JPS5777658A - 4'-cyanophenyl 4-(alpha-alkoxymethyl)benzoate - Google Patents
4'-cyanophenyl 4-(alpha-alkoxymethyl)benzoateInfo
- Publication number
- JPS5777658A JPS5777658A JP15479880A JP15479880A JPS5777658A JP S5777658 A JPS5777658 A JP S5777658A JP 15479880 A JP15479880 A JP 15479880A JP 15479880 A JP15479880 A JP 15479880A JP S5777658 A JPS5777658 A JP S5777658A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- formula
- reacted
- alkoxymethyl
- cyanophenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 abstract 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 abstract 1
- 239000003513 alkali Substances 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 230000002542 deteriorative effect Effects 0.000 abstract 1
- 239000004973 liquid crystal related substance Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 229910052708 sodium Inorganic materials 0.000 abstract 1
- 239000011734 sodium Substances 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Liquid Crystal Substances (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP15479880A JPS5777658A (en) | 1980-11-04 | 1980-11-04 | 4'-cyanophenyl 4-(alpha-alkoxymethyl)benzoate |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP15479880A JPS5777658A (en) | 1980-11-04 | 1980-11-04 | 4'-cyanophenyl 4-(alpha-alkoxymethyl)benzoate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5777658A true JPS5777658A (en) | 1982-05-15 |
| JPS6321658B2 JPS6321658B2 (cs) | 1988-05-09 |
Family
ID=15592114
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP15479880A Granted JPS5777658A (en) | 1980-11-04 | 1980-11-04 | 4'-cyanophenyl 4-(alpha-alkoxymethyl)benzoate |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5777658A (cs) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4507222A (en) * | 1982-03-26 | 1985-03-26 | Chisso Corporation | Liquid-crystalline compounds |
| US4522741A (en) * | 1982-06-12 | 1985-06-11 | Chisso Corporation | Trans-4-alkyloxymethyl-1-(4'-substituted biphenylyl-4)cyclohexanes |
| US4564694A (en) * | 1981-02-25 | 1986-01-14 | Hitachi, Ltd. | Colorless liquid crystalline compounds |
| US4707296A (en) * | 1984-08-16 | 1987-11-17 | Chisso Corporation | Alkoxyethoxybenzoic acid ester derivatives |
| EP0738709A3 (en) * | 1995-02-22 | 1997-07-16 | Chisso Corp | Ester derivative, liquid crystal composition and liquid crystal display device |
-
1980
- 1980-11-04 JP JP15479880A patent/JPS5777658A/ja active Granted
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4564694A (en) * | 1981-02-25 | 1986-01-14 | Hitachi, Ltd. | Colorless liquid crystalline compounds |
| US4694098A (en) * | 1981-02-25 | 1987-09-15 | Hitachi, Ltd. | Colorless liquid crystalline compounds |
| US4507222A (en) * | 1982-03-26 | 1985-03-26 | Chisso Corporation | Liquid-crystalline compounds |
| US4704228A (en) * | 1982-03-26 | 1987-11-03 | Chisso Corporation | Liquid-crystalline compounds |
| US4522741A (en) * | 1982-06-12 | 1985-06-11 | Chisso Corporation | Trans-4-alkyloxymethyl-1-(4'-substituted biphenylyl-4)cyclohexanes |
| US4617141A (en) * | 1982-06-12 | 1986-10-14 | Chisso Corporation | Trans-4-alkyloxymethyl-1-(4'-substituted biphenylyl-4)cyclohexanes |
| US4707296A (en) * | 1984-08-16 | 1987-11-17 | Chisso Corporation | Alkoxyethoxybenzoic acid ester derivatives |
| EP0738709A3 (en) * | 1995-02-22 | 1997-07-16 | Chisso Corp | Ester derivative, liquid crystal composition and liquid crystal display device |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6321658B2 (cs) | 1988-05-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5721359A (en) | 4'''-cyano-4"-biphenylyl 4-(trans-4'-alkylcyclohexyl)benzoate | |
| JPS5746952A (en) | 4'-(beta-alkyloxyethoxy)-4-cyanobiphenyl | |
| JPS5777658A (en) | 4'-cyanophenyl 4-(alpha-alkoxymethyl)benzoate | |
| JPS575780A (en) | Liquid crystal composition | |
| JPS5799542A (en) | 4-(trans-4'-alkylcyclohexyl)benzyl alkyl ether | |
| JPS57114531A (en) | 4-(trans 4'-(trans-4"-alkylcyclohexyl)cyclohexyl) chlorobenzene | |
| EP0312983A3 (en) | Liquid crystal composition and liquid crystal display device using the same | |
| JPS5750933A (en) | 4-(trans-4'-alkylcyclohexyl)benzyl 4"-fluorophenyl ether | |
| JPS57142955A (en) | Liquid crystal additive having high positive dielectric anisotropic value | |
| JPS5572143A (en) | Fluorine-containing phenylbenzoate compound, and its preparation and use | |
| JPS54101784A (en) | Liquid crystal composition | |
| JPS57134431A (en) | 4-(beta-alkoxyethoxy)-4'-fluorobiphenyl | |
| JPS56104844A (en) | Carboxylic ester derivative of 4-fluorophenol | |
| JPS5566556A (en) | 3-pentyloxy-6-cyclohexanecarboxy-phthalonitrile | |
| JPS57185230A (en) | 3,4-difluoro-4'-(trans-4"-alkylcyclohexyl)biphenyl | |
| JPS577445A (en) | Trans-4-(trans-4'-substituted cyclohexyl)- cyclohexanecarboxylic 3"halogenophenyl ester | |
| JPS57192351A (en) | Trans-4-(trans-4'-alkylcyclohexyl)cyclohexanecarboxylic acid 2-cyanophenyl ester | |
| JPS6475449A (en) | Liquid crystal compound | |
| JPS5738760A (en) | 4-(trans-4'-alkylcyclohexyl)benzyl 4"-cyanophenyl ether | |
| JPS574927A (en) | 4'-substituted-1'-cyclohexen-1'-yl-4-fluorobenzene | |
| JPS56138135A (en) | Liquid crystal compound | |
| JPS57176931A (en) | Carboxylic acid pentafluorophenol ester | |
| JPS57130956A (en) | 4-fluoro-4'-hydroxybiphenyl derivative | |
| JPS57176943A (en) | 4-(trans-4'-alkylcyclohexylmethyloxy)benzoic acid 3"- chloro-4"-cyanophenyl ester | |
| JPS5616458A (en) | Ester compound |