NZ199828A - 4-substituted mercapto-2-oxo-1-azetidine-sulphonic acid derivatives and pharmaceutical compositions - Google Patents
4-substituted mercapto-2-oxo-1-azetidine-sulphonic acid derivatives and pharmaceutical compositionsInfo
- Publication number
- NZ199828A NZ199828A NZ199828A NZ19982882A NZ199828A NZ 199828 A NZ199828 A NZ 199828A NZ 199828 A NZ199828 A NZ 199828A NZ 19982882 A NZ19982882 A NZ 19982882A NZ 199828 A NZ199828 A NZ 199828A
- Authority
- NZ
- New Zealand
- Prior art keywords
- amino
- compound
- accordance
- oxo
- hydrogen
- Prior art date
Links
- -1 4-substituted mercapto-2-oxo-1-azetidine-sulphonic acid Chemical class 0.000 title claims description 71
- 239000008194 pharmaceutical composition Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 77
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 59
- 239000001257 hydrogen Substances 0.000 claims description 30
- 229910052739 hydrogen Inorganic materials 0.000 claims description 30
- 125000000217 alkyl group Chemical group 0.000 claims description 25
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 23
- KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical compound COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 22
- 150000002431 hydrogen Chemical class 0.000 claims description 15
- 125000003118 aryl group Chemical group 0.000 claims description 13
- 125000002252 acyl group Chemical group 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 8
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 7
- 150000001768 cations Chemical class 0.000 claims description 7
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 5
- 125000004104 aryloxy group Chemical group 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 3
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 3
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 150000001721 carbon Chemical group 0.000 claims 1
- 238000000034 method Methods 0.000 description 41
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- 125000004149 thio group Chemical group *S* 0.000 description 33
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 30
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 30
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- 238000002844 melting Methods 0.000 description 22
- 230000008018 melting Effects 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 20
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 150000004702 methyl esters Chemical class 0.000 description 14
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 13
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 12
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 229910052736 halogen Inorganic materials 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 150000002367 halogens Chemical class 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 7
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 7
- 229960003424 phenylacetic acid Drugs 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 6
- 238000010511 deprotection reaction Methods 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- XCYCLYQMEZDUMZ-WUJLRWPWSA-N 2-[(2s,3r)-3-amino-4-oxo-1-sulfoazetidin-2-yl]sulfanylacetic acid Chemical compound N[C@H]1[C@H](SCC(O)=O)N(S(O)(=O)=O)C1=O XCYCLYQMEZDUMZ-WUJLRWPWSA-N 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- LVQFHDAKZHGEAJ-UHFFFAOYSA-M 4-methylbenzenesulfonate Chemical compound [CH2]C1=CC=C(S([O-])(=O)=O)C=C1 LVQFHDAKZHGEAJ-UHFFFAOYSA-M 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 229910014033 C-OH Inorganic materials 0.000 description 4
- 229910014570 C—OH Inorganic materials 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 4
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 3
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 229930182555 Penicillin Natural products 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 150000002960 penicillins Chemical class 0.000 description 3
- LVTHXRLARFLXNR-UHFFFAOYSA-M potassium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate Chemical compound [K+].[O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F LVTHXRLARFLXNR-UHFFFAOYSA-M 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000000547 substituted alkyl group Chemical group 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- WVJXGOQEFTYBSR-IFMALSPDSA-N (2r,3r)-2-methylsulfanyl-4-oxo-3-(tritylamino)azetidine-1-sulfonic acid Chemical compound O=C1N(S(O)(=O)=O)[C@H](SC)[C@@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 WVJXGOQEFTYBSR-IFMALSPDSA-N 0.000 description 2
- ZBZYMXHTRAAATC-IFMALSPDSA-N (3r,4r)-4-methylsulfanyl-3-(tritylamino)azetidin-2-one Chemical compound CS[C@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 ZBZYMXHTRAAATC-IFMALSPDSA-N 0.000 description 2
- BODGSCVEFPUHGG-IAPPQJPRSA-N (3r,4s)-4-[(4-chlorophenyl)methylsulfanyl]-3-(tritylamino)azetidin-2-one Chemical compound C1=CC(Cl)=CC=C1CS[C@H]1[C@H](NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C(=O)N1 BODGSCVEFPUHGG-IAPPQJPRSA-N 0.000 description 2
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 2
- VMHUARXJDIVGNG-UHFFFAOYSA-N 1-(tritylamino)azetidin-2-one Chemical compound O=C1CCN1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 VMHUARXJDIVGNG-UHFFFAOYSA-N 0.000 description 2
- YZUAEMWUAVEPKS-GGAORHGYSA-N 2-[(2s,3r)-4-oxo-3-(tritylamino)azetidin-2-yl]sulfanylacetic acid Chemical compound OC(=O)CS[C@@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 YZUAEMWUAVEPKS-GGAORHGYSA-N 0.000 description 2
- CDFGMYLBUSYTKQ-UHFFFAOYSA-N 2-oxoazetidine-1-sulfonic acid Chemical compound OS(=O)(=O)N1CCC1=O CDFGMYLBUSYTKQ-UHFFFAOYSA-N 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 2
- 229930186147 Cephalosporin Natural products 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 101000777301 Homo sapiens Uteroglobin Proteins 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- 102100031083 Uteroglobin Human genes 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001408 amides Chemical group 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 229940124587 cephalosporin Drugs 0.000 description 2
- 150000001780 cephalosporins Chemical class 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 125000000068 chlorophenyl group Chemical group 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 125000004966 cyanoalkyl group Chemical group 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- UAXYBJSAPFTPNB-ZHACJKMWSA-N ethyl (2e)-2-(3-ethyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)acetate Chemical compound O=C1N(CC)C(=C/C(=O)OCC)\SC1N1CCCCC1 UAXYBJSAPFTPNB-ZHACJKMWSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- XALRIMOAWPYCNG-IXCJQBJRSA-N (2r,3r)-2-[(4-chlorophenyl)methylsulfanyl]-4-oxo-3-(tritylamino)azetidine-1-sulfonic acid Chemical compound S([C@H]1N(C([C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C=1C=CC=CC=1)=O)S(=O)(=O)O)CC1=CC=C(Cl)C=C1 XALRIMOAWPYCNG-IXCJQBJRSA-N 0.000 description 1
- CLPAUMVVTBNDGG-PSASIEDQSA-N (2r,3r)-3-amino-2-[(2-chlorophenyl)methylsulfanyl]-4-oxoazetidine-1-sulfonic acid Chemical group OS(=O)(=O)N1C(=O)[C@@H](N)[C@H]1SCC1=CC=CC=C1Cl CLPAUMVVTBNDGG-PSASIEDQSA-N 0.000 description 1
- RYSCMWPPMNKCJD-PSASIEDQSA-N (2r,3r)-3-amino-2-[(4-chlorophenyl)methylsulfanyl]-4-oxoazetidine-1-sulfonic acid Chemical compound OS(=O)(=O)N1C(=O)[C@@H](N)[C@H]1SCC1=CC=C(Cl)C=C1 RYSCMWPPMNKCJD-PSASIEDQSA-N 0.000 description 1
- XCHQGDOOCJKIAY-VVJJHMBFSA-N (2r,3r)-3-amino-2-methylsulfanyl-4-oxoazetidine-1-sulfonic acid Chemical compound CS[C@@H]1[C@H](N)C(=O)N1S(O)(=O)=O XCHQGDOOCJKIAY-VVJJHMBFSA-N 0.000 description 1
- RYSCMWPPMNKCJD-WCBMZHEXSA-N (2r,3s)-3-amino-2-[(4-chlorophenyl)methylsulfanyl]-4-oxoazetidine-1-sulfonic acid Chemical compound OS(=O)(=O)N1C(=O)[C@H](N)[C@H]1SCC1=CC=C(Cl)C=C1 RYSCMWPPMNKCJD-WCBMZHEXSA-N 0.000 description 1
- XALRIMOAWPYCNG-IAPPQJPRSA-N (2s,3r)-2-[(4-chlorophenyl)methylsulfanyl]-4-oxo-3-(tritylamino)azetidine-1-sulfonic acid Chemical group S([C@@H]1N(C([C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C=1C=CC=CC=1)=O)S(=O)(=O)O)CC1=CC=C(Cl)C=C1 XALRIMOAWPYCNG-IAPPQJPRSA-N 0.000 description 1
- PLSQOJDFTDBYQZ-VDTYLAMSSA-N (2s,3r)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-methylsulfanyl-4-oxoazetidine-1-sulfonic acid Chemical compound CS[C@H]1[C@H](NC(=O)OC(C)(C)C)C(=O)N1S(O)(=O)=O PLSQOJDFTDBYQZ-VDTYLAMSSA-N 0.000 description 1
- RYSCMWPPMNKCJD-SCZZXKLOSA-N (2s,3r)-3-amino-2-[(4-chlorophenyl)methylsulfanyl]-4-oxoazetidine-1-sulfonic acid Chemical group OS(=O)(=O)N1C(=O)[C@@H](N)[C@@H]1SCC1=CC=C(Cl)C=C1 RYSCMWPPMNKCJD-SCZZXKLOSA-N 0.000 description 1
- MOZTTZBTRBOIAT-VVJJHMBFSA-N (3r,4r)-3-amino-4-methylsulfanylazetidin-2-one Chemical compound CS[C@H]1NC(=O)[C@H]1N MOZTTZBTRBOIAT-VVJJHMBFSA-N 0.000 description 1
- BODGSCVEFPUHGG-IXCJQBJRSA-N (3r,4r)-4-[(4-chlorophenyl)methylsulfanyl]-3-(tritylamino)azetidin-2-one Chemical group C1=CC(Cl)=CC=C1CS[C@@H]1[C@H](NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C(=O)N1 BODGSCVEFPUHGG-IXCJQBJRSA-N 0.000 description 1
- AYQZTQXDNITKRP-IFMALSPDSA-N (3r,4r)-4-methylsulfonyl-3-(tritylamino)azetidin-2-one Chemical compound CS(=O)(=O)[C@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 AYQZTQXDNITKRP-IFMALSPDSA-N 0.000 description 1
- ZBZYMXHTRAAATC-IRLDBZIGSA-N (3r,4s)-4-methylsulfanyl-3-(tritylamino)azetidin-2-one Chemical group CS[C@@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 ZBZYMXHTRAAATC-IRLDBZIGSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 1
- YFMLAZBUXVEFHJ-UHFFFAOYSA-N 2,2,2-trifluoro-N-silylacetamide Chemical compound FC(F)(F)C(=O)N[SiH3] YFMLAZBUXVEFHJ-UHFFFAOYSA-N 0.000 description 1
- RZYHXKLKJRGJGP-UHFFFAOYSA-N 2,2,2-trifluoro-n,n-bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)N([Si](C)(C)C)C(=O)C(F)(F)F RZYHXKLKJRGJGP-UHFFFAOYSA-N 0.000 description 1
- WUEPMEXUMQVEGN-UHFFFAOYSA-N 2,2,2-trifluoroacetic acid;2,2,2-trifluoro-n-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethyl]acetamide Chemical compound OC(=O)C(F)(F)F.FC(F)(F)C(=O)NCCNCCNC(=O)C(F)(F)F WUEPMEXUMQVEGN-UHFFFAOYSA-N 0.000 description 1
- IQVADDJLQDIUIC-UHFFFAOYSA-N 2,6-dimethylpyridine;sulfur trioxide Chemical compound O=S(=O)=O.CC1=CC=CC(C)=N1 IQVADDJLQDIUIC-UHFFFAOYSA-N 0.000 description 1
- XCYCLYQMEZDUMZ-NQXXGFSBSA-N 2-[(2r,3r)-3-amino-4-oxo-1-sulfoazetidin-2-yl]sulfanylacetic acid Chemical compound N[C@H]1[C@@H](SCC(O)=O)N(S(O)(=O)=O)C1=O XCYCLYQMEZDUMZ-NQXXGFSBSA-N 0.000 description 1
- OAONRDQMBRNHKF-NQXXGFSBSA-N 2-[(2r,3r)-3-amino-4-oxoazetidin-2-yl]sulfanylacetic acid Chemical compound N[C@H]1[C@@H](SCC(O)=O)NC1=O OAONRDQMBRNHKF-NQXXGFSBSA-N 0.000 description 1
- OAONRDQMBRNHKF-WUJLRWPWSA-N 2-[(2s,3r)-3-amino-4-oxoazetidin-2-yl]sulfanylacetic acid Chemical compound N[C@H]1[C@H](SCC(O)=O)NC1=O OAONRDQMBRNHKF-WUJLRWPWSA-N 0.000 description 1
- GZDNDVUJSARLLF-UHFFFAOYSA-N 2-methylpyridine;sulfur trioxide Chemical compound O=S(=O)=O.CC1=CC=CC=N1 GZDNDVUJSARLLF-UHFFFAOYSA-N 0.000 description 1
- WIOZPTKQKIKZLI-UHFFFAOYSA-N 2-methylsulfanyl-4-oxoazetidine-1-sulfonic acid Chemical compound O=C1N(C(C1)SC)S(=O)(=O)O WIOZPTKQKIKZLI-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- ZAUWZWFPEMDUSL-UHFFFAOYSA-N 3-(tritylamino)azetidin-2-one Chemical compound O=C1NCC1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 ZAUWZWFPEMDUSL-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 1
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 1
- 125000003341 7 membered heterocyclic group Chemical group 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 101100313763 Arabidopsis thaliana TIM22-2 gene Proteins 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- LXWBXEWUSAABOA-UHFFFAOYSA-N Cephamycin-C Natural products S1CC(COC(N)=O)=C(C(O)=O)N2C(=O)C(OC)(NC(=O)CCCC(N)C(O)=O)C21 LXWBXEWUSAABOA-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241001676573 Minium Species 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010057190 Respiratory tract infections Diseases 0.000 description 1
- QWQONZVLXJGXHV-UHFFFAOYSA-N [chlorosulfonyloxy(dimethyl)silyl]methane Chemical compound C[Si](C)(C)OS(Cl)(=O)=O QWQONZVLXJGXHV-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 1
- 125000005276 alkyl hydrazino group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000003782 beta lactam antibiotic agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- LXWBXEWUSAABOA-VXSYNFHWSA-N cephamycin C Chemical compound S1CC(COC(N)=O)=C(C(O)=O)N2C(=O)[C@@](OC)(NC(=O)CCC[C@@H](N)C(O)=O)[C@H]21 LXWBXEWUSAABOA-VXSYNFHWSA-N 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-O dicyclohexylazanium Chemical compound C1CCCCC1[NH2+]C1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-O 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- JILPJDVXYVTZDQ-UHFFFAOYSA-N lithium methoxide Chemical compound [Li+].[O-]C JILPJDVXYVTZDQ-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229940111688 monobasic potassium phosphate Drugs 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- AFDQGRURHDVABZ-UHFFFAOYSA-N n,n-dimethylformamide;sulfur trioxide Chemical compound O=S(=O)=O.CN(C)C=O AFDQGRURHDVABZ-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- ZUFQCVZBBNZMKD-UHFFFAOYSA-M potassium 2-ethylhexanoate Chemical compound [K+].CCCCC(CC)C([O-])=O ZUFQCVZBBNZMKD-UHFFFAOYSA-M 0.000 description 1
- GNSKLFRGEWLPPA-UHFFFAOYSA-M potassium dihydrogen phosphate Chemical compound [K+].OP(O)([O-])=O GNSKLFRGEWLPPA-UHFFFAOYSA-M 0.000 description 1
- 239000008057 potassium phosphate buffer Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- MFPWEWYKQYMWRO-UHFFFAOYSA-N tert-butyl carboxy carbonate Chemical compound CC(C)(C)OC(=O)OC(O)=O MFPWEWYKQYMWRO-UHFFFAOYSA-N 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- WIMAKAOYSPYAJV-IYSWYEEDSA-N tert-butyl n-[(2r,3r)-2-methylsulfanyl-4-oxoazetidin-3-yl]carbamate Chemical compound CS[C@H]1NC(=O)[C@H]1NC(=O)OC(C)(C)C WIMAKAOYSPYAJV-IYSWYEEDSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 150000007944 thiolates Chemical class 0.000 description 1
- 208000019206 urinary tract infection Diseases 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/09—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4
- C07D205/095—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4 and with a nitrogen atom directly attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US24925881A | 1981-03-30 | 1981-03-30 | |
US28375181A | 1981-07-16 | 1981-07-16 |
Publications (1)
Publication Number | Publication Date |
---|---|
NZ199828A true NZ199828A (en) | 1985-11-08 |
Family
ID=26939931
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NZ199828A NZ199828A (en) | 1981-03-30 | 1982-02-24 | 4-substituted mercapto-2-oxo-1-azetidine-sulphonic acid derivatives and pharmaceutical compositions |
Country Status (11)
Families Citing this family (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
MX7096E (es) * | 1980-12-05 | 1987-06-19 | Takeda Chemical Industries Ltd | Metodo para preparacion de derivados de 2-oxoazetidina |
JPS58210060A (ja) * | 1982-05-31 | 1983-12-07 | Takeda Chem Ind Ltd | 2−オキソアゼチジン誘導体、その製造法および用途 |
DE3342929A1 (de) * | 1983-11-26 | 1985-06-05 | Bayer Ag, 5090 Leverkusen | Ss-lactamantibiotika, verfahren zu deren herstellung sowie ihre verwendung als arzneimittel |
Family Cites Families (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CA1338538C (en) * | 1979-06-08 | 1996-08-20 | Taisuke Matsuo | 1-sulfo-2-oxoazetidine derivatives and their production |
MX7096E (es) * | 1980-12-05 | 1987-06-19 | Takeda Chemical Industries Ltd | Metodo para preparacion de derivados de 2-oxoazetidina |
-
1982
- 1982-02-24 NZ NZ199828A patent/NZ199828A/en unknown
- 1982-02-24 AU AU80766/82A patent/AU557649B2/en not_active Ceased
- 1982-03-01 PH PH26928A patent/PH21999A/en unknown
- 1982-03-02 IL IL65146A patent/IL65146A0/xx unknown
- 1982-03-09 GR GR67528A patent/GR76465B/el unknown
- 1982-03-29 IE IE750/82A patent/IE52723B1/en unknown
- 1982-03-29 EP EP82102644A patent/EP0061763B1/en not_active Expired
- 1982-03-29 ES ES510903A patent/ES510903A0/es active Granted
- 1982-03-29 DE DE8282102644T patent/DE3271742D1/de not_active Expired
- 1982-03-29 PT PT74671A patent/PT74671B/pt unknown
- 1982-03-29 DK DK142582A patent/DK142582A/da not_active Application Discontinuation
-
1983
- 1983-01-12 ES ES518920A patent/ES518920A0/es active Granted
-
1984
- 1984-01-23 PH PH30152A patent/PH20040A/en unknown
Also Published As
Publication number | Publication date |
---|---|
ES8405764A1 (es) | 1984-06-16 |
ES8305711A1 (es) | 1983-04-16 |
IL65146A0 (en) | 1982-05-31 |
IE52723B1 (en) | 1988-02-03 |
ES510903A0 (es) | 1983-04-16 |
PH20040A (en) | 1986-09-04 |
EP0061763A1 (en) | 1982-10-06 |
PT74671A (en) | 1982-04-01 |
AU557649B2 (en) | 1987-01-08 |
GR76465B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1984-08-10 |
AU8076682A (en) | 1982-10-07 |
IE820750L (en) | 1982-09-30 |
EP0061763B1 (en) | 1986-06-18 |
PT74671B (en) | 1983-11-08 |
PH21999A (en) | 1988-05-02 |
ES518920A0 (es) | 1984-06-16 |
DE3271742D1 (en) | 1986-07-24 |
DK142582A (da) | 1982-10-01 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US4581170A (en) | N-hydroxyl protecting groups and process and intermediates for the preparation of 3-acylamino-1-hydroxy-2-azetidinones | |
EP0051381B1 (en) | O-sulfated beta-lactam hydroxamic acids | |
US4633017A (en) | N-hydroxy protecting groups and process for the preparation of 3-acylamino-1-hydroxy-2-azetidinones | |
CA1246572A (en) | 2-oxo-1-[[(substituted sulfonyl)amino]- carbonyl]azetidines | |
EP0076758B1 (en) | 4-ether derivatives of 2-azetidinone-1-sulfonic acids | |
EP0303286A1 (en) | 2-Oxo-1-[[(substituted sulfonyl)amino]-carbonyl]azetidines | |
EP0085291B1 (en) | 2-oxo-1-(aminocarbonylaminosulfonylaminocarbonyl)azetidines | |
EP0068466B1 (en) | 4-aryl or heteroaryl thio-2-oxo-1-azetidinesulfonic acid salts and process for their preparation | |
US4534896A (en) | 3-Acylamino-2-oxoazetidine-1-(β-oxopropionic acid) | |
US5189157A (en) | Antibacterial cephalosporin compounds | |
US4533660A (en) | Antibacterial O-sulfated β-lactam hydroxamic acids | |
NZ199828A (en) | 4-substituted mercapto-2-oxo-1-azetidine-sulphonic acid derivatives and pharmaceutical compositions | |
US4680388A (en) | O-sulfated spiro β-lactam hydroxamic acids | |
CA1253502A (en) | 4-[[(amidomethyl)oxy]methyl]-2-oxo-1- azetidinesulfonic acid salts | |
NZ201523A (en) | Beta-lactam antibiotic;2-oxo((acylamino)sulphonyl)azetidines | |
US4638060A (en) | O-sulfated spiro β-lactam hydroxamic acids | |
US4734496A (en) | 4-amino derivatives of 2-oxo-1-azetidinesulfonic acid salts | |
US4548751A (en) | (2-Oxo-1-azetidinyloxy)-2-propenoic acid | |
GB2103212A (en) | 4-Substituted derivatives of 2-oxo-1-azatidinesulfonic acid salts | |
NZ205642A (en) | Beta-lactams and pharmaceutical compositions | |
EP0124123B1 (en) | 3-acylamino-1-sulfonylaminocarbonylmethoxy-2-azetidinones | |
CA1254218A (en) | 4-(3-acylamino-2-oxo-1-azetidinyl)-4-oxo-2-butenoic acid | |
CA1193272A (en) | O-sulfated beta-lactam hydroxamic acids | |
CA1268780A (en) | N-hydroxyl protecting groups and process for the preparation of 3-acylamino-1-hydroxy-2-azetidinones | |
US4551276A (en) | 2-Oxoazetidin-1-yloxymethyl sulfonic acid and analogs |