JPS5687561A - Nitrogenncontaining desoxyyprostaglandin** prostacycline intermediate compound - Google Patents
Nitrogenncontaining desoxyyprostaglandin** prostacycline intermediate compoundInfo
- Publication number
- JPS5687561A JPS5687561A JP16347280A JP16347280A JPS5687561A JP S5687561 A JPS5687561 A JP S5687561A JP 16347280 A JP16347280 A JP 16347280A JP 16347280 A JP16347280 A JP 16347280A JP S5687561 A JPS5687561 A JP S5687561A
- Authority
- JP
- Japan
- Prior art keywords
- nitrogenncontaining
- desoxyyprostaglandin
- prostacycline
- intermediate compound
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title 1
- KAQKFAOMNZTLHT-VVUHWYTRSA-N epoprostenol Chemical compound O1C(=CCCCC(O)=O)C[C@@H]2[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]21 KAQKFAOMNZTLHT-VVUHWYTRSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/93—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems condensed with a ring other than six-membered
- C07D307/935—Not further condensed cyclopenta [b] furans or hydrogenated cyclopenta [b] furans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
- C07C405/0008—Analogues having the carboxyl group in the side-chains replaced by other functional groups
- C07C405/0041—Analogues having the carboxyl group in the side-chains replaced by other functional groups containing nitrogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/52—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring condensed with a ring other than six-membered
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792947493 DE2947493A1 (de) | 1979-11-24 | 1979-11-24 | Stickstoff-haltige 11-desoxy-prostaglandin/11-desoxy-prostacylin-synthone und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS5687561A true JPS5687561A (en) | 1981-07-16 |
Family
ID=6086848
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP16347280A Pending JPS5687561A (en) | 1979-11-24 | 1980-11-21 | Nitrogenncontaining desoxyyprostaglandin** prostacycline intermediate compound |
Country Status (4)
| Country | Link |
|---|---|
| JP (1) | JPS5687561A (OSRAM) |
| DE (1) | DE2947493A1 (OSRAM) |
| FR (1) | FR2470123A1 (OSRAM) |
| GB (1) | GB2063866B (OSRAM) |
-
1979
- 1979-11-24 DE DE19792947493 patent/DE2947493A1/de not_active Withdrawn
-
1980
- 1980-11-21 JP JP16347280A patent/JPS5687561A/ja active Pending
- 1980-11-24 GB GB8037649A patent/GB2063866B/en not_active Expired
- 1980-11-24 FR FR8024866A patent/FR2470123A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB2063866A (en) | 1981-06-10 |
| GB2063866B (en) | 1983-10-05 |
| FR2470123B1 (OSRAM) | 1983-08-12 |
| FR2470123A1 (fr) | 1981-05-29 |
| DE2947493A1 (de) | 1981-06-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB2052478B (en) | Guanidinothiazole compounds | |
| JPS55149222A (en) | Prostacycline analogue | |
| JPS5594363A (en) | Phenoxyphenylpiperidine compound | |
| JPS5610183A (en) | 199hydroxyypgi compound | |
| JPS5686134A (en) | Eicosapentanoate compound | |
| JPS55124743A (en) | 99aminoalkylfluorene compound | |
| JPS55143971A (en) | 144methoxymorphinann66one compound | |
| JPS55111255A (en) | Compound structure | |
| JPS56113779A (en) | Compound | |
| GB2125037B (en) | 2-acetoxymethyl-penam compounds | |
| ZA806146B (en) | Heterocyclici compounds | |
| JPS55136288A (en) | Betaalactam contained compound | |
| JPS567790A (en) | Novel penicillinn1*11dioxide compound | |
| JPS5667369A (en) | Phthaloperinone compound | |
| JPS5594364A (en) | Phenylthiophenylpiperidine compound | |
| JPS55113769A (en) | 44substitutedd22iminoimidazolidine compound | |
| GB2047708B (en) | Butyloctyl-magnesium compounds | |
| JPS5620574A (en) | Novel deterioration preventing compound | |
| JPS55136264A (en) | Pyridineacetoamide compound | |
| JPS55124648A (en) | Compound structure | |
| JPS55147293A (en) | Novel thiazolinoazetidinone compound | |
| IL61133A0 (en) | 6-methylene-morphinan compounds | |
| ZA807948B (en) | 2-oxybenzimidazoline compounds | |
| JPS55130960A (en) | Quinolone compound | |
| JPS56100858A (en) | Halootriazinyl compound |