JP4138121B2 - トナー組成物及びその調製方法 - Google Patents
トナー組成物及びその調製方法 Download PDFInfo
- Publication number
- JP4138121B2 JP4138121B2 JP00355599A JP355599A JP4138121B2 JP 4138121 B2 JP4138121 B2 JP 4138121B2 JP 00355599 A JP00355599 A JP 00355599A JP 355599 A JP355599 A JP 355599A JP 4138121 B2 JP4138121 B2 JP 4138121B2
- Authority
- JP
- Japan
- Prior art keywords
- toner
- weight
- resin
- styrene
- butadiene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000000203 mixture Substances 0.000 title claims description 76
- 238000000034 method Methods 0.000 title description 42
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 88
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 74
- 239000011347 resin Substances 0.000 claims description 48
- 229920005989 resin Polymers 0.000 claims description 48
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 36
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 36
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 35
- 239000003086 colorant Substances 0.000 claims description 21
- 229920003002 synthetic resin Polymers 0.000 claims description 5
- 239000002952 polymeric resin Substances 0.000 claims description 4
- 239000004816 latex Substances 0.000 description 49
- 229920000126 latex Polymers 0.000 description 49
- 239000000049 pigment Substances 0.000 description 37
- 239000002245 particle Substances 0.000 description 28
- 238000002156 mixing Methods 0.000 description 24
- 239000000654 additive Substances 0.000 description 22
- 239000003945 anionic surfactant Substances 0.000 description 20
- 239000007864 aqueous solution Substances 0.000 description 19
- 239000000839 emulsion Substances 0.000 description 19
- 239000002736 nonionic surfactant Substances 0.000 description 17
- 230000000996 additive effect Effects 0.000 description 15
- 238000007720 emulsion polymerization reaction Methods 0.000 description 15
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 14
- -1 cetyl pyridinium halide Chemical class 0.000 description 14
- 239000012074 organic phase Substances 0.000 description 14
- AVWQQPYHYQKEIZ-UHFFFAOYSA-K trisodium;2-dodecylbenzenesulfonate;3-dodecylbenzenesulfonate;4-dodecylbenzenesulfonate Chemical compound [Na+].[Na+].[Na+].CCCCCCCCCCCCC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCCCCC1=CC=CC(S([O-])(=O)=O)=C1.CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O AVWQQPYHYQKEIZ-UHFFFAOYSA-K 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000008346 aqueous phase Substances 0.000 description 13
- 239000006185 dispersion Substances 0.000 description 13
- 239000002563 ionic surfactant Substances 0.000 description 12
- 239000000126 substance Substances 0.000 description 12
- 239000003093 cationic surfactant Substances 0.000 description 11
- 229920000642 polymer Polymers 0.000 description 8
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 7
- UREZNYTWGJKWBI-UHFFFAOYSA-M benzethonium chloride Chemical compound [Cl-].C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 UREZNYTWGJKWBI-UHFFFAOYSA-M 0.000 description 7
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 230000004927 fusion Effects 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 6
- 239000004925 Acrylic resin Substances 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 230000002776 aggregation Effects 0.000 description 5
- 239000000975 dye Substances 0.000 description 5
- SZVJSHCCFOBDDC-UHFFFAOYSA-N iron(II,III) oxide Inorganic materials O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical class O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Chemical class 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- ISCIUIIRLMFIQC-UHFFFAOYSA-N C=CC=C.C=CC#N.OC(=O)C=C.C=CC1=CC=CC=C1 Chemical compound C=CC=C.C=CC#N.OC(=O)C=C.C=CC1=CC=CC=C1 ISCIUIIRLMFIQC-UHFFFAOYSA-N 0.000 description 3
- 238000005054 agglomeration Methods 0.000 description 3
- 229960000686 benzalkonium chloride Drugs 0.000 description 3
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- SMQZZQFYHUDLSJ-UHFFFAOYSA-L disodium;1-dodecylnaphthalene;sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O.C1=CC=C2C(CCCCCCCCCCCC)=CC=CC2=C1 SMQZZQFYHUDLSJ-UHFFFAOYSA-L 0.000 description 3
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 238000004220 aggregation Methods 0.000 description 2
- 125000006177 alkyl benzyl group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- VVSMKOFFCAJOSC-UHFFFAOYSA-L disodium;dodecylbenzene;sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O.CCCCCCCCCCCCC1=CC=CC=C1 VVSMKOFFCAJOSC-UHFFFAOYSA-L 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 238000007580 dry-mixing Methods 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical compound [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 229910000859 α-Fe Inorganic materials 0.000 description 2
- WTXXSZUATXIAJO-OWBHPGMISA-N (Z)-14-methylpentadec-2-enoic acid Chemical compound CC(CCCCCCCCCC\C=C/C(=O)O)C WTXXSZUATXIAJO-OWBHPGMISA-N 0.000 description 1
- FFJCNSLCJOQHKM-CLFAGFIQSA-N (z)-1-[(z)-octadec-9-enoxy]octadec-9-ene Chemical compound CCCCCCCC\C=C/CCCCCCCCOCCCCCCCC\C=C/CCCCCCCC FFJCNSLCJOQHKM-CLFAGFIQSA-N 0.000 description 1
- QAQSNXHKHKONNS-UHFFFAOYSA-N 1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carboxamide Chemical compound CCN1C(O)=C(C(N)=O)C(C)=CC1=O QAQSNXHKHKONNS-UHFFFAOYSA-N 0.000 description 1
- VEBJYBIQIYFEFN-UHFFFAOYSA-N 2-[2-[2-[2-[2-(4-octylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanol Chemical compound CCCCCCCCC1=CC=C(OCCOCCOCCOCCOCCO)C=C1 VEBJYBIQIYFEFN-UHFFFAOYSA-N 0.000 description 1
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 description 1
- JYCQQPHGFMYQCF-UHFFFAOYSA-N 4-tert-Octylphenol monoethoxylate Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 JYCQQPHGFMYQCF-UHFFFAOYSA-N 0.000 description 1
- HWTDMFJYBAURQR-UHFFFAOYSA-N 80-82-0 Chemical compound OS(=O)(=O)C1=CC=CC=C1[N+]([O-])=O HWTDMFJYBAURQR-UHFFFAOYSA-N 0.000 description 1
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 239000004908 Emulsion polymer Substances 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 229920002449 FKM Polymers 0.000 description 1
- 108700042658 GAP-43 Proteins 0.000 description 1
- 241000720945 Hosta Species 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- NRCMAYZCPIVABH-UHFFFAOYSA-N Quinacridone Chemical compound N1C2=CC=CC=C2C(=O)C2=C1C=C1C(=O)C3=CC=CC=C3NC1=C2 NRCMAYZCPIVABH-UHFFFAOYSA-N 0.000 description 1
- BGZBAHNFAZYSQJ-UHFFFAOYSA-J S(=O)(=O)([O-])[O-].S(=O)(=O)([O-])[O-].C(CCCCCCCCCCCCCCCCC)[N+](C)(C)CCCCCCCCCCCCCCCCCC.C(CCCCCCCCCCCCCCCCC)[N+](CCCCCCCCCCCCCCCCCC)(C)C.C(CCCCCCCCCCCCCCCCC)[N+](CCCCCCCCCCCCCCCCCC)(C)C.C(CCCCCCCCCCCCCCCCC)[N+](CCCCCCCCCCCCCCCCCC)(C)C Chemical class S(=O)(=O)([O-])[O-].S(=O)(=O)([O-])[O-].C(CCCCCCCCCCCCCCCCC)[N+](C)(C)CCCCCCCCCCCCCCCCCC.C(CCCCCCCCCCCCCCCCC)[N+](CCCCCCCCCCCCCCCCCC)(C)C.C(CCCCCCCCCCCCCCCCC)[N+](CCCCCCCCCCCCCCCCCC)(C)C.C(CCCCCCCCCCCCCCCCC)[N+](CCCCCCCCCCCCCCCCCC)(C)C BGZBAHNFAZYSQJ-UHFFFAOYSA-J 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229940077484 ammonium bromide Drugs 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229960001716 benzalkonium Drugs 0.000 description 1
- CYDRXTMLKJDRQH-UHFFFAOYSA-N benzododecinium Chemical compound CCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 CYDRXTMLKJDRQH-UHFFFAOYSA-N 0.000 description 1
- WMLFGKCFDKMAKB-UHFFFAOYSA-M benzyl-diethyl-tetradecylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCCC[N+](CC)(CC)CC1=CC=CC=C1 WMLFGKCFDKMAKB-UHFFFAOYSA-M 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229960004830 cetylpyridinium Drugs 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229920006026 co-polymeric resin Polymers 0.000 description 1
- 238000004581 coalescence Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000008119 colloidal silica Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- FPDLLPXYRWELCU-UHFFFAOYSA-M dimethyl(dioctadecyl)azanium;methyl sulfate Chemical class COS([O-])(=O)=O.CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC FPDLLPXYRWELCU-UHFFFAOYSA-M 0.000 description 1
- HWEPKCDYOXFXKM-UHFFFAOYSA-L dimethyl(dioctadecyl)azanium;sulfate Chemical compound [O-]S([O-])(=O)=O.CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC.CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC HWEPKCDYOXFXKM-UHFFFAOYSA-L 0.000 description 1
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 description 1
- FWDBOZPQNFPOLF-UHFFFAOYSA-N ethenyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)C=C FWDBOZPQNFPOLF-UHFFFAOYSA-N 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000005227 gel permeation chromatography Methods 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 238000010191 image analysis Methods 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 229920002114 octoxynol-9 Polymers 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920000259 polyoxyethylene lauryl ether Polymers 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 239000011342 resin composition Substances 0.000 description 1
- 229940043267 rhodamine b Drugs 0.000 description 1
- 150000003870 salicylic acids Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 238000002411 thermogravimetry Methods 0.000 description 1
- AISMNBXOJRHCIA-UHFFFAOYSA-N trimethylazanium;bromide Chemical class Br.CN(C)C AISMNBXOJRHCIA-UHFFFAOYSA-N 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical compound [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/087—Binders for toner particles
- G03G9/08702—Binders for toner particles comprising macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- G03G9/08706—Polymers of alkenyl-aromatic compounds
- G03G9/08708—Copolymers of styrene
- G03G9/08711—Copolymers of styrene with esters of acrylic or methacrylic acid
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/087—Binders for toner particles
- G03G9/08702—Binders for toner particles comprising macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- G03G9/08704—Polyalkenes
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/087—Binders for toner particles
- G03G9/08702—Binders for toner particles comprising macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- G03G9/08726—Polymers of unsaturated acids or derivatives thereof
- G03G9/08731—Polymers of nitriles
Landscapes
- Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Spectroscopy & Molecular Physics (AREA)
- General Physics & Mathematics (AREA)
- Developing Agents For Electrophotography (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US09/006,521 US5910387A (en) | 1998-01-13 | 1998-01-13 | Toner compositions with acrylonitrile and processes |
| US006521 | 1998-01-13 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JPH11258852A JPH11258852A (ja) | 1999-09-24 |
| JPH11258852A5 JPH11258852A5 (enExample) | 2006-02-23 |
| JP4138121B2 true JP4138121B2 (ja) | 2008-08-20 |
Family
ID=21721287
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP00355599A Expired - Fee Related JP4138121B2 (ja) | 1998-01-13 | 1999-01-11 | トナー組成物及びその調製方法 |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US5910387A (enExample) |
| JP (1) | JP4138121B2 (enExample) |
Families Citing this family (122)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6203961B1 (en) | 2000-06-26 | 2001-03-20 | Xerox Corporation | Developer compositions and processes |
| US6352810B1 (en) | 2001-02-16 | 2002-03-05 | Xerox Corporation | Toner coagulant processes |
| US6495302B1 (en) | 2001-06-11 | 2002-12-17 | Xerox Corporation | Toner coagulant processes |
| US6562541B2 (en) | 2001-09-24 | 2003-05-13 | Xerox Corporation | Toner processes |
| US6673500B1 (en) | 2002-08-20 | 2004-01-06 | Xerox Corporation | Document security processes |
| US6664017B1 (en) | 2002-08-20 | 2003-12-16 | Xerox Corporation | Document security processes |
| US7186494B2 (en) | 2003-04-14 | 2007-03-06 | Xerox Corporation | Toner processes |
| US6841329B2 (en) * | 2003-04-14 | 2005-01-11 | Xerox Corporation | Toner processes |
| US7291437B2 (en) * | 2003-04-14 | 2007-11-06 | Xerox Corporation | Toner processes |
| US6890696B2 (en) * | 2003-05-27 | 2005-05-10 | Xerox Corporation | Toner processes |
| US6984480B2 (en) | 2003-06-25 | 2006-01-10 | Xerox Corporation | Toner processes |
| US7037633B2 (en) | 2003-06-25 | 2006-05-02 | Xerox Corporation | Toner processes |
| US6942954B2 (en) * | 2003-06-25 | 2005-09-13 | Xerox Corporation | Toner processes |
| US6936396B2 (en) * | 2003-06-25 | 2005-08-30 | Xerox Corporation | Toner processes |
| US7250238B2 (en) * | 2003-12-23 | 2007-07-31 | Xerox Corporation | Toners and processes thereof |
| US7052818B2 (en) * | 2003-12-23 | 2006-05-30 | Xerox Corporation | Toners and processes thereof |
| US7208257B2 (en) * | 2004-06-25 | 2007-04-24 | Xerox Corporation | Electron beam curable toners and processes thereof |
| US7652128B2 (en) * | 2004-11-05 | 2010-01-26 | Xerox Corporation | Toner composition |
| US20060105263A1 (en) * | 2004-11-16 | 2006-05-18 | Xerox Corporation | Toner composition |
| US7615327B2 (en) * | 2004-11-17 | 2009-11-10 | Xerox Corporation | Toner process |
| US7645552B2 (en) * | 2004-12-03 | 2010-01-12 | Xerox Corporation | Toner compositions |
| US20060121387A1 (en) * | 2004-12-03 | 2006-06-08 | Xerox Corporation | Toner processes |
| US20060121380A1 (en) * | 2004-12-03 | 2006-06-08 | Xerox Corporation | Toner compositions |
| US7276320B2 (en) * | 2005-01-19 | 2007-10-02 | Xerox Corporation | Surface particle attachment process, and particles made therefrom |
| JP2006295878A (ja) * | 2005-01-25 | 2006-10-26 | Ricoh Co Ltd | 画像形成装置 |
| US20060199094A1 (en) | 2005-03-07 | 2006-09-07 | Xerox Corporation | Carrier and developer compositions |
| US7622234B2 (en) * | 2005-03-31 | 2009-11-24 | Xerox Corporation | Emulsion/aggregation based toners containing a novel latex resin |
| US7799502B2 (en) * | 2005-03-31 | 2010-09-21 | Xerox Corporation | Toner processes |
| US7432324B2 (en) * | 2005-03-31 | 2008-10-07 | Xerox Corporation | Preparing aqueous dispersion of crystalline and amorphous polyesters |
| US7468232B2 (en) | 2005-04-27 | 2008-12-23 | Xerox Corporation | Processes for forming latexes and toners, and latexes and toner formed thereby |
| US8475985B2 (en) | 2005-04-28 | 2013-07-02 | Xerox Corporation | Magnetic compositions |
| US7459258B2 (en) * | 2005-06-17 | 2008-12-02 | Xerox Corporation | Toner processes |
| US7524602B2 (en) * | 2005-06-20 | 2009-04-28 | Xerox Corporation | Low molecular weight latex and toner compositions comprising the same |
| US7413842B2 (en) * | 2005-08-22 | 2008-08-19 | Xerox Corporation | Toner processes |
| US7910275B2 (en) * | 2005-11-14 | 2011-03-22 | Xerox Corporation | Toner having crystalline wax |
| US7662272B2 (en) | 2005-11-14 | 2010-02-16 | Xerox Corporation | Crystalline wax |
| US7553596B2 (en) | 2005-11-14 | 2009-06-30 | Xerox Corporation | Toner having crystalline wax |
| US7686939B2 (en) * | 2005-11-14 | 2010-03-30 | Xerox Corporation | Crystalline wax |
| US7749670B2 (en) * | 2005-11-14 | 2010-07-06 | Xerox Corporation | Toner having crystalline wax |
| US20070111130A1 (en) * | 2005-11-15 | 2007-05-17 | Xerox Corporation | Toner compositions |
| US20070111129A1 (en) * | 2005-11-15 | 2007-05-17 | Xerox Corporation | Toner compositions |
| US7419753B2 (en) * | 2005-12-20 | 2008-09-02 | Xerox Corporation | Toner compositions having resin substantially free of crosslinking, crosslinked resin, polyester resin, and wax |
| US7939176B2 (en) | 2005-12-23 | 2011-05-10 | Xerox Corporation | Coated substrates and method of coating |
| US7521165B2 (en) * | 2006-04-05 | 2009-04-21 | Xerox Corporation | Varnish |
| US7524599B2 (en) * | 2006-03-22 | 2009-04-28 | Xerox Corporation | Toner compositions |
| US7553595B2 (en) * | 2006-04-26 | 2009-06-30 | Xerox Corporation | Toner compositions and processes |
| US7622233B2 (en) * | 2006-04-28 | 2009-11-24 | Xerox Corporation | Styrene-based toner compositions with multiple waxes |
| US7736831B2 (en) * | 2006-09-08 | 2010-06-15 | Xerox Corporation | Emulsion/aggregation process using coalescent aid agents |
| US20090123865A1 (en) * | 2006-09-19 | 2009-05-14 | Xerox Corporation | Toner composition having fluorinated polymer additive |
| US7785763B2 (en) * | 2006-10-13 | 2010-08-31 | Xerox Corporation | Emulsion aggregation processes |
| US7851519B2 (en) * | 2007-01-25 | 2010-12-14 | Xerox Corporation | Polyester emulsion containing crosslinked polyester resin, process, and toner |
| US8039187B2 (en) | 2007-02-16 | 2011-10-18 | Xerox Corporation | Curable toner compositions and processes |
| US8278018B2 (en) * | 2007-03-14 | 2012-10-02 | Xerox Corporation | Process for producing dry ink colorants that will reduce metamerism |
| US7901859B2 (en) | 2007-04-10 | 2011-03-08 | Xerox Corporation | Chemical toner with covalently bonded release agent |
| US8137884B2 (en) | 2007-12-14 | 2012-03-20 | Xerox Corporation | Toner compositions and processes |
| US7970333B2 (en) * | 2008-07-24 | 2011-06-28 | Xerox Corporation | System and method for protecting an image on a substrate |
| US20100092215A1 (en) | 2008-10-10 | 2010-04-15 | Xerox Corporation | Printing system with toner blend |
| US8187780B2 (en) * | 2008-10-21 | 2012-05-29 | Xerox Corporation | Toner compositions and processes |
| US20100122642A1 (en) * | 2008-11-17 | 2010-05-20 | Xerox Corporation | Inks including carbon nanotubes dispersed in a polymer matrix |
| US20100124713A1 (en) | 2008-11-17 | 2010-05-20 | Xerox Corporation | Toners including carbon nanotubes dispersed in a polymer matrix |
| US8084177B2 (en) * | 2008-12-18 | 2011-12-27 | Xerox Corporation | Toners containing polyhedral oligomeric silsesquioxanes |
| US7985523B2 (en) | 2008-12-18 | 2011-07-26 | Xerox Corporation | Toners containing polyhedral oligomeric silsesquioxanes |
| US8221948B2 (en) * | 2009-02-06 | 2012-07-17 | Xerox Corporation | Toner compositions and processes |
| US8318398B2 (en) * | 2009-02-06 | 2012-11-27 | Xerox Corporation | Toner compositions and processes |
| US8076048B2 (en) * | 2009-03-17 | 2011-12-13 | Xerox Corporation | Toner having polyester resin |
| US8124307B2 (en) | 2009-03-30 | 2012-02-28 | Xerox Corporation | Toner having polyester resin |
| US8073376B2 (en) | 2009-05-08 | 2011-12-06 | Xerox Corporation | Curable toner compositions and processes |
| US8192912B2 (en) | 2009-05-08 | 2012-06-05 | Xerox Corporation | Curable toner compositions and processes |
| US8313884B2 (en) * | 2009-06-05 | 2012-11-20 | Xerox Corporation | Toner processes utilizing a defoamer as a coalescence aid for continuous and batch emulsion aggregation |
| US8741534B2 (en) | 2009-06-08 | 2014-06-03 | Xerox Corporation | Efficient solvent-based phase inversion emulsification process with defoamer |
| US8211604B2 (en) | 2009-06-16 | 2012-07-03 | Xerox Corporation | Self emulsifying granules and solvent free process for the preparation of emulsions therefrom |
| US8563627B2 (en) * | 2009-07-30 | 2013-10-22 | Xerox Corporation | Self emulsifying granules and process for the preparation of emulsions therefrom |
| US8207246B2 (en) * | 2009-07-30 | 2012-06-26 | Xerox Corporation | Processes for producing polyester latexes via solvent-free emulsification |
| US20110028570A1 (en) * | 2009-07-30 | 2011-02-03 | Xerox Corporation | Self emulsifying granules and process for the preparation of emulsions therefrom |
| US8323865B2 (en) * | 2009-08-04 | 2012-12-04 | Xerox Corporation | Toner processes |
| US9594319B2 (en) * | 2009-09-03 | 2017-03-14 | Xerox Corporation | Curable toner compositions and processes |
| US8722299B2 (en) * | 2009-09-15 | 2014-05-13 | Xerox Corporation | Curable toner compositions and processes |
| US20110086302A1 (en) * | 2009-10-09 | 2011-04-14 | Xerox Corporation | Toner compositions and processes |
| US8257895B2 (en) * | 2009-10-09 | 2012-09-04 | Xerox Corporation | Toner compositions and processes |
| US8168361B2 (en) * | 2009-10-15 | 2012-05-01 | Xerox Corporation | Curable toner compositions and processes |
| US8486602B2 (en) * | 2009-10-22 | 2013-07-16 | Xerox Corporation | Toner particles and cold homogenization method |
| US8450040B2 (en) * | 2009-10-22 | 2013-05-28 | Xerox Corporation | Method for controlling a toner preparation process |
| US20110129774A1 (en) * | 2009-12-02 | 2011-06-02 | Xerox Corporation | Incorporation of an oil component into phase inversion emulsion process |
| US7977025B2 (en) * | 2009-12-03 | 2011-07-12 | Xerox Corporation | Emulsion aggregation methods |
| US8618192B2 (en) * | 2010-02-05 | 2013-12-31 | Xerox Corporation | Processes for producing polyester latexes via solvent-free emulsification |
| US9201324B2 (en) * | 2010-02-18 | 2015-12-01 | Xerox Corporation | Processes for producing polyester latexes via solvent-based and solvent-free emulsification |
| US8603720B2 (en) * | 2010-02-24 | 2013-12-10 | Xerox Corporation | Toner compositions and processes |
| US8163459B2 (en) | 2010-03-01 | 2012-04-24 | Xerox Corporation | Bio-based amorphous polyester resins for emulsion aggregation toners |
| US9012118B2 (en) | 2010-03-04 | 2015-04-21 | Xerox Corporation | Toner compositions and processes |
| US8178269B2 (en) * | 2010-03-05 | 2012-05-15 | Xerox Corporation | Toner compositions and methods |
| US8221951B2 (en) | 2010-03-05 | 2012-07-17 | Xerox Corporation | Toner compositions and methods |
| US8431306B2 (en) | 2010-03-09 | 2013-04-30 | Xerox Corporation | Polyester resin containing toner |
| US8252494B2 (en) | 2010-05-03 | 2012-08-28 | Xerox Corporation | Fluorescent toner compositions and fluorescent pigments |
| US8192913B2 (en) | 2010-05-12 | 2012-06-05 | Xerox Corporation | Processes for producing polyester latexes via solvent-based emulsification |
| US8338071B2 (en) | 2010-05-12 | 2012-12-25 | Xerox Corporation | Processes for producing polyester latexes via single-solvent-based emulsification |
| JP5418396B2 (ja) * | 2010-05-12 | 2014-02-19 | コニカミノルタ株式会社 | 静電荷像現像用トナーの製造方法 |
| US8221953B2 (en) | 2010-05-21 | 2012-07-17 | Xerox Corporation | Emulsion aggregation process |
| US8168699B2 (en) | 2010-06-21 | 2012-05-01 | Xerox Corporation | Solvent-assisted continuous emulsification processes for producing polyester latexes |
| US8142975B2 (en) | 2010-06-29 | 2012-03-27 | Xerox Corporation | Method for controlling a toner preparation process |
| US8574804B2 (en) | 2010-08-26 | 2013-11-05 | Xerox Corporation | Toner compositions and processes |
| US8247156B2 (en) | 2010-09-09 | 2012-08-21 | Xerox Corporation | Processes for producing polyester latexes with improved hydrolytic stability |
| US8647805B2 (en) | 2010-09-22 | 2014-02-11 | Xerox Corporation | Emulsion aggregation toners having flow aids |
| US8592115B2 (en) | 2010-11-24 | 2013-11-26 | Xerox Corporation | Toner compositions and developers containing such toners |
| US8394566B2 (en) | 2010-11-24 | 2013-03-12 | Xerox Corporation | Non-magnetic single component emulsion/aggregation toner composition |
| US8802344B2 (en) | 2010-12-13 | 2014-08-12 | Xerox Corporation | Toner processes utilizing washing aid |
| US9354530B2 (en) | 2011-12-12 | 2016-05-31 | Xerox Corporation | Carboxylic acid or acid salt functionalized polyester polymers |
| US8673990B2 (en) | 2012-01-18 | 2014-03-18 | Xerox Corporation | Process of making polyester latex with buffer |
| US9822217B2 (en) | 2012-03-19 | 2017-11-21 | Xerox Corporation | Robust resin for solvent-free emulsification |
| US8697323B2 (en) | 2012-04-03 | 2014-04-15 | Xerox Corporation | Low gloss monochrome SCD toner for reduced energy toner usage |
| US8841055B2 (en) | 2012-04-04 | 2014-09-23 | Xerox Corporation | Super low melt emulsion aggregation toners comprising a trans-cinnamic di-ester |
| US8703379B2 (en) | 2012-07-27 | 2014-04-22 | Xerox Corporation | Chemical binding of renewable oils to polyester emulsion |
| US9329508B2 (en) | 2013-03-26 | 2016-05-03 | Xerox Corporation | Emulsion aggregation process |
| US9023574B2 (en) | 2013-06-28 | 2015-05-05 | Xerox Corporation | Toner processes for hyper-pigmented toners |
| US9023566B2 (en) * | 2013-07-17 | 2015-05-05 | Stratasys, Inc. | ABS part material for electrophotography-based additive manufacturing |
| US9195155B2 (en) | 2013-10-07 | 2015-11-24 | Xerox Corporation | Toner processes |
| US20150104742A1 (en) | 2013-10-11 | 2015-04-16 | Xerox Corporation | Emulsion aggregation toners |
| US9134635B1 (en) | 2014-04-14 | 2015-09-15 | Xerox Corporation | Method for continuous aggregation of pre-toner particles |
| US9285699B2 (en) | 2014-05-01 | 2016-03-15 | Xerox Corporation | Carrier and developer |
| US9188890B1 (en) | 2014-09-17 | 2015-11-17 | Xerox Corporation | Method for managing triboelectric charge in two-component developer |
| US9383666B1 (en) | 2015-04-01 | 2016-07-05 | Xerox Corporation | Toner particles comprising both polyester and styrene acrylate polymers having a polyester shell |
| US10649355B2 (en) | 2016-07-20 | 2020-05-12 | Xerox Corporation | Method of making a polymer composite |
| US10315409B2 (en) | 2016-07-20 | 2019-06-11 | Xerox Corporation | Method of selective laser sintering |
Family Cites Families (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4137188A (en) * | 1975-11-07 | 1979-01-30 | Shigeru Uetake | Magnetic toner for electrophotography |
| US4558108A (en) * | 1982-12-27 | 1985-12-10 | Xerox Corporation | Aqueous suspension polymerization process |
| DE3571355D1 (en) * | 1984-04-17 | 1989-08-10 | Hitachi Chemical Co Ltd | Process for producing toner for electrophotography |
| JPH0740142B2 (ja) * | 1985-11-05 | 1995-05-01 | 日本カーバイド工業株式会社 | 静電荷像現像用トナ− |
| DE3855939T2 (de) * | 1987-01-29 | 1997-10-23 | Nippon Carbide Kogyo Kk | Toner zur entwicklung elektrostatisch geladener bilder |
| US5290654A (en) * | 1992-07-29 | 1994-03-01 | Xerox Corporation | Microsuspension processes for toner compositions |
| US5278020A (en) * | 1992-08-28 | 1994-01-11 | Xerox Corporation | Toner composition and processes thereof |
| US5308734A (en) * | 1992-12-14 | 1994-05-03 | Xerox Corporation | Toner processes |
| US5346797A (en) * | 1993-02-25 | 1994-09-13 | Xerox Corporation | Toner processes |
| US5348832A (en) * | 1993-06-01 | 1994-09-20 | Xerox Corporation | Toner compositions |
| US5364729A (en) * | 1993-06-25 | 1994-11-15 | Xerox Corporation | Toner aggregation processes |
| US5403693A (en) * | 1993-06-25 | 1995-04-04 | Xerox Corporation | Toner aggregation and coalescence processes |
| US5418108A (en) * | 1993-06-25 | 1995-05-23 | Xerox Corporation | Toner emulsion aggregation process |
| US5370963A (en) * | 1993-06-25 | 1994-12-06 | Xerox Corporation | Toner emulsion aggregation processes |
| US5405728A (en) * | 1993-06-25 | 1995-04-11 | Xerox Corporation | Toner aggregation processes |
| US5344738A (en) * | 1993-06-25 | 1994-09-06 | Xerox Corporation | Process of making toner compositions |
| US5366841A (en) * | 1993-09-30 | 1994-11-22 | Xerox Corporation | Toner aggregation processes |
| US5501935A (en) * | 1995-01-17 | 1996-03-26 | Xerox Corporation | Toner aggregation processes |
| US5527658A (en) * | 1995-03-13 | 1996-06-18 | Xerox Corporation | Toner aggregation processes using water insoluble transition metal containing powder |
| US5496676A (en) * | 1995-03-27 | 1996-03-05 | Xerox Corporation | Toner aggregation processes |
| US5593807A (en) * | 1996-05-10 | 1997-01-14 | Xerox Corporation | Toner processes using sodium sulfonated polyester resins |
| US5585215A (en) * | 1996-06-13 | 1996-12-17 | Xerox Corporation | Toner compositions |
| US5660965A (en) * | 1996-06-17 | 1997-08-26 | Xerox Corporation | Toner processes |
| US5658704A (en) * | 1996-06-17 | 1997-08-19 | Xerox Corporation | Toner processes |
| US5648193A (en) * | 1996-06-17 | 1997-07-15 | Xerox Corporation | Toner processes |
| US5650255A (en) * | 1996-09-03 | 1997-07-22 | Xerox Corporation | Low shear toner aggregation processes |
| US5683848A (en) * | 1996-10-02 | 1997-11-04 | Xerox Corporation | Acrylonitrile-modified toner composition and processes |
| US5650256A (en) * | 1996-10-02 | 1997-07-22 | Xerox Corporation | Toner processes |
-
1998
- 1998-01-13 US US09/006,521 patent/US5910387A/en not_active Expired - Lifetime
-
1999
- 1999-01-11 JP JP00355599A patent/JP4138121B2/ja not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| JPH11258852A (ja) | 1999-09-24 |
| US5910387A (en) | 1999-06-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP4138121B2 (ja) | トナー組成物及びその調製方法 | |
| US5804349A (en) | Acrylonitrile-modified toner compositions and processes | |
| JP3973287B2 (ja) | トナーの調製方法 | |
| US5585215A (en) | Toner compositions | |
| US5554480A (en) | Fluorescent toner processes | |
| US5827633A (en) | Toner processes | |
| JP3825060B2 (ja) | トナー組成物の製造方法 | |
| US5403693A (en) | Toner aggregation and coalescence processes | |
| US5869215A (en) | Toner compositions and processes thereof | |
| US5405728A (en) | Toner aggregation processes | |
| US5366841A (en) | Toner aggregation processes | |
| US6130021A (en) | Toner processes | |
| EP0613057B1 (en) | Toner processes | |
| US5650256A (en) | Toner processes | |
| US5858601A (en) | Toner processes | |
| JP2005182064A (ja) | エマルション凝集トナー | |
| US20040058268A1 (en) | Toner processes | |
| US5688626A (en) | Gamut toner aggregation processes | |
| US20040202951A1 (en) | Toner processes | |
| US7291437B2 (en) | Toner processes | |
| BRPI1004089B1 (pt) | Toner e processo para produzir toner | |
| US5525452A (en) | Toner aggregation processes | |
| US7507515B2 (en) | Toner compositions | |
| US20060269859A1 (en) | Emulsion aggregation toner and developer | |
| JP5095123B2 (ja) | 表面添加剤としてのアミノ含有ポリマーを含むトナー組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Written amendment |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20060110 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20060110 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20070925 |
|
| A521 | Written amendment |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20071029 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20080108 |
|
| A521 | Written amendment |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20080404 |
|
| TRDD | Decision of grant or rejection written | ||
| A01 | Written decision to grant a patent or to grant a registration (utility model) |
Free format text: JAPANESE INTERMEDIATE CODE: A01 Effective date: 20080507 |
|
| A01 | Written decision to grant a patent or to grant a registration (utility model) |
Free format text: JAPANESE INTERMEDIATE CODE: A01 |
|
| A61 | First payment of annual fees (during grant procedure) |
Free format text: JAPANESE INTERMEDIATE CODE: A61 Effective date: 20080605 |
|
| R150 | Certificate of patent or registration of utility model |
Free format text: JAPANESE INTERMEDIATE CODE: R150 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20110613 Year of fee payment: 3 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20110613 Year of fee payment: 3 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20120613 Year of fee payment: 4 |
|
| FPAY | Renewal fee payment (event date is renewal date of database) |
Free format text: PAYMENT UNTIL: 20130613 Year of fee payment: 5 |
|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| LAPS | Cancellation because of no payment of annual fees |