JPS5799542A - 4-(trans-4'-alkylcyclohexyl)benzyl alkyl ether - Google Patents
4-(trans-4'-alkylcyclohexyl)benzyl alkyl etherInfo
- Publication number
- JPS5799542A JPS5799542A JP17670980A JP17670980A JPS5799542A JP S5799542 A JPS5799542 A JP S5799542A JP 17670980 A JP17670980 A JP 17670980A JP 17670980 A JP17670980 A JP 17670980A JP S5799542 A JPS5799542 A JP S5799542A
- Authority
- JP
- Japan
- Prior art keywords
- formula
- expressed
- trans
- compound expressed
- reacted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- -1 benzyl alkyl ether Chemical class 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 7
- 239000004973 liquid crystal related substance Substances 0.000 abstract 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 abstract 2
- 239000000203 mixture Substances 0.000 abstract 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 abstract 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 abstract 1
- UNDXPKDBFOOQFC-UHFFFAOYSA-N 4-[2-nitro-4-(trifluoromethyl)phenyl]morpholine Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=CC=C1N1CCOCC1 UNDXPKDBFOOQFC-UHFFFAOYSA-N 0.000 abstract 1
- 239000005711 Benzoic acid Substances 0.000 abstract 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 235000010233 benzoic acid Nutrition 0.000 abstract 1
- 235000019441 ethanol Nutrition 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 229910052708 sodium Inorganic materials 0.000 abstract 1
- 239000011734 sodium Substances 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Liquid Crystal Substances (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP17670980A JPS5799542A (en) | 1980-12-15 | 1980-12-15 | 4-(trans-4'-alkylcyclohexyl)benzyl alkyl ether |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP17670980A JPS5799542A (en) | 1980-12-15 | 1980-12-15 | 4-(trans-4'-alkylcyclohexyl)benzyl alkyl ether |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5799542A true JPS5799542A (en) | 1982-06-21 |
| JPS643858B2 JPS643858B2 (esLanguage) | 1989-01-23 |
Family
ID=16018380
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP17670980A Granted JPS5799542A (en) | 1980-12-15 | 1980-12-15 | 4-(trans-4'-alkylcyclohexyl)benzyl alkyl ether |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5799542A (esLanguage) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4507222A (en) * | 1982-03-26 | 1985-03-26 | Chisso Corporation | Liquid-crystalline compounds |
| US4522741A (en) * | 1982-06-12 | 1985-06-11 | Chisso Corporation | Trans-4-alkyloxymethyl-1-(4'-substituted biphenylyl-4)cyclohexanes |
| US4564694A (en) * | 1981-02-25 | 1986-01-14 | Hitachi, Ltd. | Colorless liquid crystalline compounds |
| US4622164A (en) * | 1983-06-14 | 1986-11-11 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Bicyclohexyls |
| US4654162A (en) * | 1984-08-13 | 1987-03-31 | Chisso Corporation | Alcohol derivatives |
| US4723005A (en) * | 1983-09-10 | 1988-02-02 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Anisotropic compounds and liquid crystal mixtures |
| US5252252A (en) * | 1983-09-10 | 1993-10-12 | Merck Patent Gesellschaft Mit Beschraenkter Haftung | Anisotropic compounds and liquid crystal mixtures |
| CN102329192A (zh) * | 2011-09-30 | 2012-01-25 | 山东天一化学股份有限公司 | 溴化苄的合成方法 |
-
1980
- 1980-12-15 JP JP17670980A patent/JPS5799542A/ja active Granted
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4564694A (en) * | 1981-02-25 | 1986-01-14 | Hitachi, Ltd. | Colorless liquid crystalline compounds |
| US4694098A (en) * | 1981-02-25 | 1987-09-15 | Hitachi, Ltd. | Colorless liquid crystalline compounds |
| US4507222A (en) * | 1982-03-26 | 1985-03-26 | Chisso Corporation | Liquid-crystalline compounds |
| US4704228A (en) * | 1982-03-26 | 1987-11-03 | Chisso Corporation | Liquid-crystalline compounds |
| US4522741A (en) * | 1982-06-12 | 1985-06-11 | Chisso Corporation | Trans-4-alkyloxymethyl-1-(4'-substituted biphenylyl-4)cyclohexanes |
| US4617141A (en) * | 1982-06-12 | 1986-10-14 | Chisso Corporation | Trans-4-alkyloxymethyl-1-(4'-substituted biphenylyl-4)cyclohexanes |
| US4622164A (en) * | 1983-06-14 | 1986-11-11 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Bicyclohexyls |
| US4723005A (en) * | 1983-09-10 | 1988-02-02 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Anisotropic compounds and liquid crystal mixtures |
| US5252252A (en) * | 1983-09-10 | 1993-10-12 | Merck Patent Gesellschaft Mit Beschraenkter Haftung | Anisotropic compounds and liquid crystal mixtures |
| US4654162A (en) * | 1984-08-13 | 1987-03-31 | Chisso Corporation | Alcohol derivatives |
| CN102329192A (zh) * | 2011-09-30 | 2012-01-25 | 山东天一化学股份有限公司 | 溴化苄的合成方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS643858B2 (esLanguage) | 1989-01-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS57118526A (en) | Dicyclohexylethane derivative | |
| JPS5799542A (en) | 4-(trans-4'-alkylcyclohexyl)benzyl alkyl ether | |
| JPS5746952A (en) | 4'-(beta-alkyloxyethoxy)-4-cyanobiphenyl | |
| JPS575780A (en) | Liquid crystal composition | |
| JPS54109949A (en) | Trans-(equatorial-equatorial) 1,4-disubstituted cyclohexane derivative | |
| JPS5759851A (en) | 4-trans-(trans-4'-alkylcyclohexyl)cylohexylmethyl 4-cyanophenyl ether | |
| JPS5750933A (en) | 4-(trans-4'-alkylcyclohexyl)benzyl 4"-fluorophenyl ether | |
| JPS575782A (en) | Liquid crystal composition | |
| JPS5738760A (en) | 4-(trans-4'-alkylcyclohexyl)benzyl 4"-cyanophenyl ether | |
| JPS57114531A (en) | 4-(trans 4'-(trans-4"-alkylcyclohexyl)cyclohexyl) chlorobenzene | |
| JPS5711935A (en) | 4'-alkyl-1'-cyclohexene-1'-yl-4-methoxybenzene | |
| JPS5566556A (en) | 3-pentyloxy-6-cyclohexanecarboxy-phthalonitrile | |
| JPS57140737A (en) | Colorless liquid crystal substance, colorless liquid crystal composition, and display element of liquid crystal | |
| JPS5777658A (en) | 4'-cyanophenyl 4-(alpha-alkoxymethyl)benzoate | |
| JPS5770851A (en) | Cinnamoyl nitrile | |
| JPS57134431A (en) | 4-(beta-alkoxyethoxy)-4'-fluorobiphenyl | |
| JPS5572143A (en) | Fluorine-containing phenylbenzoate compound, and its preparation and use | |
| JPS56150030A (en) | 4'-alkyl-4-fluorobiphenyl | |
| JPS575781A (en) | Liquid crystal composition | |
| JPS5711944A (en) | Optically active ester | |
| JPS5718649A (en) | 4-(trans-4'-alkylcyclohexylmethoxy)benzoic acid trans-4"- alkylcyclohexyl ester | |
| JPS574927A (en) | 4'-substituted-1'-cyclohexen-1'-yl-4-fluorobenzene | |
| JPS5785343A (en) | Trans-4-alkylcyclohexanecarboxylic 3'-fluoro-4'- alkoxyphenyl ester | |
| JPS579752A (en) | Trans-4-(trans-4'-substituted cyclohexyl)- cyclohexanecarboxylic acid 3"-cyanophenyl ester | |
| JPS5572156A (en) | 3-butoxy-6-cyclohexanecarboxy-phthalonitriles |