IT987964B - Dispositivo di montaggio per gruppi motori a turbina a gas industriali - Google Patents
Dispositivo di montaggio per gruppi motori a turbina a gas industrialiInfo
- Publication number
- IT987964B IT987964B IT24512/73A IT2451273A IT987964B IT 987964 B IT987964 B IT 987964B IT 24512/73 A IT24512/73 A IT 24512/73A IT 2451273 A IT2451273 A IT 2451273A IT 987964 B IT987964 B IT 987964B
- Authority
- IT
- Italy
- Prior art keywords
- gas turbine
- turbine engine
- assembly device
- industrial gas
- engine groups
- Prior art date
Links
- RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F02—COMBUSTION ENGINES; HOT-GAS OR COMBUSTION-PRODUCT ENGINE PLANTS
- F02C—GAS-TURBINE PLANTS; AIR INTAKES FOR JET-PROPULSION PLANTS; CONTROLLING FUEL SUPPLY IN AIR-BREATHING JET-PROPULSION PLANTS
- F02C7/00—Features, components parts, details or accessories, not provided for in, or of interest apart form groups F02C1/00 - F02C6/00; Air intakes for jet-propulsion plants
- F02C7/20—Mounting or supporting of plant; Accommodating heat expansion or creep
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Connection Of Motors, Electrical Generators, Mechanical Devices, And The Like (AREA)
- Motor Or Generator Frames (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2432872A GB1409902A (en) | 1972-05-24 | 1972-05-24 | Stationary gas turbine power plant mounting apparatus |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IT987964B true IT987964B (it) | 1975-03-20 |
Family
ID=10209986
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT24512/73A IT987964B (it) | 1972-05-24 | 1973-05-23 | Dispositivo di montaggio per gruppi motori a turbina a gas industriali |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3837164A (enExample) |
| JP (1) | JPS5310205B2 (enExample) |
| CA (1) | CA980585A (enExample) |
| DE (1) | DE2325642C3 (enExample) |
| FR (1) | FR2185755B1 (enExample) |
| GB (1) | GB1409902A (enExample) |
| IT (1) | IT987964B (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4076452A (en) * | 1974-04-09 | 1978-02-28 | Brown, Boveri-Sulzer Turbomaschinen Ag | Gas turbine plant |
| US4057371A (en) * | 1974-05-03 | 1977-11-08 | Norwalk-Turbo Inc. | Gas turbine driven high speed centrifugal compressor unit |
| CH591043A5 (enExample) * | 1975-06-16 | 1977-08-31 | Bbc Brown Boveri & Cie | |
| SE403393B (sv) * | 1976-07-05 | 1978-08-14 | Stal Laval Turbin Ab | Gasturbin |
| DE3022861C2 (de) * | 1980-06-19 | 1983-12-08 | M.A.N. Maschinenfabrik Augsburg-Nürnberg AG, 4200 Oberhausen | Strömungsmaschine, insbesondere Heißgasturbine, und Verfahren zur selbsttätigen kontinuierlichen Beeinflussung des Labyrinthdichtugsspieles der Strömungsmaschine |
| IT1138763B (it) * | 1981-05-04 | 1986-09-17 | Nuovo Pignone Spa | Perfezionamenti in una turbina a gas di potenza |
| JPS58119284U (ja) * | 1982-02-04 | 1983-08-13 | 松下電器産業株式会社 | スピ−カ接続装置 |
| JPS58145920U (ja) * | 1982-03-29 | 1983-10-01 | 住金鋼材工業株式会社 | 床板 |
| US5051061A (en) * | 1988-12-23 | 1991-09-24 | Asea Brown Boveri Ltd. | Multi-cylinder steam turbine set |
| AU1213097A (en) * | 1996-02-13 | 1997-09-02 | Kvaerner Energy A.S. | Turbine pack and method for adapting a turbine pack |
| DE19643336C2 (de) * | 1996-10-21 | 2002-03-28 | Rolls Royce Deutschland | Verfahren zum Demontieren des stirnseitigen Lagergehäuses oder ND-Verdichter-Wellenteiles eines Flugtriebwerkes |
| WO2000017492A1 (en) * | 1998-09-24 | 2000-03-30 | Ramgen Power Systems, Inc. | Modular multi-part rail mounted engine assembly |
| EP1249579A1 (de) * | 2001-04-11 | 2002-10-16 | Siemens Aktiengesellschaft | Turbinenanlage, inbesondere Dampfturbinenanlage |
| RU2204036C2 (ru) * | 2001-04-23 | 2003-05-10 | Открытое акционерное общество "Авиадвигатель" | Газотурбинный двигатель |
| RU2269018C1 (ru) * | 2004-06-16 | 2006-01-27 | Открытое акционерное общество "Авиадвигатель" | Энергетическая газотурбинная установка |
| US7546742B2 (en) * | 2004-12-08 | 2009-06-16 | General Electric Company | Gas turbine engine assembly and method of assembling same |
| US20060120854A1 (en) * | 2004-12-08 | 2006-06-08 | Wakeman Thomas G | Gas turbine engine assembly and method of assembling same |
| DE102005052077B4 (de) * | 2005-10-28 | 2016-11-24 | Man Diesel & Turbo Se | Vorrichtung zur seitlichen Montage und Demontage eines Kompressorbarrels |
| US8672606B2 (en) * | 2006-06-30 | 2014-03-18 | Solar Turbines Inc. | Gas turbine engine and system for servicing a gas turbine engine |
| US8590151B2 (en) * | 2006-06-30 | 2013-11-26 | Solar Turbines Inc. | System for supporting and servicing a gas turbine engine |
| US7976266B2 (en) | 2006-06-30 | 2011-07-12 | Solar Turbines Inc | Power system |
| US20080187431A1 (en) * | 2006-06-30 | 2008-08-07 | Ian Trevor Brown | Power system |
| EP1983161A1 (de) | 2007-04-16 | 2008-10-22 | Siemens Aktiengesellschaft | Sicherungsvorrichtung zur Sicherung eines quer gegenüber einer Horizontalebene aufgestellten Rotors einer Strömungsmaschine gegen Umkippen sowie Montagevorrichtung |
| US20110000222A1 (en) * | 2007-08-31 | 2011-01-06 | General Electric Company | Gas turbine rotor-stator support system |
| US20120009058A1 (en) * | 2010-07-09 | 2012-01-12 | General Electric Company | Compressible supports for turbine engines |
| KR101504848B1 (ko) * | 2011-03-31 | 2015-03-20 | 미츠비시 쥬고교 가부시키가이샤 | 증기 터빈의 차실 위치 조정 장치 |
| ITFI20120221A1 (it) * | 2012-10-22 | 2014-04-23 | Nuovo Pignone Srl | "exhaust gas collector and gas turbine" |
| US11008884B2 (en) * | 2018-08-10 | 2021-05-18 | Rolls-Royce North American Technologies, Inc. | Gensets and methods of producing gensets from an engine and generator for hybrid electric propulsion |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3273654A (en) * | 1966-09-20 | Movable turbine-fan unit for an aircraft jet engine | ||
| US2650753A (en) * | 1947-06-11 | 1953-09-01 | Gen Electric | Turbomachine stator casing |
| US2585576A (en) * | 1948-11-06 | 1952-02-12 | Svenska Turbinfab Ab | Gas turbine unit for driving electric generators |
| US2971334A (en) * | 1955-01-04 | 1961-02-14 | Solar Aircraft Co | Gas turbine engine adaptable for multi-purpose use |
| US2936978A (en) * | 1957-03-29 | 1960-05-17 | United Aircraft Corp | Rear engine mount |
| US2968922A (en) * | 1958-09-29 | 1961-01-24 | Napier & Son Ltd | Combustion turbine power units |
| GB985457A (en) * | 1962-08-02 | 1965-03-10 | Bristol Siddeley Engines Ltd | Improvements in or relating to gas turbine power plant |
| GB1080747A (en) * | 1964-09-29 | 1967-08-23 | English Electric Co Ltd | Improvements in or relating to turbines |
| US3556672A (en) * | 1969-05-26 | 1971-01-19 | Gen Electric | Gas turbine support arrangement |
-
1972
- 1972-05-24 GB GB2432872A patent/GB1409902A/en not_active Expired
-
1973
- 1973-05-21 DE DE2325642A patent/DE2325642C3/de not_active Expired
- 1973-05-21 US US00362058A patent/US3837164A/en not_active Expired - Lifetime
- 1973-05-22 FR FR7318509A patent/FR2185755B1/fr not_active Expired
- 1973-05-23 IT IT24512/73A patent/IT987964B/it active
- 1973-05-23 CA CA172,003A patent/CA980585A/en not_active Expired
- 1973-05-24 JP JP5822573A patent/JPS5310205B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2325642B2 (de) | 1978-11-09 |
| DE2325642C3 (de) | 1979-07-12 |
| GB1409902A (en) | 1975-10-15 |
| FR2185755B1 (enExample) | 1979-08-03 |
| DE2325642A1 (de) | 1973-12-06 |
| CA980585A (en) | 1975-12-30 |
| JPS4943011A (enExample) | 1974-04-23 |
| JPS5310205B2 (enExample) | 1978-04-12 |
| FR2185755A1 (enExample) | 1974-01-04 |
| US3837164A (en) | 1974-09-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IT987964B (it) | Dispositivo di montaggio per gruppi motori a turbina a gas industriali | |
| IT998522B (it) | Apparato di combustione per motori a turbina a gas | |
| IT997686B (it) | Motore a turbina a gas | |
| AR198400A1 (es) | Motor de turbina de gas | |
| IT989653B (it) | Camera di combustione per motori a turbina a gas | |
| IT996392B (it) | Apparecchio di combustione per una turbina a gas | |
| IT1011477B (it) | Perfezionamento negli impianti motori a turbina a gas | |
| IT1002829B (it) | Sghiacciatori di ogiva per motori a turbina | |
| IT1000742B (it) | Impianto di turbina a gas | |
| IT999255B (it) | Turbina a gas | |
| IT978244B (it) | Paletta mobile raffreddata per turbine a gas | |
| IT993440B (it) | Paletta rotorica per motori a turbina a gas | |
| SE391222B (sv) | Regleringsanordning for en gasturbinmotor | |
| IT1029533B (it) | Dispositivo di scarico per motori mapini | |
| IT973079B (it) | Carcassa di turbina per un motore a turbina a gas | |
| NL7401496A (nl) | Verbrandingsinrichting voor een gasturbinemotor. | |
| IT1010226B (it) | Dispositivo di scarico per turbine a gas ad impianto chiuso | |
| IT977086B (it) | Dispositivo di alimentazione di combustibile per turbine a gas | |
| IT983725B (it) | Reattore depuratore per gas di scarico di motori a combustione | |
| BR7305129D0 (pt) | Turbina acionada a gas de mancais a gas | |
| IT996224B (it) | Dispositivo di valvola a farfalla per motori a turbina a gas | |
| IT942541B (it) | Cappottatura per motori a turbina a gas | |
| IT976800B (it) | Dispositivo ad alette di comando per turbine a gas | |
| IT1002533B (it) | Dispositivo di alimentazione di combustibile per un motore a turbina a gas | |
| IT979974B (it) | Circuito elettrico di rivelazione di fiamma per motori a turbna a gas |