JP2005529079A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2005529079A5 JP2005529079A5 JP2003572976A JP2003572976A JP2005529079A5 JP 2005529079 A5 JP2005529079 A5 JP 2005529079A5 JP 2003572976 A JP2003572976 A JP 2003572976A JP 2003572976 A JP2003572976 A JP 2003572976A JP 2005529079 A5 JP2005529079 A5 JP 2005529079A5
- Authority
- JP
- Japan
- Prior art keywords
- group
- atom
- hydrogen atom
- aryl
- aralkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 22
- 125000003118 aryl group Chemical group 0.000 claims description 16
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 125000002950 monocyclic group Chemical group 0.000 claims description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000003367 polycyclic group Chemical group 0.000 claims description 3
- 125000000027 (C1-C10) alkoxy group Chemical group 0.000 claims description 2
- 150000004677 hydrates Chemical class 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 230000003287 optical effect Effects 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 12
- 125000000217 alkyl group Chemical group 0.000 claims 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 8
- 229910052717 sulfur Inorganic materials 0.000 claims 8
- 125000003342 alkenyl group Chemical group 0.000 claims 5
- 125000005647 linker group Chemical group 0.000 claims 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 4
- 125000003545 alkoxy group Chemical group 0.000 claims 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 4
- 125000005842 heteroatom Chemical group 0.000 claims 4
- 125000000623 heterocyclic group Chemical group 0.000 claims 4
- 229910052760 oxygen Inorganic materials 0.000 claims 4
- 239000001301 oxygen Substances 0.000 claims 4
- 125000001424 substituent group Chemical group 0.000 claims 4
- 239000011593 sulfur Substances 0.000 claims 4
- 125000004434 sulfur atom Chemical group 0.000 claims 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 3
- 125000001589 carboacyl group Chemical group 0.000 claims 2
- 150000001721 carbon Chemical group 0.000 claims 2
- 150000001875 compounds Chemical class 0.000 claims 2
- 125000004475 heteroaralkyl group Chemical group 0.000 claims 2
- 125000001072 heteroaryl group Chemical group 0.000 claims 2
- 125000005223 heteroarylcarbonyl group Chemical group 0.000 claims 2
- 125000002256 xylenyl group Chemical group C1(C(C=CC=C1)C)(C)* 0.000 claims 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 230000002159 abnormal effect Effects 0.000 claims 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims 1
- 230000004663 cell proliferation Effects 0.000 claims 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims 1
- 201000010099 disease Diseases 0.000 claims 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 229930195733 hydrocarbon Natural products 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- -1 polycyclic hydrocarbon Chemical class 0.000 claims 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000004950 trifluoroalkyl group Chemical group 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
- FUCIBTODMLSEEU-UHFFFAOYSA-N CC1=CC=CC=[IH]1C Chemical compound CC1=CC=CC=[IH]1C FUCIBTODMLSEEU-UHFFFAOYSA-N 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10/085,141 US6552073B1 (en) | 2002-03-01 | 2002-03-01 | Compounds and methods of treating cell proliferative diseases |
| PCT/IB2003/001050 WO2003074508A1 (en) | 2002-03-01 | 2003-02-28 | Compounds and methods of treating cell proliferative diseases |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2005529079A JP2005529079A (ja) | 2005-09-29 |
| JP2005529079A5 true JP2005529079A5 (cg-RX-API-DMAC7.html) | 2006-04-06 |
Family
ID=22189708
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2003572976A Pending JP2005529079A (ja) | 2002-03-01 | 2003-02-28 | 細胞増殖性疾患を処置する化合物および方法 |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US6552073B1 (cg-RX-API-DMAC7.html) |
| EP (1) | EP1480966A1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP2005529079A (cg-RX-API-DMAC7.html) |
| AU (1) | AU2003209924A1 (cg-RX-API-DMAC7.html) |
| CA (1) | CA2477003A1 (cg-RX-API-DMAC7.html) |
| WO (1) | WO2003074508A1 (cg-RX-API-DMAC7.html) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6552073B1 (en) * | 2002-03-01 | 2003-04-22 | Exonhit Therapeutics Sa | Compounds and methods of treating cell proliferative diseases |
| EP1471063A1 (en) * | 2003-02-28 | 2004-10-27 | Exonhit Therapeutics S.A. | Compounds and methods of treating cell proliferative diseases, retinopathies and arthritis |
| WO2006028523A2 (en) * | 2004-04-29 | 2006-03-16 | THE REGENTS OF THE UNIVERSITY OF CALIFORNIA, SAN DIEGO USDC Technology Transfer Office | Hydroxypyridinone, hydroxypyridinethione, pyrone, and thiopyrone metalloprotein inhibitors |
| WO2005110399A2 (en) | 2004-04-29 | 2005-11-24 | The Regents Of The University Of California | Zinc-binding groups for metalloprotein inhibitors |
| DE102007002260A1 (de) * | 2007-01-16 | 2008-07-31 | Sanofi-Aventis | Verwendung von substituierten Pyranonsäurederivaten zur Herstellung von Medikamenten zur Behandlung des Metabolischen Syndroms |
| EP3503884B1 (en) * | 2016-08-23 | 2021-07-21 | Neurim Pharmaceuticals Ltd. | Pharmaceutical composition for use in treating pruritus and/or itch |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4812584A (en) * | 1984-07-11 | 1989-03-14 | G. D. Searle & Co. | Aralkoxy and aryloxyalkoxy kojic acid derivatives |
| US4705871A (en) * | 1984-07-11 | 1987-11-10 | G. D. Searle & Co. | Aralkoxy and aryloxyalkoxy kojic acid derivatives |
| US4644071A (en) * | 1984-07-11 | 1987-02-17 | G. D. Searle & Co. | Aralkoxy and aryloxyalkoxy kojic acid derivatives |
| PH22520A (en) * | 1984-11-12 | 1988-10-17 | Yamanouchi Pharma Co Ltd | Heterocyclic compounds having 4-lover alkyl-3-hydroxy-2-lower alkyl phenoxy-lower alkylene-y-group, and process of producing them |
| US6552073B1 (en) * | 2002-03-01 | 2003-04-22 | Exonhit Therapeutics Sa | Compounds and methods of treating cell proliferative diseases |
-
2002
- 2002-03-01 US US10/085,141 patent/US6552073B1/en not_active Expired - Fee Related
-
2003
- 2003-02-28 CA CA002477003A patent/CA2477003A1/en not_active Abandoned
- 2003-02-28 US US10/502,625 patent/US20050054629A1/en not_active Abandoned
- 2003-02-28 EP EP03743474A patent/EP1480966A1/en not_active Withdrawn
- 2003-02-28 WO PCT/IB2003/001050 patent/WO2003074508A1/en not_active Ceased
- 2003-02-28 JP JP2003572976A patent/JP2005529079A/ja active Pending
- 2003-02-28 AU AU2003209924A patent/AU2003209924A1/en not_active Abandoned