NL141273B - Van schoepen voorziene rotor, in het bijzonder een turbinewiel. - Google Patents
Van schoepen voorziene rotor, in het bijzonder een turbinewiel.Info
- Publication number
- NL141273B NL141273B NL63295165A NL295165A NL141273B NL 141273 B NL141273 B NL 141273B NL 63295165 A NL63295165 A NL 63295165A NL 295165 A NL295165 A NL 295165A NL 141273 B NL141273 B NL 141273B
- Authority
- NL
- Netherlands
- Prior art keywords
- shade
- turbine wheel
- equipped rotor
- rotor
- turbine
- Prior art date
Links
- RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F01—MACHINES OR ENGINES IN GENERAL; ENGINE PLANTS IN GENERAL; STEAM ENGINES
- F01D—NON-POSITIVE DISPLACEMENT MACHINES OR ENGINES, e.g. STEAM TURBINES
- F01D11/00—Preventing or minimising internal leakage of working-fluid, e.g. between stages
- F01D11/005—Sealing means between non relatively rotating elements
- F01D11/006—Sealing the gap between rotor blades or blades and rotor
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F01—MACHINES OR ENGINES IN GENERAL; ENGINE PLANTS IN GENERAL; STEAM ENGINES
- F01D—NON-POSITIVE DISPLACEMENT MACHINES OR ENGINES, e.g. STEAM TURBINES
- F01D5/00—Blades; Blade-carrying members; Heating, heat-insulating, cooling or antivibration means on the blades or the members
- F01D5/30—Fixing blades to rotors; Blade roots ; Blade spacers
- F01D5/3007—Fixing blades to rotors; Blade roots ; Blade spacers of axial insertion type
- F01D5/3015—Fixing blades to rotors; Blade roots ; Blade spacers of axial insertion type with side plates
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Turbine Rotor Nozzle Sealing (AREA)
- Structures Of Non-Positive Displacement Pumps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US209099A US3137478A (en) | 1962-07-11 | 1962-07-11 | Cover plate assembly for sealing spaces between turbine buckets |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL141273B true NL141273B (nl) | 1974-02-15 |
Family
ID=22777333
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL295165D NL295165A (enExample) | 1962-07-11 | ||
| NL63295165A NL141273B (nl) | 1962-07-11 | 1963-07-11 | Van schoepen voorziene rotor, in het bijzonder een turbinewiel. |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL295165D NL295165A (enExample) | 1962-07-11 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3137478A (enExample) |
| CH (1) | CH403402A (enExample) |
| DE (1) | DE1212108B (enExample) |
| GB (1) | GB1012066A (enExample) |
| NL (2) | NL141273B (enExample) |
| SE (1) | SE304417B (enExample) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3508844A (en) * | 1968-07-25 | 1970-04-28 | United Aircraft Corp | Blade lock |
| GB1291302A (en) * | 1970-03-14 | 1972-10-04 | Sec Dep For Defendence | Improvements in bladed rotor assemblies |
| US3656865A (en) * | 1970-07-21 | 1972-04-18 | Gen Motors Corp | Rotor blade retainer |
| BE792286A (fr) * | 1971-12-06 | 1973-03-30 | Gen Electric | Dispositif de retenue d'aubes sans boulon pour un rotor de turbomachin |
| US3814539A (en) * | 1972-10-04 | 1974-06-04 | Gen Electric | Rotor sealing arrangement for an axial flow fluid turbine |
| US3936222A (en) * | 1974-03-28 | 1976-02-03 | United Technologies Corporation | Gas turbine construction |
| GB1479332A (en) * | 1974-11-06 | 1977-07-13 | Rolls Royce | Means for retaining blades to a disc or like structure |
| US4033705A (en) * | 1976-04-26 | 1977-07-05 | The United States Of America As Represented By The Administrator Of The National Aeronautics And Space Administration | Blade retainer assembly |
| US4088421A (en) * | 1976-09-30 | 1978-05-09 | General Electric Company | Coverplate damping arrangement |
| US4094615A (en) * | 1976-12-27 | 1978-06-13 | Electric Power Research Institute, Inc. | Blade attachment structure for gas turbine rotor |
| US4221542A (en) * | 1977-12-27 | 1980-09-09 | General Electric Company | Segmented blade retainer |
| US4192633A (en) * | 1977-12-28 | 1980-03-11 | General Electric Company | Counterweighted blade damper |
| GB2043796B (en) * | 1979-03-10 | 1983-04-20 | Rolls Royce | Bladed rotor for gas turbine engine |
| US4422827A (en) * | 1982-02-18 | 1983-12-27 | United Technologies Corporation | Blade root seal |
| US4659285A (en) * | 1984-07-23 | 1987-04-21 | United Technologies Corporation | Turbine cover-seal assembly |
| US4659289A (en) * | 1984-07-23 | 1987-04-21 | United Technologies Corporation | Turbine side plate assembly |
| GB8705216D0 (en) * | 1987-03-06 | 1987-04-08 | Rolls Royce Plc | Rotor assembly |
| US5339619A (en) * | 1992-08-31 | 1994-08-23 | United Technologies Corporation | Active cooling of turbine rotor assembly |
| US5486095A (en) * | 1994-12-08 | 1996-01-23 | General Electric Company | Split disk blade support |
| GB2307520B (en) * | 1995-11-14 | 1999-07-07 | Rolls Royce Plc | A gas turbine engine |
| US6190131B1 (en) * | 1999-08-31 | 2001-02-20 | General Electric Co. | Non-integral balanced coverplate and coverplate centering slot for a turbine |
| CZ20002685A3 (cs) * | 1999-12-20 | 2001-08-15 | General Electric Company | Zařízení pro uchycení lopatek otáčivého stroje a způsob jejich uchycení |
| EP1284339A1 (de) * | 2001-08-14 | 2003-02-19 | Siemens Aktiengesellschaft | Abdeckringsystem für Schaufelscheiben von Gasturbinen |
| US6533550B1 (en) | 2001-10-23 | 2003-03-18 | Pratt & Whitney Canada Corp. | Blade retention |
| JP3864157B2 (ja) * | 2003-12-05 | 2006-12-27 | 本田技研工業株式会社 | 軸流型タービンホイール |
| US7090466B2 (en) * | 2004-09-14 | 2006-08-15 | General Electric Company | Methods and apparatus for assembling gas turbine engine rotor assemblies |
| US7465149B2 (en) * | 2006-03-14 | 2008-12-16 | Rolls-Royce Plc | Turbine engine cooling |
| US20080044284A1 (en) * | 2006-08-16 | 2008-02-21 | United Technologies Corporation | Segmented fluid seal assembly |
| US8128371B2 (en) | 2007-02-15 | 2012-03-06 | General Electric Company | Method and apparatus to facilitate increasing turbine rotor efficiency |
| RU2486349C2 (ru) * | 2007-10-25 | 2013-06-27 | Сименс Акциенгезелльшафт | Уплотнительный гребень, узел лопаток турбины и газовая турбина, содержащая такой узел лопаток |
| US8277191B2 (en) * | 2009-02-25 | 2012-10-02 | General Electric Company | Apparatus for bucket cover plate retention |
| US8696320B2 (en) * | 2009-03-12 | 2014-04-15 | General Electric Company | Gas turbine having seal assembly with coverplate and seal |
| US20100232939A1 (en) * | 2009-03-12 | 2010-09-16 | General Electric Company | Machine Seal Assembly |
| US8251668B2 (en) * | 2009-06-30 | 2012-08-28 | General Electric Company | Method and apparatus for assembling rotating machines |
| US8459953B2 (en) * | 2010-01-19 | 2013-06-11 | General Electric Company | Seal plate and bucket retention pin assembly |
| US20120045337A1 (en) * | 2010-08-20 | 2012-02-23 | Michael James Fedor | Turbine bucket assembly and methods for assembling same |
| US8888459B2 (en) * | 2011-08-23 | 2014-11-18 | General Electric Company | Coupled blade platforms and methods of sealing |
| DE102011082493A1 (de) * | 2011-09-12 | 2013-03-14 | Rolls-Royce Deutschland Ltd & Co Kg | Sicherungssegment zur Schwingungsdämpfung von Turbinenlauf-schaufeln und Rotorvorrichtung |
| JP5675674B2 (ja) * | 2012-02-29 | 2015-02-25 | 三菱重工業株式会社 | タービン動翼の抜け止め構造およびこれを備えた回転機械 |
| US20130256996A1 (en) * | 2012-03-28 | 2013-10-03 | General Electric Company | Shiplap plate seal |
| US9151169B2 (en) * | 2012-03-29 | 2015-10-06 | General Electric Company | Near-flow-path seal isolation dovetail |
| US9328622B2 (en) * | 2012-06-12 | 2016-05-03 | General Electric Company | Blade attachment assembly |
| US10145249B2 (en) | 2016-02-23 | 2018-12-04 | Mechanical Dynamics & Analysis Llc | Turbine bucket lockwire anti-rotation device for gas turbine engine |
| US10196916B2 (en) | 2016-04-08 | 2019-02-05 | Siemens Aktiengesellschaft | Rotor disk having an end-side sealing element |
| DE102016208759A1 (de) * | 2016-05-20 | 2017-11-23 | Siemens Aktiengesellschaft | Rotorscheibe mit stirnseitigem Dichtelement |
| DE102016107315A1 (de) * | 2016-04-20 | 2017-10-26 | Rolls-Royce Deutschland Ltd & Co Kg | Rotor mit Überhang an Laufschaufeln für ein Sicherungselement |
| US10494934B2 (en) | 2017-02-14 | 2019-12-03 | General Electric Company | Turbine blades having shank features |
| US10683765B2 (en) | 2017-02-14 | 2020-06-16 | General Electric Company | Turbine blades having shank features and methods of fabricating the same |
| EP3438410B1 (en) | 2017-08-01 | 2021-09-29 | General Electric Company | Sealing system for a rotary machine |
| WO2019040171A1 (en) * | 2017-08-25 | 2019-02-28 | Siemens Aktiengesellschaft | PLATE ASSEMBLY |
| EP3511524A1 (de) * | 2018-01-10 | 2019-07-17 | Siemens Aktiengesellschaft | Rotor mit in schaufelhaltenuten befestigten dichtelementen |
| EP3521561A1 (de) * | 2018-02-02 | 2019-08-07 | Siemens Aktiengesellschaft | Rotor mit dichtelement und dichtring |
| US11377956B2 (en) | 2018-07-23 | 2022-07-05 | Siemens Energy Global GmbH & Co. KG | Cover plate with flow inducer and method for cooling turbine blades |
| WO2020023007A1 (en) * | 2018-07-23 | 2020-01-30 | Siemens Aktiengesellschaft | Cover plate with flow inducer and method for cooling turbine blades |
| FR3108941B1 (fr) * | 2020-04-07 | 2022-08-26 | Safran Aircraft Engines | Rotor de turbine pour turbomachine, procede de montage dudit rotor |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1554614A (en) * | 1922-09-13 | 1925-09-22 | Westinghouse Electric & Mfg Co | Turbine blading |
| GB652099A (en) * | 1947-10-16 | 1951-04-18 | Rolls Royce | Improvements relating to axial flow turbines |
| GB699582A (en) * | 1950-11-14 | 1953-11-11 | Rolls Royce | Improvements in or relating to gas-turbine engines |
| NL88170C (enExample) * | 1952-10-31 | 1900-01-01 | ||
| GB742477A (en) * | 1952-10-31 | 1955-12-30 | Rolls Royce | Improvements in or relating to bladed stator or rotor constructions for fluid machines such as axial-flow turbines or compressors |
| GB779059A (en) * | 1954-07-15 | 1957-07-17 | Rolls Royce | Improvements in or relating to axial-flow fluid machines, for example compressors orturbines of gas-turbine engines |
| BE551145A (enExample) * | 1955-09-26 | |||
| GB802476A (en) * | 1955-09-29 | 1958-10-08 | Rolls Royce | Improvements in or relating to rotors of axial-flow fluid machines for example compressors and turbines |
| US2988325A (en) * | 1957-07-18 | 1961-06-13 | Rolls Royce | Rotary fluid machine with means supplying fluid to rotor blade passages |
| US2999668A (en) * | 1958-08-28 | 1961-09-12 | Curtiss Wright Corp | Self-balanced rotor blade |
| US3037741A (en) * | 1958-12-29 | 1962-06-05 | Gen Electric | Damping turbine buckets |
| US2994507A (en) * | 1959-01-23 | 1961-08-01 | Westinghouse Electric Corp | Blade locking structure |
| GB905582A (en) * | 1960-05-26 | 1962-09-12 | Rolls Royce | Improvements relating to the sealing of blades in a bladed rotor |
| GB928349A (en) * | 1960-12-06 | 1963-06-12 | Rolls Royce | Improvements in or relating to bladed rotors of fluid flow machines |
| US3043562A (en) * | 1961-04-10 | 1962-07-10 | Gen Electric | Combination sealing and restraining member for long-shank turbo-machine buckets |
-
0
- NL NL295165D patent/NL295165A/xx unknown
-
1962
- 1962-07-11 US US209099A patent/US3137478A/en not_active Expired - Lifetime
-
1963
- 1963-06-20 GB GB24670/63A patent/GB1012066A/en not_active Expired
- 1963-06-26 DE DEG38030A patent/DE1212108B/de active Pending
- 1963-07-09 CH CH862063A patent/CH403402A/de unknown
- 1963-07-09 SE SE7610/63A patent/SE304417B/xx unknown
- 1963-07-11 NL NL63295165A patent/NL141273B/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1012066A (en) | 1965-12-08 |
| DE1212108B (de) | 1966-03-10 |
| CH403402A (de) | 1965-11-30 |
| US3137478A (en) | 1964-06-16 |
| SE304417B (enExample) | 1968-09-23 |
| NL295165A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL141273B (nl) | Van schoepen voorziene rotor, in het bijzonder een turbinewiel. | |
| DK126220B (da) | Kabelspændbånd, der er støbt i ét stykke. | |
| NL142637B (nl) | Meerversnellingsnaaf. | |
| FR1444888A (fr) | Roue-turbine | |
| DK113123B (da) | Sæde, i særdeleshed bilsæde. | |
| AT299991B (de) | Einrichtung an kraftangetriebenen Schreib-, Buchungs- od.ähnl. Maschinen | |
| FR2553M (fr) | Ester utilisable en cardiologie. | |
| NL142361B (nl) | Tweeversnellingsnaaf. | |
| DK121774B (da) | Radialt blæserhjul. | |
| NL150162B (nl) | Schachtoven, in het bijzonder hoogoven, voorzien van een beschermpantser. | |
| FR93118E (fr) | Perfectionnement aux compteurs-mesureurs a turbine. | |
| DK111156B (da) | Kantpåvalsningsmaskine, især finerkantpålimningsmaskine. | |
| DK105302C (da) | Motordrevet sprøjteapparat, der kan bæres på ryggen. | |
| DK104667C (da) | Oppustelig, selvudfoldende flåde. | |
| DK125291B (da) | Centripetal turbinerotor. | |
| NL173087B (nl) | Radiale turbine. | |
| ES117902Y (es) | Rueda. | |
| NL141613B (nl) | Meertraps-turbomachine. | |
| ES126343Y (es) | Rueda pivotante perfeccionada. | |
| ES118569Y (es) | Rueda dentada extensible,perfeccionada. | |
| ES115116Y (es) | Rueda orientable. | |
| ES96384Y (es) | Rueda orientable perfeccionada. | |
| DK92142C (da) | Støbt hjul, især remskive. | |
| ES131467Y (es) | Nueva rueda. | |
| ES153800Y (es) | Colector-deflector neumatico, perfeccionado. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NL80 | Abbreviated name of patent owner mentioned of already nullified patent |
Owner name: GEN ELECTRIC |
|
| V4 | Discontinued because of reaching the maximum lifetime of a patent |