NO793078L - Varmeherdbar halogenholdig polymer - Google Patents
Varmeherdbar halogenholdig polymerInfo
- Publication number
- NO793078L NO793078L NO793078A NO793078A NO793078L NO 793078 L NO793078 L NO 793078L NO 793078 A NO793078 A NO 793078A NO 793078 A NO793078 A NO 793078A NO 793078 L NO793078 L NO 793078L
- Authority
- NO
- Norway
- Prior art keywords
- heat
- parts
- diaminopropane
- stated
- halogen polymer
- Prior art date
Links
- 229920000642 polymer Polymers 0.000 title claims description 38
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 claims description 56
- 229910052736 halogen Inorganic materials 0.000 claims description 37
- 150000002367 halogens Chemical class 0.000 claims description 37
- 239000002253 acid Substances 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 20
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 19
- -1 polyethylene Polymers 0.000 claims description 16
- 239000011593 sulfur Substances 0.000 claims description 14
- 229910052717 sulfur Inorganic materials 0.000 claims description 13
- 239000004709 Chlorinated polyethylene Substances 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- UBUCNCOMADRQHX-UHFFFAOYSA-N N-Nitrosodiphenylamine Chemical compound C=1C=CC=CC=1N(N=O)C1=CC=CC=C1 UBUCNCOMADRQHX-UHFFFAOYSA-N 0.000 claims description 9
- 229920000573 polyethylene Polymers 0.000 claims description 8
- 239000004698 Polyethylene Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- UEZWYKZHXASYJN-UHFFFAOYSA-N cyclohexylthiophthalimide Chemical compound O=C1C2=CC=CC=C2C(=O)N1SC1CCCCC1 UEZWYKZHXASYJN-UHFFFAOYSA-N 0.000 claims description 6
- 239000003112 inhibitor Substances 0.000 claims description 6
- 238000006467 substitution reaction Methods 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 4
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 claims description 3
- 239000000920 calcium hydroxide Substances 0.000 claims description 3
- 229910001861 calcium hydroxide Inorganic materials 0.000 claims description 3
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims description 3
- 239000000292 calcium oxide Substances 0.000 claims description 3
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 3
- 239000000395 magnesium oxide Substances 0.000 claims description 3
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 3
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 claims description 3
- 229920001084 poly(chloroprene) Polymers 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229920002681 hypalon Polymers 0.000 claims 1
- 210000004243 sweat Anatomy 0.000 claims 1
- 239000003760 tallow Substances 0.000 claims 1
- 238000001723 curing Methods 0.000 description 26
- 239000000370 acceptor Substances 0.000 description 17
- 238000012360 testing method Methods 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 10
- 229920001187 thermosetting polymer Polymers 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 5
- 238000005660 chlorination reaction Methods 0.000 description 4
- 238000004132 cross linking Methods 0.000 description 4
- 230000007423 decrease Effects 0.000 description 4
- 229920001971 elastomer Polymers 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 150000001451 organic peroxides Chemical class 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920000098 polyolefin Polymers 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 230000002195 synergetic effect Effects 0.000 description 3
- 241001441571 Hiodontidae Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- GPZPVAIBXPRLFD-UHFFFAOYSA-N acetic acid;azane Chemical compound N.N.CC(O)=O GPZPVAIBXPRLFD-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 238000004455 differential thermal analysis Methods 0.000 description 2
- 239000000806 elastomer Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 238000013007 heat curing Methods 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 230000035900 sweating Effects 0.000 description 2
- 229920003051 synthetic elastomer Polymers 0.000 description 2
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical group CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- SNDGSXYUWAVQDK-UHFFFAOYSA-N 3-azaniumylpropylazanium;diacetate Chemical class CC(O)=O.CC(O)=O.NCCCN SNDGSXYUWAVQDK-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 229910000004 White lead Inorganic materials 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- OZZOVSQSDIWNIP-UHFFFAOYSA-N acetic acid;azane Chemical compound [NH4+].[NH4+].CC([O-])=O.CC([O-])=O OZZOVSQSDIWNIP-UHFFFAOYSA-N 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- YWJUZWOHLHBWQY-UHFFFAOYSA-N decanedioic acid;hexane-1,6-diamine Chemical compound NCCCCCCN.OC(=O)CCCCCCCCC(O)=O YWJUZWOHLHBWQY-UHFFFAOYSA-N 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- TXKMVPPZCYKFAC-UHFFFAOYSA-N disulfur monoxide Inorganic materials O=S=S TXKMVPPZCYKFAC-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 229910021485 fumed silica Inorganic materials 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000007373 indentation Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 229940006461 iodide ion Drugs 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- RYZCLUQMCYZBJQ-UHFFFAOYSA-H lead(2+);dicarbonate;dihydroxide Chemical compound [OH-].[OH-].[Pb+2].[Pb+2].[Pb+2].[O-]C([O-])=O.[O-]C([O-])=O RYZCLUQMCYZBJQ-UHFFFAOYSA-H 0.000 description 1
- 229920004889 linear high-density polyethylene Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 238000010060 peroxide vulcanization Methods 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- QBIAZVPERXOGAL-UHFFFAOYSA-N prop-1-ene-1,3-diamine Chemical compound NCC=CN QBIAZVPERXOGAL-UHFFFAOYSA-N 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- 238000013040 rubber vulcanization Methods 0.000 description 1
- 238000010008 shearing Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 235000011044 succinic acid Nutrition 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000011885 synergistic combination Substances 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 1
- 229960002447 thiram Drugs 0.000 description 1
- 229940062627 tribasic potassium phosphate Drugs 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 238000004073 vulcanization Methods 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B29—WORKING OF PLASTICS; WORKING OF SUBSTANCES IN A PLASTIC STATE IN GENERAL
- B29C—SHAPING OR JOINING OF PLASTICS; SHAPING OF MATERIAL IN A PLASTIC STATE, NOT OTHERWISE PROVIDED FOR; AFTER-TREATMENT OF THE SHAPED PRODUCTS, e.g. REPAIRING
- B29C44/00—Shaping by internal pressure generated in the material, e.g. swelling or foaming ; Producing porous or cellular expanded plastics articles
- B29C44/02—Shaping by internal pressure generated in the material, e.g. swelling or foaming ; Producing porous or cellular expanded plastics articles for articles of definite length, i.e. discrete articles
- B29C44/04—Shaping by internal pressure generated in the material, e.g. swelling or foaming ; Producing porous or cellular expanded plastics articles for articles of definite length, i.e. discrete articles consisting of at least two parts of chemically or physically different materials, e.g. having different densities
- B29C44/0461—Shaping by internal pressure generated in the material, e.g. swelling or foaming ; Producing porous or cellular expanded plastics articles for articles of definite length, i.e. discrete articles consisting of at least two parts of chemically or physically different materials, e.g. having different densities by having different chemical compositions in different places, e.g. having different concentrations of foaming agent, feeding one composition after the other
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/17—Amines; Quaternary ammonium compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/945,944 US4204048A (en) | 1978-09-26 | 1978-09-26 | Halopolymers crosslinked with a 1,3-diaminopropane |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO793078L true NO793078L (no) | 1980-03-27 |
Family
ID=25483741
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO793078A NO793078L (no) | 1978-09-26 | 1979-09-25 | Varmeherdbar halogenholdig polymer |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4204048A (de) |
| EP (1) | EP0010789B1 (de) |
| JP (1) | JPS5545789A (de) |
| CA (1) | CA1129594A (de) |
| DE (1) | DE2965383D1 (de) |
| ES (1) | ES8100321A1 (de) |
| NO (1) | NO793078L (de) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS622360Y2 (de) * | 1981-02-19 | 1987-01-20 | ||
| JPS5926668A (ja) * | 1982-08-06 | 1984-02-10 | Nok Corp | ガスケツト及びその製造方法 |
| JPS6018363U (ja) * | 1983-07-16 | 1985-02-07 | エヌオーケー株式会社 | ガスケツト |
| GB8400984D0 (en) * | 1984-01-14 | 1984-02-15 | Hepburn C | Polychloroprene rubber |
| JPH0532697Y2 (de) * | 1986-10-25 | 1993-08-20 | ||
| JPH0538298Y2 (de) * | 1987-12-28 | 1993-09-28 | ||
| US7026410B2 (en) * | 2002-10-17 | 2006-04-11 | Henkel Corporation | Solventless method for preparation of carboxylic polymers |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB547732A (en) * | 1939-11-30 | 1942-09-09 | Du Pont | Manufacture of synthetic resins |
| US2395493A (en) * | 1943-05-21 | 1946-02-26 | Goodrich Co B F | Vulcanization of chloroprene polymers |
| US2811501A (en) * | 1953-12-21 | 1957-10-29 | Minnesota Mining & Mfg | Vulcanized fluoroacrylate polymers |
| US3071565A (en) * | 1954-03-15 | 1963-01-01 | Minnesota Mining & Mfg | Cross-linking of polymers |
| GB814560A (en) | 1955-09-17 | 1959-06-10 | Permutit Co Ltd | Improvements in ion-exchange membranes |
| NL113765C (de) * | 1956-04-24 | |||
| BE559380A (de) | 1956-07-20 | |||
| US2951832A (en) * | 1958-09-26 | 1960-09-06 | Du Pont | Fluoroelastomers |
| US3080347A (en) * | 1959-03-02 | 1963-03-05 | Minnesota Mining & Mfg | Low molecular weight vulcanizable polymers |
| US3001965A (en) * | 1959-04-09 | 1961-09-26 | Du Pont | Chlorosulfonated polyethylene compositions |
| US3090775A (en) * | 1960-04-07 | 1963-05-21 | Du Pont | Process for curing fluorocarbon elastomers without foaming thereof |
| US3080336A (en) * | 1960-06-09 | 1963-03-05 | Du Pont | Improved process for curing fluorocarbon elastomers |
| BE662902A (de) | 1964-04-23 | |||
| US3345315A (en) * | 1964-08-13 | 1967-10-03 | Allied Chem | Chlorinated polyethylene cross-linked with a polyamide |
| BE668726A (de) * | 1964-08-24 | |||
| US3594449A (en) * | 1969-09-15 | 1971-07-20 | Gen Motors Corp | Polyurethane cross-linked chlorinated polyethylenes |
| CA922448A (en) | 1970-04-27 | 1973-03-06 | Diamond Shamrock Corporation | Reaction products of halopolymers and amines |
| CA906141A (en) * | 1971-02-11 | 1972-07-25 | Polymer Corporation Limited | Vulcanization of elastomers |
| US3751378A (en) * | 1971-03-31 | 1973-08-07 | Sartomer Ind Inc | Inhibiting prevulcanization of rubber with polyfunctional methacrylate monomers as cross-linking coagents with peroxides |
| GB1457328A (en) * | 1973-06-25 | 1976-12-01 | Exxon Research Engineering Co | Aminated polymers useful as additives for fuels and lubricants |
-
1978
- 1978-09-26 US US05/945,944 patent/US4204048A/en not_active Expired - Lifetime
-
1979
- 1979-09-25 CA CA336,295A patent/CA1129594A/en not_active Expired
- 1979-09-25 DE DE7979200537T patent/DE2965383D1/de not_active Expired
- 1979-09-25 ES ES484443A patent/ES8100321A1/es not_active Expired
- 1979-09-25 EP EP79200537A patent/EP0010789B1/de not_active Expired
- 1979-09-25 NO NO793078A patent/NO793078L/no unknown
- 1979-09-25 JP JP12213279A patent/JPS5545789A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| EP0010789B1 (de) | 1983-05-11 |
| EP0010789A1 (de) | 1980-05-14 |
| ES484443A0 (es) | 1980-11-01 |
| DE2965383D1 (en) | 1983-06-16 |
| ES8100321A1 (es) | 1980-11-01 |
| JPS5545789A (en) | 1980-03-31 |
| US4204048A (en) | 1980-05-20 |
| CA1129594A (en) | 1982-08-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4948840A (en) | Thermoplastic elastomer of propylene polymer material and crosslinked ethylene-propylene rubber | |
| US4146689A (en) | Vulcanizable compositions of bromobutyl rubber and amino acids | |
| US5292815A (en) | Peroxide vulcanized rubber composition | |
| US2804448A (en) | Novel method for preparing rubbery chlorinated isoolefin-polyolefin interpolymer derivatives | |
| US4289861A (en) | Curable rubber compositions with amino acids | |
| NO793078L (no) | Varmeherdbar halogenholdig polymer | |
| CA1227597A (en) | Sulfur vulcanizable polymer compositions | |
| US2816098A (en) | Method for preparing brominated isoolefin-polyolefin interpolymer derivatives | |
| CA1340668C (en) | Cure system for open steam curing of mineral-loaded chlorobutyl compounds | |
| EP0156475B1 (de) | Vulkanisierbare Polymermischungen, deren Herstellung und deren Verwendung | |
| CA1152448A (en) | Process for vulcanizing in the ultrahigh-frequency field a rubber composition containing the usual vulcanizing agents and additives | |
| US3534123A (en) | Heat and aging stabilization of uncured halogenated butyl rubber | |
| JPH09111052A (ja) | ポリマーコンパウンド及びハロゲン−含有ゴムの加硫のためのそれらの利用 | |
| CA1129593A (en) | Synergistic prevulcanization inhibitor for certain heat-curable halopolymer compositions | |
| US2395778A (en) | Vulcanization of olefin-diolefin copolymers | |
| US2143470A (en) | Rubber composition | |
| US4173694A (en) | Polychloroprene rubber composition | |
| US3177182A (en) | Vulcanization of halogenated rubbery polymers | |
| US4286079A (en) | Curable composition | |
| JPS59213743A (ja) | 加硫可能ゴム組成物 | |
| KR20070110872A (ko) | 개선된 경화 시스템 조성물 및 염소화 엘라스토머 조성물의경화 방법 | |
| NO163622B (no) | Fremgangsmaate for aa forbedre bearbeidbarheten ved reduksjon av viskositeten av blandinger paa basis av uvulkanisert naturgummi. | |
| US4262098A (en) | Curable composition of amino acid and chlorinated polyethylene | |
| JPH05271479A (ja) | 優れた加工性、良好な耐熱性及び良好な機械的及び動的特性を有する加硫性のゴム組成物 | |
| JP3168301B2 (ja) | 塩素化ポリエチレン組成物 |