JPS52105177A - 2-substituted methyl-thiochroman derivatives - Google Patents
2-substituted methyl-thiochroman derivativesInfo
- Publication number
- JPS52105177A JPS52105177A JP2086876A JP2086876A JPS52105177A JP S52105177 A JPS52105177 A JP S52105177A JP 2086876 A JP2086876 A JP 2086876A JP 2086876 A JP2086876 A JP 2086876A JP S52105177 A JPS52105177 A JP S52105177A
- Authority
- JP
- Japan
- Prior art keywords
- substituted methyl
- thiochroman derivatives
- thiochroman
- derivatives
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- -1 2-substituted methyl-thiochroman Chemical class 0.000 title abstract 2
- VCTNNGLPUPDIRD-UHFFFAOYSA-N 3,4-dihydro-2h-thiochromen-2-ylmethyl acetate Chemical compound C1=CC=C2SC(COC(=O)C)CCC2=C1 VCTNNGLPUPDIRD-UHFFFAOYSA-N 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
Landscapes
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2086876A JPS52105177A (en) | 1976-02-26 | 1976-02-26 | 2-substituted methyl-thiochroman derivatives |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2086876A JPS52105177A (en) | 1976-02-26 | 1976-02-26 | 2-substituted methyl-thiochroman derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS52105177A true JPS52105177A (en) | 1977-09-03 |
| JPS5715759B2 JPS5715759B2 (enExample) | 1982-04-01 |
Family
ID=12039125
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2086876A Granted JPS52105177A (en) | 1976-02-26 | 1976-02-26 | 2-substituted methyl-thiochroman derivatives |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS52105177A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6011270U (ja) * | 1983-07-02 | 1985-01-25 | トヨタ自動車株式会社 | ステアリング装置 |
| JPH02148871U (enExample) * | 1989-05-19 | 1990-12-18 |
-
1976
- 1976-02-26 JP JP2086876A patent/JPS52105177A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5715759B2 (enExample) | 1982-04-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5297950A (en) | Chalconeether derivatives | |
| JPS52106844A (en) | 3-cyanomethylcyclopentanone derivatives | |
| JPS52105177A (en) | 2-substituted methyl-thiochroman derivatives | |
| JPS52113929A (en) | Glucoside derivatives | |
| JPS549273A (en) | 7-arginylamono-4-methylcoumarin | |
| JPS5293771A (en) | Benzotriazoles | |
| JPS5328163A (en) | Novel 1-benzyl-3-pyrrolidoneoxime derivatives and their preparation | |
| JPS53108974A (en) | 7-arginylamino-4-methylcoumarin | |
| JPS5321186A (en) | Penicillanic acid derivatives and their preparation | |
| JPS52105178A (en) | 2-substituted methyl-thiochromans | |
| JPS5312893A (en) | Preparation of tetraquinazolone derivatives | |
| JPS5283652A (en) | Benzanthrone derivatives | |
| JPS52105158A (en) | D8-dihydropimaride derivatives | |
| JPS52134634A (en) | 3,10-dialkoxy-4-halogeno-13-cyanotriphenodioxazines | |
| JPS5346937A (en) | Preparation of n-p-aminobenzoyl-n,-p-aminourea | |
| JPS539763A (en) | Methylidene-amine derivatives | |
| JPS5291867A (en) | Preparation of indenopyridine derivatives | |
| JPS536424A (en) | Thiophosphoroamide compounds and insecticide-miticide containing the same | |
| JPS52148045A (en) | 4-hydroxypent-2-ene-1-one derivatives | |
| JPS5297966A (en) | Novel oxazolinone derivatives | |
| JPS5293715A (en) | Bis-(1-methyl-2-vinyl-4,6-heptadienyl)carbonate | |
| JPS5266630A (en) | Aricultural fungicide | |
| JPS52142053A (en) | Dialkoxynaphthalenesulfonylhalogenides | |
| JPS5346954A (en) | Utendin derivatives | |
| JPS52118461A (en) | Thiophene-silylenole-ether |