NO121785B - - Google Patents
Download PDFInfo
- Publication number
- NO121785B NO121785B NO504269A NO504269A NO121785B NO 121785 B NO121785 B NO 121785B NO 504269 A NO504269 A NO 504269A NO 504269 A NO504269 A NO 504269A NO 121785 B NO121785 B NO 121785B
- Authority
- NO
- Norway
- Prior art keywords
- formula
- general formula
- tetraazaphenalenes
- addition salts
- inorganic
- Prior art date
Links
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 10
- DNPVEBBFVJUASY-UHFFFAOYSA-N ctk0i2885 Chemical class N1N=CC2=CC=CC3=CN=NC1=C32 DNPVEBBFVJUASY-UHFFFAOYSA-N 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 5
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 5
- SOMQAIAICJTERE-UHFFFAOYSA-N 2,3,11,12-tetrazatricyclo[7.3.1.05,13]trideca-1,5,7,9(13),10-pentaene-4-thione Chemical class SC1=NNC=2N=NC=C3C=CC=C1C23 SOMQAIAICJTERE-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- AWGBNOQONQAYBG-UHFFFAOYSA-N 12-methyl-2,3,11,12-tetrazatricyclo[7.3.1.05,13]trideca-1,5,7,9(13),10-pentaene-4-thione Chemical compound S=C1NN=C2N(N=CC=3C=CC=C1C23)C AWGBNOQONQAYBG-UHFFFAOYSA-N 0.000 description 1
- GBXYCEXJPRKVTQ-UHFFFAOYSA-N 2,3,11,12-tetrazatricyclo[7.3.1.05,13]trideca-1,5,7,9(13),10-pentaen-4-one Chemical compound O=C1NNC=2N=NC=C3C=CC=C1C23 GBXYCEXJPRKVTQ-UHFFFAOYSA-N 0.000 description 1
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO504269A NO121785B (index.php) | 1966-04-04 | 1969-12-19 |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO16245066A NO121495B (index.php) | 1965-04-05 | 1966-04-04 | |
| NO504269A NO121785B (index.php) | 1966-04-04 | 1969-12-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO121785B true NO121785B (index.php) | 1971-04-13 |
Family
ID=26647553
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO504269A NO121785B (index.php) | 1966-04-04 | 1969-12-19 |
Country Status (1)
| Country | Link |
|---|---|
| NO (1) | NO121785B (index.php) |
-
1969
- 1969-12-19 NO NO504269A patent/NO121785B/no unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0314315B2 (index.php) | ||
| US2467692A (en) | Naphthyridones and processes fob | |
| KR840001953B1 (ko) | 벤조구아나민 유도체의 제조법 | |
| US3176017A (en) | Aroylalkyl derivatives of diazabicyclo-nonanes and-decanes | |
| US2671086A (en) | 3,6-dichloro and 3,6-dibromopyridazines | |
| US3316251A (en) | 5, 6-dihydro-5-oxo-11h-pyrido-[2, 3-b][1, 5]-benzodiazepine derivatives and process | |
| IL33920A (en) | Process for the manufacture of oximino-dithiolanes | |
| US1939025A (en) | Aromatic amino-sulpho chlorides, substituted in the amino-group | |
| NO121785B (index.php) | ||
| NO126084B (index.php) | ||
| GB2081261A (en) | Condensed as-triazine derivatives and process for preparing the same | |
| US3331835A (en) | Novel epsilon-caprolactams | |
| US2802008A (en) | Halogenated and alkoxylated 1-phenyl-1-pyridyl derivatives of urea and 3-alkylurea | |
| US3433802A (en) | 3-(n-lower-alkylanilino)pyrrolidines | |
| SU728718A3 (ru) | Способ получени триазоло-тиено- диазепин-1-онов | |
| US3062816A (en) | New derivatives of the gh-i | |
| US2690441A (en) | 3-carboline derivatives | |
| US3378555A (en) | Thiazine compounds and production thereof | |
| US3294782A (en) | 3, 4-dihydro-6-phenyl-1, 5-benzodiazocin-2-ones | |
| US3106559A (en) | Nu-substituted cyclohepta (beta)-pyrrol-8-ones | |
| US2748120A (en) | 2-amino-6-aryl-5, 6-dihydro-4-hydroxy-pyrimidines | |
| SU437284A1 (ru) | Способ получени производных индено-пиридина | |
| US3265693A (en) | 3-phenyl-4-dialkylaminoalkylamino-cinnolines | |
| EP0135079B1 (en) | Process for preparing 1-substituted-1,4-benzodiazepine derivatives | |
| SU520914A3 (ru) | Способ получени производных бензоциклогептатиофенонов или их солей |