JPS5283870A - Cephalosprin compounds - Google Patents
Cephalosprin compoundsInfo
- Publication number
- JPS5283870A JPS5283870A JP127576A JP127576A JPS5283870A JP S5283870 A JPS5283870 A JP S5283870A JP 127576 A JP127576 A JP 127576A JP 127576 A JP127576 A JP 127576A JP S5283870 A JPS5283870 A JP S5283870A
- Authority
- JP
- Japan
- Prior art keywords
- compounds
- cephalosprin
- carboethoxycarbamoyl
- carboxyvaleramido
- cephem
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001875 compounds Chemical class 0.000 title abstract 2
- RWTUAOUHOCGKNX-KEKZHRQWSA-N (6R)-4-benzoyloxy-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C1=CC=CC=C1)(=O)OC1(S[C@H]2N(C(=C1)C(=O)O)C(C2)=O)C RWTUAOUHOCGKNX-KEKZHRQWSA-N 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 abstract 1
Landscapes
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP127576A JPS5283870A (en) | 1976-01-01 | 1976-01-01 | Cephalosprin compounds |
| DE2619243A DE2619243C2 (de) | 1975-05-06 | 1976-04-30 | Verfahren zur Herstellung von 3-Acyloxymethyl-cephem-Verbindungen |
| CA251,663A CA1074296A (en) | 1975-05-06 | 1976-05-03 | 3-acyloxymethylcephem compounds |
| HU76TA00001399A HU172550B (hu) | 1975-05-06 | 1976-05-04 | Sposob poluchenija novykh 3-aciloksimetil-cefemnykh proizvodnykh |
| FR7613290A FR2310352A1 (fr) | 1975-05-06 | 1976-05-04 | Nouveaux composes 3-acyloxymethyl-cephem et leur procede de preparation |
| GB18370/76A GB1535293A (en) | 1975-05-06 | 1976-05-05 | Method for producing cephalosporin compounds |
| DK201676A DK201676A (da) | 1975-05-06 | 1976-05-05 | 3-acyloxymethyl-cephemforbindelser og fremgangsmade til fremstilling deraf |
| BE166739A BE841469A (fr) | 1975-05-06 | 1976-05-05 | Nouveaux composes 3-acyloxymethyl-cephem et leur procede de preparation |
| SE7605131A SE435185B (sv) | 1975-05-06 | 1976-05-05 | Cefalosporinderivat till anvendning som mellan produkt for framstellning av cefalosporinderivat |
| ES447615A ES447615A1 (es) | 1975-05-06 | 1976-05-05 | Un procedimiento para obtener compuesto de cefalosporina. |
| CH570576A CH627756A5 (en) | 1975-05-06 | 1976-05-06 | Process for the preparation of 3-acyloxymethylcephem compounds |
| NL7604869A NL7604869A (nl) | 1975-05-06 | 1976-05-06 | Werkwijze ter bereiding van nieuwe 3-acyloxy- methylcefemverbindingen. |
| US05/897,157 US4166178A (en) | 1975-05-06 | 1978-04-17 | 3-acyloxymethyl-cephem compounds |
| US06/032,692 US4224441A (en) | 1975-05-06 | 1979-04-23 | Derivatives of 7-aminocephalosporanic acid |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP127576A JPS5283870A (en) | 1976-01-01 | 1976-01-01 | Cephalosprin compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5283870A true JPS5283870A (en) | 1977-07-13 |
| JPS6126549B2 JPS6126549B2 (Direct) | 1986-06-20 |
Family
ID=11496899
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP127576A Granted JPS5283870A (en) | 1975-05-06 | 1976-01-01 | Cephalosprin compounds |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5283870A (Direct) |
-
1976
- 1976-01-01 JP JP127576A patent/JPS5283870A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6126549B2 (Direct) | 1986-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5297950A (en) | Chalconeether derivatives | |
| JPS5395977A (en) | 1,4-dihydropyrimidine compounds and process for their preparation | |
| JPS5430197A (en) | Novel antibiotic compound | |
| JPS5283870A (en) | Cephalosprin compounds | |
| JPS52131544A (en) | Phenoxymalonic acid derivatives and herbicides containing them | |
| JPS5379879A (en) | 1,3-substituted-5-fluorouracils and process for their preparation | |
| JPS5419947A (en) | Chalcone derivatives | |
| JPS52102280A (en) | 5,7,8-trimethyltocotrienol-nicotinic acid esters and preparation there of | |
| JPS52111577A (en) | Diaminomaleonitrile derivatives, their preparation and germicides and herbicides containing the same | |
| JPS52125146A (en) | Arylacetylenesulfonamide derivatives and method of preparing the same | |
| JPS5353617A (en) | Alpha-isocyano fatty acid amide derivatives and process for preparation of thesame | |
| JPS52100486A (en) | Gamma-glutamic acid n-carboxyanhydride | |
| JPS5285169A (en) | Novel allantoin-n-acetylglutamine-aluminum molecular complex and its p reparation | |
| JPS52116472A (en) | Baciferacins | |
| JPS52106851A (en) | Benzophenone derivatives and plasticizer containing the same | |
| JPS5283569A (en) | 1,2,5,6-tetrahydropyridine derivatives | |
| JPS5283668A (en) | 5-benzylpicoline derivatives | |
| JPS5346970A (en) | 8-azaprostanoic acids and their preparation | |
| JPS5384972A (en) | Nucleocide derivative | |
| JPS52100424A (en) | Urethane derivatives of diaminomaleonitriles and their preparation | |
| JPS5265298A (en) | Synthesis of novel 2-substituted-thioadenosine-n-oxides | |
| JPS52131590A (en) | Bis-trimethoxybenzylpiperazino-alkanes | |
| JPS5283395A (en) | Synthesis of 5,-chloro-5,-deoxyadenosine-sulfonic acid esters | |
| JPS5325519A (en) | Novel thioacrylamide and its preparation | |
| JPS5419948A (en) | Chalcone compounds |