JP2006502095A - C5a受容体モジュレーターとしての置換ビアリールアミド - Google Patents
C5a受容体モジュレーターとしての置換ビアリールアミド Download PDFInfo
- Publication number
- JP2006502095A JP2006502095A JP2003580294A JP2003580294A JP2006502095A JP 2006502095 A JP2006502095 A JP 2006502095A JP 2003580294 A JP2003580294 A JP 2003580294A JP 2003580294 A JP2003580294 A JP 2003580294A JP 2006502095 A JP2006502095 A JP 2006502095A
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- substituted
- alkoxy
- independently
- hydroxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- -1 biaryl amides Chemical class 0.000 title claims abstract description 340
- 102000005590 Anaphylatoxin C5a Receptor Human genes 0.000 title claims abstract description 186
- 108010059426 Anaphylatoxin C5a Receptor Proteins 0.000 title claims abstract description 185
- 150000001875 compounds Chemical class 0.000 claims abstract description 330
- 230000000694 effects Effects 0.000 claims abstract description 75
- 238000000034 method Methods 0.000 claims abstract description 50
- 238000000338 in vitro Methods 0.000 claims abstract description 34
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 25
- 238000001727 in vivo Methods 0.000 claims abstract description 20
- 241001465754 Metazoa Species 0.000 claims abstract description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 323
- 125000001424 substituent group Chemical group 0.000 claims description 264
- 229910052736 halogen Inorganic materials 0.000 claims description 250
- 150000002367 halogens Chemical class 0.000 claims description 246
- 125000001188 haloalkyl group Chemical group 0.000 claims description 214
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 186
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 175
- 150000003839 salts Chemical class 0.000 claims description 159
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 147
- 125000006413 ring segment Chemical group 0.000 claims description 112
- 125000003545 alkoxy group Chemical group 0.000 claims description 107
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 96
- 229910052760 oxygen Inorganic materials 0.000 claims description 83
- 102100031506 Complement C5 Human genes 0.000 claims description 81
- 238000003556 assay Methods 0.000 claims description 80
- 229910052717 sulfur Inorganic materials 0.000 claims description 80
- 101000941598 Homo sapiens Complement C5 Proteins 0.000 claims description 79
- 229910052799 carbon Inorganic materials 0.000 claims description 72
- 125000001544 thienyl group Chemical group 0.000 claims description 72
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 68
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 64
- 125000004414 alkyl thio group Chemical group 0.000 claims description 62
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 61
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 58
- 229920006395 saturated elastomer Polymers 0.000 claims description 55
- 230000027455 binding Effects 0.000 claims description 54
- 125000003118 aryl group Chemical group 0.000 claims description 53
- 239000000203 mixture Substances 0.000 claims description 51
- 210000004027 cell Anatomy 0.000 claims description 50
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 44
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 44
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 38
- 230000035605 chemotaxis Effects 0.000 claims description 37
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 36
- 239000000556 agonist Substances 0.000 claims description 35
- 125000001072 heteroaryl group Chemical group 0.000 claims description 35
- 230000001404 mediated effect Effects 0.000 claims description 33
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 claims description 28
- 229960005235 piperonyl butoxide Drugs 0.000 claims description 28
- 125000004591 piperonyl group Chemical group C(C1=CC=2OCOC2C=C1)* 0.000 claims description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 239000001257 hydrogen Substances 0.000 claims description 27
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 26
- 230000027425 release of sequestered calcium ion into cytosol Effects 0.000 claims description 25
- 150000002431 hydrogen Chemical class 0.000 claims description 23
- 125000004076 pyridyl group Chemical group 0.000 claims description 23
- 229910052757 nitrogen Inorganic materials 0.000 claims description 21
- 125000003282 alkyl amino group Chemical group 0.000 claims description 19
- 125000004429 atom Chemical group 0.000 claims description 19
- 125000005842 heteroatom Chemical group 0.000 claims description 19
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 19
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 17
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 17
- 125000001624 naphthyl group Chemical group 0.000 claims description 17
- 125000004043 oxo group Chemical group O=* 0.000 claims description 17
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 17
- 125000004193 piperazinyl group Chemical group 0.000 claims description 16
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 15
- 125000000623 heterocyclic group Chemical group 0.000 claims description 15
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims description 15
- 125000002757 morpholinyl group Chemical group 0.000 claims description 15
- 125000003386 piperidinyl group Chemical group 0.000 claims description 15
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 15
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 15
- 125000001153 fluoro group Chemical group F* 0.000 claims description 13
- 239000000651 prodrug Substances 0.000 claims description 13
- 229940002612 prodrug Drugs 0.000 claims description 13
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 13
- 125000004737 (C1-C6) haloalkoxy group Chemical group 0.000 claims description 12
- 125000001041 indolyl group Chemical group 0.000 claims description 12
- 238000000159 protein binding assay Methods 0.000 claims description 12
- 230000019491 signal transduction Effects 0.000 claims description 12
- 125000004568 thiomorpholinyl group Chemical group 0.000 claims description 11
- 125000006677 (C1-C3) haloalkoxy group Chemical group 0.000 claims description 10
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 10
- 210000000265 leukocyte Anatomy 0.000 claims description 10
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 claims description 10
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 9
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 9
- 125000002883 imidazolyl group Chemical group 0.000 claims description 9
- 230000002401 inhibitory effect Effects 0.000 claims description 9
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 9
- 125000000335 thiazolyl group Chemical group 0.000 claims description 9
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 7
- 125000002971 oxazolyl group Chemical group 0.000 claims description 7
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 7
- 125000004768 (C1-C4) alkylsulfinyl group Chemical group 0.000 claims description 6
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 6
- 206010063837 Reperfusion injury Diseases 0.000 claims description 6
- 125000002541 furyl group Chemical group 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 6
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 230000001413 cellular effect Effects 0.000 claims description 5
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 claims description 4
- 201000001320 Atherosclerosis Diseases 0.000 claims description 4
- 208000024172 Cardiovascular disease Diseases 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 201000004681 Psoriasis Diseases 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 claims description 4
- 208000006673 asthma Diseases 0.000 claims description 4
- 125000006485 halo alkoxy phenyl group Chemical group 0.000 claims description 4
- 208000030603 inherited susceptibility to asthma Diseases 0.000 claims description 4
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 4
- 208000010125 myocardial infarction Diseases 0.000 claims description 4
- 206010039073 rheumatoid arthritis Diseases 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 208000006011 Stroke Diseases 0.000 claims description 3
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 3
- 208000012947 ischemia reperfusion injury Diseases 0.000 claims description 3
- 208000031225 myocardial ischemia Diseases 0.000 claims description 3
- VHMGLNZWVLWCLE-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-2-methyl-6-phenylbenzamide Chemical compound C=1C=CC=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C=1C(C)=CC=CC=1C1=CC=CC=C1 VHMGLNZWVLWCLE-UHFFFAOYSA-N 0.000 claims description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims description 3
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 239000006188 syrup Substances 0.000 claims description 3
- 235000020357 syrup Nutrition 0.000 claims description 3
- 125000006728 (C1-C6) alkynyl group Chemical group 0.000 claims description 2
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 claims description 2
- YTMAESGDKJHTST-UHFFFAOYSA-N n-(1,3-benzodioxol-5-ylmethyl)-n-benzyl-2-[4-(trifluoromethyl)phenyl]benzamide Chemical compound C1=CC(C(F)(F)F)=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=C2OCOC2=CC=1)CC1=CC=CC=C1 YTMAESGDKJHTST-UHFFFAOYSA-N 0.000 claims description 2
- JMQSOEQIMIEPIL-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(2-fluorophenyl)methyl]-2-(5-methylthiophen-2-yl)naphthalene-1-carboxamide Chemical compound S1C(C)=CC=C1C1=CC=C(C=CC=C2)C2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC=C1F JMQSOEQIMIEPIL-UHFFFAOYSA-N 0.000 claims description 2
- DRJPUEBHZSFFFC-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(2-fluorophenyl)methyl]-2-hydroxynaphthalene-1-carboxamide Chemical compound OC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC=C1F DRJPUEBHZSFFFC-UHFFFAOYSA-N 0.000 claims description 2
- GZFBFPOQDOLRSS-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(2-fluorophenyl)methyl]-2-methoxynaphthalene-1-carboxamide Chemical compound COC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC=C1F GZFBFPOQDOLRSS-UHFFFAOYSA-N 0.000 claims description 2
- LFEHJNLHGXVHPA-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-2-methoxynaphthalene-1-carboxamide Chemical compound COC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC=C1 LFEHJNLHGXVHPA-UHFFFAOYSA-N 0.000 claims description 2
- WCKKBATUFCMDSP-UHFFFAOYSA-N n-benzyl-n-[(2-methylphenyl)methyl]-2-pyrrol-1-ylbenzamide Chemical compound CC1=CC=CC=C1CN(C(=O)C=1C(=CC=CC=1)N1C=CC=C1)CC1=CC=CC=C1 WCKKBATUFCMDSP-UHFFFAOYSA-N 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 239000006187 pill Substances 0.000 claims description 2
- 125000005936 piperidyl group Chemical group 0.000 claims description 2
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 claims description 2
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 claims description 2
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 claims 10
- 125000004130 indan-2-yl group Chemical group [H]C1=C([H])C([H])=C2C(=C1[H])C([H])([H])C([H])(*)C2([H])[H] 0.000 claims 10
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 claims 9
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 claims 8
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 claims 8
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 claims 7
- 125000006507 2,4-difluorobenzyl group Chemical group [H]C1=C(F)C([H])=C(F)C(=C1[H])C([H])([H])* 0.000 claims 5
- 125000006497 3-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 claims 4
- 125000000579 2,2-diphenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(C1=C([H])C([H])=C([H])C([H])=C1[H])C([H])([H])* 0.000 claims 3
- 125000006179 2-methyl benzyl group Chemical group [H]C1=C([H])C(=C(C([H])=C1[H])C([H])([H])*)C([H])([H])[H] 0.000 claims 3
- 125000006186 3,5-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C([H])=C1C([H])([H])[H])C([H])([H])*)C([H])([H])[H] 0.000 claims 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims 2
- 125000006498 halo alkoxy benzyl group Chemical group 0.000 claims 2
- XIMAHGDXRNAODX-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methoxy-n-[(3-methoxyphenyl)methyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C3=CC=CC=C3C=CC=2OC)=C1 XIMAHGDXRNAODX-UHFFFAOYSA-N 0.000 claims 2
- XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical group [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 claims 1
- YPODEHLMDRNVCM-UHFFFAOYSA-N 2-(3-acetamidophenyl)-n,n-dibenzylbenzamide Chemical compound CC(=O)NC1=CC=CC(C=2C(=CC=CC=2)C(=O)N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)=C1 YPODEHLMDRNVCM-UHFFFAOYSA-N 0.000 claims 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims 1
- 125000003890 2-phenylbutyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 claims 1
- JEDICTNUQVTWDG-UHFFFAOYSA-N 4-[[2,3-dihydro-1h-inden-2-yl-(2-methoxynaphthalene-1-carbonyl)amino]methyl]benzoic acid Chemical compound COC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=C(C(O)=O)C=C1 JEDICTNUQVTWDG-UHFFFAOYSA-N 0.000 claims 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 claims 1
- PRPUVGVCKNGUNT-UHFFFAOYSA-N 5-chloro-n-(2,3-dihydro-1h-inden-2-yl)-2-phenyl-n-(2-phenylethyl)benzamide Chemical compound C=1C=CC=CC=1CCN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(Cl)=CC=C1C1=CC=CC=C1 PRPUVGVCKNGUNT-UHFFFAOYSA-N 0.000 claims 1
- PSRLIZKHLVPQHZ-UHFFFAOYSA-N 5-chloro-n-(2,3-dihydro-1h-inden-2-yl)-n-[(2-fluorophenyl)methyl]-2-phenylbenzamide Chemical compound FC1=CC=CC=C1CN(C(=O)C=1C(=CC=C(Cl)C=1)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 PSRLIZKHLVPQHZ-UHFFFAOYSA-N 0.000 claims 1
- ZWBGCLAPSOZQMP-UHFFFAOYSA-N 5-chloro-n-(2,3-dihydro-1h-inden-2-yl)-n-[(3-fluorophenyl)methyl]-2-phenylbenzamide Chemical compound FC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=C(Cl)C=2)C=2C=CC=CC=2)=C1 ZWBGCLAPSOZQMP-UHFFFAOYSA-N 0.000 claims 1
- ZWYVWARMRBYNKM-UHFFFAOYSA-N 5-chloro-n-(2,3-dihydro-1h-inden-2-yl)-n-[(3-methoxyphenyl)methyl]-2-phenylbenzamide Chemical compound COC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=C(Cl)C=2)C=2C=CC=CC=2)=C1 ZWYVWARMRBYNKM-UHFFFAOYSA-N 0.000 claims 1
- AIYHJGBNBBYDKW-UHFFFAOYSA-N 5-chloro-n-(2,3-dihydro-1h-inden-2-yl)-n-[(3-methylphenyl)methyl]-2-phenylbenzamide Chemical compound CC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=C(Cl)C=2)C=2C=CC=CC=2)=C1 AIYHJGBNBBYDKW-UHFFFAOYSA-N 0.000 claims 1
- OYACMTSRYCBMCY-UHFFFAOYSA-N 5-chloro-n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-fluorophenyl)methyl]-2-phenylbenzamide Chemical compound C1=CC(F)=CC=C1CN(C(=O)C=1C(=CC=C(Cl)C=1)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 OYACMTSRYCBMCY-UHFFFAOYSA-N 0.000 claims 1
- BJEKFYWKWNZXTK-UHFFFAOYSA-N 5-chloro-n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-methoxyphenyl)methyl]-2-phenylbenzamide Chemical compound C1=CC(OC)=CC=C1CN(C(=O)C=1C(=CC=C(Cl)C=1)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 BJEKFYWKWNZXTK-UHFFFAOYSA-N 0.000 claims 1
- KLUBHMKMCLVFPC-UHFFFAOYSA-N 5-chloro-n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-methylphenyl)methyl]-2-phenylbenzamide Chemical compound C1=CC(C)=CC=C1CN(C(=O)C=1C(=CC=C(Cl)C=1)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 KLUBHMKMCLVFPC-UHFFFAOYSA-N 0.000 claims 1
- CLSWQRFHZWIHCZ-UHFFFAOYSA-N 5-chloro-n-[(3,4-difluorophenyl)methyl]-n-(2,3-dihydro-1h-inden-2-yl)-2-phenylbenzamide Chemical compound C1=C(F)C(F)=CC=C1CN(C(=O)C=1C(=CC=C(Cl)C=1)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 CLSWQRFHZWIHCZ-UHFFFAOYSA-N 0.000 claims 1
- HHJACKUDLFYPHJ-UHFFFAOYSA-N 5-chloro-n-[(3-methoxyphenyl)methyl]-2-phenyl-n-(2-phenylethyl)benzamide Chemical compound COC1=CC=CC(CN(CCC=2C=CC=CC=2)C(=O)C=2C(=CC=C(Cl)C=2)C=2C=CC=CC=2)=C1 HHJACKUDLFYPHJ-UHFFFAOYSA-N 0.000 claims 1
- 239000000443 aerosol Substances 0.000 claims 1
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- 239000002775 capsule Substances 0.000 claims 1
- 239000006071 cream Substances 0.000 claims 1
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 claims 1
- 239000012530 fluid Substances 0.000 claims 1
- 239000000499 gel Substances 0.000 claims 1
- 125000004129 indan-1-yl group Chemical group [H]C1=C([H])C([H])=C2C(=C1[H])C([H])([H])C([H])([H])C2([H])* 0.000 claims 1
- PQIOSYKVBBWRRI-UHFFFAOYSA-N methylphosphonyl difluoride Chemical group CP(F)(F)=O PQIOSYKVBBWRRI-UHFFFAOYSA-N 0.000 claims 1
- NIFRRAYVYJKLCV-UHFFFAOYSA-N n,n-dibenzyl-2-(2,3-dichlorophenyl)benzamide Chemical compound ClC1=CC=CC(C=2C(=CC=CC=2)C(=O)N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)=C1Cl NIFRRAYVYJKLCV-UHFFFAOYSA-N 0.000 claims 1
- PTSIAUYIVYYSHO-UHFFFAOYSA-N n,n-dibenzyl-2-(2,4-dichlorophenyl)benzamide Chemical compound ClC1=CC(Cl)=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 PTSIAUYIVYYSHO-UHFFFAOYSA-N 0.000 claims 1
- STDRIBGDZUDOMU-UHFFFAOYSA-N n,n-dibenzyl-2-(2,4-dimethoxyphenyl)benzamide Chemical compound COC1=CC(OC)=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 STDRIBGDZUDOMU-UHFFFAOYSA-N 0.000 claims 1
- QVYZZQHABCSKIE-UHFFFAOYSA-N n,n-dibenzyl-2-(2-chlorophenyl)benzamide Chemical compound ClC1=CC=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 QVYZZQHABCSKIE-UHFFFAOYSA-N 0.000 claims 1
- RQXCDNFCCVZYKO-UHFFFAOYSA-N n,n-dibenzyl-2-(2-fluorophenyl)benzamide Chemical compound FC1=CC=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 RQXCDNFCCVZYKO-UHFFFAOYSA-N 0.000 claims 1
- OEHXCAIWGFKLDV-UHFFFAOYSA-N n,n-dibenzyl-2-(2-methoxyphenyl)benzamide Chemical compound COC1=CC=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 OEHXCAIWGFKLDV-UHFFFAOYSA-N 0.000 claims 1
- KXYSITUMTRADQU-UHFFFAOYSA-N n,n-dibenzyl-2-(2-methylphenyl)benzamide Chemical compound CC1=CC=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 KXYSITUMTRADQU-UHFFFAOYSA-N 0.000 claims 1
- KDLRLKGWOHDOHN-UHFFFAOYSA-N n,n-dibenzyl-2-(2-methylsulfanylphenyl)benzamide Chemical compound CSC1=CC=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 KDLRLKGWOHDOHN-UHFFFAOYSA-N 0.000 claims 1
- SHJPCSOSGTWEIT-UHFFFAOYSA-N n,n-dibenzyl-2-(3,4-dimethoxyphenyl)benzamide Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 SHJPCSOSGTWEIT-UHFFFAOYSA-N 0.000 claims 1
- SAKPRPCRWIJKAW-UHFFFAOYSA-N n,n-dibenzyl-2-(3,4-dimethylphenyl)benzamide Chemical compound C1=C(C)C(C)=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 SAKPRPCRWIJKAW-UHFFFAOYSA-N 0.000 claims 1
- RANUQHHJIZAOII-UHFFFAOYSA-N n,n-dibenzyl-2-(3,5-dichlorophenyl)benzamide Chemical compound ClC1=CC(Cl)=CC(C=2C(=CC=CC=2)C(=O)N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)=C1 RANUQHHJIZAOII-UHFFFAOYSA-N 0.000 claims 1
- CMRCFHGCZOWHNF-UHFFFAOYSA-N n,n-dibenzyl-2-(3-chlorophenyl)benzamide Chemical compound ClC1=CC=CC(C=2C(=CC=CC=2)C(=O)N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)=C1 CMRCFHGCZOWHNF-UHFFFAOYSA-N 0.000 claims 1
- DZAVLFOTJPKCSB-UHFFFAOYSA-N n,n-dibenzyl-2-(3-fluorophenyl)benzamide Chemical compound FC1=CC=CC(C=2C(=CC=CC=2)C(=O)N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)=C1 DZAVLFOTJPKCSB-UHFFFAOYSA-N 0.000 claims 1
- NLIQBHMQDGHHHY-UHFFFAOYSA-N n,n-dibenzyl-2-(3-methylphenyl)benzamide Chemical compound CC1=CC=CC(C=2C(=CC=CC=2)C(=O)N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)=C1 NLIQBHMQDGHHHY-UHFFFAOYSA-N 0.000 claims 1
- NBWOBXJUIJWXKU-UHFFFAOYSA-N n,n-dibenzyl-2-(4-chlorophenyl)benzamide Chemical compound C1=CC(Cl)=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 NBWOBXJUIJWXKU-UHFFFAOYSA-N 0.000 claims 1
- PHAGOGZREVCAEM-UHFFFAOYSA-N n,n-dibenzyl-2-(4-ethylsulfanylphenyl)benzamide Chemical compound C1=CC(SCC)=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 PHAGOGZREVCAEM-UHFFFAOYSA-N 0.000 claims 1
- CDGDQADYZHNLKT-UHFFFAOYSA-N n,n-dibenzyl-2-(4-fluorophenyl)benzamide Chemical compound C1=CC(F)=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 CDGDQADYZHNLKT-UHFFFAOYSA-N 0.000 claims 1
- KNYNTZXIBMXUQZ-UHFFFAOYSA-N n,n-dibenzyl-2-(4-methoxyphenyl)benzamide Chemical compound C1=CC(OC)=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 KNYNTZXIBMXUQZ-UHFFFAOYSA-N 0.000 claims 1
- PLSSAKXISGFAAH-UHFFFAOYSA-N n,n-dibenzyl-2-(4-methylphenyl)benzamide Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 PLSSAKXISGFAAH-UHFFFAOYSA-N 0.000 claims 1
- GKKUWNBAZWPCGR-UHFFFAOYSA-N n,n-dibenzyl-2-[4-(trifluoromethoxy)phenyl]benzamide Chemical compound C1=CC(OC(F)(F)F)=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 GKKUWNBAZWPCGR-UHFFFAOYSA-N 0.000 claims 1
- CPJLPABBYDCQDX-UHFFFAOYSA-N n,n-dibenzyl-2-[4-(trifluoromethyl)phenyl]benzamide Chemical compound C1=CC(C(F)(F)F)=CC=C1C1=CC=CC=C1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 CPJLPABBYDCQDX-UHFFFAOYSA-N 0.000 claims 1
- ZFKYAFZDACUXRY-UHFFFAOYSA-N n,n-dibenzyl-2-phenylbenzamide Chemical compound C=1C=CC=C(C=2C=CC=CC=2)C=1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 ZFKYAFZDACUXRY-UHFFFAOYSA-N 0.000 claims 1
- UAGPNUKBGKKYMI-UHFFFAOYSA-N n,n-dibenzyl-2-thiophen-3-ylbenzamide Chemical compound C=1C=CC=C(C2=CSC=C2)C=1C(=O)N(CC=1C=CC=CC=1)CC1=CC=CC=C1 UAGPNUKBGKKYMI-UHFFFAOYSA-N 0.000 claims 1
- QQRBRGCNOFKUCZ-UHFFFAOYSA-N n-(1,3-benzodioxol-5-ylmethyl)-5-chloro-n-(2,3-dihydro-1h-inden-2-yl)-2-phenylbenzamide Chemical compound C=1C=C2OCOC2=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(Cl)=CC=C1C1=CC=CC=C1 QQRBRGCNOFKUCZ-UHFFFAOYSA-N 0.000 claims 1
- ITMFYQLNJVXSDP-UHFFFAOYSA-N n-(1,3-benzodioxol-5-ylmethyl)-n-(2,3-dihydro-1h-inden-2-yl)-2-(3-methoxyphenyl)benzamide Chemical compound COC1=CC=CC(C=2C(=CC=CC=2)C(=O)N(CC=2C=C3OCOC3=CC=2)C2CC3=CC=CC=C3C2)=C1 ITMFYQLNJVXSDP-UHFFFAOYSA-N 0.000 claims 1
- LPFYXJDHQXABLI-UHFFFAOYSA-N n-(1,3-benzodioxol-5-ylmethyl)-n-(2,3-dihydro-1h-inden-2-yl)-2-methoxynaphthalene-1-carboxamide Chemical compound C1C2=CC=CC=C2CC1N(CC=1C=C2OCOC2=CC=1)C(=O)C1=C2C=CC=CC2=CC=C1OC LPFYXJDHQXABLI-UHFFFAOYSA-N 0.000 claims 1
- SQLVYAFGGJAIHC-UHFFFAOYSA-N n-(1,3-benzodioxol-5-ylmethyl)-n-(2,3-dihydro-1h-inden-2-yl)-2-methyl-6-phenylbenzamide Chemical compound C=1C=C2OCOC2=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C=1C(C)=CC=CC=1C1=CC=CC=C1 SQLVYAFGGJAIHC-UHFFFAOYSA-N 0.000 claims 1
- GXNLDEHQCIZNSV-UHFFFAOYSA-N n-(1,3-benzodioxol-5-ylmethyl)-n-(2,3-dihydro-1h-inden-2-yl)-2-phenylbenzamide Chemical compound C=1C=C2OCOC2=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC=CC=C1C1=CC=CC=C1 GXNLDEHQCIZNSV-UHFFFAOYSA-N 0.000 claims 1
- XMDYUNIDUPSQRS-UHFFFAOYSA-N n-(1,3-benzodioxol-5-ylmethyl)-n-(2,3-dihydro-1h-inden-2-yl)-9h-fluorene-4-carboxamide Chemical compound C1C2=CC=CC=C2C2=C1C=CC=C2C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=C(OCO2)C2=C1 XMDYUNIDUPSQRS-UHFFFAOYSA-N 0.000 claims 1
- ITBHUMRLUIVISY-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-(2-fluorophenyl)-n-[(2-methoxyphenyl)methyl]benzamide Chemical compound COC1=CC=CC=C1CN(C(=O)C=1C(=CC=CC=1)C=1C(=CC=CC=1)F)C1CC2=CC=CC=C2C1 ITBHUMRLUIVISY-UHFFFAOYSA-N 0.000 claims 1
- VTCZXXXQDSOQFR-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-(2-fluorophenyl)-n-[(3-fluorophenyl)methyl]benzamide Chemical compound FC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=CC=2)C=2C(=CC=CC=2)F)=C1 VTCZXXXQDSOQFR-UHFFFAOYSA-N 0.000 claims 1
- YMNWANPXHBMDPU-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-(2-fluorophenyl)-n-[(3-methylphenyl)methyl]benzamide Chemical compound CC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=CC=2)C=2C(=CC=CC=2)F)=C1 YMNWANPXHBMDPU-UHFFFAOYSA-N 0.000 claims 1
- MSTHBRFPZKTXQH-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-(2-fluorophenyl)-n-[(4-fluorophenyl)methyl]benzamide Chemical compound C1=CC(F)=CC=C1CN(C(=O)C=1C(=CC=CC=1)C=1C(=CC=CC=1)F)C1CC2=CC=CC=C2C1 MSTHBRFPZKTXQH-UHFFFAOYSA-N 0.000 claims 1
- VQQSRWAEKFNPNR-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-(2-fluorophenyl)-n-[(4-methylphenyl)methyl]benzamide Chemical compound C1=CC(C)=CC=C1CN(C(=O)C=1C(=CC=CC=1)C=1C(=CC=CC=1)F)C1CC2=CC=CC=C2C1 VQQSRWAEKFNPNR-UHFFFAOYSA-N 0.000 claims 1
- WIAMKPMPJXUOTK-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-(3-methoxyphenyl)-n-[(3-methylphenyl)methyl]benzamide Chemical compound COC1=CC=CC(C=2C(=CC=CC=2)C(=O)N(CC=2C=C(C)C=CC=2)C2CC3=CC=CC=C3C2)=C1 WIAMKPMPJXUOTK-UHFFFAOYSA-N 0.000 claims 1
- OZZKWHOSRYUNAA-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-(3-methoxyphenyl)-n-[(4-methylphenyl)methyl]benzamide Chemical compound COC1=CC=CC(C=2C(=CC=CC=2)C(=O)N(CC=2C=CC(C)=CC=2)C2CC3=CC=CC=C3C2)=C1 OZZKWHOSRYUNAA-UHFFFAOYSA-N 0.000 claims 1
- PIFHMYUUCHSDLJ-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-(4-methylphenyl)-n-[(2-methylphenyl)methyl]benzamide Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC=C1C PIFHMYUUCHSDLJ-UHFFFAOYSA-N 0.000 claims 1
- RNJCXZISNCJBDR-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-(4-methylphenyl)-n-[(3-methylphenyl)methyl]benzamide Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC(C)=C1 RNJCXZISNCJBDR-UHFFFAOYSA-N 0.000 claims 1
- RRWXEYIPOQODHM-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-(4-methylphenyl)-n-[(4-methylphenyl)methyl]benzamide Chemical compound C1=CC(C)=CC=C1CN(C(=O)C=1C(=CC=CC=1)C=1C=CC(C)=CC=1)C1CC2=CC=CC=C2C1 RRWXEYIPOQODHM-UHFFFAOYSA-N 0.000 claims 1
- PJKHIHGUOYAZAN-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-hydroxy-n-[(4-methylphenyl)methyl]naphthalene-1-carboxamide Chemical compound C1=CC(C)=CC=C1CN(C(=O)C=1C2=CC=CC=C2C=CC=1O)C1CC2=CC=CC=C2C1 PJKHIHGUOYAZAN-UHFFFAOYSA-N 0.000 claims 1
- IPPQMCOMOGJUEO-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methoxy-n-(2-phenylethyl)naphthalene-1-carboxamide Chemical compound COC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CCC1=CC=CC=C1 IPPQMCOMOGJUEO-UHFFFAOYSA-N 0.000 claims 1
- DKGLEQYNSYMXMP-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methoxy-n-[(2-methylphenyl)methyl]naphthalene-1-carboxamide Chemical compound COC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC=C1C DKGLEQYNSYMXMP-UHFFFAOYSA-N 0.000 claims 1
- DMYAILOXUZNFEV-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methoxy-n-[(3-methoxyphenyl)methyl]-6-phenylbenzamide Chemical compound COC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=CC=2OC)C=2C=CC=CC=2)=C1 DMYAILOXUZNFEV-UHFFFAOYSA-N 0.000 claims 1
- SOZFTKFBPZPQBV-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methoxy-n-[(4-methoxyphenyl)methyl]naphthalene-1-carboxamide Chemical compound C1=CC(OC)=CC=C1CN(C(=O)C=1C2=CC=CC=C2C=CC=1OC)C1CC2=CC=CC=C2C1 SOZFTKFBPZPQBV-UHFFFAOYSA-N 0.000 claims 1
- LUCNNLKTXSJREP-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methoxy-n-[(4-methylphenyl)methyl]naphthalene-1-carboxamide Chemical compound COC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=C(C)C=C1 LUCNNLKTXSJREP-UHFFFAOYSA-N 0.000 claims 1
- VNMUPEUJVMFOEF-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methyl-6-phenyl-n-(2-phenylethyl)benzamide Chemical compound C=1C=CC=CC=1CCN(C1CC2=CC=CC=C2C1)C(=O)C=1C(C)=CC=CC=1C1=CC=CC=C1 VNMUPEUJVMFOEF-UHFFFAOYSA-N 0.000 claims 1
- VNIGJMXJSWEOKG-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methyl-n-(2-phenylethyl)naphthalene-1-carboxamide Chemical compound CC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CCC1=CC=CC=C1 VNIGJMXJSWEOKG-UHFFFAOYSA-N 0.000 claims 1
- KHWOYXDLKXPJPH-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methyl-n-[(2-methylphenyl)methyl]-6-phenylbenzamide Chemical compound CC1=CC=CC=C1CN(C(=O)C=1C(=CC=CC=1C)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 KHWOYXDLKXPJPH-UHFFFAOYSA-N 0.000 claims 1
- QXIHVZFGLTWWPW-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methyl-n-[(2-methylphenyl)methyl]naphthalene-1-carboxamide Chemical compound CC1=CC=CC=C1CN(C(=O)C=1C2=CC=CC=C2C=CC=1C)C1CC2=CC=CC=C2C1 QXIHVZFGLTWWPW-UHFFFAOYSA-N 0.000 claims 1
- XLESKBUGHZBUIN-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methyl-n-[(3-methylphenyl)methyl]-6-phenylbenzamide Chemical compound CC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=CC=2C)C=2C=CC=CC=2)=C1 XLESKBUGHZBUIN-UHFFFAOYSA-N 0.000 claims 1
- HQVFCDCCWAPZCE-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methyl-n-[(3-methylphenyl)methyl]naphthalene-1-carboxamide Chemical compound CC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C3=CC=CC=C3C=CC=2C)=C1 HQVFCDCCWAPZCE-UHFFFAOYSA-N 0.000 claims 1
- DUISPKPTEFJOLH-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methyl-n-[(4-methylphenyl)methyl]-6-phenylbenzamide Chemical compound C1=CC(C)=CC=C1CN(C(=O)C=1C(=CC=CC=1C)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 DUISPKPTEFJOLH-UHFFFAOYSA-N 0.000 claims 1
- OUQSATZJYHNIGR-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-2-methyl-n-[(4-methylphenyl)methyl]naphthalene-1-carboxamide Chemical compound C1=CC(C)=CC=C1CN(C(=O)C=1C2=CC=CC=C2C=CC=1C)C1CC2=CC=CC=C2C1 OUQSATZJYHNIGR-UHFFFAOYSA-N 0.000 claims 1
- ISOSSDQIQUDZOH-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-5-methoxy-n-[(2-methylphenyl)methyl]-2-phenylbenzamide Chemical compound C=1C=CC=C(C)C=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(OC)=CC=C1C1=CC=CC=C1 ISOSSDQIQUDZOH-UHFFFAOYSA-N 0.000 claims 1
- QPFMSABCGBELDC-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-5-methoxy-n-[(3-methoxyphenyl)methyl]-2-(5-methylthiophen-2-yl)benzamide Chemical compound COC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=C(OC)C=2)C=2SC(C)=CC=2)=C1 QPFMSABCGBELDC-UHFFFAOYSA-N 0.000 claims 1
- YGUVKNSJMSWCQA-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-5-methoxy-n-[(3-methoxyphenyl)methyl]-2-phenylbenzamide Chemical compound COC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=C(OC)C=2)C=2C=CC=CC=2)=C1 YGUVKNSJMSWCQA-UHFFFAOYSA-N 0.000 claims 1
- CHEDUXCSRIWMTM-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-5-methoxy-n-[(3-methoxyphenyl)methyl]-2-thiophen-3-ylbenzamide Chemical compound COC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=C(OC)C=2)C2=CSC=C2)=C1 CHEDUXCSRIWMTM-UHFFFAOYSA-N 0.000 claims 1
- UHSKYZXAUCDMQE-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-5-methoxy-n-[(3-methylphenyl)methyl]-2-phenylbenzamide Chemical compound C=1C=CC(C)=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(OC)=CC=C1C1=CC=CC=C1 UHSKYZXAUCDMQE-UHFFFAOYSA-N 0.000 claims 1
- INCDGTYGBJZQMJ-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-5-methoxy-n-[(4-methylphenyl)methyl]-2-phenylbenzamide Chemical compound C=1C=C(C)C=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(OC)=CC=C1C1=CC=CC=C1 INCDGTYGBJZQMJ-UHFFFAOYSA-N 0.000 claims 1
- OMTACZSLWIFNHD-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-(naphthalen-2-ylmethyl)-2-thiophen-3-ylbenzamide Chemical compound C=1C=C2C=CC=CC2=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC=CC=C1C=1C=CSC=1 OMTACZSLWIFNHD-UHFFFAOYSA-N 0.000 claims 1
- PKIHNMFXTCUSQR-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(2-fluorophenyl)methyl]-2-(4-methylphenyl)benzamide Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC=C1F PKIHNMFXTCUSQR-UHFFFAOYSA-N 0.000 claims 1
- YAKMAHBUAMQTFO-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(2-fluorophenyl)methyl]-2-methyl-6-phenylbenzamide Chemical compound C=1C=CC=C(F)C=1CN(C1CC2=CC=CC=C2C1)C(=O)C=1C(C)=CC=CC=1C1=CC=CC=C1 YAKMAHBUAMQTFO-UHFFFAOYSA-N 0.000 claims 1
- CZNCRUXJXDUIPP-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(2-fluorophenyl)methyl]-2-methylnaphthalene-1-carboxamide Chemical compound CC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC=C1F CZNCRUXJXDUIPP-UHFFFAOYSA-N 0.000 claims 1
- LZQKBEGCSMDJFB-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(2-fluorophenyl)methyl]-2-phenylbenzamide Chemical compound FC1=CC=CC=C1CN(C(=O)C=1C(=CC=CC=1)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 LZQKBEGCSMDJFB-UHFFFAOYSA-N 0.000 claims 1
- YAZPWTIMAYZTSF-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(2-fluorophenyl)methyl]-2-phenylnaphthalene-1-carboxamide Chemical compound FC1=CC=CC=C1CN(C(=O)C=1C2=CC=CC=C2C=CC=1C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 YAZPWTIMAYZTSF-UHFFFAOYSA-N 0.000 claims 1
- KDBNAEHOKGOFMZ-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(2-fluorophenyl)methyl]-5-methoxy-2-phenylbenzamide Chemical compound C=1C=CC=C(F)C=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(OC)=CC=C1C1=CC=CC=C1 KDBNAEHOKGOFMZ-UHFFFAOYSA-N 0.000 claims 1
- ONORQQPKMWAIJC-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(2-methoxyphenyl)methyl]-2-thiophen-3-ylbenzamide Chemical compound COC1=CC=CC=C1CN(C(=O)C=1C(=CC=CC=1)C1=CSC=C1)C1CC2=CC=CC=C2C1 ONORQQPKMWAIJC-UHFFFAOYSA-N 0.000 claims 1
- JRKLPINKHQOOCA-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(2-methylphenyl)methyl]-2-phenylbenzamide Chemical compound CC1=CC=CC=C1CN(C(=O)C=1C(=CC=CC=1)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 JRKLPINKHQOOCA-UHFFFAOYSA-N 0.000 claims 1
- DWHZHQUCCVCZKC-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(3,5-dimethoxyphenyl)methyl]-2-thiophen-3-ylbenzamide Chemical compound COC1=CC(OC)=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=CC=2)C2=CSC=C2)=C1 DWHZHQUCCVCZKC-UHFFFAOYSA-N 0.000 claims 1
- KPIMWSZXAYNUDG-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(3-fluorophenyl)methyl]-2-(4-methylphenyl)benzamide Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC(F)=C1 KPIMWSZXAYNUDG-UHFFFAOYSA-N 0.000 claims 1
- GIIKJIFSTIDCHN-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(3-fluorophenyl)methyl]-2-methoxynaphthalene-1-carboxamide Chemical compound COC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC(F)=C1 GIIKJIFSTIDCHN-UHFFFAOYSA-N 0.000 claims 1
- OIVRCUNDXMESHF-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(3-fluorophenyl)methyl]-2-methyl-6-phenylbenzamide Chemical compound C=1C=CC(F)=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C=1C(C)=CC=CC=1C1=CC=CC=C1 OIVRCUNDXMESHF-UHFFFAOYSA-N 0.000 claims 1
- IOEQMMIAYDPHTP-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(3-fluorophenyl)methyl]-2-methylnaphthalene-1-carboxamide Chemical compound CC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC(F)=C1 IOEQMMIAYDPHTP-UHFFFAOYSA-N 0.000 claims 1
- ZSWHNBYIXAGSJF-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(3-fluorophenyl)methyl]-2-phenylbenzamide Chemical compound FC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=CC=2)C=2C=CC=CC=2)=C1 ZSWHNBYIXAGSJF-UHFFFAOYSA-N 0.000 claims 1
- WUUXFUBRYOJMQE-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(3-fluorophenyl)methyl]-5-methoxy-2-phenylbenzamide Chemical compound C=1C=CC(F)=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(OC)=CC=C1C1=CC=CC=C1 WUUXFUBRYOJMQE-UHFFFAOYSA-N 0.000 claims 1
- UONDYZPQCQIHKD-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(3-methoxyphenyl)methyl]-2-methyl-6-phenylbenzamide Chemical compound COC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=CC=2C)C=2C=CC=CC=2)=C1 UONDYZPQCQIHKD-UHFFFAOYSA-N 0.000 claims 1
- GQCPMBSGOVDPNW-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(3-methylphenyl)methyl]-2-phenylbenzamide Chemical compound CC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=CC=2)C=2C=CC=CC=2)=C1 GQCPMBSGOVDPNW-UHFFFAOYSA-N 0.000 claims 1
- NCUYFMGSTQWANZ-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(3-methylphenyl)methyl]-2-pyrrol-1-ylbenzamide Chemical compound CC1=CC=CC(CN(C2CC3=CC=CC=C3C2)C(=O)C=2C(=CC=CC=2)N2C=CC=C2)=C1 NCUYFMGSTQWANZ-UHFFFAOYSA-N 0.000 claims 1
- LCWNUZKGGCULQJ-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-fluorophenyl)methyl]-2-(3-methoxyphenyl)benzamide Chemical compound COC1=CC=CC(C=2C(=CC=CC=2)C(=O)N(CC=2C=CC(F)=CC=2)C2CC3=CC=CC=C3C2)=C1 LCWNUZKGGCULQJ-UHFFFAOYSA-N 0.000 claims 1
- QYJUKQMESZMSSA-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-fluorophenyl)methyl]-2-(4-methylphenyl)benzamide Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=C(F)C=C1 QYJUKQMESZMSSA-UHFFFAOYSA-N 0.000 claims 1
- AJZSYCRCXAPQNG-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-fluorophenyl)methyl]-2-methoxynaphthalene-1-carboxamide Chemical compound COC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=C(F)C=C1 AJZSYCRCXAPQNG-UHFFFAOYSA-N 0.000 claims 1
- QLKRPYFXQKAOLZ-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-fluorophenyl)methyl]-2-methyl-6-phenylbenzamide Chemical compound C=1C=C(F)C=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C=1C(C)=CC=CC=1C1=CC=CC=C1 QLKRPYFXQKAOLZ-UHFFFAOYSA-N 0.000 claims 1
- RRAYRUVFEHEVFS-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-fluorophenyl)methyl]-2-methylnaphthalene-1-carboxamide Chemical compound CC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=C(F)C=C1 RRAYRUVFEHEVFS-UHFFFAOYSA-N 0.000 claims 1
- IMBCQBWXUCPJTI-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-fluorophenyl)methyl]-2-phenylbenzamide Chemical compound C1=CC(F)=CC=C1CN(C(=O)C=1C(=CC=CC=1)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 IMBCQBWXUCPJTI-UHFFFAOYSA-N 0.000 claims 1
- RKUFNFQHNJSJIO-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-fluorophenyl)methyl]-5-methoxy-2-phenylbenzamide Chemical compound C=1C=C(F)C=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(OC)=CC=C1C1=CC=CC=C1 RKUFNFQHNJSJIO-UHFFFAOYSA-N 0.000 claims 1
- WXHBYFVSDQNABC-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-methoxyphenyl)methyl]-2-methyl-6-phenylbenzamide Chemical compound C1=CC(OC)=CC=C1CN(C(=O)C=1C(=CC=CC=1C)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 WXHBYFVSDQNABC-UHFFFAOYSA-N 0.000 claims 1
- YXMFYCOBTWROMF-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-methoxyphenyl)methyl]-2-thiophen-3-ylbenzamide Chemical compound C1=CC(OC)=CC=C1CN(C(=O)C=1C(=CC=CC=1)C1=CSC=C1)C1CC2=CC=CC=C2C1 YXMFYCOBTWROMF-UHFFFAOYSA-N 0.000 claims 1
- UAPJVMSJMWPKQK-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-methylphenyl)methyl]-2-phenylbenzamide Chemical compound C1=CC(C)=CC=C1CN(C(=O)C=1C(=CC=CC=1)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 UAPJVMSJMWPKQK-UHFFFAOYSA-N 0.000 claims 1
- CKFKMJKKAAPZEP-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-methylphenyl)methyl]-2-phenylnaphthalene-1-carboxamide Chemical compound C1=CC(C)=CC=C1CN(C(=O)C=1C2=CC=CC=C2C=CC=1C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 CKFKMJKKAAPZEP-UHFFFAOYSA-N 0.000 claims 1
- NSELTYOMHHHOPK-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-n-[(4-methylphenyl)methyl]-2-pyrrol-1-ylbenzamide Chemical compound C1=CC(C)=CC=C1CN(C(=O)C=1C(=CC=CC=1)N1C=CC=C1)C1CC2=CC=CC=C2C1 NSELTYOMHHHOPK-UHFFFAOYSA-N 0.000 claims 1
- AEBCKCSTVLACLS-UHFFFAOYSA-N n-[(3,4-difluorophenyl)methyl]-n-(2,3-dihydro-1h-inden-2-yl)-2-methoxynaphthalene-1-carboxamide Chemical compound COC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=C(F)C(F)=C1 AEBCKCSTVLACLS-UHFFFAOYSA-N 0.000 claims 1
- SOHHODRLTDUDBN-UHFFFAOYSA-N n-[(3,4-difluorophenyl)methyl]-n-(2,3-dihydro-1h-inden-2-yl)-2-methyl-6-phenylbenzamide Chemical compound C=1C=C(F)C(F)=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C=1C(C)=CC=CC=1C1=CC=CC=C1 SOHHODRLTDUDBN-UHFFFAOYSA-N 0.000 claims 1
- LQVZIIPFEGKOAZ-UHFFFAOYSA-N n-[(3,4-difluorophenyl)methyl]-n-(2,3-dihydro-1h-inden-2-yl)-2-phenylbenzamide Chemical compound C1=C(F)C(F)=CC=C1CN(C(=O)C=1C(=CC=CC=1)C=1C=CC=CC=1)C1CC2=CC=CC=C2C1 LQVZIIPFEGKOAZ-UHFFFAOYSA-N 0.000 claims 1
- MRAMEMGMGZLUAP-UHFFFAOYSA-N n-[(3,4-difluorophenyl)methyl]-n-(2,3-dihydro-1h-inden-2-yl)-5-methoxy-2-phenylbenzamide Chemical compound C=1C=C(F)C(F)=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(OC)=CC=C1C1=CC=CC=C1 MRAMEMGMGZLUAP-UHFFFAOYSA-N 0.000 claims 1
- YLCMIPNZQMHJMM-UHFFFAOYSA-N n-[(4-carbamoyl-3-hydroxyphenyl)methyl]-n-(2,3-dihydro-1h-inden-2-yl)-2-methoxynaphthalene-1-carboxamide Chemical compound COC1=CC=C2C=CC=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=C(C(N)=O)C(O)=C1 YLCMIPNZQMHJMM-UHFFFAOYSA-N 0.000 claims 1
- CMEYKWMBWKYDNB-UHFFFAOYSA-N n-benzyl-5-chloro-n-(2,3-dihydro-1-benzofuran-6-ylmethyl)-2-phenylbenzamide Chemical compound C=1C=CC=CC=1CN(CC=1C=C2OCCC2=CC=1)C(=O)C1=CC(Cl)=CC=C1C1=CC=CC=C1 CMEYKWMBWKYDNB-UHFFFAOYSA-N 0.000 claims 1
- NXEXMRXLDVKBQX-UHFFFAOYSA-N n-benzyl-5-chloro-n-(2,3-dihydro-1h-inden-2-yl)-2-phenylbenzamide Chemical compound C=1C=CC=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(Cl)=CC=C1C1=CC=CC=C1 NXEXMRXLDVKBQX-UHFFFAOYSA-N 0.000 claims 1
- ZEDIUFLCJAERJH-UHFFFAOYSA-N n-benzyl-5-chloro-n-(2,3-dihydro-1h-inden-2-yl)-2-thiophen-3-ylbenzamide Chemical compound C=1C=CC=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(Cl)=CC=C1C=1C=CSC=1 ZEDIUFLCJAERJH-UHFFFAOYSA-N 0.000 claims 1
- AOVUEVYCPVDHKF-UHFFFAOYSA-N n-benzyl-5-chloro-n-(naphthalen-1-ylmethyl)-2-phenylbenzamide Chemical compound C=1C=CC=CC=1CN(CC=1C2=CC=CC=C2C=CC=1)C(=O)C1=CC(Cl)=CC=C1C1=CC=CC=C1 AOVUEVYCPVDHKF-UHFFFAOYSA-N 0.000 claims 1
- GIPUQJODCQGKDB-UHFFFAOYSA-N n-benzyl-5-chloro-n-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2-phenylbenzamide Chemical compound CC1=C(O)C(C)=CC(CN(CC=2C=CC=CC=2)C(=O)C=2C(=CC=C(Cl)C=2)C=2C=CC=CC=2)=C1 GIPUQJODCQGKDB-UHFFFAOYSA-N 0.000 claims 1
- SLDKNPQTUARQMZ-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-1-yl)-2-(2-fluorophenyl)benzamide Chemical compound FC1=CC=CC=C1C1=CC=CC=C1C(=O)N(C1C2=CC=CC=C2CC1)CC1=CC=CC=C1 SLDKNPQTUARQMZ-UHFFFAOYSA-N 0.000 claims 1
- SBNHSFDRYKGCLN-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-2-(3-methoxyphenyl)benzamide Chemical compound COC1=CC=CC(C=2C(=CC=CC=2)C(=O)N(CC=2C=CC=CC=2)C2CC3=CC=CC=C3C2)=C1 SBNHSFDRYKGCLN-UHFFFAOYSA-N 0.000 claims 1
- GIGVUPXTTOEKKZ-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-2-(4-methylphenyl)benzamide Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC=C1 GIGVUPXTTOEKKZ-UHFFFAOYSA-N 0.000 claims 1
- ODSJEIUHSPEHHG-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-2-fluoro-6-(5-methylthiophen-2-yl)benzamide Chemical compound S1C(C)=CC=C1C1=CC=CC(F)=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC=C1 ODSJEIUHSPEHHG-UHFFFAOYSA-N 0.000 claims 1
- NYMRDEXPGFBVEB-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-2-fluoro-6-phenylbenzamide Chemical compound C=1C=CC=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C=1C(F)=CC=CC=1C1=CC=CC=C1 NYMRDEXPGFBVEB-UHFFFAOYSA-N 0.000 claims 1
- YDUSMHLIXYDYJP-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-2-hydroxy-6-phenylbenzamide Chemical compound C=1C=CC=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C=1C(O)=CC=CC=1C1=CC=CC=C1 YDUSMHLIXYDYJP-UHFFFAOYSA-N 0.000 claims 1
- LNWLOQMWGFFZNP-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-2-methoxy-6-phenylbenzamide Chemical compound C=1C=CC=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C=1C(OC)=CC=CC=1C1=CC=CC=C1 LNWLOQMWGFFZNP-UHFFFAOYSA-N 0.000 claims 1
- VBXMYLSZXBXVOA-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-2-phenylbenzamide Chemical compound C=1C=CC=C(C=2C=CC=CC=2)C=1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC=C1 VBXMYLSZXBXVOA-UHFFFAOYSA-N 0.000 claims 1
- ONEMRRFOTWQKRR-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-2-thiophen-2-ylbenzamide Chemical compound C=1C=CC=C(C=2SC=CC=2)C=1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=CC=C1 ONEMRRFOTWQKRR-UHFFFAOYSA-N 0.000 claims 1
- ICADFSIUPYIDCY-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-5-hydroxy-2-phenylbenzamide Chemical compound C=1C=CC=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(O)=CC=C1C1=CC=CC=C1 ICADFSIUPYIDCY-UHFFFAOYSA-N 0.000 claims 1
- PJTOFRMZBBAGQI-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-5-methoxy-2-(5-methylthiophen-2-yl)benzamide Chemical compound C=1C=CC=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(OC)=CC=C1C1=CC=C(C)S1 PJTOFRMZBBAGQI-UHFFFAOYSA-N 0.000 claims 1
- MPOINJHJLKHREI-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-5-methoxy-2-phenylbenzamide Chemical compound C=1C=CC=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(OC)=CC=C1C1=CC=CC=C1 MPOINJHJLKHREI-UHFFFAOYSA-N 0.000 claims 1
- CWWNHUVLLKVVOI-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-5-methyl-2-phenylbenzamide Chemical compound C=1C=CC=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(C)=CC=C1C1=CC=CC=C1 CWWNHUVLLKVVOI-UHFFFAOYSA-N 0.000 claims 1
- WQFKKUKIQGILNV-UHFFFAOYSA-N n-benzyl-n-(2,3-dihydro-1h-inden-2-yl)-5-methyl-2-thiophen-3-ylbenzamide Chemical compound C=1C=CC=CC=1CN(C1CC2=CC=CC=C2C1)C(=O)C1=CC(C)=CC=C1C=1C=CSC=1 WQFKKUKIQGILNV-UHFFFAOYSA-N 0.000 claims 1
- QRDNALXWVVNNJN-UHFFFAOYSA-N n-benzyl-n-(5-methoxy-2,3-dihydro-1h-inden-2-yl)-2-phenylbenzamide Chemical compound C1C2=CC(OC)=CC=C2CC1N(C(=O)C=1C(=CC=CC=1)C=1C=CC=CC=1)CC1=CC=CC=C1 QRDNALXWVVNNJN-UHFFFAOYSA-N 0.000 claims 1
- OBYRAAASBRKSDZ-UHFFFAOYSA-N n-benzyl-n-(5-methyl-2,3-dihydro-1h-inden-2-yl)-2-phenylbenzamide Chemical compound C1C2=CC(C)=CC=C2CC1N(C(=O)C=1C(=CC=CC=1)C=1C=CC=CC=1)CC1=CC=CC=C1 OBYRAAASBRKSDZ-UHFFFAOYSA-N 0.000 claims 1
- OFLVRSQNMRIBAL-HEVIKAOCSA-N n-benzyl-n-[(1s,2s)-2-[4-(2-methoxyphenyl)piperazin-1-yl]cyclohexyl]-2-phenylbenzamide Chemical compound COC1=CC=CC=C1N1CCN([C@@H]2[C@H](CCCC2)N(CC=2C=CC=CC=2)C(=O)C=2C(=CC=CC=2)C=2C=CC=CC=2)CC1 OFLVRSQNMRIBAL-HEVIKAOCSA-N 0.000 claims 1
- IGCIKCBYPISXOA-UHFFFAOYSA-N n-benzyl-n-[(2-chloro-4-hydroxyphenyl)methyl]naphthalene-1-carboxamide Chemical compound ClC1=CC(O)=CC=C1CN(C(=O)C=1C2=CC=CC=C2C=CC=1)CC1=CC=CC=C1 IGCIKCBYPISXOA-UHFFFAOYSA-N 0.000 claims 1
- SNVNACAFPIMHOW-UHFFFAOYSA-N n-benzyl-n-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2-methoxynaphthalene-1-carboxamide Chemical compound COC1=CC=C2C=CC=CC2=C1C(=O)N(CC=1C=C(C)C(O)=C(C)C=1)CC1=CC=CC=C1 SNVNACAFPIMHOW-UHFFFAOYSA-N 0.000 claims 1
- WELAEGASBDFQDI-UHFFFAOYSA-N n-benzyl-n-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2-phenylbenzamide Chemical compound CC1=C(O)C(C)=CC(CN(CC=2C=CC=CC=2)C(=O)C=2C(=CC=CC=2)C=2C=CC=CC=2)=C1 WELAEGASBDFQDI-UHFFFAOYSA-N 0.000 claims 1
- HRMLWXPVCDGEPM-UHFFFAOYSA-N n-benzyl-n-[1-(4-methoxyphenyl)propan-2-yl]-2-(4-methylphenyl)benzamide Chemical compound C1=CC(OC)=CC=C1CC(C)N(C(=O)C=1C(=CC=CC=1)C=1C=CC(C)=CC=1)CC1=CC=CC=C1 HRMLWXPVCDGEPM-UHFFFAOYSA-N 0.000 claims 1
- PVXAMERNYKMIJX-UHFFFAOYSA-N n-benzyl-n-[[4-(difluoromethoxy)phenyl]methyl]-2-phenylbenzamide Chemical compound C1=CC(OC(F)F)=CC=C1CN(C(=O)C=1C(=CC=CC=1)C=1C=CC=CC=1)CC1=CC=CC=C1 PVXAMERNYKMIJX-UHFFFAOYSA-N 0.000 claims 1
- 102000005962 receptors Human genes 0.000 abstract description 53
- 108020003175 receptors Proteins 0.000 abstract description 53
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 23
- 201000010099 disease Diseases 0.000 abstract description 17
- 239000003446 ligand Substances 0.000 abstract description 11
- 230000004913 activation Effects 0.000 abstract description 7
- 244000144972 livestock Species 0.000 abstract description 7
- 238000002474 experimental method Methods 0.000 abstract description 4
- 230000004807 localization Effects 0.000 abstract description 3
- 230000001575 pathological effect Effects 0.000 abstract description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 50
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 46
- 239000000243 solution Substances 0.000 description 44
- 238000002360 preparation method Methods 0.000 description 31
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- 239000005557 antagonist Substances 0.000 description 23
- 125000004432 carbon atom Chemical group C* 0.000 description 22
- XOFLBQFBSOEHOG-UUOKFMHZSA-N γS-GTP Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=S)[C@@H](O)[C@H]1O XOFLBQFBSOEHOG-UUOKFMHZSA-N 0.000 description 22
- 235000019439 ethyl acetate Nutrition 0.000 description 17
- 238000006243 chemical reaction Methods 0.000 description 16
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 239000000523 sample Substances 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 13
- 208000015181 infectious disease Diseases 0.000 description 13
- 239000012528 membrane Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 12
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 12
- 239000012267 brine Substances 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 230000004044 response Effects 0.000 description 12
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 12
- 239000000725 suspension Substances 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- 125000002252 acyl group Chemical group 0.000 description 11
- 239000003795 chemical substances by application Substances 0.000 description 11
- 238000009472 formulation Methods 0.000 description 11
- 210000000440 neutrophil Anatomy 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- 238000011282 treatment Methods 0.000 description 11
- 241000701447 unidentified baculovirus Species 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 10
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 10
- 238000003653 radioligand binding assay Methods 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 229940044551 receptor antagonist Drugs 0.000 description 10
- 239000002464 receptor antagonist Substances 0.000 description 10
- 238000003786 synthesis reaction Methods 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 101000867983 Homo sapiens C5a anaphylatoxin chemotactic receptor 1 Proteins 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 9
- 102000056190 human C5AR1 Human genes 0.000 description 9
- 239000002609 medium Substances 0.000 description 9
- 238000011534 incubation Methods 0.000 description 8
- 239000012071 phase Substances 0.000 description 8
- 238000000746 purification Methods 0.000 description 8
- 230000002829 reductive effect Effects 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 208000024891 symptom Diseases 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 241000282412 Homo Species 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 241000288906 Primates Species 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 241000700605 Viruses Species 0.000 description 7
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 7
- 239000011575 calcium Substances 0.000 description 7
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 7
- 239000003814 drug Substances 0.000 description 7
- 239000008188 pellet Substances 0.000 description 7
- 238000010898 silica gel chromatography Methods 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- 210000001519 tissue Anatomy 0.000 description 7
- 108010039627 Aprotinin Proteins 0.000 description 6
- 101000693922 Bos taurus Albumin Proteins 0.000 description 6
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 6
- 241000282472 Canis lupus familiaris Species 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 6
- 125000004423 acyloxy group Chemical group 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 229960004405 aprotinin Drugs 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 150000004665 fatty acids Chemical class 0.000 description 6
- 239000000796 flavoring agent Substances 0.000 description 6
- ZPNFWUPYTFPOJU-LPYSRVMUSA-N iniprol Chemical compound C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@H]2CSSC[C@H]3C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC=4C=CC=CC=4)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=4C=CC=CC=4)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC2=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC=2C=CC=CC=2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]2N(CCC2)C(=O)[C@@H](N)CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N2[C@@H](CCC2)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N3)C(=O)NCC(=O)NCC(=O)N[C@@H](C)C(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H](C(=O)N1)C(C)C)[C@@H](C)O)[C@@H](C)CC)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 ZPNFWUPYTFPOJU-LPYSRVMUSA-N 0.000 description 6
- 239000012194 insect media Substances 0.000 description 6
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 230000007935 neutral effect Effects 0.000 description 6
- 239000003755 preservative agent Substances 0.000 description 6
- 238000001525 receptor binding assay Methods 0.000 description 6
- 229940075993 receptor modulator Drugs 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 241000894007 species Species 0.000 description 6
- 238000006467 substitution reaction Methods 0.000 description 6
- 229910052722 tritium Inorganic materials 0.000 description 6
- 108010001478 Bacitracin Proteins 0.000 description 5
- 239000005711 Benzoic acid Substances 0.000 description 5
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- 102000004190 Enzymes Human genes 0.000 description 5
- 108090000790 Enzymes Proteins 0.000 description 5
- 206010061218 Inflammation Diseases 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 5
- 230000003321 amplification Effects 0.000 description 5
- 238000000376 autoradiography Methods 0.000 description 5
- 229960003071 bacitracin Drugs 0.000 description 5
- 229930184125 bacitracin Natural products 0.000 description 5
- CLKOFPXJLQSYAH-ABRJDSQDSA-N bacitracin A Chemical compound C1SC([C@@H](N)[C@@H](C)CC)=N[C@@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]1C(=O)N[C@H](CCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CC=2N=CNC=2)C(=O)N[C@H](CC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)NCCCC1 CLKOFPXJLQSYAH-ABRJDSQDSA-N 0.000 description 5
- 235000010233 benzoic acid Nutrition 0.000 description 5
- 229910052791 calcium Inorganic materials 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 239000007859 condensation product Substances 0.000 description 5
- 208000035475 disorder Diseases 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 239000012091 fetal bovine serum Substances 0.000 description 5
- 235000013355 food flavoring agent Nutrition 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 230000002757 inflammatory effect Effects 0.000 description 5
- 230000028709 inflammatory response Effects 0.000 description 5
- 239000002480 mineral oil Substances 0.000 description 5
- 235000010446 mineral oil Nutrition 0.000 description 5
- 238000003199 nucleic acid amplification method Methods 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 239000004031 partial agonist Substances 0.000 description 5
- 125000006187 phenyl benzyl group Chemical group 0.000 description 5
- 239000002287 radioligand Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000000375 suspending agent Substances 0.000 description 5
- 239000003765 sweetening agent Substances 0.000 description 5
- SXPBNKRSGVLWJQ-UHFFFAOYSA-N 2-methoxynaphthalene-1-carbonyl chloride Chemical compound C1=CC=CC2=C(C(Cl)=O)C(OC)=CC=C21 SXPBNKRSGVLWJQ-UHFFFAOYSA-N 0.000 description 4
- PGLLLRXIMBKIMY-UHFFFAOYSA-N 4-bromo-1-methyl-5-propan-2-ylindazole Chemical compound CC(C)C1=CC=C2N(C)N=CC2=C1Br PGLLLRXIMBKIMY-UHFFFAOYSA-N 0.000 description 4
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- 208000023275 Autoimmune disease Diseases 0.000 description 4
- 241000283690 Bos taurus Species 0.000 description 4
- 0 CC(C1)C1([C@]1(C)C=CC)*1(C)NC Chemical compound CC(C1)C1([C@]1(C)C=CC)*1(C)NC 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- 241000282326 Felis catus Species 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 229930006000 Sucrose Natural products 0.000 description 4
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 4
- 150000005215 alkyl ethers Chemical class 0.000 description 4
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 4
- 125000000304 alkynyl group Chemical group 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000007900 aqueous suspension Substances 0.000 description 4
- 125000004104 aryloxy group Chemical group 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000006285 cell suspension Substances 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 230000007423 decrease Effects 0.000 description 4
- 238000001514 detection method Methods 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- 235000003599 food sweetener Nutrition 0.000 description 4
- 230000004054 inflammatory process Effects 0.000 description 4
- 238000001990 intravenous administration Methods 0.000 description 4
- 229940125425 inverse agonist Drugs 0.000 description 4
- 210000004185 liver Anatomy 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 210000000056 organ Anatomy 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 4
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 108090000765 processed proteins & peptides Proteins 0.000 description 4
- 235000018102 proteins Nutrition 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- 150000003384 small molecules Chemical class 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000005720 sucrose Substances 0.000 description 4
- 239000006228 supernatant Substances 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 4
- 230000002792 vascular Effects 0.000 description 4
- 239000000080 wetting agent Substances 0.000 description 4
- NRIYPIBRPGAWDD-UHFFFAOYSA-N (5-methylthiophen-2-yl)boronic acid Chemical compound CC1=CC=C(B(O)O)S1 NRIYPIBRPGAWDD-UHFFFAOYSA-N 0.000 description 3
- FWLWTILKTABGKQ-UHFFFAOYSA-N 1-(bromomethyl)-3-methylbenzene Chemical compound CC1=CC=CC(CBr)=C1 FWLWTILKTABGKQ-UHFFFAOYSA-N 0.000 description 3
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 3
- DVCLJDAZHYRZHZ-UHFFFAOYSA-N 4-bromo-5-methyl-1h-indole Chemical compound CC1=CC=C2NC=CC2=C1Br DVCLJDAZHYRZHZ-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 108010017384 Blood Proteins Proteins 0.000 description 3
- 102000004506 Blood Proteins Human genes 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 102000015554 Dopamine receptor Human genes 0.000 description 3
- 108050004812 Dopamine receptor Proteins 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- 206010018364 Glomerulonephritis Diseases 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 102000029828 Melanin-concentrating hormone receptor Human genes 0.000 description 3
- 108010047068 Melanin-concentrating hormone receptor Proteins 0.000 description 3
- 101710151321 Melanostatin Proteins 0.000 description 3
- 102400000064 Neuropeptide Y Human genes 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 241000283984 Rodentia Species 0.000 description 3
- 229910004298 SiO 2 Inorganic materials 0.000 description 3
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000005360 alkyl sulfoxide group Chemical group 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 125000002619 bicyclic group Chemical group 0.000 description 3
- 239000012148 binding buffer Substances 0.000 description 3
- 210000001124 body fluid Anatomy 0.000 description 3
- 239000010839 body fluid Substances 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 210000004556 brain Anatomy 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000003651 drinking water Substances 0.000 description 3
- 235000020188 drinking water Nutrition 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- FBPFZTCFMRRESA-UHFFFAOYSA-N hexane-1,2,3,4,5,6-hexol Chemical compound OCC(O)C(O)C(O)C(O)CO FBPFZTCFMRRESA-UHFFFAOYSA-N 0.000 description 3
- 150000004677 hydrates Chemical class 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 238000002513 implantation Methods 0.000 description 3
- 238000000099 in vitro assay Methods 0.000 description 3
- 208000027866 inflammatory disease Diseases 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229940057995 liquid paraffin Drugs 0.000 description 3
- 238000004949 mass spectrometry Methods 0.000 description 3
- 239000002207 metabolite Substances 0.000 description 3
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- WTKSWRHPZRVBTG-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-1-methyl-n-[(4-methylphenyl)methyl]-5-propan-2-ylindazole-4-carboxamide Chemical compound CC(C)C1=CC=C2N(C)N=CC2=C1C(=O)N(C1CC2=CC=CC=C2C1)CC1=CC=C(C)C=C1 WTKSWRHPZRVBTG-UHFFFAOYSA-N 0.000 description 3
- 208000004235 neutropenia Diseases 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 230000009871 nonspecific binding Effects 0.000 description 3
- 239000004006 olive oil Substances 0.000 description 3
- 235000008390 olive oil Nutrition 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 230000036961 partial effect Effects 0.000 description 3
- 239000002953 phosphate buffered saline Substances 0.000 description 3
- 230000036470 plasma concentration Effects 0.000 description 3
- 238000002600 positron emission tomography Methods 0.000 description 3
- 102000004196 processed proteins & peptides Human genes 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 230000019254 respiratory burst Effects 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- 238000010189 synthetic method Methods 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 235000015112 vegetable and seed oil Nutrition 0.000 description 3
- 239000008158 vegetable oil Substances 0.000 description 3
- 239000003643 water by type Substances 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 2
- QWHXRLJLUYODAN-UHFFFAOYSA-N 1,5-dimethylindole-4-carboxylic acid Chemical compound CC1=CC=C2N(C)C=CC2=C1C(O)=O QWHXRLJLUYODAN-UHFFFAOYSA-N 0.000 description 2
- DAIQAGJNTBTHLD-UHFFFAOYSA-N 1-methyl-5-propan-2-ylindazole-4-carbonyl chloride Chemical compound CC(C)C1=CC=C2N(C)N=CC2=C1C(Cl)=O DAIQAGJNTBTHLD-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- KHZIUZUDLBDCMN-UHFFFAOYSA-N 2-bromo-1,3-dimethyl-4-nitrobenzene Chemical compound CC1=CC=C([N+]([O-])=O)C(C)=C1Br KHZIUZUDLBDCMN-UHFFFAOYSA-N 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- OSTYZAHQVPMQHI-UHFFFAOYSA-N 2-methoxynaphthalene-1-carboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(OC)=CC=C21 OSTYZAHQVPMQHI-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- HNZIFVCVIVUGIK-UHFFFAOYSA-N 4-bromo-1,5-dimethylindole Chemical compound CC1=CC=C2N(C)C=CC2=C1Br HNZIFVCVIVUGIK-UHFFFAOYSA-N 0.000 description 2
- YKZRMRNUPRUYCW-UHFFFAOYSA-N 4-bromo-5-propan-2-yl-1h-indazole Chemical compound CC(C)C1=CC=C2NN=CC2=C1Br YKZRMRNUPRUYCW-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 2
- 208000024827 Alzheimer disease Diseases 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 108010089414 Anaphylatoxins Proteins 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 description 2
- 125000004649 C2-C8 alkynyl group Chemical group 0.000 description 2
- 101150073986 C3AR1 gene Proteins 0.000 description 2
- 108010078546 Complement C5a Proteins 0.000 description 2
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 2
- 229920002307 Dextran Polymers 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 241000283086 Equidae Species 0.000 description 2
- OZLGRUXZXMRXGP-UHFFFAOYSA-N Fluo-3 Chemical compound CC1=CC=C(N(CC(O)=O)CC(O)=O)C(OCCOC=2C(=CC=C(C=2)C2=C3C=C(Cl)C(=O)C=C3OC3=CC(O)=C(Cl)C=C32)N(CC(O)=O)CC(O)=O)=C1 OZLGRUXZXMRXGP-UHFFFAOYSA-N 0.000 description 2
- 108091006027 G proteins Proteins 0.000 description 2
- 102000003688 G-Protein-Coupled Receptors Human genes 0.000 description 2
- 108090000045 G-Protein-Coupled Receptors Proteins 0.000 description 2
- 102000030782 GTP binding Human genes 0.000 description 2
- 108091000058 GTP-Binding Proteins 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 206010019842 Hepatomegaly Diseases 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 108090001090 Lectins Proteins 0.000 description 2
- 102000004856 Lectins Human genes 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 208000010718 Multiple Organ Failure Diseases 0.000 description 2
- 108010008211 N-Formylmethionine Leucyl-Phenylalanine Proteins 0.000 description 2
- PRQROPMIIGLWRP-UHFFFAOYSA-N N-formyl-methionyl-leucyl-phenylalanin Chemical compound CSCCC(NC=O)C(=O)NC(CC(C)C)C(=O)NC(C(O)=O)CC1=CC=CC=C1 PRQROPMIIGLWRP-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 235000019483 Peanut oil Nutrition 0.000 description 2
- 241001494479 Pecora Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920002873 Polyethylenimine Polymers 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 241000282887 Suidae Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 206010051379 Systemic Inflammatory Response Syndrome Diseases 0.000 description 2
- 108010025083 TRPV1 receptor Proteins 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical group C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000006177 alkyl benzyl group Chemical group 0.000 description 2
- 125000005011 alkyl ether group Chemical group 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 229960005070 ascorbic acid Drugs 0.000 description 2
- 239000012131 assay buffer Substances 0.000 description 2
- 230000001363 autoimmune Effects 0.000 description 2
- 230000008499 blood brain barrier function Effects 0.000 description 2
- 210000001218 blood-brain barrier Anatomy 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 229910000389 calcium phosphate Inorganic materials 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 230000034196 cell chemotaxis Effects 0.000 description 2
- 239000013553 cell monolayer Substances 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000002975 chemoattractant Substances 0.000 description 2
- 230000003399 chemotactic effect Effects 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 230000024203 complement activation Effects 0.000 description 2
- 239000002299 complementary DNA Substances 0.000 description 2
- 238000002591 computed tomography Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 231100000135 cytotoxicity Toxicity 0.000 description 2
- 230000003013 cytotoxicity Effects 0.000 description 2
- 229910052805 deuterium Inorganic materials 0.000 description 2
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000037213 diet Effects 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000013604 expression vector Substances 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- GNBHRKFJIUUOQI-UHFFFAOYSA-N fluorescein Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 GNBHRKFJIUUOQI-UHFFFAOYSA-N 0.000 description 2
- 238000001943 fluorescence-activated cell sorting Methods 0.000 description 2
- 239000007850 fluorescent dye Substances 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 238000002825 functional assay Methods 0.000 description 2
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 2
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 2
- RWSXRVCMGQZWBV-WDSKDSINSA-N glutathione Chemical compound OC(=O)[C@@H](N)CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O RWSXRVCMGQZWBV-WDSKDSINSA-N 0.000 description 2
- 239000001963 growth medium Substances 0.000 description 2
- 239000007902 hard capsule Substances 0.000 description 2
- 210000003494 hepatocyte Anatomy 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 238000000265 homogenisation Methods 0.000 description 2
- 239000011539 homogenization buffer Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000003384 imaging method Methods 0.000 description 2
- 210000004969 inflammatory cell Anatomy 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000002523 lectin Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000013507 mapping Methods 0.000 description 2
- 239000003550 marker Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 230000003228 microsomal effect Effects 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 208000029744 multiple organ dysfunction syndrome Diseases 0.000 description 2
- CUBMNQRGAYKFKH-UHFFFAOYSA-N n-benzyl-2,3-dihydro-1h-inden-2-amine Chemical compound C1C2=CC=CC=C2CC1NCC1=CC=CC=C1 CUBMNQRGAYKFKH-UHFFFAOYSA-N 0.000 description 2
- 201000008383 nephritis Diseases 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000000346 nonvolatile oil Substances 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 125000000160 oxazolidinyl group Chemical group 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000000312 peanut oil Substances 0.000 description 2
- 230000010412 perfusion Effects 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 2
- YBYRMVIVWMBXKQ-UHFFFAOYSA-N phenylmethanesulfonyl fluoride Chemical compound FS(=O)(=O)CC1=CC=CC=C1 YBYRMVIVWMBXKQ-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 239000013641 positive control Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 238000009738 saturating Methods 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 238000002603 single-photon emission computed tomography Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000015424 sodium Nutrition 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000007901 soft capsule Substances 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 238000004611 spectroscopical analysis Methods 0.000 description 2
- 238000012289 standard assay Methods 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 238000013268 sustained release Methods 0.000 description 2
- 239000012730 sustained-release form Substances 0.000 description 2
- 208000011580 syndromic disease Diseases 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- 238000002054 transplantation Methods 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- 238000003828 vacuum filtration Methods 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 239000011534 wash buffer Substances 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- MZOFCQQQCNRIBI-VMXHOPILSA-N (3s)-4-[[(2s)-1-[[(2s)-1-[[(1s)-1-carboxy-2-hydroxyethyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-[[2-[[(2s)-2,6-diaminohexanoyl]amino]acetyl]amino]-4-oxobutanoic acid Chemical compound OC[C@@H](C(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@@H](N)CCCCN MZOFCQQQCNRIBI-VMXHOPILSA-N 0.000 description 1
- 125000004738 (C1-C6) alkyl sulfinyl group Chemical group 0.000 description 1
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 description 1
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N (e)-2-hydroxybut-2-enedioic acid Chemical compound OC(=O)\C=C(\O)C(O)=O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- PZNYKBLADPHGMI-UHFFFAOYSA-N 1,5-dimethylindole Chemical compound CC1=CC=C2N(C)C=CC2=C1 PZNYKBLADPHGMI-UHFFFAOYSA-N 0.000 description 1
- WGVYCXYGPNNUQA-UHFFFAOYSA-N 1-(bromomethyl)-2-methylbenzene Chemical compound CC1=CC=CC=C1CBr WGVYCXYGPNNUQA-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- CMKNHQQTSYXVPO-UHFFFAOYSA-N 1-methyl-5-propan-2-ylindazole-4-carboxylic acid Chemical compound CC(C)C1=CC=C2N(C)N=CC2=C1C(O)=O CMKNHQQTSYXVPO-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005955 1H-indazolyl group Chemical group 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- LMHHFZAXSANGGM-UHFFFAOYSA-N 2-aminoindane Chemical compound C1=CC=C2CC(N)CC2=C1 LMHHFZAXSANGGM-UHFFFAOYSA-N 0.000 description 1
- HTFXWAOSQODIBI-UHFFFAOYSA-N 2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine Chemical compound C1C2=CC=NC=C2CN1CC1=CC=CC=C1 HTFXWAOSQODIBI-UHFFFAOYSA-N 0.000 description 1
- MYMYVYZLMUEVED-UHFFFAOYSA-N 2-bromo-1,3-dimethylbenzene Chemical group CC1=CC=CC(C)=C1Br MYMYVYZLMUEVED-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 1
- LLVYMVJLXNNRND-UHFFFAOYSA-N 2-iodo-6-methylbenzoic acid Chemical compound CC1=CC=CC(I)=C1C(O)=O LLVYMVJLXNNRND-UHFFFAOYSA-N 0.000 description 1
- CJNZAXGUTKBIHP-UHFFFAOYSA-N 2-iodobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1I CJNZAXGUTKBIHP-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- GTKIGDZXPDCIKR-UHFFFAOYSA-N 2-phenylbenzamide Chemical compound NC(=O)C1=CC=CC=C1C1=CC=CC=C1 GTKIGDZXPDCIKR-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- GNWTWXOZRSBCOZ-UHFFFAOYSA-N 2-pyrrol-1-ylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1N1C=CC=C1 GNWTWXOZRSBCOZ-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000005925 3-methylpentyloxy group Chemical group 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- HTMGQIXFZMZZKD-UHFFFAOYSA-N 5,6,7,8-tetrahydroisoquinoline Chemical group N1=CC=C2CCCCC2=C1 HTMGQIXFZMZZKD-UHFFFAOYSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- 125000005330 8 membered heterocyclic group Chemical group 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- 230000002407 ATP formation Effects 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 238000010953 Ames test Methods 0.000 description 1
- 231100000039 Ames test Toxicity 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 235000003911 Arachis Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 238000009010 Bradford assay Methods 0.000 description 1
- 102000010183 Bradykinin receptor Human genes 0.000 description 1
- 108050001736 Bradykinin receptor Proteins 0.000 description 1
- 206010006482 Bronchospasm Diseases 0.000 description 1
- 125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 208000005623 Carcinogenesis Diseases 0.000 description 1
- 102000014914 Carrier Proteins Human genes 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 108010028773 Complement C5 Proteins 0.000 description 1
- 108010069112 Complement System Proteins Proteins 0.000 description 1
- 102000000989 Complement System Proteins Human genes 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 206010011091 Coronary artery thrombosis Diseases 0.000 description 1
- 108010056643 Corticotropin-Releasing Hormone Receptors Proteins 0.000 description 1
- 102100038018 Corticotropin-releasing factor receptor 1 Human genes 0.000 description 1
- 208000011231 Crohn disease Diseases 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 108010074922 Cytochrome P-450 CYP1A2 Proteins 0.000 description 1
- 108010026925 Cytochrome P-450 CYP2C19 Proteins 0.000 description 1
- 108010000543 Cytochrome P-450 CYP2C9 Proteins 0.000 description 1
- 108010001237 Cytochrome P-450 CYP2D6 Proteins 0.000 description 1
- 108010001202 Cytochrome P-450 CYP2E1 Proteins 0.000 description 1
- 108010081668 Cytochrome P-450 CYP3A Proteins 0.000 description 1
- 108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 1
- 102000002004 Cytochrome P-450 Enzyme System Human genes 0.000 description 1
- 102100026533 Cytochrome P450 1A2 Human genes 0.000 description 1
- 102100036194 Cytochrome P450 2A6 Human genes 0.000 description 1
- 102100029363 Cytochrome P450 2C19 Human genes 0.000 description 1
- 102100029358 Cytochrome P450 2C9 Human genes 0.000 description 1
- 102100021704 Cytochrome P450 2D6 Human genes 0.000 description 1
- 102100024889 Cytochrome P450 2E1 Human genes 0.000 description 1
- 102100039205 Cytochrome P450 3A4 Human genes 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- 108020004414 DNA Proteins 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 206010012689 Diabetic retinopathy Diseases 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 244000165918 Eucalyptus papuana Species 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 102000005915 GABA Receptors Human genes 0.000 description 1
- 108010005551 GABA Receptors Proteins 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 108010024636 Glutathione Proteins 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 239000007995 HEPES buffer Substances 0.000 description 1
- 241000162682 Heterogen Species 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 102000000543 Histamine Receptors Human genes 0.000 description 1
- 108010002059 Histamine Receptors Proteins 0.000 description 1
- 101000878678 Homo sapiens Corticotropin-releasing factor receptor 1 Proteins 0.000 description 1
- 101000875170 Homo sapiens Cytochrome P450 2A6 Proteins 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 108010002352 Interleukin-1 Proteins 0.000 description 1
- 102000000589 Interleukin-1 Human genes 0.000 description 1
- 108090001005 Interleukin-6 Proteins 0.000 description 1
- 102000004889 Interleukin-6 Human genes 0.000 description 1
- 102000004890 Interleukin-8 Human genes 0.000 description 1
- 108090001007 Interleukin-8 Proteins 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- GDBQQVLCIARPGH-UHFFFAOYSA-N Leupeptin Natural products CC(C)CC(NC(C)=O)C(=O)NC(CC(C)C)C(=O)NC(C=O)CCCN=C(N)N GDBQQVLCIARPGH-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 208000004852 Lung Injury Diseases 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 102000018697 Membrane Proteins Human genes 0.000 description 1
- 108010052285 Membrane Proteins Proteins 0.000 description 1
- 102000016193 Metabotropic glutamate receptors Human genes 0.000 description 1
- 108010010914 Metabotropic glutamate receptors Proteins 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 102000014415 Muscarinic acetylcholine receptor Human genes 0.000 description 1
- 108050003473 Muscarinic acetylcholine receptor Proteins 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- ZKGNPQKYVKXMGJ-UHFFFAOYSA-N N,N-dimethylacetamide Chemical compound CN(C)C(C)=O.CN(C)C(C)=O ZKGNPQKYVKXMGJ-UHFFFAOYSA-N 0.000 description 1
- HUTWYDTXGLBWOQ-UHFFFAOYSA-N N-(2,3-dihydro-1H-inden-2-yl)-N-[(3-methylphenyl)methyl]-2-pyrrol-1-ylbenzamide 2-pyrrol-1-ylbenzoic acid Chemical compound N1(C=CC=C1)C1=C(C(=O)O)C=CC=C1.C1C(CC2=CC=CC=C12)N(C(C1=C(C=CC=C1)N1C=CC=C1)=O)CC1=CC(=CC=C1)C HUTWYDTXGLBWOQ-UHFFFAOYSA-N 0.000 description 1
- 208000001738 Nervous System Trauma Diseases 0.000 description 1
- 102000009493 Neurokinin receptors Human genes 0.000 description 1
- 108050000302 Neurokinin receptors Proteins 0.000 description 1
- 102000004108 Neurotransmitter Receptors Human genes 0.000 description 1
- 108090000590 Neurotransmitter Receptors Proteins 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 108010058846 Ovalbumin Proteins 0.000 description 1
- 206010034277 Pemphigoid Diseases 0.000 description 1
- 241000721454 Pemphigus Species 0.000 description 1
- 206010057249 Phagocytosis Diseases 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 108010039918 Polylysine Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010037394 Pulmonary haemorrhage Diseases 0.000 description 1
- 239000012980 RPMI-1640 medium Substances 0.000 description 1
- 108070000025 Releasing hormones receptors Proteins 0.000 description 1
- 102000016983 Releasing hormones receptors Human genes 0.000 description 1
- 206010038563 Reocclusion Diseases 0.000 description 1
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 101000948733 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) Probable phospholipid translocase non-catalytic subunit CRF1 Proteins 0.000 description 1
- 206010039710 Scleroderma Diseases 0.000 description 1
- 206010040047 Sepsis Diseases 0.000 description 1
- 206010040070 Septic Shock Diseases 0.000 description 1
- 108010071390 Serum Albumin Proteins 0.000 description 1
- 102000007562 Serum Albumin Human genes 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 238000006619 Stille reaction Methods 0.000 description 1
- 238000000692 Student's t-test Methods 0.000 description 1
- 238000006069 Suzuki reaction reaction Methods 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- OXMKNUCRSLQWMI-UHFFFAOYSA-N Tetrahydropyridone Natural products O=C1CCCC=N1 OXMKNUCRSLQWMI-UHFFFAOYSA-N 0.000 description 1
- 102000003911 Thyrotropin Receptors Human genes 0.000 description 1
- 206010052779 Transplant rejections Diseases 0.000 description 1
- 206010069363 Traumatic lung injury Diseases 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 1
- 102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 description 1
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 1
- 206010053648 Vascular occlusion Diseases 0.000 description 1
- 206010047115 Vasculitis Diseases 0.000 description 1
- 102000012088 Vasoactive Intestinal Peptide Receptors Human genes 0.000 description 1
- 108010075974 Vasoactive Intestinal Peptide Receptors Proteins 0.000 description 1
- WERKSKAQRVDLDW-ANOHMWSOSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO WERKSKAQRVDLDW-ANOHMWSOSA-N 0.000 description 1
- 230000001594 aberrant effect Effects 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000003377 acid catalyst Chemical group 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 238000001467 acupuncture Methods 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 125000005596 alkyl carboxamido group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 102000004305 alpha Adrenergic Receptors Human genes 0.000 description 1
- 108090000861 alpha Adrenergic Receptors Proteins 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000012805 animal sample Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 238000011861 anti-inflammatory therapy Methods 0.000 description 1
- 229940124346 antiarthritic agent Drugs 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 239000003435 antirheumatic agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 239000002473 artificial blood Substances 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 150000001543 aryl boronic acids Chemical class 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 210000003651 basophil Anatomy 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000005512 benztetrazolyl group Chemical group 0.000 description 1
- 102000012740 beta Adrenergic Receptors Human genes 0.000 description 1
- 108010079452 beta Adrenergic Receptors Proteins 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 150000005347 biaryls Chemical group 0.000 description 1
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 108091008324 binding proteins Proteins 0.000 description 1
- 230000000975 bioactive effect Effects 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 230000007885 bronchoconstriction Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007975 buffered saline Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- BQRGNLJZBFXNCZ-UHFFFAOYSA-N calcein am Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC(CN(CC(=O)OCOC(C)=O)CC(=O)OCOC(C)=O)=C(OC(C)=O)C=C1OC1=C2C=C(CN(CC(=O)OCOC(C)=O)CC(=O)OCOC(=O)C)C(OC(C)=O)=C1 BQRGNLJZBFXNCZ-UHFFFAOYSA-N 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 230000003185 calcium uptake Effects 0.000 description 1
- 230000036952 cancer formation Effects 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 125000004623 carbolinyl group Chemical group 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 231100000504 carcinogenesis Toxicity 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000005779 cell damage Effects 0.000 description 1
- 208000037887 cell injury Diseases 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 238000003320 cell separation method Methods 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 208000015114 central nervous system disease Diseases 0.000 description 1
- 210000001175 cerebrospinal fluid Anatomy 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 210000004978 chinese hamster ovary cell Anatomy 0.000 description 1
- 238000004296 chiral HPLC Methods 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000013599 cloning vector Substances 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 208000002528 coronary thrombosis Diseases 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000012228 culture supernatant Substances 0.000 description 1
- 210000004748 cultured cell Anatomy 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000007405 data analysis Methods 0.000 description 1
- 238000013480 data collection Methods 0.000 description 1
- 125000004856 decahydroquinolinyl group Chemical group N1(CCCC2CCCCC12)* 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 201000001981 dermatomyositis Diseases 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000005363 dialkylsulfonamide group Chemical group 0.000 description 1
- 238000000502 dialysis Methods 0.000 description 1
- PXOIIZOTNBIMPZ-UHFFFAOYSA-N dichloromethane;oxalyl dichloride Chemical compound ClCCl.ClC(=O)C(Cl)=O PXOIIZOTNBIMPZ-UHFFFAOYSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 230000036267 drug metabolism Effects 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 238000002565 electrocardiography Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 210000003979 eosinophil Anatomy 0.000 description 1
- 210000003013 erythroid precursor cell Anatomy 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-N ethanedisulfonic acid Chemical compound OS(=O)(=O)CCS(O)(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-N 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 210000003722 extracellular fluid Anatomy 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000001605 fetal effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 229960003180 glutathione Drugs 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 210000000224 granular leucocyte Anatomy 0.000 description 1
- 210000003714 granulocyte Anatomy 0.000 description 1
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical class O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 description 1
- 238000001631 haemodialysis Methods 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 210000003709 heart valve Anatomy 0.000 description 1
- 230000000322 hemodialysis Effects 0.000 description 1
- 230000002949 hemolytic effect Effects 0.000 description 1
- 239000002638 heterogeneous catalyst Chemical group 0.000 description 1
- 102000034345 heterotrimeric G proteins Human genes 0.000 description 1
- 108091006093 heterotrimeric G proteins Proteins 0.000 description 1
- 150000002402 hexoses Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000013537 high throughput screening Methods 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 208000026278 immune system disease Diseases 0.000 description 1
- 238000009169 immunotherapy Methods 0.000 description 1
- 125000004926 indolenyl group Chemical group 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000006301 indolyl methyl group Chemical group 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 102000002467 interleukin receptors Human genes 0.000 description 1
- 108010093036 interleukin receptors Proteins 0.000 description 1
- 102000010681 interleukin-8 receptors Human genes 0.000 description 1
- 108010038415 interleukin-8 receptors Proteins 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 238000007917 intracranial administration Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 208000002551 irritable bowel syndrome Diseases 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 208000028867 ischemia Diseases 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000005438 isoindazolyl group Chemical group 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 208000017169 kidney disease Diseases 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 230000011268 leukocyte chemotaxis Effects 0.000 description 1
- VNYSSYRCGWBHLG-AMOLWHMGSA-N leukotriene B4 Chemical compound CCCCC\C=C/C[C@@H](O)\C=C\C=C\C=C/[C@@H](O)CCCC(O)=O VNYSSYRCGWBHLG-AMOLWHMGSA-N 0.000 description 1
- 150000002617 leukotrienes Chemical class 0.000 description 1
- GDBQQVLCIARPGH-ULQDDVLXSA-N leupeptin Chemical compound CC(C)C[C@H](NC(C)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C=O)CCCN=C(N)N GDBQQVLCIARPGH-ULQDDVLXSA-N 0.000 description 1
- 108010052968 leupeptin Proteins 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 231100000515 lung injury Toxicity 0.000 description 1
- 206010025135 lupus erythematosus Diseases 0.000 description 1
- 210000004880 lymph fluid Anatomy 0.000 description 1
- 230000002132 lysosomal effect Effects 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- SNVLJLYUUXKWOJ-UHFFFAOYSA-N methylidenecarbene Chemical group C=[C] SNVLJLYUUXKWOJ-UHFFFAOYSA-N 0.000 description 1
- 239000011859 microparticle Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 244000309715 mini pig Species 0.000 description 1
- 239000003068 molecular probe Substances 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 210000001616 monocyte Anatomy 0.000 description 1
- 201000006417 multiple sclerosis Diseases 0.000 description 1
- 231100000150 mutagenicity / genotoxicity testing Toxicity 0.000 description 1
- 206010028417 myasthenia gravis Diseases 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- HXRAMSFGUAOAJR-UHFFFAOYSA-N n,n,n',n'-tetramethyl-1-[(2-methylpropan-2-yl)oxy]methanediamine Chemical compound CN(C)C(N(C)C)OC(C)(C)C HXRAMSFGUAOAJR-UHFFFAOYSA-N 0.000 description 1
- HRQJDEOSZHNOEV-UHFFFAOYSA-N n,n-dimethyl-4-[(4-propan-2-ylanilino)methyl]aniline Chemical compound C1=CC(C(C)C)=CC=C1NCC1=CC=C(N(C)C)C=C1 HRQJDEOSZHNOEV-UHFFFAOYSA-N 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- PUBLVNIUFCOQFU-UHFFFAOYSA-N n-(1,3-benzodioxol-5-ylmethyl)-1-phenylmethanamine Chemical compound C=1C=C2OCOC2=CC=1CNCC1=CC=CC=C1 PUBLVNIUFCOQFU-UHFFFAOYSA-N 0.000 description 1
- FOCIYMQPTAUNAM-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-yl)-1,5-dimethyl-n-[(4-methylphenyl)methyl]indole-4-carboxamide Chemical compound C1=CC(C)=CC=C1CN(C(=O)C=1C=2C=CN(C)C=2C=CC=1C)C1CC2=CC=CC=C2C1 FOCIYMQPTAUNAM-UHFFFAOYSA-N 0.000 description 1
- SSKBHGNADGHEHC-UHFFFAOYSA-N n-(4-methylphenyl)-2,3-dihydro-1h-inden-2-amine Chemical compound C1=CC(C)=CC=C1NC1CC2=CC=CC=C2C1 SSKBHGNADGHEHC-UHFFFAOYSA-N 0.000 description 1
- PATUSYFZGVUANO-UHFFFAOYSA-N n-[[4-(dimethylamino)phenyl]methyl]-1,5-dimethyl-n-(4-propan-2-ylphenyl)indole-4-carboxamide Chemical compound C1=CC(C(C)C)=CC=C1N(C(=O)C=1C=2C=CN(C)C=2C=CC=1C)CC1=CC=C(N(C)C)C=C1 PATUSYFZGVUANO-UHFFFAOYSA-N 0.000 description 1
- WPRUJSBIXXAWTC-UHFFFAOYSA-N n-[[4-(dimethylamino)phenyl]methyl]-1-methyl-5-propan-2-yl-n-(4-propan-2-ylphenyl)benzimidazole-4-carboxamide Chemical compound C1=CC(C(C)C)=CC=C1N(C(=O)C=1C=2N=CN(C)C=2C=CC=1C(C)C)CC1=CC=C(N(C)C)C=C1 WPRUJSBIXXAWTC-UHFFFAOYSA-N 0.000 description 1
- YFHNGNRDPNWOJA-UHFFFAOYSA-N n-[[4-(dimethylamino)phenyl]methyl]-1-methyl-5-propan-2-yl-n-(4-propan-2-ylphenyl)indazole-4-carboxamide Chemical compound C1=CC(C(C)C)=CC=C1N(C(=O)C=1C=2C=NN(C)C=2C=CC=1C(C)C)CC1=CC=C(N(C)C)C=C1 YFHNGNRDPNWOJA-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 208000028412 nervous system injury Diseases 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- PSACHCMMPFMFAJ-UHFFFAOYSA-N nmm n-methylmorpholine Chemical compound CN1CCOCC1.CN1CCOCC1 PSACHCMMPFMFAJ-UHFFFAOYSA-N 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- UMRZSTCPUPJPOJ-KNVOCYPGSA-N norbornane Chemical group C1C[C@H]2CC[C@@H]1C2 UMRZSTCPUPJPOJ-KNVOCYPGSA-N 0.000 description 1
- 238000002414 normal-phase solid-phase extraction Methods 0.000 description 1
- 210000004940 nucleus Anatomy 0.000 description 1
- GYCKQBWUSACYIF-UHFFFAOYSA-N o-hydroxybenzoic acid ethyl ester Natural products CCOC(=O)C1=CC=CC=C1O GYCKQBWUSACYIF-UHFFFAOYSA-N 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 125000004930 octahydroisoquinolinyl group Chemical group C1(NCCC2CCCC=C12)* 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 229940100692 oral suspension Drugs 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- 229940092253 ovalbumin Drugs 0.000 description 1
- 125000005882 oxadiazolinyl group Chemical group 0.000 description 1
- QNNHQVPFZIFNFK-UHFFFAOYSA-N oxazolo[4,5-b]pyridine Chemical compound C1=CC=C2OC=NC2=N1 QNNHQVPFZIFNFK-UHFFFAOYSA-N 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 102000014187 peptide receptors Human genes 0.000 description 1
- 108010011903 peptide receptors Proteins 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 230000008782 phagocytosis Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 1
- 229940068196 placebo Drugs 0.000 description 1
- 239000000902 placebo Substances 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 238000002616 plasmapheresis Methods 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000962 poly(amidoamine) Polymers 0.000 description 1
- 229920001606 poly(lactic acid-co-glycolic acid) Polymers 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000656 polylysine Polymers 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 150000004804 polysaccharides Chemical class 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 210000004206 promonocyte Anatomy 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 239000000700 radioactive tracer Substances 0.000 description 1
- 239000000018 receptor agonist Substances 0.000 description 1
- 229940044601 receptor agonist Drugs 0.000 description 1
- 238000003259 recombinant expression Methods 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000010410 reperfusion Effects 0.000 description 1
- 108091008146 restriction endonucleases Proteins 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000003345 scintillation counting Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003334 secondary amides Chemical class 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 230000036303 septic shock Effects 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 231100000188 sister chromatid exchange Toxicity 0.000 description 1
- 230000016160 smooth muscle contraction Effects 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910001467 sodium calcium phosphate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000003506 spasmogen Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000007619 statistical method Methods 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 238000002636 symptomatic treatment Methods 0.000 description 1
- 210000001179 synovial fluid Anatomy 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 210000001138 tear Anatomy 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 231100000378 teratogenic Toxicity 0.000 description 1
- 230000003390 teratogenic effect Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003511 tertiary amides Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- PHCBRBWANGJMHS-UHFFFAOYSA-J tetrasodium;disulfate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O PHCBRBWANGJMHS-UHFFFAOYSA-J 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 230000003582 thrombocytopenic effect Effects 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 230000007888 toxin activity Effects 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 238000001890 transfection Methods 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- 230000000472 traumatic effect Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 238000003211 trypan blue cell staining Methods 0.000 description 1
- 208000035408 type 1 diabetes mellitus 1 Diseases 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 208000021331 vascular occlusion disease Diseases 0.000 description 1
- 239000013598 vector Substances 0.000 description 1
- 230000002861 ventricular Effects 0.000 description 1
- 230000035899 viability Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Landscapes
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Pyrrole Compounds (AREA)
- Medicinal Preparation (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US36846202P | 2002-03-28 | 2002-03-28 | |
| US37215002A | 2002-12-04 | 2002-12-04 | |
| PCT/US2003/009045 WO2003082826A1 (en) | 2002-03-28 | 2003-03-25 | Substituted biaryl amides as c5a receptor modulators |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2006502095A true JP2006502095A (ja) | 2006-01-19 |
| JP2006502095A5 JP2006502095A5 (https=) | 2006-03-09 |
Family
ID=35798500
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2003580294A Withdrawn JP2006502095A (ja) | 2002-03-28 | 2003-03-25 | C5a受容体モジュレーターとしての置換ビアリールアミド |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JP2006502095A (https=) |
-
2003
- 2003-03-25 JP JP2003580294A patent/JP2006502095A/ja not_active Withdrawn
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP5260818B2 (ja) | 高親和性低分子C5a受容体調節物質 | |
| US6777422B2 (en) | Substituted tetrahydroisoquinolines as C5a receptor modulators | |
| EP1487796A1 (en) | Substituted biaryl amides as c5a receptor modulators | |
| US20110160187A1 (en) | 3-aryl-5,6-disubstituted pyridazines | |
| JP2008518014A (ja) | Cb1拮抗薬としてのジアリール尿素 | |
| US20070208048A1 (en) | New Aryl Imidazoles and Related Compounds as C5a Receptor Modulators | |
| US6723743B1 (en) | High affinity small molecule C5a receptor modulators | |
| US8007767B2 (en) | Amino methyl imidazoles and related compounds as C5a receptor modulators | |
| US7148225B2 (en) | Substituted biaryl amides as C5A receptor modulators | |
| WO2005007087A2 (en) | Substituted (heterocycloalkyl)methyl azole derivatives as c5a receptor modulators | |
| US7915288B2 (en) | 1-aryl-4-substituted isoquinolines | |
| US7271270B2 (en) | High affinity small molecule C5a receptor modulators | |
| JP2006502095A (ja) | C5a受容体モジュレーターとしての置換ビアリールアミド | |
| JP2011219476A (ja) | 高親和性低分子C5a受容体調節物質 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20060118 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20060118 |
|
| RD04 | Notification of resignation of power of attorney |
Free format text: JAPANESE INTERMEDIATE CODE: A7424 Effective date: 20060119 |
|
| A761 | Written withdrawal of application |
Free format text: JAPANESE INTERMEDIATE CODE: A761 Effective date: 20060405 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A821 Effective date: 20060405 |