JPS5382750A - Alpha-thio-alpha-(m-phehoxyphenyl)propionic acid derivs. - Google Patents
Alpha-thio-alpha-(m-phehoxyphenyl)propionic acid derivs.Info
- Publication number
- JPS5382750A JPS5382750A JP15636076A JP15636076A JPS5382750A JP S5382750 A JPS5382750 A JP S5382750A JP 15636076 A JP15636076 A JP 15636076A JP 15636076 A JP15636076 A JP 15636076A JP S5382750 A JPS5382750 A JP S5382750A
- Authority
- JP
- Japan
- Prior art keywords
- alpha
- thio
- propionic acid
- phehoxyphenyl
- acid derivs
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 title 2
- 235000019260 propionic acid Nutrition 0.000 title 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 abstract 1
- 239000005977 Ethylene Substances 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP15636076A JPS5382750A (en) | 1976-12-27 | 1976-12-27 | Alpha-thio-alpha-(m-phehoxyphenyl)propionic acid derivs. |
| GB43075/77A GB1577550A (en) | 1976-10-18 | 1977-10-17 | -thio-alkanoic acid derivatives |
| CA288,833A CA1090811A (en) | 1976-10-18 | 1977-10-17 | .alpha.-THIO-ALKANOIC ACID DERIVATIVES |
| NLAANVRAGE7711371,A NL175407C (nl) | 1976-10-18 | 1977-10-17 | Werkwijze voor het bereiden van op de alfa-arylalkaancarbonzuurverbindingen. |
| DE2746754A DE2746754C2 (de) | 1976-10-18 | 1977-10-18 | Verfahren zur Herstellung von α-Aryl-propionsäure- und α-Aryl-isovaleriansäurederivaten und von deren Estern |
| FR7731252A FR2367742A1 (fr) | 1976-10-18 | 1977-10-18 | Derives d'a-thio-alcanoiques, leur preparation et leur utilisation |
| CH1269677A CH632740A5 (de) | 1976-10-18 | 1977-10-18 | Verfahren zur herstellung neuer alpha-thio-alkanoylsaeure-derivate. |
| BE181839A BE859846A (fr) | 1976-10-18 | 1977-10-18 | Nouveaux derives d'acide alpha-thio-alcanoique |
| US06/020,231 US4242519A (en) | 1976-10-18 | 1979-03-13 | Novel α-thio-alkanoic acid derivatives |
| US06/156,349 US4278802A (en) | 1976-10-18 | 1980-06-04 | Novel α-thio-alkanoic acid derivatives |
| US06/156,348 US4308208A (en) | 1976-10-18 | 1980-06-04 | α-Methylthio-α-(p-phthalimidophenyl)-propionic acid |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP15636076A JPS5382750A (en) | 1976-12-27 | 1976-12-27 | Alpha-thio-alpha-(m-phehoxyphenyl)propionic acid derivs. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5382750A true JPS5382750A (en) | 1978-07-21 |
| JPS5748064B2 JPS5748064B2 (OSRAM) | 1982-10-14 |
Family
ID=15626046
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP15636076A Granted JPS5382750A (en) | 1976-10-18 | 1976-12-27 | Alpha-thio-alpha-(m-phehoxyphenyl)propionic acid derivs. |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5382750A (OSRAM) |
-
1976
- 1976-12-27 JP JP15636076A patent/JPS5382750A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5748064B2 (OSRAM) | 1982-10-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS52154528A (en) | Remedy for glaucoma | |
| JPS52106844A (en) | 3-cyanomethylcyclopentanone derivatives | |
| JPS52153947A (en) | Dicyclododecyl peroxycarbonate | |
| JPS5382750A (en) | Alpha-thio-alpha-(m-phehoxyphenyl)propionic acid derivs. | |
| JPS5318540A (en) | Alpha-chloroacetamides and their use | |
| JPS5293730A (en) | Thioethers | |
| JPS5346968A (en) | Novel hexadecapeptides | |
| JPS5231082A (en) | Preparation of 2- piperazinophenylpropionic acid | |
| JPS5382749A (en) | Alpha-thio(m-phenoxyphenyl)acetic acid derivs. | |
| JPS5346937A (en) | Preparation of n-p-aminobenzoyl-n,-p-aminourea | |
| JPS53141284A (en) | N u4 -dialkylaminomethylenearabinofuranosylcytosine and process for its preparation | |
| JPS5291880A (en) | 3-acyl-5-fluorouracil | |
| JPS52134634A (en) | 3,10-dialkoxy-4-halogeno-13-cyanotriphenodioxazines | |
| JPS52116472A (en) | Baciferacins | |
| JPS5382769A (en) | Bicyclolactone derivs. their preparation | |
| JPS5419948A (en) | Chalcone compounds | |
| JPS52148045A (en) | 4-hydroxypent-2-ene-1-one derivatives | |
| JPS5377012A (en) | Peptide | |
| JPS5346955A (en) | Polyoxypregnane type compound | |
| JPS52133952A (en) | Beta-(1-ethoxycarbonyl-2-oxocyclododecyl)-propionic acid and method of preparing the same | |
| JPS52118461A (en) | Thiophene-silylenole-ether | |
| JPS52133943A (en) | 3-chloro-4-allyloxyphenylyzuvic acids | |
| JPS545043A (en) | Digestive ulcer remedy containing polyprenylcarboxylic | |
| JPS5283708A (en) | Desacyl-pepsidin | |
| JPS521020A (en) | Weedkiller |