JPS5793949A - Alpha-cyanophenoxybenzylamine derivative - Google Patents
Alpha-cyanophenoxybenzylamine derivativeInfo
- Publication number
- JPS5793949A JPS5793949A JP56156310A JP15631081A JPS5793949A JP S5793949 A JPS5793949 A JP S5793949A JP 56156310 A JP56156310 A JP 56156310A JP 15631081 A JP15631081 A JP 15631081A JP S5793949 A JPS5793949 A JP S5793949A
- Authority
- JP
- Japan
- Prior art keywords
- cyanophenoxybenzylamine
- alpha
- derivative
- cyanophenoxybenzylamine derivative
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- VHBVGUIJSMIJJQ-UHFFFAOYSA-N 2-(phenoxyamino)-2-phenylacetonitrile Chemical class C=1C=CC=CC=1C(C#N)NOC1=CC=CC=C1 VHBVGUIJSMIJJQ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/145—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AU587180 | 1980-10-03 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5793949A true JPS5793949A (en) | 1982-06-11 |
| JPH029580B2 JPH029580B2 (enExample) | 1990-03-02 |
Family
ID=3696362
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP56156310A Granted JPS5793949A (en) | 1980-10-03 | 1981-10-02 | Alpha-cyanophenoxybenzylamine derivative |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4420614A (enExample) |
| EP (1) | EP0049577B1 (enExample) |
| JP (1) | JPS5793949A (enExample) |
| CA (1) | CA1181756A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9011618D0 (en) * | 1990-05-24 | 1990-07-11 | Unilever Plc | Bleaching composition |
| GB9012001D0 (en) * | 1990-05-30 | 1990-07-18 | Unilever Plc | Bleaching composition |
| DE4431212A1 (de) * | 1994-09-02 | 1996-03-07 | Basf Ag | Verfahren zur Herstellung von quaternierten Glycinnitrilen |
| CN102607128A (zh) * | 2012-04-11 | 2012-07-25 | 刘喆 | 超声波雾化装置 |
| CN102620375A (zh) * | 2012-04-25 | 2012-08-01 | 黄宇嵩 | 超声波加湿器 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55104254A (en) * | 1979-02-05 | 1980-08-09 | Kuraray Co Ltd | N-substituted-alpha-cyano-3-phenoxybenzylamine |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4110362A (en) * | 1976-03-01 | 1978-08-29 | Shell Oil Company | Preparation of esters |
| US4167576A (en) * | 1977-10-06 | 1979-09-11 | Rohm And Haas Company | Cyanoaralkylheterocyclic compounds |
| HU180444B (en) | 1979-07-02 | 1983-03-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing esters of cyclopropane-carboxylic acids |
-
1981
- 1981-09-08 US US06/300,191 patent/US4420614A/en not_active Expired - Fee Related
- 1981-09-16 CA CA000386058A patent/CA1181756A/en not_active Expired
- 1981-09-16 EP EP81304247A patent/EP0049577B1/en not_active Expired
- 1981-10-02 JP JP56156310A patent/JPS5793949A/ja active Granted
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55104254A (en) * | 1979-02-05 | 1980-08-09 | Kuraray Co Ltd | N-substituted-alpha-cyano-3-phenoxybenzylamine |
Also Published As
| Publication number | Publication date |
|---|---|
| CA1181756A (en) | 1985-01-29 |
| US4420614A (en) | 1983-12-13 |
| JPH029580B2 (enExample) | 1990-03-02 |
| EP0049577B1 (en) | 1984-04-11 |
| EP0049577A1 (en) | 1982-04-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA816809B (en) | Aminoalkylfuran derivative | |
| GB2079270B (en) | Imidazo-rifamycin derivatives | |
| JPS5785379A (en) | 3-aryl-5-isothiazole derivative | |
| GB2086380B (en) | L-argininal derivatives | |
| JPS56150050A (en) | Oxitocin derivative | |
| JPS5781476A (en) | Isooxazolylbenzamide derivative | |
| GB2075499B (en) | Nonaprenylamine derivatives | |
| GB2088365B (en) | Moranoline derivative | |
| GB2067989B (en) | Bis-moranoline derivatives | |
| PH18633A (en) | Novel antrancyclinone derivative | |
| GB8324990D0 (en) | 3-aminopropoxyphenyl derivatives | |
| JPS577467A (en) | Novel phenylpropargylamine derivative | |
| GB2088379B (en) | 1-phenethylimidazole derivatives | |
| JPS5793949A (en) | Alpha-cyanophenoxybenzylamine derivative | |
| GB2085882B (en) | Aprosamine derivatives | |
| GB2076815B (en) | Aminophenylpyridine derivatives | |
| GB2074165B (en) | Nonaprenylamine derivatives | |
| GB2070589B (en) | 7a1methoxycephalospin derivatives | |
| GB2076395B (en) | Nonaprenylamine derivatives | |
| GB2073201B (en) | Steroid-spiro-oxathiazolidine derivatives | |
| JPS57118540A (en) | Bis-aminomethyl-anthraquinone derivative | |
| JPS5795981A (en) | Novel dibenzopyrane derivative | |
| JPS56133270A (en) | Substituted phenoxy-aminopropanol derivative | |
| JPS56140955A (en) | O-haloalkyl-2-haloacetanilide derivative | |
| JPS56103200A (en) | 200carboxypregnane derivative |