JPS567775A - 4-alkoxy-2-pyrrone derivative - Google Patents
4-alkoxy-2-pyrrone derivativeInfo
- Publication number
- JPS567775A JPS567775A JP8248979A JP8248979A JPS567775A JP S567775 A JPS567775 A JP S567775A JP 8248979 A JP8248979 A JP 8248979A JP 8248979 A JP8248979 A JP 8248979A JP S567775 A JPS567775 A JP S567775A
- Authority
- JP
- Japan
- Prior art keywords
- alkoxy
- formula
- pyrrone
- derivative
- chlorophenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 abstract 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 abstract 2
- JUVQRUUSIBSMHI-UHFFFAOYSA-N 2-[2-(4-chlorophenyl)ethyl]-4-methoxy-2,3-dihydropyran-6-one Chemical compound C1C(OC)=CC(=O)OC1CCC1=CC=C(Cl)C=C1 JUVQRUUSIBSMHI-UHFFFAOYSA-N 0.000 abstract 1
- -1 5,6,7,8-tetrahydronaphthyl Chemical group 0.000 abstract 1
- 201000005577 familial hyperlipidemia Diseases 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 230000003449 preventive effect Effects 0.000 abstract 1
Landscapes
- Pyrane Compounds (AREA)
Abstract
NEW MATERIAL:A compound shown by the formula I (R is methyl or ethyl; when R is methyl, Z is p-chlorophenyl or 5,6,7,8-tetrahydronaphthyl, when R is ethyl, Z is phenyl or p-chlorophenyl).
EXAMPLE: 4-Methoxy-6-(p-chlorophenylethyl)-5,6-dihydro-2H-pyran-2-one.
USE: A remedy and preventive for hyperlipemia.
PROCESS: A compound shwon by the formula I is obtained according to the reaction formula.
COPYRIGHT: (C)1981,JPO&Japio
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8248979A JPS567775A (en) | 1979-06-29 | 1979-06-29 | 4-alkoxy-2-pyrrone derivative |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8248979A JPS567775A (en) | 1979-06-29 | 1979-06-29 | 4-alkoxy-2-pyrrone derivative |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS567775A true JPS567775A (en) | 1981-01-27 |
Family
ID=13775905
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP8248979A Pending JPS567775A (en) | 1979-06-29 | 1979-06-29 | 4-alkoxy-2-pyrrone derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS567775A (en) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57179430A (en) * | 1981-04-30 | 1982-11-05 | Matsushita Electric Ind Co Ltd | Manufacture of rotor for electromagnetic clutch |
| JPS58134233A (en) * | 1982-02-02 | 1983-08-10 | Mitsubishi Electric Corp | Electromagnetic connection apparatus |
| US4613610A (en) * | 1984-06-22 | 1986-09-23 | Sandoz Pharmaceuticals Corp. | Cholesterol biosynthesis inhibiting pyrazole analogs of mevalonolactone and its derivatives |
| US4668794A (en) * | 1985-05-22 | 1987-05-26 | Sandoz Pharm. Corp. | Intermediate imidazole acrolein analogs |
| JPH0492124A (en) * | 1990-08-06 | 1992-03-25 | Ishizaki Kogyo Kk | Rotor with pulley of electromagnetic clutch and manufacture of the same |
| US5651181A (en) * | 1995-04-28 | 1997-07-29 | Nippondenso Co., Ltd. | Method of manufacturing a V-pulley |
| JP2009023975A (en) * | 2007-07-23 | 2009-02-05 | Nagoya Industrial Science Research Inst | Peroxisome proliferator-responsive receptor (PPAR) alpha ligand agent |
-
1979
- 1979-06-29 JP JP8248979A patent/JPS567775A/en active Pending
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57179430A (en) * | 1981-04-30 | 1982-11-05 | Matsushita Electric Ind Co Ltd | Manufacture of rotor for electromagnetic clutch |
| JPS58134233A (en) * | 1982-02-02 | 1983-08-10 | Mitsubishi Electric Corp | Electromagnetic connection apparatus |
| US4613610A (en) * | 1984-06-22 | 1986-09-23 | Sandoz Pharmaceuticals Corp. | Cholesterol biosynthesis inhibiting pyrazole analogs of mevalonolactone and its derivatives |
| US4668794A (en) * | 1985-05-22 | 1987-05-26 | Sandoz Pharm. Corp. | Intermediate imidazole acrolein analogs |
| JPH0492124A (en) * | 1990-08-06 | 1992-03-25 | Ishizaki Kogyo Kk | Rotor with pulley of electromagnetic clutch and manufacture of the same |
| US5651181A (en) * | 1995-04-28 | 1997-07-29 | Nippondenso Co., Ltd. | Method of manufacturing a V-pulley |
| DE19616833B4 (en) * | 1995-04-28 | 2004-11-11 | Denso Corp., Kariya | Method of manufacturing a V-belt pulley |
| JP2009023975A (en) * | 2007-07-23 | 2009-02-05 | Nagoya Industrial Science Research Inst | Peroxisome proliferator-responsive receptor (PPAR) alpha ligand agent |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS567775A (en) | 4-alkoxy-2-pyrrone derivative | |
| ES8301928A1 (en) | Herbicidal 4-benzoyl-5-phenacyloxy-pyrazole derivatives, composition and method | |
| JPS53134060A (en) | Novel polysaccharide | |
| JPS5424882A (en) | Novel heterocyclic compounds and their preparation | |
| JPS5424856A (en) | 1-(3 or 4-methyl-3-cyclohexenyl)-2-methyl-1-penten-3-ol | |
| JPS51123824A (en) | A non-medical antibacterial and its preparation | |
| JPS53127466A (en) | Thiocarbamate type heterocyclic compounds and its preparation | |
| JPS53133229A (en) | Novel disazo compounds and their preparation | |
| JPS5419945A (en) | Cyclohexane derivatives, their preparation and herbicides | |
| JPS5424869A (en) | Heterocyclic compounds and their preparation | |
| JPS52125146A (en) | Arylacetylenesulfonamide derivatives and method of preparing the same | |
| JPS5416451A (en) | 3,5-dichloro-4-fluoropheyl isocyanate and its preparation | |
| JPS5387360A (en) | 5-halomethyl-gamma-tocopheral nicotinate | |
| JPS5412355A (en) | Alkyl cyclohexyldichlorosilane compounds and their preparation | |
| JPS52133949A (en) | 3'-deoxy-5-0-pentoforanosyl-neamine derivatives | |
| JPS5724368A (en) | 5-amino-1,4-dihydrocinnoline and its preparation | |
| JPS5210420A (en) | A method for regulating plant growth | |
| JPS5328186A (en) | Preparation of novel s-triazine compound | |
| JPS52131590A (en) | Bis-trimethoxybenzylpiperazino-alkanes | |
| JPS5432452A (en) | 2-(2-pentynyl)cyclopentanol derivative and its preparation | |
| JPS5528938A (en) | Alpha-substituted amino-epsilon-caprolactam | |
| JPS5283742A (en) | Novel thiazole compounds | |
| JPS52133948A (en) | Novel 3'-deoxykanamycin a derivatives | |
| JPS53134086A (en) | Photopolymerizable composition | |
| JPS5422353A (en) | 2-chloro-2-cyano-7-alkylidene-bicyclo(2,2,1)-5-heptene and its preparation |