JPS52136109A - Unsaturated halo compound derivatives and their preparation - Google Patents
Unsaturated halo compound derivatives and their preparationInfo
- Publication number
- JPS52136109A JPS52136109A JP5367376A JP5367376A JPS52136109A JP S52136109 A JPS52136109 A JP S52136109A JP 5367376 A JP5367376 A JP 5367376A JP 5367376 A JP5367376 A JP 5367376A JP S52136109 A JPS52136109 A JP S52136109A
- Authority
- JP
- Japan
- Prior art keywords
- preparation
- compound derivatives
- halo compound
- unsaturated halo
- unsaturated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- -1 Unsaturated halo compound Chemical class 0.000 title abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrane Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5367376A JPS52136109A (en) | 1976-05-10 | 1976-05-10 | Unsaturated halo compound derivatives and their preparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5367376A JPS52136109A (en) | 1976-05-10 | 1976-05-10 | Unsaturated halo compound derivatives and their preparation |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS52136109A true JPS52136109A (en) | 1977-11-14 |
| JPS5653292B2 JPS5653292B2 (member.php) | 1981-12-17 |
Family
ID=12949338
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP5367376A Granted JPS52136109A (en) | 1976-05-10 | 1976-05-10 | Unsaturated halo compound derivatives and their preparation |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS52136109A (member.php) |
-
1976
- 1976-05-10 JP JP5367376A patent/JPS52136109A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5653292B2 (member.php) | 1981-12-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5377057A (en) | 1,2-benxisoxazole derivatives | |
| JPS537671A (en) | 3-phenylhydantoin derivatives, their preparation and nonmedical fungicides containing the same | |
| JPS52153947A (en) | Dicyclododecyl peroxycarbonate | |
| JPS52136109A (en) | Unsaturated halo compound derivatives and their preparation | |
| JPS52106844A (en) | 3-cyanomethylcyclopentanone derivatives | |
| JPS5424856A (en) | 1-(3 or 4-methyl-3-cyclohexenyl)-2-methyl-1-penten-3-ol | |
| JPS5276434A (en) | Dungicides for nonmedical use and method of making the same | |
| JPS549273A (en) | 7-arginylamono-4-methylcoumarin | |
| JPS5318540A (en) | Alpha-chloroacetamides and their use | |
| JPS5392789A (en) | Selective herbicides | |
| JPS52113929A (en) | Glucoside derivatives | |
| JPS53108974A (en) | 7-arginylamino-4-methylcoumarin | |
| JPS5293771A (en) | Benzotriazoles | |
| JPS52100483A (en) | Isoleucomycin a5 | |
| JPS5346968A (en) | Novel hexadecapeptides | |
| JPS53105583A (en) | Polysaccharide sulfate derivative | |
| JPS5392774A (en) | 5,6,7,3',4',5'-hexahydrooxyflavone | |
| JPS5346937A (en) | Preparation of n-p-aminobenzoyl-n,-p-aminourea | |
| JPS53141284A (en) | N u4 -dialkylaminomethylenearabinofuranosylcytosine and process for its preparation | |
| JPS5291880A (en) | 3-acyl-5-fluorouracil | |
| JPS536424A (en) | Thiophosphoroamide compounds and insecticide-miticide containing the same | |
| JPS52134634A (en) | 3,10-dialkoxy-4-halogeno-13-cyanotriphenodioxazines | |
| JPS52142053A (en) | Dialkoxynaphthalenesulfonylhalogenides | |
| JPS52136148A (en) | Derivatives of cyclopropyl unsaturated compound and their preparation | |
| JPS52118487A (en) | Isotentoxin and method of preparing the same |