NZ212976A - Amino-anthracenedione-platinum complexes and anti-cancer compositions - Google Patents
Amino-anthracenedione-platinum complexes and anti-cancer compositionsInfo
- Publication number
- NZ212976A NZ212976A NZ212976A NZ21297685A NZ212976A NZ 212976 A NZ212976 A NZ 212976A NZ 212976 A NZ212976 A NZ 212976A NZ 21297685 A NZ21297685 A NZ 21297685A NZ 212976 A NZ212976 A NZ 212976A
- Authority
- NZ
- New Zealand
- Prior art keywords
- anthracenedione
- amino
- platinum complexes
- cancer compositions
- cancer
- Prior art date
Links
- OPEJZQFCUBLFRA-UHFFFAOYSA-N 3-aminoanthracene-1,2-dione;platinum Chemical class [Pt].C1=CC=C2C=C(C(=O)C(C(N)=C3)=O)C3=CC2=C1 OPEJZQFCUBLFRA-UHFFFAOYSA-N 0.000 title 1
- 230000001093 anti-cancer Effects 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F15/00—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table
- C07F15/0006—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table compounds of the platinum group
- C07F15/0086—Platinum compounds
- C07F15/0093—Platinum compounds without a metal-carbon linkage
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT8422224A IT1213205B (it) | 1984-08-03 | 1984-08-03 | Amminoantrachinoni cis-platino complessi e loro impiego come agenti antitumorali. |
| IT21324/85A IT1201425B (it) | 1985-06-27 | 1985-06-27 | Cis-platino complessi e loro impiego come agenti antitumorali |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ212976A true NZ212976A (en) | 1989-10-27 |
Family
ID=26327865
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ212976A NZ212976A (en) | 1984-08-03 | 1985-08-02 | Amino-anthracenedione-platinum complexes and anti-cancer compositions |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4732893A (enFirst) |
| EP (1) | EP0170290B1 (enFirst) |
| AU (1) | AU571988B2 (enFirst) |
| CA (1) | CA1251203A (enFirst) |
| DE (1) | DE3578180D1 (enFirst) |
| DK (1) | DK352285A (enFirst) |
| ES (1) | ES8604248A1 (enFirst) |
| GR (1) | GR851903B (enFirst) |
| HU (1) | HU193339B (enFirst) |
| IL (1) | IL76002A0 (enFirst) |
| NZ (1) | NZ212976A (enFirst) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4732970A (en) * | 1986-06-13 | 1988-03-22 | American Cyanamid Company | Antitumor amino acid and peptide derivatives of 1,4-bis(aminoalkyl and hydroxy-aminoalkyl)amino)-5,8-dihydroxyanthraquinones |
| US4772735A (en) * | 1986-08-25 | 1988-09-20 | University Of Delaware | Coordination complexes of platinum with amides |
| WO1989005815A1 (en) * | 1987-12-18 | 1989-06-29 | Boehringer Biochemia Robin S.P.A. | Amino anthracenediones-bis platinum complexes, useful as antitumoral agents |
| US5436243A (en) * | 1993-11-17 | 1995-07-25 | Research Triangle Institute Duke University | Aminoanthraquinone derivatives to combat multidrug resistance |
| DE19635557C2 (de) * | 1996-09-02 | 1998-09-03 | Baykut Goekhan Dr | Neue Hydroxyanthrachinon-Derivate |
| FR2786484B1 (fr) * | 1998-11-30 | 2001-01-05 | Oreal | Aminoanthraquinones cationiques, leur utilisation pour la teinture des fibres keratiniques, compositions tinctoriales les renfermant et procedes de teinture |
| CZ20031262A3 (en) * | 2000-10-16 | 2004-03-17 | Neopharm, Inc. | Liposomal formulation of mitoxantrone |
| US7138520B2 (en) * | 2003-01-13 | 2006-11-21 | Massachusetts Institute Of Technology | Coordination complexes having tethered therapeutic agents and/or targeting moieties, and methods of making and using the same |
| CN105254679B (zh) * | 2013-11-19 | 2018-05-15 | 辽宁大学 | 单6-(氮杂环取代)蒽醌二氯化铂配合物及其制备方法和应用 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2166076A (en) * | 1936-02-27 | 1939-07-11 | Baker & Co Inc | Platinum metal compounds and methods of making them |
| US3876675A (en) * | 1969-01-21 | 1975-04-08 | Du Pont | Bis-chelate derivatives of palladium |
| DE2730342C3 (de) * | 1976-07-07 | 1980-12-18 | Ciba-Geigy Ag, Basel (Schweiz) | Verfahren zur Herstellung von Anthrachinonverbindungen |
| US4197249A (en) * | 1977-08-15 | 1980-04-08 | American Cyanamid Company | 1,4-Bis(substituted-amino)-5,8-dihydroxyanthraquinones and leuco bases thereof |
| NL7810433A (nl) * | 1977-10-19 | 1979-04-23 | Johnson Matthey Co Ltd | Nieuwe platinaverbindingen. |
| SE7903361L (sv) * | 1978-04-20 | 1979-10-21 | Johnson Matthey Co Ltd | Kompositioner innehallande platina |
| US4283342A (en) * | 1980-01-31 | 1981-08-11 | University Of Delaware | Anticancer agents and methods of manufacture |
| US4296030A (en) * | 1980-04-09 | 1981-10-20 | American Cyanamid Company | Metal chelates of 1,4-bis(substituted-amino-5,8-dihydroxy-anthraquinones |
| AU541781B2 (en) * | 1981-05-22 | 1985-01-17 | American Cyanamid Company | Hetero alkylene bis antraquinones |
| DE3574932D1 (de) * | 1984-02-27 | 1990-02-01 | American Cyanamid Co | Verwendung von 1,4 bisubstituierten anthrachinonen zur herstellung von immunsuppressiva. |
| US4588831A (en) * | 1984-11-09 | 1986-05-13 | Natec | Platinum complex compounds of substituted 5,8-dihydroxyl-1,4-naphthoquinone, and process for their production and use |
-
1985
- 1985-08-01 IL IL76002A patent/IL76002A0/xx not_active IP Right Cessation
- 1985-08-02 ES ES545861A patent/ES8604248A1/es not_active Expired
- 1985-08-02 NZ NZ212976A patent/NZ212976A/xx unknown
- 1985-08-02 DK DK352285A patent/DK352285A/da not_active Application Discontinuation
- 1985-08-02 EP EP85109732A patent/EP0170290B1/en not_active Expired - Lifetime
- 1985-08-02 AU AU45733/85A patent/AU571988B2/en not_active Ceased
- 1985-08-02 DE DE8585109732T patent/DE3578180D1/de not_active Expired - Lifetime
- 1985-08-02 GR GR851903A patent/GR851903B/el unknown
- 1985-08-02 CA CA000488014A patent/CA1251203A/en not_active Expired
- 1985-08-02 US US06/761,787 patent/US4732893A/en not_active Expired - Fee Related
- 1985-08-02 HU HU852973A patent/HU193339B/hu not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IL76002A0 (en) | 1985-12-31 |
| AU4573385A (en) | 1986-02-06 |
| DE3578180D1 (de) | 1990-07-19 |
| HUT38366A (en) | 1986-05-28 |
| ES8604248A1 (es) | 1986-01-16 |
| HU193339B (en) | 1987-09-28 |
| EP0170290A3 (en) | 1986-04-23 |
| DK352285D0 (da) | 1985-08-02 |
| US4732893A (en) | 1988-03-22 |
| AU571988B2 (en) | 1988-04-28 |
| GR851903B (enFirst) | 1985-12-03 |
| DK352285A (da) | 1986-02-04 |
| CA1251203A (en) | 1989-03-14 |
| EP0170290A2 (en) | 1986-02-05 |
| ES545861A0 (es) | 1986-01-16 |
| EP0170290B1 (en) | 1990-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ218440A (en) | N-benzoylureas and anti-cancer compositions | |
| NZ211145A (en) | 4-aza-5-alpha-androst-1-en-3-ones and pharmaceutical compositions | |
| NZ212005A (en) | Pyrrolobenzimidazoles and pharmaceutical compositions | |
| IL74343A0 (en) | Liposome-gel compositions | |
| GB8509884D0 (en) | Compositions | |
| NZ212099A (en) | Substituted arylhydroxamates and pharmaceutical compositions | |
| GB8426152D0 (en) | Medicinal compositions | |
| IL74950A (en) | Pharmaceutical compositions comprising iron complexes with hydroxypyrone derivatives | |
| PT80275A (en) | Compositions | |
| NZ214522A (en) | Pteridine derivatives and pharmaeutical compositions | |
| ZA859339B (en) | Processes and compositions | |
| GB8507516D0 (en) | Compositions | |
| GB8505058D0 (en) | Powder compositions | |
| EP0159194A3 (en) | Iron 3-hydroxypyrone or 3-hydroxypyridone complexes and pharmaceutical compositions containing them | |
| GB2154874B (en) | Bromoscriptine compositions | |
| NZ214259A (en) | Homopropargylamines and fungicidal compositions | |
| NZ212953A (en) | 3-acyl-1-aminoalkyl-1h-indoles and pharmaceutical compositions thereof | |
| NZ212976A (en) | Amino-anthracenedione-platinum complexes and anti-cancer compositions | |
| NZ211872A (en) | Chartreusin derivatives and antitumorous compositions | |
| EP0182611A3 (en) | Platinum-phosphine-vinylsiloxane complexes | |
| NZ213581A (en) | Carboxyalkyldipeptides and pharmaceutical compositions | |
| EP0230052A3 (en) | Immunoamplifiers and related compositions | |
| GB2158714B (en) | Composition | |
| GB8521761D0 (en) | Detergent-softener compositions | |
| GB8418082D0 (en) | Compositions |