQXHFXNZFDCH-VIFPVBQESA-N carbetamide Chemical compound CCNC(=O)[C@H](C)OC(=O)NC1=CC=CC=C1 AMRQXHFXNZFDCH-VIFPVBQESA-N 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N carbodiimide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 150000001747 carotenoids Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- WYKYKTKDBLFHCY-UHFFFAOYSA-N chloridazon Chemical compound O=C1C(Cl)=C(N)C=NN1C1=CC=CC=C1 WYKYKTKDBLFHCY-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 description 1
- 125000004773 chlorofluoromethyl group Chemical group [H]C(F)(Cl)* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- NNKKTZOEKDFTBU-YBEGLDIGSA-N cinidon ethyl Chemical compound C1=C(Cl)C(/C=C(\Cl)C(=O)OCC)=CC(N2C(C3=C(CCCC3)C2=O)=O)=C1 NNKKTZOEKDFTBU-YBEGLDIGSA-N 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- SILSDTWXNBZOGF-JWGBMQLESA-N clethodim Chemical compound CCSC(C)CC1CC(O)=C(C(CC)=NOC\C=C\Cl)C(=O)C1 SILSDTWXNBZOGF-JWGBMQLESA-N 0.000 description 1
- 235000015501 common wild sorghum Nutrition 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 235000005824 corn Nutrition 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 235000008135 creeping sowthistle Nutrition 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- HBGGBCVEFUPUNY-UHFFFAOYSA-N cyclododecanamine Chemical compound NC1CCCCCCCCCCC1 HBGGBCVEFUPUNY-UHFFFAOYSA-N 0.000 description 1
- JCWIWBWXCVGEAN-UHFFFAOYSA-L cyclopentyl(diphenyl)phosphane;dichloropalladium;iron Chemical compound [Fe].Cl[Pd]Cl.[CH]1[CH][CH][CH][C]1P(C=1C=CC=CC=1)C1=CC=CC=C1.[CH]1[CH][CH][CH][C]1P(C=1C=CC=CC=1)C1=CC=CC=C1 JCWIWBWXCVGEAN-UHFFFAOYSA-L 0.000 description 1
- GGWHBJGBERXSLL-UHFFFAOYSA-N cycloxydim Chemical compound C1C(=O)C(C(=NOCC)CCC)=C(O)CC1C1CSCCC1 GGWHBJGBERXSLL-UHFFFAOYSA-N 0.000 description 1
- 235000014079 dandelion Nutrition 0.000 description 1
- 230000000994 depressed Effects 0.000 description 1
- 238000005828 desilylation reaction Methods 0.000 description 1
- WZJZMXBKUWKXTQ-UHFFFAOYSA-N desmedipham Chemical compound CCOC(=O)NC1=CC=CC(OC(=O)NC=2C=CC=CC=2)=C1 WZJZMXBKUWKXTQ-UHFFFAOYSA-N 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N deuterated chloroform Substances [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 125000004774 dichlorofluoromethyl group Chemical group FC(Cl)(Cl)* 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- OPGCOAPTHCZZIW-UHFFFAOYSA-N diethyl 1-(2,4-dichlorophenyl)-5-methyl-4H-pyrazole-3,5-dicarboxylate Chemical group CCOC(=O)C1(C)CC(C(=O)OCC)=NN1C1=CC=C(Cl)C=C1Cl OPGCOAPTHCZZIW-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- WYEHFWKAOXOVJD-UHFFFAOYSA-N diflufenican Chemical compound FC1=CC(F)=CC=C1NC(=O)C1=CC=CN=C1OC1=CC=CC(C(F)(F)F)=C1 WYEHFWKAOXOVJD-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- SCCDDNKJYDZXMM-UHFFFAOYSA-N dimethachlor Chemical compound COCCN(C(=O)CCl)C1=C(C)C=CC=C1C SCCDDNKJYDZXMM-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- KWABLUYIOFEZOY-UHFFFAOYSA-N dioctyl butanedioate Chemical compound CCCCCCCCOC(=O)CCC(=O)OCCCCCCCC KWABLUYIOFEZOY-UHFFFAOYSA-N 0.000 description 1
- SYJFEGQWDCRVNX-UHFFFAOYSA-N diquat Chemical compound C1=CC=[N+]2CC[N+]3=CC=CC=C3C2=C1 SYJFEGQWDCRVNX-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000002708 enhancing Effects 0.000 description 1
- 229960000514 ethenzamide Drugs 0.000 description 1
- OSUHJPCHFDQAIT-GFCCVEGCSA-N ethyl (2R)-2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate Chemical group C1=CC(O[C@H](C)C(=O)OCC)=CC=C1OC1=CN=C(C=C(Cl)C=C2)C2=N1 OSUHJPCHFDQAIT-GFCCVEGCSA-N 0.000 description 1
- DNUAYCRATWAJQE-UHFFFAOYSA-N ethyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetate Chemical group C1=C(Cl)C(OCC(=O)OCC)=CC(N2C(C(C)=C(C=N2)C(F)(F)F)=O)=C1F DNUAYCRATWAJQE-UHFFFAOYSA-N 0.000 description 1
- 229940093499 ethyl acetate Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- IANUJLZYFUDJIH-UHFFFAOYSA-N flufenacet Chemical compound C=1C=C(F)C=CC=1N(C(C)C)C(=O)COC1=NN=C(C(F)(F)F)S1 IANUJLZYFUDJIH-UHFFFAOYSA-N 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- PXDNXJSDGQBLKS-UHFFFAOYSA-N foramsulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=C(NC=O)C=2)C(=O)N(C)C)=N1 PXDNXJSDGQBLKS-UHFFFAOYSA-N 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000000855 fungicidal Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 102000005396 glutamine synthetase family Human genes 0.000 description 1
- 108020002326 glutamine synthetase family Proteins 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005553 heteroaryloxy group Chemical group 0.000 description 1
- 125000005842 heteroatoms Chemical group 0.000 description 1
- RBJAKRVCYLJDPZ-UHFFFAOYSA-N hexyl 2-[5-(4-bromophenoxy)-2-nitrophenoxy]propanoate Chemical compound C1=C([N+]([O-])=O)C(OC(C)C(=O)OCCCCCC)=CC(OC=2C=CC(Br)=CC=2)=C1 RBJAKRVCYLJDPZ-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- RUCAXVJJQQJZGU-UHFFFAOYSA-M hydron;2-(phosphonatomethylamino)acetate;trimethylsulfanium Chemical compound C[S+](C)C.OP(O)(=O)CNCC([O-])=O RUCAXVJJQQJZGU-UHFFFAOYSA-M 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 230000000749 insecticidal Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- NRXQIUSYPAHGNM-UHFFFAOYSA-N ioxynil Chemical compound OC1=C(I)C=C(C#N)C=C1I NRXQIUSYPAHGNM-UHFFFAOYSA-N 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940074928 isopropyl myristate Drugs 0.000 description 1
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 description 1
- 229940088649 isoxaflutole Drugs 0.000 description 1
- 230000002147 killing Effects 0.000 description 1
- 235000005819 lambsquarters Nutrition 0.000 description 1
- 235000014054 lambsquarters Nutrition 0.000 description 1
- ZTMKADLOSYKWCA-UHFFFAOYSA-N lenacil Chemical compound O=C1NC=2CCCC=2C(=O)N1C1CCCCC1 ZTMKADLOSYKWCA-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- XKJMBINCVNINCA-UHFFFAOYSA-N linuron Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XKJMBINCVNINCA-UHFFFAOYSA-N 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- RMGJCSHZTFKPNO-UHFFFAOYSA-M magnesium;ethene;bromide Chemical compound [Mg+2].[Br-].[CH-]=C RMGJCSHZTFKPNO-UHFFFAOYSA-M 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 235000008132 marsh sowthistle Nutrition 0.000 description 1
- 101700021309 mcpB Proteins 0.000 description 1
- XIGAUIHYSDTJHW-UHFFFAOYSA-N mefenacet Chemical compound N=1C2=CC=CC=C2SC=1OCC(=O)N(C)C1=CC=CC=C1 XIGAUIHYSDTJHW-UHFFFAOYSA-N 0.000 description 1
- VHCNQEUWZYOAEV-UHFFFAOYSA-N metamitron Chemical compound O=C1N(N)C(C)=NN=C1C1=CC=CC=C1 VHCNQEUWZYOAEV-UHFFFAOYSA-N 0.000 description 1
- STEPQTYSZVCJPV-UHFFFAOYSA-N metazachlor Chemical compound CC1=CC=CC(C)=C1N(C(=O)CCl)CN1N=CC=C1 STEPQTYSZVCJPV-UHFFFAOYSA-N 0.000 description 1
- FWJLFUVWQAXWLE-UHFFFAOYSA-N methometon Chemical compound COCCCNC1=NC(NCCCOC)=NC(OC)=N1 FWJLFUVWQAXWLE-UHFFFAOYSA-N 0.000 description 1
- MFSWTRQUCLNFOM-SECBINFHSA-N methyl (2R)-2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoate Chemical group C1=CC(O[C@H](C)C(=O)OC)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl MFSWTRQUCLNFOM-SECBINFHSA-N 0.000 description 1
- CBLVUXPPNHUKDE-QBFSEMIESA-N methyl (5Z)-2,2-dimethyl-4,6-dioxo-5-[1-(prop-2-enoxyamino)butylidene]cyclohexane-1-carboxylate Chemical compound C=CCONC(/CCC)=C1/C(=O)CC(C)(C)C(C(=O)OC)C1=O CBLVUXPPNHUKDE-QBFSEMIESA-N 0.000 description 1
- LYPWWQLKWQNQKV-UHFFFAOYSA-N methyl 2-[5-ethyl-2-[[4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]phenoxy]methyl]phenoxy]propanoate Chemical compound COC(=O)C(C)OC1=CC(CC)=CC=C1COC1=CC=C(N2C(N(C)C(=CC2=O)C(F)(F)F)=O)C=C1 LYPWWQLKWQNQKV-UHFFFAOYSA-N 0.000 description 1
- ZTYVMAQSHCZXLF-UHFFFAOYSA-N methyl 2-[[4,6-bis(difluoromethoxy)pyrimidin-2-yl]carbamoylsulfamoyl]benzoate Chemical group COC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(OC(F)F)=CC(OC(F)F)=N1 ZTYVMAQSHCZXLF-UHFFFAOYSA-N 0.000 description 1
- XSKZXGDFSCCXQX-UHFFFAOYSA-N methyl 4-[(3-methoxy-4-methyl-5-oxo-1,2,4-triazole-1-carbonyl)sulfamoyl]-5-methylthiophene-3-carboxylate Chemical compound COC(=O)C1=CSC(C)=C1S(=O)(=O)NC(=O)N1C(=O)N(C)C(OC)=N1 XSKZXGDFSCCXQX-UHFFFAOYSA-N 0.000 description 1
- DVHKEMKISPDBAK-UHFFFAOYSA-N methyl 4-acetamido-3-chloro-6-(7-fluoro-1H-indol-6-yl)pyridine-2-carboxylate Chemical compound CC(=O)NC1=C(Cl)C(C(=O)OC)=NC(C=2C(=C3NC=CC3=CC=2)F)=C1 DVHKEMKISPDBAK-UHFFFAOYSA-N 0.000 description 1
- KKYGRAZUDDLVHY-UHFFFAOYSA-N methyl 4-acetamido-3-chloro-6-iodopyridine-2-carboxylate Chemical compound COC(=O)C1=NC(I)=CC(NC(C)=O)=C1Cl KKYGRAZUDDLVHY-UHFFFAOYSA-N 0.000 description 1
- IWRBWWHSYSDSAV-UHFFFAOYSA-N methyl 4-acetamido-3-chloro-6-trimethylstannylpyridine-2-carboxylate Chemical compound COC(=O)C1=NC([Sn](C)(C)C)=CC(NC(C)=O)=C1Cl IWRBWWHSYSDSAV-UHFFFAOYSA-N 0.000 description 1
- JVRRFCJGMDGZNY-UHFFFAOYSA-N methyl 4-amino-3,6-dichloro-5-methylpyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(C)C(N)=C1Cl JVRRFCJGMDGZNY-UHFFFAOYSA-N 0.000 description 1
- KDHKOPYYWOHESS-UHFFFAOYSA-N methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylate Chemical group NC1=C(Cl)C(C(=O)OC)=NC(C=2C(=C(OC)C(Cl)=CC=2)F)=C1 KDHKOPYYWOHESS-UHFFFAOYSA-N 0.000 description 1
- QXWCCCVDANKCLV-UHFFFAOYSA-N methyl 4-amino-3-chloro-6-(7-chloro-1-benzofuran-4-yl)-5-fluoropyridine-2-carboxylate Chemical compound NC1=C(Cl)C(C(=O)OC)=NC(C=2C=3C=COC=3C(Cl)=CC=2)=C1F QXWCCCVDANKCLV-UHFFFAOYSA-N 0.000 description 1
- PZUMSDCIWAESCE-UHFFFAOYSA-N methyl 4-amino-3-chloro-6-iodopyridine-2-carboxylate Chemical compound COC(=O)C1=NC(I)=CC(N)=C1Cl PZUMSDCIWAESCE-UHFFFAOYSA-N 0.000 description 1
- MXSMNAYNNWXEQP-UHFFFAOYSA-N methyl 4-amino-6-bromo-3,5-difluoropyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Br)=C(F)C(N)=C1F MXSMNAYNNWXEQP-UHFFFAOYSA-N 0.000 description 1
- WUCUJDCRYGSBBL-UHFFFAOYSA-N methyl 4-amino-6-chloro-5-fluoro-3-iodopyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(F)C(N)=C1I WUCUJDCRYGSBBL-UHFFFAOYSA-N 0.000 description 1
- OHCUEIWJGFSBLH-UHFFFAOYSA-N methyl 4-amino-6-chloro-5-fluoro-3-methoxypyridine-2-carboxylate Chemical compound COC(=O)C1=NC(Cl)=C(F)C(N)=C1OC OHCUEIWJGFSBLH-UHFFFAOYSA-N 0.000 description 1
- YEUYMEGMXJWEDE-UHFFFAOYSA-N methyl 6-amino-2,5-dichloropyrimidine-4-carboxylate Chemical compound COC(=O)C1=NC(Cl)=NC(N)=C1Cl YEUYMEGMXJWEDE-UHFFFAOYSA-N 0.000 description 1
- QWOGPGBREMPNFZ-UHFFFAOYSA-N methyl 6-amino-2-chloro-5-ethenylpyrimidine-4-carboxylate Chemical compound COC(=O)C1=NC(Cl)=NC(N)=C1C=C QWOGPGBREMPNFZ-UHFFFAOYSA-N 0.000 description 1
- MYURAHUSYDVWQA-UHFFFAOYSA-N methyl N'-(4-chlorophenyl)-N,N-dimethylcarbamimidate Chemical compound COC(N(C)C)=NC1=CC=C(Cl)C=C1 MYURAHUSYDVWQA-UHFFFAOYSA-N 0.000 description 1
- ZGUYPJJFHYFLBV-UHFFFAOYSA-N methyl N-(5-tert-butyl-1,2-oxazol-3-yl)carbamate Chemical compound COC(=O)NC=1C=C(C(C)(C)C)ON=1 ZGUYPJJFHYFLBV-UHFFFAOYSA-N 0.000 description 1
- ZTFLDKYLDUZSMN-UHFFFAOYSA-N methyl N-[4-(methoxycarbonylamino)phenyl]sulfonylcarbamate Chemical compound COC(=O)NC1=CC=C(S(=O)(=O)NC(=O)OC)C=C1 ZTFLDKYLDUZSMN-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- LGDSHSYDSCRFAB-UHFFFAOYSA-N methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 1
- VCCPBPXMXHHRLN-UHFFFAOYSA-N methylsulfinylmethane;propan-2-one Chemical compound CC(C)=O.CS(C)=O VCCPBPXMXHHRLN-UHFFFAOYSA-N 0.000 description 1
- 229960002939 metizoline Drugs 0.000 description 1
- 230000011278 mitosis Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000006011 modification reaction Methods 0.000 description 1
- 230000000051 modifying Effects 0.000 description 1
- 229910003465 moissanite Inorganic materials 0.000 description 1
- BMLIZLVNXIYGCK-UHFFFAOYSA-N monuron Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C=C1 BMLIZLVNXIYGCK-UHFFFAOYSA-N 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- 229940113083 morpholine Drugs 0.000 description 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N n-pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- JXTHEWSKYLZVJC-UHFFFAOYSA-N naptalam Chemical compound OC(=O)C1=CC=CC=C1C(=O)NC1=CC=CC2=CC=CC=C12 JXTHEWSKYLZVJC-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000003472 neutralizing Effects 0.000 description 1
- RTCOGUMHFFWOJV-UHFFFAOYSA-N nicosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CN=2)C(=O)N(C)C)=N1 RTCOGUMHFFWOJV-UHFFFAOYSA-N 0.000 description 1
- NVGOPFQZYCNLDU-UHFFFAOYSA-N norflurazon Chemical compound O=C1C(Cl)=C(NC)C=NN1C1=CC=CC(C(F)(F)F)=C1 NVGOPFQZYCNLDU-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N o-xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- LLLFASISUZUJEQ-UHFFFAOYSA-N orbencarb Chemical compound CCN(CC)C(=O)SCC1=CC=CC=C1Cl LLLFASISUZUJEQ-UHFFFAOYSA-N 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000005416 organic matter Substances 0.000 description 1
- IOXAXYHXMLCCJJ-UHFFFAOYSA-N oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoyl]benzoate Chemical compound CC1=CC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(=O)OC2COC2)=N1 IOXAXYHXMLCCJJ-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- INFDPOAKFNIJBF-UHFFFAOYSA-N paraquat Chemical compound C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 INFDPOAKFNIJBF-UHFFFAOYSA-N 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- CSWIKHNSBZVWNQ-UHFFFAOYSA-N pethoxamide Chemical compound CCOCCN(C(=O)CCl)C(=C(C)C)C1=CC=CC=C1 CSWIKHNSBZVWNQ-UHFFFAOYSA-N 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- IDOWTHOLJBTAFI-UHFFFAOYSA-N phenmedipham Chemical compound COC(=O)NC1=CC=CC(OC(=O)NC=2C=C(C)C=CC=2)=C1 IDOWTHOLJBTAFI-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- MGOHCFMYLBAPRN-UHFFFAOYSA-N pinoxaden Chemical compound CCC1=CC(C)=CC(CC)=C1C(C1=O)=C(OC(=O)C(C)(C)C)N2N1CCOCC2 MGOHCFMYLBAPRN-UHFFFAOYSA-N 0.000 description 1
- 239000001184 potassium carbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- AAEVYOVXGOFMJO-UHFFFAOYSA-N prometryn Chemical compound CSC1=NC(NC(C)C)=NC(NC(C)C)=N1 AAEVYOVXGOFMJO-UHFFFAOYSA-N 0.000 description 1
- JBDHZKLJNAIJNC-LLVKDONJSA-N prop-2-ynyl (2R)-2-[4-(5-chloro-3-fluoropyridin-2-yl)oxyphenoxy]propanoate Chemical group C1=CC(O[C@H](C)C(=O)OCC#C)=CC=C1OC1=NC=C(Cl)C=C1F JBDHZKLJNAIJNC-LLVKDONJSA-N 0.000 description 1
- OYJMHAFVOZPIOY-UHFFFAOYSA-N propan-2-yl 2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate Chemical compound C1=C(Cl)C(C(=O)OC(C)C)=CC(N2C(N(C)C(=CC2=O)C(F)(F)F)=O)=C1 OYJMHAFVOZPIOY-UHFFFAOYSA-N 0.000 description 1
- FKLQIONHGSFYJY-UHFFFAOYSA-N propan-2-yl 5-[4-bromo-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-chloro-4-fluorobenzoate Chemical compound C1=C(Cl)C(C(=O)OC(C)C)=CC(C=2C(=C(N(C)N=2)C(F)(F)F)Br)=C1F FKLQIONHGSFYJY-UHFFFAOYSA-N 0.000 description 1
- FROBCXTULYFHEJ-OAHLLOKOSA-N propaquizafop Chemical compound C1=CC(O[C@H](C)C(=O)OCCON=C(C)C)=CC=C1OC1=CN=C(C=C(Cl)C=C2)C2=N1 FROBCXTULYFHEJ-OAHLLOKOSA-N 0.000 description 1
- WJNRPILHGGKWCK-UHFFFAOYSA-N propazine Chemical compound CC(C)NC1=NC(Cl)=NC(NC(C)C)=N1 WJNRPILHGGKWCK-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- NQLVQOSNDJXLKG-UHFFFAOYSA-N prosulfocarb Chemical compound CCCN(CCC)C(=O)SCC1=CC=CC=C1 NQLVQOSNDJXLKG-UHFFFAOYSA-N 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 235000012587 purple deadnettle Nutrition 0.000 description 1
- 235000012589 purple deadnettle Nutrition 0.000 description 1
- ASRAWSBMDXVNLX-UHFFFAOYSA-N pyrazolate Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=O)C=1C(C)=NN(C)C=1OS(=O)(=O)C1=CC=C(C)C=C1 ASRAWSBMDXVNLX-UHFFFAOYSA-N 0.000 description 1
- VTRWMTJQBQJKQH-UHFFFAOYSA-N pyributicarb Chemical compound COC1=CC=CC(N(C)C(=S)OC=2C=C(C=CC=2)C(C)(C)C)=N1 VTRWMTJQBQJKQH-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- ALZOLUNSQWINIR-UHFFFAOYSA-N quinmerac Chemical compound OC(=O)C1=C(Cl)C=CC2=CC(C)=CN=C21 ALZOLUNSQWINIR-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- MEFOUWRMVYJCQC-UHFFFAOYSA-N rimsulfuron Chemical compound CCS(=O)(=O)C1=CC=CN=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 MEFOUWRMVYJCQC-UHFFFAOYSA-N 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- HKAMKLBXTLTVCN-UHFFFAOYSA-N simeton Chemical compound CCNC1=NC(NCC)=NC(OC)=N1 HKAMKLBXTLTVCN-UHFFFAOYSA-N 0.000 description 1
- MGLWZSOBALDPEK-UHFFFAOYSA-N simetryn Chemical compound CCNC1=NC(NCC)=NC(SC)=N1 MGLWZSOBALDPEK-UHFFFAOYSA-N 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229940080281 sodium chlorate Drugs 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- KZOJQMWTKJDSQJ-UHFFFAOYSA-M sodium;2,3-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S([O-])(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 KZOJQMWTKJDSQJ-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- PQTBTIFWAXVEPB-UHFFFAOYSA-N sulcotrione Chemical compound ClC1=CC(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O PQTBTIFWAXVEPB-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- RJKCKKDSSSRYCB-UHFFFAOYSA-N tebutam Chemical compound CC(C)(C)C(=O)N(C(C)C)CC1=CC=CC=C1 RJKCKKDSSSRYCB-UHFFFAOYSA-N 0.000 description 1
- BCQMBFHBDZVHKU-UHFFFAOYSA-N terbumeton Chemical compound CCNC1=NC(NC(C)(C)C)=NC(OC)=N1 BCQMBFHBDZVHKU-UHFFFAOYSA-N 0.000 description 1
- IROINLKCQGIITA-UHFFFAOYSA-N terbutryn Chemical compound CCNC1=NC(NC(C)(C)C)=NC(SC)=N1 IROINLKCQGIITA-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000005622 tetraalkylammonium hydroxides Chemical class 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000019529 tetraterpenoid Nutrition 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- BQZXUHDXIARLEO-UHFFFAOYSA-N tribenuron Chemical compound COC1=NC(C)=NC(N(C)C(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(O)=O)=N1 BQZXUHDXIARLEO-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 229940087291 tridecyl alcohol Drugs 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- CCRMAATUKBYMPA-UHFFFAOYSA-N trimethyltin Chemical compound C[Sn](C)C.C[Sn](C)C CCRMAATUKBYMPA-UHFFFAOYSA-N 0.000 description 1
- PIHCREFCPDWIPY-UHFFFAOYSA-N tris[2-(2,4-dichlorophenoxy)ethyl] phosphite Chemical compound ClC1=CC(Cl)=CC=C1OCCOP(OCCOC=1C(=CC(Cl)=CC=1)Cl)OCCOC1=CC=C(Cl)C=C1Cl PIHCREFCPDWIPY-UHFFFAOYSA-N 0.000 description 1
- KVEQCVKVIFQSGC-UHFFFAOYSA-N tritosulfuron Chemical compound FC(F)(F)C1=NC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(F)(F)F)=N1 KVEQCVKVIFQSGC-UHFFFAOYSA-N 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000004562 water dispersible granule Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 235000005765 wild carrot Nutrition 0.000 description 1
- 235000009037 wild proso millet Nutrition 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- SJZRECIVHVDYJC-UHFFFAOYSA-N γ-Hydroxybutyric acid Chemical compound OCCCC(O)=O SJZRECIVHVDYJC-UHFFFAOYSA-N 0.000 description 1
Abstract
4-Amino-6-(heterocyclic)picolinic acids, 6amino-2-(heterocyclic)pyrimidine-4-carboxylates, and derivatives thereof are provided. Also provided are herbicidal compositions including these compounds, as well as methods of using thereof as herbicides.
Description
4-AMINO-6-(HETEROCYCLIC)PICOLINATES AND 6-AMINO-2(HETEROCYCLIC)PYRIMIDINE-4-CARBOXYLATES AND THEIR USE AS HERBICIDES
Cross Reference to Related Applications
This application daims benefit of U.S. Application No. 13/839,000 filed March 15, 2013, the disclosure of which is expressly incorporated herein by reference.
Field
The invention relates to herbicidal compounds and compositions and to methods for controlling undesirable végétation.
Background
The occurrence of undesirable végétation, e.g., weeds, is a constant problem facing famers in crops, pasture, and other settings. Weeds compete with crops and negatively impact crop yield. The use of chemical herbicides is an important tool in controlling undesirable végétation.
There remains a need for new chemical herbicides that offer a broader spectrum of weed control, selectivity, minimal crop damage, storage stability, ease of handling, higher activity against weeds, and/or a means to address herbicide-tolerance that develops with respect to herbicides currently in use.
Summary of the Invention
Provided herein are compounds of Formula (I):
wherein
X is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio or C1-C3 haloalkylthio;
R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Ci-Cs alkyl, or C7-C10 arylalkyl, and R1 and R are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;
•y
R is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18
-117485 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently CiC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;
R3 and R4 are independently hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, Cj-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3’(R4 ), wherein R3' and R4 are independently hydrogen, Ci-C6 alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-C6 alkoxy or Ci-C6 alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is one of groups Al to A36
r6
Ry
A4
A12
-217485
A20
A17 Re | A18 Re | A19 Re | ||||
Re'x | yKY | Re'- | rïr | < | r6'^ | YiT^ |
Re' | \#-R7' | r6- | '0 | Re | /^r 7' | |
0 \ | ( | s \ | ||||
r7 | r7 | r7 | r7 | |||
A21 | A22 | A23 |
Re
R,iZy\-R,'
N—Y R8Z R7
A27
Re
Re>TN-R8 R7 R?
A28
Re | |
Re\ | |
Re | H r7 |
A31
N
Ry
A32
-317485
A33
A34
A3 5
A36
R5, if applicable to the A group, is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, Ci-C4alkylamino, C2-C4 haloalkylamino, OH, or CN;
R6, R6 , and R6 , if applicable to the A group, are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
R7 and R7 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C1-C4 haloalkylamino, or phenyl;
R8 is hydrogen, Ci-Cé alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Côalkoxycarbonyl, C]-C6 alkylcarbamyl, Cj-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl;
or an N-oxide or agriculturally acceptable sait thereof.
In some embodiments, the compound is a compound of Formula (I):
wherein
X is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;
R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Ci-Cg alkyl, or C7-C10 arylalkyl, and R1 and R1 are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;
-417485
R2 is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R , R , and R are independently CiC10 alkyl, C3-Cô cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;
R3 and R4 are independently hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3Cô haloalkenyl, C3-Cô alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, C]-C6 alkoxycarbonyl, Cj-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, Ci-C6 dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or t A I O f A f
R and R taken together represent =CR (R ), wherein R and R are independently hydrogen, Ci-Cô alkyl, C3-Cô alkenyl, C3-Cô alkynyl, Ci-Cô alkoxy or Cj-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, Al8, Al9, A20, A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;
R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;
R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, or phenyl;
Q
R is hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-Cô alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl;
or an N-oxide or agriculturally acceptable sait thereof, with the proviso that the compound is not a compound of Formula (I):
-517485
(I) wherein
X is N, CH, CF, CCI, or CBr;
R1 is OR1, wherein R1 is hydrogen or C1-C4 alkyl;
R is chlorine;
R3 and R4 are hydrogen;
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17,
A18, A19, or A20;
R5 is hydrogen, halogen, OH, amino, CN, C1-C3 alkyl, C1-C3 alkoxy, C1-C3 alkylamino, or cyclopropyl;
R6, R6 , and R6 are independently hydrogen, halogen, OH, NH2, CN, C1-C3 alkyl, C1-C3 alkoxy, cyclopropyl, or vinyl;
R7and R7 are independently hydrogen, halogen, C1-C3 alkyl, C1-C3 alkoxy, C1-C3 alkylthio, cyclopropyl, or Ci-C3 alkylamino, or phenyl; and
R8 is hydrogen, C1-C3 alkyl, phenyl, or C1-C3 alkylcarbonyl;
or an N-oxide or agriculturally acceptable sait thereof.
In some embodiments, the compound is a compound of Formula (I):
wherein
X is CF;
R is OR , wherein R is hydrogen, C|-C8 alkyl, or C7-C10 arylalkyl;
R2 is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently CiC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, Cj-Cio alkoxy, or OH;
-617485
R3 and R4 are independently hydrogen, Cj-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Ci-C6 alkylcarbamyl, Cj-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, Ci-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3(R4), wherein R3 and R4 are independently hydrogen, Cj-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Cj-Cô alkoxy or C]-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, A18, A19, A20, A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;
R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;
R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
R7and R7 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, or phenyl;
R8 is hydrogen, Ci-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, C|-C6 alkylcarbamyl, Cj-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl;
or an N-oxide or agriculturally acceptable sait thereof
In some embodiments, R is Cl, methoxy, vinyl, or 1-propenyl, and R and R are hydrogen. In certain embodiments, R2 is Cl, and R3 and R4 are hydrogen.
In some embodiments, A is Al5 and/or R5 is hydrogen or F.
In one embodiment, the compound is 4-amino-3-chloro-5-fluoro-6-(7-fluoro-177-indol-6-yl) picolinic acid. In one embodiment, the compound is methyl 4-amino-3-chloro-5-fluoro-6-(7fluoro-177-indol-6-yl) picolinate.
Also provided are methods of controlling undesirable végétation comprising (a) contacting the undesirable végétation or area adjacent to the undesirable végétation or (b) pre-emergently
-717485 contacting soil or water a herbicidally effective amount of at least one compound of Formula (I) or agriculturally acceptable dérivative thereof.
Also provided are novel precursors of Formula (II):
(Π) wherein:
R7 and R7 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, or phenyl;
R8 is hydrogen, Ci-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, Q-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-C6alkoxycarbonyl, Ci-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl;
Z is B(OR22)2, BF3M, or Sn(R23)3) wherein each R22 is independently hydrogen or C1-C4 alkyl, or the two OR22 moieties combine to form -O-C(CH3)2-C(CH3)2-O- or -O-CH2-C(CH3)2-CH2-O-; M is a métal cation, e.g. sodium or potassium, and R is C1-C4 alkyl;
provided the following compound is excluded:
Detailed Description
DEFINITIONS
As used herein, herbicide and herbicidal active ingrédient mean a compound that controls undesirable végétation when applied in an appropriate amount.
As used herein, control of or controlling undesirable végétation means killing or preventing the végétation, or causing some other adversely modifying effect to the végétation e.g., déviations from naturel growth or development, régulation, desiccation, retardation, and the like.
-817485
As used herein, a herbicidally effective or végétation controlling amount is an amount of herbicidal active ingrédient the application of which controls the relevant undesirable végétation.
As used herein, applying a herbicide or herbicidal composition means delivering it directly to the targeted végétation or to the locus thereof or to the area where control of undesired végétation is desired. Methods of application include, but are not limited to pre-emergently contacting soil or water, post-emergently contacting the undesirable végétation or area adjacent to the undesirable végétation.
As used herein, plants and végétation include, but are not limited to, dormant seeds, germinant seeds, emerging seedlings, plants emerging from végétative propagules, immature végétation, and established végétation.
As used herein, agriculturally acceptable salts and esters refer to salts and esters that exhibit herbicidal activity, or that are or can be converted in plants, water, or soil to the referenced herbicide. Exemplary agriculturally acceptable esters are those that are or can by hydrolyzed, oxidized, metabolized, or otherwise converted, e.g., in plants, water, or soil, to the corresponding carboxylic acid which, depending on the pH, may be in the dissociated or undissociated form.
Suitable salts include those derived from alkali or alkaline earth metals and those derived from ammonia and amines. Preferred cations include sodium, potassium, magnésium, and aminium cations of the formula:
r13r14r15r16 n+ wherein R13, R14, R15 and R16 each, independently represents hydrogen or C1-C12 alkyl, C3-C12 alkenyl or C3-C12 alkynyl, each of which is optionally substituted by one or more hydroxy, C1-C4 alkoxy, C1-C4 alkylthio or phenyl groups, provided that R13, R14, R15 and R16 are sterically compatible. Additionally, any two R13, R14, R15 and R16 together may represent an aliphatic difunctional moiety containing one to twelve carbon atoms and up to two oxygen or sulfiir atoms. Salts of the compounds of Formula I can be prepared by treatment of compounds of Formula I with a métal hydroxide, such as sodium hydroxide, with an amine, such as ammonia, trimethylamine, diethanolamine, 2-methylthiopropylamine, bisallylamine,
2-butoxyethylamine, morpholine, cyclododecylamine, or benzylamine or with a tetraalkylammonium hydroxide, such as tétraméthylammonium hydroxide or choline hydroxide. Amine salts are often preferred forms of the compounds of Formula I because
-917485 they are water-soluble and lend themselves to the préparation of désirable aqueous based herbicidal compositions.
Compounds of the formula (I) include N-oxides. Pyridine N-oxides can be obtained by oxidation of the corresponding pyridines. Suitable oxidation methods are described, for example, in Houben-Weyl, Methoden der organischen Chemie [Methods in organic chemistry], expanded and subséquent volumes to the 4th édition, volume E 7b, p. 565 f. As used herein, unless otherwise specified, acyl refers to formyl, C1-C3 alkylcarbonyl, and C1-C3 haloalkylcarbonyl. Cj-Cô acyl refers to formyl, C1-C5 alkylcarbonyl, and C1-C5 haloalkylcarbonyl (the group contains a total of 1 to 6 carbon atoms).
As used herein, alkyl refers to saturated, straight-chained or branched saturated hydrocarbon moieties. Unless otherwise specified, C1-C10 alkyl groups are intended. Examples include methyl, ethyl, propyl, 1-methyl-ethyl, butyl, 1-methyl-propyl, 2-methyl-propyl, 1,1-dimethylethyl, pentyl, 1-methyl-butyl, 2-methyl-butyl, 3-methyl-butyl, 2,2-dimethyl-propyl, 1-ethylpropyl, hexyl, 1,1-dimethyl-propyl, 1,2-dimethyl-propyl, 1-methyl-pentyl, 2-methyl-pentyl,
3-methyl-pentyl, 4-methyl-pentyl, 1,1-dimethyl-butyl, 1,2-dimethyl-butyl, 1,3-dimethylbutyl, 2,2-dimethyl-butyl, 2,3-dimethyl-butyl, 3,3-dimethyl-butyl, 1-ethyl-butyl, 2-ethylbutyl, 1,1,2-trimethyl-propyl, 1,2,2-trimethyl-propyl, 1-ethyl-1-methyl-propyl, and l-ethyl-2methyl-propyl.
As used herein, “haloalkyl” refers to straight-chained or branched alkyl groups, wherein these groups the hydrogen atoms may partially or entirely be substituted with halogen atoms. Unless otherwise specified, Ci-Cs groups are intended. Examples include chloromethyl, bromomethyl, dichloromethyl, trichloromethyl, fluoromethyl, difluoromethyl, trifluoromethyl, chlorofluoromethyl, dichlorofluoromethyl, chlorodifluoromethyl, 1 chloroethyl, 1-bromoethyl, 1-fluoroethyl, 2-fluoroethyl, 2,2-difluoroethyl, 2,2,2trifluoroethyl, 2-chloro-2-fluoroethyl, 2-chloro-2-difluoroethyl, 2,2-dichloro-2-fluoroethyl,
2,2,2-trichloroethyl, pentafluoroethyl, and l,l,l-trifluoroprop-2-yl.
As used herein, alkenyl refers to unsaturated, straight-chained, or branched hydrocarbon moieties containing a double bond. Unless otherwise specified, C2-Cs alkenyl are intended. Alkenyl groups may contain more than one unsaturated bond. Examples include ethenyl, 1 propenyl, 2-propenyl, 1-methylethenyl, 1-butenyl, 2-butenyl, 3-butenyl, 1-methyl-1propenyl, 2-methyl-1 -propenyl, l-methyl-2-propenyl, 2-methyl-2-propenyl, 1-pentenyl, 2pentenyl, 3-pentenyl, 4-pentenyl, 1-methyl-1-butenyl, 2-methyl- 1-butenyl, 3-methyl-1butenyl, l-methyl-2-butenyl, 2-methyl-2-butenyl, 3-methyl-2-butenyl, l-methyl-3-butenyl, 2methyl-3-butenyl, 3-methyl-3-butenyl, l,l-dimethyl-2-propenyl, 1,2-dimethyl-1-propenyl,
-1017485
1.2- dimethyl-2-propenyl, 1-ethyl-l-propenyl, l-ethyl-2-propenyl, 1-hexenyl, 2-hexenyl, 3hexenyl, 4-hexenyl, 5-hexenyl, 1-methyl-l-pentenyl, 2-methyl-l-pentenyl, 3-methyl-lpentenyl, 4-methyl-l-pentenyl, l-methyl-2-pentenyl, 2-methyl-2-pentenyl, 3-methyl-2pentenyl, 4-methyl-2-pentenyl, l-methyl-3-pentenyl, 2-methyl-3-pentenyl, 3-methyl-3pentenyl, 4-methyl-3-pentenyl, l-methyl-4-pentenyl, 2-methyl-4-pentenyl, 3-methyl-4pentenyl, 4-methyl-4-pentenyl, l,l-dimethyl-2-butenyl, l,l-dimethyl-3-butenyl, 1,2dimethyl-l-butenyl, 1,2-dimethyl-2-butenyl, l,2-dimethyl-3-butenyl, 1,3-dimethyl-l-butenyl,
1.3- dimethyl-2-butenyl, l,3-dimethyl-3-butenyl, 2,2-dimethyl-3-butenyl, 2,3-dimethyl-lbutenyl, 2,3-dimethyl-2-butenyl, 2,3-dimethyl-3-butenyl, 3,3-dimethyl-l-butenyl, 3,3dimethyl-2-butenyl, 1-ethyl-l-butenyl, l-ethyl-2-butenyl, l-ethyl-3-butenyl, 2-ethyl-lbutenyl, 2-ethyl-2-butenyl, 2-ethyl-3-butenyl, l,l,2-trimethyl-2-propenyl, 1-ethyl-l-methyl-
2-propenyl, l-ethyl-2-methyl-l-propenyl, and l-ethyl-2-methyl-2-propenyl. Vinyl refers to a group having the strutcture -CH=CH2; 1-propenyl refers to a group with the structureCH=CH-CH3; and 2- propenyl refers to a group with the structure -CH2-CH=CH2.
As used herein, alkynyl represents straight-chained or branched hydrocarbon moieties containing a triple bond. Unless otherwise specified, C2-C8 alkynyl groups are intended. Alkynyl groups may contain more than one unsaturated bond. Examples include C2-C6alkynyl, such as ethynyl, 1-propynyl, 2-propynyl (or propargyl), 1-butynyl, 2-butynyl, 3butynyl, l-methyl-2-propynyl, 1-pentynyl, 2-pentynyl, 3-pentynyl, 4-pentynyl, 3-methyl-lbutynyl, 1-methyl-2-butynyl, l-methyl-3-butinyul, 2-methyl-3-butynyl, 1,1-dimethyl-2propynyl, l-ethyl-2-propynyl, 1-hexynyl, 2-hexynyl, 3-hexynyl, 4-hexynyl, 5-hexynyl, 3methyl-1-pentynyl, 4-methyl-1-pentynyl, l-methyl-2-pentynyl, 4-methyl-2-pentynyl, 1methyl-3-pentynyl, 2-methyl-3-pentynyl, 1 -methyl-4-pentynyl, 2-methyl-4-pentynyl, 3methyl-4-pentynyl, 1,1 -dimethyl-2-butynyl, 1,1 -dimethyl-3 -butynyl, 1,2-dimethyl-3 -butynyl, 2,2-dimethyl-3-butynyl, 3,3-dimethyl-1-butynyl, l-ethyl-2-butynyl, l-ethyl-3-butynyl, 2ethyl-3-butynyl, and l-ethyl-l-methyl-2-propynyl.
As used herein, alkoxy refers to a group of the formula R-O-, where R is alkyl as defined above. Unless otherwise specified, alkoxy groups wherein R is a Ci-Cs alkyl group are intended. Examples include methoxy, ethoxy, propoxy, 1-methyl-ethoxy, butoxy, 1-methylpropoxy, 2-methyl-propoxy, 1,1-dimethyl-ethoxy, pentoxy, 1-methyl-butyloxy, 2-methylbutoxy, 3-methyl-butoxy, 2,2-di-methyl-propoxy, 1-ethyl-propoxy, hexoxy, 1,1-dimethylpropoxy, 1,2-dimethyl-propoxy, 1-methyl-pentoxy, 2-methyl-pentoxy, 3-methyl-pentoxy, 4methyl-penoxy, 1,1-dimethyl-butoxy, 1,2-dimethyl-butoxy, 1,3-dimethyl-butoxy, 2,2dimethyl-butoxy, 2,3-dimethyl-butoxy, 3,3-dimethyl-butoxy, 1-ethyl-butoxy, 2-ethylbutoxy,
-1117485
1,1,2-trimethyl-propoxy, 1,2,2-trimethyl-propoxy, 1-ethyl-1-methyl-propoxy, and l-ethyl-2methyl-propoxy.
As used herein, haloalkoxy refers to a group of the formula R-O-, where R is haloalkyl as defined above. Unless otherwise specified, haloalkoxy groups wherein R is a Cj-Cs alkyl group are intended. Examples include chloromethoxy, bromomethoxy, dichloromethoxy, trichloromethoxy, fluoromethoxy, difluoromethoxy, trifluoromethoxy, chlorofluoromethoxy, dichlorofluoromethoxy, chlorodifluoromethoxy, 1-chloroethoxy, 1-bromoethoxy, 1fluoroethoxy, 2-fluoroethoxy, 2,2-difluoroethoxy, 2,2,2-trifluoroethoxy, 2-chloro-2fluoroethoxy, 2-chloro,2-difluoroethoxy, 2,2-dichloro-2-fluoroethoxy, 2,2,2-trichloroethoxy, pentafluoroethoxy, and l,l,l-trifluoroprop-2-oxy.
As used herein, alkylthio refers to a group of the formula R-S- where R is alkyl as defined above. Unless otherwise specified, alkylthio groups wherein R is a Cj-Cg alkyl group are intended. Examples include methylthio, ethylthio, propylthio, 1-methylethylthio, butylthio, 1-methyl-propylthio, 2-methylpropylthio, 1,1-dimethylethylthio, pentylthio, 1methylbutylthio, 2-methylbutylthio, 3-methylbutylthio, 2,2-dio-methylpropylthio, 1ethylpropylthio, hexylthio, 1,1-dimethyl propylthio, 1,2-dimethyl propylthio, 1methylpentylthio, 2-methylpentylthio, 3-methyl-pentylthio, 4-methyl-pentylthio, 1,1dimethyl butylthio, 1,2-dimethyl-butylthio, 1,3-dimethyl-butylthio, 2,2-dimethyl butylthio,
2,3-dimethyl butylthio, 3,3-dimethylbutylthio, 1-ethylbutylthio, 2-ethylbutylthio, 1,1,2trimethyl propylthio, 1,2,2-trimethyl propylthio, 1-ethyl-1-methyl propylthio, and l-ethyl-2methylpropylthio.
As used herein, haloalkylthio refers to an alkylthio group as defined above wherein the carbon atoms are partially or entirely substituted with halogen atoms. Unless otherwise specified, haloalkylthio groups wherein R is a Ci-C8 alkyl group are intended. Examples include chloromethylthio, bromomethylthio, dichloromethylthio, trichloromethylthio, fluoromethylthio, difluoromethylthio, trifluoromethylthio, chlorofluoromethylthio, dichlorofluoro-methylthio, chlorodifluoromethylthio, 1-chloroethylthio, 1-bromoethylthio, 1fluoroethylthio, 2-fluoroethylthio, 2,2-difluoroethylthio, 2,2,2-trifluoroethylthio, 2-chloro-2fluoroethylthio, 2-chloro-2-difluoroethylthio, 2,2-dichloro-2-fluoroethylthio, 2,2,2trichloroethylthio, pentafluoroethylthio, and l,l,l-trifluoroprop-2-ylthio.
As used herein, aryl, as well as dérivative terms such as aryloxy, refers to a phenyl, indanyl or naphthyl group with phenyl being preferred. The term heteroaryl, as well as dérivative terms such as heteroaryloxy, refers to a 5- or 6-membered aromatic ring containing one or more heteroatoms, viz., N, O or S; these heteroaromatic rings maybe fused to other aromatic
-1217485
Systems. The aryl or heteroaryl substituents may be unsubstituted or substituted with one or more substituents selected from halogen, hydroxy, nitro, cyano, formyl, Cj-Cô alkyl, C2-Cô alkenyl, C2-C6 alkynyl, Ci-Cô alkoxy, Cj-Cô haloalkyl, CpCô haloalkoxy, Ci-Ceacyl, Ci-C6 alkylthio, Cj-Cô alkylsulfinyl, Cj-Cô alkylsulfonyl, Cj-Cô alkoxycarbonyl, Ci-Côcarbamoyl, hydroxycarbonyl, Cj-Cô alkylcarbonyl, aminocarbonyl, Ci-Céalkylaminocarbonyl, Cj-Cô dialkylaminocarbonyl, provided that the substituents are sterically compatible and the rules of chemical bonding and strain energy are satisfied. Preferred substituents include halogen, Cj-C2 alkyl and C]-C2 haloalkyl.
As used herein alkylcarbonyl refers to an alkyl group bonded to a carbonyl group. C1-C3 alkylcarbonyl and C1-C3 haloalkylcarbonyl refer to groups wherein a C1-C3 alkyl group is bonded to a carbonyl group (the group contains a total of 2 to 4 carbon atoms).
As used herein, alkoxycarbonyl refers to a group of the formula OR wherein R is alkyl. As used herein, arylalkyl refers to an alkyl group substituted with an aryl group. C7-C10 arylalkyl refers to a group wherein the total number of carbon atoms in the group is 7 to 10. As used herein alkylamino refers to an amino group substituted with one or two alkyl groups, which may be the same or different.
As used herein haloalkylamino refers to an alkylamino group wherein the alkyl carbon atoms are partially or entirely substituted with halogen atoms.
As used herein, Ci-Cô alkylaminocarbonyl refers to a group of the formula RNHC(O)wherein R is Ci-Cô alkyl, and Cj-Cô dialkylaminocarbonyl refers to a group of the formula R2NC(O)- wherein each R is independently Ci-Cô alkyl.
As used herein alkylcarbamyl refers to a carbamyl group substituted on the nitrogen with an alkyl group.
As used herein alkylsulfonyl refers to a group of the formula θ R , where R is alkyl.
O
As used herein carbamyl (also referred to as carbamoyl and aminocarbonyl) refers to a group
O of the formula
II
As used herein dialkylphosphonyl refers to a group of the formula ? 0R where R is
OR independently alkyl in each occurrence.
-1317485
As used herein, Cj-Cô trialkylsilyl refers to a group of the formula -S1R3 wherein each R is independently a Ci-Cô alkyl group (the group contains a total of 3 to 18 carbon atoms).
As used herein Me refers to a methyl group; OMe refers to a methoxy group; z-Pr refers to an isopropyl group.
As used herein, the term “halogen” including dérivative terms such as “halo” refers to fluorine, chlorine, bromine and iodine.
As used herein, plants and végétation include, but are not limited to, germinant seeds, emerging seedlings, plants emerging from végétative propagules, immature végétation, and established végétation.
COMPOUNDS OF FORMULA (I)
The invention provides compounds of Formula (I) as defined above and N-oxides and agriculturally acceptable salts thereof.
In some embodiments, the compound is the carboxylic acid or an agriculturally acceptable ester or sait. In some embodiments, the compound is the carboxylic acid or its methyl ester. In some embodiments:
A is one of groups Al to A20;
R1 is OR1, wherein R1 is hydrogen or C1-C4 alkyl;
R2 is chlorine;
R3 and R4 are hydrogen;
X is N, CH, CF, CCI, or CBr;
R5 is hydrogen, halogen, OH, NH2, CN, C1-C3 alkyl, C1-C3 alkoxy, C1-C3 alkylamino, or cyclopropyl;
R6, R6 , and R6 are independently hydrogen, halogen, OH, NH2, CN, C1-C3 alkyl, CiC3 alkoxy, cyclopropyl, or vinyl;
R and R are independently hydrogen, halogen, C1-C3 alkyl, C1-C3 alkoxy, C1-C3 alkylthio, cyclopropyl, or C1-C3 alkylamino, or phenyl; and
R8 is hydrogen, C1-C3 alkyl, phenyl, or C1-C3 alkylcarbonyl.
In some embodiments, R1 is OR1 , wherein R1 is hydrogen, Ci-Cs alkyl, or C7-C10 arylalkyl.
In some embodiments, R1 is hydrogen or Ci-Cs alkyl. In some embodiments, R1 is hydrogen.
-1417485
In some embodiments, R2 is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkynyl, C2-C4alkenyl, C2-C4 haloalkenyl, or C]-C4-alkoxy, or C]-C4 haloalkoxy. In some embodiments, R is halogen, C2-C4-alkenyl, C2-C4 haloalkenyl, or Ci-C4-alkoxy. In some embodiments, R is halogen. In some embodiements, R2 is C2-C4-alkenyl or C2-C4 haloalkenyl. In some embodiments, R is C1-C4 alkoxy. In some embodiments, R is Cl, OMe, vinyl, or 1 9 9 propenyl. In some embodiments, R is Cl. In some embodiments, R is OMe. In some embodiments, R is vinyl or 1-propenyl.
In some embodiments, R3 and R4 are independently hydrogen, Cj-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Cj-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, or R3 and R4 taken together represent =CR3(R4), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6
O alkenyl, C3-C6 alkynyl, Cj-Cô alkoxy, or Cj-Cô alkylamino. In some embodiments, R and R4 are independently hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, or R3 and R4 taken together represent =CR3(R4), wherein R3 and R4 are independently hydrogen, C|-C6 alkyl, Cj-Cô alkoxy or Cj-Cô alkylamino. In some embodiments, R3 and R4 are independently hydrogen, Cj-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, formyl, C1-C3 alkylcarbonyl, or C1-C3 haloalkylcarbonyl. In some embodiments, at least one of R3 and R4 are hydrogen. In some embodiments, R3 and R4 are both hydrogen.
In some embodiments, X is N, CH or CF. In some embodiments, X is N. In some embodiments, X is CH. In some embodiments, X is CF.
In some embodiments, A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, A18, A19, or A20.
In some embodiments, A is one of A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, and A36.
In some embodiments, A is one of groups Al, A2, A3, A7, A8, A9, A10, A13, A14, and Al5. In some embodiments, A is one of groups Al, A2, A3, Al3, A14, and Al5. In some embodiments, A is one of groups Al3, A14, and Al5. In some embodiments, A is Al5. In some embodiments, R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, or amino. In some embodiments, R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, or amino. In some embodiments, R5 is hydrogen, halogen, C1-C4 alkyl or C1-C4 alkoxy. In some embodiments, R5 is hydrogen or F. In some embodiments, R5 is hydrogen.
In other embodiments, R5 is F.
-1517485
In some embodiments, R6 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, C1-C3 alkoxy, or C1-C3 haloalkoxy. In some embodiments, R6 is hydrogen or fluorine. In some embodiments, R6 is hydrogen. In some embodiments, R6 is fluorine.
In some embodiments, R is hydrogen or halogen. In some embodiments, R is hydrogen, F, or Cl. In some embodiments, R6 is hydrogen or F. In some embodiments, R6 is hydrogen.
In some embodiments, R6 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, C2-C4 alkynyl, CN, or NO2. In some embodiments, R6 is hydrogen. In some embodiments, R6 is halogen. In some embodiments, R6 is Ci-C4 alkyl. In some embodiments, R6 isCiC4 haloalkyl. In some embodiments, R6 is cyclopropyl. In some embodiments, R6 is C2-C4 alkynyl. In some embodiments, R6 is CN. In some embodiments, R6 is NO2.
In some embodiments:
R2 is halogen, C2-C4-alkenyl, C2-C4 haloalkenyl, or Ci-C4-alkoxy;
R3 and R4 are both hydrogen; and
X is N, CH, or CF.
In some embodiments:
•y
R is halogen;
R3 and R4 are both hydrogen; and
X is N, CH, or CF.
In some embodiments:
R2 is C2-C4-alkenyl or C2-C4 haloalkenyl;
R3 and R4 are both hydrogen; and
X is N, CH, or CF.
In some embodiments:
R2 is Ci-C4-alkoxy;
R3 and R4 are both hydrogen; and
X is N, CH, or CF.
In some embodiments:
R2 is halogen, C2-C4-alkenyl, C2-C4 haloalkenyl, or C]-C4-alkoxy;
R3 and R4 are both hydrogen;
X is N, CH, or CF;
R5 is hydrogen or F;
R6 is hydrogen or F;
R6 is hydrogen;
R6 ,if applicable to the relevant A group, is hydrogen or halogen; and
-1617485
7e
R and R ,if applicable to the relevant A group, are independently hydrogen or halogen.
In some embodiments:
R is halogen, Ci-C4-alkoxy, or C2-C4-alkenyl ;
R3 and R4 are hydrogen;
XisN, CH, or CF; and
A is one of groups Al to A20;
In some embodiments:
R is chlorine;
R3 and R4 are hydrogen;
X is N, CH, or CF;
A is one of groups Al to A20;
R5 is hydrogen or F;
R6 and R6 are independently hydrogen or F; and
R and R ,if applicable to the relevant A group, are independently hydrogen, halogen, C1-C4 alkyl, or C1-C4 haloalkyl.
In some embodiments:
R is chlorine, methoxy, vinyl, or 1-propenyl;
R3 and R4 are hydrogen; and
X is N, CH, or CF.
In some embodiments:
R is chlorine;
R3 and R4 are hydrogen; and
X is N, CH, or CF.
In some embodiments:
R is vinyl or 1-propenyl;
R3 and R4 are hydrogen; and
X is N, CH, or CF.
In some embodiments:
R2 is methoxy;
R3 and R4 are hydrogen; and
X is N, CH, or CF.
In some embodiments:
-1717485
R is chlorine;
R3 and R4 are hydrogen; and
Xis N.
In some embodiments:
R is chlorine;
R3 and R4 are hydrogen; and
X is CH.
In some embodiments:
R is chlorine;
R3 and R4 are hydrogen; and
X is CF.
In some embodiments:
R2 is chlorine;
R3 and R4 are hydrogen;
X is CF;
A is one of Al, A2, A3, A7, A8, A9, A10, A13, A14, or A15;
R5 is F; and
R6 is H.
In some embodiments:
R is chlorine, methoxy, vinyl, or 1-propenyl;
R3 and R4 are hydrogen;
X is N, CH, or CF; and
A is one of A21-A36.
In some embodiments:
R is chlorine, methoxy, vinyl, or 1-propenyl;
R3 and R4 are hydrogen;
X is CF; and
A is one of
NH
O
S
-1817485
,wherein R5 is hydrogen
In some embodiments:
R is chlorine, methoxy, vinyl, or 1-propenyl;
R3 and R4 are hydrogen;
•y
R is chlorine, methoxy, vinyl, or 1-propenyl; R3 and R4 are hydrogen;
In some embodiments:
R2 is chlorine, methoxy, vinyl, or 1-propenyl;
R3 and R4 are hydrogen;
It is particularly noteworthy that compounds of Formula (I) wherein A is, e.g. Al 5, exhibit a significant increase in activity when X is CF. This is demonstrated by comparing the activity of Compounds 1.21 and 1.22 (wherein X is CH) with that of 1.08 and 1.09 (wherein X is CF). It is also demonstrated by comparing the activity of Compounds 1.23 and 1.24 (wherein X is CH) with that of Compounds 1.15 and 1.16 (wherein X is CF). The increased activity is further enhanced when R5 is F.
-1917485
In some embodiments, the compound is a compound of Formula (I):
wherein
X is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;
R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Cj-Cg alkyl, or C7-C10 arylalkyl, and R1 and R are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;
R2 is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently CiC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;
R3 and R4 are independently hydrogen, Ci-Cô alkyl, C]-Cô haloalkyl, C3-C6 alkenyl, C3Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, Ci-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Ci-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, A18, A19, A20, A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;
R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;
R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
-2017485
R7and R7 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkyl amino, or phenyl; and
R8 is hydrogen, C|-C6 alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Cj-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, or phenyl;
or an N-oxide or agriculturally acceptable sait thereof, with the proviso that the compound is not a compound of Formula (I):
wherein
X is N, CH, CF, CCI, or CBr;
R1 is OR1, wherein R1 is hydrogen or C1-C4 alkyl;
O
R is chlorine;
R3 and R4 are hydrogen;
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Al 1, A12, A13, A14, A15, A16, A17, Al 8, A19, or A20;
R5 is hydrogen, halogen, OH, amino, CN, C1-C3 alkyl, C1-C3 alkoxy, C1-C3 alkylamino, or cyclopropyl;
R6, R6, and R6 are independently hydrogen, halogen, OH, NH2, CN, C1-C3 alkyl, C1-C3 alkoxy, cyclopropyl, or vinyl;
R and R are independently hydrogen, halogen, C1-C3 alkyl, Cj-C3 alkoxy, C1-C3 alkylthio, cyclopropyl, or C1-C3 alkylamino, or phenyl; and
R8 is hydrogen, C1-C3 alkyl, phenyl, or C1-C3 alkylcarbonyl;
or an N-oxide or agriculturally acceptable sait thereof.
In some of these embodiments, R1 is OR1. In some of these embodiments, X is CF. In some of these embodiments, A is Al5. In some of these embodiments, R5 is F.
In some embodiments:
X is CY, wherein Y is C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, CiC3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;
-2117485
R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Ci-Cg alkyl, or C7-C10 arylalkyl, and R1 and R are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;
R is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CRI8-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently CiC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;
R3 and R4 are independently hydrogen, Cj-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Cj-Cô alkyl carbamyl, Cj-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, Cj-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Ci-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Al 1, A12, A13, A14, A15, A16, A17, Al 8, Al 9, A20, A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A3 5, or A36;
R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;
R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, or phenyl; and
R8 is hydrogen, Ci-Ce alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cé alkoxycarbonyl, Ci-Cé alkylcarbamyl, Ci-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl.
In some of these embodiments, R1 is OR1. In some of these embodiments, A is Al5. In some of these embodiments, R5 is F.
-2217485
In some embodiments:
X is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;
R is OR1 or NR1 R1 , wherein R1 is C5-C8 alkyl, or C7-C10 arylalkyl, and R and R1 are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;
•y
R is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R , R , and R are independently CiC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;
R3 and R4 are independently hydrogen, Cj-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, Cj-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Cj-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, A18, A19, A20, A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;
R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;
R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
R7and R7 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,C]-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, or phenyl;
-2317485
R8 is hydrogen, C[-C6 alkyl, C]-C6 haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl;
In some of these embodiments, R1 is OR1. In some of these embodiments, X is CF. In some of these embodiments, A is Al 5. In some of these embodiments, R5 is F.
In some embodiments:
X is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;
R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Ci-Cg alkyl, or C7-C10 arylalkyl, and R1 and R1 are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;
R2 is F, Br, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently CiC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;
R3 and R4 are independently hydrogen, Ci-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, C]-C6 alkoxycarbonyl, Ci-C6 alkylcarbamyl, Ci-Cô alkylsulfonyl, C|-C6 trialkylsilyl, C|-C6 dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Cj-Cô alkoxy or C]-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, A18, A19, A20, A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;
R5 is hydrogen, halogen, Ci-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;
R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
-2417485
R7and R7 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, or phenyl; and
R8 is hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, or phenyl.
In some of these embodiments, R1 is OR1. In some of these embodiments, X is CF. In some of these embodiments, A is Al5. In some of these embodiments, R5 is F.
In some embodiments:
X is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;
R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Cj-Cg alkyl, or C7-C10 arylalkyl, and R1 and R are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;
R2 is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CRl8-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R , R , and R are independently CjC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, Cj-Cjo alkoxy, or OH;
R3 and R4 are independently Cj-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Cj-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, Cj-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Cj-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Cj-Cô alkoxy or Cj-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Al 1, A12, A13, A14, A15, A16, A17, A18, A19, A20, A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;
R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;
-2517485
R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, or phenyl; and
Q
R is hydrogen, C[-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Cj-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, or phenyl.
In some of these embodiments, R1 is OR1. In some of these embodiments, X is CF. In some of these embodiments, A is Al 5. In some of these embodiments, R5 is F.
In some embodiments:
X is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;
R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Ci-Cs alkyl, or C7-C10 arylalkyl, and R1 and R are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;
R2 is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R , R , and R are independently CiC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;
R3 and R4 are independently hydrogen, Cj-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, C]-C6 alkylsulfonyl, Cj-Cô trialkylsilyl, Ci-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, C]-C6 alkoxy or Ci-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;
-2617485
R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;
£ £, £»i
R , R , and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, or phenyl; and o
R is hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl.
In some of these embodiments, R1 is OR1. In some of these embodiments, X is CF. In some of these embodiments, R5 is F.
In some embodiments:
X is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;
R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Cj-Cs alkyl, or C7-C10 arylalkyl, and R1 and R1 are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;
R is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R , R , and R are independently CiC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;
R3 and R4 are independently hydrogen, Ci-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, C]-C6 alkylcarbamyl, Cj-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, Cj-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Ci-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
-2717485
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, Al 8, A19,orA20;
R5 is C4 alkyl, Ci-C4 haloalkyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, C4 alkylamino, or C2-C4 haloalkylamino;
R6, R6, and R6 are independently hydrogen, halogen, Ci-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, Ci-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
R and R are independently hydrogen, halogen, Cj-C4 alkyl, Ci-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, Ci-C4 alkylamino, C2-C4 haloalkylamino, or phenyl; and n
R is hydrogen, Cj-Cg alkyl, Ci-Cg haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cg alkoxycarbonyl, Cj-Cg alkylcarbamyl, Ci-Cg alkylsulfonyl, Cj-Cg trialkylsilyl, or phenyl.
In some of these embodiments, R1 is OR1. In some of these embodiments, X is CF. In some of these embodiments, A is Al5. In some of these embodiments, R5 is F.
In some embodiments:
X is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;
R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Cj-Cg alkyl, or C7-C10 arylalkyl, and R1 and R are independently hydrogen, C]-Ci2 alkyl, C3-Cj2 alkenyl, or C3-Cj2 alkynyl;
o
R is halogen, C[-C4 alkyl, C]-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, Ci-C4 alkoxy, Ci-C4 haloalkoxy, Ci-C4 alkylthio, Cj-C4 haloalkylthio, amino, Ci-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, Ci-C4 alkyl, or Ci-C4 haloalkyl; and R , R , and R are independently CjC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, Cj-Cio alkoxy, or OH;
R3 and R4 are independently hydrogen, Ci-Cg alkyl, Cj-Cg haloalkyl, C3-C6 alkenyl, C3Cf, haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Cj-Cg alkoxycarbonyl, Cj-Cg alkylcarbamyl, Cj-Cg alkylsulfonyl, C[-Cg trialkylsilyl, Cj-Cg dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen,
-2817485
Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Ci-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Al 1, A12, A13, A14, A15, A16, A17, A18, A19, orA20;
R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;
R6, R6, and R6 are independently C4 alkyl, C1-C4 haloalkyl, halocyclopropyl, C3-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, C1-C4 alkylamino or C2-C4 haloalkylamino, or NO2;
R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, or phenyl; and
R8 is hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl.
In some of these embodiments, R1 is OR1. In some of these embodiments, X is CF. In some of these embodiments, A is Al5. In some of these embodiments, R5 is F.
In some embodiments:
X is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;
R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Cj-Cg alkyl, or C7-C10 arylalkyl, and R1 and R are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;
R is halogen, Q-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CRl8-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently CiC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;
R3 and R4 are independently hydrogen, Cj-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, Ci-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or
-2917485
R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, C|-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Cj-Cô alkoxy or Cj-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, Al7, or A18;
R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C4-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;
R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
R7and R7 are independently C4 alkyl, C1-C4 haloalkyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 haloalkoxy, C1-C3 haloalkylthio, amino, C4 alkylamino, or C2-C4 haloalkylamino; and
R8 is hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, C|-C6 alkoxycarbonyl, Ci-C6 alkylcarbamyl, Cj-Cô alkylsulfonyl, C|-Cô trialkylsilyl, or phenyl
In some of these embodiments, R1 is OR1. In some of these embodiments, X is CF. In some of these embodiments, A is Al5. In some of these embodiments, R5 is F.
In some embodiments:
X is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;
R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Cj-Cs alkyl, or C7-C10 arylalkyl, and R1 and R1 are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;
R is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently CiC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;
R3 and R4 are independently hydrogen, Ci-Cô alkyl, Ci-Cg haloalkyl, C3-C6 alkenyl, C3Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, C1-G5
-3017485 dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Cj-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Cj-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is A3, A6, Ail, A12, Al5, Al8, Al9, or A20;
R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;
R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, or phenyl; and
R8 is C3-C6 alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, or Ci-Cô trialkylsilyl.
In some of these embodiments, R1 is OR1. In some of these embodiments, X is CF. In some of these embodiments, A is Al 5. In some of these embodiments, R5 is F.
In some embodiments, the compound is a compound of Formula (I):
wherein
X is CF;
R* is OR1, wherein R1 is hydrogen, Ci-Cs alkyl, or C7-C10 arylalkyl;
R is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18
-3117485 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently CiC10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;
R3 and R4 are independently hydrogen, Cj-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, C|-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, Cj-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cê alkoxy or Ci-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;
A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Al 1, A12, A13, A14, A15, A16, A17, Al 8, Al9, A20, A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;
R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;
R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;
R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, or phenyl; and
Q
R is hydrogen, Cj-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Cj-Cé alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl;
or an N-oxide or agriculturally acceptable sait thereof.
In some embodiments:
R1 is OR1, wherein R1 is hydrogen, Cj-Cs alkyl, or C7-C10 arylalkyl;
R is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4-alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, Ci-C4-alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, or C1-C4 haloalkylthio.
R3 and R4 are hydrogen, Ci-Cé alkyl, C1-C6 haloalkyl, Cy-Cf, alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, or R3 and R4 taken
-3217485 together represent =CR3(R4), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3C6 alkenyl, C3-C6 alkynyl, Cj-Cô alkoxy or Cj-Cô alkylamino;
A is Al, A2, A3, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A21, A22, A23, A24, A27, A28, A29, A30, A31, or A32;
R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, CiC4 alkylamino, or C2-C4 haloalkylamino;
R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, CN, orNCh;
R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, cyclopropyl, amino or C1-C4 alkylamino; and
Q
R is hydrogen, Cj-Cô alkyl, C1-C4 haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Côalkoxycarbonyl, or Cj-Cô alkylcarbamyl.
In some embodiments, R is halogen, C2-C4-alkenyl, C2-C4 haloalkenyl, or C1-C4alkoxy. In certain embodiments, R is Cl, methoxy, vinyl, or 1-propenyl. In some embodiments, R3 and R4 are hydrogen.
In some embodiments, A is Al, A2, A3, A7, A8, A9, A10, A13, A14, or A15. In certain embodiments, A is Al, A2, A3, A13, A14, or Al5. In certain embodiments, A is A15.
In some embodiments, R5 is hydrogen or F. In certain embodiments, R5 is F. In certain embodiments, R5 is H.
In some embodiments, R6 is hydrogen or F. In certain embodiments, R6 is F. In certain embodiments, R6 is H. In some embodiments, R6 is hydrogen, halogen, C1-C4 alkyl, CiC4 haloalkyl, cyclopropyl, C2-C4 alkynyl, CN, or NO2. In certain embodiments, R6, R6, and R6 are ail hydrogen.
In certain embodiments:
R is Cl, methoxy, vinyl, or 1-propenyl;
R3 and R4 are hydrogen;
A is A15;
R5 is hydrogen or F; and
R6 is hydrogen or F; and
R6 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, C2-C4 alkynyl, CN, or NO2.
-3317485
In one embodiment, the compound is 4-amino-3-chloro-5-fluoro-6-(7-fluoro-l/7indol-6-yl) picolinic acid. In one embodiment, the compound is methyl 4-amino-3-chloro-5fluoro-6-(7-fluoro-127-indol-6-yl) picolinate.
EXEMPLARY COMPOUNDS
The following Tables 1-9 describe exemplary compounds of Formula (Γ)
Table 10 sets forth the structure, appearance, préparation method, and precursor(s) used in synthesis of the exemplary compounds. Table 11 sets forth physical data for each of the exemplary compounds.
Blank spaces in compound tables herein indicate hydrogen, or that for the A group indicated in a particular row the column in which the blank occurs is not relevant
Table 1: Compounds of Formula (Γ) with indolyl tails
Ais A3, Al5, A27, or A28:
Re | Re | Re | Re | ||||
Re'-ykv | Re’x | •X | R^ | 'Ύι' | A | ||
11 | Re' | /¼. A | xi\rR8 | ||||
N Rs | / Rs | \ >-r7 | Re' | ||||
N-— | |||||||
Ry R7 | R; Re | r8 z | Ry | Ry' | Ry | ||
A3 | A15 | A27 | A28 |
C.No. | R1 | R2 | X | A | R5 | R6 | R6’ | -----À Rb | R7 | R7 | R8 |
1.01 | H | Cl | CF | A3 | Me | ||||||
1.02 | Me | Cl | CF | A3 | |||||||
1.03 | Me | Cl | CF | A3 | Me | ||||||
1.04 | H | Cl | CF | A3 | |||||||
1.05 | Me | Cl | CCI | A15 | |||||||
1.06 | H | Cl | CCI | A15 | |||||||
1.07 | Me | Cl | CCI | A15 | F | ||||||
1.08 | Me | Cl | CF | A15 | |||||||
1.09 | H | Cl | CF | A15 |
-3417485
C.No. | R1 | R2 | X | A | R5 | R6 | R6' | R’ | r' | R7 | R8 |
1.10 | Me | Cl | CF | A15 | Me | ||||||
1.11 | H | Cl | CF | A15 | Me | ||||||
1.12 | Me | Cl | CF | A15 | F | Si(i-Pr) | |||||
1.13 | Me | Cl | CF | A15 | F | ||||||
1.14 | H | Cl | CF | A15 | F | ||||||
1.15 | Me | Cl | CF | A15 | F | ||||||
1.16 | H | Cl | CF | A15 | F | ||||||
1.17 | H | OMe | CF | A15 | F | ||||||
1.18 | Me | vinyl | CF | A15 | F | ||||||
1.19 | H | vinyl | CF | A15 | F | ||||||
1.20 | Me | OMe | CF | A15 | F | ||||||
1.21 | Me | Cl | CH | A15 | |||||||
1.22 | H | Cl | CH | A15 | |||||||
1.23 | Me | Cl | CH | A15 | F | ||||||
1.24 | H | Cl | CH | A15 | F | ||||||
1.25 | Me | Cl | CH | A15 | F | ||||||
1.26 | H | Cl | CH | A15 | F | ||||||
1.27 | Me | Cl | CH | A15 | F | F | |||||
1.28 | Me | Cl | CMe | A15 | |||||||
1.29 | H | Cl | CMe | A15 | |||||||
1.30 | Me | Cl | N | A15 | |||||||
1.31 | Me | Cl | N | A15 | F | ||||||
1.32 | Me | OMe | N | A15 | |||||||
1.33 | H | OMe | N | A15 | |||||||
1.34 | Me | OMe | N | A15 | F | ||||||
1.35 | H | OMe | N | A15 | F | ||||||
1.36 | Me | OMe | N | A15 | F | ||||||
1.37 | H | OMe | N | A15 | F | ||||||
1.38 | Me | vinyl | N | A15 | F | ||||||
1.39 | H | vinyl | N | A15 | F | ||||||
1.40 | Me | Cl | CF | A27 | |||||||
1.41 | Me | Cl | CF | A27 | Me | ||||||
1.42 | H | Cl | CF | A27 | Me | ||||||
1.43 | Me | Cl | CF | A27 | Cl | ||||||
1.44 | Me | Cl | CH | A27 | Cl | ||||||
1.45 | Me | OMe | N | A27 | Cl | ||||||
1.46 | Me | Cl | CF | A28 | Cl | ||||||
1.47 | Me | Cl | CF | A28 | |||||||
1.48 | H | Cl | CF | A28 | |||||||
1.49 | Me | Cl | CH | A28 | Cl | ||||||
1.50 | Me | OMe | N | A28 | Cl |
Table 2: Compounds of Formula (Γ) with benzofuranyl tails
A is Al, A13, A21, or A22:
-3517485
C.No. | R1 | R2 | X | A | R5 | R6 | Rb | Rô | r' | R7 | R8 |
2.01 | Me | Cl | CF | Al | |||||||
2.02 | H | Cl | CF | Al | |||||||
2.03 | Me | Cl | CH | Al | |||||||
2.04 | Me | Cl | CH | Al | F | ||||||
2.05 | Me | OMe | N | Al | F | ||||||
2.06 | Me | OMe | N | Al | |||||||
2.07 | Me | Cl | CF | A13 | |||||||
2.08 | H | Cl | CF | A13 | |||||||
2.09 | Me | Cl | CF | A13 | F | ||||||
2.10 | Me | Cl | CF | A13 | F | ||||||
2.11 | Me | Cl | CH | A13 | F | ||||||
2.12 | Me | Cl | CH | A13 | F | ||||||
2.13 | Me | OMe | N | A13 | F | ||||||
2.14 | Me | OMe | N | A13 | F | ||||||
2.15 | Me | Cl | CF | A21 | |||||||
2.16 | Me | Cl | CF | A21 | Cl | ||||||
2.17 | H | Cl | CF | A21 | |||||||
2.18 | H | Cl | CF | A21 | Cl | ||||||
2.19 | Me | Cl | CH | A21 | Cl | ||||||
2.20 | Me | Cl | N | A21 | Cl | ||||||
2.21 | Me | OMe | N | A21 | Cl | ||||||
2.22 | H | OMe | N | A21 | Cl | ||||||
2.23 | H | Cl | N | A21 | Cl | ||||||
2.24 | Me | Cl | CF | A22 | Cl | ||||||
2.25 | Me | Cl | CH | A22 | Cl | ||||||
2.26 | Me | OMe | N | A22 | Cl |
-3617485
Table 3: Compounds of Formula (Γ) with benzothiofuranyl tails
Aïs A2, A14, A23, or A24:
Rs | Re | Re'x | r6 | Re1' | Re | V |
r7 r7 | / s R? | r6 x | Àx. Λ. \ >R’' S \ Ry | Re | R?' | 's r7 |
A2 | A14 | A23 | A24 |
C.No. | R1' | R2 | X | A | R5 | R6 | R6 | r’v | R | R | R8 |
3.01 | Me | Cl | CCI | A2 | |||||||
3.02 | H | Cl | CCI | A2 | |||||||
3.03 | Me | Cl | CF | A2 | |||||||
3.04 | H | Cl | CF | A2 | |||||||
3.05 | Me | Cl | CH | A2 | |||||||
3.06 | Me | Cl | CMe | A2 | |||||||
3.07 | H | Cl | CMe | A2 | |||||||
3.08 | Me | OMe | N | A2 | |||||||
3.09 | H | OMe | N | A2 | |||||||
3.10 | Me | Cl | CCI | A14 | |||||||
3.11 | H | Cl | CCI | A14 | |||||||
3.12 | Me | Cl | CF | A14 | |||||||
3.13 | H | Cl | CF | A14 | |||||||
3.14 | Me | Cl | CF | A14 | F | ||||||
3.15 | Me | Cl | CH | A14 | |||||||
3.16 | H | Cl | CH | A14 | |||||||
3.17 | Me | Cl | CH | A14 | F | ||||||
3.18 | Me | Cl | CMe | A14 | |||||||
3.19 | H | Cl | CMe | A14 | |||||||
3.20 | Me | OMe | N | A14 | |||||||
3.21 | H | OMe | N | A14 | |||||||
3.22 | Me | OMe | N | A14 | F | ||||||
3.23 | Me | Cl | CF | A23 | |||||||
3.24 | Me | Cl | CF | A24 | |||||||
3.25 | H | Cl | CF | A24 | |||||||
3.26 | Me | Cl | CF | A24 | Br | ||||||
3.27 | Me | Cl | CH | A24 |
-3717485
Table 4: Compounds of Formula (Γ) with 1/7-indazolyl tails
A is one of groups A6, Al8, A25, and A26:
r6 | Re | RA | Re | Re- | Re ykv |
Ra /Y. | /¼. A. | /k D | |||
8xn y *5 | R5 | Re' | Ύ L·-R? | Re' | n^rs |
N^N | N-N | /=N | |||
R7 | r8 | r8 z | Ry | ||
A6 | A18 | A25 | A26 |
C.No. | R1’ | R2 | X | A | RS | R6 | R6 | !U | R' | R | R8 |
4.01 | Me | Cl | CF | A6 | |||||||
4.02 | H | Cl | CF | A6 | |||||||
4.03 | Me | Cl | CF | A6 | Me | ||||||
4.04 | H | Cl | CF | A6 | Me | ||||||
4.05 | Me | Cl | CF | A18 | |||||||
4.06 | H | Cl | CF | A18 | |||||||
4.07 | Me | Cl | CF | A18 | Me | ||||||
4.08 | H | Cl | CF | A18 | Me | ||||||
4.09 | Me | Cl | CH | A18 | |||||||
4.10 | Me | Cl | CF | A25 | Me | ||||||
4.11 | H | Cl | CF | A25 | Me | ||||||
4.12 | Me | Cl | CF | A25 | |||||||
4.13 | Me | Cl | CF | A26 |
Table 5: Compounds of Formula (Γ) with benzoxazolyl tails
A is A7, A9, A29, or A30:
Re | Re | Re | Re | |||
rb'xAa | R6\ | Re'x | A | |||
/A/L· | JL· L· | -L·! | ||||
OZ R5 | N r5 | R6 | \ /,N | R6 | \ | o |
Ry | Ry | Ry | Ry | |||
A7 | A9 | A29 | A30 |
C.No. | R1' | R2 | X | A | R5 | R6 | R6 | R” | R | R7 | R8 |
5.01 | Me | Cl | CF | A9 |
-3817485
Table 6: Compounds of Formula (Γ) with benzothiazolyl tails
A is A8, A10, A31, or A32:
Table 7: Compounds of Formula (I') with 177-benzimidazolyl tails
C.No. | R1' | R2 | X | A | RS | R6 | R6’ | Rb | R7 | R7 | R8 |
7.01 | Me | Cl | CF | A12 | |||||||
7.02 | Me | Cl | CF | A12 | Me | ||||||
7.03 | H | Cl | CF | A12 | Me |
Table 8: Compounds of Formula (Γ) with indoxazinyl tails
A is A4, A16, A33, or A34:
-3917485
A4 | Al 6 | A33 | A34 |
C.No. | R1 | R2 | X | A | R5 | R6 | R6' | Rb | R' | R7 | R8 |
8.01 | Me | Cl | CF | A16 | NMe2 |
Table 9: Compounds of Formula (!') with 1/f-benzotriazolyl tails
METHODS OF PREPARING THE COMPOUNDS
Exemplary procedures to synthesize the compounds of Formula (I) are provided below.
The 4-amino-6-(heterocyclic)picolinic acids of Formula (I) can be prepared in a number of ways. As depicted in Scheme I, the 4-amino-6-chloropicolinates of Formula (II) can be converted to the 4-amino-6-substituted-picolinates of Formula (III), wherein Ar is as herein defïned, via Suzuki coupling with a boronic acid or ester, in the presence of a base, such as potassium fluoride, and a catalyst, such as bis(triphenylphosphine)-palladium(II) dichloride, in a polar, protic solvent mixture, such as acetonitrile-water, at a température, such as 110 °C, e.g., in a microwave reactor (reaction af). 4-Amino-6-substituted-picolinates of Formula (III) can be transformed into the 5-iodo-4-amino-6-substituted-picolinates of Formula (IV) via a reaction with iodinating reagents, such as periodic acid and iodine, in a polar, protic solvent, such as methyl alcohol (reaction bj). Stille coupling of the 5-iodo-4-amino-6-substituted-picolinates of Formula (IV) with a stannane, such as tetramethyltin, in the presence of a catalyst, such as bis(triphenylphosphine)-palladium(II) dichloride, in a non-reactive solvent, such as 1,2dichloroethane, at a température, such as 120-130 °C, e.g., in a micro wave reactor, pro vides 5(substituted)-4-amino-6-substituted-picolinates of Formula (I-A), wherein Zi is alkyl, alkenyl, alkynyl, haloalkenyl and alkylthio (reaction c/).
-4017485
Altematively, 4-amino-6-chloropicolinates of Formula (II) can be transformée! to the
5-iodo-4-amino-6-chloropicolinates of Formula (V) via a reaction with iodinating reagents, such as periodic acid and iodine, in a polar, protic solvent, such as methyl alcohol (reaction έ>2). Stille coupling of the 5-iodo-4-amino-6-chloropicolinates of Formula (V) with a stannane, such as tetramethyltin, in the presence of a catalyst, such as bis(triphenylphosphine)-palladium(II) dichloride, in a non-reactive solvent, such as 1,2-dichloroethane, at a température, such as 120
130 °C, e.g., in a microwave reactor, provides 5-(substituted)-4-amino-6-chloropicolinates of Formula (VI), wherein Zj is alkyl, alkenyl, alkynyl, haloalkenyl and alkylthio (reaction c2). The 5-substituted-4-amino-6-chloropicolinates of Formula (VI) can be converted to the 5-substituted-
4-amino-6-substituted-picolinates of Formula (I-A), wherein Ar is as herein defined, via Suzuki coupling with a boronic acid or ester, in the presence of a base, such as potassium fluoride, and a catalyst, such as bis(triphenylphosphine)-palladium(II) dichloride, in a polar, protic solvent mixture, such as acetonitrile-water, at a température, such as 110 °C, e.g., in a microwave reactor (reaction a2).
Scheme I
As depicted in Scheme II, the 4,5,6-trichloropicolinate of Formula (VII) can be converted to the corresponding isopropyl ester of Formula (VIII), via a reaction with isopropyl alcohol and concentrated sulfuric acid, e.g., at reflux température under Dean-Stark conditions (reaction d). The isopropyl ester of Formula (VIII) can be reacted with a fluoride ion source, such as césium fluoride, in a polar, aprotic solvent, such as dimethyl sulfoxide (DMSO), at a
-4117485 température, such as 80 °C, under Dean-Stark conditions, to yield the isopropyl 4,5,6trifluoropicolinate of Formula (IX) (reaction e). The isopropyl 4,5,6-trifluoropicolinate of Formula (IX) can be aminated with a nitrogen source, such as ammonia, in a polar, aprotic solvent, such as DMSO, to produce a 4-amino-5,6-difluoropicolinate of Formula (X) (reaction f).
The fluoro substituent in the 6-position of the 4-amino-5,6-difluoropicolinate of Formula (X) can be exchanged with a chloro substituent by treatment with a chloride source, such as hydrogen chloride, e.g., in dioxane, in a Parr reactor, at a température, such as 100 °C, to produce a 4amino-5-fluoro-6-chloro-picolinate of Formula (XI) (reaction g). The 4-amino-5-fluoro-6chloropicolinate of Formula (XI) can be transesterified to the corresponding methyl ester of
Formula (XII) by reaction with titanium(IV) isopropoxide in methyl alcohol at reflux température (reaction h).
Scheme II
As depicted in Scheme III, the 4-amino-5-fluoro-6-chloropicolinate of Formula (XII) can be transformed into the 3-iodo-4-amino-5-fluoro-6-chloropicolinate of Formula (XIII) via
-4217485 reaction with iodinating reagents, such as periodic acid and iodine, in a polar, protic solvent, such as methyl alcohol (reaction Z?j). Stille coupling of the 3-iodo-4-amino-5-fluoro-6chloropicolinates of Formula (XIII) with a stannane, such as tributyl(vinyl)stannane, in the presence of a catalyst, such as bis(triphenylphosphine)-palladium(II) dichloride, in a non-reactive solvent, such as 1,2-dichloroethane, at a température, such as 120-130 °C, e.g., in a microwave reactor, provides 3-(substituted)-4-amino-5-fluoro-6-chloropicolinates of Formula (XIV), wherein R is alkyl, alkenyl, alkynyl, haloalkenyl and alkylthio (reaction cj). Altematively, the
3-iodo-4-amino-5-fluoro-6-chloropicolinates of Formula (XIII) can be treated with césium carbonate and a catalytic amount of both copper(I) iodide and 1,10-phenanthroline in the presence of a polar, protic solvent, such as methyl alcohol, at a température, such as 65 °C, to provide a 3-(substituted)-4-amino-5-fluoro-6-chloropicolinic acids of Formula (XIV), wherein R is alkoxy or haloalkoxy (reaction z’y), which can be esterified to the methyl esters, e.g., by treatment with hydrogen chloride (gas) and methyl alcohol at 50 °C (reaction jî). The 3(substituted)-4-amino-5-fluoro-6-chloropicolinates of Formula (XIV) can be converted to the 4amino-6-substituted-picolinates of Formula (I-B), wherein Ar is as herein defined, via Suzuki coupling with a boronic acid or ester, in the presence of a base, such as potassium fluoride, and a catalyst, such as bis(triphenylphosphine)-palladium(II) dichloride, in a polar, protic solvent mixture, such as acetonitrile-water, at a température, such as 110 °C, e.g., in a microwave reactor (reaction 03).
Altematively, the 4-amino-5-fluoro-6-chloropicolinates of Formula (XII) can be converted to the 4-amino-5-fluoro-6-substituted-picolinates of Formula (XV), wherein Ar is as herein defmed, via Suzuki coupling with a boronic acid or ester, in the presence of a base, such as potassium fluoride, and a catalyst, such as bis(triphenylphosphine)-palladium(II) dichloride, in a polar, protic solvent mixture, such as acetonitrile-water, at a température, such as 110 °C, e.g., in a microwave reactor (reaction 04). The 4-amino-5-fluoro-6-substituted-picolinates of Formula (XV) can be transformed into the 3-iodo-4-amino-5-fluoro-6-substituted-picolinates of Formula (XVI) via reaction with iodinating reagents, such as periodic acid and iodine, in a polar, protic solvent, such as methyl alcohol (reaction 64). Stille coupling of the 3-iodo-4-amino-5-fluoro-6substituted-picolinates of Formula (XVI) with a stannane, such as tributyl(vinyl)stannane, in the presence of a catalyst, such as bis(triphenylphosphine)-palladium(II) dichloride, in a non-reactive solvent, such as 1,2-dichloroethane, at a température, such as 120-130 °C, e.g., in a microwave reactor, provides 3-(substituted)-4-amino-5-fluoro-6-substituted-picolinates of Formula (I-B), wherein R is alkyl, alkenyl, alkynyl, haloalkenyl and alkylthio (reaction C4). Altematively, the
3-iodo-4-amino-5-fluoro-6-substituted-picolinates of Formula (XVI) can be treated with césium
-4317485 carbonate and a catalytic amount of both copper(I) iodide and 1,10-phenanthroline in the presence of a polar, protic solvent, such as methyl alcohol, at a température, such as 65 °C, to provide a 3-(substituted)-4-amino-5-fluoro-6-substituted-picolinic acids of Formula (I-B), wherein R2 is alkoxy or haloalkoxy (reaction 12), which can be esterified to the methyl esters,
e.g., by treatment with hydrogen chloride (gas) and methyl alcohol, at a température, such as 50 °C (reaction72).
Scheme III
XII
a4
XV
As depicted in Scheme IV, the 4-acetamido-6-(trimethylstannyl)picolinates of
Formula (XVII) can be converted to the 4-acetamido-6-substituted-picolinates of Formula (XVIII), wherein Ar is as herein defined, via Stille coupling with an aryl bromide or aryl iodide, in the presence of a catalyst, such as bis(triphenylphosphine)-palladium(II) dichloride, in a solvent, such as 1,2-dichloroethane, e.g., at reflux température (reaction k). 4-Amino-6substituted-picolinates of Formula (I-C), wherein Ar is as herein defined, can be synthesized from 4-acetamido-6-substituted-picolinates of Formula (XVIII) via standard deprotecting methods, such as hydrochloric acid gas in methanol (reaction Γ).
-4417485
Scheme IV
As depicted in Scheme V, 2,4-dichloro-5-methoxypyrimidine (XIX) can be transformed into 2,4-dichloro-5-methoxy-6-vinylpyrimidine (XX) via a reaction with vinyl magnésium bromide, in a polar, aprotic solvent, such as tetrahydrofuran (reaction m). 2,4Dichloro-5-methoxy-6-vinylpyrimidine (XX) can be transformed into 2,6-dichloro-5methoxypyrimidine-4-carboxaldehyde (XXI) via treatment with ozone, e.g., in a dichloromethane:methanol solvent mixture (reaction ri). 2,6-Dichloro-5-methoxypyrimidine-4carboxaldehyde (XXI) can be transformed into methyl 2,6-dichloro-5-methoxypyrimidine-410 carboxylate (XXII) via treatment with bromine, e.g., in a methanol:water solvent mixture (reaction o). Methyl 2,6-dichloro-5-methoxypyrimidine-4-carboxylate (XXII) can be transformed into methyl 6-amino-2-chloro-5-methoxypyrimidine-4-carboxylate (XXIII) via treatment with ammonia (e.g., 2 équivalents) in a solvent, such as DMSO (reactionp). Finally,
6-amino-2-substituted-5-methoxypyrimidine-4-carboxylates of Formula (I-D), wherein Ar is as herein defined, can be prepared via Suzuki coupling with a boronic acid or ester, with 6-amino-
2-chloro-5-methoxypyrimidine-4-carboxylate (XXIII), in the presence of a base, such as potassium fluoride, and a catalyst, such as bis(triphenylphosphine)-palladium(II) dichloride, in a polar, protic solvent mixture, such as acetonitrile-water, at a température, such as 110 °C, e.g., in a microwave reactor (reaction a§).
-4517485
Scheme V
The compounds of Formulae I-A, I-B, I-C, and I-D obtained by any of these processes, can be recovered by conventional means and purified by standard procedures, such as by recrystallization or chromatography. The compounds of Formula (I) can be prepared from compounds of Formulae I-A, I-B, I-C, and I-D using standard methods well known in the art.
COMPOSITIONS AND METHODS
In some embodiments, the compounds provided herein are employed in mixtures containing a herbicidally effective amount of the compound along with at least one agriculturally acceptable adjuvant or carrier. Exemplary adjuvants or carriers include those that are not phytotoxic or significantly phytotoxic to valuable crops, e.g., at the concentrations employed in applying the compositions for sélective weed control in the presence of crops, and/or do not react or significantly react chemically with the compounds provided herein or other composition ingrédients. Such mixtures can be designed for application directly to weeds or their locus or can be concentrâtes or formulations that are \diluted with additional carriers and adjuvants before application. They can be solids, such as, for example, dusts, granules, water dispersible granules, or wettable powders, or liquids, such as, and for example, emulsifiable concentrâtes, solutions, émulsions or suspensions. They can also be provided as a pre-mix or tank-mixed.
Suitable agricultural adjuvants and carriers that are useful in preparing the herbicidal mixtures of the disclosure are well known to those skilled in the art. Some of these adjuvants include, but are not limited to, crop oil concentrate (minerai oil (85%) + emulsifiers (15%)); nonylphenol ethoxylate; benzylcocoalkyldimethyl quatemary ammonium sait; blend of
-4617485 petroleum hydrocarbon, alkyl esters, organic acid, and anionic surfactant; C9-C11 alkylpolyglycoside; phosphated alcohol ethoxylate; natural primary alcohol (C12-C16) ethoxylate; di-sec-butylphenol EO-PO block copolymer; polysiloxane-methyl cap; nonylphenol ethoxylate + urea ammonium nitrate; emulsified methylated seed oil; tridecyl alcohol (synthetic) ethoxylate (8EO); tallow amine ethoxylate (15 EO); PEG(400) dioleate-99.
Liquid carriers that can be employed include water and organic solvents. The organic solvents typically used include, but are not limited to, petroleum fractions or hydrocarbons such as minerai oil, aromatic solvents, paraffmic oils, and the like; vegetable oils such as soybean oil, rapeseed oil, olive oil, castor oil, sunflower seed oil, coconut oil, corn oil, cottonseed oil, linseed oil, palm oil, peanut oil, safflower oil, sesame oil, tung oil and the like; esters of the above vegetable oils; esters of monoalcohols or dihydric, trihydric, or other lower polyalcohols (4-6 hydroxy containing), such as 2-ethylhexyl stéarate, w-butyl oleate, isopropyl myristate, propylene glycol dioleate, di-octyl succinate, di-butyl adipate, di-octyl phthalate and the like; esters of mono-, di- and poly-carboxylic acids and the like. Spécifie organic solvents include toluene, xylene, petroleum naphtha, crop oil, acetone, methyl ethyl ketone, cyclohexanone, trichloroethylene, perchloroethylene, ethyl acetate, amyl acetate, butyl acetate, propylene glycol monomethyl ether and diethylene glycol monomethyl ether, methyl alcohol, ethyl alcohol, isopropyl alcohol, amyl alcohol, ethylene glycol, propylene glycol, glycérine, 7V-methyl-2pyrrolidinone, Λζ/V-dimethyl alkylamides, dimethyl sulfoxide, liquid fertilizers, and the like. In some embodiments, water is the carrier for the dilution of concentrâtes.
Suitable solid carriers include talc, pyrophyllite clay, silica, attapulgus clay, kaolin clay, kieselguhr, chalk, diatomaceous earth, lime, calcium carbonate, bentonite clay, Fuller's earth, cottonseed hulls, wheat flour, soybean flour, pumice, wood flour, walnut shell flour, lignin, and the like.
In some embodiments, one or more surface-active agents are utilized in the compositions of the présent disclosure. Such surface-active agents are, in some embodiments, employed in both solid and liquid compositions, e.g., those designed to be diluted with carrier before application. The surface-active agents can be anionic, cationic or nonionic in character and can be employed as emulsifying agents, wetting agents, suspending agents, or for other purposes. Surfactants conventionally used in the art of formulation and which may also be used in the présent formulations are described, inter alia, in McCutcheon ’s Détergents and Emulsifiers Annual, MC Publishing Corp., Ridgewood, New Jersey, 1998, and in Encyclopedia of Surfactants, Vol. I-III, Chemical Publishing Co., New York, 1980-81. Typical surface-active agents include salts of alkyl sulfates, such as diethanolammonium lauryl sulfate;
-4717485 alkylarylsulfonate salts, such as calcium dodecylbenzenesulfonate; alkylphenol-alkylene oxide addition products, such as nonylphenol-Cis ethoxylate; alcohol-alkylene oxide addition products, such as tridecyl alcohol-Ciô ethoxylate; soaps, such as sodium stéarate; alkylnaphthalenesulfonate salts, such as sodium dibutylnaphthalenesulfonate; dialkyl esters of sulfosuccinate salts, such as sodium di(2-ethylhexyl) sulfosuccinate; sorbitol esters, such as sorbitol oleate; quatemary amines, such as lauryl trimethylammonium chloride; polyethylene glycol esters of fatty acids, such as polyethylene glycol stéarate; block copolymers of ethylene oxide and propylene oxide; salts of mono- and dialkyl phosphate esters; vegetable or seed oils such as soybean oil, rapeseed/canola oil, olive oil, castor oil, sunflower seed oil, coconut oil, corn oil, cottonseed oil, linseed oil, palm oil, peanut oil, safflower oil, sesame oil, tung oil and the like; and esters of the above vegetable oils, e.g., methyl esters.
Oftentimes, some of these materials, such as vegetable or seed oils and their esters, can be used interchangeably as an agricultural adjuvant, as a liquid carrier or as a surface active agent.
Other adjuvants commonly used in agricultural compositions include compatibilizing agents, antifoam agents, sequestering agents, neutralizing agents and buffers, corrosion inhibitors, dyes, odorants, spreading agents, pénétration aids, sticking agents, dispersing agents, thickening agents, freezing point depressants, antimicrobial agents, and the like. The compositions may also contain other compatible components, for example, other herbicides, plant growth régulants, fongicides, insecticides, and the like and can be formulated with liquid fertilizers or solid, particulate fertilizer carriers such as ammonium nitrate, urea and the like.
The concentration of the active ingrédients in the herbicidal compositions of this disclosure is generally from about 0.001 to about 98 percent by weight. Concentrations from about 0.01 to about 90 percent by weight are often employed. In compositions designed to be employed as concentrâtes, the active ingrédient is generally présent in a concentration from about 5 to about 98 weight percent, preferably about 10 to about 90 weight percent. Such compositions are typically diluted with an inert carrier, such as water, before application. The diluted compositions usually applied to weeds or the locus of weeds generally contain about 0.0001 to about 1 weight percent active ingrédient and preferably contain about 0.001 to about 0.05 weight percent.
The présent compositions can be applied to weeds or their locus by the use of conventional ground or aerial dusters, sprayers, and granule applicators, by addition to irrigation or flood water, and by other conventional means known to those skilled in the art.
-4817485
In some embodiments, the compounds and compositions described herein are applied as a post-emergence application, pre-emergence application, in-water application to flooded paddy rice or water bodies (e.g., ponds, lakes and streams), or bum-down application.
In some embodiments, the compounds and compositions provided herein are utilized to control weeds in crops, including but not limited to citrus, apple, rubber, oil, palm, forestry, direct-seeded, water-seeded and transplanted rice, wheat, barley, oats, rye, sorghum, com/maize, pastures, grasslands, rangelands, fallowland, turf, tree and vine orchards, aquatics, or row-crops, as well as non-crop settings, e.g., industrial végétation management (IVM) or rights-of-way. In some embodiments, the compounds and compositions are used to control woody plants, broadleaf and grass weeds, or sedges.
In some embodiments, the compounds and compositions provided herein are utilized to control undesirable végétation in rice. In certain embodiments, the undesirable végétation is Brachiaria platyphylla (Groseb.) Nash (broadleaf signalgrass, BRAPP), Digitaria sanguinalis (L.) Scop. (large crabgrass, DIGSA), Echinochloa crus-galli (L.) P. Beauv. (bamyardgrass, ECHCG), Echinochloa colonum (L.) LINK (junglerice, ECHCO), Echinochloa oryzoides (Ard.) Fritsch (early watergrass, ECHOR), Echinochloa oryzicola (Vasinger) Vasinger (late watergrass, ECHPH), Ischaemum rugosum Salisb. (saramollagrass, ISCRU), Leptochloa chinensis (L.) Nees (Chinese sprangletop, LEFCH), Leptochloa fascicularis (Lam.) Gray (bearded sprangletop, LEFFA), Leptochloa panicoides (Presl.) Hitchc. (Amazon sprangletop, LEFPA), Panicum dichotomiflorum (L.) Michx. (fall panicum, PANDI), Paspalum dilatatum Poir. (dallisgrass, PASDI), Cyperus difformis L. (smallflower flatsedge, CYPDI), Cyperus esculentus L. (yellow nutsedge, CYPES), Cyperus iria L. (rice flatsedge, CYPIR), Cyperus rotundus L. (purple nutsedge, CYPRO), Eleocharis species (ELOSS), Fimbristylis miliacea (L.) Vahl (globe fringerush, FIMMI), Schoenoplectus juncoides Roxb. (Japanese bulrush, SPCJU), Schoenoplectus maritimus L. (sea clubrush, SCPMA), Schoenoplectus mucronatus L. (ricefield bulrush, SCPMU), Aeschynomene species, (jointvetch, AESSS), Alternanthera philoxeroides (Mari.) Griseb. (alligatorweed, ALRPH), Alisma plantago-aquatica L. (common waterplantain, ALSPA), Amaranthus species, (pigweeds and amaranths, AMASS), Ammannia coccinea Rottb. (redstem, AMMCO), Eclipta alba (L.) Hassk. (American false daisy, ECLAL), Heteranthera limosa (SW.) Willd./Vahl (ducksalad, HETLI), Heteranthera reniformis R. & P. (roundleaf mudplantain, HETRE), Ipomoea hederacea (L.) Jacq. (ivyleaf momingglory, IPOHE), Lindernia dubia (L.) Pennell (low false pimpemel, LIDDU), Monochoria korsakowii Regel & Maack (monochoria, MOOKA), Monochoria vaginalis (Burm. F.) C. Presl ex Kuhth, (monochoria, MOOVA), Murdannia nudiflora (L.) Brenan (doveweed, MUDNU), Polygonum pensylvanicum
-4917485
L., (Pennsylvania smartweed, POLPY), Polygonum persicaria L. (ladysthumb, POLPE), Polygonum hydropiperoides Michx. (POLHP, mild smartweed), Rotala indica (Willd.) Koehne (Indian toothcup, ROTIN), Sagittaria species, (arrowhead, S AGS S), Sesbania exaltata (Raf.) Cory/Rydb. Ex Hill (hemp sesbania, SEBEX), or Sphenoclea zeylanica Gaertn. (gooseweed, SPDZE).
In some embodiments, the compounds and compositions provided herein are utilized to control undesirable végétation in cereals. In certain embodiments, the undesirable végétation is Alopecurus myosuroides Huds. (blackgrass, ALOMY), Apera spica-venti (L.) Beauv. (windgrass, APESV), Avena fatua L. (wild oat, AVEFA), Bromus tectorum L. (downy brome, BROTE), Lolium multiflorum Lam. (Italian ryegrass, LOLMU), Phalaris minor Retz, (littleseed canarygrass, PHAMI), Poa annua L. (annual bluegrass, POANN), Setaria pumila (Poir.) Roemer & J.A. Schultes (yellow foxtail, SETLU), Setaria viridis (L.) Beauv. (green foxtail, SETVI), Cirsium arvense (L.) Scop. (Canada thistle, CIRARJ, Galium aparine L. (catchweed bedstraw, GALAP), Kochia scoparia (L.) Schrad. (kochia, KCHSC), Lamium purpureum L. (purple deadnettle , LAMPU), Matricaria recutita L. (wild chamomile, MATCH), Matricaria matricarioides (Less.) Porter (pineappleweed, MATMT), Papaver rhoeas L. (common poppy, PAPRH), Polygonum convolvulus L. (wild buckwheat, POLCO), Salsola tragus L. (Russian thistle, SASKR), Stellaria media (L.) Vill. (common chickweed, STEME), Veronica persica Poir. (Persian speedwell, VERPE), Viola arvensis Murr. (field violet, VIOAR), or Viola tricolor L. (wild violet, VIOTR).
In some embodiments, the compounds and compostions provided herein are utilized to control undesirable végétation in range and pasture. In certain embodiments, the undesirable végétation is Ambrosia artemisiifolia L. (common ragweed, AMBEL), Cassia obtusifolia (sickle pod, CASOB), Centaurea maculosa auct. non Lam. (spotted knapweed, CENMA), Cirsium arvense (L.) Scop. (Canada thistle, CIRAR), Convolvulus arvensis L. (field bindweed, CONAR), Euphorbia esula L. (leafy spurge, EPHES), Lactuca serriola L./Tom. (prickly lettuce, LACSE), Plantago lanceolata L. (buckhom plantain, PLALA), Rumex obtusifolius L. (broadleaf dock, RUMOB), Sida spinosa L. (prickly sida, SIDSP), Sinapis arvensis L. (wild mustard, SINAR), Sonchus arvensis L. (perennial sowthistle, SONAR), Solidago species (goldenrod, SOOSS), Taraxacum officinale G.H. Weber ex Wiggers (dandelion, TAROF), Trifolium repens L. (white clover, TRFRE), or Urtica dioica L. (common nettle, URTDI).
In some embodiments, the compounds and compositions provided herein are utilized to control undesirable végétation found in row crops. In certain embodiments, the undesirable végétation is Alopecurus myosuroides Huds. (blackgrass, ALOMY), Avena fatua L. (wild oat,
-5017485
AVEFA), Brachiaria platyphylla (Groseb.) Nash (broadleaf signalgrass, BRAPP), Digitaria sanguinalis (L.) Scop. (large crabgrass, DIGSA), Echinochloa crus-galli (L.) P. Beauv. (bamyardgrass, ECHCG), Echinochloa colonum (L.) Link (junglerice, ECHCO), Loliurn multiflorum Lam. (Italian ryegrass, LOLMU), Panicum dichotomiflorum Michx. (fall panicum, PANDI), Panicum miliaceum L. (wild-proso millet, PANMI), Setaria faberi Herrm. (giant foxtail, SETFA), Setaria viridis (L.) Beauv. (green foxtail, SETVI), Sorghum halepense (L.) Pers. (Johnsongrass, SORHA), Sorghum bicolor (L.) Moench ssp. Arundinaceum (shattercane, SORVU), Cyperus esculentus L. (yellow nutsedge, CYPES), Cyperus rotundus L. (purple nutsedge, CYPRO), Abutilon theophrasti Medik. (velvetleaf, ABUTH), Amaranthus species (pigweeds and amaranths, AMASS), Ambrosia artemisiifolia L. (common ragweed, AMBEL), Ambrosia psilostachya DC. (western ragweed, AMBPS), Ambrosia trifida L. (giant ragweed, AMBTR), Asclepias syriaca L. (common milkweed, ASCSY), Chenopodium album L. (common lambsquarters, CHEAL), Cirsium arvense (L.) Scop. (Canada thistle, CIRAR), Commelina benghalensis L. (tropical spiderwort, COMBE), Datura stramonium L. (jimsonweed, DATST), Daucus carota L. (wild carrot, DAUCA), Euphorbia heterophylla L. (wild poinsettia, EPHHL), Erigeron bonariensis L. (hairy fleabane, ERIBO), Erigeron canadensis L. (Canadian fleabane, ERICA), Helianthus annuus L. (common sunflower, HELAN), Jacquemontia tamnifolia (L.) Griseb. (smallflower momingglory, IAQTA), Ipomoea hederacea (L.) Jacq. (ivyleaf momingglory, IPOHE), Ipomoea lacunosa L. (white momingglory, IPOLA), Lactuca serriola L./Tom. (prickly lettuce, LACSE), Portulaca oleracea L. (common purslane, POROL), Sida spinosa L. (prickly sida, SIDSP), Sinapis arvensis L. (wild mustard, SINAR), Solanum ptychanthum Dunal (eastem black nightshade, SOLPT), oxXanthium strumarium L. (common cocklebur, XANST).
In some embodiments, application rates of about 1 to about 4,000 grams/hectare (g/ha) are employed in post-emergence operations. In some embodiments, rates of about 1 to about 4,000 g/ha are employed in pre-emergence operations.
In some embodiments, the compounds, compositions, and methods provided herein are used in conjunction with one or more other herbicides to control a wider variety of undesirable végétation. When used in conjunction with other herbicides, the presently claimed compounds can be formulated with the other herbicide or herbicides, tank-mixed with the other herbicide or herbicides or applied sequentially with the other herbicide or herbicides. Some of the herbicides that can be employed in conjunction with the compounds of the présent disclosure include: 4-CPA, 4-CPB, 4-CPP, 2,4-D, 2,4-D choline sait, 2,4-D esters and amines, 2,4-DB, 3,4DA, 3,4-DB, 2,4-DEB, 2,4-DEP, 3,4-DP, 2,3,6-TBA, 2,4,5-T, 2,4,5-TB, acetochlor, acifluorfen,
-5117485 aclonifen, acrolein, alachlor, allidochlor, alloxydim, allyl alcohol, alorac, ametridione, ametryn, amibuzin, amicarbazone, amidosulfuron, aminocyclopyrachlor, aminopyralid, amiprofos-methyl, amitrole, ammonium sulfamate, anilofos, anisuron, asulam, atraton, atrazine, azafenidin, azimsulfuron, aziprotryne, barban, BCPC, beflubutamid, benazolin, bencarbazone, benfluralin, benfuresate, bensulfuron-methyl, bensulide, benthiocarb, bentazon-sodium, benzadox, benzfendizone, benzipram, benzobicyclon, benzofenap, benzofluor, benzoylprop, benzthiazuron, bicyclopyrone, bifenox, bilanafos, bispyribac-sodium, borax, bromacil, bromobonil, bromobutide, bromofenoxim, bromoxynil, brompyrazon, butachlor, butafenacil, butamifos, butenachlor, buthidazole, buthiuron, butralin, butroxydim, buturon, butylate, cacodylic acid, cafenstrole, calcium chlorate, calcium cyanamide, cambendichlor, carbasulam, carbetamide, carboxazole, chlorprocarb, carfentrazone-ethyl, CDEA, CEPC, chlomethoxyfen, chloramben, chloranocryl, chlorazifop, chlorazine, chlorbromuron, chlorbufam, chloreturon, chlorfenac, chlorfenprop, chlorflurazole, chlorflurenol, chloridazon, chlorimuron, chlomitrofen, chloropon, chlorotoluron, chloroxuron, chloroxynil, chlorpropham, chlorsulfuron, chlorthal, chlorthiamid, cinidon-ethyl, cinmethylin, cinosulfuron, cisanilide, clethodim, cliodinate, clodinafop-propargyl, clofop, clomazone, clomeprop, cloprop, cloproxydim, clopyralid, cloransulam-methyl, CMA, copper sulfate, CPMF, CPPC, credazine, cresol, cumyluron, cyanatryn, cyanazine, cycloate, cyclosulfamuron, cycloxydim, cycluron, cyhalofop-butyl, cyperquat, cyprazine, cyprazole, cypromid, daimuron, dalapon, dazomet, delachlor, desmedipham, desmetryn, di-allate, dicamba, dichlobenil, dichloralurea, dichlormate, dichlorprop, dichlorprop-P, diclofop, diclosulam, diethamquat, diethatyl, difenopenten, difenoxuron, difenzoquat, diflufenican, diflufenzopyr, dimefuron, dimepiperate, dimethachlor, dimethametryn, dimethenamid, dimethenamid-P, dimexano, dimidazon, dinitramine, dinofenate, dinoprop, dinosam, dinoseb, dinoterb, diphenamid, dipropetryn, diquat, disul, dithiopyr, diuron, DMP A, DNOC, DSMA, EBEP, eglinazine, endothal, epronaz, EPTC, erbon, esprocarb, ethalfluralin, ethbenzamide, ethametsulfuron, ethidimuron, ethiolate, ethobenzamid, etobenzamid, ethofumesate, ethoxyfen, ethoxysulfuron, etinofen, etnipromid, etobenzanid, EXD, fenasulam, fenoprop, fenoxaprop, fenoxaprop-P-ethyl, fenoxaprop-P-ethyl + isoxadifen-ethyl, fenoxasulfone, fenteracol, fenthiaprop, fentrazamide, fenuron, ferrous sulfate, flamprop, flamprop-M, flazasulfuron, florasulam, fluazifop, fluazifop-P-butyl, fluazolate, flucarbazone, flucetosulfuron, fluchloralin, flufenacet, flufenican, flufenpyr-ethyl, flumetsulam, flumezin, flumiclorac-pentyl, flumioxazin, flumipropyn, fluometuron, fluorodifen, fluoroglycofen, fluoromidine, fluoronitrofen, fluothiuron, flupoxam, flupropacil, flupropanate, flupyrsulfuron, fluridone, flurochloridone, fluroxypyr, flurtamone, fluthiacet, fomesafen, foramsulfuron, fosamine, furyloxyfen, glufosinate,
-5217485 glufosinate-ammonium, glyphosate, halosafen, halosulfuron-methyl, haloxydine, haloxyfopmethyl, haloxyfop-P-methyl, halauxifen-methyl, hexachloroacetone, hexaflurate, hexazinone, imazamethabenz, imazamox, imazapic, imazapyr, imazaquin, imazethapyr, imazosulfuron, indanofan, indaziflam, iodobonil, iodomethane, iodosulfuron, iofensulfuron, ioxynil, ipazine, ipfencarbazone, iprymidam, isocarbamid, isocil, isomethiozin, isonoruron, isopolinate, isopropalin, isoproturon, isouron, isoxaben, isoxachlortole, isoxaflutole, isoxapyrifop, karbutilate, ketospiradox, lactofen, lenacil, linuron, MAA, ΜΑΜΑ, MCPA esters and amines, MCPA-thioethyl, MCPB, mecoprop, mecoprop-P, medinoterb, mefenacet, mefluidide, mesoprazine, mesosulfuron, mesotrione, metam, metamifop, metamitron, metazachlor, metazosulfuron, metflurazon, methabenzthiazuron, methalpropalin, methazole, methiobencarb, methiozolin, methiuron, methometon, methoprotryne, methyl bromide, methyl isothiocyanate, methyldymron, metobenzuron, metobromuron, metolachlor, metosulam, metoxuron, metribuzin, metsulfuron, molinate, monalide, monisouron, monochloroacetic acid, monolinuron, monuron, morfamquat, MSMA, naproanilide, napropamide, napropamide-M, naptalam, neburon, nicosulfuron, nipyraclofen, nitralin, nitrofen, nitrofluorfen, norflurazon, noruron, OCH, orbencarb, orrizo-dichlorobenzene, orthosulfamuron, oryzalin, oxadiargyl, oxadiazon, oxapyrazon, oxasulfuron, oxaziclomefone, oxyfluorfen, paraflufen-ethyl, parafluron, paraquat, pebulate, pelargonic acid, pendimethalin, penoxsulam, pentachlorophenol, pentanochlor, pentoxazone, perfluidone, pethoxamid, phenisopham, phenmedipham, phenmedipham-ethyl, phenobenzuron, phenylmercury acetate, picloram, picolinafen, pinoxaden, piperophos, potassium arsenite, potassium azide, potassium cyanate, pretilachlor, primisulfuron-methyl, procyazine, prodiamine, profluazol, profluralin, profoxydim, proglinazine, prohexadione-calcium, prometon, prometryn, propachlor, propanil, propaquizafop, propazine, propham, propisochlor, propoxycarbazone, propyrisulfuron, propyzamide, prosulfalin, prosulfocarb, prosulfuron, proxan, prynachlor, pydanon, pyraclonil, pyraflufen, pyrasulfotole, pyrazogyl, pyrazolynate, pyrazosulfuron-ethyl, pyrazoxyfen, pyribenzoxim, pyributicarb, pyriclor, pyridafol, pyridate, pyriftalid, pyriminobac, pyrimisulfan, pyrithiobac-methyl, pyroxasulfone, pyroxsulam, quinclorac, quinmerac, quinoclamine, quinonamid, quizalofop, quizalofop-P-ethyl, rhodethanil, rimsulfuron, saflufenacil, S-metolachlor, sebuthylazine, secbumeton, sethoxydim, siduron, simazine, simeton, simetryn, SMA, sodium arsenite, sodium azide, sodium chlorate, sulcotrione, sulfallate, sulfentrazone, sulfometuron, sulfosate, sulfosulfuron, sulfuric acid, sulglycapin, swep, TCA, tebutam, tebuthiuron, tefuryltrione, tembotrione, tepraloxydim, terbacil, terbucarb, terbuchlor, terbumeton, terbuthylazine, terbutryn, tetrafluron, thenylchlor, thiazafluron, thiazopyr, thidiazimin, thidiazuron, thiencarbazone-methyl, thifensulfuron, thiobencarb,
-5317485 tiocarbazil, tioclorim, topramezone, tralkoxydim, triafamone, tri-allate, triasulfuron, triaziflam, tribenuron, tricamba, triclopyr esters and amines, tridiphane, trietazine, trifloxysulfuron, trifluralin, triflusulfuron, trifop, trifopsime, trihydroxytriazine, trimeturon, tripropindan, tritac, tritosulfuron, vemolate and xylachlor.
The compounds and compositions of the présent disclosure can generally be employed in combination with known herbicide safeners, such as benoxacor, benthiocarb, brassinolide, cloquintocet (e.g., mexyl), cyometrinil, daimuron, dichlormid, dicyclonon, dimepiperate, disulfoton, fenchlorazole-ethyl, fenclorim, flurazole, fluxofenim, furilazole, harpin proteins, isoxadifen-ethyl, mefenpyr-diethyl, MG 191, MON 4660, naphthalic anhydride (NA), oxabetrinil, R29148 and 7V-phenylsulfonylbenzoic acid amides, to enhance their selectivity.
The compounds, compositions, and methods described herein be used to control undesirable végétation on glyphosate-tolerant-, glufosinate-tolerant-, dicamba-tolerant-, phenoxy auxin-tolerant-, pyridyloxy auxin-tolerant-, aryloxyphenoxypropionate-tolerant-, acetyl CoA carboxylase (ACCase) inhibitor-tolerant-, imidazolinone-tolerant-, acetolactate synthase (ALS) inhibitor-tolerant-, 4-hydroxyphenyl-pyruvate dioxygenase (HPPD) inhibitor -tolérant-, protoporphyrinogen oxidase (PPO) inhibitor -tolérant-, triazine-tolerant-, and bromoxyniltolerant- crops (such as, but not limited to, soybean, cotton, canola/oilseed râpe, rice, cereals, corn, turf, etc), for example, in conjunction with glyphosate, glufosinate, dicamba, phenoxy auxins, pyridyloxy auxins, aryloxyphenoxypropionates, ACCase inhibitors, imidazolinones, ALS inhibitors, HPPD inhibitors, PPO inhibitors, triazines, and bromoxynil. The compositions and methods may be used in controlling undesirable végétation in crops possessing multiple or stacked traits conferring tolérance to multiple chemistries and/or inhibitors of multiple modes-ofaction.
The compounds and compositions provided herein may also be employed to control herbicide résistant or tolérant weeds. Exemplary résistant or tolérant weeds include, but are not limited to, biotypes résistant or tolérant to acetolactate synthase (ALS) inhibitors, photosystem II inhibitors, acetyl CoA carboxylase (ACCase) inhibitors, synthetic auxins, photosystem I inhibitors, 5-enolpyruvylshikimate-3-phosphate (EPSP) synthase inhibitors, microtubule assembly inhibitors, lipid synthesis inhibitors, protoporphyrinogen oxidase (PPO) inhibitors, carotenoid biosynthesis inhibitors, very long chain fatty acid (VLCFA) inhibitors, phytoene desaturase (PDS) inhibitors, glutamine synthetase inhibitors, 4-hydroxyphenyl-pyruvatedioxygenase (HPPD) inhibitors, mitosis inhibitors, cellulose biosynthesis inhibitors, herbicides with multiple modes-of-action such as quinclorac, and unclassified herbicides such as arylaminopropionic acids, difenzoquat, endothall, and organoarsenicals. Exemplary résistant or
-5417485 tolérant weeds include, but are not limited to, biotypes with résistance or tolérance to multiple herbicides, multiple chemical classes, and multiple herbicide modes-of-action.
The described embodiments and following examples are for illustrative purposes and are not intended to limit the scope of the daims. Other modifications, uses, or combinations with respect to the compositions described herein will be apparent to a person of ordinary skill in the art without departing from the spirit and scope of the claimed subject matter.
SYNTHESIS OF PRECURSORS
Préparation 1: Methyl 4-amino-3,6-dichloropicolinate (Head A)
Prepared as described in Fields et al., WO 2001051468 Al.
Préparation 2: Methyl 4-amino-3,6-dichloro-5-fluoropicolinate (Head B)
CH
Prepared as described in Fields et al.,
Tetrahedron Letters 2010, 571, 79-81.
Préparation 3: 2,6-Dichloro-5-methoxy-4-vinyl pyrimidine
To a solution of commercially available 2,6-dichloro-5-methoxy pyrimidine (100 grams (g), 0.55 moles (mol)) in dry tetrahydrofuran (THF) was added, dropwise, lmolar (M) vinyl magnésium bromide in tetrahydrofuran solvent (124 g, 0.94 mol) over one hour (h) at room température. The mixture was then stirred for 4 h at room température. Excess Grignard reagent was quenched by addition of acetone (200 milliliters (mL)) while the température of the mixture
-5517485 was maintained at a température below 20 °C. Thereafter, 2,3-dichloro-5,6-dicyano-pbenzoquinone (DDQ; 151g, 0.67 mol) was added at once and stirred ovemight. A yellow solid precipitated out. The solid was filtered and washed with ethyl acetate (500 mL). The filtrate was concentrated under reduced pressure and the resulting crude compound was diluted with ethyl acetate (2 liters (L)). The resulting undissolved, dark, semi-solid was separated by filtration using ethyl acetate. It was further concentrated under reduced pressure to provide a crude compound, which was purified by column chromatography. The compound was eluted with 5% to 10% ethyl acetate in hexane mixture to provide the title compound (70 g, 60%): mp 60-61 °C; ’H NMR (CDC13) δ 3.99 (s, 3H), 5.85 (d, 1H), 6.75 (d, 1H), 6.95 (dd, 1H).
Préparation 4: 2,6-Dichloro-5-methoxy-pyrimidine-4-carbaIdehyde
A solution of 2,6-dichloro-5-methoxy-4-vinyl pyrimidine (50 g, 0.24 mol) in dichloromethane:methanol (4:1,2 L) was cooled to -78 °C. Ozone gas was bubbled therethrough for 5 h. The reaction was quenched with dimethyl sulfide (50 mL). The mixture was slowly warmed to room température and concentrated under reduced pressure at 40 °C to provide the title compound (50.5 g, 100%); high-performance liquid chromatorgraphy (HPLC; 85% acetonitrile buffered with 0.1% volume per volume (v/v) acetic acid).
Préparation 5: Methyl 2,6-dichloro-5-methoxy-pyrimidine-4-carboxylate
CH3
A solution of 2,6-dichloro-5-methoxy-pyrimidine-4-carbaldehyde (50 g, 0.24 mol) in methanol (1 L) and water (60 mL) was prepared. To the solution, sodium bicarbonate (400 g) was added. A 2 M solution of bromine (192 g, 1.2 mol) in methanol/water (600 mL, 9:1) was added dropwise to the pyrimidine solution over 45 minutes (min) at 0 °C while stirring the mixture. The stirring was continued at the same température for 1 h. Later, the mixture was stirred at room température for 4 h. While stirring, the reaction mixture was thereafter poured
-5617485 onto a mixture of crushed ice (2L), sodium bisulfite (50 g), and sodium chloride (200 g). The product was extracted with ethyl acetate (IL x 2), and the combined organic layer was dried over sodium sulfate and filtered. Evaporation of the solvent under reduced pressure produced a thick material, which solidified on long standing to afford the title compound (50.8 g, 87%); ESIMS m/z 238 ([M+H]+).
Préparation 6: Methyl 6-amino-2-chloro-5-methoxy-pyrimidine-4-carboxyIate (Head C)
A solution of methyl 2,6-dichloro-5-methoxy-pyrimidine-4-carboxylate (25 g, 0.1 mol) and dimethyl sulfoxide (DMSO) was prepared. To this solution was added, at 0-5 °C, a solution of ammonia (2 eq) in DMSO. This mixture was stirred at the same 0-5 °C température for 10 to 15 min. Later, the mixture was diluted with ethyl acetate, and the resulting solid was filtered off. The ethyl acetate filtrate was washed with a brine solution and dried over sodium sulfate. Upon concentration, the crude product was obtained. The crude product was stirred in a minimum amount of ethyl acetate and filtered to obtain the pure compound. Additional pure compound was obtained from the filtrate which, after concentration, was purified by flash chromatography. This produced the title compound (11 g, 50%): mp 158 °C; 'H NMR (DMSOJ6) δ 3.71 (s, 3H), 3.86 (s, 3H), 7.65 (br s, 1H), 8.01 (br s, 1H).
Préparation 7: Methyl 4-amino-3,6-dichloro-5-iodopicolinate
CH3
Methyl 4-amino-3,6-dichloropicolinate (10.0 g, 45.2 mmol), periodic acid (3.93 g, 17.2 millimoles (mmol)), and iodine (11.44 g, 45.1 mmol) were dissolved in methanol (30 mL) and stirred at reflux at 60 °C for 27 h. The reaction mixture was concentrated, diluted with diethyl ether, and washed twice with saturated aqueous sodium bisulfite. The aqueous layers were extracted once with diethyl ether, and the combined organic layers were dried over anhydrous sodium sulfate. The product was concentrated and purified by flash chromatography
-5717485 (silica gel, 0-50% ethyl acetate/hexanes) to provide the title compound as a pale yellow solid (12.44 g, 35.9 mmol, 79%): mp 130.0-131.5 °C; *H NMR (400 MHz, CDC13) δ 5.56 (s, 2H), 3.97 (s, 3H); 13C NMR (101 MHz, CDC13) δ 163.80, 153.00, 152.75, 145.63, 112.12, 83.91, 53.21; EIMSm/z 346.
Préparation 8: Methyl 4-amino-3,6-dichloro-5-methylpicolinate (Head D)
NH2
H3C^L/CI JL cr n ch3
O
A mixture of methyl 4-amino-3,6-dichloro-5-iodopicolinate (8.1 g, 23.4 mmol), tetramethylstannane (8.35 g, 46.7 mmol), and bis(triphenylphosphine)palladium(II) chloride (2.5 g, 3.5 mmol) in 1,2-dichloroethane (40 mL) was irradiated in a Biotage Initiator microwave at 120 °C for 30 min, with extemal infrared (IR)-sensor température monitoring from the side. The reaction mixture was loaded directly onto a silica gel cartridge and purified by flash chromatography (silica gel, 0-50% ethyl acetate/hexanes) to provide the title compund as an orange solid (4.53 g, 83 %): mp 133-136 °C; *H NMR (400 MHz, CDC13) δ 4.92 (s, 2H), 3.96 (s, 3H), 2.29 (s, 3H); 13CNMR (101 MHz, CDC13) δ 164.34, 150.24, 148.69, 143.94, 117.01, 114.60, 53.02, 14.40; ESIMS m/z 236 ([M+H]+), 234 ([M-H]').
Préparation 9: Methyl 6-amino-2,5-dichloropyrimidine-4-carboxylate (Head E)
NH?
X teK .0^ cr n y ch3 o
Prepared as described in Epp et al., WO 2007082076 Al.
Préparation 10: Methyl 4-amino-6-chloro-5-fluoro-3-methoxypicolinate (Head F) ch3
I J O
NH2
F.
Cl
O
-5817485
Prepared as described in Epp et al., WO 2013003740 Al.
Préparation 11: Methyl 4-amino-6-chloro-5-fluoro-3-vinylpicolinate (Head G) nh2 ch2 ch2
FCl
Methyl 4-amino-6-chloro-5-fluoro-3-iodopicolinate (7.05 g, 21.33 mmol, prepared as described in Epp et al., WO 2013003740 Al) and vinyltri-n-butyltin (7.52 mL, 25.6 mmol) were suspended in dichloroethane (71.1 mL) and the mixture was degassed with Argon for 10 min. Bis(triphenylphosphine)palladium(II) chloride (1.497 g, 2.133 mmol) was then added, and the reaction mixture was stirred at 70 °C ovemight (clear orange solution). The reaction was monitored by gas chromatography-mass spectrometry (GC-MS). After 20 h, the reaction mixture was concentrated, adsorbed onto Celite, and purified by column chromatography (silica gel (S1O2), hexanes/ethyl acetate gradient) to afford the title compound (3.23 g, 65.7 %) as a light brown solid: mp 99-100°C; ’H NMR (400 MHz, CDC13) δ 6.87 (dd, J= 18.1, 11.6 Hz,
1H), 5.72 (dd, J= 11.5, 1.3 Hz, 1H), 5.52 (dd, J= 18.2, 1.3 Hz, 1H), 4.79 (s, 2H), 3.91 (s, 3H); 19F NMR (376 MHz, CDCI3) δ -138.79 (s); EIMS m/z 230.
Préparation 12: Methyl 4-amino-3,5,6-trichloropicolinate (Head H)
NHo
Cl
Cl
Prepared as described in Finkelstein et al., WO 2006062979 Al.
Préparation 13: Methyl 4-amino-6-bromo-3-chloro-5-fluoropicolinate (Head I) NH2
F.
Br
Prepared as described in Amdt et al., US 20120190857 Al.
-5917485
Préparation 14: Methyl 4-amino-3-chloro-5-fluoro-6-(trimethylstannyl)picoiinate (Head J) NH2
Methyl 4-amino-6-bromo-3-chloro-5-fluoropicolinate (500 mg, 1.8 mmol),
1,1,1,2,2,2-hexamethyldistannane (580 mg, 1.8 mmol) and bis(triphenylphosphine)-palladium(II) chloride (120 mg, 0.18 mmol) were combined in dry dioxane (6 mL), sparged with a stream of nitrogen for 10 min and then heated to 80 °C for 2 h. The cooled mixture was stirred with ethyl acetate (25 mL) and saturated NaCl (25 mL) for 15 min. The organic phase was separated, filtered through diatomaceous earth, dried (NajSC^) and evaporated. The residue was taken up in ethyl acetate (4 mL), stirred and treated in portions with hexane (15 mL). The milky white solution was decanted from any solids produced, filtered through glass wool and evaporated to give the title compound as an off-white solid (660 mg, 100%): *H NMR (400 MHz, CDCI3) δ 4.63 (d, J = 29.1 Hz, 1H), 3.97 (s, 2H), 0.39 (s, 4H); 19F NMR (376 MHz, CDC13) δ -130.28; EIMS m/z 366.
Préparation 15: Methyl 4-acetamido-3-chloro-6-(trimethylstannyl)-picolinate (Head K)
O
H
NH
Prepared as described in Balko et al., WO 2003011853 Al.
Préparation 16: Methyl 4-acetamido-3,6-dichloropicolinate (Head L)
O
X X./°-.
cr ch3 o
Z-6017485
Prepared as described in Fields et al., WO 2001051468 Al.
Préparation 17: Methyl 4-amino-3-chloro-6-iodopicolinate (Head M)
xch3
Prepared as described in Balko et al., WO 2007082098 A2.
Préparation 18: Methyl 4-acetamido-3-chloro-6-iodopicolinate (Head N)
O
Prepared as described in Balko et al., WO 2007082098 A2.
Préparation 19: Methyl 4-amino-6-bromo-3,5-difluoropicolinate (Head O)
Prepared as described in Fields et al., WO 2001051468 Al.
Préparation 20: Methyl 6-amino-2-chloro-5-vinylpyrimidine-4-carboxylate (Head P)
Prepared as described in Epp et al., US 20090088322.
-6117485
Préparation 21: l-Bromo-4-(2,2-diethoxyethoxy)-2-fluorobenzene
4-Bromo-3-fluorophenol (7 g, 0.03665 mol) and potassium carbonate (7.6 g, 0.055 mol) were dissolved in A.A-dimethylformamide (9 mL). 2-Bromo-l,l-diethoxyethane (8.5 mL, 0.055 mol) was added and the reaction mixture was stirred and heated to 135 °C for 7 h. The solvent was removed after the reaction was completed. The residue was dissolved in ethyl acetate and washed with 2M NaOH solution. The organic phase was dried over Na2SO4. The solvent was evaporated to yield l-bromo-4-(2,2-diethoxyethoxy)-2-fluorobenzene as an oil (11.4 g, 100%).
Préparation 22: l-Bromo-3-(2,2-diethoxyethoxy)-2-fluorobenzene
l-Bromo-3-(2,2-diethoxyethoxy)-2-fluorobenzene was prepared from 3-bromo-2fluorophenol as described in Préparation 21.
Préparation 23: 2-Bromo-4-(2,2-diethoxyethoxy)-l-fluorobenzene
OEt
2-Bromo-4-(2,2-diethoxyethoxy)-l-fluorobenzene was prepared from 3-bromo-4fluorophenol as described in Préparation 21.
Préparation 24: l-Bromo-4-chloro-2-(2,2-diethoxyethoxy)benzene
-6217485 l-Bromo-4-chloro-2-(2,2-diethoxyethoxy)benzene was prepared from 2-bromo-5chlorophenol as described in Préparation 21.
Préparation 25: (4-Bromo-3-fluorophenyl)(2,2-diethoxyethyl)sulfane
(4-Bromo-3-fluorophenyl)(2,2-diethoxyethyl)sulfane was prepared from 4-bromo-3fluorobenzenethiol as described in Préparation 21.
Préparation 26: 4-Bromo-7-chlorobenzofuran
To 80 mL of benzene was added polyphosphoric acid (3.47 g, 36.9 mmol) and commercially available 2-(5-bromo-2-chlorophenoxy)acetaldehyde (9.2 g, 36.9 mmol) and separated into eight 20 mL vials containing equal amounts. The vials were heated to an extemal température of 90 °C for 4 days. Upon cooling of the reaction, the benzene was removed by decanting. Celite (50 g) was added to the organic solution and the solvent was removed using a rotary evaporator. The impregnated Celite was loaded onto a Teledyne-Isco purification System and purified by silica gel chromatography using 0-30% ethyl acetate:hexanes to give 4-bromo-7chlorobenzofuran as a white solid (2.7 g, 32%): XH NMR (400 MHz, CDCI3) δ 7.73 (d, J= 2.2 Hz, 1H), 7.33 (d, J= 8.3 Hz, 1H), 7.18 (d, J= 8.3 Hz, 1H), 6.85 (d, J= 2.2 Hz, 1H); 13C NMR (101 MHz, CDCI3) δ 150.38 (s), 146.14 (s), 130.27 (s), 126.56 (s), 125.32 (s), 116.44 (s), 112.49 (s), 107.71 (s); ESIMS m/z 232 ([M+H]+), 230 ([M-H]').
Préparation 27: 6-Bromobenzofuran and 4-bromobenzofuran
-6317485
6-Bromobenzofuran and 4-bromobenzofuran were prepared as described in US20040147559 from l-bromo-3-(2,2-diethoxyethoxy)benzene.
Préparation 28: 5-Bromo-6-fluorobenzofuran and 5-bromo-4-fluorobenzofuran
l-Bromo-4-(2,2-diethoxyethoxy)-2-fluorobenzene (11.4 g, 0.037 mol) was dissolved in toluene (78 mL). Polyphosphoric acid (11.9 g) was added and the mixture was heated to reflux for 5 h. The solvent was removed and the residue was diluted with water and ethyl acetate. The organic phase was washed with 2 M NaOH solution and then dried over Na2SC>4. A mixture of 5-bromo-6-fluorobenzofuran and 5-bromo-4-fluorobenzofuran (4.8 g, 60.3%) were obtained as a mixture after purification via column chromatography.
Préparation 29: 6-Bromo-7-fluorobenzofuran
6-Bromo-7-fluorobenzoiuran was prepared from l-bromo-3-(2,2-diethoxyethoxy)-2fluorobenzene as described in Préparation 28: ESIMS m/z 216 ([M+H]+).
Préparation 30: 6-Bromo-5-fluorobenzofuran
F
6-Bromo-5-fluorobenzofuran was prepared from 2-bromo-4-(2,2-diethoxyethoxy)-lfluorobenzene as described in Préparation 28: ESIMS m/z 216 ([M+H]+).
-6417485
Préparation 31: 7-Bromo-4-chlorobenzofuran
7-Bromo-4-chlorobenzofuran was prepared from l-bromo-4-chloro-2-(2,2diethoxyethoxy)benzene as described in Préparation 28: ESIMS m/z 232 ([M+H]+).
Préparation 32: 5-Bromo-4-fluorobenzo [6] thiophene and 5-bromo-6fluorobenzo [b ] thiophene
Polyphosphoric acid (13.9 g) was stirred in chlorobenzene (50 mL) at 130 °C. (4Bromo-3-fluorophenyl)(2,2-diethoxyethyl)sulfane (7.7 g, 0.0238 mol) in chlorobenzene (15.4 mL) was added dropwise at 130 °C. The mixture was then stirred at 130 °C for 10 h. The solvent was removed and the residue was extracted with toluene, hexane, and then water. The organic phase was combined and washed with saturated sodium bicarbonate (NaHCCh) solution and brine, and then dried over Na2SC>4. The products 5-bromo-4-fluorobenzo[è]thiophene and 5bromo-6-fluorobenzo[à] thiophene were obtained after purification via column chromatography (3.6 g, 65.5%).
Préparation 33: 6-Bromo-5-fluorobenzo[à] thiophene and 4-bromo-5fluor obenzo [Λ] thiophene
-6517485
6-Bromo-5-fluorobenzo[b]thiophene and 4-bromo-5-fluorobenzo[ô]thiophene were prepared from (3-bromo-4-fluorophenyl)(2,2-diethoxyethyl)sulfane as described in Préparation 32: ESIMS m/z 232 ([M+H]+).
Préparation 34: 2-(7-Chlorobenzofuran-4-yl)-5,5-dimethyl-l,3,2-dioxaborinane
2-(7-Chlorobenzofuran-4-yl)-5,5-dimethyl-l,3,2-dioxaborinane was prepared as described in Préparation 55 from 4-bromo-7-chlorobenzofuran (prepared as described in W02005056015) to afford a white solid (66%): IR (cm'1) 669.18,701.26, 741.33, 792.08, 773.25, 842.53, 811.66, 863.44, 876.27, 884.51, 953.31, 993.58, 1027.34, 1132.28, 1059.34, 1157.92, 1217.21, 1207.86, 1253.95, 1238.65, 1302.38, 1266.72, 1359.16, 1335.94, 1370.05, 1422.73, 1438.38, 1480.37, 1577.30, 1602.05, 2903.59, 2871.91, 2940.30, 2955.31, 3140.15, 3161.21; *H NMR (400 MHz, CDC13) δ 7.69 (d, ./=2.1 Hz, 1H), 7.63 (d, J=7.8 Hz, 1H), 7.28 (dd, J= 6.7, 2.6 Hz, 1H), 7.27 (d, J= 2.2 Hz, 1H), 3.82 (s, 4H), 1.05 (s, 6H); ESIMS m/z 265 ([M+H]+), 263([M-H]’).
Préparation 35: 2-(Benzofuran-6-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane and 2(benzofuran-4-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane
2-(Benzofuran-6-yl)-4,4,5,5-tetramethyl-l ,3,2-dioxaborolane and 2-(benzofuran-4yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane were prepared as described in Préparation 55 from 4bromobenzofuran and 6-bromobenzofuran to afford the mixture as a clear oil (48%): ’H NMR (400 MHz, CDC13) δ 7.97 (s, 1H), 7.72 - 7.68 (m, 1H), 7.66 (dd, J= 4.9, 2.6 Hz, 2H), 7.60 (dd, J = 8.0, 5.2 Hz, 2H), 7.30 (dd, J = 7.1, 6.2 Hz, 1H), 7.28 - 7.21 (m, 2H), 6.77 (dd, J= 2.1, 0.8 Hz, 1H), 1.37 (d,J= 6.2 Hz, 22H), 1.29-1.22 (m, 8H); 13C NMR (101 MHz, CDC13) δ 146.01,
-6617485
145.21, 130.19, 130.11, 128.76, 123.56, 120.60, 117.60, 114.05, 108.45, 106.63, 83.82, 83.69, 83.50, 25.02, 24.98, 24.88; ESIMS m/z 245 ([M+H]+), 243([M-H]‘).
Préparation 36: 2-(6-Fluorobenzofuran-5-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane and
2-(4-fluorobenzofuran-5-yi)-4,4,5,5-tetramethyl-l,3,2-dioxaboro!ane
A mixture of 5-bromo-6-fluorobenzofuran and 5-bromo-4-fluorobenzofuran (1 combined équivalent), potassium acetate (KOAc; 3 eq) and bis(pinacolato) diboron (1.2 eq) were stirred in dioxane (0.1 M with respect to the 5-bromo-6-fluorobenzofuran and 5-bromo-4fluorobenzofuran mixture) under nitrogen flow for 30 min. The catalyst [1,1bis(diphenylphosphino)ferrocene]dichloropalladium(II) (PdCl2(dppf); 0.15 eq) was added and the nitrogen flow was maintained for 10 min. The reaction mixture was heated to 85 °C ovemight. The solvent was removed, the residue was dissolved in methylene chloride, and the solid was filtered. The filtrate was concentrated and purified through a column to give a mixture of 2-(6-fluorobenzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane and 2-(4fluorobenzofuran-5-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane (63%): 'H NMR (400 MHz, CDC13) δ 7.98 (d, J=5.7 Hz, 1H), 7.59 (d,J=2.1 Hz, 1H), 7.18 (d, J =9.4 Hz, 1H), 6.73 (d,J =
1.3 Hz, 1H), 1.38 (s, 12H); *H NMR (400 MHz, CDCI3) δ 7.81 (d, J= 7.0 Hz, 1H), 7.37 (t, J =
7.4 Hz, 1H), 7.30 (d, J= 8.4 Hz, 1H), 6.87 (s, 1H), 1.38 (s, 12H); 19F NMR (376 MHz, CDC13) δ -107.80, -107.81, -107.82, -107.84, -108.47, -108.48; ESIMS m/z 262 ([M+H]+).
Préparation 37: 2-(4-Chlorobenzofuran-7-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane
2-(4-Chlorobenzofuran-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane was prepared as described in Préparation 36 from 7-bromo-4-chlorobenzofuran: ’H NMR (400 MHz, CDCI3) δ
-6717485
7.75 (d, J= 2.2 Hz, 1H), 7.67 (d, J= 7.8 Hz, 1H), 7.24 (d, J= 7.8 Hz, 1H), 6.86 (d, J= 2.2 Hz, 1H), 1.41 (s, 12H); ESIMS m/z 278 ([M+H]+).
Préparation 38: 2-(5-Fluorobenzofuran-6-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane
2-(5-Fluorobenzofuran-6-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane was prepared as described in Préparation 36 from 6-bromo-5-fluorobenzofuran: *H NMR (400 MHz, CDCI3) δ 7.85 (d, .7=4.3 Hz, 1H), 7.68 (d,J=2.2 Hz, 1H), 7.24-7.20 (m, 1H), 6.75-6.70 (m, 1H), 1.38 (s, 12H); 19F NMR (376 MHz, CDC13) δ -110.23 (dd, J= 9.6,4.1 Hz); ESIMS m/z 262 ([M+H]+).
Préparation 39: 2-(7-Fluorobenzofuran-6-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane
2-(7-Fluorobenzofuran-6-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane was prepared as described in Préparation 36 from 6-bromo-7-fluorobenzofuran: 'H NMR (400 MHz, CDCI3) δ
7.68 (t, .7= 3.1 Hz, 1H), 7.55 (dd, .7=7.8,4.5 Hz, 1H), 7.34 (t,.7= 6.5 Hz, 1H), 6.80 (dd,J=2.9,
2.2 Hz, 1H), 1.38 (s, 12H); 19F NMR (376 MHz, CDC13) δ -127.62 (dd, J= 4.2, 3.1 Hz); ESIMS m/z 262 ([M+H]+).
-6817485
Préparation 40: 2-(6-Fluorobenzo[o]thiophen-5-yl)-4,4,5,5-tetramethyI-l,3,2-dioxaborolane and 2-(4-fluorobenzo[Z»]thiophen-5-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane
2-(6-Fluorobenzo[ô]thiophen-5-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane and 2-(4fluorobenzo[è]thiophen-5-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane were prepared as described in Préparation 36 from 5-bromo-4-fluorobenzo[ô]thiophene and 5-bromo-6fluorobenzo[ô]thiophene: *H NMR (400 MHz, CDCl3) δ 8.20 (d, J= 5.5 Hz, 1H), 7.53 (d, J = 9.3 Hz, 1H), 7.35 (d, 7= 5.5 Hz, 1H), 7.30 (d, J= 5.5 Hz, 1H), 1.39 (s, 12H); *H NMR (400 MHz, CDC13) δ 7.69 - 7.61 (m, 2H), 7.47 (d, J= 5.6 Hz, 1H), 7.39 (d, J= 5.6 Hz, 1H), 1.39 (s, 12H); 19F NMR (376 MHz, CDCI3) δ -107.24, -109.56; ESIMS m/z 278 ([M+H]+).
Préparation 41: 2-(5-Fluorobenzo[Z»]thiophen-6-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane and 2-(5-fluorobenzo [Z>] thiophen-4-yl)-4,4,5,5-tetramethyl-l ,3,2-dioxaborolane
2-(5-Fluorobenzo[à]thiophen-6-yl)-4,4,5,5-tetramethyl-l ,3,2-dioxaborolane and 2-(5fluorobenzo[ô]thiophen-4-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane were prepared as described in Préparation 36 from 6-bromo-5-fluorobenzo[ô]thiophene and 4-bromo-5fluorobenzo[è]thiophene: *H NMR (400 MHz, CDCI3) δ 8.26 (d, J= 5.1 Hz, 1H), 7.59 (d, J=
5.4 Hz, 1H), 7.45 (d, J =9.9 Hz, 1H), 7.28 (d, J =5.4 Hz, 1H), 1.39 (s, 12H); ’HNMR (400
MHz, CDCI3) δ 7.92 (d, J= 5.5 Hz, 1H), 7.88 (dd, J= 8.8, 4.9 Hz, 1H), 7.55 (d, J= 5.5 Hz, 1H),
7.07 (t, 7= 9.1 Hz, 1H), 1.42 (s, 12H); 19FNMR (376 MHz, CDCI3) δ-107.32,-107.34,-107.35, -107.36, -111.00, -111.02, -111.02, -111.03, -111.04, -111.04; ESIMS m/z 278 ([M+H]+).
-6917485
Préparation 42: 2-(Benzo[/)]thiophen-6-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane
6-Bromobenzo[ô]thiophene (3.09 g, 14.5 mmol), 4,4,4',4',5,5,5',5'-octamethyl-2,2'bi(l,3,2-dioxaborolane) (4.42 g, 17.4 mmol), PdC12(dppf) (0.54 g, 0.74 mmol), and KOAc (2.89 g, 29.4 mmol) in anhydrous dioxane (48 mL) was stirred at reflux at 80 °C for 4 h. The reaction mixture was cooled and diluted with ethyl acetate, filtered through a pad of Celite, and washed with brine. The aqueous layer was extracted with ethyl acetate. The organic layers were dried, filtered, and adsorbed onto silica gel. Purification by flash chromatography (0 - 30% ethyl acetate/hexanes) provided 2-(benzo[6]thiophen-6-yl)-4,4,5,5-tetramethyl-l ,3,2-dioxaborolane (3.266 g, 87%) as a yellow oily solid: !H NMR (400 MHz, CDC13) δ 8.38 (d, J= 0.7 Hz, 1H), 7.79 (ddd, J= 20.2, 8.0, 0.8 Hz, 2H), 7.51 (d, J= 5.5 Hz, 1H), 7.34 (dd, J= 5.4, 0.7 Hz, 1H), 1.37 (s, 12H); 13C NMR (101 MHz, CDC13) δ 141.78, 129.75, 129.58, 128.18, 123.87, 122.94, 83.89, 24.92; EIMS m/z 260.
Préparation 43: 5-Fluoro-6-(4,4,5,5-tetramethyI-l,3,2-dioxaborolan-2-yl)-lJ7-indole
To a round bottom flask, 4,4,4',4',5,5,5',5'-octamethyl-2,2'-bi(l,3,2-dioxaborolane) (1.424 g, 5.61 mmol), [l,r-bis(diphenylphosphino)ferrocene] dichloropalladium(II) (0.342 g, 0.467 mmol), and potassium acetate (0.917 g, 9.34 mmol) were charged as solids. The flask was sealed, and pumped and purged (3x) with inert gas. Then 6-bromo-5-fluoro-177-indole (1.0 g, 4.67 mmol) in dioxane (15.57 mL) was added. The reaction mixture was stirred and warmed to an internai température of 85 °C. After 18 h the reaction mixture was cooled and filtered through a pad of Celite, washing with excess ethyl acetate. The filtrate was diluted with water and partitioned. The aqueous layer was extracted with ethyl acetate (3x15 mL). The combined organic layers were dried over MgSC>4, filtered and concentrated in vacuo. The crude product
-7017485 was purified using a Teledyne ISCO purification System with a gradient eluent System of ethyl acetate and hexanes to yield the title compound as a peach-colored solid (656 mg, 54%): *H NMR (400 MHz, DMSO-t/6) δ 1.31 (s, 12H), 6.42 (ddd, J = 2.9, 1.9, 0.9 Hz, 1H), 7.22 (d, J = 10.5 Hz, 1H), 7.52 (t, J = 2.8 Hz, 1H), 7.69 (d, J = 4.8 Hz, 1H), 11.24 (s, 1H); 19F NMR (376 MHz, DMSO-Z) δ -116.07; ESIMS m/z 262.0 ([M+H]+), 260.0 ([M-H]).
Préparation 44: 7-Bromo-4-chloro-l/7-indole
To a solution of l-bromo-4-chloro-2-nitrobenzene (932 mg, 3.95 mmol) in tetrahydrofuran (10 mL), vinylmagnesium bromide (0.7 M in tetrahydrofuran; 12 mmol) in tetrahydrofuran (15 mL) was added drop wise at -40 °C. After 1 h the reaction mixture was poured into saturated ammonium chloride (NH4CI). The resulting organic layer was concentrated. The resulting residue was purified using a Teledyne ISCO chromatography System with a gradient eluent System of 2% ethyl acetate in hexane to yield the title compound (400 mg, 44%): ’H NMR (300 MHz, CDCI3) δ 6.73 (t, J= 2.8 Hz, 1H), 7.02 (d, J= 8.1 Hz, 1H), 7.19 7.39 (m, 2H), 8.43 (s, 1H).
Préparation 45: 4-Bromo-7-chloro-l//-indole
4-Bromo-7-chloro-lH-indole was prepared from 4-bromo-l-chloro-2-nitrobenzene as described in Préparation 44: *H NMR (300 MHz, CDC13) δ 6.49 - 6.74 (m, 1H), 7.07 (d, J= 8.1 Hz, 1H), 7.15 - 7.42 (m, 2H), 8.49 (s, 1H).
Préparation 46: 6-Bromo-7-fluoro-l/f-indole
-7117485
6-Bromo-7-fluoro-l/7-indole was prepared from l-bromo-2-fluoro-3-nitrobenzene as described in Préparation 44 (250 mg, 25.2%): *H NMR (300 MHz, CDCI3) δ 6.52 - 6.62 (m, 1H), 7.13 - 7.34 (m, 3H), 8.38 (s, 1H); ESIMS m/z 215.0 ([M+H]+).
Préparation 47 (Precursor Example 1): 4-Chloro-7-(4,4,5,5-tetramethyl-l,3,2dioxaborolan-2-yl)-l//-indo!e
To a solution of 7-bromo-4-chloro-l/7-indole (8 g, 0.03 mol) in dioxane, KOAc (9.8 g, 0.1 mol), dichloro[l,l’-bis(diphenylphosphino)ferrocene]-palladium(II) (2.19 g, 0.003 mol), and 4,4,4',4',5,5,5',5'-octamethyl-2,2'-bi(l,3,2-dioxaborolane) (13.2 g, 0.052 mol) were charged as solids. The reaction mixture was placed under inert atmosphère and the flask was sealed. The reaction was heated to 100 °C for 16 h. The reaction mixture was then treated with H2O and extracted with ethyl acetate. The organic layer was partitioned and concentrated. The resulting residue was purfied using a Teledyne ISCO chromatography System with a gradient eluent System of ethyl acetate in hexane to yield the title compound (1.3 g, 15.6%): ’H NMR (300 MHz, CDCI3) δ 1.40 (s, 12H), 6.58 - 6.73 (m, 1H), 7.14 (d, J= 7.6 Hz, 1H), 7.28 - 7.36 (m, 1H), 7.56 (d, J= 7.6 Hz, 1H), 9.34 (s, 1H).
Préparation 48: 7-Chloro-4-(4,4,5,5-tetramethyl-l,3,2-dioxaboroIan-2-yl)-l//-indole
7-Chloro-4-(4,4,5,5-tetramethyl-l,3,2-dioxaborolan-2-yl)-l/7-indole was prepared as described in Préparation 47 from 4-bromo-7-chloro-l//-indole (4.2 g, 43.7%): ’H NMR (300 MHz, CDCI3) δ 1.38 (s, 26H), 7.08 (dd, J= 3.2, 2.2 Hz, 1H), 7.20 (d, J= 7.6 Hz, 1H), 7.30 (t, J = 2.8 Hz, 1H), 7.56 (d, J= 7.6 Hz, 1H), 8.40 (s, 1H).
-7217485
Préparation 49 (Precursor Example 2): 7-Fluoro-6-(4,4,5,5-tetramethyl-l,3,2-dioxaborolan2-yl)-lH-indole
7-Fluoro-6-(4,4,5,5-tetramethyl-l,3,2-dioxaborolan-2-yl)-lH-indole was prepared as described in Préparation 47 from 6-bromo-7-fluoro-l/7-indole (150 mg, 45.5%): *H NMR (300 MHz, CDC13) δ 1.26 (s, 25H), 1.39 (s, 24H), 7.27 (d, J= 4.5 Hz, 2H), 7.40 (d, J= 2.6 Hz, 2H), 8.43 (s, 1H); 19F NMR (282 MHz, CDC13) δ -124.52; 13C NMR (101 MHz, CDC13) δ 24.87 (d, J = 15.9 Hz), 77.30,83.49 (d, J= 6.9 Hz), 103.25, 115.98 (d, J= 3.3 Hz), 126.08 (d, .7=7.7 Hz).
Préparation 50 (Precursor Example 3): 7-FIuoro-6-(4,4,5,5-tetramethyl-l,3,2-dioxaborolan2-yl)-l-(triisopropylsilyl)-l/7-indole
7-Fluoro-l-(triisopropylsilyl)-17f-indole (4.0 g, 14 mmol) (Prepared accordingto M. Schlosser, et al., Eur. J. Org. Chem. 2006, 2956-2969) was dissolved in 30 mL dry THF, cooled to -75 °C, treated in portions with sec-butyl lithium (10 mL, 1.4 M, 14 mmol) and stirred for 2 h at -75 °C. 2-Isopropoxy-4,4,5,5-tetramethyl-l,3,2-dioxaborolane (3.0 mL, 2.7 g, 14 mmol) was added in portions and the mixture was stirred for 1 h at -75 °C. The cooling bath was removed and the température was allowed to rise to 5 °C over 30 min. The reaction was quenched by addition of 5 mL saturated NH4CI and partitioned between ethyl acetate and water. The organic phase was washed with saturated sodium chloride (NaCl), dried (Na2SC>4), evaporated onto silica gel, and purified by flash chromatography (SiCh; eluting with hexanes) to give the title compound as a thick oil (4.2 g, 73%): *H NMR (400 MHz, CDC13) δ 7.43 (dd, J= 7.9, 4.6 Hz, 1H), 7.38 (m, 2H), 1.75 (m, 3H), 1.38 (s, 12H), 1.13 (d, J = 7.6 Hz, 18H); 19F NMR (376 MHz, CDCI3) δ -113.07; EIMS m/z 417.
-7317485
Préparation 51: 2-Ethynyl-4,6-difluoroaniline
Step 1: 2-Bromo-4,6-difluoroaniline (10 g, 48 mmol), copper (I) iodide (Cul; 180 mg, 0.96 mmol), bis(triphenylphosphine)palladium(II) chloride (680 mg, 0.96 mmol) and ethynyltrimethylsilane (7.1 g, 72 mmol) were combined with 10 mL dry DMF and heated to 50 °C for 18 h. An additional 2 mL ethynyltrimethylsilane, 200 mg bis(triphenylphosphine)palladium(II) chloride, and 60 mg Cul were added and heating was continued for 4 h. After cooling, the mixture was diluted with ethyl acetate and stirred with 1 normal (N) hydrochloric acid (HCl). The dark mixture was filtered through Celite to remove fine solids. The organic phase was washed with water, saturated NaCl, dried and concentrated. Purification by flash chromatography (SiC>2, eluting with 0-20% EtOAc in hexanes) afforded 9 g of material that consisted of a 70/30 ratio of the TMS alkyne dérivative and the starting bromide.
Step 2: The mixture was carried in to the desilylation without further purification. The TMS dérivative was dissolved in methanol (500 mL) and treated with 8.5 g KF. A clear solution formed which was stirred ovemight at room température (RT). Most of the volatiles were removed under vacuum, the residue was taken up in ethyl acetate and washed water and with saturated NaCl. The solution was dried, evaporated and purified by flash chromatography (S1O2, eluting with 0-10% ethyl acetate in hexanes) to provide the title compound (4.2 g, 70 area % pure by flame-ionization detector-gas chromatography (FID-GC)): *H NMR (400 MHz, CDCI3) δ 6.83 (m, 1H), 4.13 (m, 1H), 3.46 (s, 1H); 19F NMR (376 MHz, CDCI3) δ -124.04, 124.88, -126.94, -130.08; EIMS m/z 153. This material was carried through to the cyclization step without further purification.
Préparation 52: 5,7-Difluoro-lZT-indole
F
The impure 2-ethynyl-4,6-difluoroaniline (4.2 g, 19 mmol) from the previous préparation was dissolved in éthanol (75 mL), treated with sodium gold(III) chloride dihydrate
-7417485 (310 mg, 0.77 mmol) and stirred for 3 h under an atmosphère of nitrogen. The mixture was concentrated, taken up in ethyl acetate, washed with water, washed with saturated NaCl, dried over sodium sulfate (NaiSOzi) and evaporated. Purification by flash chromatography (SiO2, 100-200 mesh; eluting with 0-15% EtOAc in hexanes containing 2% acetic acid) provided the title product (2.0 g, ca 85% purity): *H NMR (400 MHz, CDC13) δ 8.32 (s, 1H), 7.26 (dd, J= 4.8, 2.0 Hz, 1H), 7.09 (dd, J= 9.1, 2.2 Hz, 1H), 6.74 (ddd, J= 11.2, 9.3, 2.0 Hz, 1H), 6.55 (td, J = 3.3, 2.2 Hz, 1H); 19F NMR (376 MHz, CDC13) δ -122.11, -131.96; EIMS m/z 153.
Préparation 53: 5,7-Difluoro-l-(triisopropylsilyl)-l//-indole
A-Butyl lithium (2.7 mL, 2.5 M, 6.9 mmol) was added to 10 mL dry THF at -70 °C. 5,7-Difluoro-177-indole (1.0 g, 6.5 mmol) in 5 mL THF was added in portions to the solution and the mixture was stirred for 30 min at -75 0 C. Triisopropylchlorosilane (1.5 mL, 1.3 g, 6.9 mmol) was added, stirring was continued for 1 h at -75 °C and then the mixture was allowed to warm to -5 °C over 2 h. After treatment with 5 mL saturated NH4CI, the mixture was mixed with 30 mL ether and the organic phase was washed with 5 mL saturated NaCl, dried (Na2SC>4) and evaporated. The product was purified by flash chromatography(SiO2; hexanes) to provide the title compound as a clear oil (1.5 g; 74%): *H NMR (400 MHz, CDCI3) δ 7.35 (d, J= 3.1 Hz, 1H), 7.07 (dd, J= 8.7, 2.3 Hz, 1H), 6.69 (m, 1H), 6.59(t, J= 3.1 Hz, 1H), 1.67 (m, 3H), 1.13 (d, J= 7.6 Hz, 18H); l9F NMR (376 MHz, CDCI3) δ -120.64, -120.65, -122.49, -122.49; EIMS m/z 309.
Préparation 54: 5,7-Difluoro-6-iodo-l-(triisopropyIsilyl)-ljî-indole
-7517485
5,7-Difluoro-l-(triisopropylsilyl)-177-indole (1.4 g, 4.5 mmol) and pentamethyldiethylene -triamine( 830 mg, 4.8 mmol) were combined in 10 mL dry THF, cooled to -70 °C and treated in portions with sec-butyl lithium (3.4 mL, 1.4 M, 4.8 mmol) and stirred for 3 h at this température. Iodine (1.3 g, 5.0 mmol) in 5 mL THF was added, the mixture was stirred for 50 min, quenched by addition of 3 mL saturated NH4CI and partitioned between diethyl ether and water. The organic phase was washed with saturated NaCl, dried (Na2SO4), evaporated and purified by flash chromatography (SiO2; hexanes) to provide the title compound as a clear oil which solidified on standing (1.9 g, 90%): mp 74-76 °C; *H NMR (400 MHz, CDC13)Ô7.34 (d, J =3.1 Hz, 1H), 7.14 (dd, J= 7.7, 0.9 Hz, 1H), 6.60 (t,J=3.1 Hz, 1H), 1.67 (m,3H), 1.13 (d, J=7.6 Hz, 18H); 19F NMR (376 MHz, CDC13) δ-101.37,-105.33.
Préparation 55: 2-(2,2-dimethylbenzo[d] [l,3]dioxol-5-yl)-4,4,5,5-tetramethyl-l,3,2dioxaborolane
To DMSO (lOmL) was added potassium acetate (1.671 g, 17.03 mmol), 4,4,4',4',5,5,5',5'-octamethyl-2,2'-bi(l,3,2-dioxaborolane) (1.729 g, 6.81 mmol), 5-bromo2,2-dimethylbenzo[d][l,3]dioxole (1.3 g, 5.68 mmol), and PdC12(dppf) (0.415 g, 0.568 mmol). The reaction was heated to an extemal température of 80 °C for 18 hours. Upon cooling, the reaction was poured reaction into 50mL ice water. The ice water mixture was transferred to a separatory funnela and two extractions with EtOAc (50mL) were completed. The organic layers were combined, dried over Na2SO4, and filtered. The solutiown was concentrated onto 5g of celite using EtOAc as solvent. The impregnated celite was loaded onto a Teledyne Isco purification System and purified by silica gel chromatograpy using 0-30% EtOAc:hexanes to yield 2-(2,2dimethylbenzo[d][l,3]dioxol-5-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane (767mg, 49%) as a red semi-solid: *H NMR (400 MHz, CDC13) δ 7.31 (dt, J= 6.6, 3.3 Hz, 1H), 7.15 (s, 1H), 6.74 (d,J=7.7 Hz, 1H), 1.66 (s, 6H), 1.32 (s, 12H); 13CNMR(101 MHz, CDCI3) δ 129.21 (s), 113.78 (s), 108.15 (s), 83.59 (s), 25.86 (s), 24.82 (s); ESIMS m/z 277 ([M+H]+), 275 ([M-H]').
-7617485
EXAMPLES OF SYNTHESIS OF COMPOUNDS OF FORMULA (I)
Example 1. Methyl 4-amino-3-chloro-5-fluoro-6-(7-fluoro-lÆ-indol-6-yl)picolinate (Compound No. 1.14)
Methyl 4-amino-3,6-dichloro-5-fluoropicolinate (0.650 g, 2.72 mmol), 7-fluoro-6(4,4,5,5-tetramethyl-l,3,2-dioxaborolan-2-yl)-17/-indole (0.817 g, 3.13 mmol), bis(triphenylphosphine)palladium(II) chloride (0.191 g, 0.272 mmol), and césium fluoride (0.826 g, 5.44 mmol) were combined in acetonitrile (4.53 mL) and water (4.53 mL). The reaction mixture was irradiated in a Biotage Initiator microwave at 110 °C in a sealed vial for 30 min. The cooled reaction mixture was partitioned between ethyl acetate and water. The organic phase was dried and concentrated. The product was purified by flash chromatography (SiCh; eluting with 5-40% ethyl acetate in hexanes) to provide the title compound as an white solid (0.517 g, 52.4 % yield). Note: Potassium fluoride replaced césium fluoride in some examples that refer to this particular example.
The préparation method used in this example is referred to in Table 10 as “Coupling 1”.
Example 2: Methyl 4-amino-3-chloro-5-fluoro-6-(lZ7-indol-5-yl)picolinate (Compound No.
1-2)
CH lH-Indol-5-ylboronic acid (220 mg, 1.4 mmol, 1.1 equiv) and methyl 4-amino-3,6dichloro-5-fluoropicolinate (300 mg, 1.3 mmol, 1.0 equiv) were sequentially added to a 5 mL Biotage microwave vessel, followed by césium fluoride (380 mg, 2.5 mmol, 2.0 equiv), palladium(II) acetate (14 mg, 0.063 mmol, 0.05 equiv), and sodium 3,3',3
-7717485 phosphinetriyltribenzenesulfonate (71 mg, 0.13 mmol, 0.10 equiv). A 3:1 mixture of water:acetonitrile (2.5 mL) was added and the resulting dark brown mixture was placed in a Biotage microwave and heated to 150 °C for 5 min, with extemal IR-sensor température monitoring from the side of the vessel. The cooled reaction mixture was diluted with water (50 mL) and extracted with dichloromethane (15 x 30 mL). The combined organic layers were dried (sodium sulfate), gravity filtered, and concentrated by rotary évaporation. The residue was purified by reverse phase column chromatography (5% acetonitrile to 100% acetonitrile gradient) to yield the title compound as a tan powder (290 mg, 73%).
The préparation method used in this example is referred to in Table 10 as “Coupling 2”.
Example 3: Methyl 4-amino-6-(benzo[iZ]thiazol-5-yl)-3-chloro-5-fluoropicolinate (Compound No. 6.1)
To a 5 mL microwave vial was added methyl 4-amino-6-bromo-3-chloro-5fluoropicolinate (200 mg, 1.0 mmol), benzo[<7]thiazol-5-ylboronic acid (237 mg, 1.35 mmol), potassium fluoride (KF; 122 mg, 2.12 mmol), TPPTS-Na (tris-(3-sulfomatophenyl)-phosphine4hydrate sodium sait, 67 mg, 0.106 mmol) and Pd(OAc)2 (11 mg, 0.053 mmol). Subsequently, CH3CN (1.0 mL) and H2O (3.0 mL) were added, and the reaction vial was sealed and heated in a Biotage micro wave at 150 °C for 5 min, with extemal IR-sensor température monitoring from the side of the vessel. The reaction mixture was cooled to room température and diluted with dichloromethane, and washed with water. The organic extracts were combined, dried (Na2SÛ4), filtered, and concentrated in vacuo. The crude product was purified by triturating with diethyl (Et2O) to yield the title compound as a brown solid (172 mg, 51%).
The préparation method used in this example is referred to in Table 10 as “Coupling 3”.
-7817485
Example 4: Methyl 4-amino-6-(benzo[h]thiophenyl-5-yl)-3,5-dichloropicolinate (Compound
No. 3.1)
To a 5 mL microwave vial was added methyl 4-amino-3,5,6-trichloropicolinate (0.232 g, 0.909 mmol), 2-(benzo[h]thiophen-5-yl)-4,4,5,5-tetramethyl-l,3,2-dioxaborolane (0.260 g, 0.999 mmol), césium fluoride (0.276 g, 1.817 mmol) and (PPl^PdCh (0.064 g, 0.091 mmol). The reaction vial was then sealed and placed under inert atmosphère. Subsequently, dioxane (4.0 mL) and H2O (1.0 mL) were added and the reaction mixture was heated in a Biotage microwave at 120 °C for 60 min, with extemal IR-sensor température monitoring from the side of the vessel. The reaction mixture was cooled to room température and diluted with ethyl acetate (5 mL) and poured into brine solution. The layers were separated and the aqueous phase was extracted with ethyl acetate (3x10 mL). The organic extracts were combined, dried (MgSCU), fîltered, and concentrated in vacuo. The crude product was purified using a Teledyne ISCO purification System with a gradient eluent System of ethyl acetate and hexanes. Further purification was performed, as needed, using a Teledyne ISCO reverse phase System with a gradient eluent System of acetonitrile and H2O to yield the title compound as a white solid.
The préparation method used in this example is referred to in Table 10 as “Coupling 4”.
Example 5: Methyl 4-amino-3-chloro-6-(7-chlorobenzofuran-4-yl)-5-fluoropicolinate (Compound No. 2.16)
CH3
Potassium fluoride (0.365 g, 6.28 mmol), palladium diacetate (0.047 g, 0.209 mmol),
2-(7-chlorobenzofuran-4-yl)-5,5-dimethyl-l,3,2-dioxaborinane (0.609 g, 2.301 mmol), sodium
3,3',3-phosphinetriyltribenzenesulfonate tetrahydrate (0.134 g, 0.209 mmol), and methyl 4
-7917485 amino-3,6-dichloro-5-fluoropicolinate (0.5 g, 2.092 mmol) were combined in a microwave reactor vial. To these were added water (3 mL) and acetonitrile (1 mL). The reaction mixture was heated at 150 °C in a microwave reactor for 6 min. The cooled reaction mixture was diluted with ethyl acetate and water and filtered through a cotton plug. The organic phase was dried (Na2SC>4) and concentrated under vacuum. Purification by reverse phase chromatography provided the title compound as a white solid (127 mg, 12.5% yield).
The préparation method used in this example is referred to in Table 10 as “Coupling 5”.
Example 6 Methyl 4-amino-3-chloro-6-(7-fluoro-l/7-indol-6-yl)picolinate (Compound No.
1.22)
Methyl 4-acetamido-3,6-dichloropicolinate (400 mg, 1.520 mmol),7-fluoro-6(4,4,5,5-tetramethyl-l,3,2-dioxaborolan-2-yl)-177-indole (437 mg, 1.673 mmol), césium fluoride (462 mg, 3.04 mmol), and (PPl^PdCh (107 mg, 0.152 mmol) were charged as solids into a micro wave reaction vessel and dioxane (4 mL) and water (1 mL) were added. The reaction vessel was sealed and irradiated in a Biotage Initiator microwave at 110 °C for 2 h, with extemal IR-sensor température monitoring from the side. The reaction mixture was partitioned between ethyl acetate and water. The organic phase was filtered and concentrated. The intermediate product was purified by flash chromatography (ISCO 40 g silica 10-75% EtOAc: Hexanes 16 CV). Fractions containing product were combined and concentrated to give 524 mg of a white solid intermediate methyl 4-acetamido-3-chloro-6-(7-fluoro-lH-indol-6-yl)picolinate (0.524 g, 1.448 mmol) which was subsequently diluted with methanol (10.0 mL). Then acetyl chloride (0.725 mL, 10.20 mmol) was added. The reaction mixture was allowed to stir at room température for 18 h. The reaction mixture was concentrated to dryness. The resulting residue was dissolved in ethyl acetate and poured into saturated NaHCCh solution. The layers were partitioned and the aqueous layer was extracted with ethyl acetate (3x15 mL). The organic extracts were combined, washed with saturated NaCl solution, dried (MgSÛ4), filtered and concentrated in vacuo. The crude product was purified using a Teledyne ISCO purification
-8017485
System with a gradient eluent System of ethyl acetate and hexanes to yield the title compound as a white solid (365 mg, 79%).
The préparation method used in this example is referred to in Table 10 as “Coupling 6”.
Example 7: Methyl 4-amino-3-chloro-6-(5,7-difluoro-l//-indoI-6-yI)picolinate (Compound No. 1.26)
5,7-Difluoro-6-iodo-l-(triisopropylsilyl)-17/-indole (450 mg, 1.0 mmol), methyl 4acetamido-3-chloro-6-(trimethylstannyl)picolinate (450 mg, 1.1 mmol) were combined in 7 mL dry DMF, deaerated with a stream of nitrogen for 15 min, treated with bis(triphenylphosphine)palladium(II) chloride (72 mg, 0.10 mmol) and copper (I) iodide and heated to 60 °C for 2 h. The mixture was partitioned between ethyl acetate and water. The organic phase was washed with water, washed with saturated NaCl, dried (Na2SÛ4), and evaporated. Purification by flash chromatography (S1O2, 100-200 mesh; eluting with 0-30% EtOAc in hexanes) provide 200 mg of the silylated TV-acetamide product. This material was slurried in methanol (15 mL), treated with 2 mL acetyl chloride and heated at reflux for 2 h. The volatiles were removed under vacuum and the residue was purified by flash chromatography (S1O2; 0-40% ethyl acetate in hexanes) to provide 30 mg of the title compound plus 60 mg of title compound that was still protected by the TIPS group on the indole nitrogen. The TIPS dérivative was dissolved in 5 mL dry THF, treated with tetrabutylammonium fluoride hydrate (140 mg, 0.5 mmol) and stirred for 1 h at 20 °C. The mixture was partitioned between 20 mL ethyl acetate and saturated NaCl. The organic phase was dried (Na2SÛ4) and evaporated. Purification by flash chromatography (SiO2; 0-50% ethyl acetate in hexanes) provided another 30 mg of the title compound as a white solid (60 mg, 16%).
The préparation method used in this example is referred to in Table 10 as “Coupling 7”.
-8117485
Example 8: Methyl 4-amino-3-chIoro-5-fluoro-6-(7-fluoro-127-indol-6-yl)picolinate (Compound No. 1.14)
7-Fluoro-6-(4,4,5,5-tetramethyl-l,3,2-dioxaborolan-2-yl)-l-(triisopropylsilyl)-l/7indole (500 mg, 1.2 mmol), methyl 4-amino-3,6-dichloro-5-fluoropicolinate (290 mg, 1.2 mmol), césium fluoride (360 mg, 2.4 mmol) and bis(triphenylphosphine)palladium(II) chloride (84 mg, 0.12 mmol) were combined in 4 mL of a 1:1 v/v acetonitrile-water mixture and heated at 115 °C for 25 min in a Biotage Initiator microwave reactor. The mixture was partitoned between ethyl acetate and saturated NaCl and the organic phase was dried and evaporated. Purification by flash chromatography (SiO2; eluting with 0-20% ethyl acetate in dichloromethane) provided impure product. The material was purified by flash chromatography again (SiO2; eluting with 0-30% ethyl acetate in hexanes) to provide the title compound as a white solid (220 mg, 52%).
The préparation method used in this example is referred to in Table 10 as “Coupling 8”.
Example 9: Methyl 4-amino-5-fluoro-6-(7-fluoro-117-indol-6-yl)-3-vinylpicolinate (Compound No. 1.17)
7-Fluoro-6-(4,4,5,5-tetramethyl-l,3,2-dioxaborolan-2-yl)-l-(triisopropylsilyl)-l/7indole (320 mg, 0.77 mmol), methyl 4-amino-6-chloro-5-fluoro-3-vinylpicolinate (190 mg,0.84 mmol), sodium carbonate (81 mg, 0.77 mmol) and bis(triphenylphosphine)palladium(II) chloride (54 mg, 0.08 mmol) were combined in 4 mL of a 1:1 v/v acetonitrile-water mixture and heated to 115 °C for 30 min in a Biotage Initiator microwave reactor. The mixture was partitioned between ethyl acetate and water. The organic phase was washed with saturated NaCl, dried (Na2SO4), and evaporated. Purification by flash chromatography (SiO2; eluting with 0-20%
-8217485 ethyl acetate in hexanes) provided 220 mg of the TIPS protected product. This material was dissolved in 10 mL of THF, treated with tetrabutylammonium fluoride hydrate (260 mg, 1.0 mmol) and stirred for 1 h. The mixture was partitioned between saturated NaCl and ethyl acetate. The organic phase was washed with saturated NaCl, dried (Na2SO4), and evaporated. Purification by flash chromatography (SiO2; eluting with 0-20% ethyl acetate in hexanes) provided the title compound as a white solid (100 mg, 37%).
The préparation method used in this example is referred to in Table 10 as “Coupling 9”.
Example 10: Préparation of methyl 4-amino-3-chloro-5-fluoro-6-(7-fluoro-l(triisopropylsilyl)- l/7-indol-6-yl)picoIinate (Compound 1.12)
7-Fluoro-6-(4,4,5,5-tetramethyl-l,3,2-dioxaborolan-2-yl)-l-(triisopropylsilyl)-l//indole (1.0 g, 2.4 mmol), methyl 4-amino-3,6-dichloro-5-fluoropicolinate (630 mg, 2.6 mmol), sodium carbonate (250 mg, 2.4 mmol) and with bis(triphenylphosphine)palladium(II) chloride (170 mg, 0.24 mmol) were combined in 10 mL of 1:1 v/v acetonitrile-water and heated at 110 °C for 30 min in a Biotage Initiator microwave reactor. The mixture was stirred with 30 mL ethyl acetate and 20 mL water and filtered through glass wool to remove dark solids. The organic phase was washed with saturated NaCl, dried (Na2SO4), and evaporated. Purification by flash chromatography (SiO2; eluting with 0-30% ethyl acetate in hexanes) provided the title compound as a white solid (520 mg; 42%).
The préparation method used in this example is referred to in Table 10 as “Coupling 10”.
-8317485
Example 11: Methyl 4-ammo-6-(3-bromobenzo[/>]thiophen-7-yl)-3-chloro-5fluoropicolinate (Compound No. 3.26)
Methyl 4-amino-6-(benzo[ô]thiophen-7-yl)-3-chloro-5-fluoropicolinate (0.500 g,
1.485 mmol) was dissolved in dichloromethane (9.90 mL) and cooled to -5 °C in an acetone bath to which was added a few pièces of dry ice. Bromine (114 pL, 2.227 mmol) was dissolved in dichloromethane (9.90 mL) and added dropwise. The reaction mixture was stirred ovemight, and then partitioned between ethyl acetate and water. The organic phase was dried and concentrated and the product purified by flash chromatography (S1O2; 5-40% ethyl acetate / hexane gradient) followed by a second purification by reverse phase chromatography to provide the title compound as a grey solid (0.278 g, 45%).
Example 12: 4-Amino-3-chloro-5-fluoro-6-(7-fluoro-l//-indol-6-yl)picolinic acid (Compound 1.38)
To a reaction vessel containing methyl 4-amino-3-chloro-5-fluoro-6-(7-fluoro-lHindol-6-yl)picolinate (0.500 g, 1.481 mmol) was added methanol (14.81 mL) and sodium hydroxide (2.96 mL, 5.92 mmol). The reaction mixture was stirred ovemight at RT then acidfied by adding a slight excess of 2 N HCl. The mixture was concentrated and the precipitate that formed was washed with water and dried under vacuum to provide 4-amino-3-chloro-5-fluoro-6(7-fluoro-177-indol-6-yl)picolinic acid (0.400 g, 79% yield) as an off-white solid.
The préparation method used in this example is referred to in Table 10 as “Hydrolysis 1:.
-8417485
Example 13: 4-Amino-6-(benzo[6]thiophen-5-yl)-3,5-dichloropicolinic acid (Compound 3.2)
In a 100 mL round bottom flask, methyl 4-amino-6-(benzo[6]thiophen-5-yl)-3,5dichloropicolinate (210 mg, 0.595 mmol) was dissolved in methanol (2.3 mL), tetrahydrofuran (2.3 mL), and H2O (1.2 mL). Lithium hydroxide hydrate (74.8 mg, 1.784 mmol) was added as a solid. The reaction mixture was stirred at room température until complété. The reaction mixture was concentrated to dryness. The resulting residue was dissolved in H2O (2.0 mL) and 1 N HCl was used to adjust the pH to 3.0, causing a precipitate to form. This suspension was extracted with ethyl acetate (3x15 mL). The organic extracts were combined, washed with saturated NaCl solution, dried (MgSCU), filtered and concentrated. Additional purification of the resulting solid was performed, as needed, using a Teledyne ISCO reverse phase System with a gradient eluent System of acetonitrile and H2O to yield the title compound as a white solid (110 mg, 55%).
The préparation method used in this example is referred to in Table 10 as “Hydrolysis 15 2”.
Table 10. Compound Number, Structure, Appearance, and Préparation Method
Compound Number | Structure | Appear- ance | Préparation Method: | Precursor(s) |
1.01 | nh2 /L· JL· /Oh il N XL· ° Hsc-v ητ | White Powder | Hydrolysis 1 | Compound 1.03 |
-8517485
Compound Number | Structure | Appear- ance | Préparation Method: | Precursor(s) | |||
nh2 | |||||||
F. | Jr c· | ||||||
1.02 | ίΓπ | Λ\/Ο. N γΓ | ch3 | Tan Powder | Coupling 2 | As described | |
HN | 0 | ||||||
nh2 | |||||||
F | Vyc1 | Head B; | |||||
1.03 | J< x<J | X- /G N o | ch3 | White Powder | Coupling 2 | 1-Methyl-1Hindol-5- | |
H3c- | ylboronic acid | ||||||
nh2 | |||||||
F. | yVci | ||||||
1.04 | J-L N Y | ZOH | Tan Powder | Hydrolysis 1 | Compound 1.02 | ||
HN' | 0 | ||||||
nh2 | |||||||
Cl. | Αγ01 | Head H; | |||||
1.05 | X | N 0 | ch3 | Yellow Solid | Coupling 1 | (12/-indol-6yl)boronic acid | |
V | NH | ||||||
nh2 | |||||||
Cl\ | J^XI | ||||||
1.06 | Ji <>L. . N γ | OH | Yellow Solid | Hydrolysis 1 | Compound 1.05 | ||
0 | |||||||
c | —NH |
-8617485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
1.07 | nh2 Ut Λ r il N if CHs 0 V-NH | White Solid | Coupling 9 | Head H |
1.08 | nh2 yx X. Xa f X N Y CH3 XX ° Xnh | Off-White Foam | Coupling 2 | Head B; 177-Indol-6ylboronic acid |
1.09 | nh2 R^Lzi U^- JU /°h il N xx ° Xnh | White Powder | Hydrolysis 1 | Compound 1.08 |
1.10 | nh2 uf5rcl r N CH3 AX o vN r ch3 | Tan Powder | Coupling 2 | Head B; 1 -Methyl-6(4,4,5,5tetramethyl1,3,2dioxaborolan2-yl)-177indole |
1.11 | nh2 FJy=' aAVh AZ 0 Y CH. | Pale Yellow Powder | Hydrolysis 1 | Compound 1.10 |
-8717485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
1.12 | nh2 F-yk/Ci Λ N CH3 V-n XSi(/-Pr)3 | White Solid | Coupling 10 | Head B |
1.13 | nh2 F f-A<ci xA H N [Γ CHs ° \^NH | Off-White Solid | Coupling 4 | Head B; 5-fluoro-6(4,4,5,5tetramethyl1,3,2dioxaborolan2-yl)-17findole |
1.14 | nh2 F Uy Λ/'ν^τοη 0 V- NH | Tan Solid | Hydrolysis 2 | Compound 1.13 |
1.15 | nh2 fyVci /Y >1 /0^ fl N iT CH3 JA 0 'c—NH | White Solid | Coupling 4 | Head B; 7-fluoro-6(4,4,5,5tetramethyl1,3,2dioxaborolan2-yl)-177indole |
1.16 | nh2 f.X=' ^vUf AAf ° v— NH | Tan Solid | Hydrolysis 2 | Compound 1.15 |
-8817485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
1.17 | nh2 ch3 F ° | White Solid | Hydrolysis 1 | Compound 1.20 |
1.18 | nh2 çh2 JL .0^ 1 II N CH3 AA o NH | White Solid | Coupling 9 | Head G |
1.19 | nh2 çh2 Γ¥ν^Τ°η F 0 | Tan Solid | Hydrolysis 1 | Compound 1.18 |
1.20 | nh2 ch3 N<^Jx'°^CH3 AA 0 V^NH | White Solid | Coupling 8 | Head F |
1.21 | nh2 A J\ il N [Γ CHs JU 0 NH | White Solid | Coupling 1 | Head A, (lH-indol-6yl)boronic acid |
-8917485
Compound Number | Structure | Appear- ance | Préparation Method: | Precursor(s) |
1.22 | nh2 JL /OH il N îf AA ° NH | Orange Solid | Hydrolysis 1 | Compound 1.21 |
1.23 | nh2 A/ci J-L A λ il N CHs ° v—NH | White Solid | Coupling 6 | As described |
1.24 | nh2 ίΊ θ' iqLnA°h v—-NH | Yellow Solid | Hydrolysis 2 | Compound 1.23 |
1.25 | nh2 f ACI Â. A <A /0^ l· N lT CH3 AA o Anh | White Solid | Coupling 6 | Head L; 5fluoro-6(4,4,5,5tetramethyl1,3,2dioxaborolan- 2-yl)-l/7indole |
1.26 | nh2 F iiV /'ίΓζ'Τ°Η /// ° AnH | White Solid | Hydrolysis 2 | Compound 1.25 |
-9017485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
1.27 | nh2 F ncl /L Al A\ /°r il N lT CH3 F 0 Anh | White Solid | Coupling 7 | Head K |
1.28 | nh2 H3CvK/CI fl N CH3 AA o Anh | Yellow Powder | Coupling 1 | Head D; (177-indol-6yl)boronic acid |
1.29 | nh2 H3C\A/CI /^ A -A /OH Ci N * Anh | Pale Pink Flaky Solid | Hydrolysis 1 | Compound 1.28 |
1.30 | nh2 A xi i A| n^Y°ch3 AA ° Anh | White Solid | Coupling 1 | Head E |
1.31 | nh2 A /Cl Ί Ay AC<0ch3 0 'Y—N H | Yellow Solid | Coupling 8 | Head E |
-9117485
Compound Number | Structure | Appear- ance | Préparation Method: | Precursor(s) | ||||
nh2 | ch3 | Head C; | ||||||
N jl | 0 | 6-(4,4,5,5tetramethyl- | ||||||
1.32 | f| | N | ~]f ch3 | White Solid | Coupling 4 | 1,3,2dioxaborolan- | ||
v | NH | 0 | 2-yl)-177indole | |||||
nh2 | O | |||||||
N | ch3 | |||||||
1.33 | N | Ύχοη | Yellow Solid | Hydrolysis 2 | Compound 1.32 | |||
c | 0 | |||||||
—NH | ||||||||
nh2 | o | Head C; 7-fluoro-6- | ||||||
N | ch3 | (4,4,5,5- | ||||||
J! | ..CL | tetramethyl- | ||||||
1.34 | îî | N | Y ch3 | White Solid | Coupling 4 | 1,3,2- | ||
0 | dioxaborolan- | |||||||
v | F | 2-yl)-177- | ||||||
NH | indole | |||||||
nh2 | n | |||||||
N'^A | < ch3 | |||||||
1.35 | N | \zOH | Yellow Solid | Hydrolysis 2 | Compound 1.34 | |||
c | F | 0 | ||||||
—NH | ||||||||
nh2 | o | Head C; 5-fluoro-6- | ||||||
F | N | ch3 | (4,4,5,5- | |||||
1.36 | 1 | \ -Α- Ν | ch3 | White Solid | Coupling 4 | tetramethyl- 1,3,2- | ||
1! | o | dioxaborolan- | ||||||
v. | 2-yl)-177- | |||||||
-NH | indole |
-9217485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) | |
nh2 | |||||
F | A N CH3 | ||||
1.37 | (Γι' | A A .OH N ]< | Yellow Solid | Hydrolysis 2 | Compound 1.36 |
0 | |||||
V-nh | |||||
nh2 ch2 | |||||
1.38 | yzz | ^/γ%Η3 | Tan Solid | Coupling 8 | HeadP |
A-NH | 0 F | ||||
nh2 ch2 r il | |||||
nAZ | |||||
1.39 | A <A /OH | White Solid | Hydrolysis 1 | Compound 1.38 | |
/A^ V-NH | k o F | ||||
nh2 | Head B; | ||||
1.40 | R | fl 01 ^Ν<>γχ0^ΟΗ3 | White Solid | Coupling 1 | 4-(4,4,5,5tetramethyl1,3,2dioxaborolan- |
AA\ HN—-V | O | 2-yl)-17Z- indole | |||
1.41 | F^ | nh2 Uy Cl A <A /0^ N ]< CH3 | White Solid | Coupling 1 | Head B; l-methyl-4(4,4,5,5tetramethyl1,3,2- |
AA\ | 0 | dioxaborolan- | |||
M h3c | 2-yl)-lÆ- indole |
-9317485
Compound Number | Structure | Appear- ance | Préparation Method: | Precursor(s) | |||
nh2 | |||||||
'ϊΓί' | /Cl | ||||||
1.42 | AL xY N | V/0H | Off-White Solid | Hydrolysis 1 | Compound 1.41 | ||
0 | |||||||
U / | |||||||
H3C | |||||||
nh9 | Head B; | ||||||
R | XI | 7-chloro-4- | |||||
NI | (4,4,5,5- | ||||||
Jt Λ | /0^ | tetramethyl- | |||||
1.43 | N | '-'Ηβ | White Solid | Coupling 4 | 1,3,2- | ||
Cl | 0 | dioxaborolan- | |||||
A // | 2-yl)-177- | ||||||
HN— | indole | ||||||
Head L; 7- | |||||||
nh2 | chloro-4- | ||||||
XI | (4,4,5,5- | ||||||
1.44 | C X N | x^ Y ch3 | Off-White Solid | Coupling 6 | tetramethyl- 1,3,2- | ||
1 1 | dioxaborolan- | ||||||
Cl | X\<X\ HN— | 0 | 2-yl)-17/- | ||||
indole | |||||||
Head C; | |||||||
nh2 | 7-chloro-4- | ||||||
N'X | X^ ch3 | (4,4,5,5- | |||||
1.45 | a X N | >< ch3 | Off-White Solid | Coupling 4 | tetramethyl- 1,3,2- | ||
dioxaborolan- | |||||||
Cl | HN— | 0 | 2-yl)-177- | ||||
indole | |||||||
NH2 | Head B; | ||||||
XI | 4-chloro-7- | ||||||
(4,4,5,5- | |||||||
/0- | tetramethyl- | ||||||
1.46 | N | Y ch3 | White Solid | Coupling 4 | 1,3,2- | ||
Cl | /A | 0 | dioxaborolan- | ||||
Ύ NH | 2-yl)-lZ7- | ||||||
indole |
-9417485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) | ||||
nh2 | Head B; | |||||||
R | 7-(4,4,5,5- | |||||||
Off-White | tetramethyl- | |||||||
1.47 | \ <A N [i | XO | ''CH·, | Solid | Coupling 1 | 1,3,2- | ||
V» IJ | dioxaborolan- | |||||||
0 NH | 2-yl)-lÆ- | |||||||
indole | ||||||||
nh2 | ||||||||
F, | yA | Cl | ||||||
1.48 | xk. -ixk^ N | ,OH | Tan Solid | Hydrolysis 1 | Compound 1.47 | |||
AA | 0 | |||||||
\ - | NH | |||||||
nh2 | Cl | Head L; 4chloro-7- | ||||||
ΑΥκ | (4,4,5,5- | |||||||
1.49 | Cl | A | xA> A< N | 0 | CK ch3 | Off-White Solid | Coupling 6 | tetramethyl - 1,3,2dioxaborolan- |
NH | 2-yl)-177- | |||||||
indole | ||||||||
nh2 | XL | Head C; 4-chloro-7- | ||||||
nA | ch3 | (4,4,5,5- | ||||||
1.50 | iPi | A A N | -CK ch3 | Off-White Solid | Coupling 4 | tetramethyl- 1,3,2- | ||
Cl | AA | 0 | dioxaborolan- | |||||
NH | 2-yl)-ltt- | |||||||
indole | ||||||||
nh2 | ||||||||
F. | A | Cl | CK ch3 | Head B; 2(benzofuran-5- | ||||
2.01 | /¾. | xL> xK N | Yellow | 134 | yl)-4,4,5,5- | |||
1 | 0 | Solid | tetramethyl- | |||||
o' | AA | 1,3,2- | ||||||
z=J | dioxaborolane |
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) | |||
nh2 | |||||||
V\ | Cl | ||||||
2.02 | ζ J N | OH | White Solid | Hydrolysis 1 | Compound 2.01 | ||
0 | |||||||
0 / | |||||||
nh2 | |||||||
2.03 | .Cl 0 | Yellow Solid | Coupling 1 | Head L; benzofuran-5- | |||
CQ | N | 0 | xCH3 | ylboronic acid | |||
nh2 | Head A; 2-(6- | ||||||
F < | Cl | fluorobenzofur | |||||
2.04 | I fi ilT | /À N | 0 | ch3 | Off-White Solid | Coupling 1 | an-5-yl)- 4,4,5,5- |
0 | tetramethyl- | ||||||
0 / | 1,3,2- | ||||||
dioxaborolane | |||||||
nh2 | çh3 | Head C; 2-(6- | |||||
F < | A/ | .0 | fluorobenzofur | ||||
1 I | 0 | an-5-yl)- | |||||
2.05 | N | ΌΗ·> | White Solid | Coupling 1 | 4,4,5,5- | ||
fi T | 0 | tetramethyl- | |||||
0 / | 1,3,2- | ||||||
dioxaborolane | |||||||
nh2 | çh3 ,0 | ||||||
N | |||||||
Jl | 0 | Lt Yellow | Head C; | ||||
2.06 | N | ch3 | Oil At | Coupling 1 | benzofuran-5- | ||
jJ | 0 | Room Temp | boronic acid | ||||
o | |||||||
-9617485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
2.07 | nh2 FXfcl /^ Ul A il N if ch3 ° | White Solid | 134 | Head B; 2(benzofuran-6- yl)-4,4,5,5tetramethyl1,3,2dioxaborolane |
2.08 | nh2 X X /OH N if /X 0 Vo | Off-White Solid | Hydrolysis 1 | Compound 2.07 |
2.09 | nh2 Cl /^ /A U\ X il N if CH3 J'/f O V— O | Light Yellow Solid | Coupling 1 | Head B; 2-(7fluorobenzofur an-6-yl)4,4,5,5tetramethyl1,3,2dioxaborolane |
2.10 | nh2 F Xf01 /V /Λ x [f^y N [f ch3 ° | White Solid | Coupling 1 | Head B; 2-(5fluorobenzofur an-6-yl)- 4,4,5,5tetramethyl1,3,2dioxaborolane |
2.11 | nh2 /L^c| /<\ UL /Οχ. r il N if Ch*3 0 | Off-White Solid | Coupling 1 | Head A; 2-(7fluorobenzofur an-6-yl)4,4,5,5tetramethyl1,3,2dioxaborolane |
-9717485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
2.12 | nh2 F A^ci JL 1 II N 1Γ CHs \/ 0 | Beige Solid | Coupling 1 | Head A; 2-(5fluorobenzofur an-6-yl)4,4,5,5tetramethyl1,3,2dioxaborolane |
2.13 | nh2 ch3 nzK/O N^Y°^CH3 AAf ° U | White Solid | Coupling 1 | Head C; 2-(7fluorobenzofur an-6-yl)4,4,5,5tetramethyl1,3,2dioxaborolane |
2.14 | nh2 ch3 J^ /0 F N J^ JL r il N CH3 A^J 0 v<T | Off-White Solid | Coupling 1 | Head C; 2-(5fluorobenzofur an-6-yl)4,4,5,5tetramethyl1,3,2dioxaborolane |
2.15 | nh2 br><0^CH3 ° | White Solid | Coupling 5 | Head B; 2- (benzofuran-4- yl)-4,4,5,5tetramethyl1,3,2dioxaborolane |
2.16 | nh2 FWCI A zU Il N if CH3 c, JLîJx 0 o*-!] | White Solid | Coupling 5 | Head B; 2-(7chlorobenzofor an-4-yl)-5,5dimethyl-1,3,2dioxaborinane |
-9817485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
2.17 | nh2 Ογ<=1 Cï N ÏÏ°H \/ ° | Tan Solid | Hydrolysis 1 | Compound 2.15 |
2.18 | nh2 F^X,CI /^. /-U J-L /OH H N 1Γ X 0 o^/ | Off-White Solid | Hydrolysis 1 | Compound 2.16 |
2.19 | nh2 X/d XK il N CH3 /XX 0 CIQ 0-^ | Light Yellow Solid | Coupling 5 | Head M; 2-(7chlorobenzofur an-4-yl)-5,5dimethyl-1,3,2dioxaborinane |
2.20 | nh2 X /θ1 1 Νάγ°χΟΗ3 JL 0 CIO 0-v | Tan Solid | Coupling 5 | Head E; 2-(7chlorobenzofur an-4-yl)-5,5dimethyl-1,3,2dioxaborinane |
2.21 | nh2 X z0-, n ch3 N ï JL zX o ci'\X o-y | Tan Solid | Coupling 5 | Head C; 2-(7chlorobenzofur an-4-yl)-5,5dimethyl-1,3,2dioxaborinane |
-9917485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
2.22 | nh2 A |< CH3 /ïx /X X /OH [Γη N X JL o O-A | Tan Solid | Hydrolysis 1 | Compound 2.21 |
2.23 | nh2 X /Cl rAyy /^ /X X /OH |f η N Y JL/Y o °'^ΧΧ Ο—V | Tan Solid | Hydrolysis 1 | Compound 2.20 |
2.24 | nh2 Ύ^Τ /ïx X A /Οχ JY N Y CH3 JL J 0 a y \ | Off-White Solid | Coupling 1 | Head B; 2-(4chlorobenzofur an-7-yl)4,4,5,5tetramethyl1,3,2dioxaborolane |
2.25 | nh2 /X A -iX /Ox J YNY CH3 JLX\ 0 cr yX | Off-White Solid | Coupling 1 | Head A; 2-(4chlorobenzofur an-7-yl)4,4,5,5tetramethyl1,3,2dioxaborolane |
2.26 | nh2 ch3 nXa0 n^y°-ch3 JLX\ o cr yxo | Off-White Solid | Coupling 1 | Head C; 2-(4chlorobenzofur an-7-yl)4,4,5,5tetramethyl1,3,2dioxaborolane |
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) | ||||
nh2 | Head H; 2- | |||||||
Ck | Cl | (benzo[ô]thiop | ||||||
L | hen-5-yl)- | |||||||
3.01 | N | /0^ >< CH. | White Solid | Coupling 4 | 4,4,5,5- | |||
ί | .o | tetramethyl- | ||||||
0 | 1,3,2- | |||||||
dioxaborolane | ||||||||
nh2 | Head H; 2- | |||||||
Ck | .ci | (benzo[6]thiop | ||||||
OH | hen-5-yl)- | |||||||
3.02 | N | White Solid | Hydrolysis 2 | 4,4,5,5tetramethyl- | ||||
-/R | 0 | 1,3,2- | ||||||
sz | dioxaborolane | |||||||
NH2 | ||||||||
R | Ak- | .Cl | Head B; 2(benzo[6]thiop | |||||
L | 0 | hen-5-yl)- | ||||||
3.03 | f| | N | ch3 | White Solid | Coupling 2 | 4,4,5,5- | ||
II | /R | 0 | tetramethyl- | |||||
sz | 1,3,2- | |||||||
dioxaborolane | ||||||||
NH; | ? | |||||||
F. | Cl | |||||||
3.04 | JL N | O | .OH | Tan Solid | Hydrolysis 1 | Compound 3.03 | ||
sz | ||||||||
nh2 | .Cl | Head L; 2(benzo[ô]thiop | ||||||
3.05 | s | V | ÔC N | 0 0 | ch3 | Yellow Solid | Coupling 1 | hen-5-yl)- 4,4,5,5tetramethyl- |
ez | 1,3,2- | |||||||
dioxaborolane |
-10117485
Compound Number | Structure | Appear- ance | Préparation Method: | Precursor(s) |
3.06 | nh2 H3C\^V/CI J-L il N lT CH3 XJ 0 S / | Off-White Solid | Coupling 1 | Head D; 2(benzo[ô]thiop hen-5-yl)4,4,5,5tetramethyl1,3,2dioxaborolane |
3.07 | nh2 H3C^%v/CI /^ X /OH ί| η N Y AJ 0 S / | Off-White Solid | Hydrolysis 1 | Compound 3.06 |
3.08 | nh2 ch3 n<^<°''ch3 0 s / | White Solid | Coupling 4 | Head C; 2(benzo[ô]thiop hen-5-yl)4,4,5,5tetramethyl1,3,2dioxaborolane |
3.09 | nh2 ch3 ΓΥΥγ 0Η J../J 0 s / | White Solid | Hydrolysis 2 | Compound 3.08 |
3.10 | nh2 α^Αχι /^ /Λ <A /0^ il N îT CHs ° | White Solid | Coupling 1 | Head H; 2(benzo[6]thiop hen-6-yl)4,4,5,5tetramethyl1,3,2dioxaborolane |
Compound Number | Structure | Appear- ance | Préparation Method: | Precursor(s) | ||
Cl\ | nh2 | /Cl | ||||
TiX | ||||||
3.11 | Y A N | a^0H | Yellow Solid | Hydrolysis 1 | Compound 3.10 | |
/JJ | 0 | |||||
AI | ||||||
nh2 | ||||||
F. | Cl | Head B; 2- | ||||
3.12 | AR/ /JJ | . <îY N | /A ch3 0 | Light Yellow Solid | Coupling 5 | (benzothiophen -6-yl)-4,4,5,5tetramethyl1,3,2- |
AI | dioxaborolane | |||||
nh2 | ||||||
Fx | Cl | |||||
3.13 | At | J- N | JjDH | Tan Solid | Hydrolysis 1 | Compound 3.12 |
II 1 | 0 | |||||
at | ||||||
nh2 | Head B; 2-(5- | |||||
F. F T'' | Cl | fluorobenzothi | ||||
-C/ Ά CH-î | Light | ophen-6-yl)- | ||||
3.14 | i|Yf | N | Yellow | Coupling 1 | 4,4,5,5- | |
ÂJ | 0 | Solid | tetramethyl- 1,3,2- | |||
AI | dioxaborolane | |||||
nh2 | ,CI | Head A; 2- | ||||
A/ | (benzo[ô]thiop | |||||
3.15 | N | O / o ΞΕ ω | Off-White Brittle Solid | Coupling 1 | hen-6-yl)- 4,4,5,5- | |
/JJ | 0 | tetramethyl- | ||||
AI | 1,3,2- | |||||
dioxaborolane |
-10317485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) | ||
nh2 | ||||||
fi^l | /Cl | |||||
3.16 | \ <> N | ..OH | White Solid | Hydrolysis 1 | Compound 3.15 | |
0 | ||||||
U | ||||||
nh2 | Cl | Head A; 2-(5- | ||||
F (i | A/ | fluorobenzothi | ||||
JL JI | ophen-6-yl)- | |||||
3.17 | il | N | 'jf ch3 | White Solid | Coupling 1 | 4,4,5,5- |
0 | tetramethyl- | |||||
il | 1,3,2- | |||||
dioxaborolane | ||||||
NH? | ||||||
H3c | Cl | Head D; 2(benzo[6]thiop | ||||
3.18 | <>k N | 'jf ch3 | Yellow Solid | Coupling 1 | hen-6-yl)- 4,4,5,5- | |
0 | tetramethyl- | |||||
vl | 1,3,2- | |||||
dioxaborolane | ||||||
NH; | ||||||
h3cx | ïl^ | Cl | ||||
3.19 | k O N | L.oh | Off-White Solid | Hydrolysis 1 | Compound 3.18 | |
0 | ||||||
vl | ||||||
nh2 | Head C; 2- | |||||
N | Αγ- | .0^ CHo | (benzo[è]thiop | |||
3.20 | jl ίΤ^ι' A/J | ^>k 'N | Y ch3 0 | Light Yellow Solid | Coupling 4 | hen-6-yl)- 4,4,5,5tetramethyl1,3,2- |
vl | dioxaborolane |
-10417485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
3.21 | nh2 ch3 pAV AA ° tr | White Solid | Hydrolysis 2 | Compound 3.20 |
3.22 | nh2 F | CHs ΛΑ ° VsT | Off-White Solid | Coupling 1 | Head C; 2-(5fluorobenzothi ophen-6-yl)4,4,5,5tetramethyl1,3,2dioxaborolane |
3.23 | nh2 F\xAxCI A -A il N [Γ CHs 0 | White Solid | Coupling 1 | Head B; benzo[è]thioph en-4-ylboronic acid |
3.24 | nh2 aS^ A -A .0^ p N >¥ CH3 AA 0 \ S | Whjte Solid | Coupling 1 | Head B; benzo[à]thioph en-7-ylboronic acid |
3.25 | nh2 fAA0H ° \ s | White Solid | Hydrolysis 1 | Compound 3.24 |
-10517485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
3.26 | nh2 >L /Ox ί| N CH3 0 \ S Br | Grey Solid | 140 | As described |
3.27 | nh2 S r^V0' \ A». J^· JL Il N |T CHs Ly 0 | Yellow Oil | Coupling 1 | Head L; benzo[b]thioph en-7-ylboronic acid |
4.01 | nh2 ΥγΙχι YOY Il N [T CH3 JLxJ 0 HN J N=^ | White Powder | Coupling 2 | Head B; l/7-Indazol-5ylboronic acid |
4.02 | nh2 Fyk/Ci Γύ N π H JL ° HN Y | White Powder | Hydrolysis 1 | Compound 4.01 |
4.03 | nh2 FWCI /k J-L /Ox || Y N Y CH3 Jl J ° Η3ο~Νγγ N=^ | White Powder | Coupling 2 | Head B; 1-Methyl-1/7indazol-5ylboronic acid |
-10617485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
4.04 | nh2 /. A JC /OH HsC-nJt ÏA | White Powder | Hydrolysis 1 | Compound 4.03 |
4.05 | nh2 FAa /^/A A/°H N lT CHs AA ° n^nh | White Powder | Coupling 2 | Head B; 177-Indazol-6ylboronic acid |
4.06 | nh2 F<UyCI Ci N koh JJ ° N-NH | Off-White Powder | Hydrolysis 1 | Compound 4.05 |
4.07 | nh2 /<^ A A /0^ il N [T CHa AA ° N-Nx ch3 | White Powder | Coupling 2 | Head B; 1 -Methyl-177indazol-6ylboronic acid |
4.08 | nh2 F^^CI /^ A- A /OH fl 1^ N AA 0 N-N ch3 | White Powder | Hydrolysis 1 | Compound 4.07 |
-10717485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) | ||
nh2 | /Cl | |||||
ij | Head A, | |||||
4.09 | . N | V. /O\ Y ch3 | White Solid | Coupling 1 | (177-indazol-6yl)boronic acid | |
/AA | 0 | |||||
v / n-nh | ||||||
nh2 | Head B; | |||||
R | .Cl | l-methyl-4- | ||||
η | «4,5,5- | |||||
tetramethyl- | ||||||
4.10 | il A | N | [| CH3 | Solid | Coupling 1 | 1,3,2- |
0 | dioxabor°lan- | |||||
λ /? | 2-yl)-lH- | |||||
n-n | indazole | |||||
h3c | ||||||
NH | 2 | |||||
Cl | ||||||
4.11 | IL z N | I OH | Off-White Solid | Hydrolysis 1 | Compound 4.10 | |
AA\ | o | |||||
\ Il | ||||||
n—n | ||||||
h3cz | ||||||
nh2 | ||||||
F\. | Ί | Cl | Head B; | |||
4.12 | N | ch3 | White Solid | Coupling 1 | 12Z-indazol-4ylboronic acid | |
AA. | o | |||||
\ U | ||||||
HN—N | ||||||
nh2 | ||||||
Head B; | ||||||
F\. | Ά/ | .Cl | 7-(4,4,5,5tetramethyl- | |||
4.13 | N | Ί< ch3 | White Solid | Coupling 1 | 1,3,2- | |
dioxaborolan- | ||||||
k/\ \ NH | 0 | 2-yl)-177- | ||||
\ ! | indazole | |||||
^N |
-10817485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
5.01 | nh2 fX/X/ci Ut U\ f ΎΝΥ CH3 XX ° 0 / \^N | Off White Solid | Coupling 5 | Head B; benzooxazole5-boronic acid pinacol ester |
6.01 | nh2 urSt i| N if CH3 \^N | Light Brown Solid | Coupling 3 | As described |
6.02 | nh2 FyVcl ίπΛΝ<τ0Η XX ° s / | Light Brown Solid | Hydrolysis 1 | Compound 6.01 |
7.01 | nh2 Ut^Uf [| Y N Y CH3 XX ° N / '^-NH | Off-White Powder | Coupling 2 | Head B; 6-(4,4,5,5Tetramethyl1,3,2dioxaborolan2-yl)-177benzo[i7]imida zole |
7.02 | nh2 faU\zci X- X JA Π N if CH3 XX ° N J \Zn xch3 | White Powder | Coupling 2 | Head B; l-Methyl-177benzofc/Jimida zol-6-ylboronic acid |
-10917485
Compound Number | Structure | Appearance | Préparation Method: | Precursor(s) |
7.03 | nh2 fAtci Λ7 ° N / N xch3 | White Powder | Hydrolysis 1 | Compound 7.02 |
8.01 | nh2 fyVci /A X/ h3c N [Γ ch3 h3c A\ t N-0 | Yellow Solid | Coupling 1 | Head B; ΛζΎ-dimethyl6-(4,4,5,5tetramethyl1,3,2dioxaborolan2yl)benzo[c?]iso xazol-3-amine |
9.01 | nh2 N /J Λ n ch3 N II 3 ° H | White Solid | Coupling 7 | Head K; 6-bromo-177benzo[i/][l,2,3] triazole |
Table 11. Analytical Data for Compounds in Table 1
C. No. | MP (°C) | ’hnmr |
1.01 | 166- 168 | ‘h NMR (300 MHz, DMSO-î76) δ 8.06 (s, 1H), 7.67 (br d, J= 8 Hz, 1H), 7.53 (d, J= 8 Hz, 1H), 7.39 (d, J= 3 Hz, 1H), 6.77 (br s, 2H), 6.54 (d, J= 3 Hz, 1H), 3.83 (s, 3H) |
1.02 | 221- 224 | *H NMR (300 MHz, DMSO-î76) δ 8.04 (s, 1H), 7.59 (dt, J= 7, 1.5 Hz, 1H), 7.48 (d, J= 7 Hz, 1H), 7.41 (t, J= 3 Hz, 1H), 6.85 (br s, 2H), 6.54 (m, 1H), 3.89 (s, 3H) |
1.03 | 125- 127 | ’H NMR (300 MHz, DMSO-î76) δ 8.21 (s, 1H), 7.82 (dt, J = 9, 1.5 Hz, 1H), 7.39 (d, J= 9 Hz, 1H), 7.08 (d, J= 3 Hz, 1H), 6.56 (d, J= 3 Hz, 1H), 4.84 (br s, 2H), 3.99 (s, 3H), 3.82 (s, 3H) |
1.04 | 180- 182 | !H NMR (300 MHz, DMSO-î/6) δ 11.26 (br s, 1H), 8.05 (s, 1H), 7.61 (dt, J |
-110J
C. No. | MP (°C) | *HNMR |
= 9, 1.5 Hz, 1H), 7.48 (d, J= 9 Hz, 1H), 7.41 (t, J= 3 Hz, 1H), 7.67 (br s, 2H), 6.54 (m, 1H) | ||
1.05 | 174- 179 | ‘H NMR (400 MHz, CDC13) δ 8.50 (s, 1H), 7.65 (d, J= 8.2 Hz, 2H), 7.40 (dd, .7=8.3,1.4 Hz, 1H), 7.23 - 7.17 (m, 1H), 6.54 - 6.48 (m, 1H), 5.30 (d, J= 3.9 Hz, 2H), 3.94 (s, 3H) |
1.06 | 160- 164 | *H NMR (400 MHz, DMSO-î/6) δ 13.64 (s, 1H), 11.26 (s, 1H), 7.67 - 7.63 (m, 1H), 7.60 (d, J= 8.3 Hz, 1H), 7.48 - 7.41 (m, 1H), 7.25 (dd, J= 8.2, 1.5 Hz, 1H), 6.89 (s, 2H), 6.48 (dd, .7=2.5, 1.5 Hz, 1H) |
1.07 | 185- 190 | ’H NMR (400 MHz, DMSO-î/6) δ 11.79 (s, 1H), 7.94 (s, 2H), 7.55 (m, 1H), 7.52 (m, 1H), 7.40 (d, J= 8.4 Hz, 1H), 6.55 (m, 1H), 3.93 (s, 3H). 19F NMR (376 MHz, DMSO-J6) δ -132.43. ESIMS m/z 321 [(M+H)+], |
1.08 | 66-69 | ’H NMR (300 MHz, CDC13) δ 8.31 (br s, 1H), 8.02 (s, 1H), 7.71 (s, 2H), 7.29 (t, J= 3 Hz, 1H), 6.58 (m, 1H), 4.86 (br s, 2H), 3.99 (s, 3H) |
1.09 | 138- 140 | ’H NMR (300 MHz, DMSO-îZ6) δ 7.95 (s, 1H), 7.63 (d, J = 8 Hz, 1H), 7.54 (dt, J = 8, 2 Hz, 1H), 7.47 (t, J= 3 Hz, 1H), 6.79 (br s, 2H), 6.48 (m, 1H) |
1.10 | 116- 119 | *H NMR (400 MHz, CDC13) δ 7.94 (t, J = 1 Hz, 1H), 7.69 (br s, 2H), 7.13 (d, J= 3 Hz, 1H), 6.50 (dd, J = 3, 1 Hz, 1H), 4.85 (br s, 2H), 3.99 (s, 3H), 3.84 (s, 3H) |
1.11 | 173- 176 | ’H NMR (400 MHz, DMSO-îZ6) δ 7.93 (s, 1H), 7.66 (d, J= 8.5 Hz, 1H), 7.59 (d, J= 8.5 Hz, 1H), 7.46 (d, J= 3 Hz, 1H), 6.50 (d, J= 3 Hz, 1H), 6.37 (br s, 2H),3.87 (s, 3H) |
1.12 | 181- 182 | ’H NMR (400 MHz, CDCI3) δ 7.49 (d, J= 8.1 Hz, 1H), 7.40 (d, J= 3.2 Hz, 1H), 7.29 (dd, J= 8.1, 5.9 Hz, 1H), 4.90 (s, 2H), 3.98 (s, 3H), 1.68 (m, 3H), 1.14 (d, J= 7.6 Hz, 18H). 19FNMR(376 MHz, CDCI3) δ-124.55, 124.65, -136.90, -137.00. ESIMS m/z 492 [(M-H)']. |
1.13 | ‘H NMR (DMSO-i/g) δ 3.88 (s, 3H), 6.49 (ddd, J = 2.9, 1.9, 0.8 Hz, 1H), 6.96 (s, 2H), 7.43 (d, J = 11.1 Hz, 1H), 7.50 (d, J = 6.0 Hz, 1H), 7.54 (t, J = 2.8 Hz, 1H), 11.32 (s, 1H) | |
1.14 | ’H NMR (DMSO-Jô) δ 6.46 - 6.52 (m, 1H), 6.88 (s, 2H), 7.42 (d, J = 11.1 Hz, 1H), 7.49 - 7.56 (m, 2H), 11.33 (s, 1H), 13.56 (s, 1H) | |
1.15 | *H NMR (DMSO-c/ô) δ 3.88 (s, 3H), 6.59 (td, J = 3.2, 1.9 Hz, 1H), 6.99 (s, 2H), 7.08 (dd, J = 8.2, 6.2 Hz, 1H), 7.47 (d, J = 8.2 Hz, 1H), 7.52 (t, J = 2.8 Hz, 1H), 11.82 (t, J =2.2 Hz, 1H) | |
1.16 | ’HNMR (DMSO-îZ6) Ô 6.59 (td, J = 3.2,1.9 Hz, 1H), 6.90 (s, 2H), 7.10 (dd, J = 8.2, 6.2 Hz, 1H), 7.47 (d, J = 8.1 Hz, 1H), 7.51 (t, J = 2.8 Hz, 1H), 11.81 (s, 1H), 13.57 (s, 1H) |
-11117485
C. No. | MP (°C) | ‘H NMR |
1.17 | 133- 140 | 'H NMR (400 MHz, DMSO-J6) δ 11.76 (s, 1H), 7.49 (dd, J= 3.0, 2.5 Hz, 1H), 7.44 (d, J= 7.9 Hz, 1H), 7.09 (dd, J= 8.2, 6.2 Hz, 1H), 6.57 (td, J= 3.3, 1.9 Hz, 1H), 6.41 (s, 2H), 3.80 (s, 3H). 19F NMR (376 MHz, DMSOJ6) δ -134.66, -134.73. ESIMS m/z 320 [(M+H)+J. |
1.18 | 164- 166 | *H NMR (400 MHz, CDC13) δ 8.45 (s, 1H), 7.49 (dd, J= 8.2, 0.8 Hz, 1H), 7.35-7.28 (m, 2H), 6.94 (dd,J=18.1,11.5 Hz, 1H), 6.61 (td, J= 3.4, 2.1 Hz, 1 H), 5.72 (dd, J= 11.5, 1.5 Hz, 1 H), 5.60 (dd, J= 18.1,1.5 Hz, 1H), 4.72 (s, 2H), 3.91 (s, 2H). 19F NMR (376 MHz, CDC13) δ -135.79, -135.87, -140.98, -141.07. ESIMS m/z 330 [(M+H)+], |
1.19 | *H NMR (400 MHz, DMSO-î/6) δ 11.76 (d, J= 16.4 Hz, 1H), 7.48 (m, 1H), 7.11 (dd,J=8.2, 6.2 Hz, 1H), 6.79 (dd, J= 17.8, 11.5 Hz, 1H), 6.58 (dd, J= 5.1, 3.2 Hz, 1H), 6.38 (s, 1H), 5.56 (m, 1H). 19FNMR (376 MHz, DMSO-Jô) δ -134.07, -134.15, -143.26, -143.34. ESIMS m/z 316 [(M+H)+]. | |
1.20 | 203- 205 | ’H NMR (400 MHz, DMSO-J6) δ 11.76 (s, 1H), 7.49 (dd, J= 6.0, 3.3 Hz, 1H), 7.44 (d, J= 8.2 Hz, 1H), 7.05 (dd, J= 8.1, 6.3 Hz, 1H), 6.57 (m, 1H), 6.49 (s, 2H), 3.84 (s, 3H), 3.79 (s, 3H). 19F NMR (376 MHz, DMSO-J6) δ 134.75, -134.82, -138.34, -138.42. ESIMS m/z 334 [(M+H)+]. |
1.21 | 83-85 | 'H NMR (400 MHz, DMSOX) δ 11.20 (s, 1H), 8.00 (m, 1H), 7.59 (m, 1H), 7.53 (m, 1H), 7.43 (dd, J= 3.1, 2.4 Hz, 1H), 7.32 (s, 1H), 6.61 (s, 2H), 6.45 (s, 1H), 3.91 (s, 3H) |
1.22 | 172- 174 | *H NMR (400 MHz, DMSO-</6) δ 11.47 (s, 1H), 7.94 (d, J= 1.2 Hz, 1H), 7.67 (d, J= 8.3 Hz, 2H), 7.52 (t, J= 2.8 Hz, 1H), 7.46 (dd, J= 8.4, 1.7 Hz, 1H), 6.51 (t, J= 2.5 Hz, 1H), NaN (m, 2H) |
1.23 | ‘H NMR (DMSO-îZ6) δ 3.89 (s, 3H), 6.54 (td, J = 3.4, 1.9 Hz, 1H), 6.75 (s, 2H), 7.31 (d, J =1.5 Hz, 1H), 7.37-7.52 (m, 3H), 11.76 (s, 1H) | |
1.24 | *H NMR (DMSO-J6) δ 6.50 - 6.62 (m, 1H), 6.71 (s, 2H), 7.27 (d, J = 1.5 Hz, 1H), 7.41 (d, J = 8.3 Hz, 1H), 7.45 - 7.53 (m, 2H), 11.76 (d, J = 2.4 Hz, 1H), 13.48 (s, 1H) | |
1.25 | ’H NMR (DMSO-Jd) δ 3.90 (s, 3H), 6.45 (ddd, J = 2.9, 1.9, 0.9 Hz, 1H), 6.75 (s, 2H), 7.29 (d, J = 1.7 Hz, 1H), 7.40 (d, J = 12.7 Hz, 1H), 7.52 (t, J = 2.8 Hz, 1H), 7.93 (dd, J =6.8, 0.8 Hz, 1H), 11.27 (t, J = 2.3 Hz, 1H) | |
1.26 | ‘H NMR (DMSOX) δ 6.45 (t, J = 2.4 Hz, 1H), 6.68 (s, 2H), 7.24 (d, J = 1.6 Hz, 1H), 7.40 (d, J = 12.8 Hz, 1H), 7.52 (t, J = 2.8 Hz, 1H), 7.95 (d, J = 6.7 Hz, 1H), 11.29 (s, 1H), 13.54 (s, 1H) | |
1.27 | 169- 171 | *H NMR (400 MHz, CDCI3) δ 8.45 (s, 1H), 7.29 (t, J= 2.7 Hz, 1H), 7.16 (d, J= 10.0 Hz, 1H), 6.93 (dd,J= 1.5, 0.8 Hz, 1H), 6.54 (s, 1H), 4.82 (s, 2H), 3.98 (s, 3H). 19F NMR (376 MHz, CDC13) δ -126.04, -135.41. ESIMS |
-11217485
C. No. | MP (°C) | ‘H NMR |
m/z 336 [(Μ-H)']. | ||
1.28 | 231- 234 | ’H NMR (400 MHz, DMSO-J6) δ 11.15 (s, 1H), 7.57 (d, J =8.1 Hz, 1H), 7.42 (dd, J= 6.3, 3.6 Hz, 2H), 7.05 (dd, J= 8.2,1.5 Hz, 1H), 6.47 (dd, J= 2.5, 1.6 Hz, 1H), 6.39 (s, 2H), 3.85 (s, 3H), 2.14 (s, 3H) |
1.29 | 168- 175 | *H NMR (400 MHz, DMSO-J6) δ 11.31 (s, 1H), 7.66 - 7.60 (m, 1H), 7.49 (s, 1H), 7.48 - 7.43 (m, 1H), 7.07 (dt, J= 15.8, 7.9 Hz, 3H), 6.53 - 6.48 (m, lH),2.13(s, 3H) |
1.30 | 240- 242 | ‘H NMR (400 MHz, DMSO-J6) δ 11.33 (s, 1H), 8.37 (s, 1H), 7.96 (dd, J= 8.4, 1.5 Hz, 1H), 7.58 (d, J= 8.4 Hz, 1H), 7.50 (m, 1H), 6.47 (d, J= 1.1 Hz, 1H), 3.94 (s, 3H); ESIMS m/z 303 [(M+H)+J. |
1.31 | 185- 190 | *H NMR (400 MHz, DMSO-î76) δ 11.79 (s, 1H), 7.94 (s, 2H), 7.55 (m, 1H), 7.52 (m, 1H), 7.40 (d, J= 8.4 Hz, 1H), 6.55 (m, 1H), 3.93 (s, 3H). 19F NMR (376 MHz, DMSO-î/6) δ -132.43. ESIMS m/z 321 [(M+H)+], |
1.32 | 190- 191 | ‘H NMR (DMSO-Jé) δ 3.74 (s, 3H), 3.92 (s, 3H), 6.46 (ddd, J = 3.0, 1.9, 0.9 Hz, 1H), 7.27 (s, 2H), 7.46 (t, J = 2.7 Hz, 1H), 7.56 (d, J = 8.4 Hz, 1H), 7.94 (dd, J= 8.4, 1.5 Hz, 1H), 8.33 (d, J = 1.1 Hz, 1H), 11.26 (d, J = 2.3 Hz, 1H). |
1.33 | 154- 157 | 'H NMR (DMSO-d6) δ 3.75 (s, 3H), 6.41 - 6.50 (m, 1H), 7.20 (s, 2H), 7.46 (t, J = 2.7 Hz, 1H), 7.56 (d, J = 8.4 Hz, 1H), 7.96 (dd, J = 8.4, 1.5 Hz, 1H), 8.25 - 8.46 (m, 1H), 11.27 (s, 1H) |
1.34 | ’H NMR (DMSO-Jô) δ 3.75 (s, 3H), 3.90 (s, 3H), 6.53 (td, J = 3.2, 1.9 Hz, 1H), 7.37 (d, J= 8.3 Hz, 3H), 7.44-7.54 (m, 2H), 11.71 (s, 1H) | |
1.35 | ’H NMR (DMSO-Jô) δ 3.77 (s, 3H), 6.53 (td, J = 3.2, 1.9 Hz, 1H), 7.12 - 7.35 (m, 2H), 7.37 (d, J = 8.3 Hz, 1H), 7.46 - 7.58 (m, 2H), 11.72 (t, J = 2.2 Hz, 1H), 13.49 (s, 1H) | |
1.36 | ’H NMR (DMSO-î/6) δ 3.76 (s, 3H), 3.89 (s, 3H), 6.44 (ddd, J = 3.0, 1.8, 0.9 Hz, 1H), 7.32 (d, 7 = 11.9 Hz, 3H), 7.51 (t, J = 2.8 Hz, 1H), 7.85 (d,7 = 6.5 Hz, 1H), 11.30 (s, 1H) | |
1.37 | *H NMR (DMSO-J6) δ 3.75 (s, 3H), 6.43 (ddd, J = 2.9, 1.9, 0.8 Hz, 1H), 7.10 - 7.46 (m, 3H), 7.50 (t, J = 2.7 Hz, 1H), 7.85 (dd, J = 6.4, 0.8 Hz, 1 H), 11.29 (t, J = 2.3 Hz, 1 H), 13.48 (s, 1 H) | |
1.38 | 172- 173 | *H NMR (400 MHz, DMSO-76) δ 11.75 (s, 1H), 7.55 (dd, J= 8.3, 6.7 Hz, 1H), 7.50 (m, 1H), 7.38 (d, J= 8.4 Hz, 1H), 7.21 (s, 1H), 6.67 (dd, J= 17.6, 11.5 Hz, 1H), 6.54 (dd, J= 5.1, 3.2 Hz, 1 H), 5.48 (ddd, J=11.4, 7.3, 1.1 Hz, 1H), 3.83 (s, 1H), 3.33 (s, 1H). 19F NMR (376 MHz, DMSO-J6) δ 132.89. ESIMS m/z 313 [(M+H)+], |
1.39 | 209- | ’H NMR (400 MHz, DMSO-J6) δ 13.51 (s, 1H), 11.75 (s, 1H), 7.56 (m, |
-11317485
C. No. | MP (°C) | ‘hnmr |
211 | 1H), 7.50 (t, J= 2.5 Hz, 1H), 7.38 (d, J= 8.3 Hz, 1H), 7.14 (s, 1H), 6.67 (dd, J= 17.7, 11.5 Hz, 1H), 6.54 (s, 1H), 5.60 (d, J= 17.8 Hz, 1H), 5.49 (d, J= 11.4 Hz, 1H). 19F NMR (376 MHz, DMSO-î/6) δ -132.98. ESIMS m/z 299 [(M+H)+J. | |
1.40 | 233- 236 | ’H NMR (400 MHz, CDC13) δ 8.27 (s, 1H), 7.51 - 7.45 (m, 2H), 7.32 - 7.28 (m, 2H), 6.93 - 6.79 (m, 1H), 4.90 (s, 2H), 3.98 (s, 3H) |
1.41 | 167- 169 | ‘H NMR (400 MHz, CDC13) δ 7.46 (ddd, J= 7.3, 2.1, 0.8 Hz, 1H), 7.41 (d, J= 8.2 Hz, 1H), 7.33 - 7.28 (m, 1H), 7.13 (d, J= 3.1 Hz, 1H), 6.79 - 6.68 (m, 1H), 4.89 (s, 2H), 3.98 (s, 3H), 3.83 (s, 3H) |
1.42 | 158- 160 | ‘H NMR (400 MHz, DMSO-zZ6) δ 7.55 (d, J= 7.5 Hz, 1H), 7.38 (d, J= 3.1 Hz, 1H), 7.32 - 7.22 (m, 2H), 6.77 (s, 2H), 6.50 (t, J= 2.3 Hz, 1H), 3.84 (s, 3H) |
1.43 | *H NMR (DMSO-J6) δ 3.88 (s, 3H), 6.61 (dt, J = 3.1, 2.0 Hz, 1H), 6.95 (s, 2H), 7.22 - 7.35 (m, 2H), 7.49 (t, J = 2.8 Hz, 1H), 11.65 (s, 1H) | |
1.44 | 116 | *H NMR (DMSO-J6) δ 3.91 (s, 3H), 6.74 (s, 2H), 6.97 (dd, J = 3.2, 1.8 Hz, 1H), 7.28 (d, J = 8.0 Hz, 1H), 7.36 (s, 1H), 7.43 (d, J = 8.0 Hz, 1H), 7.54 (t, J = 2.8 Hz, 1 H), 11.65 (s, 1 H) |
1.45 | 226 | ‘H NMR (DMSO-î/ô) δ 3.76 (s, 3H), 3.93 (s, 3H), 7.25 (d, J = 8.1 Hz, 1H), 7.34 (s, 2H), 7.49 (t, J = 2.8 Hz, 1H), 7.59 (dd, J = 3.0, 2.0 Hz, 1H), 7.99 (d, J =8.2 Hz, 1H), 11.55 (s, 1H) |
1.46 | ’H NMR (DMSO-î/ô) δ 3.93 (s, 3H), 6.60 (dd, J = 3.2, 2.0 Hz, 1H), 7.03 (s, 2H), 7.24 (d, J = 8.0 Hz, 1H), 7.50 (dd, J = 8.0, 0.9 Hz, 1H), 7.55 (t, J = 2.8 Hz, 1H), 11.44 (s, 1H) | |
1.47 | 96- 100 | lH NMR (300 MHz, CDC13) δ 11.33 (s, 1H), 7.97 (d, J= 7.7 Hz, 1H), 7.76 (d, J=7.8Hz, 1H), 7.37-7.29 (m, 1H), 7.18 (t,J= 7.7 Hz, 1H), 6.656.55 (m, 1H), 4.83 (s, 2H), 4.03 (s, 3H) |
1.48 | 171- 175 | ’H NMR (400 MHz, DMSO-îZ6) δ 11.12 (s, 1H), 7.68 (d, J = 7.8 Hz, 1H), 7.51 (d, J = 7.4 Hz, 1H), 7.41 (t, J= 2.8 Hz, 1H), 7.13 (t, J= 7.6 Hz, 1H), 6.89 (s, 2H), 6.53 (dd, J = 3.0, 2.1 Hz, 1H) |
1.49 | 186- 188 | ’H NMR (DMSO-îZô) δ 3.96 (s, 3H), 6.57 (dd, J = 3.2, 2.2 Hz, 1H), 6.81 (s, 2H), 7.23 (d, J = 8.0 Hz, 1H), 7.45 (s, 1H), 7.53 (d, J = 8.1 Hz, 1H), 7.55 7.59 (m, 1 H), 11.51 (s, 1H) |
1.50 | 147- 149 | ’H NMR (DMSO-îZ6) δ 3.78 (s, 3H), 3.94 (s, 3H), 6.60 (dd, J = 3.2, 2.2 Hz, 1H), 7.20 (d, J = 8.1 Hz, 1H), 7.29 - 7.88 (m, 3H), 8.09 (d, J = 8.2 Hz, 1 H), 11.75 (s, 1H) |
2.01 | 114- 117 | ’H NMR (400 MHz, CDC13) δ 8.16 (t, J = 1.4 Hz, 1H), 7.87 (dt, J= 8.7, 1.8 Hz, 1H), 7.66 (d, J =2.2 Hz, 1H), 7.61 -7.54 (m, 1H), 6.86-6.81 (m, |
-11417485
C. No. | MP (°C) | ‘H NMR |
1H), 4.90 (s, 2H), 4.00 (s, 3H) | ||
2.02 | 165- 167 | *H NMR (400 MHz, DM S 0-6^) δ 13.60 (s, 1H), 8.13 (s, 1H), 8.07 (d, J= 2.2 Hz, 1H), 7.80 (d, J= 8.7 Hz, 1H), 7.75 - 7.64 (m, 1H), 7.07 (dd, J= 7.9, 6.5 Hz, 1H), 6.88 (s, 2H) |
2.03 | 84-87 | ’H NMR (400 MHz, DMSO-c?6) δ 3.90 (d, J = 3.3 Hz, 3H), 6.75 (d, J = 19.2 Hz, 2H), 6.92 - 8.22 (m, 6H) |
2.04 | 98 | ’H NMR (400 MHz, CDC13) δ 8.19 (d, J= 7.7 Hz, 1H), 7.63 (d, J= 2.2 Hz, 1 H), 7.28 (d, J = 11.2 Hz, 1 H), 7.22 (d, J = 2.0 Hz, 1 H), 6.79 (dd, J= 2.2, 0.9 Hz, 1H), 4.80 (s, 2H), 4.01 (s, 3H) |
2.05 | 160 | ’H NMR (400 MHz, CDC13) δ 8.11 (d, J = 7.4 Hz, 1H), 7.63 (d, J= 22 Hz, 1H), 7.29 (d, J= 10.6 Hz, 1H), 6.78 (dd, J= 2.2, 0.9 Hz, 1H), 5.40 (s, 2H), 4.01 (s, 3H), 3.95 (s, 3H) |
2.06 | ’H NMR (400 MHz, CDCI3) δ 8.20 (dd, J= 7.7, 0.8 Hz, 1H), 7.79 (dd, J= 2.1, 0.9 Hz, 1H), 7.69 (d, J= 2.2 Hz, 1H), 7.62 (d, J= 8.2 Hz, 1H), 6.79 (dd, J = 2.1, 1.0 Hz, 1H), 5.32 (s, 2H), 3.95 (s, 3H), 3.93 (s, 3H) | |
2.07 | ’H NMR (400 MHz, CDCI3) δ 8.10 (s, 1H), 7.88 - 7.83 (m, 1H), 7.70 (t, J = 2.5 Hz, 1H), 7.69-7.66 (m, 1H), 6.81 (dd, J =22, 1.0 Hz, 1H), 4.91 (s, 2H), 4.00 (d,J=1.5 Hz, 3H) | |
2.08 | 168- 170 | ‘H NMR (400 MHz, DMSO-î/6) δ 13.59 (s, 1H), 8.11 (d,J=2.2 Hz, 1H), 8.03 (s, 1H), 7.77 (s, 2H), 7.04 (dd, J= 2.1, 0.9 Hz, 1H), 6.90 (s, 2H) |
2.09 | 151 | ’H NMR (400 MHz, CDC13) δ 7.73 (d, J= 2.1 Hz, 1H), 7.48 - 7.41 (m, 2H), 6.85 (s, 1H), 4.94 (s, 2H), 3.97 (d, J= 5.6 Hz, 3H) |
2.10 | 109 | ’H NMR (400 MHz, CDCI3) δ 7.72 (t, J = 3.3 Hz, 2H), 7.34 (dd, J= 9.5, 5.3 Hz, 1H), 6.79 (dd, J= 22, 0.9 Hz, 1H), 4.93 (s, 2H), 3.98 (s, 3H) |
2.11 | 148 | ’H NMR (400 MHz, CDC13) δ 7.87 (dd, J= 8.2, 6.5 Hz, 1H), 7.71 (d, J = 2.1 Hz, 1H), 7.42 (d, J= 8.2 Hz, 1H), 7.29 (d, J= 1.6 Hz, 1H), 6.82 (dd, J = 3.0, 2.2 Hz, 1H), 4.82 (s, 2H), 4.01 (s, 3H) |
2.12 | 130 | ’H NMR (400 MHz, CDC13) δ 8.15 (d, J = 5.7 Hz, 1H), 7.70 (d, J= 2.2 Hz, 1H), 7.35 - 7.28 (m, 2H), 6.75 (dd, J= 22, 0.9 Hz, 1H), 4.80 (s, 2H), 4.01 (s, 3H) |
2.13 | 178 | ’H NMR (400 MHz, CDC13) δ 7.82 (dd, J= 8.2, 6.3 Hz, 1H), 7.71 (d, J= 2.1 Hz, 1H), 7.39 (d, J= 8.2 Hz, 1H), 6.84 - 6.75 (m, 1H), 5.40 (s, 2H), 4.01 (s, 3H), 3.95 (s, 3H) |
2.14 | 153 | ’H NMR (400 MHz, CDC13) δ 8.06 (d, J= 5.9 Hz, 1H), 7.70 (t, J= 3.4 Hz, 1H), 7.32 (d, J= 10.6 Hz, 1H), 6.75 (dd, J= 22, 0.9 Hz, 1H), 5.39 (s, 2H), 4.01 (s, 3H), 3.96 (s, 3H) |
-11517485
C. No. | MP (°C) | ’HNMR |
2.15 | 100- 103 | !H NMR (400 MHz, CDC13) δ 7.72 - 7.69 (m, 1H), 7.68 - 7.63 (m, 1H), 7.59 (d, J= 8.3 Hz, 1H), 7.42 - 7.36 (m, 1H), 7.20 - 7.15 (m, 1H), 4.94 (s, 2H), 4.00 (d, 7=1.5 Hz, 3H) |
2.16 | 184- 186 | ‘H NMR (400 MHz, CDC13) δ 7.76 (d, J= 2.2 Hz, 1H), 7.61 (dd, J= 8.2, 2.1 Hz, 1H), 7.42 - 7.38 (m, 1H), 7.26 - 7.24 (m, 1H), 4.96 (s, 2H), 4.00 (s, 3H) |
2.17 | 170- 173 | *H NMR (400 MHz, DMSO-76) δ 13.63 (s, 1H), 8.07 (d, J= 22 Hz, 1H), 7.72 (d, J= 8.2 Hz, 1H), 7.57 (d, J= 7.5 Hz, 1H), 7.44 (t, J= 7.9 Hz, 1H), 7.09 (s, 1H), 6.93 (s, 2H) |
2.18 | ‘H NMR (400 MHz, CDC13) δ 7.81 (d, J= 2.3 Hz, 1H), 7.54 (d, J= 8.0 Hz, 2H), 7.45 (d, J= 8.2 Hz, 1H), 6.96 (s, 1H), 5.20 (s, 2H) | |
2.19 | 158- 159 | !H NMR (400 MHz, DMSO-J6) δ 8.24 (d, J= 2.1 Hz, 1H), 7.68 (d, J= 8.2 Hz, 1H), 7.55 (d, J= 8.2 Hz, 1H), 7.50 (d, J= 2.1 Hz, 1H), 7.37 (s, 1H), 6.83 (s, 2H), 3.93 (s, 3H) |
2.20 | *H NMR (400 MHz, CDC13) δ 8.22 (d, J= 8.3 Hz, 1H), 7.79 (dd, J= 12.0, 2.1 Hz, 2H), 7.38 (d, 7 = 8.3 Hz, 1H), 5.61 (s, 2H), 4.05 (s, 3H) | |
2.21 | *H NMR (400 MHz, CDCI3) δ 8.22 - 8.09 (m, 1H), 7.86 (d, J= 2.1 Hz, 1H), 7.77 (d, J= 2.1 Hz, 1H), 7.42 - 7.34 (m, 1H), 5.39 (s, 2H), 4.04 (s, 3H), 3.95 (s, 3H) | |
2.22 | 204- 206 | *H NMR (400 MHz, DMSO-76) δ 8.22 (d, J= 2.1 Hz, 1H), 8.20 (d, J= 8.3 Hz, 1H), 8.00 (d, J= 2.1 Hz, 1H), 7.52 (d, J= 8.3 Hz, 1H), 7.42 (s, 1H), 3.78 (s, 3H) |
2.23 | 173- 174.5 | ’H NMR (400 MHz, CDCI3) δ 7.76 (d, J= 2.2 Hz, 1H), 7.61 (dd, J= 8.2, 2.1 Hz, 1H), 7.42 - 7.38 (m, 1H), 7.26 - 7.24 (m, 1H), 4.96 (s, 2H), 4.00 (s, 3H) |
2.24 | 167 | *H NMR (400 MHz, CDC13) δ 7.68 (d, J= 2.2 Hz, 1H), 7.54 (d, J= 8.1 Hz, 1H), 7.37 - 7.34 (m, 1H), 6.93 (d, J= 22 Hz, 1H), 4.95 (s, 2H), 3.99 (d, J =4.7 Hz, 3H) |
2.25 | 169 | ‘H NMR (400 MHz, CDCI3) δ 8.14 (d, J= 8.2 Hz, 1H), 7.75 (d, J= 10.0 Hz, 2H), 7.34 (d, J= 8.3 Hz, 1H), 6.97 (t, J= 8.0 Hz, 1H), 4.86 (s, 2H), 4.02 (s, 3H) |
2.26 | 178 | 'H NMR (400 MHz, CDC13) δ 8.09 (d, J= 8.2 Hz, 1H), 7.79 (d, J= 2.1 Hz, 1H), 7.32 (d, J= 8.3 Hz, 1H), 6.92 (d, 7= 2.2 Hz, 1H), 5.44 (s, 2H), 4.04 (s, 3H), 3.96 (s, 3H) |
3.01 | 50-56 | ’H NMR (DMSO-76) δ 3.89 (s, 3H), 7.09 (s, 2H), 7.52 - 7.63 (m, 2H), 7.86 (d, 7 = 5.4 Hz, 1H), 8.07-8.17 (m, 2H) |
-11617485
C. No. | MP (°C) | ’hnmr |
3.02 | 157- 159 | ’H NMR (DMSO-fik) δ 6.98 (s, 2H), 7.53 - 7.61 (m, 2H), 7.84 (d, J = 5.5 Hz, 1H), 8.06 - 8.13 (m, 2H), 13.70 (s, 1H) |
3.03 | 84-85 | ’H NMR (400 MHz, DMSO-cZ6) δ 8.34 (s, 1H), 8.12 (d, J= 8.5 Hz, 1H), 7.87 - 7.78 (m, 2H), 7.60 (dd, J= 5.5, 0.6 Hz, 1H), 6.95 (s, 2H), 3.90 (s, 3H) |
3.04 | 149- 150 | ’H NMR (400 MHz, DMSO-î/6) δ 8.36 (s, 1H), 8.11 (d, J= 8.5 Hz, 1H), 7.83 (t, J= 6.1 Hz, 2H), 7.58 (d, J= 5.4 Hz, 1H), 6.71 (s, 2H) |
3.05 | 142- 144 | ‘H NMR (400 MHz, DMSOY6) δ 8.41 (d, J = 1.7 Hz, 1H), 8.11 (d, J = 8.5 Hz, 1H), 7.82 - 7.88 (m, 2H), 7.51 - 7.72 (m, 3H), 7.39 (s, 1H), 3.92 (s, 3H) |
3.06 | 155- 159 | *H NMR (400 MHz, CDC13) δ 7.94 - 7.88 (m, 2H), 7.48 (d, J = 5.4 Hz, 1H), 7.41 (dd, J= 8.3, 1.7 Hz, 1H), 7.36 (dd, J= 5.4, 0.6 Hz, 1H), 4.83 (s, 2H), 3.96 (s, 3H), 2.19 (s, 3H) |
3.07 | 159- 165 | ’H NMR (400 MHz, DMSO-îZ6) δ 8.10 (d, J= 8.3 Hz, 1H), 7.97 (s, 1H), 7.85 (d, J= 5.4 Hz, 1H), 7.54 (d, J= 5.5 Hz, 1H), 7.44 (d, J = 8.3 Hz, 1H), 6.81 (s, 2H), 2.12 (s, 3H) |
3.08 | 125- 127 | ’H NMR (DMSO-Jô) δ 3.76 (s, 3H), 3.92 (s, 3H), 7.40 (s, 2H), 7.60 (dd, J = 5.4, 0.7 Hz, 1H), 7.81 (d, J = 5.4 Hz, 1H), 8.06 (d, J = 8.6 Hz, 1H), 8.24 (dd, J=8.5, 1.7 Hz, 1H), 8.73 (d,J= 1.5 Hz, 1H) |
3.09 | 137- 139 | *H NMR (DMSO-Jtf) δ 3.76 (s, 3H), 7.31 (s, 2H), 7.59 (d, J = 5.4 Hz, 1H), 7.81 (d, J = 5.4 Hz, 1H), 8.06 (d, J = 8.5 Hz, 1H), 8.26 (dd, J = 8.5, 1.7 Hz, 1H), 8.76 (d, J= 1.5 Hz, 1H), 13.54 (s, 1H) |
3.10 | 134- 135 | ’H NMR (400 MHz, CDC13) δ 8.22 - 8.09 (m, 1H), 7.87 (d, J= 8.2 Hz, 1H), 7.66 (dd, <7=8.3,1.6 Hz, 1H), 7.52 (d, J=5.5Hz, 1H), 7.36(dd,J= 5.5, 0.6 Hz, 1H), 5.34 (s, 2H), 3.97 (s, 3H) |
3.11 | 239 (dec) | *H NMR (400 MHz, DMSO-J6) δ 8.22 (d, J= 0.7 Hz, 1H), 7.96 (d, J= 8.2 Hz, 1H), 7.88 (d,J=5.4 Hz, 1H), 7.59 (dd, .7=8.3,1.6 Hz, 1H), 7.53 (d,J = 5.4 Hz, 1H), 7.02 (s, 2H) |
3.12 | 185- 189 | ’H NMR (400 MHz, CDC13) δ 8.48 (s, 1H), 7.95 (dt, J= 8.4, 1.6 Hz, 1H), 7.90 (d, J= 8.3 Hz, 1H), 7.54 (d, J= 5.4 Hz, 1H), 7.37 (d, J= 5.4 Hz, 1H), 4.91 (s, 2H), 4.01 (s, 3H) |
3.13 | 165- 167 | ’H NMR (400 MHz, DMSO-^) δ 13.60 (s, 1H), 8.45 (d, J= 6.7 Hz, 1H), 7.99 (t, J= 7.0 Hz, 1H), 7.88 (dd, J= 13.5, 6.4 Hz, 2H), 7.52 (t, J= 4.7 Hz, 1H), 6.83 (d, J =64.9 Hz, 2H) |
3.14 | 112 | ’H NMR (400 MHz, CDCI3) δ 8.08 (d, J= 6.2 Hz, 1H), 7.60 (d, J= 5.5 Hz, 1H), 7.56 (s, 1H), 7.33 (s, 1H), 4.94 (s, 2H), 3.99 (s, 3H) |
-11717485
C. No. | MP (°C) | ’hnmr |
3.15 | 'H NMR (400 MHz, CDC13) δ 8.55 - 8.44 (m, 1H), 7.92 - 7.79 (m, 2H), 7.50 (d, J = 5.4 Hz, 1H), 7.34 (dd, J = 5.4, 0.7 Hz, 1H), 7.17 (s, 1H), 4.82 (s, 2H), 4.02 (s, 3H) | |
3.16 | 176- 177 | ‘H NMR (400 MHz, DMSO-<4) δ 13.51 (s, 1H), 8.60 - 8.51 (m, 1H), 7.97 (d,J=8.3 Hz, 1H), 7.91 (dd, J =8.4,1.6 Hz, 1H), 7.85 (d, J =5.4 Hz, 1H), 7.51 (dd, J = 5.4, 0.6 Hz, 1H), 7.35 (s, 1H), 6.69 (s, 2H) |
3.17 | 70 | ‘H NMR (400 MHz, CDC13) δ 8.53 (d, J = 7.0 Hz, 1H), 7.58 (d, J = 5.5 Hz, 1H), 7.55 (d, J = 7.1 Hz, 1H), 7.52 (s, 1H), 7.29 (d, J = 5.5 Hz, 1H), 4.81 (s, 2H), 4.02 (s, 3H) |
3.18 | 143- 146 | *H NMR (400 MHz, CDCI3) δ 8.01 - 7.94 (m, 1H), 7.85 (d, J= 8.2 Hz, 1H), 7.49 (d, J= 5.4 Hz, 1H), 7.43 (dd, J= 8.2, 1.5 Hz, 1H), 7.36 (dd, J= 5.5, 0.6 Hz, 1H), 4.84 (s, 2H), 3.96 (s, 3H), 2.19 (s, 3H) |
3.19 | 157- 162 | ’H NMR (400 MHz, DMSO-î/6) δ 8.11 (s, 1H), 7.97 (d, J= 8.2 Hz, 1H), 7.87 (d, J= 5.5 Hz, 1H), 7.54 (d, J= 5.4 Hz, 1H), 7.46 (dd, J= 8.2, 1.5 Hz, 1H), 6.86 (s, 2H), 2.12 (s, 3H) |
3.20 | MSMS | *H NMR (DMSO-îZ6) δ 3.76 (s, 3H), 3.92 (s, 3H), 7.40 (s, 2H), 7.51 (d, J = 5.5 Hz, 1H), 7.88 (d, J = 5.4 Hz, 1H), 7.95 (d, J = 8.4 Hz, 1H), 8.26 (dd, J = 8.5, 1.5 Hz, 1H), 8.79 (d, J = 1.1 Hz, 1H) |
3.21 | 134- 136 | 'H NMR (DMSO-îZô) δ 3.77 (s, 3H), 7.32 (s, 1H), 7.51 (dd, J = 5.4, 0.8 Hz, 1H), 7.88 (d, J = 5.4 Hz, 1H), 7.94 (d, J = 8.4 Hz, 1H), 8.28 (dd, J = 8.4, 1.5 Hz, 1H), 8.81 - 8.86 (m, 1H) |
3.22 | 168 | ’H NMR (400 MHz, CDC13) δ 8.44 (d, J= 6.8 Hz, 1H), 7.58 (t, J= 4.0 Hz, 1H), 7.54 - 7.52 (m, 1H), 7.30 (d, J= 5.4 Hz, 1H), 5.41 (s, 2H), 4.02 (s, 3H), 3.96 (s, 3H) |
3.23 | 219- 221 | ’H NMR (400 MHz, CDC13) δ 8.01 (d, J= 1.7 Hz, 1H), 7.85 (ddt, J= 9.5, 7.3, 3.6 Hz, 2H), 7.43 - 7.33 (m, 2H), 4.93 (s, 2H), 4.02 (s, 3H) |
3.24 | 121- 123 | ]H NMR (400 MHz, CDC13) δ 7.97 - 7.85 (m, 2H), 7.54 (d, J= 5.6 Hz, 1H), 7.47 (t, J= 7.7 Hz, 1H), 7.39 (d, J= 5.6 Hz, 1H), 4.96 (s, 2H), 4.04 (s, 3H) |
3.25 | 183- 185 | *H NMR (300 MHz, DMSO-J6) δ 8.00 (dd, J= 7.9, 0.8 Hz, 1H), 7.87 - 7.82 (m, 1H), 7.80 (d, J= 5.5 Hz, 1H), 7.56 - 7.50 (m, 2H), 6.97 (s, 2H) |
3.26 | 181- 184 | !H NMR (600 MHz, CDCI3) δ 8.05 (d, J= 7.5 Hz, 1H), 7.95 (d, J= 8.0 Hz, 1H), 7.58 (t, J= 7.8 Hz, 1H), 7.56 (s, 1H), 4.98 (s, 2H), 4.05 (s, 3H) |
3.27 | *H NMR (400 MHz, DMSO-î/6) δ 7.96 (dd, J = 7.8, 1.0 Hz, 1H), 7.76 - 7.84 (m, 2H), 7.53 (d, J = 7.7 Hz, 1H), 7.47 - 7.51 (m, 2H), 6.82 (s, 2H), 3.94 (s, 3H) |
-11817485
C. No. | MP (°C) | ’hnmr |
4.01 | 188- 190 | ’H NMR (300 MHz, CDC13) δ 10.09 (br s, 1H), 8.36 (s, 1H), 8.16 (s, 1H), 8.03 (dt, J= 9,1.5 Hz, 1H), 7.57 (d, J= 9 Hz, 1H), 4.90 (br s, 2H), 4.00 (s, 3H) |
4.02 | 284- 287 | ’H NMR (300 MHz, DMSO-î/6) δ 13.49 (br s, 1H), 13.19 (br s, 1H), 8.28 (s, 1H), 8.21 (s, 1H), 7.89 (dt, J= 9, 1 Hz, 1H), 7.66 (dt, J= 9, 1 Hz, 1H), 6.82 (br s, 2H) |
4.03 | 156- 159 | *H NMR (400 MHz, CDC13) δ 8.34 (m, 1H), 8.07 (d, J= 1 Hz, 1H), 8.03 (dt,J=9,1.5 Hz, 1H), 7.47 (dt, J =9, 1 Hz, 1H), 4.89 (br s, 2H), 4.10 (s, 3H), 3.99 (s, 3H) |
4.04 | 186- 188 | *H NMR (400 MHz, DMSO-îZ6) δ 13.53 (br s, 1H), 8.28 (s, 1H), 8.19 (s, 1H), 7.92 (d, J= 9 Hz, 1H), 7.75 (d, J= 9 Hz, 1H), 6.81 (br s, 2H), 4.10 (s, 3H) |
4.05 | 185- 187 | *H NMR (400 MHz, DMSO-t/6) δ 13.21 (br s, 1H), 8.16 (s, 1H), 8.01 (s, 1H), 7.88 (dd, J= 9, 1 Hz, 1H), 7.61 (dt, J= 9, 1.5 Hz, 1H), 6.96 (br s, 2H), 3.91 (s, 3H) |
4.06 | >300 | ’H NMR (400 MHz, DMSO-4) δ 13.20 (br s, 1H), 8.15 (s, 1H), 8.03 (s, 1H), 7.87 (d, J= 9 Hz, 1H), 7.64 (dt, J= 9, 1.5 Hz, 1H), 6.66 (br s, 2H) |
4.07 | 187- 190 | *H NMR (400 MHz, CDC13) δ 8.03 (d, J= 1 Hz, 1H), 8.00 (t, J= 1 Hz, 1H), 7.82 (dd, J= 9, 1 Hz, 1H), 7.72 (m, 1H), 4.94 (br s, 2H), 4.15 (s, 3H), 4.01 (s, 3H) |
4.08 | 182- 184 | ’H NMR (400 MHz, DMSO-J6) δ 13.68 (br s, 1H), 8.14 (d, J= 1 Hz, 1H), 8.06 (s, 1H), 7.89 (dd, J= 9, 0.5 Hz, 1H), 7.62 (dt, J= 9, 1 Hz, 1H), 6.88 (br s, 2H), 4.13 (s, 3 H) |
4.09 | 191 - 193 | ’H NMR (400 MHz, DMSO-î/6) δ 13.19 (s, 1H), 8.08 (d, J= 21.7 Hz, 2H), 7.84 (d, J= 8.5 Hz, 1H), 7.63 (d, J= 8.5 Hz, 1H), 7.38 (s, 1H), 6.76 (s, 2H), 3.91 (s, 3H) |
4.10 | 170- 175 | ’H NMR (400 MHz, CDC13) δ 8.42 (s, 1H), 7.63 (dt, J= 5.8, 2.2 Hz, 1H), 7.53 - 7.45 (m, 2H), 4.96 (s, 2H), 4.12 (s, 3H), 4.01 (s, 3H) |
4.11 | 173- 175 | ’H NMR (400 MHz, DMSO-J6) δ 13.62 (s, 1H), 8.23 (s, 1H), 7.88 - 7.70 (m, 1H), 7.63 - 7.45 (m, 2H), 6.93 (s, 2H), 4.11 (d, J= 10.3 Hz, 4H) |
4.12 | 212- 215 | ’H NMR (400 MHz, CDC13) δ 10.10 (s, 1H), 8.55 (s, 1H), 7.66 (dd, J= 7.2, 1.5 Hz, 1H), 7.59 (d, J= 8.4 Hz, 1H), 7.54-7.45 (m, 1H), 4.97 (s, 2H), 4.02 (s, 3H) |
4.13 | 207- 210 | ’H NMR (400 MHz, CDC13) δ 12.67 (s, 1H), 8.23 (d, J= 7.5 Hz, 1H), 8.15 (d,J=1.9 Hz, 1H), 7.89 (d,J=8.0 Hz, 1H), 7.29 (d,J=7.7 Hz, 1 H), 5.02 (s, 2H), 4.12 (s, 3H) |
-11917485
C. No. | MP (°C) | ’HNMR |
5.01 | *HNMR (400 MHz, CDC13) δ 8.36 (d, 7= 1.5 Hz, 1H), 8.16 (s, 1H), 8.06 - 7.98 (m, 1H), 7.68 (d, 7= 8.6 Hz, 1H), 4.95 (s, 2H), 4.00 (s, 3H) | |
6.01 | 216 | ’H NMR (400 MHz, DMSO-76) δ 9.48 (s, 1H), 8.49 (s, 1H), 8.30 (d, 7= 8.8 Hz, 1H), 7.95 (d, 7= 8.5 Hz, 1H), 6.99 (s, 2H), 3.91 (s, 3H) |
6.02 | 186- 187 | ’H NMR (400 MHz, DMSO-76) δ 13.54 (s, 1H), 9.47 (s, 1H), 8.52 (s, 1H), 8.30 (d, 7= 8.5 Hz, 1H), 7.98 (d, 7= 8.5 Hz, 1H), 6.91 (s, 2H) |
7.01 | 219- 221 | ’H NMR (300 MHz, DMSO-76) δ 8.31 (s, 1H), 8.04 (br s, 1H), 7.70 (br s, 2H), 6.92 (br s, 2H), 3.89 (s, 3H) |
7.02 | 218- 220 | ‘H NMR (300 MHz, DMSO-76) δ 8.28 (s, 1H), 7.97 (br s, 1H), 7.75 (d, J= 9 Hz, 1H), 7.68 (dt, 7= 9,1.5 Hz, 1H), 6.94 (br s, 2H), 3.90 (s, 6H) |
7.03 | 230- 235 (dec) | ’H NMR (300 MHz, DMSO-76) δ 8.76 (s, 1H), 8.13 (s, 1H), 7.83 (s, 2H), 6.92 (br s, 2H),3.98 (s, 3H) |
8.01 | *H NMR (400 MHz, DMSO-76) δ 8.10 (t, 7= 9.8 Hz, 1H), 7.89 (s, 1H), 7.70 (t, 7= 8.2 Hz, 1H), 7.08 (s, 2H), 3.94 - 3.85 (m, 3H), 3.16 (s, 6H) | |
9.01 | 129- 33 | 'H NMR (400 MHz, DMSO-76) δ 15.84 (s, 1H), 8.35 (s, 1H), 7.98 (s, 2H), 7.41 (s, 1H), 6.79 (s, 2H), 3.91 (s, 3H) |
Table 12: Percent Control Rating Conversion Table
Rating | % Visual Growth Réduction |
A | 95-100 |
B | 85-94 |
C | 75-84 |
D | 60-74 |
E | 45-59 |
F | 30-44 |
G | 0-29 |
Example A. Evaluation of Postemergent Ilerbicidal Activity
Post-emergent Test I Seeds of test species were obtained from commercial suppliers and planted into a 5-round pot containing soil-less media mix (Metro-Mix 360®, Sun Gro Horticulture). Postemergence treatments were planted 8-12 days (d) prior to application and
-12017485 cultured in a greenhouse equipped with supplémentai light sources to provide a 16 h photoperiod at 24-29 °C. Ail pots were surface irrigated.
Approximately 10 milligrams (mg) of each compound were dissolved in 1.3 mL acetone-DMSO (97:3, v/v) and diluted with 4.1 mL water-isopropanol-crop oil concentrate (78:20:2, v/v/v) containing 0.02% Triton X-155. Treatments were serial diluted with the above formulation solvent to provide 1.85, 0.926, 0.462 and 0.231 mg/mL of test compound delivered in 2.7 mL/pot (roughly équivalent to 4.0, 2.0, 1.0, and 0.5 kilograms per hectare (kg/ha), respectively).
Formulated compounds were applied using a DeVilbiss® compressed air sprayer at 2-4 pounds per square inch (psi). Following treatment, pots were retumed to the greenhouse for the duration of the experiment. Ail pots were sub-irrigated as need to provide optimum growing conditions. Ail pots were fertilized one time per week by subirrigating with Peters Peat-Lite Spécial® fertilizer (20-10-20).
Phytotoxicity ratings were obtained 10 days after treatment postemergence applications. Ail évaluations were made visually on a scale of 0 to 100 where 0 represents no activity and 100 represents complété plant death.
Some of the compounds tested, application rates employed, plant species tested, and results are given in Table 13.
Table 13. Post-emergent Test I Herbicidal Activity on Key Broadleaf and Grass Weed as well as Crop Species
Compound Number | Application Rate (kg ai/ha) | Visual Growth Réduction (%) 10 Days After Application | ||||
AVEFA | ECHCG | HELAN | IPOHE | SETFA | ||
1.10 | 3.96 | G | G | A | F | G |
1.48 | 4 | G | G | C | n/t | G |
3.05 | 4 | C | A | B | B | A |
AVEFA: wild oats (Avena fatua)
ECHCG: bamyardgrass (Echinochloa crus-gallî)
HELAN: sunflower (Helianthus annuus)
IPOHE: ivyleaf momingglory (Ipomoea hederecea) SETFA: giant foxtail (Setaria faberï) kg ai/ha: kilograms active ingrédient per hectare n/t: not tested
-12117485
Example B. Evaluation of Preemergent Herbicidal Activity
Pre-emergent Test I Seeds of test species were planted into round plastic pots (5-inch diameter) containing sandy loam soil. After planting, ail pots were sub-irrigated 16 h prior to compound application.
Compounds were dissolved in a 97:3 v/v (volume/volume) mixture of acetone and DMSO and diluted to the appropriate concentration in a final application solution containing water, acetone, isopropanol, DMSO and Agri-dex (crop oil concentrate) in a 59:23:15:1.0:1.5 v/v ratio and 0.02% w/v (weight/volume) of Triton X-155 to obtain the spray solution containing the highest application rate. The high application rate was serial diluted with the above application solution to provide delivery of the compound at rates 1/2X, 1/4X andl/8X of the highest rate (équivalent to 4.0, 2.0, 1.0, and 0.5 kg/ha, respectively).
Formulated compound (2.7 mL) was applied/pipetted evenly over the soil surface followed by incorporation with water (15 mL). Following treatment, pots were retumed to the greenhouse for the duration of the experiment. The greenhouse was programmed for an approximate 15 h photoperiod which was maintained at about 23-29 °C during the day and 22-28 °C during the night. Nutrients and water were added on a regular basis through surface irrigation and supplémentai lighting was provided with overhead métal halide 1000-Watt lamps as necessary.
Herbicidal effect ratings were obtained 14 days after treatment. Ail évaluations were made relative to appropriate controls on a scale of 0 to 100 where 0 represents no herbicidal effect and 100 represents plant death or lack of emergence from the soil. Some of the compounds tested, application rates employed, plant species tested, and results are given in Table 14.
Table 14. Pre-emergent Test I Herbicidal Activity on Key Broadleaf and Grass Weed as well as Crop Species
Compound Number | Application Rate (kg ai/ha) | Visual Growth Réduction (%) 14 Days After Application | ||||
AVEFA | ECHCG | HELAN | IPOHE | SETFA | ||
1.10 | 3.96 | G | F | G | G | G |
1.48 | 4 | G | G | C | D | G |
3.05 | 4 | F | A | F | A | A |
AVEFA: wild oats (Avena fatua)
ECHCG: bamyardgrass (Echinochloa crus-galli)
-12217485
HELAN: sunflower (Helianthus annuus)
IPOHE: ivyleaf momingglory (Ipomoea hederecea) SETFA: giant foxtail (Setaria faberî) kg ai/ha: kilograms active ingrédient per hectare
Example C. Evaluation of Postemergent Herbicidal Activity
Post-emergent Test II: Seeds or nutlets of the desired test plant species were planted in Sun Gro Metro-Mix® 360 planting mixture, which typically has a pH of 6.0 to 6.8 and an organic matter content of about 30 percent, in plastic pots with a surface area of 64 square centimeters (cm ). When required to ensure good germination and healthy plants, a fungicide treatment and/or other chemical or physical treatment was applied. The plants were grown for Ί21 d in a greenhouse with an approximate 15 h photoperiod which was maintained at about 2329 °C during the day and 22-28 °C during the night. Nutrients and water were added on a regular basis and supplémentai lighting was provided with overhead métal halide 1000-Watt lamps as necessary. The plants were employed for testing when they reached the first or second true leaf stage.
A weighed amount, determined by the highest rate to be tested, of each test compound was placed in a 25 mL glass vial and was dissolved in 4 mL of a 97:3 v/v mixture of acetone and DMSO to obtain concentrated stock solutions. If the test compound did not dissolve readily, the mixture was warmed and/or sonicated. The concentrated stock solutions obtained were diluted with 20 mL of an aqueous mixture containing acetone, water, isopropyl alcohol, DMSO, Atplus 411F crop oil concentrate, and Triton® X-155 surfactant in a 48.5:39:10:1.5:1.0:0.02 v/v ratio to obtain spray solutions containing the highest application rates. Additional application rates were obtained by serial dilution of 12 mL of the high rate solution into a solution containing 2 mL of 97:3 v/v mixture of acetone and DMSO and 10 mL of an aqueous mixture containing acetone, water, isopropyl alcohol, DMSO, Atplus 411F crop oil concentrate, and Triton X-155 surfactant in a 48.5:39:10:1.5:1.0:0.02 v/v ratio to obtain 1/2X, 1/4X, 1/8X and 1/16X rates of the high rate. Compound requirements are based upon a 12 mL application volume at a rate of 187 liters per hectare (L/ha). Formulated compounds were applied to the plant material with an overhead Mandel track sprayer equipped with 8002E nozzles calibrated to deliver 187 L/ha over an application area of 0.503 square meters at a spray height of 18 inches (43 cm) above the average plant canopy height. Control plants were sprayed in the same manner with the solvent blank.
-12317485
The treated plants and control plants were placed in a greenhouse as described above and watered by subirrigation to prevent wash-off of the test compounds. After 14 d, the condition of the test plants as compared with that of the untreated plants was determined visually and scored on a scale of 0 to 100 percent where 0 corresponds to no injury and 100 corresponds to complété kill. Some of the compounds tested, application rates employed, plant species tested, and results are given in Tables 15 and 16.
Table 15. Post-emergent Test II Herbicidal Activity on Key Broadleaf Weed and Crop Species
C.No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
ABUTH | AMARE | BRSNN | CHEAL | EPHHL | HELAN | ||
1.01 | 35 | G | n/a | G | G | A | G |
70 | G | G | G | G | A | C | |
140 | F | E | G | G | A | C | |
1.02 | 35 | G | n/t | G | C | E | E |
70 | G | B | G | B | E | D | |
140 | G | B | G | A | D | D | |
1.03 | 35 | G | n/t | G | B | A | G |
70 | G | n/t | G | B | A | G | |
140 | C | B | G | A | B | E | |
1.04 | 35 | E | D | F | E | A | E |
70 | G | D | E | D | A | E | |
140 | G | D | E | D | A | B | |
1.05 | 35 | E | D | F | B | F | A |
70 | A | C | E | A | F | A | |
140 | B | A | D | A | E | A | |
1.06 | 35 | G | A | C | B | G | G |
70 | G | B | B | A | G | G | |
140 | G | C | B | A | G | G | |
1.07 | 35 | G | B | G | B | D | A |
70 | G | A | G | B | D | A | |
140 | G | A | G | B | D | A | |
1.08 | 35 | B | A | E | A | A | B |
70 | A | A | C | A | A | A | |
140 | A | A | B | A | A | A | |
1.09 | 35 | A | A | A | A | B | A |
C.No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
ABUTH | AMARE | BRSNN | CHEAL | EPHHL | HELAN | ||
70 | A | A | A | A | A | A | |
140 | A | A | A | A | A | A | |
1.10 | 35 | G | G | G | A | G | G |
70 | G | B | G | A | G | G | |
140 | G | A | G | A | G | E | |
1.13 | 35 | G | G | G | D | G | E |
70 | G | F | G | C | G | D | |
140 | G | F | F | B | F | D | |
1.14 | 35 | G | C | E | D | G | D |
70 | G | B | D | D | G | C | |
140 | G | B | C | C | D | C | |
1.15 | 35 | A | A | C | A | A | A |
70 | A | A | A | A | A | A | |
140 | A | A | A | A | A | A | |
1.16 | 35 | B | A | A | A | A | A |
70 | A | A | A | A | A | A | |
140 | A | A | A | A | A | B | |
1.17 | 35 | E | A | A | A | A | A |
70 | E | A | A | A | A | A | |
140 | D | A | A | A | A | A | |
1.19 | 35 | A | A | A | A | A | D |
70 | A | A | A | A | A | C | |
140 | A | A | A | A | A | A | |
1.20 | 35 | E | C | A | A | A | A |
70 | D | B | A | A | A | A | |
140 | D | A | A | A | A | A | |
1.21 | 35 | D | G | G | E | C | E |
70 | D | G | G | B | B | C | |
140 | D | E | D | B | A | C | |
1.22 | 35 | G | C | E | G | E | C |
70 | G | C | D | G | C | B | |
140 | G | B | D | G | B | B | |
1.23 | 35 | A | A | D | A | A | D |
70 | A | A | C | A | A | C | |
140 | A | A | B | A | A | B | |
1.24 | 35 | B | A | B | B | A | D |
-12517485
C.No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
ABUTH | AMARE | BRSNN | CHEAL | EPHHL | HELAN | ||
70 | A | A | E | A | A | C | |
140 | A | A | A | A | A | B | |
1.25 | 35 | G | C | D | G | G | G |
70 | G | B | C | D | G | G | |
140 | F | A | B | D | F | G | |
1.26 | 35 | G | C | B | G | G | G |
70 | G | B | A | F | F | G | |
140 | G | A | A | F | E | G | |
1.27 | 35 | D | D | B | B | A | G |
70 | B | A | A | B | A | G | |
140 | B | A | A | B | A | G | |
1.28 | 35 | B | G | C | E | G | A |
70 | B | G | B | D | G | A | |
140 | A | D | B | D | G | A | |
1.29 | 35 | G | E | C | E | G | D |
70 | G | G | C | E | G | D | |
140 | G | G | B | C | G | C | |
1.30 | 35 | G | G | E | F | G | G |
70 | G | C | E | F | E | G | |
140 | C | D | D | E | D | G | |
1.31 | 35 | E | D | B | A | A | F |
70 | D | A | A | A | A | E | |
140 | D | A | A | A | A | D | |
1.32 | 35 | G | G | F | G | G | E |
70 | G | F | E | G | D | D | |
140 | G | D | D | C | B | C | |
1.33 | 35 | G | D | A | G | E | D |
70 | G | D | A | E | D | D | |
140 | G | C | A | D | C | C | |
1.34 | 35 | G | G | C | G | G | B |
70 | G | G | B | E | G | A | |
140 | G | F | A | D | D | A | |
1.35 | 35 | G | C | A | G | C | F |
70 | G | B | A | G | C | D | |
140 | G | A | A | B | B | A | |
1.37 | 35 | G | G | F | G | G | G |
-12617485
C.No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
ABUTH | AMARE | BRSNN | CHEAL | EPHHL | HELAN | ||
70 | G | G | D | G | G | G | |
140 | G | G | C | G | G | G | |
1.39 | 35 | G | A | C | A | B | G |
70 | G | A | B | C | C | G | |
1.40 | 35 | G | n/t | G | G | G | G |
70 | G | A | G | G | G | F | |
140 | G | n/t | G | G | G | E | |
1.43 | 35 | G | A | G | C | G | D |
70 | G | A | G | B | G | C | |
140 | D | A | G | B | F | C | |
1.44 | 35 | G | B | G | B | E | G |
70 | C | A | G | B | C | G | |
140 | B | A | F | A | B | G | |
1.45 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | E | G | G | G | F | |
1.46 | 35 | G | G | G | C | G | G |
70 | G | G | G | B | G | F | |
140 | G | D | G | A | G | E | |
1.47 | 35 | G | G | G | C | G | G |
70 | G | G | G | C | G | G | |
140 | G | F | G | B | G | E | |
1.48 | 140 | G | G | G | D | G | C |
1.49 | 35 | B | G | G | B | G | G |
70 | B | F | G | B | G | G | |
140 | B | G | G | A | G | E | |
2.02 | 35 | E | C | G | A | C | C |
70 | B | A | F | A | A | B | |
140 | B | A | F | A | A | A | |
2.03 | 35 | A | D | G | B | E | G |
70 | A | B | G | A | C | D | |
140 | A | B | G | A | C | C | |
280 | A | A | F | A | B | B | |
2.04 | 35 | C | A | G | A | A | G |
70 | B | A | G | A | A | G | |
140 | A | A | F | A | A | F |
-12717485
C.No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
ABUTH | AMARE | BRSNN | CHEAL | EPHHL | HELAN | ||
2.05 | 35 | G | B | G | G | F | G |
70 | G | C | G | G | F | G | |
140 | G | A | G | E | E | F | |
2.06 | 35 | G | C | F | D | F | D |
70 | G | A | D | C | C | C | |
140 | C | A | B | B | A | B | |
2.09 | 35 | B | B | D | A | A | D |
70 | B | A | C | A | A | C | |
140 | B | A | B | A | A | B | |
2.10 | 35 | D | B | F | B | A | C |
70 | D | A | D | A | A | B | |
140 | B | A | C | B | A | A | |
2.11 | 35 | A | A | C | A | A | E |
70 | A | A | B | A | A | D | |
140 | A | A | A | A | A | C | |
2.12 | 35 | B | A | C | A | A | F |
70 | A | A | B | A | A | D | |
140 | A | A | A | A | A | D | |
2.13 | 35 | A | D | A | A | A | C |
70 | A | A | A | A | A | B | |
140 | A | A | A | A | A | A | |
2.14 | 35 | G | A | A | B | B | D |
70 | G | A | A | A | A | B | |
140 | G | A | A | A | A | A | |
2.15 | 35 | E | A | E | A | G | E |
70 | C | A | C | A | G | C | |
140 | A | A | B | A | G | C | |
2.16 | 35 | B | A | E | A | G | A |
70 | A | A | D | A | G | A | |
140 | A | A | D | A | G | A | |
2.17 | 140 | C | A | C | A | A | B |
2.18 | 35 | G | A | E | B | G | C |
70 | G | A | D | B | G | C | |
140 | G | A | D | B | G | B | |
2.19 | 35 | A | A | G | A | G | G |
70 | A | A | D | A | G | C |
-12817485
C.No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
ABUTH | AMARE | BRSNN | CHEAL | EPHHL | HELAN | ||
140 | A | A | D | A | G | C | |
2.20 | 35 | E | A | G | B | G | B |
70 | D | A | G | A | G | A | |
140 | D | A | F | A | G | A | |
2.21 | 35 | F | A | F | B | G | D |
70 | D | A | F | B | G | C | |
140 | D | A | E | A | G | C | |
2.22 | 35 | F | A | G | A | G | C |
70 | F | A | E | A | G | B | |
140 | E | A | D | A | G | A | |
2.23 | 35 | G | A | G | A | G | B |
70 | G | A | G | A | G | A | |
140 | G | A | G | A | G | A | |
2.24 | 35 | C | A | D | A | D | C |
70 | C | A | C | A | C | C | |
140 | A | A | C | A | C | B | |
2.25 | 35 | C | A | G | A | G | G |
70 | C | A | E | A | C | F | |
140 | A | A | C | A | B | B | |
2.26 | 35 | E | A | E | A | E | C |
70 | D | A | D | A | D | A | |
140 | D | A | D | A | C | A | |
3.01 | 35 | D | B | G | A | G | C |
70 | D | A | G | A | G | C | |
140 | C | A | G | A | G | B | |
3.02 | 35 | G | A | G | B | G | D |
70 | G | A | G | B | G | C | |
140 | G | A | G | B | G | B | |
3.03 | 35 | A | A | G | A | A | A |
70 | A | A | D | A | A | A | |
140 | A | A | D | A | A | A | |
3.05 | 35 | B | F | G | C | D | G |
70 | B | E | G | B | D | G | |
140 | A | D | G | B | C | F | |
280 | A | B | G | B | B | E | |
3.06 | 35 | E | B | F | F | G | A |
-12917485
C.No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
ABUTH | AMARE | BRSNN | CHEAL | EPHHL | HELAN | ||
70 | D | B | F | D | G | A | |
140 | B | A | E | D | F | A | |
3.07 | 35 | G | G | E | G | G | B |
70 | G | D | D | G | G | B | |
140 | G | C | D | C | G | B | |
3.08 | 35 | G | G | G | B | D | D |
70 | F | F | G | B | C | C | |
140 | F | D | F | B | B | B | |
3.09 | 35 | G | F | E | B | A | D |
70 | G | C | B | B | A | C | |
140 | E | B | A | A | A | B | |
3.10 | 35 | G | A | G | C | G | B |
70 | G | A | G | C | G | B | |
140 | G | A | G | C | G | B | |
3.11 | 35 | G | n/a | G | B | G | B |
70 | G | n/a | G | B | G | B | |
140 | G | n/a | G | B | G | B | |
3.12 | 35 | D | D | G | A | D | B |
70 | A | D | G | A | D | B | |
140 | A | B | F | A | B | B | |
3.13 | 35 | G | A | G | B | G | B |
70 | G | A | G | A | G | B | |
140 | C | A | D | A | D | B | |
3.14 | 35 | G | B | G | B | F | B |
70 | G | A | G | B | F | B | |
140 | G | A | G | A | D | A | |
3.15 | 35 | B | A | F | B | C | D |
70 | A | A | E | B | C | D | |
140 | A | A | E | A | B | B | |
3.16 | 35 | D | B | G | B | D | G |
70 | D | A | G | B | D | G | |
140 | C | B | E | B | D | G | |
3.17 | 35 | G | C | G | B | E | G |
70 | E | A | G | A | D | G | |
140 | D | A | D | A | C | F | |
3.18 | 35 | D | D | G | F | E | A |
-13017485
C.No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
ABUTH | AMARE | BRSNN | CHEAL | EPHHL | HELAN | ||
70 | C | C | G | D | G | A | |
140 | C | A | G | D | F | A | |
3.19 | 35 | G | D | G | D | G | B |
70 | G | A | G | D | G | B | |
140 | D | C | G | C | G | B | |
3.20 | 35 | G | G | F | B | C | C |
70 | G | D | D | A | A | B | |
140 | G | D | D | A | A | B | |
3.21 | 35 | G | A | C | B | C | D |
70 | F | A | B | B | B | D | |
140 | E | A | A | A | A | C | |
3.22 | 35 | G | D | G | D | A | C |
70 | G | A | F | C | A | B | |
140 | G | A | D | B | A | B | |
3.23 | 35 | G | G | G | G | G | G |
70 | G | G | G | E | G | G | |
140 | G | G | G | B | G | G | |
3.24 | 35 | G | B | E | B | G | D |
70 | G | B | E | A | G | D | |
140 | G | A | E | A | G | B | |
3.25 | 140 | G | A | C | A | G | E |
3.27 | 35 | G | B | E | C | G | E |
70 | G | A | D | B | G | D | |
140 | E | A | D | A | G | C | |
280 | C | A | B | A | G | B | |
4.01 | 35 | G | G | G | G | G | G |
70 | G | E | G | D | G | G | |
140 | G | D | G | D | G | G | |
4.03 | 35 | G | G | G | A | E | G |
70 | G | E | G | A | D | E | |
140 | G | C | G | A | C | D | |
4.05 | 35 | G | G | G | B | D | D |
70 | G | A | G | B | A | D | |
140 | E | A | E | A | A | A | |
4.06 | 35 | G | C | D | G | E | E |
70 | G | A | C | E | D | D |
-13117485
C.No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
ABUTH | AMARE | BRSNN | CHEAL | EPHHL | HELAN | ||
140 | G | A | B | A | B | C | |
4.07 | 140 | E | n/t | E | G | D | A |
4.08 | 140 | G | n/t | D | A | G | B |
4.09 | 35 | G | G | G | E | G | G |
70 | G | E | G | C | G | F | |
140 | G | B | D | B | G | E | |
4.10 | 35 | G | G | G | G | G | G |
70 | G | A | G | G | G | G | |
140 | G | A | G | G | G | E | |
4.13 | 35 | G | n/t | G | G | G | G |
70 | G | n/t | G | G | G | G | |
140 | G | n/t | G | D | G | G | |
5.01 | 35 | D | C | B | D | n/t | B |
70 | D | B | A | B | A | B | |
140 | D | B | A | B | n/t | A | |
6.01 | 35 | B | B | A | A | G | B |
70 | B | A | A | A | B | B | |
140 | B | A | A | A | A | B | |
6.02 | 35 | B | A | A | A | A | A |
70 | B | A | A | A | A | A | |
140 | B | A | A | A | A | A | |
7.02 | 35 | G | G | G | G | G | G |
70 | G | G | G | C | G | G | |
140 | G | G | G | A | G | G | |
8.01 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G |
ABUTH: velvetleaf (Abutilon theophrasti) AMARE: redroot pigweed (Amaranthus retroflexus) BRSNN: oilseed râpe, canola (Brassica napus)
CHEAL: lambsquarters (Chenopodium album) EPHHL: wild poinsettia (Euphorbia heterophylla) HELAN: sunflower (Helianthus annuus) g ai/ha: grams active ingrédient per hectare
-13217485 n/t: not tested
Table 16. Post-emergent Test II Herbicidal Activity on Key Grass and Sedge Weeds as well as Grass Crops
C. No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
CYPES | ECHCG | SETFA | ORYSA | TRZAS | ZEAMX | ||
1.01 | 35 | G | G | G | G | G | G |
70 | G | n/t | G | G | G | A | |
140 | G | C | G | G | G | B | |
1.02 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | E | G | G | G | G | |
1.03 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | D | G | G | G | G | |
1.04 | 35 | G | G | G | G | G | G |
70 | G | n/t | G | G | G | G | |
140 | G | B | G | G | G | G | |
1.05 | 35 | G | G | F | G | G | G |
70 | G | G | E | G | F | F | |
140 | G | D | D | G | E | E | |
106 | 35 | G | G | G | G | G | G |
70 | G | D | G | G | G | G | |
140 | G | C | G | G | G | G | |
1.07 | 35 | G | G | D | G | G | G |
70 | G | G | C | G | G | G | |
140 | G | G | C | G | G | G | |
1.08 | 35 | G | B | G | G | G | E |
70 | G | A | D | G | G | C | |
140 | G | A | C | G | F | B | |
1.09 | 35 | F | A | B | G | G | D |
70 | C | A | B | G | G | C | |
140 | B | A | B | G | G | C | |
1.10 | 35 | G | G | G | G | G | G |
-13317485
C.No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
CYPES | ECHCG | SETFA | ORYSA | TRZAS | ZEAMX | ||
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.12 | 35 | G | G | C | G | E | G |
70 | G | G | D | G | G | G | |
140 | G | B | C | G | G | G | |
1.13 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.14 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.15 | 35 | G | C | D | G | E | G |
70 | D | B | D | G | D | F | |
140 | E | A | B | F | D | D | |
1.16 | 35 | G | C | D | F | F | G |
70 | D | B | C | D | D | F | |
140 | B | A | B | D | D | D | |
1.17 | 35 | E | B | C | G | D | D |
70 | E | B | B | G | D | C | |
140 | E | B | B | G | D | C | |
1.19 | 35 | B | B | D | F | D | D |
70 | C | B | C | E | C | D | |
140 | A | A | B | D | C | B | |
1.20 | 35 | G | G | E | G | G | F |
70 | G | D | C | G | E | E | |
140 | G | C | B | G | D | D | |
1.21 | 35 | G | G | n/t | G | G | G |
70 | G | G | n/t | G | G | G | |
140 | G | G | n/t | G | G | G | |
1.22 | 35 | G | G | G | G | G | G |
70 | G | G | D | G | G | G | |
140 | G | G | B | G | G | G | |
1.23 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | D | D | G | F | G | |
1.24 | 35 | G | G | G | G | G | G |
70 | G | G | E | G | F | G |
-13417485
C. No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
CYPES | ECHCG | SETFA | ORYSA | TRZAS | ZEAMX | ||
140 | G | G | D | G | E | G | |
1.25 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.26 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.27 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.28 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | F | G | |
140 | G | G | G | G | F | G | |
1.29 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | F | G | G | G | G | G | |
1.30 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.31 | 35 | G | C | D | G | C | G |
70 | G | C | C | G | G | G | |
140 | G | B | B | G | F | G | |
1.32 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.33 | 35 | G | G | G | G | G | n/t |
70 | G | G | G | G | G | n/t | |
140 | G | G | G | G | F | n/t | |
1.34 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | D | G | F | G | |
1.35 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | F | G | |
140 | G | G | G | G | E | G | |
1.37 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G |
C. No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
CYPES | ECHCG | SETFA | ORYSA | TRZAS | ZEAMX | ||
1.39 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
1.40 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.43 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.44 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.45 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.46 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.47 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
1.48 | 140 | G | G | G | G | G | G |
2.02 | 35 | G | B | D | G | G | A |
70 | G | B | D | G | F | A | |
140 | G | A | C | G | E | A | |
2.03 | 35 | G | F | G | G | G | G |
70 | G | D | G | G | G | G | |
140 | G | B | F | G | G | G | |
280 | G | A | F | G | G | D | |
2.04 | 35 | G | D | D | G | G | D |
70 | G | A | C | G | F | C | |
140 | F | A | B | G | E | B | |
2.05 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
2.06 | 35 | G | G | G | G | G | G |
70 | G | E | G | G | G | G | |
140 | G | A | G | G | G | G |
-13617485
C.No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
CYPES | ECHCG | SETFA | ORYSA | TRZAS | ZEAMX | ||
2.08 | 35 | G | B | E | G | G | E |
70 | G | B | D | F | G | D | |
140 | G | A | B | F | G | D | |
2.09 | 35 | G | D | E | G | G | E |
70 | G | B | D | F | G | D | |
140 | G | B | D | F | G | D | |
2.10 | 35 | G | D | D | G | G | G |
70 | G | D | D | F | F | F | |
140 | F | B | C | F | D | E | |
2.11 | 35 | G | B | E | G | G | E |
70 | G | A | D | G | G | D | |
140 | F | A | C | G | F | B | |
2.12 | 35 | G | A | E | G | G | G |
70 | G | A | D | G | G | F | |
140 | G | A | D | G | G | D | |
2.13 | 35 | F | C | G | G | G | G |
70 | B | A | E | F | E | F | |
140 | B | A | D | F | E | E | |
2.14 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | C | G | G | G | G | |
2.15 | 35 | G | G | G | G | G | A |
70 | G | E | G | G | G | A | |
140 | G | C | G | G | G | A | |
2.16 | 35 | G | G | G | G | G | E |
70 | G | G | G | G | G | A | |
140 | G | G | G | G | G | A | |
2.17 | 140 | A | C | G | G | G | F |
2.18 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
2.19 | 35 | G | G | n/t | G | G | G |
70 | G | G | n/t | G | G | G | |
140 | G | G | n/t | G | G | G | |
2.20 | 35 | G | n/t | G | G | G | G |
70 | G | n/t | F | G | G | G | |
140 | G | n/t | D | G | G | G |
-13717485
C. No. | Application Rate (g | Visual Growth Réduction (%) 14 Days After Application | |||||
ai/ha) | CYPES | ECHCG | SETFA | ORYSA | TRZAS | ZEAMX | |
2.21 | 35 | G | n/t | G | G | G | G |
70 | G | n/t | G | G | G | G | |
140 | G | n/t | G | G | G | G | |
2.22 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
2.23 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
2.24 | 35 | D | G | G | G | G | G |
70 | C | G | G | G | G | F | |
140 | B | G | G | G | G | D | |
2.25 | 35 | G | G | G | G | G | G |
70 | F | G | G | G | G | G | |
140 | C | G | G | G | G | E | |
2.26 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
3.01 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | E | |
140 | G | G | G | G | G | D | |
3.02 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | D | |
140 | G | G | G | G | G | D | |
3.03 | 35 | E | B | G | G | G | A |
70 | E | A | B | G | F | A | |
140 | E | A | B | G | E | A | |
3.05 | 35 | G | E | G | G | G | G |
70 | G | C | G | G | G | G | |
140 | G | B | F | G | G | E | |
280 | G | B | D | G | G | D | |
3.06 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
3.07 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G |
-13817485
C. No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
CYPES | ECHCG | SETFA | ORYSA | TRZAS | ZEAMX | ||
3.08 | 35 | G | G | G | G | E | F |
70 | G | G | G | G | D | D | |
140 | F | C | G | G | D | C | |
3.09 | 35 | G | B | G | G | D | D |
70 | G | B | G | G | C | C | |
140 | G | B | G | G | B | B | |
3.10 | 35 | G | G | G | G | G | D |
70 | G | G | G | G | G | D | |
140 | G | G | G | G | G | D | |
3.11 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
3.12 | 35 | G | B | G | G | G | A |
70 | G | B | G | G | G | A | |
140 | G | B | G | G | G | A | |
3.13 | 35 | G | D | n/t | G | G | D |
70 | G | D | n/t | G | G | D | |
140 | G | C | n/t | G | G | D | |
3.14 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | F | |
140 | G | G | G | G | G | D | |
3.15 | 35 | G | C | G | G | G | D |
70 | G | C | G | G | G | D | |
140 | G | A | G | G | G | D | |
3.16 | 35 | G | C | G | G | G | D |
70 | G | C | G | G | G | D | |
140 | E | C | G | G | G | C | |
3.17 | 35 | G | E | G | G | G | F |
70 | G | D | G | G | G | D | |
140 | G | A | F | G | G | C | |
3.18 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
3.19 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
3.20 | 35 | F | G | G | G | G | G |
-13917485
C. No. | Application Rate (g | Visual Growth Réduction (%) 14 Days After Application | |||||
ai/ha) | CYPES | ECHCG | SETFA | ORYSA | TRZAS | ZEAMX | |
70 | F | E | G | G | G | C | |
140 | B | D | D | G | F | B | |
3.21 | 35 | G | C | G | G | F | F |
70 | G | B | F | F | F | D | |
140 | G | B | D | F | E | C | |
3.22 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
3.23 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
3.24 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
3.25 | 140 | G | G | G | G | G | G |
3.27 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
280 | G | G | G | G | G | G | |
4.01 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
4.03 | 35 | G | D | n/t | G | G | G |
70 | G | C | n/t | G | G | G | |
140 | G | C | n/t | G | G | G | |
4.05 | 35 | G | n/t | n/t | G | G | G |
70 | G | n/t | n/t | G | G | D | |
140 | G | B | A | G | G | D | |
4.06 | 35 | G | G | G | G | G | G |
70 | G | E | G | G | G | G | |
140 | G | C | E | G | G | G | |
4.07 | 140 | G | G | G | G | G | G |
4.08 | 140 | G | G | G | G | G | G |
4.09 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
4.10 | 35 | G | G | G | G | G | G |
-14017485
C. No. | Application Rate (g ai/ha) | Visual Growth Réduction (%) 14 Days After Application | |||||
CYPES | ECHCG | SETFA | ORYSA | TRZAS | ZEAMX | ||
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
4.13 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
5.01 | 35 | n/t | C | G | G | G | G |
70 | n/t | C | G | G | G | G | |
140 | n/t | B | G | G | G | G | |
6.01 | 35 | E | G | G | G | G | G |
70 | E | E | G | G | G | G | |
140 | E | D | G | G | G | G | |
6.02 | 35 | E | C | G | G | G | G |
70 | E | C | E | G | G | G | |
140 | E | B | D | G | F | G | |
7.02 | 35 | G | G | n/t | G | G | G |
70 | G | G | n/t | G | G | G | |
140 | G | G | n/t | G | G | G | |
8.01 | 35 | G | G | G | G | G | G |
70 | G | G | G | G | G | G | |
140 | G | G | G | G | G | G | |
9.01 | 140 | G | G | G | G | G | G |
ECHCG: bamyardgrass (Echinochloa crus-gallî)
CYPES: yellow nutsedge (Cyperus esculentus)
ORYSA: rice (Oryza sativà)
SETFA: giant foxtail (Setaria faberi)
TRZAS: wheat, spring (Triticum aestivum)
ZEAMX: maize, corn (Zea mays) g ai/ha: grams active ingrédient per hectare n/t: not tested
Example D. Evaluation of Postemergent Herbicidal Activity in Wheat and Barley
Post-emergent Test III. Seeds of the desired test plant species were planted in Sun Gro MetroMix® 306 planting mixture, which typically has a pH of 6.0 to 6.8 and an organic matter content of about 30 percent, in plastic pots with a surface area of 103.2 square centimeters
-14117485 (cm2). When required to ensure good germination and healthy plants, a fongicide treatment and/or other chemical or physical treatment was applied. The plants were grown for 7-36 days (d) in a greenhouse with an approximate 14 hour (h) photoperiod which was maintained at about 18 °C during the day and 17 °C during the night. Nutrients and water were added on a regular basis and supplémentai lighting was provided with overhead métal halide 1000-Watt lamps as necessary. The plants were employed for testing when they reached the second or third true leaf stage.
A weighed amount, determined by the highest rate to be tested, of each test compound was placed in a 25 mL glass vial and was dissolved in 4 mL of a 97:3 v/v mixture of acetone and DMSO to obtain concentrated stock solutions. If the test compound did not dissolve readily, the mixture was warmed and/or sonicated. The concentrated stock solutions obtained were diluted with 20 mL of an aqueous mixture containing acetone, water, isopropyl alcohol, DMSO, Agri-Dex crop oil concentrate, and X-77 surfactant in a 48:39:10:1.5:1.5:0.02 v/v ratio to obtain spray solutions containing the highest application rates. Additional application rates were obtained by serial dilution of 12 mL of the high rate solution into a solution containing 2 mL of 97:3 v/v mixture of acetone and DMSO and 10 mL of an aqueous mixture containing acetone, water, isopropyl alcohol, DMSO, Agri-Dex crop oil concentrate, and X-77 surfactant in a 48:39:10:1.5:1.5:0.02 v/v ratio to obtain 1/2X, 1/4X, 1/8X and 1/16X rates of the high rate. Compound requirements are based upon a 12 mL application volume at a rate of 187 liters per hectare (L/ha). Formulated compounds were applied to the plant material with an overhead Mandel track sprayer equipped with 8002E nozzles calibrated to deliver 187 L/ha over an application area of 0.503 square meters at a spray height of 18 inches (43 cm) above the average plant canopy height. Control plants were sprayed in the same manner with the solvent blank.
The treated plants and control plants were placed in a greenhouse as described above and watered by subirrigation to prevent wash-off of the test compounds. After 21 d, the condition of the test plants as compared with that of the untreated plants was determined visually and scored on a scale of 0 to 100 percent where 0 corresponds to no injury and 100 corresponds to complété kill.
By applying the well-accepted probit analysis as described by J. Berkson in Journal of the American Statistical Society, 48, 565 (1953) and by D. Finney in “Probit Analysis” Cambridge University Press (1952), the above data can be used to calculate GR20, GR50, GRso and GR90 values, which are defined as growth réduction factors that correspond to the effective dose of herbicide required to kill or control 20 percent, 50 percent, 80 percent or 90 percent, respectively, of a target plant.
-14217485
Some of the compounds tested, application rates employed, plant species tested, and results are given in Table 17.
-14317485
Table 17: Activity of Herbicidal Compounds in Wheat and Barley
Visual growth Réduction (%) 21 Days After Application | VIOTR | w | Q | O | 1 1 | CM CM | CD ko | ω | Q | O | 1 1 | Ok | KO WD | Ch Ch | |
VERPE | < | < | 1 f | 0.28 | CM | KO | < | < | 1 t | 0.0004 | 0.05 | ||||
SINAR | < | < | < | t 1 | ^F | 00 | CM | m | < | < | l 1 | WD | F- | ||
SASK R | O | O | 00 | 1 1 | r* | O CD | WD Ck | Q | O | CQ | 1 1 | O | 00 CM | 00 F- | |
PAPR H | < | < | 1 1 | 0.06 | - | CM | < | 0.0004 | 0.0004 | tf o o o o | |||||
MATC H | Mm | ω | Q | 1 1 | WD | >140 | >140 | 03 | < | < | 1 1 | CD | Ch | KO | |
LAMP U | < | < | < | 1 | O | CM | O | < | 1 1 | CD | O | Ch | |||
KCHS C | Q | 03 | 03 | t 1 | KO | OO CM | KO | O | CQ | < | t 1 | r- | O CM | Ch CD | |
GALA P | Q | CQ | < | 1 1 | CD CM | CD | Mm | W | < | 1 1 | KO CM | CD | O ^F | ||
CIRAR | 0- | Q | O | 1 1 | O CD | O C- | 109 | Q | CQ | < | 1 1 | O\ | WD CM | CD tF | |
TRZAS | b | W | Q | CD | 1 1 | 1 1 | 1 1 | O | O | Mm | tF | 1 1 | 1 1 | 1 1 | |
HORV S | Mm | ω | W | OO | 1 1 | 1 1 | 1 1 | O | <3 | MM | ^F TF | 1 1 | 1 1 | 1 1 | |
Applica tion Rate (g ai/ha) | 17.5 | WD cd | O r- | GR20 | GR50 | GR80 | GR90 | 17.5 | WD CD | O F- | GR20 | GR50 | GR80 | o O) ai O | |
Compo und No. | 1.15 | KO |
-14417485
Visual growth Réduction (%) 21 Days After Application | VIOTR | O | W | Q | 1 1 | tF tF | Ox | >140 | ω | Q | o | 1 l | tF CN | OO F-· | O Λ |
VERPE | CQ | m | < | 1 1 | - | OO | CN | Pi | Q | o | 1 1 | O m | X© X© | o o | |
SINAR | O | u | < | 1 1 | en | TF | CN en | CQ | < | < | 1 1 | X© | en | Ox | |
SASK R | Uh | M | U | 1 1 | Ox CN | o Ox | >140 | Q | CQ | CQ | l t | m | 00 CN | un Ox | |
PAPR H | Q | < | 1 1 | - | F- | CN CN | Q | Q | U | 1 1 | tF CN | CN un | Fr^· | ||
MATC H | Φ | o | O | 1 1 | >140 | >140 | >140 | O | O | O | 1 1 | •-H | >140 | o tf Λ | |
LAMP U | M | < | < | 1 1 | m | X© | Ox | ω | Q | U | 1 1 | un | en Ox | o tF Λ | |
KCHS C | kx | w | Q | 1 1 | un en | o | >140 | Q | U | m | 1 | tf | en en | en o | |
GALA P | < | < | < | 1 1 | - | TF | O | Q | CQ | CQ | 1 1 | F' | en CM | tF tF | |
U | o | o | O | 1 i | >140 | >140 | >140 | Q | O | CQ | 1 1 | tF | un en | un | |
TRZAS | o | o | O | o o | 1 1 | 1 1 | 1 1 | Ü | Û | PL | CM un | 1 1 | 1 1 | 1 1 | |
HORV S | Ü | Ü | O | >140 | 1 1 | 1 t | 1 1 | O | O | <3 | X© X© | 1 1 | 1 1 | 1 1 | |
Applica tion Rate (g ai/ha) | 17.5 | un en | O F- | GR20 | GR50 | GR80 | GR90 | 17.5 | Un m | O | GR20 | GR50 | GR80 | o OX O | |
Compo und No, | 1.23 | TF CN |
4· S'
-14517485
Claims (33)
- WHAT IS CLAIMED IS:1. A compound of the Formula (I):whereinX is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;1 1 t 1 H 1 Ht 11R is OR or NR R , wherein R is hydrogen, Ci-Cg alkyl, or C7-C10 arylalkyl, and R and R are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;R2 is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently C1-C10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;R3 and R4 are independently hydrogen, Ci-Cô alkyl, C|-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, CiCô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, Ci-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Cj-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Cj-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;A is one of groups Al to A36-14617485Rg Rg R6 ^6AlA2A3A4A17A18A19A20-14717485Rg Rg Rg RgA21A22A23A24A25A26A27A28A29 A30 A31 A32Re Re Rg RgA33 A34 A35 A36R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl,C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN; R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino orC2-C4 haloalkylamino, OH, CN, or NO2;-14817485R7and R7 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2C4 haloalkylamino, or phenyl;R8 is hydrogen, Ci-C6 alkyl, Ci-Cé haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Cj-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl;or an N-oxide or agriculturally acceptable sait thereof, with the proviso that the compound is not a compound of Formula (I):whereinX is N, CH, CF, CCI, or CBr;R1 is OR1, wherein R1 is hydrogen or C1-C4 alkyl;R2 is chlorine;R3 and R4 are hydrogen;A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, A18, A19, or A20;R5 is hydrogen, halogen, OH, amino, CN, C1-C3 alkyl, C1-C3 alkoxy, C1-C3 alkylamino, or cyclopropyl;R6, R6, and R6 are independently hydrogen, halogen, OH, NH2, CN, C1-C3 alkyl, CiC3 alkoxy, cyclopropyl, or vinyl;R7and R7 are independently hydrogen, halogen, C1-C3 alkyl, C1-C3 alkoxy, C1-C3 alkylthio, cyclopropyl, or C1-C3 alkylamino, or phenyl; andR8 is hydrogen, C1-C3 alkyl, phenyl, or C1-C3 alkylcarbonyl;or an N-oxide or agriculturally acceptable sait thereof.
- 2. The compound of claim 1 whereinX is CY, wherein Y is C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy,C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;-14917485R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Cj-Cs alkyl, or C7-C10 arylalkyl, and R1 and R1 are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;R is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiRl9R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently C1-C10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;R3 and R4 are independently hydrogen, Ci-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, CiCô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, Cj-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Ci-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, A18, A19, A20, A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;R7and R7 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2C4 haloalkylamino, or phenyl;R8 is hydrogen, Ci-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, or phenyl;or an N-oxide or agriculturally acceptable sait thereof.-15017485
- 3. The compound of claim 1 whereinX is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;R1 is OR1 or NR1 R1 , wherein R1 is Cs-Cg alkyl, or C7-C10 arylalkyl, and R1 and R1 are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;R is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently C1-C10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;R3 and R4 are independently hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, CiCô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, Cj-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, C]-Cé alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Ci-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, Al7, Al 8, Al 9, A20, A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2C4 haloalkylamino, or phenyl;-151Y17485R8 is hydrogen, Cj-Cô alkyl, CpCô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Cj-Côalkoxycarbonyl, Cj-Cô alkylcarbamyl, Cj-Cé alkylsulfonyl, CpCô trialkylsilyl, or phenyl;or an N-oxide or agriculturally acceptable sait thereof.
- 4. The compound of claim 1 whereinX is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Ci-Cg alkyl, or C7-C10 arylalkyl, and1 II 1 HtR and R are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;R2 is F, Br, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently Ci-Cæ alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;R3 and R4 are independently hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, CiCf> alkoxycarbonyl, Ci-C6 alkylcarbamyl, Ci-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, C]-C6 dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Ci-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, A18, A19, A20, A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;-15217485Ύ 7’R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2C4 haloalkylamino, or phenyl;OR is hydrogen, Cj-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Cj-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, or phenyl;or an N-oxide or agriculturally acceptable sait thereof.
- 5. The compound of claim 1 whereinX is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, Cj-C3 alkylthio, or C1-C3 haloalkylthio;R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Cj-Cs alkyl, or C7-C10 arylalkyl, and R1 and R1 are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;•yR is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, CJ-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiRl9R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently Cj-Cjo alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, Cj-Cjo alkoxy, or OH;R3 and R4 are independently Cj-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Cj-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, Cj-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Cj-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Cj-Cô alkoxy or Cj-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, Al 7, Al 8, Al9, A20, A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;-15317485R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;R7and R7 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2C4 haloalkylamino, or phenyl;R8 is hydrogen, Ci-Ce alkyl, Ci-C6 haloalkyl, C3-C6 alkenyl, C3-Cô haloalkenyl, C3-Cô alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cgalkoxycarbonyl, CpCô alkylcarbamyl, Cj-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl;or an N-oxide or agriculturally acceptable sait thereof.
- 6. The compound of claim 1 whereinX is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Ci-Cg alkyl, or C7-C10 arylalkyl, and R and R are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;R2 is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently C1-C10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;R3 and R4 are independently hydrogen, Cj-Cé alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-Cô haloalkenyl, C3-Cô alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, CiCô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Cj-Cè trialkylsilyl, Ci-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Cj-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Ci-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;A is A21, A22, A23, A24, A25, A26, A27, A28, A29, A30, A31, A32, A33, A34, A35, or A36;-15417485R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;R7and R7 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2C4 haloalkylamino, or phenyl;QR is hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Cj-Cé trialkylsilyl, or phenyl;or an N-oxide or agriculturally acceptable sait thereof.
- 7. The compound of claim 1 whereinX is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Ci-Cg alkyl, or C7-C10 arylalkyl, and R1 and R1 are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;R2 is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently Ci-Cæ alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, or OH;R3 and R4 are independently hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, CjCô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, C]-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently-15517485 hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Cj-Cô alkoxy or Ci-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, A18, A19, or A20;R5 is C4 alkyl, C1-C4 haloalkyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, C4 alkylamino, or C2C4 haloalkylamino;R , R , and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2C4 haloalkylamino, or phenyl;QR is hydrogen, Ci-Cô alkyl, Ci-Cô haloalkyl, C3-Cô alkenyl, C3-Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl;or an N-oxide or agriculturally acceptable sait thereof.
- 8. The compound of claim 1 whereinX is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Ci-Cs alkyl, or C7-C10 arylalkyl, andR1 and R* are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;R is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR8 * * * * * * * * 17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl;R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently C1-C10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, C1-C10 alkoxy, orOH;R3 and R4 are independently hydrogen, Ci-Cô alkyl, Ci-Cô haloalkyl, C3-Cô alkenyl,C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Cj-15617485Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, Cj-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Cj-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Cj-Cô alkoxy or Cj-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, A18, A19, or A20;R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, Cj-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;R6, R6, and R6 are independently C4 alkyl, Cj-C4 haloalkyl, halocyclopropyl, C3-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, C1-C4 alkylamino or C2-C4 haloalkylamino, or NO2;R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Cj-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2C4 haloalkylamino, or phenyl;QR is hydrogen, Cj-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Cj-Cô alkoxycarbonyl, Cj-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, or phenyl;or an N-oxide or agriculturally acceptable sait thereof. 9
- 9. The compound of claim 1 whereinX is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Cj-Cs alkyl, or C7-C10 arylalkyl, and R1 and R1 are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;R is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently Cj-Cjo alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, Cj-Cjo alkoxy, or OH;-15717485R3 and R4 are independently hydrogen, Ci-Cô alkyl, Cj-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, CiC6 alkoxycarbonyl, Cj-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, Ci-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or C]-C6 alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;A is Al, A2, A3, A4, A5, A6, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A16, A17, orA18;R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C4-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C]-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;R and R are independently C4 alkyl, C1-C4 haloalkyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 haloalkoxy, C1-C3 haloalkylthio, amino, C4 alkylamino, or C2-C4 haloalkylamino;oR is hydrogen, Ci-Cé alkyl, C]-C6 haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-C6 alkoxycarbonyl, C]-C6 alkylcarbamyl, C]-C6 alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl;or an N-oxide or agriculturally acceptable sait thereof.
- 10. The compound of claim 1 whereinX is N or CY, wherein Y is hydrogen, halogen, C1-C3 alkyl, C1-C3 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkoxy, C1-C3 alkylthio, or C1-C3 haloalkylthio;R1 is OR1 or NR1 R1 , wherein R1 is hydrogen, Ci-Cg alkyl, or C7-C10 arylalkyl, andR1 and R1 are independently hydrogen, C1-C12 alkyl, C3-C12 alkenyl, or C3-C12 alkynyl;R2 is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR10 * * * * * * 17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl;R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are-15817485 independently Ci-Cio alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, Cj-Cio alkoxy, or OH;R3 and R4 are independently hydrogen, Ci-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, CiCô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Ci-Cô alkylsulfonyl, Cj-Cô trialkylsilyl, Ci-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Ci-Cô alkylamino, or, •j» A1R and R taken together with =C represent a 5- or 6-membered saturated ring;A is A3, A6, Ail, A12, Al5, Al8, Al9, or A20;R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN;R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino or C2-C4 haloalkylamino, OH, CN, or NO2;R and R are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2C4 haloalkylamino, or phenyl;R8 is C3-C6 alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, Ci-Cô alkylcarbamyl, Cj-Cô alkylsulfonyl, or Ci-Cô trialkylsilyl;or an N-oxide or agriculturally acceptable sait thereof.
- 11. The compound of any of daims 1-10, wherein R1 is OR1.
- 12. The compound of any of daims 1 or 3-11, wherein X is CF.
- 13. The compound of any of daims 1-5 or 7-12, wherein A is A15
- 14. The compound of any of daims 1-5 or 8-12, wherein R5 is F.-15917485
- 15. A compound of the Formula (I):(I) whereinX is CF;R1 is OR1, wherein R1 is hydrogen, Cj-Cg alkyl, or C7-C10 arylalkyl;R2 is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, C1-C4 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, cyano, or a group of the formula -CR17=CR18-SiR19R20R21, wherein R17 is hydrogen, F, or Cl; R18 is hydrogen, F, Cl, C1-C4 alkyl, or C1-C4 haloalkyl; and R19, R20, and R21 are independently C1-C10 alkyl, C3-C6 cycloalkyl, phenyl, substituted phenyl, Ci-Qo alkoxy, orOH;R3 and R4 are independently hydrogen, Ci-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, CiCô alkoxycarbonyl, C|-C6 alkylcarbamyl, Ci-Cô alkylsulfonyl, Ci-Cô trialkylsilyl, Ci-Cô dialkylphosphonyl, or R3 and R4 taken together with N is a 5- or 6-membered saturated ring, or R3 and R4 taken together represent =CR3 (R4 ), wherein R3 and R4 are independently hydrogen, Ci-Cô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-Cô alkoxy or Ci-Cô alkylamino, or, R3 and R4 taken together with =C represent a 5- or 6-membered saturated ring;A is one of groups Al to A36R6 R6 R6 R6AlA2A3A4-16017485A21A22A23A24-16117485A25A26A27A28A33A34A35A36R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl,C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2-C4 haloalkylamino, OH, or CN; R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino orC2-C4 haloalkylamino, OH, CN, or NO2;R7and R7 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy,Ci-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, C2C4 haloalkylamino, or phenyl;R8 is hydrogen, Ci-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3-Cô haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Cj-Côalkoxycarbonyl, Cj-Cô alkylcarbamyl, C|-C6 alkylsulfonyl, Ci-Cô trialkylsilyl, or phenyl;-16217485 or an N-oxide or agriculturally acceptable sait thereof.
- 16. The compound of claim 15, whereinR1 is OR1, wherein R1 is hydrogen, CpCs alkyl, or C7-C10 arylalkyl;R2 is halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4-alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, Ci-C4-alkoxy, C1-C4 haloalkoxy, C1-C4 alkylthio, or C1-C4 haloalkylthio.R3 and R4 are hydrogen, Ci-Cô alkyl, Ci-Cô haloalkyl, C3-C6 alkenyl, C3-C6 •J haloalkenyl, C3-C6 alkynyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, or R andR4 taken together represent =CR3(R4), wherein R3 and R4 are independently hydrogen, CiCô alkyl, C3-C6 alkenyl, C3-C6 alkynyl, Ci-C6 alkoxy or Ci-Cé alkylamino;A is Al, A2, A3, A7, A8, A9, A10, Ail, A12, A13, A14, A15, A21, A22, A23, A24,A27, A28, A29, A30, A31, or A32;R5 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, C1-C3 haloalkylthio, amino, C1-C4 alkylamino, or C2-C4 haloalkylamino;R6, R6, and R6 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, halocyclopropyl, C2-C4 alkenyl, C2-C4 haloalkenyl, C2-C4 alkynyl, C1-C3 alkoxy, C1-C3 haloalkoxy, CN, orNCh;R7and R7 are independently hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, C1-C3 alkoxy, C1-C3 haloalkoxy, C1-C3 alkylthio, cyclopropyl, amino or C1-C4 alkylamino;R8 is hydrogen, C]-C6 alkyl, C1-C4 haloalkyl, C3-C6 alkenyl, C3-C6 haloalkenyl, formyl, C1-C3 alkylcarbonyl, C1-C3 haloalkylcarbonyl, Ci-Cô alkoxycarbonyl, or C|-C6 alkylcarbamyl.
- 17. The compound of claim 15 or 16, wherein R is halogen, C2-C4-alkenyl, C2-C4 haloalkenyl, or Ci-C4-alkoxy.
- 18. The compound of any of daims 15-17, wherein R2 is Cl, methoxy, vinyl, or 1propenyl.
- 19. The compound of any of daims 15-18, wherein R3 and R4 are hydrogen.-16317485
- 20. The compound of any of daims 15-19, wherein A is Al, A2, A3, A7, A8, A9, A10, A13, A14, orA15.
- 21. The compound of any of daims 15-20, wherein A is Al, A2, A3, Al3, Al4, or Al5.
- 22. The compound of any of daims 15-21, wherein A is Al5.
- 23. The compound of any of daims 15-22, wherein R5 is hydrogen or F.
- 24. The compound of any of daims 15-23 wherein R5 is F.
- 25. The compound of any of daims 15-24, wherein R6 is hydrogen or F.
- 26. The compound of any of daims 15-25, wherein R6 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, cyclopropyl, C2-C4 alkynyl, CN, or NO2.
- 27. The compound of any of daims 15-26, wherein R6, R6, and R6 are ail hydrogen.
- 28. The compound of any of daims 15-27, wherein the compound is 4-amino-3-chloro-5fhioro-6-(7-fluoro-177-indol-6-yl) picolinic acid.
- 29. The compound of any of daims 15-27, wherein the compound is methyl 4-amino-3chloro-5-fluoro-6-(7-fluoro-177-indol-6-yl) picolinate.
- 30. A herbicidal composition comprising a compound of any of daims 1-29 and an agriculturally acceptable adjuvant or carrier.
- 31. The composition of claim 30, further comprising an additional pesticide.
- 32. The composition of claim 30 or 31, further comprising a herbicidal safener.
- 33. A method of controlling undesirable végétation which comprises applying to végétation or an area adjacent the végétation or applying to soil or water to prevent the-16417485 emergence or growth of végétation a compound of any of claims 1-29 or a herbicidal composition of any of claims 30-32.
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US13/839,000 | 2013-03-15 |
Publications (1)
Publication Number | Publication Date |
---|---|
OA17485A true OA17485A (en) | 2016-12-30 |
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
AU2018214049B2 (en) | 4-amino-6-(heterocyclic)picolinates and 6-amino-2-(heterocyclic) pyrimidine-4-carboxylates and their use as herbicides | |
AU2014235455B2 (en) | 4-amino-6-(heterocyclic)picolinates and 6-amino-2-(heterocyclic)pyrimidine-4-carboxylates and their use as herbicides | |
US10765114B2 (en) | 4-amino-6-(pyridyl and 2-substitutedphenyl)-picolinates and 6-amino-2-(pyridyl and 2-substitutedphenyl)-pyrimidine-4-carboxylates and their use as herbicides | |
EP2967069B1 (en) | 4-amino-6-(4-substituted-phenyl)-picolinates and 6-amino-2-(4-substituted-phenyl)-pyrimidine-4-carboxylates and their use as herbicides | |
EP2970186B1 (en) | 4-amino-6-(heterocyclic)picolinates and 6-amino-2-(heterocyclic) pyrimidine-4-carboxylates and their use as herbicides | |
OA17485A (en) | 4-Amino-6-(heterocycIic) picolinates and 6amino-2 (heterocyclic) pyrimidine-4-carboxylates and their use as herbicides. | |
OA17491A (en) | 4-Amino-6-(heterocycIic) picoIinates and 6amino-2-(heterocyclic) pyrimidine-4-carboxylates and their use as herbicides. | |
NZ751548B2 (en) | 4-amino-6-(4-substituted-phenyl)-picolinates and 6-amino-2-(4-substituted-phenyl)-pyrimidine-4-carboxylates and their use as herbicides |