JPS6112660A - Novel 2-pyrrolidone derivative and antiinflammatory therefrom - Google Patents
Novel 2-pyrrolidone derivative and antiinflammatory therefromInfo
- Publication number
- JPS6112660A JPS6112660A JP13382584A JP13382584A JPS6112660A JP S6112660 A JPS6112660 A JP S6112660A JP 13382584 A JP13382584 A JP 13382584A JP 13382584 A JP13382584 A JP 13382584A JP S6112660 A JPS6112660 A JP S6112660A
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- formula
- antiinflammatory
- therefrom
- novel
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000003110 anti-inflammatory Effects 0.000 title abstract 2
- 150000003953 γ-lactams Chemical class 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 abstract 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 3
- BZKBCQXYZZXSCO-UHFFFAOYSA-N sodium hydride Chemical compound [H-].[Na+] BZKBCQXYZZXSCO-UHFFFAOYSA-N 0.000 abstract 3
- HUMNYLRZRPPJDN-UHFFFAOYSA-N Benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- 125000004665 trialkylsilyl group Chemical group 0.000 abstract 2
- 150000004042 3-pyrrolidinones Chemical class 0.000 abstract 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 abstract 1
- 150000008046 alkali metal hydrides Chemical class 0.000 abstract 1
- 229940095076 benzaldehyde Drugs 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 239000011780 sodium chloride Substances 0.000 abstract 1
- -1 sodium hydride Chemical class 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
Abstract
NEW MATERIAL:A 3-pyrrolidone derivative of formula I (R1 is H, 1W3C alkyl, benzyl; R2 is H, 1W6C alkyl; R3 is H, 1W3C alkyl; R4, R5 are independently H, or incorporate to form a chemical bond) and its salt.
EXAMPLE: The compound of formula II.
USE: Anti-inflammatory.
PREPARATION: For example, the reaction of a benzaldehyde of formula III (R6 is alkyl, benzyl, trialkylsilyl) with 1-acyl-2-pyrrolidone is effected in the presence of an alkali metal hydride such as sodium hydride, when needed, alkyl, benzyl or trialkylsilyl of R6 is eliminated to give a compound of formula IV among formula I.
COPYRIGHT: (C)1986,JPO&Japio
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13382584A JPS6112660A (en) | 1984-06-27 | 1984-06-27 | Novel 2-pyrrolidone derivative and antiinflammatory therefrom |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13382584A JPS6112660A (en) | 1984-06-27 | 1984-06-27 | Novel 2-pyrrolidone derivative and antiinflammatory therefrom |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS6112660A true JPS6112660A (en) | 1986-01-21 |
Family
ID=15113919
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP13382584A Pending JPS6112660A (en) | 1984-06-27 | 1984-06-27 | Novel 2-pyrrolidone derivative and antiinflammatory therefrom |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS6112660A (en) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS61257967A (en) * | 1985-05-09 | 1986-11-15 | Eisai Co Ltd | 2-pyrrolidone derivative |
| JPH04313177A (en) * | 1991-04-11 | 1992-11-05 | Seikosha Co Ltd | Setting parameter storage means and time recorder |
| US5223533A (en) * | 1989-03-31 | 1993-06-29 | L'oreal | New benzylcyclanone derivatives process for preparing them and cosmetic and pharmaceutical compositions containing them |
| CN106748949A (en) * | 2017-01-13 | 2017-05-31 | 厦门大学 | One kind synthesis α, the method for β unsaturated acyl amines |
-
1984
- 1984-06-27 JP JP13382584A patent/JPS6112660A/en active Pending
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS61257967A (en) * | 1985-05-09 | 1986-11-15 | Eisai Co Ltd | 2-pyrrolidone derivative |
| US5223533A (en) * | 1989-03-31 | 1993-06-29 | L'oreal | New benzylcyclanone derivatives process for preparing them and cosmetic and pharmaceutical compositions containing them |
| JPH04313177A (en) * | 1991-04-11 | 1992-11-05 | Seikosha Co Ltd | Setting parameter storage means and time recorder |
| CN106748949A (en) * | 2017-01-13 | 2017-05-31 | 厦门大学 | One kind synthesis α, the method for β unsaturated acyl amines |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6089474A (en) | Morphinan derivative, production thereof and antitumor agent containing said compound | |
| JPS5745200A (en) | Anti-inflammatory steroid and pharmacological composition containing the same | |
| JPS5576829A (en) | Beta,gamma-dihydropolyprenyl alcohol and hypotensive agent made from it | |
| JPS61218571A (en) | Novel lactam derivative, novel thiolactam derivative and anti-inflammatory agent | |
| JPS6112660A (en) | Novel 2-pyrrolidone derivative and antiinflammatory therefrom | |
| JPS61100565A (en) | Indoleacetic acid derivative | |
| JPS57192340A (en) | Isoprenylamine derivative | |
| JPS60112761A (en) | Novel ryridinium compound and production thereof | |
| JPH01228997A (en) | Sialocyl glycerides and production thereof | |
| JPS61112056A (en) | Imidazole derivative and production thereof | |
| JPS61152676A (en) | Production of dibenzo(b,e)oxepine derivative | |
| JPS60190776A (en) | Thiophenes and their production | |
| JPS63316755A (en) | N-methyl-alpha-dialkylaminoacetohydroxamic acid derivative | |
| JPS6127979A (en) | Preparation of hydroxyflavan compound | |
| JPS6187638A (en) | Preparation of 2,3-disubstituted-4-substituted cyclopentanone | |
| JPS57144253A (en) | Preparation of crude aminoalkylthiol | |
| JPS6357590A (en) | Furanocumarin based compound and controlling agent for coccida containing said compound | |
| JPS60156610A (en) | Arachidonic acid 5-lipoxygenase inhibitor | |
| JPS61134386A (en) | Production of theaspirone | |
| JPS61229859A (en) | 5-acetyl-2-alkylbenzenesulfonic acid-n,n-dialkylaniline salt and production thereof | |
| JPS6092262A (en) | Production of 2-halo-2-cyclopentenone compound | |
| JPS55133357A (en) | Preparation of 1-cyano-2-hydroxy-3-phthalimidopropane | |
| JPS6169751A (en) | Salicylamide derivative, its preparation and agent for controlling crubroot of cruficerous plant | |
| JPS6210024A (en) | Asymmetric reducing agent and reduction of asymmetric ketone using same | |
| JPS59155355A (en) | Novel process for preparation of 4-thiazolyloxy-and 4-thiazolylthio-phenylacetic acid derivative |