JPS52293A - 66*d ****alphaaaminooalphaa *ppoxyphenyl**acetamide* penicillanic acid or 77*d ****alphaaaminooalpha *pp oxyphenyl**acetamide**33 - Google Patents
66*d ****alphaaaminooalphaa *ppoxyphenyl**acetamide* penicillanic acid or 77*d ****alphaaaminooalpha *pp oxyphenyl**acetamide**33Info
- Publication number
- JPS52293A JPS52293A JP6963876A JP6963876A JPS52293A JP S52293 A JPS52293 A JP S52293A JP 6963876 A JP6963876 A JP 6963876A JP 6963876 A JP6963876 A JP 6963876A JP S52293 A JPS52293 A JP S52293A
- Authority
- JP
- Japan
- Prior art keywords
- acetamide
- ppoxyphenyl
- alphaaaminooalphaa
- alphaaaminooalpha
- oxyphenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 title 4
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2544675A GB1546068A (en) | 1975-06-13 | 1975-06-13 | Process for recovering 6-(d(-)-alpha-amino-alpha-(p-hydroxyphenyl)-acetamido)penicillanic acid or 7-(d-(-)-alpha-amino-alpha-(p-hydroxyphenyl)-acetamido)-3-(1,2,3-triazol-5-yl-thiomethyl)-3-cephem-4-carboxylic acid from an acid solution thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS52293A true JPS52293A (en) | 1977-01-05 |
Family
ID=10227811
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP6963876A Pending JPS52293A (en) | 1975-06-13 | 1976-06-14 | 66*d ****alphaaaminooalphaa *ppoxyphenyl**acetamide* penicillanic acid or 77*d ****alphaaaminooalpha *pp oxyphenyl**acetamide**33 |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JPS52293A (ja) |
| DK (1) | DK263876A (ja) |
| GB (1) | GB1546068A (ja) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4908322A (en) * | 1985-09-06 | 1990-03-13 | The United States Of America As Represented By The Department Of Health And Human Services | Derivatization of amines for electrochemical detection |
-
1975
- 1975-06-13 GB GB2544675A patent/GB1546068A/en not_active Expired
-
1976
- 1976-06-11 DK DK263876A patent/DK263876A/da unknown
- 1976-06-14 JP JP6963876A patent/JPS52293A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1546068A (en) | 1979-05-16 |
| DK263876A (da) | 1976-12-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5219627A (en) | 1*33diiaminoalkanee1* 11diphosphonic acid | |
| JPS51127054A (en) | 1*1*11triaryllalkylamines | |
| JPS5214711A (en) | Novel 122alkoxyy3*7*111 trimethyldodecatetraen | |
| JPS51100042A (en) | 22 * 44 isobuchirufueniru * puropionsanno seizoho | |
| JPS51100041A (en) | 22 * 44 isobuchirufueniru * puropionsanno seizoho | |
| JPS52293A (en) | 66*d ****alphaaaminooalphaa *ppoxyphenyl**acetamide* penicillanic acid or 77*d ****alphaaaminooalpha *pp oxyphenyl**acetamide**33 | |
| JPS51100040A (en) | 22 * 44 isobuchirufueniru * puropionsanno seizoho | |
| JPS51110547A (en) | 2*2** mechirenbisu 4*66 jiarukirufuenooruno seizohoho | |
| JPS51108046A (en) | 1 arufua * 24 * r * *255 torihidorokishikorekarushifuerooruno seizoho | |
| JPS5191238A (en) | 4*4** jiokishibifueniru no seizoho | |
| JPS51110574A (en) | 88 * arufua haroarukanoiru * 3*44 jihidorokarubosuchirirujudotainoseizoho | |
| JPS51109020A (en) | 1*88 nafutaarusanimidojudotaino shinkinaseiho | |
| JPS51108020A (en) | 2*33 jihosuhoguriserinsanno jukiaminenruinoseiho | |
| JPS5141368A (en) | 55 * 2 33 ehokishi * purohokishi 3 4 jihidorokarubosuchiriruno seizoho | |
| JPS51108076A (en) | 2**3**00 surufuinirupirimijinnukureoshido 5** rinsanesuterujudotainoseizohoho | |
| JPS51110575A (en) | 88 * arufua arukiruaminoarukanoiru * 3*44 jihidorokarubosuchirirujudotainoseizoho | |
| JPS51105074A (en) | 55 * jichiokarubamoirumechiru * pikorinsanamidonoseiho | |
| JPS51100062A (en) | 1*77exoo torimechirenbishikuro * 3*2*1 * okutankara 11 mechiruadamantanoseizosuruhoho | |
| JPS5141367A (en) | 55 * 2 33 ehokishi * purohokishi 3 4 jihidorokarubosuchiriruno seizoho | |
| JPS5129447A (en) | Jiarukiru *22 jiarukiruamino ** puropiruhosuhoneetono daiyonkyuanmoniumuennoseiho | |
| JPS51100057A (en) | 1*22 tetoramechirennoruborunankara 11 mechiruadamantanoseizosuruhoho | |
| JPS51108072A (en) | 11 okiso 44 * 44 karubokishibenzoiru * isokuromennoseizoho | |
| JPS51101190A (en) | 5** hosuhojesuteraazeno seizoho | |
| JPS51100001A (en) | Shinki 1*33 jikarubonirukagobutsuno seizoho | |
| JPS51110419A (en) | * 100 * ritsuhoshugososhikikaranaru denjikohannoseizohoho |