NO123461B - - Google Patents
Download PDFInfo
- Publication number
- NO123461B NO123461B NO289270A NO289270A NO123461B NO 123461 B NO123461 B NO 123461B NO 289270 A NO289270 A NO 289270A NO 289270 A NO289270 A NO 289270A NO 123461 B NO123461 B NO 123461B
- Authority
- NO
- Norway
- Prior art keywords
- nitroimidazole
- aryl
- fluorophenyl
- nitroimidazoles
- treated
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 22
- 150000001875 compounds Chemical class 0.000 claims description 20
- -1 alkoxyethyl sulfate Chemical compound 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- DHMAQHDGTQJVPI-UHFFFAOYSA-N bis(2-ethoxyethyl) sulfate Chemical compound CCOCCOS(=O)(=O)OCCOCC DHMAQHDGTQJVPI-UHFFFAOYSA-N 0.000 claims description 6
- OQKHPZHGTCHGOQ-UHFFFAOYSA-N 2-[2-(4-fluorophenyl)-5-nitroimidazol-1-yl]ethanol Chemical compound OCCN1C([N+]([O-])=O)=CN=C1C1=CC=C(F)C=C1 OQKHPZHGTCHGOQ-UHFFFAOYSA-N 0.000 claims description 4
- 239000013067 intermediate product Substances 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 230000007935 neutral effect Effects 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 201000010099 disease Diseases 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 241000271566 Aves Species 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 241000286209 Phasianidae Species 0.000 description 4
- 241000224527 Trichomonas vaginalis Species 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 235000013312 flour Nutrition 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 3
- 235000010469 Glycine max Nutrition 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 208000005448 Trichomonas Infections Diseases 0.000 description 3
- 206010044620 Trichomoniasis Diseases 0.000 description 3
- 206010046914 Vaginal infection Diseases 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 3
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 235000005822 corn Nutrition 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 239000003651 drinking water Substances 0.000 description 3
- 235000020188 drinking water Nutrition 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000003349 gelling agent Substances 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 230000000590 parasiticidal effect Effects 0.000 description 3
- 239000002297 parasiticide Substances 0.000 description 3
- 244000144977 poultry Species 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- GYUFKWTXVZODMX-UHFFFAOYSA-N 1-diazo-1-methoxyethane Chemical compound COC(C)=[N+]=[N-] GYUFKWTXVZODMX-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- 208000010362 Protozoan Infections Diseases 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- 201000008100 Vaginitis Diseases 0.000 description 2
- 206010000496 acne Diseases 0.000 description 2
- 125000004848 alkoxyethyl group Chemical group 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 125000005228 aryl sulfonate group Chemical group 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 230000000973 chemotherapeutic effect Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 235000012054 meals Nutrition 0.000 description 2
- 150000004957 nitroimidazoles Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- 239000000196 tragacanth Substances 0.000 description 2
- 235000010487 tragacanth Nutrition 0.000 description 2
- 229940116362 tragacanth Drugs 0.000 description 2
- FRQCBSLXRZNARJ-UHFFFAOYSA-N 1-(5-nitro-1h-imidazol-2-yl)ethanol Chemical compound CC(O)C1=NC=C([N+]([O-])=O)N1 FRQCBSLXRZNARJ-UHFFFAOYSA-N 0.000 description 1
- MEPWMCNYKBTVTI-UHFFFAOYSA-N 1-diazo-1-ethoxyethane Chemical compound C(C)OC(C)=[N+]=[N-] MEPWMCNYKBTVTI-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- UWCYYERLLQZSPS-UHFFFAOYSA-N 2-(4-chlorophenyl)-5-nitro-1H-imidazole Chemical compound ClC1=CC=C(C=C1)C=1NC=C(N1)[N+](=O)[O-] UWCYYERLLQZSPS-UHFFFAOYSA-N 0.000 description 1
- KWKRIIYMWCWDNC-UHFFFAOYSA-N 2-(4-fluorophenyl)-5-nitro-1h-imidazole Chemical compound N1C([N+](=O)[O-])=CN=C1C1=CC=C(F)C=C1 KWKRIIYMWCWDNC-UHFFFAOYSA-N 0.000 description 1
- LYIIBVSRGJSHAV-UHFFFAOYSA-N 2-aminoacetaldehyde Chemical compound NCC=O LYIIBVSRGJSHAV-UHFFFAOYSA-N 0.000 description 1
- HXXNTEDKEYTYPD-UHFFFAOYSA-N 2-ethoxyethyl 4-methylbenzenesulfonate Chemical compound CCOCCOS(=O)(=O)C1=CC=C(C)C=C1 HXXNTEDKEYTYPD-UHFFFAOYSA-N 0.000 description 1
- MUQMWRLGMXFTAH-UHFFFAOYSA-N 2-ethoxyethyl phenylmethanesulfonate Chemical compound C(C)OCCOS(=O)(=O)CC1=CC=CC=C1 MUQMWRLGMXFTAH-UHFFFAOYSA-N 0.000 description 1
- DWRUTZDAZLMDEO-UHFFFAOYSA-N 2-methoxyethyl phenylmethanesulfonate Chemical compound COCCOS(=O)(=O)CC1=CC=CC=C1 DWRUTZDAZLMDEO-UHFFFAOYSA-N 0.000 description 1
- SHVHFDTVXHMMNP-UHFFFAOYSA-N 2-nitro-1,3-thiazol-4-amine Chemical class NC1=CSC([N+]([O-])=O)=N1 SHVHFDTVXHMMNP-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- CMCGTBGUWJQZCU-UHFFFAOYSA-N C(C)OCCN1C(=NC=C1[N+](=O)[O-])C1=CC=C(C=C1)F Chemical compound C(C)OCCN1C(=NC=C1[N+](=O)[O-])C1=CC=C(C=C1)F CMCGTBGUWJQZCU-UHFFFAOYSA-N 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 241000948220 Histomonas meleagridis Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 208000027954 Poultry disease Diseases 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 235000014680 Saccharomyces cerevisiae Nutrition 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000019764 Soybean Meal Nutrition 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 239000005862 Whey Substances 0.000 description 1
- 102000007544 Whey Proteins Human genes 0.000 description 1
- 108010046377 Whey Proteins Proteins 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 230000000884 anti-protozoa Effects 0.000 description 1
- 230000000842 anti-protozoal effect Effects 0.000 description 1
- 230000001572 anti-trichomonad Effects 0.000 description 1
- 239000003716 antitrichomonal agent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- 229940092782 bentonite Drugs 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- RGMUCAJQIYCOJM-UHFFFAOYSA-N bis(2-methoxyethyl) sulfate Chemical compound COCCOS(=O)(=O)OCCOC RGMUCAJQIYCOJM-UHFFFAOYSA-N 0.000 description 1
- 235000015155 buttermilk Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N dichloromethane Substances ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000009313 farming Methods 0.000 description 1
- 244000144992 flock Species 0.000 description 1
- 229920000591 gum Polymers 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 230000035764 nutrition Effects 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000010867 poultry litter Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 208000028172 protozoa infectious disease Diseases 0.000 description 1
- 244000000040 protozoan parasite Species 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 235000021055 solid food Nutrition 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000004455 soybean meal Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 210000001215 vagina Anatomy 0.000 description 1
- 239000005418 vegetable material Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 235000015099 wheat brans Nutrition 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO289270A NO123461B (member.php) | 1964-03-10 | 1970-07-24 |
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US350639A US3399211A (en) | 1964-03-10 | 1964-03-10 | Production of 2-aryl-4(5)-nitroimidazoles |
| NO157118A NO121445B (member.php) | 1964-03-10 | 1965-03-09 | |
| US72464968A | 1968-02-02 | 1968-02-02 | |
| US84374969A | 1969-07-22 | 1969-07-22 | |
| NO289270A NO123461B (member.php) | 1964-03-10 | 1970-07-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO123461B true NO123461B (member.php) | 1971-11-22 |
Family
ID=27532548
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO289270A NO123461B (member.php) | 1964-03-10 | 1970-07-24 |
Country Status (1)
| Country | Link |
|---|---|
| NO (1) | NO123461B (member.php) |
-
1970
- 1970-07-24 NO NO289270A patent/NO123461B/no unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0015124B1 (en) | Parasiticidal heterocyclic ether derivatives, processes for the manufacture thereof and compositions thereof | |
| US3487087A (en) | Nitration of imidazoles | |
| NO117369B (member.php) | ||
| US3947467A (en) | 3-(5-Nitro-2-imidazolyl) pyrazoles | |
| US3155571A (en) | Anthelmintic compositions and methods of using same | |
| NO760996L (member.php) | ||
| US4046753A (en) | Substituted 2-phenylhydrazino and 2-phenylazo thiazolines | |
| US3652579A (en) | 1-methyl-2-substituted 5-nitroimidazoles | |
| US3658832A (en) | Novel antimicrobial nitroimidazolyl-1 2 4-oxadiazoles | |
| NO123461B (member.php) | ||
| US3666860A (en) | Substituted nitroimidazolylthiadiazoles and oxadiazoles as antiprotozoal agents | |
| NO120369B (member.php) | ||
| KR102732087B1 (ko) | 벤조퓨란계 n-아실하이드라존 유도체를 포함하는 항염증 조성물 | |
| NO742091L (member.php) | ||
| NO157118B (no) | Foring av ikke-metallisk materiale. | |
| US3026332A (en) | Nitrofurfurylidene hydroxy acid hydrazides | |
| US4130661A (en) | Substituted benzoylacrylanilides | |
| EP0024638A1 (en) | Substituted quinolinone-alkanecarboxylic acids, their preparation, and medicaments containing them | |
| US3088867A (en) | Compositions for the control of coccidiosis | |
| US3075877A (en) | Anticoccidial compositions comprising 5-nitro-2-furaldehyde cyanoacetyl or dichloroacetyl-hydrazone | |
| NO122374B (member.php) | ||
| JPS6135985B2 (member.php) | ||
| US3278547A (en) | 2-pyronyl and 2-thiapyronyl benzazoles | |
| US3454575A (en) | Quaternary 5-ammonium-methyl-4-amino-2 cycloaliphatylpyrimidine salts | |
| US4053602A (en) | Compositions for treating coccidiosis containing 5-deazariboflavin and its derivatives |