NO135691B - - Google Patents
Download PDFInfo
- Publication number
- NO135691B NO135691B NO914/73A NO91473A NO135691B NO 135691 B NO135691 B NO 135691B NO 914/73 A NO914/73 A NO 914/73A NO 91473 A NO91473 A NO 91473A NO 135691 B NO135691 B NO 135691B
- Authority
- NO
- Norway
- Prior art keywords
- voltage
- input
- limit value
- integrator
- converter
- Prior art date
Links
- 230000003321 amplification Effects 0.000 claims description 2
- 238000003199 nucleic acid amplification method Methods 0.000 claims description 2
- 238000001208 nuclear magnetic resonance pulse sequence Methods 0.000 description 9
- 230000000630 rising effect Effects 0.000 description 8
- 230000033228 biological regulation Effects 0.000 description 3
- 230000000295 complement effect Effects 0.000 description 3
- 208000037516 chromosome inversion disease Diseases 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 230000005669 field effect Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K7/00—Modulating pulses with a continuously-variable modulating signal
- H03K7/06—Frequency or rate modulation, i.e. PFM or PRM
Landscapes
- Analogue/Digital Conversion (AREA)
- Control Of Voltage And Current In General (AREA)
- Dc-Dc Converters (AREA)
- Inverter Devices (AREA)
- Control Of Eletrric Generators (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2212792A DE2212792B2 (de) | 1972-03-16 | 1972-03-16 | Spannungs-Frequenzwandler |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO135691B true NO135691B (fr) | 1977-01-31 |
| NO135691C NO135691C (fr) | 1977-05-11 |
Family
ID=5839147
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO914/73A NO135691C (fr) | 1972-03-16 | 1973-03-07 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3835402A (fr) |
| JP (1) | JPS5728969B2 (fr) |
| AT (1) | AT321410B (fr) |
| BE (1) | BE796733A (fr) |
| CA (1) | CA982239A (fr) |
| CH (1) | CH552306A (fr) |
| DE (1) | DE2212792B2 (fr) |
| DK (1) | DK134209C (fr) |
| FR (1) | FR2191358B1 (fr) |
| GB (1) | GB1431056A (fr) |
| IT (1) | IT981331B (fr) |
| NL (1) | NL7302815A (fr) |
| NO (1) | NO135691C (fr) |
| SE (1) | SE381966B (fr) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3995178A (en) * | 1971-09-27 | 1976-11-30 | Motor Finance Corporation | Pulse-width and frequency modulator circuit |
| US3950706A (en) * | 1974-01-24 | 1976-04-13 | Petrolite Corporation | Voltage sweep generator with bistable current source providing linear sweep voltages |
| NL7407631A (nl) * | 1974-06-07 | 1975-12-09 | Philips Nv | Analoog-digitaal-omzetter. |
| US3943456A (en) * | 1974-06-14 | 1976-03-09 | Moog Music, Inc. | Signal generator for electronic musical instrument, employing variable rate integrator |
| JPS5333358U (fr) * | 1976-08-27 | 1978-03-23 | ||
| US4047056A (en) * | 1976-11-02 | 1977-09-06 | Honeywell Inc. | Voltage-frequency converter |
| US4303985A (en) * | 1979-12-06 | 1981-12-01 | Litton Systems, Inc. | Analog voltage to pulse rate or analog to frequency converter |
| DE3042928A1 (de) * | 1980-11-14 | 1982-10-21 | Elektro-Geräte-Bau Gustav Klein GmbH & Co KG, 8920 Schongau | Taktgeberschaltung |
| NL8301714A (nl) * | 1983-05-13 | 1984-12-03 | Philips Nv | Driehoekgenerator. |
| US4631501A (en) * | 1985-02-01 | 1986-12-23 | Honeywell Inc. | Voltage controlled oscillator |
| US4667171A (en) * | 1985-02-01 | 1987-05-19 | Honeywell Inc. | Voltage controlled oscillator with temperature compensation |
| US4775841A (en) * | 1986-06-03 | 1988-10-04 | Trofimenkoff F N | Voltage to frequency conversion circuit with a pulse width to period ratio proportional to input voltage |
| US4801817A (en) * | 1986-09-05 | 1989-01-31 | Mayhak Gary D | Apparatus and method for storing video images |
| US7178059B2 (en) | 2003-05-07 | 2007-02-13 | Egenera, Inc. | Disaster recovery for processing resources using configurable deployment platform |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3047820A (en) * | 1960-02-19 | 1962-07-31 | John G Lawton | Saw-tooth voltage generator utilizing integrator |
| NL293629A (fr) * | 1962-06-05 | 1900-01-01 | ||
| US3350651A (en) * | 1964-12-18 | 1967-10-31 | Spectral Dynamics Corp | Waveform converters |
| US3432772A (en) * | 1967-05-15 | 1969-03-11 | Teletype Corp | Differential relaxation oscillator |
-
1972
- 1972-03-16 DE DE2212792A patent/DE2212792B2/de not_active Withdrawn
-
1973
- 1973-02-14 AT AT131173A patent/AT321410B/de not_active IP Right Cessation
- 1973-02-26 CH CH272973A patent/CH552306A/xx not_active IP Right Cessation
- 1973-02-28 NL NL7302815A patent/NL7302815A/xx not_active Application Discontinuation
- 1973-03-07 DK DK122573A patent/DK134209C/da active
- 1973-03-07 NO NO914/73A patent/NO135691C/no unknown
- 1973-03-12 US US00340056A patent/US3835402A/en not_active Expired - Lifetime
- 1973-03-13 IT IT21517/73A patent/IT981331B/it active
- 1973-03-14 BE BE128759A patent/BE796733A/fr unknown
- 1973-03-15 SE SE7303627A patent/SE381966B/xx unknown
- 1973-03-15 CA CA166,181A patent/CA982239A/en not_active Expired
- 1973-03-15 FR FR7309385A patent/FR2191358B1/fr not_active Expired
- 1973-03-16 GB GB1289073A patent/GB1431056A/en not_active Expired
- 1973-03-16 JP JP3076673A patent/JPS5728969B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2212792B2 (de) | 1975-02-13 |
| AT321410B (de) | 1975-03-25 |
| BE796733A (fr) | 1973-09-14 |
| GB1431056A (en) | 1976-04-07 |
| FR2191358A1 (fr) | 1974-02-01 |
| DK134209B (da) | 1976-09-27 |
| DE2212792A1 (de) | 1973-09-20 |
| IT981331B (it) | 1974-10-10 |
| US3835402A (en) | 1974-09-10 |
| NL7302815A (fr) | 1973-09-18 |
| JPS495252A (fr) | 1974-01-17 |
| FR2191358B1 (fr) | 1975-10-31 |
| DK134209C (da) | 1977-03-14 |
| SE381966B (sv) | 1975-12-22 |
| JPS5728969B2 (fr) | 1982-06-19 |
| CH552306A (de) | 1974-07-31 |
| CA982239A (en) | 1976-01-20 |
| NO135691C (fr) | 1977-05-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO135691B (fr) | ||
| US1586233A (en) | Means for controlling rotating field motors | |
| US3303411A (en) | Regulated power supply with constant voltage/current cross-over and mode indicator | |
| US2324275A (en) | Electric translating circuit | |
| US2318140A (en) | Visual indicator | |
| NO134504B (fr) | ||
| US3304496A (en) | Phase angle indicating means | |
| US4138717A (en) | Constant-gain regulated-phase standard-phase converter | |
| US2961605A (en) | Combination loading detector and standing wave indicator circuit | |
| US2471835A (en) | Modulator circuit | |
| US2944218A (en) | Electrical signal conversion apparatus | |
| US2637495A (en) | Computing device for vapor-liquid equilibrium calculations | |
| US2996677A (en) | Quadrature signal rejector | |
| US3962631A (en) | Circuit for determining a measure value of a rectified a-c voltage | |
| US2885627A (en) | Voltage regulating device | |
| US3325724A (en) | Voltage stabilizer employing a photosensitive resistance element | |
| US3104390A (en) | Course director | |
| US3254311A (en) | Frequency-controllled phase shift oscillator | |
| US3083336A (en) | Direct reading, 360 degree phase meter | |
| US2827607A (en) | A. c. regulator bridge circuit | |
| US3303415A (en) | Bridge controlled power supply | |
| SE441550B (sv) | Koordinatomvandlare | |
| US2864001A (en) | Direct current modulator | |
| US2991423A (en) | Low-frequency regenerative amplifier | |
| GB1208851A (en) | Field regulation of asynchronous machines |